From b5ecbc6653445a8c7dc82f150889cd44a7ad12ac Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sat, 20 Dec 2025 22:33:28 +0100 Subject: [PATCH 01/14] Various fixes --- .github/workflows/pypi-publish.yml | 6 +- .github/workflows/test-pypi-publish.yml | 6 +- .github/workflows/tests.yml | 10 +- .pre-commit-config.yaml | 13 - README.md | 11 +- pyproject.toml | 3 +- skfp/applicability_domain/bounding_box.py | 14 +- skfp/applicability_domain/convex_hull.py | 4 +- .../distance_to_centroid.py | 4 +- .../applicability_domain/hotelling_t2_test.py | 2 +- skfp/applicability_domain/knn.py | 17 +- skfp/applicability_domain/leverage.py | 2 +- skfp/applicability_domain/pca_bounding_box.py | 4 +- skfp/datasets/moleculenet/pcba.py | 2 +- skfp/datasets/moleculenet/tox21.py | 2 +- skfp/descriptors/charge.py | 6 +- skfp/distances/braun_blanquet.py | 12 +- skfp/distances/ct4.py | 8 +- skfp/distances/dice.py | 8 +- skfp/distances/harris_lahey.py | 6 +- skfp/distances/kulczynski.py | 4 +- skfp/distances/mcconnaughey.py | 6 +- skfp/distances/rand.py | 8 +- skfp/distances/rogot_goldberg.py | 4 +- skfp/distances/russell.py | 8 +- skfp/distances/simpson.py | 4 +- skfp/distances/sokal_sneath.py | 4 +- skfp/distances/tanimoto.py | 24 +- skfp/filters/beyond_ro5.py | 2 +- skfp/filters/gsk.py | 2 +- skfp/fingerprints/data/SMARTS_InteLigand.txt | 4 +- skfp/fingerprints/electroshape.py | 4 +- skfp/metrics/auroc.py | 6 +- skfp/metrics/multioutput.py | 4 +- skfp/metrics/utils.py | 4 +- skfp/metrics/virtual_screening.py | 6 +- skfp/preprocessing/conformer_generator.py | 16 +- skfp/preprocessing/input_output/aminoseq.py | 5 +- skfp/preprocessing/input_output/inchi.py | 6 +- skfp/preprocessing/input_output/sdf.py | 4 +- skfp/preprocessing/input_output/smiles.py | 2 +- skfp/preprocessing/standardization.py | 2 +- skfp/utils/parallel.py | 2 +- skfp/utils/validators.py | 10 +- tests/descriptors/charge.py | 11 + uv.lock | 2600 ++++++++--------- 46 files changed, 1449 insertions(+), 1443 deletions(-) diff --git a/.github/workflows/pypi-publish.yml b/.github/workflows/pypi-publish.yml index 834e7e9b..85ad1c9f 100644 --- a/.github/workflows/pypi-publish.yml +++ b/.github/workflows/pypi-publish.yml @@ -12,17 +12,17 @@ jobs: runs-on: ubuntu-latest steps: - name: Checkout repo - uses: actions/checkout@v4 + uses: actions/checkout@v6 with: fetch-depth: 0 - name: Set up Python - uses: actions/setup-python@v5 + uses: actions/setup-python@v6 with: python-version: "3.10" - name: Install uv - uses: astral-sh/setup-uv@v5 + uses: astral-sh/setup-uv@v7 # set version (e.g. 1.2.3) from the latest Git tag on the master branch - name: Set package release version diff --git a/.github/workflows/test-pypi-publish.yml b/.github/workflows/test-pypi-publish.yml index e891da6e..9985786a 100644 --- a/.github/workflows/test-pypi-publish.yml +++ b/.github/workflows/test-pypi-publish.yml @@ -22,17 +22,17 @@ jobs: runs-on: ubuntu-latest steps: - name: Checkout repo - uses: actions/checkout@v4 + uses: actions/checkout@v6 with: fetch-depth: 0 - name: Set up Python - uses: actions/setup-python@v5 + uses: actions/setup-python@v6 with: python-version: "3.10" - name: Install uv - uses: astral-sh/setup-uv@v5 + uses: astral-sh/setup-uv@v7 # set version (e.g. 1.2.3) from the latest Git tag on master branch - name: Set package release version diff --git a/.github/workflows/tests.yml b/.github/workflows/tests.yml index 696c7a20..158a0e15 100644 --- a/.github/workflows/tests.yml +++ b/.github/workflows/tests.yml @@ -20,23 +20,23 @@ jobs: runs-on: ${{ matrix.os }} steps: - name: Checkout repo - uses: actions/checkout@v4 + uses: actions/checkout@v6 - name: Set up Python - uses: actions/setup-python@v5 + uses: actions/setup-python@v6 with: python-version: ${{ matrix.python-version }} - name: Install uv - uses: astral-sh/setup-uv@v5 + uses: astral-sh/setup-uv@v7 - - uses: actions/cache@v4 + - uses: actions/cache@v5 name: Cache venv with: path: ./.venv key: ${{ matrix.os }}-venv-${{ matrix.python-version }}-${{ hashFiles('**/uv.lock') }} - - uses: actions/cache@v4 + - uses: actions/cache@v5 name: Cache datasets with: path: ~/scikit_learn_data diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml index 39c33e94..2e06a085 100644 --- a/.pre-commit-config.yaml +++ b/.pre-commit-config.yaml @@ -9,19 +9,6 @@ repos: language: system pass_filenames: false - - repo: https://github.com/pypa/pip-audit - rev: v2.9.0 - hooks: - - id: pip-audit - args: [ - --vulnerability-service, "pypi", - --cache-dir, ".pip_audit_cache", - # false alert for setuptools, we have a much newer version - --ignore-vuln, "GHSA-5rjg-fvgr-3xxf", - # false alert for pip - --ignore-vuln, "GHSA-4xh5-x5gv-qwph" - ] - - repo: https://github.com/astral-sh/ruff-pre-commit rev: v0.13.1 hooks: diff --git a/README.md b/README.md index 3f5b7894..fd098e63 100644 --- a/README.md +++ b/README.md @@ -159,7 +159,7 @@ Examples and tutorials: ## Project overview -`scikit-fingerprint` brings molecular fingerprints and related functionalities into +`scikit-fingerprints` brings molecular fingerprints and related functionalities into the scikit-learn ecosystem. With familiar class-based design and `.transform()` method, fingerprints can be computed from SMILES strings or RDKit `Mol` objects. Resulting NumPy arrays or SciPy sparse arrays can be directly used in ML pipelines. @@ -216,13 +216,16 @@ Publications using scikit-fingerprints: 1. [J. Adamczyk, W. Czech "Molecular Topological Profile (MOLTOP) - Simple and Strong Baseline for Molecular Graph Classification" ECAI 2024](https://ebooks.iospress.nl/doi/10.3233/FAIA240663) 2. [J. Adamczyk, P. Ludynia "Scikit-fingerprints: easy and efficient computation of molecular fingerprints in Python" SoftwareX](https://www.sciencedirect.com/science/article/pii/S2352711024003145) 3. [J. Adamczyk, P. Ludynia, W. Czech "Molecular Fingerprints Are Strong Models for Peptide Function Prediction" ArXiv preprint](https://arxiv.org/abs/2501.17901) -4. [M. Fitzner et al. "BayBE: a Bayesian Back End for experimental planning in the low-to-no-data regime" RSC Digital Discovery](https://pubs.rsc.org/en/content/articlehtml/2025/dd/d5dd00050e) -5. [J. Xiong "Bridging 3D Molecular Structures and Artificial Intelligence by a Conformation Description Language"](https://www.biorxiv.org/content/10.1101/2025.05.07.652440v1.abstract) +4. [J. Adamczyk "Towards Rational Pesticide Design with Graph Machine Learning Models for Ecotoxicology" CIKM 2025](https://dl.acm.org/doi/abs/10.1145/3746252.3761660) +5. [J. Adamczyk, J. Poziemski, F. Job, M. Król, M. Makowski "MolPILE - large-scale, diverse dataset for molecular representation learning" ArXiv preprint](https://arxiv.org/abs/2509.18353) +6. [M. Fitzner et al. "BayBE: a Bayesian Back End for experimental planning in the low-to-no-data regime" RSC Digital Discovery](https://pubs.rsc.org/en/content/articlehtml/2025/dd/d5dd00050e) +7. [J. Xiong et al. "Bridging 3D Molecular Structures and Artificial Intelligence by a Conformation Description Language"](https://www.biorxiv.org/content/10.1101/2025.05.07.652440v1.abstract) +8. [S. Mavlonazarova et al. "Untargeted Metabolomics Reveals Organ-Specific and Extraction-Dependent Metabolite Profiles in Endemic Tajik Species Ferula violacea Korovin" bioRxiv preprint](https://www.biorxiv.org/content/10.1101/2025.08.24.671964v1) ## Contributing Please read [CONTRIBUTING.md](CONTRIBUTING.md) and [CODE_OF_CONDUCT.md](CODE_OF_CONDUCT.md) for details on our code of -conduct, and the process for submitting pull requests to us. + conduct and the process for submitting pull requests. ## License diff --git a/pyproject.toml b/pyproject.toml index 8948cdf5..f356a83b 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -49,13 +49,13 @@ dev = [ "coverage", "jupyter", "mypy", - "pip-audit", "pre-commit", "pytest", "pytest-cov", "pytest-rerunfailures", "ruff", "setuptools>=80", + "scipy-stubs", "xenon" ] @@ -63,7 +63,6 @@ test = [ "mypy", "ruff", "xenon", - "pip-audit", "pre-commit", "pytest", "pytest-rerunfailures" diff --git a/skfp/applicability_domain/bounding_box.py b/skfp/applicability_domain/bounding_box.py index 55e9b20c..9b07ef43 100644 --- a/skfp/applicability_domain/bounding_box.py +++ b/skfp/applicability_domain/bounding_box.py @@ -15,10 +15,10 @@ class BoundingBoxADChecker(BaseADChecker): This creates a "bounding box" using their extreme values, and new molecules should lie in this distribution, i.e. have properties in the same ranges [1]_. - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. This is - particularly important if ``"three_sigma"`` is used as percentile bound, as it + particularly important if ``"three_sigma"`` is used as the percentile bound, as it assumes normal distribution. By default, the full range of training descriptors are allowed as AD. For stricter @@ -26,7 +26,7 @@ class BoundingBoxADChecker(BaseADChecker): extremely low or large values, respectively. For looser check, use ``num_allowed_violations`` to allow a number of desrciptors to lie outside the given ranges. - This method scales very well with both number of samples and features. + This method scales very well with both the number of samples and features. Parameters ---------- @@ -42,7 +42,7 @@ class BoundingBoxADChecker(BaseADChecker): uses 3 standard deviations from the mean, a common rule-of-thumb for outliers assuming the normal distribution. - num_allowed_violations : bool, default=0 + num_allowed_violations : int, default=0 Number of allowed violations of feature ranges. By default, all descriptors must lie inside the bounding box. @@ -85,8 +85,8 @@ class BoundingBoxADChecker(BaseADChecker): _parameter_constraints: dict = { **BaseADChecker._parameter_constraints, - "percentile_lower": [Interval(Real, 0, 100, closed="both")], - "percentile_upper": [Interval(Real, 0, 100, closed="both")], + "percentile_lower": [Interval(Real, 0, 100, closed="both"), "three_sigma"], + "percentile_upper": [Interval(Real, 0, 100, closed="both"), "three_sigma"], "num_allowed_violations": [Interval(Integral, 0, None, closed="left")], } @@ -94,7 +94,7 @@ def __init__( self, percentile_lower: float | str = 0, percentile_upper: float | str = 100, - num_allowed_violations: int | None = 0, + num_allowed_violations: int = 0, n_jobs: int | None = None, verbose: int | dict = 0, ): diff --git a/skfp/applicability_domain/convex_hull.py b/skfp/applicability_domain/convex_hull.py index b742c832..46035fc0 100644 --- a/skfp/applicability_domain/convex_hull.py +++ b/skfp/applicability_domain/convex_hull.py @@ -35,11 +35,11 @@ class ConvexHullADChecker(BaseADChecker): & 1^T \lambda = 1,\\ & \lambda_i \geq 0 \text{ for all } i=1,...,n - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. - This method scales very badly with both number of samples and features. It has + This method scales very badly with both the number of samples and features. It has quadratic scaling :math:`O(n^2)` in number of samples, and can be realistically run on at most 1000-3000 molecules. Its geometry also breaks down above ~10 features, marking everything as outside AD. diff --git a/skfp/applicability_domain/distance_to_centroid.py b/skfp/applicability_domain/distance_to_centroid.py index 6b8c26e7..a81ab02e 100644 --- a/skfp/applicability_domain/distance_to_centroid.py +++ b/skfp/applicability_domain/distance_to_centroid.py @@ -63,7 +63,7 @@ class DistanceToCentroidADChecker(BaseADChecker): data centroid, i.e. the average (middle) point [1]_. New molecules should lie inside the hypersphere of a given radius (distance) from that centroid. - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. @@ -129,7 +129,7 @@ class DistanceToCentroidADChecker(BaseADChecker): _parameter_constraints: dict = { **BaseADChecker._parameter_constraints, "threshold": [Interval(Real, 0, None, closed="neither"), StrOptions({"auto"})], - "distance": [ + "metric": [ callable, StrOptions(SCIPY_METRIC_NAMES | SKFP_METRIC_NAMES | SKFP_BULK_METRIC_NAMES), ], diff --git a/skfp/applicability_domain/hotelling_t2_test.py b/skfp/applicability_domain/hotelling_t2_test.py index 53cb5eb5..802e296a 100644 --- a/skfp/applicability_domain/hotelling_t2_test.py +++ b/skfp/applicability_domain/hotelling_t2_test.py @@ -16,7 +16,7 @@ class HotellingT2TestADChecker(BaseADChecker): Mahalanobis distance of a new sample from the mean of the training data, scaled by the covariance structure of the training data. - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. In case of Hotelling's T^2 test, using PCA beforehand to obtain orthogonal features is diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 7b26c78c..1c6e18f5 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -54,10 +54,15 @@ class KNNADChecker(BaseADChecker): Distance metric to use. agg: "mean" or "max" or "min", default="mean" - Aggregation method for distances to k nearest neigbors: - - "mean": use the mean distance to k neighbors, - - "max": use the maximum distance among k neighbors, - - "min": use the distance to the closest neigbor. + Aggregation method for distances to k nearest neighbors: + + - "mean": average distance + - "max": maximum distance, to k-th neighbor + - "min": minimal distance, to the nearest neighbor + + threshold : float, default=95 + Percentile of distance distribution, used as the threshold for determining the + applicability domain. Value in range ``[0, 100]``. n_jobs : int, default=None The number of jobs to run in parallel. :meth:`transform_x_y` and @@ -115,7 +120,7 @@ class KNNADChecker(BaseADChecker): "k": [Interval(Integral, 1, None, closed="left")], "metric": [callable, StrOptions(METRIC_NAMES)], "agg": [StrOptions({"mean", "max", "min"})], - "threshold": [None, Interval(Real, 0, 1, closed="both")], + "threshold": [None, Interval(Real, 0, 100, closed="both")], } def __init__( @@ -123,7 +128,7 @@ def __init__( k: int = 1, metric: str | Callable = "tanimoto_binary_distance", agg: str = "mean", - threshold: float = 0.95, + threshold: float = 95, n_jobs: int | None = None, verbose: int | dict = 0, ): diff --git a/skfp/applicability_domain/leverage.py b/skfp/applicability_domain/leverage.py index 16013e1d..2383b46b 100644 --- a/skfp/applicability_domain/leverage.py +++ b/skfp/applicability_domain/leverage.py @@ -26,7 +26,7 @@ class LeverageADChecker(BaseADChecker): training data is used as an outlier score. Typical threshold is :math:`3(d+1)/n`, where `d` is the number of features and `n` is the number of training molecules. - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. Features should not be too strongly correlated, as this can result in near-singular matrix diff --git a/skfp/applicability_domain/pca_bounding_box.py b/skfp/applicability_domain/pca_bounding_box.py index e9a1da14..7e0cd38c 100644 --- a/skfp/applicability_domain/pca_bounding_box.py +++ b/skfp/applicability_domain/pca_bounding_box.py @@ -17,11 +17,11 @@ class PCABoundingBoxADChecker(BaseADChecker): Analysis (PCA) [1]_. AD is a hyperrectangle, with thresholds defined as minimal and maximal values from the training set on PCA axes. - Typically, physicochemical properties (continous features) are used as inputs. + Typically, physicochemical properties (continuous features) are used as inputs. Consider scaling, normalizing, or transforming them before computing AD to lessen effects of outliers, e.g. with ``PowerTransformer`` or ``RobustScaler``. - This method scales very well with both number of samples and features, but doesn't + This method scales very well with both the number of samples and features, but doesn't work well for highly sparse input features (e.g. many molecular fingerprints), since PCA centers the data. diff --git a/skfp/datasets/moleculenet/pcba.py b/skfp/datasets/moleculenet/pcba.py index 9f0a2e81..dcf927d2 100644 --- a/skfp/datasets/moleculenet/pcba.py +++ b/skfp/datasets/moleculenet/pcba.py @@ -41,7 +41,7 @@ def load_pcba( not read correctly due to disallowed hypervalent states of some atoms (see [release notes](https://github.com/rdkit/rdkit/releases/tag/Release_2024_09_1)). This version of the PCBA dataset contains manual fixes for those molecules, removing - additional hydrogens, e.g. `[AlH3] -> [Al]`. In OGB scaffold split, used for + additional hydrogens, e.g. ``[AlH3] -> [Al]``. In OGB scaffold split, used for benchmarking, both molecules are in the training set. Parameters diff --git a/skfp/datasets/moleculenet/tox21.py b/skfp/datasets/moleculenet/tox21.py index dedaef8f..8f76d158 100644 --- a/skfp/datasets/moleculenet/tox21.py +++ b/skfp/datasets/moleculenet/tox21.py @@ -41,7 +41,7 @@ def load_tox21( are not read correctly due to disallowed hypervalent states of their aluminium atoms (see [release notes](https://github.com/rdkit/rdkit/releases/tag/Release_2024_09_1)). This version of the Tox21 dataset contains manual fixes for those molecules, - removing additional hydrogens, e.g. `[AlH3] -> [Al]`. In OGB scaffold split, used + removing additional hydrogens, e.g. ``[AlH3] -> [Al]``. In OGB scaffold split, used for benchmarking, only the first 1 of those problematic 8 is from the test set. Parameters diff --git a/skfp/descriptors/charge.py b/skfp/descriptors/charge.py index 4106c8a5..065eec3c 100644 --- a/skfp/descriptors/charge.py +++ b/skfp/descriptors/charge.py @@ -18,11 +18,13 @@ def atomic_partial_charges( Parameters ---------- mol : RDKit ``Mol`` object - The molecule for which the Balaban's J index is to be calculated. + The molecule for which to calculate the atomic partial charges. partial_charge_model : {"Gasteiger", "MMFF94", "formal", "precomputed"}, default="formal" Which model to use to compute atomic partial charges. Default ``"formal"`` computes formal charges, and is the simplest and most error-resistant one. + ``"precomputed"`` assumes that the inputs are RDKit ``PropertyMol`` objects + with "charge" float property set. charge_errors : {"raise", "ignore", "zero"}, default="raise" How to handle errors during calculation of atomic partial charges. ``"raise"`` @@ -51,6 +53,8 @@ def atomic_partial_charges( ] elif partial_charge_model == "formal": charges = [atom.GetFormalCharge() for atom in atoms] + elif partial_charge_model == "precomputed": + charges = [atom.GetDoubleProp("charge") for atom in atoms] else: raise ValueError( f'Partial charge model "{partial_charge_model}" is not supported' diff --git a/skfp/distances/braun_blanquet.py b/skfp/distances/braun_blanquet.py index fccd759d..0a98aafa 100644 --- a/skfp/distances/braun_blanquet.py +++ b/skfp/distances/braun_blanquet.py @@ -177,17 +177,17 @@ def bulk_braun_blanquet_binary_similarity( Computes the pairwise Braun-Blanquet similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`braun_blanquet_binary_similarity`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array or sparse matrix, of shape :math:`m \times m` + First binary input array or sparse matrix, of shape :math:`m \times d` Y : ndarray or CSR sparse array, default=None - Second binary input array or sparse matrix, of shape :math:`n \times n`. If not passed, + Second binary input array or sparse matrix, of shape :math:`n \times d`. If not passed, similarities are computed between rows of X. Returns @@ -264,17 +264,17 @@ def bulk_braun_blanquet_binary_distance( Computes the pairwise Braun-Blanquet distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`braun_blanquet_binary_distance`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array, of shape :math:`m \times m` + First binary input array, of shape :math:`m \times d` Y : ndarray or CSR sparse array, default=None - Second binary input array, of shape :math:`n \times n`. If not passed, distances + Second binary input array, of shape :math:`n \times d`. If not passed, distances are computed between rows of X. Returns diff --git a/skfp/distances/ct4.py b/skfp/distances/ct4.py index dd2d1642..ce38f49d 100644 --- a/skfp/distances/ct4.py +++ b/skfp/distances/ct4.py @@ -359,7 +359,7 @@ def bulk_ct4_binary_similarity( Computes the pairwise Consonni–Todeschini 4 (CT4) similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`ct4_binary_similarity`. @@ -448,7 +448,7 @@ def bulk_ct4_binary_distance( Computes the pairwise Consonni–Todeschini 4 (CT4) distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column - in output corresponding to `i`-th row from first array and `j`-th row from second array. + in output corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`ct4_binary_distance`. @@ -486,7 +486,7 @@ def bulk_ct4_count_similarity( Computes the pairwise Consonni–Todeschini 4 similarity between count matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column - in output corresponding to `i`-th row from first array and `j`-th row from second array. + in output corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`ct4_count_similarity`. @@ -566,7 +566,7 @@ def bulk_ct4_count_distance( Computes the pairwise Consonni–Todeschini 4 distance between count matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column - in output corresponding to `i`-th row from first array and `j`-th row from second array. + in output corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`ct4_count_distance`. diff --git a/skfp/distances/dice.py b/skfp/distances/dice.py index cc8c584a..ac52f961 100644 --- a/skfp/distances/dice.py +++ b/skfp/distances/dice.py @@ -359,7 +359,7 @@ def bulk_dice_binary_similarity( Computes the pairwise Dice similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`dice_binary_similarity`. @@ -455,7 +455,7 @@ def bulk_dice_binary_distance( Computes the pairwise Dice distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`dice_binary_distance`. @@ -514,7 +514,7 @@ def bulk_dice_count_similarity( Computes the pairwise Dice similarity between count matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`dice_count_similarity`. @@ -609,7 +609,7 @@ def bulk_dice_count_distance( Computes the pairwise Dice distance between count matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`dice_count_distance`. diff --git a/skfp/distances/harris_lahey.py b/skfp/distances/harris_lahey.py index 56966a44..202d2148 100644 --- a/skfp/distances/harris_lahey.py +++ b/skfp/distances/harris_lahey.py @@ -161,7 +161,7 @@ def harris_lahey_binary_distance( dist(a, b) = 1 - sim(a, b) See also :py:func:`harris_lahey_binary_similarity`. It uses the normalized - similarity, scaled to range `[0, 1]`. + similarity, scaled to range ``[0, 1]``. The calculated distance falls within the range :math:`[0, 1]`. Passing all-zero or all-ones vectors to this function results in a distance of 0. @@ -234,7 +234,7 @@ def bulk_harris_lahey_binary_similarity( Computes the pairwise Harris-Lahey similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`harris_lahey_binary_similarity`. @@ -368,7 +368,7 @@ def bulk_harris_lahey_binary_distance( Computes the pairwise Harris-Lahey distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`harris_lahey_binary_distance`. diff --git a/skfp/distances/kulczynski.py b/skfp/distances/kulczynski.py index d486196b..bdad9bf0 100644 --- a/skfp/distances/kulczynski.py +++ b/skfp/distances/kulczynski.py @@ -204,7 +204,7 @@ def bulk_kulczynski_binary_similarity( Computes the pairwise Kulczynski similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`kulczynski_binary_similarity`. @@ -313,7 +313,7 @@ def bulk_kulczynski_binary_distance( Computes the pairwise Kulczynski distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`kulczynski_binary_distance`. diff --git a/skfp/distances/mcconnaughey.py b/skfp/distances/mcconnaughey.py index 2c9333f5..12912f70 100644 --- a/skfp/distances/mcconnaughey.py +++ b/skfp/distances/mcconnaughey.py @@ -137,7 +137,7 @@ def mcconnaughey_binary_distance( dist(a, b) = 1 - sim(a, b) See also :py:func:`mcconnaughey_binary_similarity`. It uses the normalized - similarity, scaled to range `[0, 1]`. + similarity, scaled to range ``[0, 1]``. The calculated distance falls within the range :math:`[0, 1]`. Passing all-zero vectors to this function results in a distance of 0. @@ -207,7 +207,7 @@ def bulk_mcconnaughey_binary_similarity( Computes the pairwise McConnaughey similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`mcconnaughey_binary_similarity`. @@ -327,7 +327,7 @@ def bulk_mcconnaughey_binary_distance( Computes the pairwise McConnaughey distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`mcconnaughey_binary_distance`. diff --git a/skfp/distances/rand.py b/skfp/distances/rand.py index 698b4b11..da02c0b1 100644 --- a/skfp/distances/rand.py +++ b/skfp/distances/rand.py @@ -190,8 +190,8 @@ def bulk_rand_binary_similarity( Computes the pairwise Rand (also known as All-Bit or Sokal-Michener) similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with - `i`-th row and `j`-th column in output corresponding to `i`-th row from first array - and `j`-th row from second array. + `i`-th row and `j`-th column in output corresponding to `i`-th row from the first array + and `j`-th row from the second array. See also :py:func:`rand_binary_similarity`. @@ -283,8 +283,8 @@ def bulk_rand_binary_distance( Computes the pairwise Rand distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th - column in output corresponding to `i`-th row from first array and `j`-th - row from second array. + column in output corresponding to `i`-th row from the first array and `j`-th + row from the second array. See also :py:func:`rand_binary_distance`. diff --git a/skfp/distances/rogot_goldberg.py b/skfp/distances/rogot_goldberg.py index ad5f7681..e04982c1 100644 --- a/skfp/distances/rogot_goldberg.py +++ b/skfp/distances/rogot_goldberg.py @@ -208,7 +208,7 @@ def bulk_rogot_goldberg_binary_similarity( Computes the pairwise Rogot-Goldberg similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`rogot_goldberg_binary_similarity`. @@ -332,7 +332,7 @@ def bulk_rogot_goldberg_binary_distance( Computes the pairwise Rogot-Goldberg distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`rogot_goldberg_binary_distance`. diff --git a/skfp/distances/russell.py b/skfp/distances/russell.py index 639a1a78..822c83d9 100644 --- a/skfp/distances/russell.py +++ b/skfp/distances/russell.py @@ -185,7 +185,7 @@ def bulk_russell_binary_similarity( Computes the pairwise Russell similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`russell_binary_similarity`. @@ -245,17 +245,17 @@ def bulk_russell_binary_distance( Computes the pairwise Russell distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`russell_binary_distance`. Parameters ---------- X : ndarray - First binary input array, of shape :math:`m \times m` + First binary input array, of shape :math:`m \times d` Y : ndarray, default=None - Second binary input array, of shape :math:`n \times n`. If not passed, distances + Second binary input array, of shape :math:`n \times d`. If not passed, distances are computed between rows of X. Returns diff --git a/skfp/distances/simpson.py b/skfp/distances/simpson.py index ba30c99c..2dc30ca0 100644 --- a/skfp/distances/simpson.py +++ b/skfp/distances/simpson.py @@ -186,7 +186,7 @@ def bulk_simpson_binary_similarity( coefficient) similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`simpson_binary_similarity`. @@ -276,7 +276,7 @@ def bulk_simpson_binary_distance( Computes the pairwise Simpson distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`simpson_binary_distance`. diff --git a/skfp/distances/sokal_sneath.py b/skfp/distances/sokal_sneath.py index 3fbc0cca..594e5d05 100644 --- a/skfp/distances/sokal_sneath.py +++ b/skfp/distances/sokal_sneath.py @@ -295,8 +295,8 @@ def bulk_sokal_sneath_2_binary_distance( Computes the pairwise Sokal-Sneath distance 2 between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th - column in output corresponding to `i`-th row from first array and `j`-th row - from second array. + column in output corresponding to `i`-th row from the first array and `j`-th row + from the second array. See also :py:func:`sokal_sneath_2_binary_distance`. diff --git a/skfp/distances/tanimoto.py b/skfp/distances/tanimoto.py index 84244751..ef9aadfc 100644 --- a/skfp/distances/tanimoto.py +++ b/skfp/distances/tanimoto.py @@ -313,17 +313,17 @@ def bulk_tanimoto_binary_similarity( Computes the pairwise Tanimoto similarity between binary matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`tanimoto_binary_similarity`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array or sparse matrix, of shape :math:`m \times m`. + First binary input array or sparse matrix, of shape :math:`m \times d`. Y : ndarray or CSR sparse array, default=None - Second binary input array or sparse matrix, of shape :math:`n \times n`. + Second binary input array or sparse matrix, of shape :math:`n \times d`. If not passed, similarities are computed between rows of X. Returns @@ -404,17 +404,17 @@ def bulk_tanimoto_binary_distance( Computes the pairwise Tanimoto distance between binary matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`tanimoto_binary_distance`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array or sparse matrix, of shape :math:`m \times m` + First binary input array or sparse matrix, of shape :math:`m \times d` Y : ndarray or CSR sparse array, default=None - Second binary input array or sparse matrix, of shape :math:`n \times n`. + Second binary input array or sparse matrix, of shape :math:`n \times d`. If not passed, distances are computed between rows of X. Returns @@ -463,17 +463,17 @@ def bulk_tanimoto_count_similarity( Computes the pairwise Tanimoto similarity between count matrices. If one array is passed, similarities are computed between its rows. For two arrays, similarities are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`tanimoto_count_similarity`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array or sparse matrix, of shape :math:`m \times m` + First binary input array or sparse matrix, of shape :math:`m \times d` Y : ndarray or CSR sparse array, default=None - Second binary input array or sparse matrix, of shape :math:`n \times n`. + Second binary input array or sparse matrix, of shape :math:`n \times d`. If not passed, similarities are computed between rows of X. Returns @@ -554,17 +554,17 @@ def bulk_tanimoto_count_distance( Computes the pairwise Tanimoto distance between count matrices. If one array is passed, distances are computed between its rows. For two arrays, distances are between their respective rows, with `i`-th row and `j`-th column in output - corresponding to `i`-th row from first array and `j`-th row from second array. + corresponding to `i`-th row from the first array and `j`-th row from the second array. See also :py:func:`tanimoto_count_distance`. Parameters ---------- X : ndarray or CSR sparse array - First binary input array or sparse matrix, of shape :math:`m \times m` + First binary input array or sparse matrix, of shape :math:`m \times d` Y : ndarray or CSR sparse array, default=None - Second binary input array or sparse matrix, of shape :math:`n \times n`. + Second binary input array or sparse matrix, of shape :math:`n \times d`. If not passed, distances are computed between rows of X. Returns diff --git a/skfp/filters/beyond_ro5.py b/skfp/filters/beyond_ro5.py index a96e98ee..dff3e7ff 100644 --- a/skfp/filters/beyond_ro5.py +++ b/skfp/filters/beyond_ro5.py @@ -22,7 +22,7 @@ class BeyondRo5Filter(BaseFilter): Molecule can violate at most one of the rules (conditions): - - molecular weight <= 1000 daltons + - molecular weight <= 1000 - logP in range [-2, 10] - HBA <= 15 - HBD <= 6 diff --git a/skfp/filters/gsk.py b/skfp/filters/gsk.py index 61c6d7a2..71094bbc 100644 --- a/skfp/filters/gsk.py +++ b/skfp/filters/gsk.py @@ -14,7 +14,7 @@ class GSKFilter(BaseFilter): Molecule must fulfill conditions: - - molecular weight <= 400 daltons + - molecular weight <= 400 - logP <= 4 Parameters diff --git a/skfp/fingerprints/data/SMARTS_InteLigand.txt b/skfp/fingerprints/data/SMARTS_InteLigand.txt index 84a61af8..b99b096c 100644 --- a/skfp/fingerprints/data/SMARTS_InteLigand.txt +++ b/skfp/fingerprints/data/SMARTS_InteLigand.txt @@ -922,7 +922,7 @@ C_ONS_bond: [#6]~[#7,#8,#16] # probably all drug-like molecules have at least one O, N, or S connected to a C -> nice filter ## Mixture: (*).(*) -# two or more seperate parts, may also be salt +# two or more separate parts, may also be salt # component-level grouping is not yet supported in Open Babel Version 2.0 @@ -933,7 +933,7 @@ Anion: [-1,-2,-3,-4,-5,-6,-7] Kation: [+1,+2,+3,+4,+5,+6,+7] Salt: ([-1,-2,-3,-4,-5,-6,-7]).([+1,+2,+3,+4,+5,+6,+7]) -# two or more seperate components with opposite charges +# two or more separate components with opposite charges ##Zwitterion: ([-1,-2,-3,-4,-5,-6,-7].[+1,+2,+3,+4,+5,+6,+7]) # both negative and positive charges somewhere within the same molecule. diff --git a/skfp/fingerprints/electroshape.py b/skfp/fingerprints/electroshape.py index 749f8ada..1b53584e 100644 --- a/skfp/fingerprints/electroshape.py +++ b/skfp/fingerprints/electroshape.py @@ -52,9 +52,9 @@ class ElectroShapeFingerprint(BaseFingerprintTransformer): charge_errors : {"raise", "ignore", "zero"}, default="raise" How to handle errors during calculation of atomic partial charges. ``"raise"`` - immediately raises any errors. ``"NaN"`` ignores any atoms that failed the + immediately raises any errors. ``"ignore"`` ignores any atoms that failed the computation; note that if all atoms fail, the error will be raised (use - ``errors`` parameter to control this). ``"zero"`` uses default value of 0 to + ``errors`` parameter to control this). ``"zero"`` uses the default value of 0 to fill all problematic charges. errors : {"raise", "NaN", "ignore"}, default="raise" diff --git a/skfp/metrics/auroc.py b/skfp/metrics/auroc.py index b1ca9de2..c09db4df 100644 --- a/skfp/metrics/auroc.py +++ b/skfp/metrics/auroc.py @@ -14,12 +14,12 @@ @deprecated( "Deprecated for scikit-learn >1.6, which returns np.nan for constant targets. " - "Will be removed in scikit-fingerprints 1.15" + "Will be removed in scikit-fingerprints 2.0" ) @validate_params( { "y_true": ["array-like"], - "y_pred": ["array-like"], + "y_score": ["array-like"], "constant_target_behavior": [ StrOptions({"raise"}), "nan", @@ -51,7 +51,7 @@ def auroc_score( y_score : array-like of shape (n_samples,) or (n_samples, n_outputs) Target scores, i.e. probability of the class with the greater label for each - output** of the classifier. + output of the classifier. *args, **kwargs Any additional parameters for the underlying ``roc_auc_score`` function. diff --git a/skfp/metrics/multioutput.py b/skfp/metrics/multioutput.py index 0f9757d2..a46e2daa 100644 --- a/skfp/metrics/multioutput.py +++ b/skfp/metrics/multioutput.py @@ -127,7 +127,7 @@ def multioutput_auroc_score( y_score : array-like of shape (n_samples,) or (n_samples, n_outputs) Target scores, i.e. probability of the class with the greater label for each - output** of the classifier. + output of the classifier. suppress_warnings : boolean, default=False Whether to suppress any warnings that may arise during evaluation on some @@ -197,7 +197,7 @@ def multioutput_auprc_score( y_score : array-like of shape (n_samples,) or (n_samples, n_outputs) Target scores, i.e. probability of the class with the greater label for each - output** of the classifier. + output of the classifier. suppress_warnings : boolean, default=False Whether to suppress any warnings that may arise during evaluation on some diff --git a/skfp/metrics/utils.py b/skfp/metrics/utils.py index c0092ee2..88d304fe 100644 --- a/skfp/metrics/utils.py +++ b/skfp/metrics/utils.py @@ -10,7 +10,7 @@ def extract_pos_proba(predictions: np.ndarray | list[np.ndarray]) -> np.ndarray: """ Extract positive class probabilities (``y-score``). - Probabilitic metrics like AUROC or AUPRC use predicted probabilities. This + Probabilistic metrics like AUROC or AUPRC use predicted probabilities. This function extracts them from ``.predict_proba()`` results. Returns `(n_samples,)` shape for single-task, and `(n_samples, n_tasks)` for @@ -25,7 +25,7 @@ def extract_pos_proba(predictions: np.ndarray | list[np.ndarray]) -> np.ndarray: Returns ------- - y_score : NumPy array of shape (n_samples,) or (n_samples, n_tasks + y_score : NumPy array of shape (n_samples,) or (n_samples, n_tasks) Predicted positive class probabilities for each task. Examples diff --git a/skfp/metrics/virtual_screening.py b/skfp/metrics/virtual_screening.py index d148888f..423f34e9 100644 --- a/skfp/metrics/virtual_screening.py +++ b/skfp/metrics/virtual_screening.py @@ -10,7 +10,7 @@ @validate_params( { "y_true": ["array-like"], - "y_pred": ["array-like"], + "y_score": ["array-like"], "fraction": [Interval(Real, 0, 1, closed="neither")], }, prefer_skip_nested_validation=True, @@ -98,7 +98,7 @@ def enrichment_factor( @validate_params( { "y_true": ["array-like"], - "y_pred": ["array-like"], + "y_score": ["array-like"], "alpha": [Interval(Real, 0, None, closed="neither")], }, prefer_skip_nested_validation=True, @@ -191,7 +191,7 @@ def rie_score( @validate_params( { "y_true": ["array-like"], - "y_pred": ["array-like"], + "y_score": ["array-like"], "alpha": [Interval(Real, 0, None, closed="neither")], }, prefer_skip_nested_validation=True, diff --git a/skfp/preprocessing/conformer_generator.py b/skfp/preprocessing/conformer_generator.py index c631a873..345459c7 100644 --- a/skfp/preprocessing/conformer_generator.py +++ b/skfp/preprocessing/conformer_generator.py @@ -30,10 +30,10 @@ class ConformerGenerator(BasePreprocessor): """ - Generate molecule conformer. + Generate molecule conformers. The implementation uses RDKit and distance geometry (DG) approach [1]_, with - optimized ETKDGv3 improvements for small rings, macrocycles and experimental + optimized ETKDGv3 improvements for small rings, macrocycles, and experimental torsional angle preferences [2]_. Generated conformations are optionally optimized with a force field approach. @@ -78,7 +78,7 @@ class ConformerGenerator(BasePreprocessor): How to select final conformer for each molecule when multiple conformers are generated. "first" selects first conformer generated by RDKit. - suppress_warnings: bool, default=False + suppress_warnings : bool, default=False Whether to suppress warnings on generating conformers, e.g. UFFTYPER warnings. errors : {"raise", "ignore", "filter"}, default="raise" @@ -152,7 +152,7 @@ class ConformerGenerator(BasePreprocessor): "n_jobs": [Integral, None], "batch_size": [Integral, None], "verbose": ["verbose", dict], - "random_state": [Interval(Integral, left=-1, right=None, closed="left")], + "random_state": [Interval(Integral, left=-1, right=None, closed="left"), None], } def __init__( @@ -203,10 +203,10 @@ def transform_x_y( """ Generate conformers for molecules. - If ``errors`` is set to ``"filter"``, then in case of errors less than - n_samples values may be returned. If ``errors`` is set to ``"ignore"``, - some molecules may be returned without conformers generated and with - ``conf_id`` property set to -1. + If ``errors`` is set to ``"filter"``, then in case of errors fewer than + n_samples values may be returned (``n_samples_conf_gen <= n_samples``). + If ``errors`` is set to ``"ignore"``, some molecules may be returned without + conformers generated and with ``conf_id`` property set to -1. Parameters ---------- diff --git a/skfp/preprocessing/input_output/aminoseq.py b/skfp/preprocessing/input_output/aminoseq.py index 09a88bad..f157ca6c 100644 --- a/skfp/preprocessing/input_output/aminoseq.py +++ b/skfp/preprocessing/input_output/aminoseq.py @@ -62,14 +62,13 @@ class MolFromAminoseqTransformer(BasePreprocessor): Examples -------- >>> from skfp.preprocessing import MolFromAminoseqTransformer - >>> sequences = ["KWLRRVWRWWR","FLPAIGRVLSGIL","ILGKLLSTAWGLLSKL",] + >>> sequences = ["KWLRRVWRWWR","FLPAIGRVLSGIL","ILGKLLSTAWGLLSKL"] >>> mol_from_aminoseq = MolFromAminoseqTransformer() >>> mol_from_aminoseq MolFromAminoseqTransformer() >>> mol_from_aminoseq.transform(sequences) # doctest: +SKIP [, - , , ] """ @@ -118,7 +117,7 @@ def transform(self, X, copy: bool = False) -> list[Mol]: Returns ------- - X : list of shape (n_samples_conf_gen,) + X : list of shape (n_samples,) List with RDKit ``Mol`` objects. """ X = super().transform(X, copy) diff --git a/skfp/preprocessing/input_output/inchi.py b/skfp/preprocessing/input_output/inchi.py index d821d097..aefd2f71 100644 --- a/skfp/preprocessing/input_output/inchi.py +++ b/skfp/preprocessing/input_output/inchi.py @@ -49,7 +49,7 @@ class MolFromInchiTransformer(BasePreprocessor): verbose : int or dict, default=0 Controls the verbosity when processing molecules. If a dictionary is passed, it is treated as kwargs for ``tqdm()``, - and can be used to control the progress bar.. + and can be used to control the progress bar. References ---------- @@ -100,7 +100,7 @@ def __init__( def transform(self, X, copy: bool = False) -> list[Mol]: """ Create RDKit ``Mol`` objects from InChI strings. If ``valid_only`` is set to - True, returns only a subset of molecules which could be successfullyloaded. + True, returns only a subset of molecules which could be successfully loaded. Parameters ---------- @@ -112,7 +112,7 @@ def transform(self, X, copy: bool = False) -> list[Mol]: Returns ------- - X : list of shape (n_samples_conf_gen,) + X : list of shape (n_samples,) List with RDKit ``Mol`` objects. """ X = super().transform(X, copy) diff --git a/skfp/preprocessing/input_output/sdf.py b/skfp/preprocessing/input_output/sdf.py index 302d578c..097a8a9f 100644 --- a/skfp/preprocessing/input_output/sdf.py +++ b/skfp/preprocessing/input_output/sdf.py @@ -75,7 +75,7 @@ def transform(self, X: str, copy: bool = False) -> list[Mol]: # type: ignore[ov Returns ------- - X : list of shape (n_samples_conf_gen,) + X : list of shape (n_samples,) List with RDKit ``Mol`` objects. """ self._validate_params() @@ -115,7 +115,7 @@ class MolToSDFTransformer(BasePreprocessor): Parameters ---------- filepath : string, default="mols.sdf" - A string with file path location to save the SDF file. Tt should be a valid + A string with file path location to save the SDF file. It should be a valid file path with ``.sdf`` extension. kekulize : bool, default=True diff --git a/skfp/preprocessing/input_output/smiles.py b/skfp/preprocessing/input_output/smiles.py index aa346698..646d82cc 100644 --- a/skfp/preprocessing/input_output/smiles.py +++ b/skfp/preprocessing/input_output/smiles.py @@ -115,7 +115,7 @@ def transform(self, X, copy: bool = False) -> list[Mol]: Returns ------- - X : list of shape (n_samples_conf_gen,) + X : list of shape (n_samples,) List with RDKit ``Mol`` objects. """ y = np.empty(len(X)) diff --git a/skfp/preprocessing/standardization.py b/skfp/preprocessing/standardization.py index bd45226e..ab420c50 100644 --- a/skfp/preprocessing/standardization.py +++ b/skfp/preprocessing/standardization.py @@ -116,7 +116,7 @@ def transform(self, X: Sequence[str | Mol], copy: bool = True) -> list[Mol]: Returns ------- - X : list of shape (n_samples_conf_gen,) + X : list of shape (n_samples,) List with RDKit ``Mol`` objects. """ return super().transform(X, copy) diff --git a/skfp/utils/parallel.py b/skfp/utils/parallel.py index 13a21511..a08e33cc 100644 --- a/skfp/utils/parallel.py +++ b/skfp/utils/parallel.py @@ -91,7 +91,7 @@ def run_in_parallel( Returns ------- X : list of length (n_samples,) - The processed data. If processing function returns functions, this will be + The processed data. If the processing function returns lists, this will be a list of lists. Examples diff --git a/skfp/utils/validators.py b/skfp/utils/validators.py index ff58650c..3e494a09 100644 --- a/skfp/utils/validators.py +++ b/skfp/utils/validators.py @@ -10,7 +10,7 @@ def ensure_mols(X: Sequence[Any]) -> list[Mol]: """ Ensure that all input sequence elements are RDKit ``Mol`` objects. Requires all input elements to be of the same type: string (SMILES strings) or ``Mol``. - In case of SMILES strings, they are converted to RDKit ``Mol`` objects with + In the case of SMILES strings, they are converted to RDKit ``Mol`` objects with default settings. """ if not all(isinstance(x, (Mol, PropertyMol, str)) for x in X): @@ -31,7 +31,7 @@ def ensure_mols(X: Sequence[Any]) -> list[Mol]: def ensure_smiles(X: Sequence[Any]) -> list[str]: """ Ensure that all input sequence elements are SMILES strings. Requires all input - elements to be of the same type: string (SMILES strings) or ``Mol``. In case of + elements to be of the same type: string (SMILES strings) or ``Mol``. In the case of RDKit ``Mol`` objects, they are converted to SMILES strings with default settings. """ if not all(isinstance(x, (Mol, PropertyMol, str)) for x in X): @@ -44,7 +44,7 @@ def ensure_smiles(X: Sequence[Any]) -> list[str]: def require_mols(X: Sequence[Any]) -> None: """ - Check that all inputs are RDKit ``Mol`` objects, raises ValueError otherwise. + Check that all inputs are RDKit ``Mol`` objects, raises TypeError otherwise. """ for idx, x in enumerate(X): if not isinstance(x, (Mol, PropertyMol)): @@ -56,7 +56,7 @@ def require_mols(X: Sequence[Any]) -> None: def require_mols_with_conf_ids(X: Sequence[Any]) -> Sequence[Mol]: """ Check that all inputs are RDKit ``Mol`` objects with ``"conf_id"`` property - set, i.e. with conformers computed and properly identified. Raises ValueError + set, i.e. with conformers computed and properly identified. Raises TypeError otherwise. """ if not all(isinstance(x, (Mol, PropertyMol)) and x.HasProp("conf_id") for x in X): @@ -70,7 +70,7 @@ def require_mols_with_conf_ids(X: Sequence[Any]) -> Sequence[Mol]: def require_strings(X: Sequence[Any]) -> None: """ - Check that all inputs are strings, raises ValueError otherwise. + Check that all inputs are strings, raises TypeError otherwise. """ for idx, x in enumerate(X): if not isinstance(x, str): diff --git a/tests/descriptors/charge.py b/tests/descriptors/charge.py index 9a547b23..6b2a3120 100644 --- a/tests/descriptors/charge.py +++ b/tests/descriptors/charge.py @@ -39,6 +39,17 @@ def test_atomic_partial_charges_gasteiger(mols_list, gasteiger_allowed_mols): ] +def test_atomic_partial_charges_precomputed(mols_list): + # set charge +1 everywhere + for mol in mols_list: + for atom in mol.GetAtoms(): + atom.SetDoubleProp("charge", 1) + + for mol in mols_list: + charges = atomic_partial_charges(mol, partial_charge_model="precomputed") + assert all(c == 1 for c in charges) + + def test_atomic_partial_charges_ignore_error(): organometallics = [ "CCCC[Li]", diff --git a/uv.lock b/uv.lock index 2d09d163..4b06c7c6 100644 --- a/uv.lock +++ b/uv.lock @@ -30,17 +30,16 @@ wheels = [ [[package]] name = "anyio" -version = "4.11.0" +version = "4.12.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "exceptiongroup", marker = "python_full_version < '3.11'" }, { name = "idna" }, - { name = "sniffio" }, { name = "typing-extensions", marker = "python_full_version < '3.13'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c6/78/7d432127c41b50bccba979505f272c16cbcadcc33645d5fa3a738110ae75/anyio-4.11.0.tar.gz", hash = "sha256:82a8d0b81e318cc5ce71a5f1f8b5c4e63619620b63141ef8c995fa0db95a57c4", size = 219094, upload-time = "2025-09-23T09:19:12.58Z" } +sdist = { url = "https://files.pythonhosted.org/packages/16/ce/8a777047513153587e5434fd752e89334ac33e379aa3497db860eeb60377/anyio-4.12.0.tar.gz", hash = "sha256:73c693b567b0c55130c104d0b43a9baf3aa6a31fc6110116509f27bf75e21ec0", size = 228266, upload-time = "2025-11-28T23:37:38.911Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/15/b3/9b1a8074496371342ec1e796a96f99c82c945a339cd81a8e73de28b4cf9e/anyio-4.11.0-py3-none-any.whl", hash = "sha256:0287e96f4d26d4149305414d4e3bc32f0dcd0862365a4bddea19d7a1ec38c4fc", size = 109097, upload-time = "2025-09-23T09:19:10.601Z" }, + { url = "https://files.pythonhosted.org/packages/7f/9c/36c5c37947ebfb8c7f22e0eb6e4d188ee2d53aa3880f3f2744fb894f0cb1/anyio-4.12.0-py3-none-any.whl", hash = "sha256:dad2376a628f98eeca4881fc56cd06affd18f659b17a747d3ff0307ced94b1bb", size = 113362, upload-time = "2025-11-28T23:36:57.897Z" }, ] [[package]] @@ -92,24 +91,24 @@ wheels = [ [[package]] name = "arrow" -version = "1.3.0" +version = "1.4.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "python-dateutil" }, - { name = "types-python-dateutil" }, + { name = "tzdata" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2e/00/0f6e8fcdb23ea632c866620cc872729ff43ed91d284c866b515c6342b173/arrow-1.3.0.tar.gz", hash = "sha256:d4540617648cb5f895730f1ad8c82a65f2dad0166f57b75f3ca54759c4d67a85", size = 131960, upload-time = "2023-09-30T22:11:18.25Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b9/33/032cdc44182491aa708d06a68b62434140d8c50820a087fac7af37703357/arrow-1.4.0.tar.gz", hash = "sha256:ed0cc050e98001b8779e84d461b0098c4ac597e88704a655582b21d116e526d7", size = 152931, upload-time = "2025-10-18T17:46:46.761Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f8/ed/e97229a566617f2ae958a6b13e7cc0f585470eac730a73e9e82c32a3cdd2/arrow-1.3.0-py3-none-any.whl", hash = "sha256:c728b120ebc00eb84e01882a6f5e7927a53960aa990ce7dd2b10f39005a67f80", size = 66419, upload-time = "2023-09-30T22:11:16.072Z" }, + { url = "https://files.pythonhosted.org/packages/ed/c9/d7977eaacb9df673210491da99e6a247e93df98c715fc43fd136ce1d3d33/arrow-1.4.0-py3-none-any.whl", hash = "sha256:749f0769958ebdc79c173ff0b0670d59051a535fa26e8eba02953dc19eb43205", size = 68797, upload-time = "2025-10-18T17:46:45.663Z" }, ] [[package]] name = "asttokens" -version = "3.0.0" +version = "3.0.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/4a/e7/82da0a03e7ba5141f05cce0d302e6eed121ae055e0456ca228bf693984bc/asttokens-3.0.0.tar.gz", hash = "sha256:0dcd8baa8d62b0c1d118b399b2ddba3c4aff271d0d7a9e0d4c1681c79035bbc7", size = 61978, upload-time = "2024-11-30T04:30:14.439Z" } +sdist = { url = "https://files.pythonhosted.org/packages/be/a5/8e3f9b6771b0b408517c82d97aed8f2036509bc247d46114925e32fe33f0/asttokens-3.0.1.tar.gz", hash = "sha256:71a4ee5de0bde6a31d64f6b13f2293ac190344478f081c3d1bccfcf5eacb0cb7", size = 62308, upload-time = "2025-11-15T16:43:48.578Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/25/8a/c46dcc25341b5bce5472c718902eb3d38600a903b14fa6aeecef3f21a46f/asttokens-3.0.0-py3-none-any.whl", hash = "sha256:e3078351a059199dd5138cb1c706e6430c05eff2ff136af5eb4790f9d28932e2", size = 26918, upload-time = "2024-11-30T04:30:10.946Z" }, + { url = "https://files.pythonhosted.org/packages/d2/39/e7eaf1799466a4aef85b6a4fe7bd175ad2b1c6345066aa33f1f58d4b18d0/asttokens-3.0.1-py3-none-any.whl", hash = "sha256:15a3ebc0f43c2d0a50eeafea25e19046c68398e487b9f1f5b517f7c0f40f976a", size = 27047, upload-time = "2025-11-15T16:43:16.109Z" }, ] [[package]] @@ -126,11 +125,11 @@ wheels = [ [[package]] name = "attrs" -version = "25.3.0" +version = "25.4.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/5a/b0/1367933a8532ee6ff8d63537de4f1177af4bff9f3e829baf7331f595bb24/attrs-25.3.0.tar.gz", hash = "sha256:75d7cefc7fb576747b2c81b4442d4d4a1ce0900973527c011d1030fd3bf4af1b", size = 812032, upload-time = "2025-03-13T11:10:22.779Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6b/5c/685e6633917e101e5dcb62b9dd76946cbb57c26e133bae9e0cd36033c0a9/attrs-25.4.0.tar.gz", hash = "sha256:16d5969b87f0859ef33a48b35d55ac1be6e42ae49d5e853b597db70c35c57e11", size = 934251, upload-time = "2025-10-06T13:54:44.725Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/77/06/bb80f5f86020c4551da315d78b3ab75e8228f89f0162f2c3a819e407941a/attrs-25.3.0-py3-none-any.whl", hash = "sha256:427318ce031701fea540783410126f03899a97ffc6f61596ad581ac2e40e3bc3", size = 63815, upload-time = "2025-03-13T11:10:21.14Z" }, + { url = "https://files.pythonhosted.org/packages/3a/2a/7cc015f5b9f5db42b7d48157e23356022889fc354a2813c15934b7cb5c0e/attrs-25.4.0-py3-none-any.whl", hash = "sha256:adcf7e2a1fb3b36ac48d97835bb6d8ade15b8dcce26aba8bf1d14847b57a3373", size = 67615, upload-time = "2025-10-06T13:54:43.17Z" }, ] [[package]] @@ -144,27 +143,27 @@ wheels = [ [[package]] name = "beautifulsoup4" -version = "4.13.5" +version = "4.14.3" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "soupsieve" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/85/2e/3e5079847e653b1f6dc647aa24549d68c6addb4c595cc0d902d1b19308ad/beautifulsoup4-4.13.5.tar.gz", hash = "sha256:5e70131382930e7c3de33450a2f54a63d5e4b19386eab43a5b34d594268f3695", size = 622954, upload-time = "2025-08-24T14:06:13.168Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c3/b0/1c6a16426d389813b48d95e26898aff79abbde42ad353958ad95cc8c9b21/beautifulsoup4-4.14.3.tar.gz", hash = "sha256:6292b1c5186d356bba669ef9f7f051757099565ad9ada5dd630bd9de5fa7fb86", size = 627737, upload-time = "2025-11-30T15:08:26.084Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/04/eb/f4151e0c7377a6e08a38108609ba5cede57986802757848688aeedd1b9e8/beautifulsoup4-4.13.5-py3-none-any.whl", hash = "sha256:642085eaa22233aceadff9c69651bc51e8bf3f874fb6d7104ece2beb24b47c4a", size = 105113, upload-time = "2025-08-24T14:06:14.884Z" }, + { url = "https://files.pythonhosted.org/packages/1a/39/47f9197bdd44df24d67ac8893641e16f386c984a0619ef2ee4c51fbbc019/beautifulsoup4-4.14.3-py3-none-any.whl", hash = "sha256:0918bfe44902e6ad8d57732ba310582e98da931428d231a5ecb9e7c703a735bb", size = 107721, upload-time = "2025-11-30T15:08:24.087Z" }, ] [[package]] name = "bleach" -version = "6.2.0" +version = "6.3.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "webencodings" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/76/9a/0e33f5054c54d349ea62c277191c020c2d6ef1d65ab2cb1993f91ec846d1/bleach-6.2.0.tar.gz", hash = "sha256:123e894118b8a599fd80d3ec1a6d4cc7ce4e5882b1317a7e1ba69b56e95f991f", size = 203083, upload-time = "2024-10-29T18:30:40.477Z" } +sdist = { url = "https://files.pythonhosted.org/packages/07/18/3c8523962314be6bf4c8989c79ad9531c825210dd13a8669f6b84336e8bd/bleach-6.3.0.tar.gz", hash = "sha256:6f3b91b1c0a02bb9a78b5a454c92506aa0fdf197e1d5e114d2e00c6f64306d22", size = 203533, upload-time = "2025-10-27T17:57:39.211Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/fc/55/96142937f66150805c25c4d0f31ee4132fd33497753400734f9dfdcbdc66/bleach-6.2.0-py3-none-any.whl", hash = "sha256:117d9c6097a7c3d22fd578fcd8d35ff1e125df6736f554da4e432fdd63f31e5e", size = 163406, upload-time = "2024-10-29T18:30:38.186Z" }, + { url = "https://files.pythonhosted.org/packages/cd/3a/577b549de0cc09d95f11087ee63c739bba856cd3952697eec4c4bb91350a/bleach-6.3.0-py3-none-any.whl", hash = "sha256:fe10ec77c93ddf3d13a73b035abaac7a9f5e436513864ccdad516693213c65d6", size = 164437, upload-time = "2025-10-27T17:57:37.538Z" }, ] [package.optional-dependencies] @@ -172,40 +171,13 @@ css = [ { name = "tinycss2" }, ] -[[package]] -name = "boolean-py" -version = "5.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/c4/cf/85379f13b76f3a69bca86b60237978af17d6aa0bc5998978c3b8cf05abb2/boolean_py-5.0.tar.gz", hash = "sha256:60cbc4bad079753721d32649545505362c754e121570ada4658b852a3a318d95", size = 37047, upload-time = "2025-04-03T10:39:49.734Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/ca/78d423b324b8d77900030fa59c4aa9054261ef0925631cd2501dd015b7b7/boolean_py-5.0-py3-none-any.whl", hash = "sha256:ef28a70bd43115208441b53a045d1549e2f0ec6e3d08a9d142cbc41c1938e8d9", size = 26577, upload-time = "2025-04-03T10:39:48.449Z" }, -] - -[[package]] -name = "cachecontrol" -version = "0.14.3" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "msgpack" }, - { name = "requests" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/58/3a/0cbeb04ea57d2493f3ec5a069a117ab467f85e4a10017c6d854ddcbff104/cachecontrol-0.14.3.tar.gz", hash = "sha256:73e7efec4b06b20d9267b441c1f733664f989fb8688391b670ca812d70795d11", size = 28985, upload-time = "2025-04-30T16:45:06.135Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/81/4c/800b0607b00b3fd20f1087f80ab53d6b4d005515b0f773e4831e37cfa83f/cachecontrol-0.14.3-py3-none-any.whl", hash = "sha256:b35e44a3113f17d2a31c1e6b27b9de6d4405f84ae51baa8c1d3cc5b633010cae", size = 21802, upload-time = "2025-04-30T16:45:03.863Z" }, -] - -[package.optional-dependencies] -filecache = [ - { name = "filelock" }, -] - [[package]] name = "certifi" -version = "2025.8.3" +version = "2025.11.12" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/dc/67/960ebe6bf230a96cda2e0abcf73af550ec4f090005363542f0765df162e0/certifi-2025.8.3.tar.gz", hash = "sha256:e564105f78ded564e3ae7c923924435e1daa7463faeab5bb932bc53ffae63407", size = 162386, upload-time = "2025-08-03T03:07:47.08Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a2/8c/58f469717fa48465e4a50c014a0400602d3c437d7c0c468e17ada824da3a/certifi-2025.11.12.tar.gz", hash = "sha256:d8ab5478f2ecd78af242878415affce761ca6bc54a22a27e026d7c25357c3316", size = 160538, upload-time = "2025-11-12T02:54:51.517Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/48/1549795ba7742c948d2ad169c1c8cdbae65bc450d6cd753d124b17c8cd32/certifi-2025.8.3-py3-none-any.whl", hash = "sha256:f6c12493cfb1b06ba2ff328595af9350c65d6644968e5d3a2ffd78699af217a5", size = 161216, upload-time = "2025-08-03T03:07:45.777Z" }, + { url = "https://files.pythonhosted.org/packages/70/7d/9bc192684cea499815ff478dfcdc13835ddf401365057044fb721ec6bddb/certifi-2025.11.12-py3-none-any.whl", hash = "sha256:97de8790030bbd5c2d96b7ec782fc2f7820ef8dba6db909ccf95449f2d062d4b", size = 159438, upload-time = "2025-11-12T02:54:49.735Z" }, ] [[package]] @@ -270,64 +242,84 @@ wheels = [ [[package]] name = "cfgv" -version = "3.4.0" +version = "3.5.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/11/74/539e56497d9bd1d484fd863dd69cbbfa653cd2aa27abfe35653494d85e94/cfgv-3.4.0.tar.gz", hash = "sha256:e52591d4c5f5dead8e0f673fb16db7949d2cfb3f7da4582893288f0ded8fe560", size = 7114, upload-time = "2023-08-12T20:38:17.776Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4e/b5/721b8799b04bf9afe054a3899c6cf4e880fcf8563cc71c15610242490a0c/cfgv-3.5.0.tar.gz", hash = "sha256:d5b1034354820651caa73ede66a6294d6e95c1b00acc5e9b098e917404669132", size = 7334, upload-time = "2025-11-19T20:55:51.612Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c5/55/51844dd50c4fc7a33b653bfaba4c2456f06955289ca770a5dbd5fd267374/cfgv-3.4.0-py2.py3-none-any.whl", hash = "sha256:b7265b1f29fd3316bfcd2b330d63d024f2bfd8bcb8b0272f8e19a504856c48f9", size = 7249, upload-time = "2023-08-12T20:38:16.269Z" }, + { url = "https://files.pythonhosted.org/packages/db/3c/33bac158f8ab7f89b2e59426d5fe2e4f63f7ed25df84c036890172b412b5/cfgv-3.5.0-py2.py3-none-any.whl", hash = "sha256:a8dc6b26ad22ff227d2634a65cb388215ce6cc96bbcc5cfde7641ae87e8dacc0", size = 7445, upload-time = "2025-11-19T20:55:50.744Z" }, ] [[package]] name = "charset-normalizer" -version = "3.4.3" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/83/2d/5fd176ceb9b2fc619e63405525573493ca23441330fcdaee6bef9460e924/charset_normalizer-3.4.3.tar.gz", hash = "sha256:6fce4b8500244f6fcb71465d4a4930d132ba9ab8e71a7859e6a5d59851068d14", size = 122371, upload-time = "2025-08-09T07:57:28.46Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/d6/98/f3b8013223728a99b908c9344da3aa04ee6e3fa235f19409033eda92fb78/charset_normalizer-3.4.3-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:fb7f67a1bfa6e40b438170ebdc8158b78dc465a5a67b6dde178a46987b244a72", size = 207695, upload-time = "2025-08-09T07:55:36.452Z" }, - { url = "https://files.pythonhosted.org/packages/21/40/5188be1e3118c82dcb7c2a5ba101b783822cfb413a0268ed3be0468532de/charset_normalizer-3.4.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:cc9370a2da1ac13f0153780040f465839e6cccb4a1e44810124b4e22483c93fe", size = 147153, upload-time = "2025-08-09T07:55:38.467Z" }, - { url = "https://files.pythonhosted.org/packages/37/60/5d0d74bc1e1380f0b72c327948d9c2aca14b46a9efd87604e724260f384c/charset_normalizer-3.4.3-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:07a0eae9e2787b586e129fdcbe1af6997f8d0e5abaa0bc98c0e20e124d67e601", size = 160428, upload-time = "2025-08-09T07:55:40.072Z" }, - { url = "https://files.pythonhosted.org/packages/85/9a/d891f63722d9158688de58d050c59dc3da560ea7f04f4c53e769de5140f5/charset_normalizer-3.4.3-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:74d77e25adda8581ffc1c720f1c81ca082921329452eba58b16233ab1842141c", size = 157627, upload-time = "2025-08-09T07:55:41.706Z" }, - { url = "https://files.pythonhosted.org/packages/65/1a/7425c952944a6521a9cfa7e675343f83fd82085b8af2b1373a2409c683dc/charset_normalizer-3.4.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d0e909868420b7049dafd3a31d45125b31143eec59235311fc4c57ea26a4acd2", size = 152388, upload-time = "2025-08-09T07:55:43.262Z" }, - { url = "https://files.pythonhosted.org/packages/f0/c9/a2c9c2a355a8594ce2446085e2ec97fd44d323c684ff32042e2a6b718e1d/charset_normalizer-3.4.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:c6f162aabe9a91a309510d74eeb6507fab5fff92337a15acbe77753d88d9dcf0", size = 150077, upload-time = "2025-08-09T07:55:44.903Z" }, - { url = "https://files.pythonhosted.org/packages/3b/38/20a1f44e4851aa1c9105d6e7110c9d020e093dfa5836d712a5f074a12bf7/charset_normalizer-3.4.3-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:4ca4c094de7771a98d7fbd67d9e5dbf1eb73efa4f744a730437d8a3a5cf994f0", size = 161631, upload-time = "2025-08-09T07:55:46.346Z" }, - { url = "https://files.pythonhosted.org/packages/a4/fa/384d2c0f57edad03d7bec3ebefb462090d8905b4ff5a2d2525f3bb711fac/charset_normalizer-3.4.3-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:02425242e96bcf29a49711b0ca9f37e451da7c70562bc10e8ed992a5a7a25cc0", size = 159210, upload-time = "2025-08-09T07:55:47.539Z" }, - { url = "https://files.pythonhosted.org/packages/33/9e/eca49d35867ca2db336b6ca27617deed4653b97ebf45dfc21311ce473c37/charset_normalizer-3.4.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:78deba4d8f9590fe4dae384aeff04082510a709957e968753ff3c48399f6f92a", size = 153739, upload-time = "2025-08-09T07:55:48.744Z" }, - { url = "https://files.pythonhosted.org/packages/2a/91/26c3036e62dfe8de8061182d33be5025e2424002125c9500faff74a6735e/charset_normalizer-3.4.3-cp310-cp310-win32.whl", hash = "sha256:d79c198e27580c8e958906f803e63cddb77653731be08851c7df0b1a14a8fc0f", size = 99825, upload-time = "2025-08-09T07:55:50.305Z" }, - { url = "https://files.pythonhosted.org/packages/e2/c6/f05db471f81af1fa01839d44ae2a8bfeec8d2a8b4590f16c4e7393afd323/charset_normalizer-3.4.3-cp310-cp310-win_amd64.whl", hash = "sha256:c6e490913a46fa054e03699c70019ab869e990270597018cef1d8562132c2669", size = 107452, upload-time = "2025-08-09T07:55:51.461Z" }, - { url = "https://files.pythonhosted.org/packages/7f/b5/991245018615474a60965a7c9cd2b4efbaabd16d582a5547c47ee1c7730b/charset_normalizer-3.4.3-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:b256ee2e749283ef3ddcff51a675ff43798d92d746d1a6e4631bf8c707d22d0b", size = 204483, upload-time = "2025-08-09T07:55:53.12Z" }, - { url = "https://files.pythonhosted.org/packages/c7/2a/ae245c41c06299ec18262825c1569c5d3298fc920e4ddf56ab011b417efd/charset_normalizer-3.4.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:13faeacfe61784e2559e690fc53fa4c5ae97c6fcedb8eb6fb8d0a15b475d2c64", size = 145520, upload-time = "2025-08-09T07:55:54.712Z" }, - { url = "https://files.pythonhosted.org/packages/3a/a4/b3b6c76e7a635748c4421d2b92c7b8f90a432f98bda5082049af37ffc8e3/charset_normalizer-3.4.3-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:00237675befef519d9af72169d8604a067d92755e84fe76492fef5441db05b91", size = 158876, upload-time = "2025-08-09T07:55:56.024Z" }, - { url = "https://files.pythonhosted.org/packages/e2/e6/63bb0e10f90a8243c5def74b5b105b3bbbfb3e7bb753915fe333fb0c11ea/charset_normalizer-3.4.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:585f3b2a80fbd26b048a0be90c5aae8f06605d3c92615911c3a2b03a8a3b796f", size = 156083, upload-time = "2025-08-09T07:55:57.582Z" }, - { url = "https://files.pythonhosted.org/packages/87/df/b7737ff046c974b183ea9aa111b74185ac8c3a326c6262d413bd5a1b8c69/charset_normalizer-3.4.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0e78314bdc32fa80696f72fa16dc61168fda4d6a0c014e0380f9d02f0e5d8a07", size = 150295, upload-time = "2025-08-09T07:55:59.147Z" }, - { url = "https://files.pythonhosted.org/packages/61/f1/190d9977e0084d3f1dc169acd060d479bbbc71b90bf3e7bf7b9927dec3eb/charset_normalizer-3.4.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:96b2b3d1a83ad55310de8c7b4a2d04d9277d5591f40761274856635acc5fcb30", size = 148379, upload-time = "2025-08-09T07:56:00.364Z" }, - { url = "https://files.pythonhosted.org/packages/4c/92/27dbe365d34c68cfe0ca76f1edd70e8705d82b378cb54ebbaeabc2e3029d/charset_normalizer-3.4.3-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:939578d9d8fd4299220161fdd76e86c6a251987476f5243e8864a7844476ba14", size = 160018, upload-time = "2025-08-09T07:56:01.678Z" }, - { url = "https://files.pythonhosted.org/packages/99/04/baae2a1ea1893a01635d475b9261c889a18fd48393634b6270827869fa34/charset_normalizer-3.4.3-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:fd10de089bcdcd1be95a2f73dbe6254798ec1bda9f450d5828c96f93e2536b9c", size = 157430, upload-time = "2025-08-09T07:56:02.87Z" }, - { url = "https://files.pythonhosted.org/packages/2f/36/77da9c6a328c54d17b960c89eccacfab8271fdaaa228305330915b88afa9/charset_normalizer-3.4.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:1e8ac75d72fa3775e0b7cb7e4629cec13b7514d928d15ef8ea06bca03ef01cae", size = 151600, upload-time = "2025-08-09T07:56:04.089Z" }, - { url = "https://files.pythonhosted.org/packages/64/d4/9eb4ff2c167edbbf08cdd28e19078bf195762e9bd63371689cab5ecd3d0d/charset_normalizer-3.4.3-cp311-cp311-win32.whl", hash = "sha256:6cf8fd4c04756b6b60146d98cd8a77d0cdae0e1ca20329da2ac85eed779b6849", size = 99616, upload-time = "2025-08-09T07:56:05.658Z" }, - { url = "https://files.pythonhosted.org/packages/f4/9c/996a4a028222e7761a96634d1820de8a744ff4327a00ada9c8942033089b/charset_normalizer-3.4.3-cp311-cp311-win_amd64.whl", hash = "sha256:31a9a6f775f9bcd865d88ee350f0ffb0e25936a7f930ca98995c05abf1faf21c", size = 107108, upload-time = "2025-08-09T07:56:07.176Z" }, - { url = "https://files.pythonhosted.org/packages/e9/5e/14c94999e418d9b87682734589404a25854d5f5d0408df68bc15b6ff54bb/charset_normalizer-3.4.3-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:e28e334d3ff134e88989d90ba04b47d84382a828c061d0d1027b1b12a62b39b1", size = 205655, upload-time = "2025-08-09T07:56:08.475Z" }, - { url = "https://files.pythonhosted.org/packages/7d/a8/c6ec5d389672521f644505a257f50544c074cf5fc292d5390331cd6fc9c3/charset_normalizer-3.4.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0cacf8f7297b0c4fcb74227692ca46b4a5852f8f4f24b3c766dd94a1075c4884", size = 146223, upload-time = "2025-08-09T07:56:09.708Z" }, - { url = "https://files.pythonhosted.org/packages/fc/eb/a2ffb08547f4e1e5415fb69eb7db25932c52a52bed371429648db4d84fb1/charset_normalizer-3.4.3-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:c6fd51128a41297f5409deab284fecbe5305ebd7e5a1f959bee1c054622b7018", size = 159366, upload-time = "2025-08-09T07:56:11.326Z" }, - { url = "https://files.pythonhosted.org/packages/82/10/0fd19f20c624b278dddaf83b8464dcddc2456cb4b02bb902a6da126b87a1/charset_normalizer-3.4.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:3cfb2aad70f2c6debfbcb717f23b7eb55febc0bb23dcffc0f076009da10c6392", size = 157104, upload-time = "2025-08-09T07:56:13.014Z" }, - { url = "https://files.pythonhosted.org/packages/16/ab/0233c3231af734f5dfcf0844aa9582d5a1466c985bbed6cedab85af9bfe3/charset_normalizer-3.4.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1606f4a55c0fd363d754049cdf400175ee96c992b1f8018b993941f221221c5f", size = 151830, upload-time = "2025-08-09T07:56:14.428Z" }, - { url = "https://files.pythonhosted.org/packages/ae/02/e29e22b4e02839a0e4a06557b1999d0a47db3567e82989b5bb21f3fbbd9f/charset_normalizer-3.4.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:027b776c26d38b7f15b26a5da1044f376455fb3766df8fc38563b4efbc515154", size = 148854, upload-time = "2025-08-09T07:56:16.051Z" }, - { url = "https://files.pythonhosted.org/packages/05/6b/e2539a0a4be302b481e8cafb5af8792da8093b486885a1ae4d15d452bcec/charset_normalizer-3.4.3-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:42e5088973e56e31e4fa58eb6bd709e42fc03799c11c42929592889a2e54c491", size = 160670, upload-time = "2025-08-09T07:56:17.314Z" }, - { url = "https://files.pythonhosted.org/packages/31/e7/883ee5676a2ef217a40ce0bffcc3d0dfbf9e64cbcfbdf822c52981c3304b/charset_normalizer-3.4.3-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:cc34f233c9e71701040d772aa7490318673aa7164a0efe3172b2981218c26d93", size = 158501, upload-time = "2025-08-09T07:56:18.641Z" }, - { url = "https://files.pythonhosted.org/packages/c1/35/6525b21aa0db614cf8b5792d232021dca3df7f90a1944db934efa5d20bb1/charset_normalizer-3.4.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:320e8e66157cc4e247d9ddca8e21f427efc7a04bbd0ac8a9faf56583fa543f9f", size = 153173, upload-time = "2025-08-09T07:56:20.289Z" }, - { url = "https://files.pythonhosted.org/packages/50/ee/f4704bad8201de513fdc8aac1cabc87e38c5818c93857140e06e772b5892/charset_normalizer-3.4.3-cp312-cp312-win32.whl", hash = "sha256:fb6fecfd65564f208cbf0fba07f107fb661bcd1a7c389edbced3f7a493f70e37", size = 99822, upload-time = "2025-08-09T07:56:21.551Z" }, - { url = "https://files.pythonhosted.org/packages/39/f5/3b3836ca6064d0992c58c7561c6b6eee1b3892e9665d650c803bd5614522/charset_normalizer-3.4.3-cp312-cp312-win_amd64.whl", hash = "sha256:86df271bf921c2ee3818f0522e9a5b8092ca2ad8b065ece5d7d9d0e9f4849bcc", size = 107543, upload-time = "2025-08-09T07:56:23.115Z" }, - { url = "https://files.pythonhosted.org/packages/65/ca/2135ac97709b400c7654b4b764daf5c5567c2da45a30cdd20f9eefe2d658/charset_normalizer-3.4.3-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:14c2a87c65b351109f6abfc424cab3927b3bdece6f706e4d12faaf3d52ee5efe", size = 205326, upload-time = "2025-08-09T07:56:24.721Z" }, - { url = "https://files.pythonhosted.org/packages/71/11/98a04c3c97dd34e49c7d247083af03645ca3730809a5509443f3c37f7c99/charset_normalizer-3.4.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:41d1fc408ff5fdfb910200ec0e74abc40387bccb3252f3f27c0676731df2b2c8", size = 146008, upload-time = "2025-08-09T07:56:26.004Z" }, - { url = "https://files.pythonhosted.org/packages/60/f5/4659a4cb3c4ec146bec80c32d8bb16033752574c20b1252ee842a95d1a1e/charset_normalizer-3.4.3-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:1bb60174149316da1c35fa5233681f7c0f9f514509b8e399ab70fea5f17e45c9", size = 159196, upload-time = "2025-08-09T07:56:27.25Z" }, - { url = "https://files.pythonhosted.org/packages/86/9e/f552f7a00611f168b9a5865a1414179b2c6de8235a4fa40189f6f79a1753/charset_normalizer-3.4.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:30d006f98569de3459c2fc1f2acde170b7b2bd265dc1943e87e1a4efe1b67c31", size = 156819, upload-time = "2025-08-09T07:56:28.515Z" }, - { url = "https://files.pythonhosted.org/packages/7e/95/42aa2156235cbc8fa61208aded06ef46111c4d3f0de233107b3f38631803/charset_normalizer-3.4.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:416175faf02e4b0810f1f38bcb54682878a4af94059a1cd63b8747244420801f", size = 151350, upload-time = "2025-08-09T07:56:29.716Z" }, - { url = "https://files.pythonhosted.org/packages/c2/a9/3865b02c56f300a6f94fc631ef54f0a8a29da74fb45a773dfd3dcd380af7/charset_normalizer-3.4.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6aab0f181c486f973bc7262a97f5aca3ee7e1437011ef0c2ec04b5a11d16c927", size = 148644, upload-time = "2025-08-09T07:56:30.984Z" }, - { url = "https://files.pythonhosted.org/packages/77/d9/cbcf1a2a5c7d7856f11e7ac2d782aec12bdfea60d104e60e0aa1c97849dc/charset_normalizer-3.4.3-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:fdabf8315679312cfa71302f9bd509ded4f2f263fb5b765cf1433b39106c3cc9", size = 160468, upload-time = "2025-08-09T07:56:32.252Z" }, - { url = "https://files.pythonhosted.org/packages/f6/42/6f45efee8697b89fda4d50580f292b8f7f9306cb2971d4b53f8914e4d890/charset_normalizer-3.4.3-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:bd28b817ea8c70215401f657edef3a8aa83c29d447fb0b622c35403780ba11d5", size = 158187, upload-time = "2025-08-09T07:56:33.481Z" }, - { url = "https://files.pythonhosted.org/packages/70/99/f1c3bdcfaa9c45b3ce96f70b14f070411366fa19549c1d4832c935d8e2c3/charset_normalizer-3.4.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:18343b2d246dc6761a249ba1fb13f9ee9a2bcd95decc767319506056ea4ad4dc", size = 152699, upload-time = "2025-08-09T07:56:34.739Z" }, - { url = "https://files.pythonhosted.org/packages/a3/ad/b0081f2f99a4b194bcbb1934ef3b12aa4d9702ced80a37026b7607c72e58/charset_normalizer-3.4.3-cp313-cp313-win32.whl", hash = "sha256:6fb70de56f1859a3f71261cbe41005f56a7842cc348d3aeb26237560bfa5e0ce", size = 99580, upload-time = "2025-08-09T07:56:35.981Z" }, - { url = "https://files.pythonhosted.org/packages/9a/8f/ae790790c7b64f925e5c953b924aaa42a243fb778fed9e41f147b2a5715a/charset_normalizer-3.4.3-cp313-cp313-win_amd64.whl", hash = "sha256:cf1ebb7d78e1ad8ec2a8c4732c7be2e736f6e5123a4146c5b89c9d1f585f8cef", size = 107366, upload-time = "2025-08-09T07:56:37.339Z" }, - { url = "https://files.pythonhosted.org/packages/8a/1f/f041989e93b001bc4e44bb1669ccdcf54d3f00e628229a85b08d330615c5/charset_normalizer-3.4.3-py3-none-any.whl", hash = "sha256:ce571ab16d890d23b5c278547ba694193a45011ff86a9162a71307ed9f86759a", size = 53175, upload-time = "2025-08-09T07:57:26.864Z" }, +version = "3.4.4" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/13/69/33ddede1939fdd074bce5434295f38fae7136463422fe4fd3e0e89b98062/charset_normalizer-3.4.4.tar.gz", hash = "sha256:94537985111c35f28720e43603b8e7b43a6ecfb2ce1d3058bbe955b73404e21a", size = 129418, upload-time = "2025-10-14T04:42:32.879Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/1f/b8/6d51fc1d52cbd52cd4ccedd5b5b2f0f6a11bbf6765c782298b0f3e808541/charset_normalizer-3.4.4-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:e824f1492727fa856dd6eda4f7cee25f8518a12f3c4a56a74e8095695089cf6d", size = 209709, upload-time = "2025-10-14T04:40:11.385Z" }, + { url = "https://files.pythonhosted.org/packages/5c/af/1f9d7f7faafe2ddfb6f72a2e07a548a629c61ad510fe60f9630309908fef/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4bd5d4137d500351a30687c2d3971758aac9a19208fc110ccb9d7188fbe709e8", size = 148814, upload-time = "2025-10-14T04:40:13.135Z" }, + { url = "https://files.pythonhosted.org/packages/79/3d/f2e3ac2bbc056ca0c204298ea4e3d9db9b4afe437812638759db2c976b5f/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:027f6de494925c0ab2a55eab46ae5129951638a49a34d87f4c3eda90f696b4ad", size = 144467, upload-time = "2025-10-14T04:40:14.728Z" }, + { url = "https://files.pythonhosted.org/packages/ec/85/1bf997003815e60d57de7bd972c57dc6950446a3e4ccac43bc3070721856/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f820802628d2694cb7e56db99213f930856014862f3fd943d290ea8438d07ca8", size = 162280, upload-time = "2025-10-14T04:40:16.14Z" }, + { url = "https://files.pythonhosted.org/packages/3e/8e/6aa1952f56b192f54921c436b87f2aaf7c7a7c3d0d1a765547d64fd83c13/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:798d75d81754988d2565bff1b97ba5a44411867c0cf32b77a7e8f8d84796b10d", size = 159454, upload-time = "2025-10-14T04:40:17.567Z" }, + { url = "https://files.pythonhosted.org/packages/36/3b/60cbd1f8e93aa25d1c669c649b7a655b0b5fb4c571858910ea9332678558/charset_normalizer-3.4.4-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9d1bb833febdff5c8927f922386db610b49db6e0d4f4ee29601d71e7c2694313", size = 153609, upload-time = "2025-10-14T04:40:19.08Z" }, + { url = "https://files.pythonhosted.org/packages/64/91/6a13396948b8fd3c4b4fd5bc74d045f5637d78c9675585e8e9fbe5636554/charset_normalizer-3.4.4-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:9cd98cdc06614a2f768d2b7286d66805f94c48cde050acdbbb7db2600ab3197e", size = 151849, upload-time = "2025-10-14T04:40:20.607Z" }, + { url = "https://files.pythonhosted.org/packages/b7/7a/59482e28b9981d105691e968c544cc0df3b7d6133152fb3dcdc8f135da7a/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:077fbb858e903c73f6c9db43374fd213b0b6a778106bc7032446a8e8b5b38b93", size = 151586, upload-time = "2025-10-14T04:40:21.719Z" }, + { url = "https://files.pythonhosted.org/packages/92/59/f64ef6a1c4bdd2baf892b04cd78792ed8684fbc48d4c2afe467d96b4df57/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_armv7l.whl", hash = "sha256:244bfb999c71b35de57821b8ea746b24e863398194a4014e4c76adc2bbdfeff0", size = 145290, upload-time = "2025-10-14T04:40:23.069Z" }, + { url = "https://files.pythonhosted.org/packages/6b/63/3bf9f279ddfa641ffa1962b0db6a57a9c294361cc2f5fcac997049a00e9c/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_ppc64le.whl", hash = "sha256:64b55f9dce520635f018f907ff1b0df1fdc31f2795a922fb49dd14fbcdf48c84", size = 163663, upload-time = "2025-10-14T04:40:24.17Z" }, + { url = "https://files.pythonhosted.org/packages/ed/09/c9e38fc8fa9e0849b172b581fd9803bdf6e694041127933934184e19f8c3/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:faa3a41b2b66b6e50f84ae4a68c64fcd0c44355741c6374813a800cd6695db9e", size = 151964, upload-time = "2025-10-14T04:40:25.368Z" }, + { url = "https://files.pythonhosted.org/packages/d2/d1/d28b747e512d0da79d8b6a1ac18b7ab2ecfd81b2944c4c710e166d8dd09c/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_s390x.whl", hash = "sha256:6515f3182dbe4ea06ced2d9e8666d97b46ef4c75e326b79bb624110f122551db", size = 161064, upload-time = "2025-10-14T04:40:26.806Z" }, + { url = "https://files.pythonhosted.org/packages/bb/9a/31d62b611d901c3b9e5500c36aab0ff5eb442043fb3a1c254200d3d397d9/charset_normalizer-3.4.4-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:cc00f04ed596e9dc0da42ed17ac5e596c6ccba999ba6bd92b0e0aef2f170f2d6", size = 155015, upload-time = "2025-10-14T04:40:28.284Z" }, + { url = "https://files.pythonhosted.org/packages/1f/f3/107e008fa2bff0c8b9319584174418e5e5285fef32f79d8ee6a430d0039c/charset_normalizer-3.4.4-cp310-cp310-win32.whl", hash = "sha256:f34be2938726fc13801220747472850852fe6b1ea75869a048d6f896838c896f", size = 99792, upload-time = "2025-10-14T04:40:29.613Z" }, + { url = "https://files.pythonhosted.org/packages/eb/66/e396e8a408843337d7315bab30dbf106c38966f1819f123257f5520f8a96/charset_normalizer-3.4.4-cp310-cp310-win_amd64.whl", hash = "sha256:a61900df84c667873b292c3de315a786dd8dac506704dea57bc957bd31e22c7d", size = 107198, upload-time = "2025-10-14T04:40:30.644Z" }, + { url = "https://files.pythonhosted.org/packages/b5/58/01b4f815bf0312704c267f2ccb6e5d42bcc7752340cd487bc9f8c3710597/charset_normalizer-3.4.4-cp310-cp310-win_arm64.whl", hash = "sha256:cead0978fc57397645f12578bfd2d5ea9138ea0fac82b2f63f7f7c6877986a69", size = 100262, upload-time = "2025-10-14T04:40:32.108Z" }, + { url = "https://files.pythonhosted.org/packages/ed/27/c6491ff4954e58a10f69ad90aca8a1b6fe9c5d3c6f380907af3c37435b59/charset_normalizer-3.4.4-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:6e1fcf0720908f200cd21aa4e6750a48ff6ce4afe7ff5a79a90d5ed8a08296f8", size = 206988, upload-time = "2025-10-14T04:40:33.79Z" }, + { url = "https://files.pythonhosted.org/packages/94/59/2e87300fe67ab820b5428580a53cad894272dbb97f38a7a814a2a1ac1011/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f819d5fe9234f9f82d75bdfa9aef3a3d72c4d24a6e57aeaebba32a704553aa0", size = 147324, upload-time = "2025-10-14T04:40:34.961Z" }, + { url = "https://files.pythonhosted.org/packages/07/fb/0cf61dc84b2b088391830f6274cb57c82e4da8bbc2efeac8c025edb88772/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:a59cb51917aa591b1c4e6a43c132f0cdc3c76dbad6155df4e28ee626cc77a0a3", size = 142742, upload-time = "2025-10-14T04:40:36.105Z" }, + { url = "https://files.pythonhosted.org/packages/62/8b/171935adf2312cd745d290ed93cf16cf0dfe320863ab7cbeeae1dcd6535f/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:8ef3c867360f88ac904fd3f5e1f902f13307af9052646963ee08ff4f131adafc", size = 160863, upload-time = "2025-10-14T04:40:37.188Z" }, + { url = "https://files.pythonhosted.org/packages/09/73/ad875b192bda14f2173bfc1bc9a55e009808484a4b256748d931b6948442/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:d9e45d7faa48ee908174d8fe84854479ef838fc6a705c9315372eacbc2f02897", size = 157837, upload-time = "2025-10-14T04:40:38.435Z" }, + { url = "https://files.pythonhosted.org/packages/6d/fc/de9cce525b2c5b94b47c70a4b4fb19f871b24995c728e957ee68ab1671ea/charset_normalizer-3.4.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:840c25fb618a231545cbab0564a799f101b63b9901f2569faecd6b222ac72381", size = 151550, upload-time = "2025-10-14T04:40:40.053Z" }, + { url = "https://files.pythonhosted.org/packages/55/c2/43edd615fdfba8c6f2dfbd459b25a6b3b551f24ea21981e23fb768503ce1/charset_normalizer-3.4.4-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ca5862d5b3928c4940729dacc329aa9102900382fea192fc5e52eb69d6093815", size = 149162, upload-time = "2025-10-14T04:40:41.163Z" }, + { url = "https://files.pythonhosted.org/packages/03/86/bde4ad8b4d0e9429a4e82c1e8f5c659993a9a863ad62c7df05cf7b678d75/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d9c7f57c3d666a53421049053eaacdd14bbd0a528e2186fcb2e672effd053bb0", size = 150019, upload-time = "2025-10-14T04:40:42.276Z" }, + { url = "https://files.pythonhosted.org/packages/1f/86/a151eb2af293a7e7bac3a739b81072585ce36ccfb4493039f49f1d3cae8c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_armv7l.whl", hash = "sha256:277e970e750505ed74c832b4bf75dac7476262ee2a013f5574dd49075879e161", size = 143310, upload-time = "2025-10-14T04:40:43.439Z" }, + { url = "https://files.pythonhosted.org/packages/b5/fe/43dae6144a7e07b87478fdfc4dbe9efd5defb0e7ec29f5f58a55aeef7bf7/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_ppc64le.whl", hash = "sha256:31fd66405eaf47bb62e8cd575dc621c56c668f27d46a61d975a249930dd5e2a4", size = 162022, upload-time = "2025-10-14T04:40:44.547Z" }, + { url = "https://files.pythonhosted.org/packages/80/e6/7aab83774f5d2bca81f42ac58d04caf44f0cc2b65fc6db2b3b2e8a05f3b3/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:0d3d8f15c07f86e9ff82319b3d9ef6f4bf907608f53fe9d92b28ea9ae3d1fd89", size = 149383, upload-time = "2025-10-14T04:40:46.018Z" }, + { url = "https://files.pythonhosted.org/packages/4f/e8/b289173b4edae05c0dde07f69f8db476a0b511eac556dfe0d6bda3c43384/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_s390x.whl", hash = "sha256:9f7fcd74d410a36883701fafa2482a6af2ff5ba96b9a620e9e0721e28ead5569", size = 159098, upload-time = "2025-10-14T04:40:47.081Z" }, + { url = "https://files.pythonhosted.org/packages/d8/df/fe699727754cae3f8478493c7f45f777b17c3ef0600e28abfec8619eb49c/charset_normalizer-3.4.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ebf3e58c7ec8a8bed6d66a75d7fb37b55e5015b03ceae72a8e7c74495551e224", size = 152991, upload-time = "2025-10-14T04:40:48.246Z" }, + { url = "https://files.pythonhosted.org/packages/1a/86/584869fe4ddb6ffa3bd9f491b87a01568797fb9bd8933f557dba9771beaf/charset_normalizer-3.4.4-cp311-cp311-win32.whl", hash = "sha256:eecbc200c7fd5ddb9a7f16c7decb07b566c29fa2161a16cf67b8d068bd21690a", size = 99456, upload-time = "2025-10-14T04:40:49.376Z" }, + { url = "https://files.pythonhosted.org/packages/65/f6/62fdd5feb60530f50f7e38b4f6a1d5203f4d16ff4f9f0952962c044e919a/charset_normalizer-3.4.4-cp311-cp311-win_amd64.whl", hash = "sha256:5ae497466c7901d54b639cf42d5b8c1b6a4fead55215500d2f486d34db48d016", size = 106978, upload-time = "2025-10-14T04:40:50.844Z" }, + { url = "https://files.pythonhosted.org/packages/7a/9d/0710916e6c82948b3be62d9d398cb4fcf4e97b56d6a6aeccd66c4b2f2bd5/charset_normalizer-3.4.4-cp311-cp311-win_arm64.whl", hash = "sha256:65e2befcd84bc6f37095f5961e68a6f077bf44946771354a28ad434c2cce0ae1", size = 99969, upload-time = "2025-10-14T04:40:52.272Z" }, + { url = "https://files.pythonhosted.org/packages/f3/85/1637cd4af66fa687396e757dec650f28025f2a2f5a5531a3208dc0ec43f2/charset_normalizer-3.4.4-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:0a98e6759f854bd25a58a73fa88833fba3b7c491169f86ce1180c948ab3fd394", size = 208425, upload-time = "2025-10-14T04:40:53.353Z" }, + { url = "https://files.pythonhosted.org/packages/9d/6a/04130023fef2a0d9c62d0bae2649b69f7b7d8d24ea5536feef50551029df/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b5b290ccc2a263e8d185130284f8501e3e36c5e02750fc6b6bdeb2e9e96f1e25", size = 148162, upload-time = "2025-10-14T04:40:54.558Z" }, + { url = "https://files.pythonhosted.org/packages/78/29/62328d79aa60da22c9e0b9a66539feae06ca0f5a4171ac4f7dc285b83688/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:74bb723680f9f7a6234dcf67aea57e708ec1fbdf5699fb91dfd6f511b0a320ef", size = 144558, upload-time = "2025-10-14T04:40:55.677Z" }, + { url = "https://files.pythonhosted.org/packages/86/bb/b32194a4bf15b88403537c2e120b817c61cd4ecffa9b6876e941c3ee38fe/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:f1e34719c6ed0b92f418c7c780480b26b5d9c50349e9a9af7d76bf757530350d", size = 161497, upload-time = "2025-10-14T04:40:57.217Z" }, + { url = "https://files.pythonhosted.org/packages/19/89/a54c82b253d5b9b111dc74aca196ba5ccfcca8242d0fb64146d4d3183ff1/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:2437418e20515acec67d86e12bf70056a33abdacb5cb1655042f6538d6b085a8", size = 159240, upload-time = "2025-10-14T04:40:58.358Z" }, + { url = "https://files.pythonhosted.org/packages/c0/10/d20b513afe03acc89ec33948320a5544d31f21b05368436d580dec4e234d/charset_normalizer-3.4.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:11d694519d7f29d6cd09f6ac70028dba10f92f6cdd059096db198c283794ac86", size = 153471, upload-time = "2025-10-14T04:40:59.468Z" }, + { url = "https://files.pythonhosted.org/packages/61/fa/fbf177b55bdd727010f9c0a3c49eefa1d10f960e5f09d1d887bf93c2e698/charset_normalizer-3.4.4-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ac1c4a689edcc530fc9d9aa11f5774b9e2f33f9a0c6a57864e90908f5208d30a", size = 150864, upload-time = "2025-10-14T04:41:00.623Z" }, + { url = "https://files.pythonhosted.org/packages/05/12/9fbc6a4d39c0198adeebbde20b619790e9236557ca59fc40e0e3cebe6f40/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:21d142cc6c0ec30d2efee5068ca36c128a30b0f2c53c1c07bd78cb6bc1d3be5f", size = 150647, upload-time = "2025-10-14T04:41:01.754Z" }, + { url = "https://files.pythonhosted.org/packages/ad/1f/6a9a593d52e3e8c5d2b167daf8c6b968808efb57ef4c210acb907c365bc4/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_armv7l.whl", hash = "sha256:5dbe56a36425d26d6cfb40ce79c314a2e4dd6211d51d6d2191c00bed34f354cc", size = 145110, upload-time = "2025-10-14T04:41:03.231Z" }, + { url = "https://files.pythonhosted.org/packages/30/42/9a52c609e72471b0fc54386dc63c3781a387bb4fe61c20231a4ebcd58bdd/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:5bfbb1b9acf3334612667b61bd3002196fe2a1eb4dd74d247e0f2a4d50ec9bbf", size = 162839, upload-time = "2025-10-14T04:41:04.715Z" }, + { url = "https://files.pythonhosted.org/packages/c4/5b/c0682bbf9f11597073052628ddd38344a3d673fda35a36773f7d19344b23/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:d055ec1e26e441f6187acf818b73564e6e6282709e9bcb5b63f5b23068356a15", size = 150667, upload-time = "2025-10-14T04:41:05.827Z" }, + { url = "https://files.pythonhosted.org/packages/e4/24/a41afeab6f990cf2daf6cb8c67419b63b48cf518e4f56022230840c9bfb2/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:af2d8c67d8e573d6de5bc30cdb27e9b95e49115cd9baad5ddbd1a6207aaa82a9", size = 160535, upload-time = "2025-10-14T04:41:06.938Z" }, + { url = "https://files.pythonhosted.org/packages/2a/e5/6a4ce77ed243c4a50a1fecca6aaaab419628c818a49434be428fe24c9957/charset_normalizer-3.4.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:780236ac706e66881f3b7f2f32dfe90507a09e67d1d454c762cf642e6e1586e0", size = 154816, upload-time = "2025-10-14T04:41:08.101Z" }, + { url = "https://files.pythonhosted.org/packages/a8/ef/89297262b8092b312d29cdb2517cb1237e51db8ecef2e9af5edbe7b683b1/charset_normalizer-3.4.4-cp312-cp312-win32.whl", hash = "sha256:5833d2c39d8896e4e19b689ffc198f08ea58116bee26dea51e362ecc7cd3ed26", size = 99694, upload-time = "2025-10-14T04:41:09.23Z" }, + { url = "https://files.pythonhosted.org/packages/3d/2d/1e5ed9dd3b3803994c155cd9aacb60c82c331bad84daf75bcb9c91b3295e/charset_normalizer-3.4.4-cp312-cp312-win_amd64.whl", hash = "sha256:a79cfe37875f822425b89a82333404539ae63dbdddf97f84dcbc3d339aae9525", size = 107131, upload-time = "2025-10-14T04:41:10.467Z" }, + { url = "https://files.pythonhosted.org/packages/d0/d9/0ed4c7098a861482a7b6a95603edce4c0d9db2311af23da1fb2b75ec26fc/charset_normalizer-3.4.4-cp312-cp312-win_arm64.whl", hash = "sha256:376bec83a63b8021bb5c8ea75e21c4ccb86e7e45ca4eb81146091b56599b80c3", size = 100390, upload-time = "2025-10-14T04:41:11.915Z" }, + { url = "https://files.pythonhosted.org/packages/97/45/4b3a1239bbacd321068ea6e7ac28875b03ab8bc0aa0966452db17cd36714/charset_normalizer-3.4.4-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:e1f185f86a6f3403aa2420e815904c67b2f9ebc443f045edd0de921108345794", size = 208091, upload-time = "2025-10-14T04:41:13.346Z" }, + { url = "https://files.pythonhosted.org/packages/7d/62/73a6d7450829655a35bb88a88fca7d736f9882a27eacdca2c6d505b57e2e/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b39f987ae8ccdf0d2642338faf2abb1862340facc796048b604ef14919e55ed", size = 147936, upload-time = "2025-10-14T04:41:14.461Z" }, + { url = "https://files.pythonhosted.org/packages/89/c5/adb8c8b3d6625bef6d88b251bbb0d95f8205831b987631ab0c8bb5d937c2/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_armv7l.manylinux_2_17_armv7l.manylinux_2_31_armv7l.whl", hash = "sha256:3162d5d8ce1bb98dd51af660f2121c55d0fa541b46dff7bb9b9f86ea1d87de72", size = 144180, upload-time = "2025-10-14T04:41:15.588Z" }, + { url = "https://files.pythonhosted.org/packages/91/ed/9706e4070682d1cc219050b6048bfd293ccf67b3d4f5a4f39207453d4b99/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:81d5eb2a312700f4ecaa977a8235b634ce853200e828fbadf3a9c50bab278328", size = 161346, upload-time = "2025-10-14T04:41:16.738Z" }, + { url = "https://files.pythonhosted.org/packages/d5/0d/031f0d95e4972901a2f6f09ef055751805ff541511dc1252ba3ca1f80cf5/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5bd2293095d766545ec1a8f612559f6b40abc0eb18bb2f5d1171872d34036ede", size = 158874, upload-time = "2025-10-14T04:41:17.923Z" }, + { url = "https://files.pythonhosted.org/packages/f5/83/6ab5883f57c9c801ce5e5677242328aa45592be8a00644310a008d04f922/charset_normalizer-3.4.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a8a8b89589086a25749f471e6a900d3f662d1d3b6e2e59dcecf787b1cc3a1894", size = 153076, upload-time = "2025-10-14T04:41:19.106Z" }, + { url = "https://files.pythonhosted.org/packages/75/1e/5ff781ddf5260e387d6419959ee89ef13878229732732ee73cdae01800f2/charset_normalizer-3.4.4-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc7637e2f80d8530ee4a78e878bce464f70087ce73cf7c1caf142416923b98f1", size = 150601, upload-time = "2025-10-14T04:41:20.245Z" }, + { url = "https://files.pythonhosted.org/packages/d7/57/71be810965493d3510a6ca79b90c19e48696fb1ff964da319334b12677f0/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f8bf04158c6b607d747e93949aa60618b61312fe647a6369f88ce2ff16043490", size = 150376, upload-time = "2025-10-14T04:41:21.398Z" }, + { url = "https://files.pythonhosted.org/packages/e5/d5/c3d057a78c181d007014feb7e9f2e65905a6c4ef182c0ddf0de2924edd65/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_armv7l.whl", hash = "sha256:554af85e960429cf30784dd47447d5125aaa3b99a6f0683589dbd27e2f45da44", size = 144825, upload-time = "2025-10-14T04:41:22.583Z" }, + { url = "https://files.pythonhosted.org/packages/e6/8c/d0406294828d4976f275ffbe66f00266c4b3136b7506941d87c00cab5272/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:74018750915ee7ad843a774364e13a3db91682f26142baddf775342c3f5b1133", size = 162583, upload-time = "2025-10-14T04:41:23.754Z" }, + { url = "https://files.pythonhosted.org/packages/d7/24/e2aa1f18c8f15c4c0e932d9287b8609dd30ad56dbe41d926bd846e22fb8d/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:c0463276121fdee9c49b98908b3a89c39be45d86d1dbaa22957e38f6321d4ce3", size = 150366, upload-time = "2025-10-14T04:41:25.27Z" }, + { url = "https://files.pythonhosted.org/packages/e4/5b/1e6160c7739aad1e2df054300cc618b06bf784a7a164b0f238360721ab86/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:362d61fd13843997c1c446760ef36f240cf81d3ebf74ac62652aebaf7838561e", size = 160300, upload-time = "2025-10-14T04:41:26.725Z" }, + { url = "https://files.pythonhosted.org/packages/7a/10/f882167cd207fbdd743e55534d5d9620e095089d176d55cb22d5322f2afd/charset_normalizer-3.4.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9a26f18905b8dd5d685d6d07b0cdf98a79f3c7a918906af7cc143ea2e164c8bc", size = 154465, upload-time = "2025-10-14T04:41:28.322Z" }, + { url = "https://files.pythonhosted.org/packages/89/66/c7a9e1b7429be72123441bfdbaf2bc13faab3f90b933f664db506dea5915/charset_normalizer-3.4.4-cp313-cp313-win32.whl", hash = "sha256:9b35f4c90079ff2e2edc5b26c0c77925e5d2d255c42c74fdb70fb49b172726ac", size = 99404, upload-time = "2025-10-14T04:41:29.95Z" }, + { url = "https://files.pythonhosted.org/packages/c4/26/b9924fa27db384bdcd97ab83b4f0a8058d96ad9626ead570674d5e737d90/charset_normalizer-3.4.4-cp313-cp313-win_amd64.whl", hash = "sha256:b435cba5f4f750aa6c0a0d92c541fb79f69a387c91e61f1795227e4ed9cece14", size = 107092, upload-time = "2025-10-14T04:41:31.188Z" }, + { url = "https://files.pythonhosted.org/packages/af/8f/3ed4bfa0c0c72a7ca17f0380cd9e4dd842b09f664e780c13cff1dcf2ef1b/charset_normalizer-3.4.4-cp313-cp313-win_arm64.whl", hash = "sha256:542d2cee80be6f80247095cc36c418f7bddd14f4a6de45af91dfad36d817bba2", size = 100408, upload-time = "2025-10-14T04:41:32.624Z" }, + { url = "https://files.pythonhosted.org/packages/0a/4c/925909008ed5a988ccbb72dcc897407e5d6d3bd72410d69e051fc0c14647/charset_normalizer-3.4.4-py3-none-any.whl", hash = "sha256:7a32c560861a02ff789ad905a2fe94e3f840803362c84fecf1851cb4cf3dc37f", size = 53402, upload-time = "2025-10-14T04:42:31.76Z" }, ] [[package]] @@ -427,7 +419,7 @@ resolution-markers = [ "python_full_version == '3.11.*'", ] dependencies = [ - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/58/01/1253e6698a07380cd31a736d248a3f2a50a7c88779a1813da27503cadc2a/contourpy-1.3.3.tar.gz", hash = "sha256:083e12155b210502d0bca491432bb04d56dc3432f95a979b429f2848c3dbe880", size = 13466174, upload-time = "2025-07-26T12:03:12.549Z" } wheels = [ @@ -484,75 +476,75 @@ wheels = [ [[package]] name = "coverage" -version = "7.10.7" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/51/26/d22c300112504f5f9a9fd2297ce33c35f3d353e4aeb987c8419453b2a7c2/coverage-7.10.7.tar.gz", hash = "sha256:f4ab143ab113be368a3e9b795f9cd7906c5ef407d6173fe9675a902e1fffc239", size = 827704, upload-time = "2025-09-21T20:03:56.815Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/6c/3a3f7a46888e69d18abe3ccc6fe4cb16cccb1e6a2f99698931dafca489e6/coverage-7.10.7-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:fc04cc7a3db33664e0c2d10eb8990ff6b3536f6842c9590ae8da4c614b9ed05a", size = 217987, upload-time = "2025-09-21T20:00:57.218Z" }, - { url = "https://files.pythonhosted.org/packages/03/94/952d30f180b1a916c11a56f5c22d3535e943aa22430e9e3322447e520e1c/coverage-7.10.7-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:e201e015644e207139f7e2351980feb7040e6f4b2c2978892f3e3789d1c125e5", size = 218388, upload-time = "2025-09-21T20:01:00.081Z" }, - { url = "https://files.pythonhosted.org/packages/50/2b/9e0cf8ded1e114bcd8b2fd42792b57f1c4e9e4ea1824cde2af93a67305be/coverage-7.10.7-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:240af60539987ced2c399809bd34f7c78e8abe0736af91c3d7d0e795df633d17", size = 245148, upload-time = "2025-09-21T20:01:01.768Z" }, - { url = "https://files.pythonhosted.org/packages/19/20/d0384ac06a6f908783d9b6aa6135e41b093971499ec488e47279f5b846e6/coverage-7.10.7-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:8421e088bc051361b01c4b3a50fd39a4b9133079a2229978d9d30511fd05231b", size = 246958, upload-time = "2025-09-21T20:01:03.355Z" }, - { url = "https://files.pythonhosted.org/packages/60/83/5c283cff3d41285f8eab897651585db908a909c572bdc014bcfaf8a8b6ae/coverage-7.10.7-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6be8ed3039ae7f7ac5ce058c308484787c86e8437e72b30bf5e88b8ea10f3c87", size = 248819, upload-time = "2025-09-21T20:01:04.968Z" }, - { url = "https://files.pythonhosted.org/packages/60/22/02eb98fdc5ff79f423e990d877693e5310ae1eab6cb20ae0b0b9ac45b23b/coverage-7.10.7-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:e28299d9f2e889e6d51b1f043f58d5f997c373cc12e6403b90df95b8b047c13e", size = 245754, upload-time = "2025-09-21T20:01:06.321Z" }, - { url = "https://files.pythonhosted.org/packages/b4/bc/25c83bcf3ad141b32cd7dc45485ef3c01a776ca3aa8ef0a93e77e8b5bc43/coverage-7.10.7-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:c4e16bd7761c5e454f4efd36f345286d6f7c5fa111623c355691e2755cae3b9e", size = 246860, upload-time = "2025-09-21T20:01:07.605Z" }, - { url = "https://files.pythonhosted.org/packages/3c/b7/95574702888b58c0928a6e982038c596f9c34d52c5e5107f1eef729399b5/coverage-7.10.7-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:b1c81d0e5e160651879755c9c675b974276f135558cf4ba79fee7b8413a515df", size = 244877, upload-time = "2025-09-21T20:01:08.829Z" }, - { url = "https://files.pythonhosted.org/packages/47/b6/40095c185f235e085df0e0b158f6bd68cc6e1d80ba6c7721dc81d97ec318/coverage-7.10.7-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:606cc265adc9aaedcc84f1f064f0e8736bc45814f15a357e30fca7ecc01504e0", size = 245108, upload-time = "2025-09-21T20:01:10.527Z" }, - { url = "https://files.pythonhosted.org/packages/c8/50/4aea0556da7a4b93ec9168420d170b55e2eb50ae21b25062513d020c6861/coverage-7.10.7-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:10b24412692df990dbc34f8fb1b6b13d236ace9dfdd68df5b28c2e39cafbba13", size = 245752, upload-time = "2025-09-21T20:01:11.857Z" }, - { url = "https://files.pythonhosted.org/packages/6a/28/ea1a84a60828177ae3b100cb6723838523369a44ec5742313ed7db3da160/coverage-7.10.7-cp310-cp310-win32.whl", hash = "sha256:b51dcd060f18c19290d9b8a9dd1e0181538df2ce0717f562fff6cf74d9fc0b5b", size = 220497, upload-time = "2025-09-21T20:01:13.459Z" }, - { url = "https://files.pythonhosted.org/packages/fc/1a/a81d46bbeb3c3fd97b9602ebaa411e076219a150489bcc2c025f151bd52d/coverage-7.10.7-cp310-cp310-win_amd64.whl", hash = "sha256:3a622ac801b17198020f09af3eaf45666b344a0d69fc2a6ffe2ea83aeef1d807", size = 221392, upload-time = "2025-09-21T20:01:14.722Z" }, - { url = "https://files.pythonhosted.org/packages/d2/5d/c1a17867b0456f2e9ce2d8d4708a4c3a089947d0bec9c66cdf60c9e7739f/coverage-7.10.7-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:a609f9c93113be646f44c2a0256d6ea375ad047005d7f57a5c15f614dc1b2f59", size = 218102, upload-time = "2025-09-21T20:01:16.089Z" }, - { url = "https://files.pythonhosted.org/packages/54/f0/514dcf4b4e3698b9a9077f084429681bf3aad2b4a72578f89d7f643eb506/coverage-7.10.7-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:65646bb0359386e07639c367a22cf9b5bf6304e8630b565d0626e2bdf329227a", size = 218505, upload-time = "2025-09-21T20:01:17.788Z" }, - { url = "https://files.pythonhosted.org/packages/20/f6/9626b81d17e2a4b25c63ac1b425ff307ecdeef03d67c9a147673ae40dc36/coverage-7.10.7-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:5f33166f0dfcce728191f520bd2692914ec70fac2713f6bf3ce59c3deacb4699", size = 248898, upload-time = "2025-09-21T20:01:19.488Z" }, - { url = "https://files.pythonhosted.org/packages/b0/ef/bd8e719c2f7417ba03239052e099b76ea1130ac0cbb183ee1fcaa58aaff3/coverage-7.10.7-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:35f5e3f9e455bb17831876048355dca0f758b6df22f49258cb5a91da23ef437d", size = 250831, upload-time = "2025-09-21T20:01:20.817Z" }, - { url = "https://files.pythonhosted.org/packages/a5/b6/bf054de41ec948b151ae2b79a55c107f5760979538f5fb80c195f2517718/coverage-7.10.7-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4da86b6d62a496e908ac2898243920c7992499c1712ff7c2b6d837cc69d9467e", size = 252937, upload-time = "2025-09-21T20:01:22.171Z" }, - { url = "https://files.pythonhosted.org/packages/0f/e5/3860756aa6f9318227443c6ce4ed7bf9e70bb7f1447a0353f45ac5c7974b/coverage-7.10.7-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:6b8b09c1fad947c84bbbc95eca841350fad9cbfa5a2d7ca88ac9f8d836c92e23", size = 249021, upload-time = "2025-09-21T20:01:23.907Z" }, - { url = "https://files.pythonhosted.org/packages/26/0f/bd08bd042854f7fd07b45808927ebcce99a7ed0f2f412d11629883517ac2/coverage-7.10.7-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:4376538f36b533b46f8971d3a3e63464f2c7905c9800db97361c43a2b14792ab", size = 250626, upload-time = "2025-09-21T20:01:25.721Z" }, - { url = "https://files.pythonhosted.org/packages/8e/a7/4777b14de4abcc2e80c6b1d430f5d51eb18ed1d75fca56cbce5f2db9b36e/coverage-7.10.7-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:121da30abb574f6ce6ae09840dae322bef734480ceafe410117627aa54f76d82", size = 248682, upload-time = "2025-09-21T20:01:27.105Z" }, - { url = "https://files.pythonhosted.org/packages/34/72/17d082b00b53cd45679bad682fac058b87f011fd8b9fe31d77f5f8d3a4e4/coverage-7.10.7-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:88127d40df529336a9836870436fc2751c339fbaed3a836d42c93f3e4bd1d0a2", size = 248402, upload-time = "2025-09-21T20:01:28.629Z" }, - { url = "https://files.pythonhosted.org/packages/81/7a/92367572eb5bdd6a84bfa278cc7e97db192f9f45b28c94a9ca1a921c3577/coverage-7.10.7-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:ba58bbcd1b72f136080c0bccc2400d66cc6115f3f906c499013d065ac33a4b61", size = 249320, upload-time = "2025-09-21T20:01:30.004Z" }, - { url = "https://files.pythonhosted.org/packages/2f/88/a23cc185f6a805dfc4fdf14a94016835eeb85e22ac3a0e66d5e89acd6462/coverage-7.10.7-cp311-cp311-win32.whl", hash = "sha256:972b9e3a4094b053a4e46832b4bc829fc8a8d347160eb39d03f1690316a99c14", size = 220536, upload-time = "2025-09-21T20:01:32.184Z" }, - { url = "https://files.pythonhosted.org/packages/fe/ef/0b510a399dfca17cec7bc2f05ad8bd78cf55f15c8bc9a73ab20c5c913c2e/coverage-7.10.7-cp311-cp311-win_amd64.whl", hash = "sha256:a7b55a944a7f43892e28ad4bc0561dfd5f0d73e605d1aa5c3c976b52aea121d2", size = 221425, upload-time = "2025-09-21T20:01:33.557Z" }, - { url = "https://files.pythonhosted.org/packages/51/7f/023657f301a276e4ba1850f82749bc136f5a7e8768060c2e5d9744a22951/coverage-7.10.7-cp311-cp311-win_arm64.whl", hash = "sha256:736f227fb490f03c6488f9b6d45855f8e0fd749c007f9303ad30efab0e73c05a", size = 220103, upload-time = "2025-09-21T20:01:34.929Z" }, - { url = "https://files.pythonhosted.org/packages/13/e4/eb12450f71b542a53972d19117ea5a5cea1cab3ac9e31b0b5d498df1bd5a/coverage-7.10.7-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7bb3b9ddb87ef7725056572368040c32775036472d5a033679d1fa6c8dc08417", size = 218290, upload-time = "2025-09-21T20:01:36.455Z" }, - { url = "https://files.pythonhosted.org/packages/37/66/593f9be12fc19fb36711f19a5371af79a718537204d16ea1d36f16bd78d2/coverage-7.10.7-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:18afb24843cbc175687225cab1138c95d262337f5473512010e46831aa0c2973", size = 218515, upload-time = "2025-09-21T20:01:37.982Z" }, - { url = "https://files.pythonhosted.org/packages/66/80/4c49f7ae09cafdacc73fbc30949ffe77359635c168f4e9ff33c9ebb07838/coverage-7.10.7-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:399a0b6347bcd3822be369392932884b8216d0944049ae22925631a9b3d4ba4c", size = 250020, upload-time = "2025-09-21T20:01:39.617Z" }, - { url = "https://files.pythonhosted.org/packages/a6/90/a64aaacab3b37a17aaedd83e8000142561a29eb262cede42d94a67f7556b/coverage-7.10.7-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:314f2c326ded3f4b09be11bc282eb2fc861184bc95748ae67b360ac962770be7", size = 252769, upload-time = "2025-09-21T20:01:41.341Z" }, - { url = "https://files.pythonhosted.org/packages/98/2e/2dda59afd6103b342e096f246ebc5f87a3363b5412609946c120f4e7750d/coverage-7.10.7-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c41e71c9cfb854789dee6fc51e46743a6d138b1803fab6cb860af43265b42ea6", size = 253901, upload-time = "2025-09-21T20:01:43.042Z" }, - { url = "https://files.pythonhosted.org/packages/53/dc/8d8119c9051d50f3119bb4a75f29f1e4a6ab9415cd1fa8bf22fcc3fb3b5f/coverage-7.10.7-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc01f57ca26269c2c706e838f6422e2a8788e41b3e3c65e2f41148212e57cd59", size = 250413, upload-time = "2025-09-21T20:01:44.469Z" }, - { url = "https://files.pythonhosted.org/packages/98/b3/edaff9c5d79ee4d4b6d3fe046f2b1d799850425695b789d491a64225d493/coverage-7.10.7-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a6442c59a8ac8b85812ce33bc4d05bde3fb22321fa8294e2a5b487c3505f611b", size = 251820, upload-time = "2025-09-21T20:01:45.915Z" }, - { url = "https://files.pythonhosted.org/packages/11/25/9a0728564bb05863f7e513e5a594fe5ffef091b325437f5430e8cfb0d530/coverage-7.10.7-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:78a384e49f46b80fb4c901d52d92abe098e78768ed829c673fbb53c498bef73a", size = 249941, upload-time = "2025-09-21T20:01:47.296Z" }, - { url = "https://files.pythonhosted.org/packages/e0/fd/ca2650443bfbef5b0e74373aac4df67b08180d2f184b482c41499668e258/coverage-7.10.7-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:5e1e9802121405ede4b0133aa4340ad8186a1d2526de5b7c3eca519db7bb89fb", size = 249519, upload-time = "2025-09-21T20:01:48.73Z" }, - { url = "https://files.pythonhosted.org/packages/24/79/f692f125fb4299b6f963b0745124998ebb8e73ecdfce4ceceb06a8c6bec5/coverage-7.10.7-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:d41213ea25a86f69efd1575073d34ea11aabe075604ddf3d148ecfec9e1e96a1", size = 251375, upload-time = "2025-09-21T20:01:50.529Z" }, - { url = "https://files.pythonhosted.org/packages/5e/75/61b9bbd6c7d24d896bfeec57acba78e0f8deac68e6baf2d4804f7aae1f88/coverage-7.10.7-cp312-cp312-win32.whl", hash = "sha256:77eb4c747061a6af8d0f7bdb31f1e108d172762ef579166ec84542f711d90256", size = 220699, upload-time = "2025-09-21T20:01:51.941Z" }, - { url = "https://files.pythonhosted.org/packages/ca/f3/3bf7905288b45b075918d372498f1cf845b5b579b723c8fd17168018d5f5/coverage-7.10.7-cp312-cp312-win_amd64.whl", hash = "sha256:f51328ffe987aecf6d09f3cd9d979face89a617eacdaea43e7b3080777f647ba", size = 221512, upload-time = "2025-09-21T20:01:53.481Z" }, - { url = "https://files.pythonhosted.org/packages/5c/44/3e32dbe933979d05cf2dac5e697c8599cfe038aaf51223ab901e208d5a62/coverage-7.10.7-cp312-cp312-win_arm64.whl", hash = "sha256:bda5e34f8a75721c96085903c6f2197dc398c20ffd98df33f866a9c8fd95f4bf", size = 220147, upload-time = "2025-09-21T20:01:55.2Z" }, - { url = "https://files.pythonhosted.org/packages/9a/94/b765c1abcb613d103b64fcf10395f54d69b0ef8be6a0dd9c524384892cc7/coverage-7.10.7-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:981a651f543f2854abd3b5fcb3263aac581b18209be49863ba575de6edf4c14d", size = 218320, upload-time = "2025-09-21T20:01:56.629Z" }, - { url = "https://files.pythonhosted.org/packages/72/4f/732fff31c119bb73b35236dd333030f32c4bfe909f445b423e6c7594f9a2/coverage-7.10.7-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:73ab1601f84dc804f7812dc297e93cd99381162da39c47040a827d4e8dafe63b", size = 218575, upload-time = "2025-09-21T20:01:58.203Z" }, - { url = "https://files.pythonhosted.org/packages/87/02/ae7e0af4b674be47566707777db1aa375474f02a1d64b9323e5813a6cdd5/coverage-7.10.7-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:a8b6f03672aa6734e700bbcd65ff050fd19cddfec4b031cc8cf1c6967de5a68e", size = 249568, upload-time = "2025-09-21T20:01:59.748Z" }, - { url = "https://files.pythonhosted.org/packages/a2/77/8c6d22bf61921a59bce5471c2f1f7ac30cd4ac50aadde72b8c48d5727902/coverage-7.10.7-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:10b6ba00ab1132a0ce4428ff68cf50a25efd6840a42cdf4239c9b99aad83be8b", size = 252174, upload-time = "2025-09-21T20:02:01.192Z" }, - { url = "https://files.pythonhosted.org/packages/b1/20/b6ea4f69bbb52dac0aebd62157ba6a9dddbfe664f5af8122dac296c3ee15/coverage-7.10.7-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c79124f70465a150e89340de5963f936ee97097d2ef76c869708c4248c63ca49", size = 253447, upload-time = "2025-09-21T20:02:02.701Z" }, - { url = "https://files.pythonhosted.org/packages/f9/28/4831523ba483a7f90f7b259d2018fef02cb4d5b90bc7c1505d6e5a84883c/coverage-7.10.7-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:69212fbccdbd5b0e39eac4067e20a4a5256609e209547d86f740d68ad4f04911", size = 249779, upload-time = "2025-09-21T20:02:04.185Z" }, - { url = "https://files.pythonhosted.org/packages/a7/9f/4331142bc98c10ca6436d2d620c3e165f31e6c58d43479985afce6f3191c/coverage-7.10.7-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:7ea7c6c9d0d286d04ed3541747e6597cbe4971f22648b68248f7ddcd329207f0", size = 251604, upload-time = "2025-09-21T20:02:06.034Z" }, - { url = "https://files.pythonhosted.org/packages/ce/60/bda83b96602036b77ecf34e6393a3836365481b69f7ed7079ab85048202b/coverage-7.10.7-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b9be91986841a75042b3e3243d0b3cb0b2434252b977baaf0cd56e960fe1e46f", size = 249497, upload-time = "2025-09-21T20:02:07.619Z" }, - { url = "https://files.pythonhosted.org/packages/5f/af/152633ff35b2af63977edd835d8e6430f0caef27d171edf2fc76c270ef31/coverage-7.10.7-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:b281d5eca50189325cfe1f365fafade89b14b4a78d9b40b05ddd1fc7d2a10a9c", size = 249350, upload-time = "2025-09-21T20:02:10.34Z" }, - { url = "https://files.pythonhosted.org/packages/9d/71/d92105d122bd21cebba877228990e1646d862e34a98bb3374d3fece5a794/coverage-7.10.7-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:99e4aa63097ab1118e75a848a28e40d68b08a5e19ce587891ab7fd04475e780f", size = 251111, upload-time = "2025-09-21T20:02:12.122Z" }, - { url = "https://files.pythonhosted.org/packages/a2/9e/9fdb08f4bf476c912f0c3ca292e019aab6712c93c9344a1653986c3fd305/coverage-7.10.7-cp313-cp313-win32.whl", hash = "sha256:dc7c389dce432500273eaf48f410b37886be9208b2dd5710aaf7c57fd442c698", size = 220746, upload-time = "2025-09-21T20:02:13.919Z" }, - { url = "https://files.pythonhosted.org/packages/b1/b1/a75fd25df44eab52d1931e89980d1ada46824c7a3210be0d3c88a44aaa99/coverage-7.10.7-cp313-cp313-win_amd64.whl", hash = "sha256:cac0fdca17b036af3881a9d2729a850b76553f3f716ccb0360ad4dbc06b3b843", size = 221541, upload-time = "2025-09-21T20:02:15.57Z" }, - { url = "https://files.pythonhosted.org/packages/14/3a/d720d7c989562a6e9a14b2c9f5f2876bdb38e9367126d118495b89c99c37/coverage-7.10.7-cp313-cp313-win_arm64.whl", hash = "sha256:4b6f236edf6e2f9ae8fcd1332da4e791c1b6ba0dc16a2dc94590ceccb482e546", size = 220170, upload-time = "2025-09-21T20:02:17.395Z" }, - { url = "https://files.pythonhosted.org/packages/bb/22/e04514bf2a735d8b0add31d2b4ab636fc02370730787c576bb995390d2d5/coverage-7.10.7-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:a0ec07fd264d0745ee396b666d47cef20875f4ff2375d7c4f58235886cc1ef0c", size = 219029, upload-time = "2025-09-21T20:02:18.936Z" }, - { url = "https://files.pythonhosted.org/packages/11/0b/91128e099035ece15da3445d9015e4b4153a6059403452d324cbb0a575fa/coverage-7.10.7-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:dd5e856ebb7bfb7672b0086846db5afb4567a7b9714b8a0ebafd211ec7ce6a15", size = 219259, upload-time = "2025-09-21T20:02:20.44Z" }, - { url = "https://files.pythonhosted.org/packages/8b/51/66420081e72801536a091a0c8f8c1f88a5c4bf7b9b1bdc6222c7afe6dc9b/coverage-7.10.7-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:f57b2a3c8353d3e04acf75b3fed57ba41f5c0646bbf1d10c7c282291c97936b4", size = 260592, upload-time = "2025-09-21T20:02:22.313Z" }, - { url = "https://files.pythonhosted.org/packages/5d/22/9b8d458c2881b22df3db5bb3e7369e63d527d986decb6c11a591ba2364f7/coverage-7.10.7-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:1ef2319dd15a0b009667301a3f84452a4dc6fddfd06b0c5c53ea472d3989fbf0", size = 262768, upload-time = "2025-09-21T20:02:24.287Z" }, - { url = "https://files.pythonhosted.org/packages/f7/08/16bee2c433e60913c610ea200b276e8eeef084b0d200bdcff69920bd5828/coverage-7.10.7-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:83082a57783239717ceb0ad584de3c69cf581b2a95ed6bf81ea66034f00401c0", size = 264995, upload-time = "2025-09-21T20:02:26.133Z" }, - { url = "https://files.pythonhosted.org/packages/20/9d/e53eb9771d154859b084b90201e5221bca7674ba449a17c101a5031d4054/coverage-7.10.7-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:50aa94fb1fb9a397eaa19c0d5ec15a5edd03a47bf1a3a6111a16b36e190cff65", size = 259546, upload-time = "2025-09-21T20:02:27.716Z" }, - { url = "https://files.pythonhosted.org/packages/ad/b0/69bc7050f8d4e56a89fb550a1577d5d0d1db2278106f6f626464067b3817/coverage-7.10.7-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:2120043f147bebb41c85b97ac45dd173595ff14f2a584f2963891cbcc3091541", size = 262544, upload-time = "2025-09-21T20:02:29.216Z" }, - { url = "https://files.pythonhosted.org/packages/ef/4b/2514b060dbd1bc0aaf23b852c14bb5818f244c664cb16517feff6bb3a5ab/coverage-7.10.7-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:2fafd773231dd0378fdba66d339f84904a8e57a262f583530f4f156ab83863e6", size = 260308, upload-time = "2025-09-21T20:02:31.226Z" }, - { url = "https://files.pythonhosted.org/packages/54/78/7ba2175007c246d75e496f64c06e94122bdb914790a1285d627a918bd271/coverage-7.10.7-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:0b944ee8459f515f28b851728ad224fa2d068f1513ef6b7ff1efafeb2185f999", size = 258920, upload-time = "2025-09-21T20:02:32.823Z" }, - { url = "https://files.pythonhosted.org/packages/c0/b3/fac9f7abbc841409b9a410309d73bfa6cfb2e51c3fada738cb607ce174f8/coverage-7.10.7-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:4b583b97ab2e3efe1b3e75248a9b333bd3f8b0b1b8e5b45578e05e5850dfb2c2", size = 261434, upload-time = "2025-09-21T20:02:34.86Z" }, - { url = "https://files.pythonhosted.org/packages/ee/51/a03bec00d37faaa891b3ff7387192cef20f01604e5283a5fabc95346befa/coverage-7.10.7-cp313-cp313t-win32.whl", hash = "sha256:2a78cd46550081a7909b3329e2266204d584866e8d97b898cd7fb5ac8d888b1a", size = 221403, upload-time = "2025-09-21T20:02:37.034Z" }, - { url = "https://files.pythonhosted.org/packages/53/22/3cf25d614e64bf6d8e59c7c669b20d6d940bb337bdee5900b9ca41c820bb/coverage-7.10.7-cp313-cp313t-win_amd64.whl", hash = "sha256:33a5e6396ab684cb43dc7befa386258acb2d7fae7f67330ebb85ba4ea27938eb", size = 222469, upload-time = "2025-09-21T20:02:39.011Z" }, - { url = "https://files.pythonhosted.org/packages/49/a1/00164f6d30d8a01c3c9c48418a7a5be394de5349b421b9ee019f380df2a0/coverage-7.10.7-cp313-cp313t-win_arm64.whl", hash = "sha256:86b0e7308289ddde73d863b7683f596d8d21c7d8664ce1dee061d0bcf3fbb4bb", size = 220731, upload-time = "2025-09-21T20:02:40.939Z" }, - { url = "https://files.pythonhosted.org/packages/ec/16/114df1c291c22cac3b0c127a73e0af5c12ed7bbb6558d310429a0ae24023/coverage-7.10.7-py3-none-any.whl", hash = "sha256:f7941f6f2fe6dd6807a1208737b8a0cbcf1cc6d7b07d24998ad2d63590868260", size = 209952, upload-time = "2025-09-21T20:03:53.918Z" }, +version = "7.13.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/b6/45/2c665ca77ec32ad67e25c77daf1cee28ee4558f3bc571cdbaf88a00b9f23/coverage-7.13.0.tar.gz", hash = "sha256:a394aa27f2d7ff9bc04cf703817773a59ad6dfbd577032e690f961d2460ee936", size = 820905, upload-time = "2025-12-08T13:14:38.055Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/db/08/bdd7ccca14096f7eb01412b87ac11e5d16e4cb54b6e328afc9dee8bdaec1/coverage-7.13.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:02d9fb9eccd48f6843c98a37bd6817462f130b86da8660461e8f5e54d4c06070", size = 217979, upload-time = "2025-12-08T13:12:14.505Z" }, + { url = "https://files.pythonhosted.org/packages/fa/f0/d1302e3416298a28b5663ae1117546a745d9d19fde7e28402b2c5c3e2109/coverage-7.13.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:367449cf07d33dc216c083f2036bb7d976c6e4903ab31be400ad74ad9f85ce98", size = 218496, upload-time = "2025-12-08T13:12:16.237Z" }, + { url = "https://files.pythonhosted.org/packages/07/26/d36c354c8b2a320819afcea6bffe72839efd004b98d1d166b90801d49d57/coverage-7.13.0-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:cdb3c9f8fef0a954c632f64328a3935988d33a6604ce4bf67ec3e39670f12ae5", size = 245237, upload-time = "2025-12-08T13:12:17.858Z" }, + { url = "https://files.pythonhosted.org/packages/91/52/be5e85631e0eec547873d8b08dd67a5f6b111ecfe89a86e40b89b0c1c61c/coverage-7.13.0-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:d10fd186aac2316f9bbb46ef91977f9d394ded67050ad6d84d94ed6ea2e8e54e", size = 247061, upload-time = "2025-12-08T13:12:19.132Z" }, + { url = "https://files.pythonhosted.org/packages/0f/45/a5e8fa0caf05fbd8fa0402470377bff09cc1f026d21c05c71e01295e55ab/coverage-7.13.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7f88ae3e69df2ab62fb0bc5219a597cb890ba5c438190ffa87490b315190bb33", size = 248928, upload-time = "2025-12-08T13:12:20.702Z" }, + { url = "https://files.pythonhosted.org/packages/f5/42/ffb5069b6fd1b95fae482e02f3fecf380d437dd5a39bae09f16d2e2e7e01/coverage-7.13.0-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:c4be718e51e86f553bcf515305a158a1cd180d23b72f07ae76d6017c3cc5d791", size = 245931, upload-time = "2025-12-08T13:12:22.243Z" }, + { url = "https://files.pythonhosted.org/packages/95/6e/73e809b882c2858f13e55c0c36e94e09ce07e6165d5644588f9517efe333/coverage-7.13.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a00d3a393207ae12f7c49bb1c113190883b500f48979abb118d8b72b8c95c032", size = 246968, upload-time = "2025-12-08T13:12:23.52Z" }, + { url = "https://files.pythonhosted.org/packages/87/08/64ebd9e64b6adb8b4a4662133d706fbaccecab972e0b3ccc23f64e2678ad/coverage-7.13.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:3a7b1cd820e1b6116f92c6128f1188e7afe421c7e1b35fa9836b11444e53ebd9", size = 244972, upload-time = "2025-12-08T13:12:24.781Z" }, + { url = "https://files.pythonhosted.org/packages/12/97/f4d27c6fe0cb375a5eced4aabcaef22de74766fb80a3d5d2015139e54b22/coverage-7.13.0-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:37eee4e552a65866f15dedd917d5e5f3d59805994260720821e2c1b51ac3248f", size = 245241, upload-time = "2025-12-08T13:12:28.041Z" }, + { url = "https://files.pythonhosted.org/packages/0c/94/42f8ae7f633bf4c118bf1038d80472f9dade88961a466f290b81250f7ab7/coverage-7.13.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:62d7c4f13102148c78d7353c6052af6d899a7f6df66a32bddcc0c0eb7c5326f8", size = 245847, upload-time = "2025-12-08T13:12:29.337Z" }, + { url = "https://files.pythonhosted.org/packages/a8/2f/6369ca22b6b6d933f4f4d27765d313d8914cc4cce84f82a16436b1a233db/coverage-7.13.0-cp310-cp310-win32.whl", hash = "sha256:24e4e56304fdb56f96f80eabf840eab043b3afea9348b88be680ec5986780a0f", size = 220573, upload-time = "2025-12-08T13:12:30.905Z" }, + { url = "https://files.pythonhosted.org/packages/f1/dc/a6a741e519acceaeccc70a7f4cfe5d030efc4b222595f0677e101af6f1f3/coverage-7.13.0-cp310-cp310-win_amd64.whl", hash = "sha256:74c136e4093627cf04b26a35dab8cbfc9b37c647f0502fc313376e11726ba303", size = 221509, upload-time = "2025-12-08T13:12:32.09Z" }, + { url = "https://files.pythonhosted.org/packages/f1/dc/888bf90d8b1c3d0b4020a40e52b9f80957d75785931ec66c7dfaccc11c7d/coverage-7.13.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0dfa3855031070058add1a59fdfda0192fd3e8f97e7c81de0596c145dea51820", size = 218104, upload-time = "2025-12-08T13:12:33.333Z" }, + { url = "https://files.pythonhosted.org/packages/8d/ea/069d51372ad9c380214e86717e40d1a743713a2af191cfba30a0911b0a4a/coverage-7.13.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4fdb6f54f38e334db97f72fa0c701e66d8479af0bc3f9bfb5b90f1c30f54500f", size = 218606, upload-time = "2025-12-08T13:12:34.498Z" }, + { url = "https://files.pythonhosted.org/packages/68/09/77b1c3a66c2aa91141b6c4471af98e5b1ed9b9e6d17255da5eb7992299e3/coverage-7.13.0-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:7e442c013447d1d8d195be62852270b78b6e255b79b8675bad8479641e21fd96", size = 248999, upload-time = "2025-12-08T13:12:36.02Z" }, + { url = "https://files.pythonhosted.org/packages/0a/32/2e2f96e9d5691eaf1181d9040f850b8b7ce165ea10810fd8e2afa534cef7/coverage-7.13.0-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:1ed5630d946859de835a85e9a43b721123a8a44ec26e2830b296d478c7fd4259", size = 250925, upload-time = "2025-12-08T13:12:37.221Z" }, + { url = "https://files.pythonhosted.org/packages/7b/45/b88ddac1d7978859b9a39a8a50ab323186148f1d64bc068f86fc77706321/coverage-7.13.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7f15a931a668e58087bc39d05d2b4bf4b14ff2875b49c994bbdb1c2217a8daeb", size = 253032, upload-time = "2025-12-08T13:12:38.763Z" }, + { url = "https://files.pythonhosted.org/packages/71/cb/e15513f94c69d4820a34b6bf3d2b1f9f8755fa6021be97c7065442d7d653/coverage-7.13.0-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:30a3a201a127ea57f7e14ba43c93c9c4be8b7d17a26e03bb49e6966d019eede9", size = 249134, upload-time = "2025-12-08T13:12:40.382Z" }, + { url = "https://files.pythonhosted.org/packages/09/61/d960ff7dc9e902af3310ce632a875aaa7860f36d2bc8fc8b37ee7c1b82a5/coverage-7.13.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:7a485ff48fbd231efa32d58f479befce52dcb6bfb2a88bb7bf9a0b89b1bc8030", size = 250731, upload-time = "2025-12-08T13:12:41.992Z" }, + { url = "https://files.pythonhosted.org/packages/98/34/c7c72821794afc7c7c2da1db8f00c2c98353078aa7fb6b5ff36aac834b52/coverage-7.13.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:22486cdafba4f9e471c816a2a5745337742a617fef68e890d8baf9f3036d7833", size = 248795, upload-time = "2025-12-08T13:12:43.331Z" }, + { url = "https://files.pythonhosted.org/packages/0a/5b/e0f07107987a43b2def9aa041c614ddb38064cbf294a71ef8c67d43a0cdd/coverage-7.13.0-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:263c3dbccc78e2e331e59e90115941b5f53e85cfcc6b3b2fbff1fd4e3d2c6ea8", size = 248514, upload-time = "2025-12-08T13:12:44.546Z" }, + { url = "https://files.pythonhosted.org/packages/71/c2/c949c5d3b5e9fc6dd79e1b73cdb86a59ef14f3709b1d72bf7668ae12e000/coverage-7.13.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:e5330fa0cc1f5c3c4c3bb8e101b742025933e7848989370a1d4c8c5e401ea753", size = 249424, upload-time = "2025-12-08T13:12:45.759Z" }, + { url = "https://files.pythonhosted.org/packages/11/f1/bbc009abd6537cec0dffb2cc08c17a7f03de74c970e6302db4342a6e05af/coverage-7.13.0-cp311-cp311-win32.whl", hash = "sha256:0f4872f5d6c54419c94c25dd6ae1d015deeb337d06e448cd890a1e89a8ee7f3b", size = 220597, upload-time = "2025-12-08T13:12:47.378Z" }, + { url = "https://files.pythonhosted.org/packages/c4/f6/d9977f2fb51c10fbaed0718ce3d0a8541185290b981f73b1d27276c12d91/coverage-7.13.0-cp311-cp311-win_amd64.whl", hash = "sha256:51a202e0f80f241ccb68e3e26e19ab5b3bf0f813314f2c967642f13ebcf1ddfe", size = 221536, upload-time = "2025-12-08T13:12:48.7Z" }, + { url = "https://files.pythonhosted.org/packages/be/ad/3fcf43fd96fb43e337a3073dea63ff148dcc5c41ba7a14d4c7d34efb2216/coverage-7.13.0-cp311-cp311-win_arm64.whl", hash = "sha256:d2a9d7f1c11487b1c69367ab3ac2d81b9b3721f097aa409a3191c3e90f8f3dd7", size = 220206, upload-time = "2025-12-08T13:12:50.365Z" }, + { url = "https://files.pythonhosted.org/packages/9b/f1/2619559f17f31ba00fc40908efd1fbf1d0a5536eb75dc8341e7d660a08de/coverage-7.13.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:0b3d67d31383c4c68e19a88e28fc4c2e29517580f1b0ebec4a069d502ce1e0bf", size = 218274, upload-time = "2025-12-08T13:12:52.095Z" }, + { url = "https://files.pythonhosted.org/packages/2b/11/30d71ae5d6e949ff93b2a79a2c1b4822e00423116c5c6edfaeef37301396/coverage-7.13.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:581f086833d24a22c89ae0fe2142cfaa1c92c930adf637ddf122d55083fb5a0f", size = 218638, upload-time = "2025-12-08T13:12:53.418Z" }, + { url = "https://files.pythonhosted.org/packages/79/c2/fce80fc6ded8d77e53207489d6065d0fed75db8951457f9213776615e0f5/coverage-7.13.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:0a3a30f0e257df382f5f9534d4ce3d4cf06eafaf5192beb1a7bd066cb10e78fb", size = 250129, upload-time = "2025-12-08T13:12:54.744Z" }, + { url = "https://files.pythonhosted.org/packages/5b/b6/51b5d1eb6fcbb9a1d5d6984e26cbe09018475c2922d554fd724dd0f056ee/coverage-7.13.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:583221913fbc8f53b88c42e8dbb8fca1d0f2e597cb190ce45916662b8b9d9621", size = 252885, upload-time = "2025-12-08T13:12:56.401Z" }, + { url = "https://files.pythonhosted.org/packages/0d/f8/972a5affea41de798691ab15d023d3530f9f56a72e12e243f35031846ff7/coverage-7.13.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5f5d9bd30756fff3e7216491a0d6d520c448d5124d3d8e8f56446d6412499e74", size = 253974, upload-time = "2025-12-08T13:12:57.718Z" }, + { url = "https://files.pythonhosted.org/packages/8a/56/116513aee860b2c7968aa3506b0f59b22a959261d1dbf3aea7b4450a7520/coverage-7.13.0-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:a23e5a1f8b982d56fa64f8e442e037f6ce29322f1f9e6c2344cd9e9f4407ee57", size = 250538, upload-time = "2025-12-08T13:12:59.254Z" }, + { url = "https://files.pythonhosted.org/packages/d6/75/074476d64248fbadf16dfafbf93fdcede389ec821f74ca858d7c87d2a98c/coverage-7.13.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:9b01c22bc74a7fb44066aaf765224c0d933ddf1f5047d6cdfe4795504a4493f8", size = 251912, upload-time = "2025-12-08T13:13:00.604Z" }, + { url = "https://files.pythonhosted.org/packages/f2/d2/aa4f8acd1f7c06024705c12609d8698c51b27e4d635d717cd1934c9668e2/coverage-7.13.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:898cce66d0836973f48dda4e3514d863d70142bdf6dfab932b9b6a90ea5b222d", size = 250054, upload-time = "2025-12-08T13:13:01.892Z" }, + { url = "https://files.pythonhosted.org/packages/19/98/8df9e1af6a493b03694a1e8070e024e7d2cdc77adedc225a35e616d505de/coverage-7.13.0-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:3ab483ea0e251b5790c2aac03acde31bff0c736bf8a86829b89382b407cd1c3b", size = 249619, upload-time = "2025-12-08T13:13:03.236Z" }, + { url = "https://files.pythonhosted.org/packages/d8/71/f8679231f3353018ca66ef647fa6fe7b77e6bff7845be54ab84f86233363/coverage-7.13.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:1d84e91521c5e4cb6602fe11ece3e1de03b2760e14ae4fcf1a4b56fa3c801fcd", size = 251496, upload-time = "2025-12-08T13:13:04.511Z" }, + { url = "https://files.pythonhosted.org/packages/04/86/9cb406388034eaf3c606c22094edbbb82eea1fa9d20c0e9efadff20d0733/coverage-7.13.0-cp312-cp312-win32.whl", hash = "sha256:193c3887285eec1dbdb3f2bd7fbc351d570ca9c02ca756c3afbc71b3c98af6ef", size = 220808, upload-time = "2025-12-08T13:13:06.422Z" }, + { url = "https://files.pythonhosted.org/packages/1c/59/af483673df6455795daf5f447c2f81a3d2fcfc893a22b8ace983791f6f34/coverage-7.13.0-cp312-cp312-win_amd64.whl", hash = "sha256:4f3e223b2b2db5e0db0c2b97286aba0036ca000f06aca9b12112eaa9af3d92ae", size = 221616, upload-time = "2025-12-08T13:13:07.95Z" }, + { url = "https://files.pythonhosted.org/packages/64/b0/959d582572b30a6830398c60dd419c1965ca4b5fb38ac6b7093a0d50ca8d/coverage-7.13.0-cp312-cp312-win_arm64.whl", hash = "sha256:086cede306d96202e15a4b77ace8472e39d9f4e5f9fd92dd4fecdfb2313b2080", size = 220261, upload-time = "2025-12-08T13:13:09.581Z" }, + { url = "https://files.pythonhosted.org/packages/7c/cc/bce226595eb3bf7d13ccffe154c3c487a22222d87ff018525ab4dd2e9542/coverage-7.13.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:28ee1c96109974af104028a8ef57cec21447d42d0e937c0275329272e370ebcf", size = 218297, upload-time = "2025-12-08T13:13:10.977Z" }, + { url = "https://files.pythonhosted.org/packages/3b/9f/73c4d34600aae03447dff3d7ad1d0ac649856bfb87d1ca7d681cfc913f9e/coverage-7.13.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d1e97353dcc5587b85986cda4ff3ec98081d7e84dd95e8b2a6d59820f0545f8a", size = 218673, upload-time = "2025-12-08T13:13:12.562Z" }, + { url = "https://files.pythonhosted.org/packages/63/ab/8fa097db361a1e8586535ae5073559e6229596b3489ec3ef2f5b38df8cb2/coverage-7.13.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:99acd4dfdfeb58e1937629eb1ab6ab0899b131f183ee5f23e0b5da5cba2fec74", size = 249652, upload-time = "2025-12-08T13:13:13.909Z" }, + { url = "https://files.pythonhosted.org/packages/90/3a/9bfd4de2ff191feb37ef9465855ca56a6f2f30a3bca172e474130731ac3d/coverage-7.13.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:ff45e0cd8451e293b63ced93161e189780baf444119391b3e7d25315060368a6", size = 252251, upload-time = "2025-12-08T13:13:15.553Z" }, + { url = "https://files.pythonhosted.org/packages/df/61/b5d8105f016e1b5874af0d7c67542da780ccd4a5f2244a433d3e20ceb1ad/coverage-7.13.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f4f72a85316d8e13234cafe0a9f81b40418ad7a082792fa4165bd7d45d96066b", size = 253492, upload-time = "2025-12-08T13:13:16.849Z" }, + { url = "https://files.pythonhosted.org/packages/f3/b8/0fad449981803cc47a4694768b99823fb23632150743f9c83af329bb6090/coverage-7.13.0-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:11c21557d0e0a5a38632cbbaca5f008723b26a89d70db6315523df6df77d6232", size = 249850, upload-time = "2025-12-08T13:13:18.142Z" }, + { url = "https://files.pythonhosted.org/packages/9a/e9/8d68337c3125014d918cf4327d5257553a710a2995a6a6de2ac77e5aa429/coverage-7.13.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:76541dc8d53715fb4f7a3a06b34b0dc6846e3c69bc6204c55653a85dd6220971", size = 251633, upload-time = "2025-12-08T13:13:19.56Z" }, + { url = "https://files.pythonhosted.org/packages/55/14/d4112ab26b3a1bc4b3c1295d8452dcf399ed25be4cf649002fb3e64b2d93/coverage-7.13.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:6e9e451dee940a86789134b6b0ffbe31c454ade3b849bb8a9d2cca2541a8e91d", size = 249586, upload-time = "2025-12-08T13:13:20.883Z" }, + { url = "https://files.pythonhosted.org/packages/2c/a9/22b0000186db663b0d82f86c2f1028099ae9ac202491685051e2a11a5218/coverage-7.13.0-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:5c67dace46f361125e6b9cace8fe0b729ed8479f47e70c89b838d319375c8137", size = 249412, upload-time = "2025-12-08T13:13:22.22Z" }, + { url = "https://files.pythonhosted.org/packages/a1/2e/42d8e0d9e7527fba439acdc6ed24a2b97613b1dc85849b1dd935c2cffef0/coverage-7.13.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f59883c643cb19630500f57016f76cfdcd6845ca8c5b5ea1f6e17f74c8e5f511", size = 251191, upload-time = "2025-12-08T13:13:23.899Z" }, + { url = "https://files.pythonhosted.org/packages/a4/af/8c7af92b1377fd8860536aadd58745119252aaaa71a5213e5a8e8007a9f5/coverage-7.13.0-cp313-cp313-win32.whl", hash = "sha256:58632b187be6f0be500f553be41e277712baa278147ecb7559983c6d9faf7ae1", size = 220829, upload-time = "2025-12-08T13:13:25.182Z" }, + { url = "https://files.pythonhosted.org/packages/58/f9/725e8bf16f343d33cbe076c75dc8370262e194ff10072c0608b8e5cf33a3/coverage-7.13.0-cp313-cp313-win_amd64.whl", hash = "sha256:73419b89f812f498aca53f757dd834919b48ce4799f9d5cad33ca0ae442bdb1a", size = 221640, upload-time = "2025-12-08T13:13:26.836Z" }, + { url = "https://files.pythonhosted.org/packages/8a/ff/e98311000aa6933cc79274e2b6b94a2fe0fe3434fca778eba82003675496/coverage-7.13.0-cp313-cp313-win_arm64.whl", hash = "sha256:eb76670874fdd6091eedcc856128ee48c41a9bbbb9c3f1c7c3cf169290e3ffd6", size = 220269, upload-time = "2025-12-08T13:13:28.116Z" }, + { url = "https://files.pythonhosted.org/packages/cf/cf/bbaa2e1275b300343ea865f7d424cc0a2e2a1df6925a070b2b2d5d765330/coverage-7.13.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:6e63ccc6e0ad8986386461c3c4b737540f20426e7ec932f42e030320896c311a", size = 218990, upload-time = "2025-12-08T13:13:29.463Z" }, + { url = "https://files.pythonhosted.org/packages/21/1d/82f0b3323b3d149d7672e7744c116e9c170f4957e0c42572f0366dbb4477/coverage-7.13.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:494f5459ffa1bd45e18558cd98710c36c0b8fbfa82a5eabcbe671d80ecffbfe8", size = 219340, upload-time = "2025-12-08T13:13:31.524Z" }, + { url = "https://files.pythonhosted.org/packages/fb/e3/fe3fd4702a3832a255f4d43013eacb0ef5fc155a5960ea9269d8696db28b/coverage-7.13.0-cp313-cp313t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:06cac81bf10f74034e055e903f5f946e3e26fc51c09fc9f584e4a1605d977053", size = 260638, upload-time = "2025-12-08T13:13:32.965Z" }, + { url = "https://files.pythonhosted.org/packages/ad/01/63186cb000307f2b4da463f72af9b85d380236965574c78e7e27680a2593/coverage-7.13.0-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:f2ffc92b46ed6e6760f1d47a71e56b5664781bc68986dbd1836b2b70c0ce2071", size = 262705, upload-time = "2025-12-08T13:13:34.378Z" }, + { url = "https://files.pythonhosted.org/packages/7c/a1/c0dacef0cc865f2455d59eed3548573ce47ed603205ffd0735d1d78b5906/coverage-7.13.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0602f701057c6823e5db1b74530ce85f17c3c5be5c85fc042ac939cbd909426e", size = 265125, upload-time = "2025-12-08T13:13:35.73Z" }, + { url = "https://files.pythonhosted.org/packages/ef/92/82b99223628b61300bd382c205795533bed021505eab6dd86e11fb5d7925/coverage-7.13.0-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:25dc33618d45456ccb1d37bce44bc78cf269909aa14c4db2e03d63146a8a1493", size = 259844, upload-time = "2025-12-08T13:13:37.69Z" }, + { url = "https://files.pythonhosted.org/packages/cf/2c/89b0291ae4e6cd59ef042708e1c438e2290f8c31959a20055d8768349ee2/coverage-7.13.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:71936a8b3b977ddd0b694c28c6a34f4fff2e9dd201969a4ff5d5fc7742d614b0", size = 262700, upload-time = "2025-12-08T13:13:39.525Z" }, + { url = "https://files.pythonhosted.org/packages/bf/f9/a5f992efae1996245e796bae34ceb942b05db275e4b34222a9a40b9fbd3b/coverage-7.13.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:936bc20503ce24770c71938d1369461f0c5320830800933bc3956e2a4ded930e", size = 260321, upload-time = "2025-12-08T13:13:41.172Z" }, + { url = "https://files.pythonhosted.org/packages/4c/89/a29f5d98c64fedbe32e2ac3c227fbf78edc01cc7572eee17d61024d89889/coverage-7.13.0-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:af0a583efaacc52ae2521f8d7910aff65cdb093091d76291ac5820d5e947fc1c", size = 259222, upload-time = "2025-12-08T13:13:43.282Z" }, + { url = "https://files.pythonhosted.org/packages/b3/c3/940fe447aae302a6701ee51e53af7e08b86ff6eed7631e5740c157ee22b9/coverage-7.13.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:f1c23e24a7000da892a312fb17e33c5f94f8b001de44b7cf8ba2e36fbd15859e", size = 261411, upload-time = "2025-12-08T13:13:44.72Z" }, + { url = "https://files.pythonhosted.org/packages/eb/31/12a4aec689cb942a89129587860ed4d0fd522d5fda81237147fde554b8ae/coverage-7.13.0-cp313-cp313t-win32.whl", hash = "sha256:5f8a0297355e652001015e93be345ee54393e45dc3050af4a0475c5a2b767d46", size = 221505, upload-time = "2025-12-08T13:13:46.332Z" }, + { url = "https://files.pythonhosted.org/packages/65/8c/3b5fe3259d863572d2b0827642c50c3855d26b3aefe80bdc9eba1f0af3b0/coverage-7.13.0-cp313-cp313t-win_amd64.whl", hash = "sha256:6abb3a4c52f05e08460bd9acf04fec027f8718ecaa0d09c40ffbc3fbd70ecc39", size = 222569, upload-time = "2025-12-08T13:13:47.79Z" }, + { url = "https://files.pythonhosted.org/packages/b0/39/f71fa8316a96ac72fc3908839df651e8eccee650001a17f2c78cdb355624/coverage-7.13.0-cp313-cp313t-win_arm64.whl", hash = "sha256:3ad968d1e3aa6ce5be295ab5fe3ae1bf5bb4769d0f98a80a0252d543a2ef2e9e", size = 220841, upload-time = "2025-12-08T13:13:49.243Z" }, + { url = "https://files.pythonhosted.org/packages/8d/4c/1968f32fb9a2604645827e11ff84a31e59d532e01995f904723b4f5328b3/coverage-7.13.0-py3-none-any.whl", hash = "sha256:850d2998f380b1e266459ca5b47bc9e7daf9af1d070f66317972f382d46f1904", size = 210068, upload-time = "2025-12-08T13:14:36.236Z" }, ] [package.optional-dependencies] @@ -569,44 +561,29 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/e7/05/c19819d5e3d95294a6f5947fb9b9629efb316b96de511b418c53d245aae6/cycler-0.12.1-py3-none-any.whl", hash = "sha256:85cef7cff222d8644161529808465972e51340599459b8ac3ccbac5a854e0d30", size = 8321, upload-time = "2023-10-07T05:32:16.783Z" }, ] -[[package]] -name = "cyclonedx-python-lib" -version = "9.1.0" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "license-expression" }, - { name = "packageurl-python" }, - { name = "py-serializable" }, - { name = "sortedcontainers" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/66/fc/abaad5482f7b59c9a0a9d8f354ce4ce23346d582a0d85730b559562bbeb4/cyclonedx_python_lib-9.1.0.tar.gz", hash = "sha256:86935f2c88a7b47a529b93c724dbd3e903bc573f6f8bd977628a7ca1b5dadea1", size = 1048735, upload-time = "2025-02-27T17:23:40.367Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/53/f1/f3be2e9820a2c26fa77622223e91f9c504e1581830930d477e06146073f4/cyclonedx_python_lib-9.1.0-py3-none-any.whl", hash = "sha256:55693fca8edaecc3363b24af14e82cc6e659eb1e8353e58b587c42652ce0fb52", size = 374968, upload-time = "2025-02-27T17:23:37.766Z" }, -] - [[package]] name = "debugpy" -version = "1.8.17" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/15/ad/71e708ff4ca377c4230530d6a7aa7992592648c122a2cd2b321cf8b35a76/debugpy-1.8.17.tar.gz", hash = "sha256:fd723b47a8c08892b1a16b2c6239a8b96637c62a59b94bb5dab4bac592a58a8e", size = 1644129, upload-time = "2025-09-17T16:33:20.633Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/38/36/b57c6e818d909f6e59c0182252921cf435e0951126a97e11de37e72ab5e1/debugpy-1.8.17-cp310-cp310-macosx_15_0_x86_64.whl", hash = "sha256:c41d2ce8bbaddcc0009cc73f65318eedfa3dbc88a8298081deb05389f1ab5542", size = 2098021, upload-time = "2025-09-17T16:33:22.556Z" }, - { url = "https://files.pythonhosted.org/packages/be/01/0363c7efdd1e9febd090bb13cee4fb1057215b157b2979a4ca5ccb678217/debugpy-1.8.17-cp310-cp310-manylinux_2_34_x86_64.whl", hash = "sha256:1440fd514e1b815edd5861ca394786f90eb24960eb26d6f7200994333b1d79e3", size = 3087399, upload-time = "2025-09-17T16:33:24.292Z" }, - { url = "https://files.pythonhosted.org/packages/79/bc/4a984729674aa9a84856650438b9665f9a1d5a748804ac6f37932ce0d4aa/debugpy-1.8.17-cp310-cp310-win32.whl", hash = "sha256:3a32c0af575749083d7492dc79f6ab69f21b2d2ad4cd977a958a07d5865316e4", size = 5230292, upload-time = "2025-09-17T16:33:26.137Z" }, - { url = "https://files.pythonhosted.org/packages/5d/19/2b9b3092d0cf81a5aa10c86271999453030af354d1a5a7d6e34c574515d7/debugpy-1.8.17-cp310-cp310-win_amd64.whl", hash = "sha256:a3aad0537cf4d9c1996434be68c6c9a6d233ac6f76c2a482c7803295b4e4f99a", size = 5261885, upload-time = "2025-09-17T16:33:27.592Z" }, - { url = "https://files.pythonhosted.org/packages/d8/53/3af72b5c159278c4a0cf4cffa518675a0e73bdb7d1cac0239b815502d2ce/debugpy-1.8.17-cp311-cp311-macosx_15_0_universal2.whl", hash = "sha256:d3fce3f0e3de262a3b67e69916d001f3e767661c6e1ee42553009d445d1cd840", size = 2207154, upload-time = "2025-09-17T16:33:29.457Z" }, - { url = "https://files.pythonhosted.org/packages/8f/6d/204f407df45600e2245b4a39860ed4ba32552330a0b3f5f160ae4cc30072/debugpy-1.8.17-cp311-cp311-manylinux_2_34_x86_64.whl", hash = "sha256:c6bdf134457ae0cac6fb68205776be635d31174eeac9541e1d0c062165c6461f", size = 3170322, upload-time = "2025-09-17T16:33:30.837Z" }, - { url = "https://files.pythonhosted.org/packages/f2/13/1b8f87d39cf83c6b713de2620c31205299e6065622e7dd37aff4808dd410/debugpy-1.8.17-cp311-cp311-win32.whl", hash = "sha256:e79a195f9e059edfe5d8bf6f3749b2599452d3e9380484cd261f6b7cd2c7c4da", size = 5155078, upload-time = "2025-09-17T16:33:33.331Z" }, - { url = "https://files.pythonhosted.org/packages/c2/c5/c012c60a2922cc91caa9675d0ddfbb14ba59e1e36228355f41cab6483469/debugpy-1.8.17-cp311-cp311-win_amd64.whl", hash = "sha256:b532282ad4eca958b1b2d7dbcb2b7218e02cb934165859b918e3b6ba7772d3f4", size = 5179011, upload-time = "2025-09-17T16:33:35.711Z" }, - { url = "https://files.pythonhosted.org/packages/08/2b/9d8e65beb2751876c82e1aceb32f328c43ec872711fa80257c7674f45650/debugpy-1.8.17-cp312-cp312-macosx_15_0_universal2.whl", hash = "sha256:f14467edef672195c6f6b8e27ce5005313cb5d03c9239059bc7182b60c176e2d", size = 2549522, upload-time = "2025-09-17T16:33:38.466Z" }, - { url = "https://files.pythonhosted.org/packages/b4/78/eb0d77f02971c05fca0eb7465b18058ba84bd957062f5eec82f941ac792a/debugpy-1.8.17-cp312-cp312-manylinux_2_34_x86_64.whl", hash = "sha256:24693179ef9dfa20dca8605905a42b392be56d410c333af82f1c5dff807a64cc", size = 4309417, upload-time = "2025-09-17T16:33:41.299Z" }, - { url = "https://files.pythonhosted.org/packages/37/42/c40f1d8cc1fed1e75ea54298a382395b8b937d923fcf41ab0797a554f555/debugpy-1.8.17-cp312-cp312-win32.whl", hash = "sha256:6a4e9dacf2cbb60d2514ff7b04b4534b0139facbf2abdffe0639ddb6088e59cf", size = 5277130, upload-time = "2025-09-17T16:33:43.554Z" }, - { url = "https://files.pythonhosted.org/packages/72/22/84263b205baad32b81b36eac076de0cdbe09fe2d0637f5b32243dc7c925b/debugpy-1.8.17-cp312-cp312-win_amd64.whl", hash = "sha256:e8f8f61c518952fb15f74a302e068b48d9c4691768ade433e4adeea961993464", size = 5319053, upload-time = "2025-09-17T16:33:53.033Z" }, - { url = "https://files.pythonhosted.org/packages/50/76/597e5cb97d026274ba297af8d89138dfd9e695767ba0e0895edb20963f40/debugpy-1.8.17-cp313-cp313-macosx_15_0_universal2.whl", hash = "sha256:857c1dd5d70042502aef1c6d1c2801211f3ea7e56f75e9c335f434afb403e464", size = 2538386, upload-time = "2025-09-17T16:33:54.594Z" }, - { url = "https://files.pythonhosted.org/packages/5f/60/ce5c34fcdfec493701f9d1532dba95b21b2f6394147234dce21160bd923f/debugpy-1.8.17-cp313-cp313-manylinux_2_34_x86_64.whl", hash = "sha256:3bea3b0b12f3946e098cce9b43c3c46e317b567f79570c3f43f0b96d00788088", size = 4292100, upload-time = "2025-09-17T16:33:56.353Z" }, - { url = "https://files.pythonhosted.org/packages/e8/95/7873cf2146577ef71d2a20bf553f12df865922a6f87b9e8ee1df04f01785/debugpy-1.8.17-cp313-cp313-win32.whl", hash = "sha256:e34ee844c2f17b18556b5bbe59e1e2ff4e86a00282d2a46edab73fd7f18f4a83", size = 5277002, upload-time = "2025-09-17T16:33:58.231Z" }, - { url = "https://files.pythonhosted.org/packages/46/11/18c79a1cee5ff539a94ec4aa290c1c069a5580fd5cfd2fb2e282f8e905da/debugpy-1.8.17-cp313-cp313-win_amd64.whl", hash = "sha256:6c5cd6f009ad4fca8e33e5238210dc1e5f42db07d4b6ab21ac7ffa904a196420", size = 5319047, upload-time = "2025-09-17T16:34:00.586Z" }, - { url = "https://files.pythonhosted.org/packages/b0/d0/89247ec250369fc76db477720a26b2fce7ba079ff1380e4ab4529d2fe233/debugpy-1.8.17-py2.py3-none-any.whl", hash = "sha256:60c7dca6571efe660ccb7a9508d73ca14b8796c4ed484c2002abba714226cfef", size = 5283210, upload-time = "2025-09-17T16:34:25.835Z" }, +version = "1.8.19" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/73/75/9e12d4d42349b817cd545b89247696c67917aab907012ae5b64bbfea3199/debugpy-1.8.19.tar.gz", hash = "sha256:eea7e5987445ab0b5ed258093722d5ecb8bb72217c5c9b1e21f64efe23ddebdb", size = 1644590, upload-time = "2025-12-15T21:53:28.044Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/bf/98/d57054371887f37d3c959a7a8dc3c76b763acb65f5e78d849d7db7cadc5b/debugpy-1.8.19-cp310-cp310-macosx_15_0_x86_64.whl", hash = "sha256:fce6da15d73be5935b4438435c53adb512326a3e11e4f90793ea87cd9f018254", size = 2098493, upload-time = "2025-12-15T21:53:30.149Z" }, + { url = "https://files.pythonhosted.org/packages/ee/dd/c517b9aa3500157a30e4f4c4f5149f880026bd039d2b940acd2383a85d8e/debugpy-1.8.19-cp310-cp310-manylinux_2_34_x86_64.whl", hash = "sha256:e24b1652a1df1ab04d81e7ead446a91c226de704ff5dde6bd0a0dbaab07aa3f2", size = 3087875, upload-time = "2025-12-15T21:53:31.511Z" }, + { url = "https://files.pythonhosted.org/packages/d8/57/3d5a5b0da9b63445253107ead151eff29190c6ad7440c68d1a59d56613aa/debugpy-1.8.19-cp310-cp310-win32.whl", hash = "sha256:327cb28c3ad9e17bc925efc7f7018195fd4787c2fe4b7af1eec11f1d19bdec62", size = 5239378, upload-time = "2025-12-15T21:53:32.979Z" }, + { url = "https://files.pythonhosted.org/packages/a6/36/7f9053c4c549160c87ae7e43800138f2695578c8b65947114c97250983b6/debugpy-1.8.19-cp310-cp310-win_amd64.whl", hash = "sha256:b7dd275cf2c99e53adb9654f5ae015f70415bbe2bacbe24cfee30d54b6aa03c5", size = 5271129, upload-time = "2025-12-15T21:53:35.085Z" }, + { url = "https://files.pythonhosted.org/packages/80/e2/48531a609b5a2aa94c6b6853afdfec8da05630ab9aaa96f1349e772119e9/debugpy-1.8.19-cp311-cp311-macosx_15_0_universal2.whl", hash = "sha256:c5dcfa21de1f735a4f7ced4556339a109aa0f618d366ede9da0a3600f2516d8b", size = 2207620, upload-time = "2025-12-15T21:53:37.1Z" }, + { url = "https://files.pythonhosted.org/packages/1b/d4/97775c01d56071969f57d93928899e5616a4cfbbf4c8cc75390d3a51c4a4/debugpy-1.8.19-cp311-cp311-manylinux_2_34_x86_64.whl", hash = "sha256:806d6800246244004625d5222d7765874ab2d22f3ba5f615416cf1342d61c488", size = 3170796, upload-time = "2025-12-15T21:53:38.513Z" }, + { url = "https://files.pythonhosted.org/packages/8d/7e/8c7681bdb05be9ec972bbb1245eb7c4c7b0679bb6a9e6408d808bc876d3d/debugpy-1.8.19-cp311-cp311-win32.whl", hash = "sha256:783a519e6dfb1f3cd773a9bda592f4887a65040cb0c7bd38dde410f4e53c40d4", size = 5164287, upload-time = "2025-12-15T21:53:40.857Z" }, + { url = "https://files.pythonhosted.org/packages/f2/a8/aaac7ff12ddf5d68a39e13a423a8490426f5f661384f5ad8d9062761bd8e/debugpy-1.8.19-cp311-cp311-win_amd64.whl", hash = "sha256:14035cbdbb1fe4b642babcdcb5935c2da3b1067ac211c5c5a8fdc0bb31adbcaa", size = 5188269, upload-time = "2025-12-15T21:53:42.359Z" }, + { url = "https://files.pythonhosted.org/packages/4a/15/d762e5263d9e25b763b78be72dc084c7a32113a0bac119e2f7acae7700ed/debugpy-1.8.19-cp312-cp312-macosx_15_0_universal2.whl", hash = "sha256:bccb1540a49cde77edc7ce7d9d075c1dbeb2414751bc0048c7a11e1b597a4c2e", size = 2549995, upload-time = "2025-12-15T21:53:43.773Z" }, + { url = "https://files.pythonhosted.org/packages/a7/88/f7d25c68b18873b7c53d7c156ca7a7ffd8e77073aa0eac170a9b679cf786/debugpy-1.8.19-cp312-cp312-manylinux_2_34_x86_64.whl", hash = "sha256:e9c68d9a382ec754dc05ed1d1b4ed5bd824b9f7c1a8cd1083adb84b3c93501de", size = 4309891, upload-time = "2025-12-15T21:53:45.26Z" }, + { url = "https://files.pythonhosted.org/packages/c5/4f/a65e973aba3865794da65f71971dca01ae66666132c7b2647182d5be0c5f/debugpy-1.8.19-cp312-cp312-win32.whl", hash = "sha256:6599cab8a783d1496ae9984c52cb13b7c4a3bd06a8e6c33446832a5d97ce0bee", size = 5286355, upload-time = "2025-12-15T21:53:46.763Z" }, + { url = "https://files.pythonhosted.org/packages/d8/3a/d3d8b48fec96e3d824e404bf428276fb8419dfa766f78f10b08da1cb2986/debugpy-1.8.19-cp312-cp312-win_amd64.whl", hash = "sha256:66e3d2fd8f2035a8f111eb127fa508469dfa40928a89b460b41fd988684dc83d", size = 5328239, upload-time = "2025-12-15T21:53:48.868Z" }, + { url = "https://files.pythonhosted.org/packages/71/3d/388035a31a59c26f1ecc8d86af607d0c42e20ef80074147cd07b180c4349/debugpy-1.8.19-cp313-cp313-macosx_15_0_universal2.whl", hash = "sha256:91e35db2672a0abaf325f4868fcac9c1674a0d9ad9bb8a8c849c03a5ebba3e6d", size = 2538859, upload-time = "2025-12-15T21:53:50.478Z" }, + { url = "https://files.pythonhosted.org/packages/4a/19/c93a0772d0962294f083dbdb113af1a7427bb632d36e5314297068f55db7/debugpy-1.8.19-cp313-cp313-manylinux_2_34_x86_64.whl", hash = "sha256:85016a73ab84dea1c1f1dcd88ec692993bcbe4532d1b49ecb5f3c688ae50c606", size = 4292575, upload-time = "2025-12-15T21:53:51.821Z" }, + { url = "https://files.pythonhosted.org/packages/5c/56/09e48ab796b0a77e3d7dc250f95251832b8bf6838c9632f6100c98bdf426/debugpy-1.8.19-cp313-cp313-win32.whl", hash = "sha256:b605f17e89ba0ecee994391194285fada89cee111cfcd29d6f2ee11cbdc40976", size = 5286209, upload-time = "2025-12-15T21:53:53.602Z" }, + { url = "https://files.pythonhosted.org/packages/fb/4e/931480b9552c7d0feebe40c73725dd7703dcc578ba9efc14fe0e6d31cfd1/debugpy-1.8.19-cp313-cp313-win_amd64.whl", hash = "sha256:c30639998a9f9cd9699b4b621942c0179a6527f083c72351f95c6ab1728d5b73", size = 5328206, upload-time = "2025-12-15T21:53:55.433Z" }, + { url = "https://files.pythonhosted.org/packages/25/3e/e27078370414ef35fafad2c06d182110073daaeb5d3bf734b0b1eeefe452/debugpy-1.8.19-py2.py3-none-any.whl", hash = "sha256:360ffd231a780abbc414ba0f005dad409e71c78637efe8f2bd75837132a41d38", size = 5292321, upload-time = "2025-12-15T21:54:16.024Z" }, ] [[package]] @@ -633,11 +610,11 @@ version = "2.8.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "pandas-flavor" }, { name = "rdkit" }, { name = "scipy", version = "1.15.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "scipy", version = "1.16.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "scipy", version = "1.16.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, ] wheels = [ { url = "https://files.pythonhosted.org/packages/7b/3c/67bfc03db3f6527a54a0f9b696809bca55eb6de27928829218ab7e6c40e7/descriptastorus-2.8.0-py3-none-any.whl", hash = "sha256:cc0c8201d6d9d8534dc8a45ce629aeaf4cf1e62ba848b9b1e392b2600ca834dc", size = 2127218, upload-time = "2024-10-26T19:48:30.328Z" }, @@ -656,11 +633,27 @@ wheels = [ name = "docutils" version = "0.21.2" source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.11'", +] sdist = { url = "https://files.pythonhosted.org/packages/ae/ed/aefcc8cd0ba62a0560c3c18c33925362d46c6075480bfa4df87b28e169a9/docutils-0.21.2.tar.gz", hash = "sha256:3a6b18732edf182daa3cd12775bbb338cf5691468f91eeeb109deff6ebfa986f", size = 2204444, upload-time = "2024-04-23T18:57:18.24Z" } wheels = [ { url = "https://files.pythonhosted.org/packages/8f/d7/9322c609343d929e75e7e5e6255e614fcc67572cfd083959cdef3b7aad79/docutils-0.21.2-py3-none-any.whl", hash = "sha256:dafca5b9e384f0e419294eb4d2ff9fa826435bf15f15b7bd45723e8ad76811b2", size = 587408, upload-time = "2024-04-23T18:57:14.835Z" }, ] +[[package]] +name = "docutils" +version = "0.22.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +sdist = { url = "https://files.pythonhosted.org/packages/ae/b6/03bb70946330e88ffec97aefd3ea75ba575cb2e762061e0e62a213befee8/docutils-0.22.4.tar.gz", hash = "sha256:4db53b1fde9abecbb74d91230d32ab626d94f6badfc575d6db9194a49df29968", size = 2291750, upload-time = "2025-12-18T19:00:26.443Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/02/10/5da547df7a391dcde17f59520a231527b8571e6f46fc8efb02ccb370ab12/docutils-0.22.4-py3-none-any.whl", hash = "sha256:d0013f540772d1420576855455d050a2180186c91c15779301ac2ccb3eeb68de", size = 633196, upload-time = "2025-12-18T19:00:18.077Z" }, +] + [[package]] name = "e3fp" version = "1.2.7" @@ -668,10 +661,10 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "mmh3" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "rdkit" }, { name = "scipy", version = "1.15.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "scipy", version = "1.16.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "scipy", version = "1.16.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "sdaxen-python-utilities" }, { name = "smart-open" }, ] @@ -682,14 +675,14 @@ wheels = [ [[package]] name = "exceptiongroup" -version = "1.3.0" +version = "1.3.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0b/9f/a65090624ecf468cdca03533906e7c69ed7588582240cfe7cc9e770b50eb/exceptiongroup-1.3.0.tar.gz", hash = "sha256:b241f5885f560bc56a59ee63ca4c6a8bfa46ae4ad651af316d4e81817bb9fd88", size = 29749, upload-time = "2025-05-10T17:42:51.123Z" } +sdist = { url = "https://files.pythonhosted.org/packages/50/79/66800aadf48771f6b62f7eb014e352e5d06856655206165d775e675a02c9/exceptiongroup-1.3.1.tar.gz", hash = "sha256:8b412432c6055b0b7d14c310000ae93352ed6754f70fa8f7c34141f91c4e3219", size = 30371, upload-time = "2025-11-21T23:01:54.787Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/36/f4/c6e662dade71f56cd2f3735141b265c3c79293c109549c1e6933b0651ffc/exceptiongroup-1.3.0-py3-none-any.whl", hash = "sha256:4d111e6e0c13d0644cad6ddaa7ed0261a0b36971f6d23e7ec9b4b9097da78a10", size = 16674, upload-time = "2025-05-10T17:42:49.33Z" }, + { url = "https://files.pythonhosted.org/packages/8a/0e/97c33bf5009bdbac74fd2beace167cab3f978feb69cc36f1ef79360d6c4e/exceptiongroup-1.3.1-py3-none-any.whl", hash = "sha256:a7a39a3bd276781e98394987d3a5701d0c4edffb633bb7a5144577f82c773598", size = 16740, upload-time = "2025-11-21T23:01:53.443Z" }, ] [[package]] @@ -712,52 +705,52 @@ wheels = [ [[package]] name = "filelock" -version = "3.19.1" +version = "3.20.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/40/bb/0ab3e58d22305b6f5440629d20683af28959bf793d98d11950e305c1c326/filelock-3.19.1.tar.gz", hash = "sha256:66eda1888b0171c998b35be2bcc0f6d75c388a7ce20c3f3f37aa8e96c2dddf58", size = 17687, upload-time = "2025-08-14T16:56:03.016Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a7/23/ce7a1126827cedeb958fc043d61745754464eb56c5937c35bbf2b8e26f34/filelock-3.20.1.tar.gz", hash = "sha256:b8360948b351b80f420878d8516519a2204b07aefcdcfd24912a5d33127f188c", size = 19476, upload-time = "2025-12-15T23:54:28.027Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/42/14/42b2651a2f46b022ccd948bca9f2d5af0fd8929c4eec235b8d6d844fbe67/filelock-3.19.1-py3-none-any.whl", hash = "sha256:d38e30481def20772f5baf097c122c3babc4fcdb7e14e57049eb9d88c6dc017d", size = 15988, upload-time = "2025-08-14T16:56:01.633Z" }, + { url = "https://files.pythonhosted.org/packages/e3/7f/a1a97644e39e7316d850784c642093c99df1290a460df4ede27659056834/filelock-3.20.1-py3-none-any.whl", hash = "sha256:15d9e9a67306188a44baa72f569d2bfd803076269365fdea0934385da4dc361a", size = 16666, upload-time = "2025-12-15T23:54:26.874Z" }, ] [[package]] name = "fonttools" -version = "4.60.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/27/d9/4eabd956fe123651a1f0efe29d9758b3837b5ae9a98934bdb571117033bb/fonttools-4.60.0.tar.gz", hash = "sha256:8f5927f049091a0ca74d35cce7f78e8f7775c83a6901a8fbe899babcc297146a", size = 3553671, upload-time = "2025-09-17T11:34:01.504Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/01/1e/7c2d660cd2a6718961946f76b6af25ae8c7ad0e2a93a34c9bf8b955cb77f/fonttools-4.60.0-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:151282a235c36024168c21c02193e939e8b28c73d5fa0b36ae1072671d8fa134", size = 2809773, upload-time = "2025-09-17T11:31:52.648Z" }, - { url = "https://files.pythonhosted.org/packages/f2/74/35cb2e17d984e712f0f7241b1b8bf06bc1b0da345f11620acd78a7eb1f0e/fonttools-4.60.0-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:3f32cc42d485d9b1546463b9a7a92bdbde8aef90bac3602503e04c2ddb27e164", size = 2345916, upload-time = "2025-09-17T11:31:55.817Z" }, - { url = "https://files.pythonhosted.org/packages/40/52/39e50212f47bad254255734903accb4f44143faf2b950ba67a61f0bfb26a/fonttools-4.60.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:336b89d169c40379b8ccef418c877edbc28840b553099c9a739b0db2bcbb57c5", size = 4863583, upload-time = "2025-09-17T11:31:57.708Z" }, - { url = "https://files.pythonhosted.org/packages/0c/2c/e701ba6a439119fe312f1ad738369519b446503b02d3f0f75424111686f1/fonttools-4.60.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:39a38d950b2b04cd6da729586e6b51d686b0c27d554a2154a6a35887f87c09b1", size = 4793647, upload-time = "2025-09-17T11:31:59.944Z" }, - { url = "https://files.pythonhosted.org/packages/d5/04/a48f5f7cce1653a876d6b57d9626c1364bcb430780bbbdd475662bbbf759/fonttools-4.60.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:7067dd03e0296907a5c6184285807cbb7bc0bf61a584ffebbf97c2b638d8641a", size = 4842891, upload-time = "2025-09-17T11:32:02.149Z" }, - { url = "https://files.pythonhosted.org/packages/dd/af/0f2b742f6b489a62c6f5a2239867c6d203e3ba358cb48dfc940baee41932/fonttools-4.60.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:342753fe1a1bd2e6896e7a4e936a67c0f441d6897bd11477f718e772d6e63e88", size = 4953569, upload-time = "2025-09-17T11:32:04.467Z" }, - { url = "https://files.pythonhosted.org/packages/d6/2b/23c4dde4a869aa138f5fb63fb124e6accb0d643600b437f4eca0f2637ea2/fonttools-4.60.0-cp310-cp310-win32.whl", hash = "sha256:0746c2b2b32087da2ac5f81e14d319c44cb21127d419bc60869daed089790e3d", size = 2231022, upload-time = "2025-09-17T11:32:06.617Z" }, - { url = "https://files.pythonhosted.org/packages/e3/1c/d53dd15d3392d8f69aa3bc49ca7bdfaea06aa875dc3a641eca85433c90b3/fonttools-4.60.0-cp310-cp310-win_amd64.whl", hash = "sha256:b83b32e5e8918f8e0ccd79816fc2f914e30edc6969ab2df6baf4148e72dbcc11", size = 2275804, upload-time = "2025-09-17T11:32:08.578Z" }, - { url = "https://files.pythonhosted.org/packages/da/3d/c57731fbbf204ef1045caca28d5176430161ead73cd9feac3e9d9ef77ee6/fonttools-4.60.0-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:a9106c202d68ff5f9b4a0094c4d7ad2eaa7e9280f06427b09643215e706eb016", size = 2830883, upload-time = "2025-09-17T11:32:10.552Z" }, - { url = "https://files.pythonhosted.org/packages/cc/2d/b7a6ebaed464ce441c755252cc222af11edc651d17c8f26482f429cc2c0e/fonttools-4.60.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:9da3a4a3f2485b156bb429b4f8faa972480fc01f553f7c8c80d05d48f17eec89", size = 2356005, upload-time = "2025-09-17T11:32:13.248Z" }, - { url = "https://files.pythonhosted.org/packages/ee/c2/ea834e921324e2051403e125c1fe0bfbdde4951a7c1784e4ae6bdbd286cc/fonttools-4.60.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1f84de764c6057b2ffd4feb50ddef481d92e348f0c70f2c849b723118d352bf3", size = 5041201, upload-time = "2025-09-17T11:32:15.373Z" }, - { url = "https://files.pythonhosted.org/packages/93/3c/1c64a338e9aa410d2d0728827d5bb1301463078cb225b94589f27558b427/fonttools-4.60.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:800b3fa0d5c12ddff02179d45b035a23989a6c597a71c8035c010fff3b2ef1bb", size = 4977696, upload-time = "2025-09-17T11:32:17.674Z" }, - { url = "https://files.pythonhosted.org/packages/07/cc/c8c411a0d9732bb886b870e052f20658fec9cf91118314f253950d2c1d65/fonttools-4.60.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8dd68f60b030277f292a582d31c374edfadc60bb33d51ec7b6cd4304531819ba", size = 5020386, upload-time = "2025-09-17T11:32:20.089Z" }, - { url = "https://files.pythonhosted.org/packages/13/01/1d3bc07cf92e7f4fc27f06d4494bf6078dc595b2e01b959157a4fd23df12/fonttools-4.60.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:53328e3ca9e5c8660ef6de07c35f8f312c189b757535e12141be7a8ec942de6e", size = 5131575, upload-time = "2025-09-17T11:32:22.582Z" }, - { url = "https://files.pythonhosted.org/packages/5a/16/08db3917ee19e89d2eb0ee637d37cd4136c849dc421ff63f406b9165c1a1/fonttools-4.60.0-cp311-cp311-win32.whl", hash = "sha256:d493c175ddd0b88a5376e61163e3e6fde3be8b8987db9b092e0a84650709c9e7", size = 2229297, upload-time = "2025-09-17T11:32:24.834Z" }, - { url = "https://files.pythonhosted.org/packages/d2/0b/76764da82c0dfcea144861f568d9e83f4b921e84f2be617b451257bb25a7/fonttools-4.60.0-cp311-cp311-win_amd64.whl", hash = "sha256:cc2770c9dc49c2d0366e9683f4d03beb46c98042d7ccc8ddbadf3459ecb051a7", size = 2277193, upload-time = "2025-09-17T11:32:27.094Z" }, - { url = "https://files.pythonhosted.org/packages/2a/9b/706ebf84b55ab03439c1f3a94d6915123c0d96099f4238b254fdacffe03a/fonttools-4.60.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:8c68928a438d60dfde90e2f09aa7f848ed201176ca6652341744ceec4215859f", size = 2831953, upload-time = "2025-09-17T11:32:29.39Z" }, - { url = "https://files.pythonhosted.org/packages/76/40/782f485be450846e4f3aecff1f10e42af414fc6e19d235c70020f64278e1/fonttools-4.60.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:b7133821249097cffabf0624eafd37f5a3358d5ce814febe9db688e3673e724e", size = 2351716, upload-time = "2025-09-17T11:32:31.46Z" }, - { url = "https://files.pythonhosted.org/packages/39/77/ad8d2a6ecc19716eb488c8cf118de10f7802e14bdf61d136d7b52358d6b1/fonttools-4.60.0-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:d3638905d3d77ac8791127ce181f7cb434f37e4204d8b2e31b8f1e154320b41f", size = 4922729, upload-time = "2025-09-17T11:32:33.659Z" }, - { url = "https://files.pythonhosted.org/packages/6b/48/aa543037c6e7788e1bc36b3f858ac70a59d32d0f45915263d0b330a35140/fonttools-4.60.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7968a26ef010ae89aabbb2f8e9dec1e2709a2541bb8620790451ee8aeb4f6fbf", size = 4967188, upload-time = "2025-09-17T11:32:35.74Z" }, - { url = "https://files.pythonhosted.org/packages/ac/58/e407d2028adc6387947eff8f2940b31f4ed40b9a83c2c7bbc8b9255126e2/fonttools-4.60.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1ef01ca7847c356b0fe026b7b92304bc31dc60a4218689ee0acc66652c1a36b2", size = 4910043, upload-time = "2025-09-17T11:32:38.054Z" }, - { url = "https://files.pythonhosted.org/packages/16/ef/e78519b3c296ef757a21b792fc6a785aa2ef9a2efb098083d8ed5f6ee2ba/fonttools-4.60.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:f3482d7ed7867edfcf785f77c1dffc876c4b2ddac19539c075712ff2a0703cf5", size = 5061980, upload-time = "2025-09-17T11:32:40.457Z" }, - { url = "https://files.pythonhosted.org/packages/00/4c/ad72444d1e3ef704ee90af8d5abf198016a39908d322bf41235562fb01a0/fonttools-4.60.0-cp312-cp312-win32.whl", hash = "sha256:8c937c4fe8addff575a984c9519433391180bf52cf35895524a07b520f376067", size = 2217750, upload-time = "2025-09-17T11:32:42.586Z" }, - { url = "https://files.pythonhosted.org/packages/46/55/3e8ac21963e130242f5a9ea2ebc57f5726d704bf4dcca89088b5b637b2d3/fonttools-4.60.0-cp312-cp312-win_amd64.whl", hash = "sha256:99b06d5d6f29f32e312adaed0367112f5ff2d300ea24363d377ec917daf9e8c5", size = 2266025, upload-time = "2025-09-17T11:32:44.8Z" }, - { url = "https://files.pythonhosted.org/packages/b4/6b/d090cd54abe88192fe3010f573508b2592cf1d1f98b14bcb799a8ad20525/fonttools-4.60.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:97100ba820936cdb5148b634e0884f0088699c7e2f1302ae7bba3747c7a19fb3", size = 2824791, upload-time = "2025-09-17T11:32:47.002Z" }, - { url = "https://files.pythonhosted.org/packages/97/8c/7ccb5a27aac9a535623fe04935fb9f469a4f8a1253991af9fbac2fe88c17/fonttools-4.60.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:03fccf84f377f83e99a5328a9ebe6b41e16fcf64a1450c352b6aa7e0deedbc01", size = 2347081, upload-time = "2025-09-17T11:32:49.204Z" }, - { url = "https://files.pythonhosted.org/packages/f8/1a/c14f0bb20b4cb7849dc0519f0ab0da74318d52236dc23168530569958599/fonttools-4.60.0-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:a3ef06671f862cd7da78ab105fbf8dce9da3634a8f91b3a64ed5c29c0ac6a9a8", size = 4902095, upload-time = "2025-09-17T11:32:51.848Z" }, - { url = "https://files.pythonhosted.org/packages/c9/a0/c7c91f07c40de5399cbaec7d25e04c9afac6c8f80036a98c125efdb5fe1a/fonttools-4.60.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3f2195faf96594c238462c420c7eff97d1aa51de595434f806ec3952df428616", size = 4959137, upload-time = "2025-09-17T11:32:54.185Z" }, - { url = "https://files.pythonhosted.org/packages/38/d2/169e49498df9f2c721763aa39b0bf3d08cb762864ebc8a8ddb99f5ba7ec8/fonttools-4.60.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:3887008865fa4f56cff58a1878f1300ba81a4e34f76daf9b47234698493072ee", size = 4900467, upload-time = "2025-09-17T11:32:56.664Z" }, - { url = "https://files.pythonhosted.org/packages/cc/9c/bfb56b89c3eab8bcb739c7fd1e8a43285c8dd833e1e1d18d4f54f2f641af/fonttools-4.60.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:5567bd130378f21231d3856d8f0571dcdfcd77e47832978c26dabe572d456daa", size = 5043508, upload-time = "2025-09-17T11:32:58.944Z" }, - { url = "https://files.pythonhosted.org/packages/77/30/2b511c7eb99faee1fd9a0b42e984fb91275da3d681da650af4edf409d0fd/fonttools-4.60.0-cp313-cp313-win32.whl", hash = "sha256:699d0b521ec0b188ac11f2c14ccf6a926367795818ddf2bd00a273e9a052dd20", size = 2216037, upload-time = "2025-09-17T11:33:01.192Z" }, - { url = "https://files.pythonhosted.org/packages/3d/73/a2cc5ee4faeb0302cc81942c27f3b516801bf489fdc422a1b20090fff695/fonttools-4.60.0-cp313-cp313-win_amd64.whl", hash = "sha256:24296163268e7c800009711ce5c0e9997be8882c0bd546696c82ef45966163a6", size = 2265190, upload-time = "2025-09-17T11:33:03.935Z" }, - { url = "https://files.pythonhosted.org/packages/f9/a4/247d3e54eb5ed59e94e09866cfc4f9567e274fbf310ba390711851f63b3b/fonttools-4.60.0-py3-none-any.whl", hash = "sha256:496d26e4d14dcccdd6ada2e937e4d174d3138e3d73f5c9b6ec6eb2fd1dab4f66", size = 1142186, upload-time = "2025-09-17T11:33:59.287Z" }, +version = "4.61.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/ec/ca/cf17b88a8df95691275a3d77dc0a5ad9907f328ae53acbe6795da1b2f5ed/fonttools-4.61.1.tar.gz", hash = "sha256:6675329885c44657f826ef01d9e4fb33b9158e9d93c537d84ad8399539bc6f69", size = 3565756, upload-time = "2025-12-12T17:31:24.246Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5b/94/8a28707adb00bed1bf22dac16ccafe60faf2ade353dcb32c3617ee917307/fonttools-4.61.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7c7db70d57e5e1089a274cbb2b1fd635c9a24de809a231b154965d415d6c6d24", size = 2854799, upload-time = "2025-12-12T17:29:27.5Z" }, + { url = "https://files.pythonhosted.org/packages/94/93/c2e682faaa5ee92034818d8f8a8145ae73eb83619600495dcf8503fa7771/fonttools-4.61.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:5fe9fd43882620017add5eabb781ebfbc6998ee49b35bd7f8f79af1f9f99a958", size = 2403032, upload-time = "2025-12-12T17:29:30.115Z" }, + { url = "https://files.pythonhosted.org/packages/f1/62/1748f7e7e1ee41aa52279fd2e3a6d0733dc42a673b16932bad8e5d0c8b28/fonttools-4.61.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d8db08051fc9e7d8bc622f2112511b8107d8f27cd89e2f64ec45e9825e8288da", size = 4897863, upload-time = "2025-12-12T17:29:32.535Z" }, + { url = "https://files.pythonhosted.org/packages/69/69/4ca02ee367d2c98edcaeb83fc278d20972502ee071214ad9d8ca85e06080/fonttools-4.61.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a76d4cb80f41ba94a6691264be76435e5f72f2cb3cab0b092a6212855f71c2f6", size = 4859076, upload-time = "2025-12-12T17:29:34.907Z" }, + { url = "https://files.pythonhosted.org/packages/8c/f5/660f9e3cefa078861a7f099107c6d203b568a6227eef163dd173bfc56bdc/fonttools-4.61.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:a13fc8aeb24bad755eea8f7f9d409438eb94e82cf86b08fe77a03fbc8f6a96b1", size = 4875623, upload-time = "2025-12-12T17:29:37.33Z" }, + { url = "https://files.pythonhosted.org/packages/63/d1/9d7c5091d2276ed47795c131c1bf9316c3c1ab2789c22e2f59e0572ccd38/fonttools-4.61.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b846a1fcf8beadeb9ea4f44ec5bdde393e2f1569e17d700bfc49cd69bde75881", size = 4993327, upload-time = "2025-12-12T17:29:39.781Z" }, + { url = "https://files.pythonhosted.org/packages/6f/2d/28def73837885ae32260d07660a052b99f0aa00454867d33745dfe49dbf0/fonttools-4.61.1-cp310-cp310-win32.whl", hash = "sha256:78a7d3ab09dc47ac1a363a493e6112d8cabed7ba7caad5f54dbe2f08676d1b47", size = 1502180, upload-time = "2025-12-12T17:29:42.217Z" }, + { url = "https://files.pythonhosted.org/packages/63/fa/bfdc98abb4dd2bd491033e85e3ba69a2313c850e759a6daa014bc9433b0f/fonttools-4.61.1-cp310-cp310-win_amd64.whl", hash = "sha256:eff1ac3cc66c2ac7cda1e64b4e2f3ffef474b7335f92fc3833fc632d595fcee6", size = 1550654, upload-time = "2025-12-12T17:29:44.564Z" }, + { url = "https://files.pythonhosted.org/packages/69/12/bf9f4eaa2fad039356cc627587e30ed008c03f1cebd3034376b5ee8d1d44/fonttools-4.61.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:c6604b735bb12fef8e0efd5578c9fb5d3d8532d5001ea13a19cddf295673ee09", size = 2852213, upload-time = "2025-12-12T17:29:46.675Z" }, + { url = "https://files.pythonhosted.org/packages/ac/49/4138d1acb6261499bedde1c07f8c2605d1d8f9d77a151e5507fd3ef084b6/fonttools-4.61.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:5ce02f38a754f207f2f06557523cd39a06438ba3aafc0639c477ac409fc64e37", size = 2401689, upload-time = "2025-12-12T17:29:48.769Z" }, + { url = "https://files.pythonhosted.org/packages/e5/fe/e6ce0fe20a40e03aef906af60aa87668696f9e4802fa283627d0b5ed777f/fonttools-4.61.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:77efb033d8d7ff233385f30c62c7c79271c8885d5c9657d967ede124671bbdfb", size = 5058809, upload-time = "2025-12-12T17:29:51.701Z" }, + { url = "https://files.pythonhosted.org/packages/79/61/1ca198af22f7dd22c17ab86e9024ed3c06299cfdb08170640e9996d501a0/fonttools-4.61.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:75c1a6dfac6abd407634420c93864a1e274ebc1c7531346d9254c0d8f6ca00f9", size = 5036039, upload-time = "2025-12-12T17:29:53.659Z" }, + { url = "https://files.pythonhosted.org/packages/99/cc/fa1801e408586b5fce4da9f5455af8d770f4fc57391cd5da7256bb364d38/fonttools-4.61.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:0de30bfe7745c0d1ffa2b0b7048fb7123ad0d71107e10ee090fa0b16b9452e87", size = 5034714, upload-time = "2025-12-12T17:29:55.592Z" }, + { url = "https://files.pythonhosted.org/packages/bf/aa/b7aeafe65adb1b0a925f8f25725e09f078c635bc22754f3fecb7456955b0/fonttools-4.61.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:58b0ee0ab5b1fc9921eccfe11d1435added19d6494dde14e323f25ad2bc30c56", size = 5158648, upload-time = "2025-12-12T17:29:57.861Z" }, + { url = "https://files.pythonhosted.org/packages/99/f9/08ea7a38663328881384c6e7777bbefc46fd7d282adfd87a7d2b84ec9d50/fonttools-4.61.1-cp311-cp311-win32.whl", hash = "sha256:f79b168428351d11e10c5aeb61a74e1851ec221081299f4cf56036a95431c43a", size = 2280681, upload-time = "2025-12-12T17:29:59.943Z" }, + { url = "https://files.pythonhosted.org/packages/07/ad/37dd1ae5fa6e01612a1fbb954f0927681f282925a86e86198ccd7b15d515/fonttools-4.61.1-cp311-cp311-win_amd64.whl", hash = "sha256:fe2efccb324948a11dd09d22136fe2ac8a97d6c1347cf0b58a911dcd529f66b7", size = 2331951, upload-time = "2025-12-12T17:30:02.254Z" }, + { url = "https://files.pythonhosted.org/packages/6f/16/7decaa24a1bd3a70c607b2e29f0adc6159f36a7e40eaba59846414765fd4/fonttools-4.61.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:f3cb4a569029b9f291f88aafc927dd53683757e640081ca8c412781ea144565e", size = 2851593, upload-time = "2025-12-12T17:30:04.225Z" }, + { url = "https://files.pythonhosted.org/packages/94/98/3c4cb97c64713a8cf499b3245c3bf9a2b8fd16a3e375feff2aed78f96259/fonttools-4.61.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:41a7170d042e8c0024703ed13b71893519a1a6d6e18e933e3ec7507a2c26a4b2", size = 2400231, upload-time = "2025-12-12T17:30:06.47Z" }, + { url = "https://files.pythonhosted.org/packages/b7/37/82dbef0f6342eb01f54bca073ac1498433d6ce71e50c3c3282b655733b31/fonttools-4.61.1-cp312-cp312-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:10d88e55330e092940584774ee5e8a6971b01fc2f4d3466a1d6c158230880796", size = 4954103, upload-time = "2025-12-12T17:30:08.432Z" }, + { url = "https://files.pythonhosted.org/packages/6c/44/f3aeac0fa98e7ad527f479e161aca6c3a1e47bb6996b053d45226fe37bf2/fonttools-4.61.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:15acc09befd16a0fb8a8f62bc147e1a82817542d72184acca9ce6e0aeda9fa6d", size = 5004295, upload-time = "2025-12-12T17:30:10.56Z" }, + { url = "https://files.pythonhosted.org/packages/14/e8/7424ced75473983b964d09f6747fa09f054a6d656f60e9ac9324cf40c743/fonttools-4.61.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:e6bcdf33aec38d16508ce61fd81838f24c83c90a1d1b8c68982857038673d6b8", size = 4944109, upload-time = "2025-12-12T17:30:12.874Z" }, + { url = "https://files.pythonhosted.org/packages/c8/8b/6391b257fa3d0b553d73e778f953a2f0154292a7a7a085e2374b111e5410/fonttools-4.61.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:5fade934607a523614726119164ff621e8c30e8fa1ffffbbd358662056ba69f0", size = 5093598, upload-time = "2025-12-12T17:30:15.79Z" }, + { url = "https://files.pythonhosted.org/packages/d9/71/fd2ea96cdc512d92da5678a1c98c267ddd4d8c5130b76d0f7a80f9a9fde8/fonttools-4.61.1-cp312-cp312-win32.whl", hash = "sha256:75da8f28eff26defba42c52986de97b22106cb8f26515b7c22443ebc9c2d3261", size = 2269060, upload-time = "2025-12-12T17:30:18.058Z" }, + { url = "https://files.pythonhosted.org/packages/80/3b/a3e81b71aed5a688e89dfe0e2694b26b78c7d7f39a5ffd8a7d75f54a12a8/fonttools-4.61.1-cp312-cp312-win_amd64.whl", hash = "sha256:497c31ce314219888c0e2fce5ad9178ca83fe5230b01a5006726cdf3ac9f24d9", size = 2319078, upload-time = "2025-12-12T17:30:22.862Z" }, + { url = "https://files.pythonhosted.org/packages/4b/cf/00ba28b0990982530addb8dc3e9e6f2fa9cb5c20df2abdda7baa755e8fe1/fonttools-4.61.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:8c56c488ab471628ff3bfa80964372fc13504ece601e0d97a78ee74126b2045c", size = 2846454, upload-time = "2025-12-12T17:30:24.938Z" }, + { url = "https://files.pythonhosted.org/packages/5a/ca/468c9a8446a2103ae645d14fee3f610567b7042aba85031c1c65e3ef7471/fonttools-4.61.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:dc492779501fa723b04d0ab1f5be046797fee17d27700476edc7ee9ae535a61e", size = 2398191, upload-time = "2025-12-12T17:30:27.343Z" }, + { url = "https://files.pythonhosted.org/packages/a3/4b/d67eedaed19def5967fade3297fed8161b25ba94699efc124b14fb68cdbc/fonttools-4.61.1-cp313-cp313-manylinux1_x86_64.manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:64102ca87e84261419c3747a0d20f396eb024bdbeb04c2bfb37e2891f5fadcb5", size = 4928410, upload-time = "2025-12-12T17:30:29.771Z" }, + { url = "https://files.pythonhosted.org/packages/b0/8d/6fb3494dfe61a46258cd93d979cf4725ded4eb46c2a4ca35e4490d84daea/fonttools-4.61.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4c1b526c8d3f615a7b1867f38a9410849c8f4aef078535742198e942fba0e9bd", size = 4984460, upload-time = "2025-12-12T17:30:32.073Z" }, + { url = "https://files.pythonhosted.org/packages/f7/f1/a47f1d30b3dc00d75e7af762652d4cbc3dff5c2697a0dbd5203c81afd9c3/fonttools-4.61.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:41ed4b5ec103bd306bb68f81dc166e77409e5209443e5773cb4ed837bcc9b0d3", size = 4925800, upload-time = "2025-12-12T17:30:34.339Z" }, + { url = "https://files.pythonhosted.org/packages/a7/01/e6ae64a0981076e8a66906fab01539799546181e32a37a0257b77e4aa88b/fonttools-4.61.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:b501c862d4901792adaec7c25b1ecc749e2662543f68bb194c42ba18d6eec98d", size = 5067859, upload-time = "2025-12-12T17:30:36.593Z" }, + { url = "https://files.pythonhosted.org/packages/73/aa/28e40b8d6809a9b5075350a86779163f074d2b617c15d22343fce81918db/fonttools-4.61.1-cp313-cp313-win32.whl", hash = "sha256:4d7092bb38c53bbc78e9255a59158b150bcdc115a1e3b3ce0b5f267dc35dd63c", size = 2267821, upload-time = "2025-12-12T17:30:38.478Z" }, + { url = "https://files.pythonhosted.org/packages/1a/59/453c06d1d83dc0951b69ef692d6b9f1846680342927df54e9a1ca91c6f90/fonttools-4.61.1-cp313-cp313-win_amd64.whl", hash = "sha256:21e7c8d76f62ab13c9472ccf74515ca5b9a761d1bde3265152a6dc58700d895b", size = 2318169, upload-time = "2025-12-12T17:30:40.951Z" }, + { url = "https://files.pythonhosted.org/packages/c7/4e/ce75a57ff3aebf6fc1f4e9d508b8e5810618a33d900ad6c19eb30b290b97/fonttools-4.61.1-py3-none-any.whl", hash = "sha256:17d2bf5d541add43822bcf0c43d7d847b160c9bb01d15d5007d84e2217aaa371", size = 1148996, upload-time = "2025-12-12T17:31:21.03Z" }, ] [[package]] @@ -771,11 +764,11 @@ wheels = [ [[package]] name = "fsspec" -version = "2025.9.0" +version = "2025.12.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/de/e0/bab50af11c2d75c9c4a2a26a5254573c0bd97cea152254401510950486fa/fsspec-2025.9.0.tar.gz", hash = "sha256:19fd429483d25d28b65ec68f9f4adc16c17ea2c7c7bf54ec61360d478fb19c19", size = 304847, upload-time = "2025-09-02T19:10:49.215Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b6/27/954057b0d1f53f086f681755207dda6de6c660ce133c829158e8e8fe7895/fsspec-2025.12.0.tar.gz", hash = "sha256:c505de011584597b1060ff778bb664c1bc022e87921b0e4f10cc9c44f9635973", size = 309748, upload-time = "2025-12-03T15:23:42.687Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/47/71/70db47e4f6ce3e5c37a607355f80da8860a33226be640226ac52cb05ef2e/fsspec-2025.9.0-py3-none-any.whl", hash = "sha256:530dc2a2af60a414a832059574df4a6e10cce927f6f4a78209390fe38955cfb7", size = 199289, upload-time = "2025-09-02T19:10:47.708Z" }, + { url = "https://files.pythonhosted.org/packages/51/c7/b64cae5dba3a1b138d7123ec36bb5ccd39d39939f18454407e5468f4763f/fsspec-2025.12.0-py3-none-any.whl", hash = "sha256:8bf1fe301b7d8acfa6e8571e3b1c3d158f909666642431cc78a1b7b4dbc5ec5b", size = 201422, upload-time = "2025-12-03T15:23:41.434Z" }, ] [[package]] @@ -789,17 +782,24 @@ wheels = [ [[package]] name = "hf-xet" -version = "1.1.10" +version = "1.2.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/74/31/feeddfce1748c4a233ec1aa5b7396161c07ae1aa9b7bdbc9a72c3c7dd768/hf_xet-1.1.10.tar.gz", hash = "sha256:408aef343800a2102374a883f283ff29068055c111f003ff840733d3b715bb97", size = 487910, upload-time = "2025-09-12T20:10:27.12Z" } +sdist = { url = "https://files.pythonhosted.org/packages/5e/6e/0f11bacf08a67f7fb5ee09740f2ca54163863b07b70d579356e9222ce5d8/hf_xet-1.2.0.tar.gz", hash = "sha256:a8c27070ca547293b6890c4bf389f713f80e8c478631432962bb7f4bc0bd7d7f", size = 506020, upload-time = "2025-10-24T19:04:32.129Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f7/a2/343e6d05de96908366bdc0081f2d8607d61200be2ac802769c4284cc65bd/hf_xet-1.1.10-cp37-abi3-macosx_10_12_x86_64.whl", hash = "sha256:686083aca1a6669bc85c21c0563551cbcdaa5cf7876a91f3d074a030b577231d", size = 2761466, upload-time = "2025-09-12T20:10:22.836Z" }, - { url = "https://files.pythonhosted.org/packages/31/f9/6215f948ac8f17566ee27af6430ea72045e0418ce757260248b483f4183b/hf_xet-1.1.10-cp37-abi3-macosx_11_0_arm64.whl", hash = "sha256:71081925383b66b24eedff3013f8e6bbd41215c3338be4b94ba75fd75b21513b", size = 2623807, upload-time = "2025-09-12T20:10:21.118Z" }, - { url = "https://files.pythonhosted.org/packages/15/07/86397573efefff941e100367bbda0b21496ffcdb34db7ab51912994c32a2/hf_xet-1.1.10-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6b6bceb6361c80c1cc42b5a7b4e3efd90e64630bcf11224dcac50ef30a47e435", size = 3186960, upload-time = "2025-09-12T20:10:19.336Z" }, - { url = "https://files.pythonhosted.org/packages/01/a7/0b2e242b918cc30e1f91980f3c4b026ff2eedaf1e2ad96933bca164b2869/hf_xet-1.1.10-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:eae7c1fc8a664e54753ffc235e11427ca61f4b0477d757cc4eb9ae374b69f09c", size = 3087167, upload-time = "2025-09-12T20:10:17.255Z" }, - { url = "https://files.pythonhosted.org/packages/4a/25/3e32ab61cc7145b11eee9d745988e2f0f4fafda81b25980eebf97d8cff15/hf_xet-1.1.10-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:0a0005fd08f002180f7a12d4e13b22be277725bc23ed0529f8add5c7a6309c06", size = 3248612, upload-time = "2025-09-12T20:10:24.093Z" }, - { url = "https://files.pythonhosted.org/packages/2c/3d/ab7109e607ed321afaa690f557a9ada6d6d164ec852fd6bf9979665dc3d6/hf_xet-1.1.10-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:f900481cf6e362a6c549c61ff77468bd59d6dd082f3170a36acfef2eb6a6793f", size = 3353360, upload-time = "2025-09-12T20:10:25.563Z" }, - { url = "https://files.pythonhosted.org/packages/ee/0e/471f0a21db36e71a2f1752767ad77e92d8cde24e974e03d662931b1305ec/hf_xet-1.1.10-cp37-abi3-win_amd64.whl", hash = "sha256:5f54b19cc347c13235ae7ee98b330c26dd65ef1df47e5316ffb1e87713ca7045", size = 2804691, upload-time = "2025-09-12T20:10:28.433Z" }, + { url = "https://files.pythonhosted.org/packages/9e/a5/85ef910a0aa034a2abcfadc360ab5ac6f6bc4e9112349bd40ca97551cff0/hf_xet-1.2.0-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:ceeefcd1b7aed4956ae8499e2199607765fbd1c60510752003b6cc0b8413b649", size = 2861870, upload-time = "2025-10-24T19:04:11.422Z" }, + { url = "https://files.pythonhosted.org/packages/ea/40/e2e0a7eb9a51fe8828ba2d47fe22a7e74914ea8a0db68a18c3aa7449c767/hf_xet-1.2.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:b70218dd548e9840224df5638fdc94bd033552963cfa97f9170829381179c813", size = 2717584, upload-time = "2025-10-24T19:04:09.586Z" }, + { url = "https://files.pythonhosted.org/packages/a5/7d/daf7f8bc4594fdd59a8a596f9e3886133fdc68e675292218a5e4c1b7e834/hf_xet-1.2.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:7d40b18769bb9a8bc82a9ede575ce1a44c75eb80e7375a01d76259089529b5dc", size = 3315004, upload-time = "2025-10-24T19:04:00.314Z" }, + { url = "https://files.pythonhosted.org/packages/b1/ba/45ea2f605fbf6d81c8b21e4d970b168b18a53515923010c312c06cd83164/hf_xet-1.2.0-cp313-cp313t-manylinux_2_28_aarch64.whl", hash = "sha256:cd3a6027d59cfb60177c12d6424e31f4b5ff13d8e3a1247b3a584bf8977e6df5", size = 3222636, upload-time = "2025-10-24T19:03:58.111Z" }, + { url = "https://files.pythonhosted.org/packages/4a/1d/04513e3cab8f29ab8c109d309ddd21a2705afab9d52f2ba1151e0c14f086/hf_xet-1.2.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:6de1fc44f58f6dd937956c8d304d8c2dea264c80680bcfa61ca4a15e7b76780f", size = 3408448, upload-time = "2025-10-24T19:04:20.951Z" }, + { url = "https://files.pythonhosted.org/packages/f0/7c/60a2756d7feec7387db3a1176c632357632fbe7849fce576c5559d4520c7/hf_xet-1.2.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:f182f264ed2acd566c514e45da9f2119110e48a87a327ca271027904c70c5832", size = 3503401, upload-time = "2025-10-24T19:04:22.549Z" }, + { url = "https://files.pythonhosted.org/packages/4e/64/48fffbd67fb418ab07451e4ce641a70de1c40c10a13e25325e24858ebe5a/hf_xet-1.2.0-cp313-cp313t-win_amd64.whl", hash = "sha256:293a7a3787e5c95d7be1857358a9130694a9c6021de3f27fa233f37267174382", size = 2900866, upload-time = "2025-10-24T19:04:33.461Z" }, + { url = "https://files.pythonhosted.org/packages/96/2d/22338486473df5923a9ab7107d375dbef9173c338ebef5098ef593d2b560/hf_xet-1.2.0-cp37-abi3-macosx_10_12_x86_64.whl", hash = "sha256:46740d4ac024a7ca9b22bebf77460ff43332868b661186a8e46c227fdae01848", size = 2866099, upload-time = "2025-10-24T19:04:15.366Z" }, + { url = "https://files.pythonhosted.org/packages/7f/8c/c5becfa53234299bc2210ba314eaaae36c2875e0045809b82e40a9544f0c/hf_xet-1.2.0-cp37-abi3-macosx_11_0_arm64.whl", hash = "sha256:27df617a076420d8845bea087f59303da8be17ed7ec0cd7ee3b9b9f579dff0e4", size = 2722178, upload-time = "2025-10-24T19:04:13.695Z" }, + { url = "https://files.pythonhosted.org/packages/9a/92/cf3ab0b652b082e66876d08da57fcc6fa2f0e6c70dfbbafbd470bb73eb47/hf_xet-1.2.0-cp37-abi3-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3651fd5bfe0281951b988c0facbe726aa5e347b103a675f49a3fa8144c7968fd", size = 3320214, upload-time = "2025-10-24T19:04:03.596Z" }, + { url = "https://files.pythonhosted.org/packages/46/92/3f7ec4a1b6a65bf45b059b6d4a5d38988f63e193056de2f420137e3c3244/hf_xet-1.2.0-cp37-abi3-manylinux_2_28_aarch64.whl", hash = "sha256:d06fa97c8562fb3ee7a378dd9b51e343bc5bc8190254202c9771029152f5e08c", size = 3229054, upload-time = "2025-10-24T19:04:01.949Z" }, + { url = "https://files.pythonhosted.org/packages/0b/dd/7ac658d54b9fb7999a0ccb07ad863b413cbaf5cf172f48ebcd9497ec7263/hf_xet-1.2.0-cp37-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:4c1428c9ae73ec0939410ec73023c4f842927f39db09b063b9482dac5a3bb737", size = 3413812, upload-time = "2025-10-24T19:04:24.585Z" }, + { url = "https://files.pythonhosted.org/packages/92/68/89ac4e5b12a9ff6286a12174c8538a5930e2ed662091dd2572bbe0a18c8a/hf_xet-1.2.0-cp37-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:a55558084c16b09b5ed32ab9ed38421e2d87cf3f1f89815764d1177081b99865", size = 3508920, upload-time = "2025-10-24T19:04:26.927Z" }, + { url = "https://files.pythonhosted.org/packages/cb/44/870d44b30e1dcfb6a65932e3e1506c103a8a5aea9103c337e7a53180322c/hf_xet-1.2.0-cp37-abi3-win_amd64.whl", hash = "sha256:e6584a52253f72c9f52f9e549d5895ca7a471608495c4ecaa6cc73dba2b24d69", size = 2905735, upload-time = "2025-10-24T19:04:35.928Z" }, ] [[package]] @@ -832,7 +832,7 @@ wheels = [ [[package]] name = "huggingface-hub" -version = "0.35.1" +version = "0.36.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "filelock" }, @@ -844,27 +844,27 @@ dependencies = [ { name = "tqdm" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/f6/42/0e7be334a6851cd7d51cc11717cb95e89333ebf0064431c0255c56957526/huggingface_hub-0.35.1.tar.gz", hash = "sha256:3585b88c5169c64b7e4214d0e88163d4a709de6d1a502e0cd0459e9ee2c9c572", size = 461374, upload-time = "2025-09-23T13:43:47.074Z" } +sdist = { url = "https://files.pythonhosted.org/packages/98/63/4910c5fa9128fdadf6a9c5ac138e8b1b6cee4ca44bf7915bbfbce4e355ee/huggingface_hub-0.36.0.tar.gz", hash = "sha256:47b3f0e2539c39bf5cde015d63b72ec49baff67b6931c3d97f3f84532e2b8d25", size = 463358, upload-time = "2025-10-23T12:12:01.413Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f1/60/4acf0c8a3925d9ff491dc08fe84d37e09cfca9c3b885e0db3d4dedb98cea/huggingface_hub-0.35.1-py3-none-any.whl", hash = "sha256:2f0e2709c711e3040e31d3e0418341f7092910f1462dd00350c4e97af47280a8", size = 563340, upload-time = "2025-09-23T13:43:45.343Z" }, + { url = "https://files.pythonhosted.org/packages/cb/bd/1a875e0d592d447cbc02805fd3fe0f497714d6a2583f59d14fa9ebad96eb/huggingface_hub-0.36.0-py3-none-any.whl", hash = "sha256:7bcc9ad17d5b3f07b57c78e79d527102d08313caa278a641993acddcb894548d", size = 566094, upload-time = "2025-10-23T12:11:59.557Z" }, ] [[package]] name = "identify" -version = "2.6.14" +version = "2.6.15" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/52/c4/62963f25a678f6a050fb0505a65e9e726996171e6dbe1547f79619eefb15/identify-2.6.14.tar.gz", hash = "sha256:663494103b4f717cb26921c52f8751363dc89db64364cd836a9bf1535f53cd6a", size = 99283, upload-time = "2025-09-06T19:30:52.938Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ff/e7/685de97986c916a6d93b3876139e00eef26ad5bbbd61925d670ae8013449/identify-2.6.15.tar.gz", hash = "sha256:e4f4864b96c6557ef2a1e1c951771838f4edc9df3a72ec7118b338801b11c7bf", size = 99311, upload-time = "2025-10-02T17:43:40.631Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/ae/2ad30f4652712c82f1c23423d79136fbce338932ad166d70c1efb86a5998/identify-2.6.14-py2.py3-none-any.whl", hash = "sha256:11a073da82212c6646b1f39bb20d4483bfb9543bd5566fec60053c4bb309bf2e", size = 99172, upload-time = "2025-09-06T19:30:51.759Z" }, + { url = "https://files.pythonhosted.org/packages/0f/1c/e5fd8f973d4f375adb21565739498e2e9a1e54c858a97b9a8ccfdc81da9b/identify-2.6.15-py2.py3-none-any.whl", hash = "sha256:1181ef7608e00704db228516541eb83a88a9f94433a8c80bb9b5bd54b1d81757", size = 99183, upload-time = "2025-10-02T17:43:39.137Z" }, ] [[package]] name = "idna" -version = "3.10" +version = "3.11" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f1/70/7703c29685631f5a7590aa73f1f1d3fa9a380e654b86af429e0934a32f7d/idna-3.10.tar.gz", hash = "sha256:12f65c9b470abda6dc35cf8e63cc574b1c52b11df2c86030af0ac09b01b13ea9", size = 190490, upload-time = "2024-09-15T18:07:39.745Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/0703ccc57f3a7233505399edb88de3cbd678da106337b9fcde432b65ed60/idna-3.11.tar.gz", hash = "sha256:795dafcc9c04ed0c1fb032c2aa73654d8e8c5023a7df64a53f39190ada629902", size = 194582, upload-time = "2025-10-12T14:55:20.501Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/76/c6/c88e154df9c4e1a2a66ccf0005a88dfb2650c1dffb6f5ce603dfbd452ce3/idna-3.10-py3-none-any.whl", hash = "sha256:946d195a0d259cbba61165e88e65941f16e9b36ea6ddb97f00452bae8b1287d3", size = 70442, upload-time = "2024-09-15T18:07:37.964Z" }, + { url = "https://files.pythonhosted.org/packages/0e/61/66938bbb5fc52dbdf84594873d5b51fb1f7c7794e9c0f5bd885f30bc507b/idna-3.11-py3-none-any.whl", hash = "sha256:771a87f49d9defaf64091e6e6fe9c18d4833f140bd19464795bc32d966ca37ea", size = 71008, upload-time = "2025-10-12T14:55:18.883Z" }, ] [[package]] @@ -878,23 +878,23 @@ wheels = [ [[package]] name = "iniconfig" -version = "2.1.0" +version = "2.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f2/97/ebf4da567aa6827c909642694d71c9fcf53e5b504f2d96afea02718862f3/iniconfig-2.1.0.tar.gz", hash = "sha256:3abbd2e30b36733fee78f9c7f7308f2d0050e88f0087fd25c2645f63c773e1c7", size = 4793, upload-time = "2025-03-19T20:09:59.721Z" } +sdist = { url = "https://files.pythonhosted.org/packages/72/34/14ca021ce8e5dfedc35312d08ba8bf51fdd999c576889fc2c24cb97f4f10/iniconfig-2.3.0.tar.gz", hash = "sha256:c76315c77db068650d49c5b56314774a7804df16fee4402c1f19d6d15d8c4730", size = 20503, upload-time = "2025-10-18T21:55:43.219Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2c/e1/e6716421ea10d38022b952c159d5161ca1193197fb744506875fbb87ea7b/iniconfig-2.1.0-py3-none-any.whl", hash = "sha256:9deba5723312380e77435581c6bf4935c94cbfab9b1ed33ef8d238ea168eb760", size = 6050, upload-time = "2025-03-19T20:10:01.071Z" }, + { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484, upload-time = "2025-10-18T21:55:41.639Z" }, ] [[package]] name = "ipykernel" -version = "6.30.1" +version = "7.1.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "appnope", marker = "sys_platform == 'darwin'" }, { name = "comm" }, { name = "debugpy" }, { name = "ipython", version = "8.37.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "ipython", version = "9.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "ipython", version = "9.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "jupyter-client" }, { name = "jupyter-core" }, { name = "matplotlib-inline" }, @@ -905,9 +905,9 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/bb/76/11082e338e0daadc89c8ff866185de11daf67d181901038f9e139d109761/ipykernel-6.30.1.tar.gz", hash = "sha256:6abb270161896402e76b91394fcdce5d1be5d45f456671e5080572f8505be39b", size = 166260, upload-time = "2025-08-04T15:47:35.018Z" } +sdist = { url = "https://files.pythonhosted.org/packages/b9/a4/4948be6eb88628505b83a1f2f40d90254cab66abf2043b3c40fa07dfce0f/ipykernel-7.1.0.tar.gz", hash = "sha256:58a3fc88533d5930c3546dc7eac66c6d288acde4f801e2001e65edc5dc9cf0db", size = 174579, upload-time = "2025-10-27T09:46:39.471Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/fc/c7/b445faca8deb954fe536abebff4ece5b097b923de482b26e78448c89d1dd/ipykernel-6.30.1-py3-none-any.whl", hash = "sha256:aa6b9fb93dca949069d8b85b6c79b2518e32ac583ae9c7d37c51d119e18b3fb4", size = 117484, upload-time = "2025-08-04T15:47:32.622Z" }, + { url = "https://files.pythonhosted.org/packages/a3/17/20c2552266728ceba271967b87919664ecc0e33efca29c3efc6baf88c5f9/ipykernel-7.1.0-py3-none-any.whl", hash = "sha256:763b5ec6c5b7776f6a8d7ce09b267693b4e5ce75cb50ae696aaefb3c85e1ea4c", size = 117968, upload-time = "2025-10-27T09:46:37.805Z" }, ] [[package]] @@ -937,7 +937,7 @@ wheels = [ [[package]] name = "ipython" -version = "9.5.0" +version = "9.8.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.12'", @@ -956,9 +956,9 @@ dependencies = [ { name = "traitlets", marker = "python_full_version >= '3.11'" }, { name = "typing-extensions", marker = "python_full_version == '3.11.*'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/6e/71/a86262bf5a68bf211bcc71fe302af7e05f18a2852fdc610a854d20d085e6/ipython-9.5.0.tar.gz", hash = "sha256:129c44b941fe6d9b82d36fc7a7c18127ddb1d6f02f78f867f402e2e3adde3113", size = 4389137, upload-time = "2025-08-29T12:15:21.519Z" } +sdist = { url = "https://files.pythonhosted.org/packages/12/51/a703c030f4928646d390b4971af4938a1b10c9dfce694f0d99a0bb073cb2/ipython-9.8.0.tar.gz", hash = "sha256:8e4ce129a627eb9dd221c41b1d2cdaed4ef7c9da8c17c63f6f578fe231141f83", size = 4424940, upload-time = "2025-12-03T10:18:24.353Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/08/2a/5628a99d04acb2d2f2e749cdf4ea571d2575e898df0528a090948018b726/ipython-9.5.0-py3-none-any.whl", hash = "sha256:88369ffa1d5817d609120daa523a6da06d02518e582347c29f8451732a9c5e72", size = 612426, upload-time = "2025-08-29T12:15:18.866Z" }, + { url = "https://files.pythonhosted.org/packages/f1/df/8ee1c5dd1e3308b5d5b2f2dfea323bb2f3827da8d654abb6642051199049/ipython-9.8.0-py3-none-any.whl", hash = "sha256:ebe6d1d58d7d988fbf23ff8ff6d8e1622cfdb194daf4b7b73b792c4ec3b85385", size = 621374, upload-time = "2025-12-03T10:18:22.335Z" }, ] [[package]] @@ -975,19 +975,19 @@ wheels = [ [[package]] name = "ipywidgets" -version = "8.1.7" +version = "8.1.8" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "comm" }, { name = "ipython", version = "8.37.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "ipython", version = "9.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "ipython", version = "9.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "jupyterlab-widgets" }, { name = "traitlets" }, { name = "widgetsnbextension" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/3e/48/d3dbac45c2814cb73812f98dd6b38bbcc957a4e7bb31d6ea9c03bf94ed87/ipywidgets-8.1.7.tar.gz", hash = "sha256:15f1ac050b9ccbefd45dccfbb2ef6bed0029d8278682d569d71b8dd96bee0376", size = 116721, upload-time = "2025-05-05T12:42:03.489Z" } +sdist = { url = "https://files.pythonhosted.org/packages/4c/ae/c5ce1edc1afe042eadb445e95b0671b03cee61895264357956e61c0d2ac0/ipywidgets-8.1.8.tar.gz", hash = "sha256:61f969306b95f85fba6b6986b7fe45d73124d1d9e3023a8068710d47a22ea668", size = 116739, upload-time = "2025-11-01T21:18:12.393Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/58/6a/9166369a2f092bd286d24e6307de555d63616e8ddb373ebad2b5635ca4cd/ipywidgets-8.1.7-py3-none-any.whl", hash = "sha256:764f2602d25471c213919b8a1997df04bef869251db4ca8efba1b76b1bd9f7bb", size = 139806, upload-time = "2025-05-05T12:41:56.833Z" }, + { url = "https://files.pythonhosted.org/packages/56/6d/0d9848617b9f753b87f214f1c682592f7ca42de085f564352f10f0843026/ipywidgets-8.1.8-py3-none-any.whl", hash = "sha256:ecaca67aed704a338f88f67b1181b58f821ab5dc89c1f0f5ef99db43c1c2921e", size = 139808, upload-time = "2025-11-01T21:18:10.956Z" }, ] [[package]] @@ -1028,11 +1028,11 @@ wheels = [ [[package]] name = "joblib" -version = "1.5.2" +version = "1.5.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e8/5d/447af5ea094b9e4c4054f82e223ada074c552335b9b4b2d14bd9b35a67c4/joblib-1.5.2.tar.gz", hash = "sha256:3faa5c39054b2f03ca547da9b2f52fde67c06240c31853f306aea97f13647b55", size = 331077, upload-time = "2025-08-27T12:15:46.575Z" } +sdist = { url = "https://files.pythonhosted.org/packages/41/f2/d34e8b3a08a9cc79a50b2208a93dce981fe615b64d5a4d4abee421d898df/joblib-1.5.3.tar.gz", hash = "sha256:8561a3269e6801106863fd0d6d84bb737be9e7631e33aaed3fb9ce5953688da3", size = 331603, upload-time = "2025-12-15T08:41:46.427Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/1e/e8/685f47e0d754320684db4425a0967f7d3fa70126bffd76110b7009a0090f/joblib-1.5.2-py3-none-any.whl", hash = "sha256:4e1f0bdbb987e6d843c70cf43714cb276623def372df3c22fe5266b2670bc241", size = 308396, upload-time = "2025-08-27T12:15:45.188Z" }, + { url = "https://files.pythonhosted.org/packages/7b/91/984aca2ec129e2757d1e4e3c81c3fcda9d0f85b74670a094cc443d9ee949/joblib-1.5.3-py3-none-any.whl", hash = "sha256:5fc3c5039fc5ca8c0276333a188bbd59d6b7ab37fe6632daa76bc7f9ec18e713", size = 309071, upload-time = "2025-12-15T08:41:44.973Z" }, ] [[package]] @@ -1112,7 +1112,7 @@ wheels = [ [[package]] name = "jupyter-client" -version = "8.6.3" +version = "8.7.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jupyter-core" }, @@ -1121,9 +1121,9 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/71/22/bf9f12fdaeae18019a468b68952a60fe6dbab5d67cd2a103cac7659b41ca/jupyter_client-8.6.3.tar.gz", hash = "sha256:35b3a0947c4a6e9d589eb97d7d4cd5e90f910ee73101611f01283732bd6d9419", size = 342019, upload-time = "2024-09-17T10:44:17.613Z" } +sdist = { url = "https://files.pythonhosted.org/packages/a6/27/d10de45e8ad4ce872372c4a3a37b7b35b6b064f6f023a5c14ffcced4d59d/jupyter_client-8.7.0.tar.gz", hash = "sha256:3357212d9cbe01209e59190f67a3a7e1f387a4f4e88d1e0433ad84d7b262531d", size = 344691, upload-time = "2025-12-09T18:37:01.953Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/11/85/b0394e0b6fcccd2c1eeefc230978a6f8cb0c5df1e4cd3e7625735a0d7d1e/jupyter_client-8.6.3-py3-none-any.whl", hash = "sha256:e8a19cc986cc45905ac3362915f410f3af85424b4c0905e94fa5f2cb08e8f23f", size = 106105, upload-time = "2024-09-17T10:44:15.218Z" }, + { url = "https://files.pythonhosted.org/packages/bb/f5/fddaec430367be9d62a7ed125530e133bfd4a1c0350fe221149ee0f2b526/jupyter_client-8.7.0-py3-none-any.whl", hash = "sha256:3671a94fd25e62f5f2f554f5e95389c2294d89822378a5f2dd24353e1494a9e0", size = 106215, upload-time = "2025-12-09T18:37:00.024Z" }, ] [[package]] @@ -1133,7 +1133,7 @@ source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "ipykernel" }, { name = "ipython", version = "8.37.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "ipython", version = "9.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "ipython", version = "9.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "jupyter-client" }, { name = "jupyter-core" }, { name = "prompt-toolkit" }, @@ -1148,16 +1148,15 @@ wheels = [ [[package]] name = "jupyter-core" -version = "5.8.1" +version = "5.9.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "platformdirs" }, - { name = "pywin32", marker = "platform_python_implementation != 'PyPy' and sys_platform == 'win32'" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/99/1b/72906d554acfeb588332eaaa6f61577705e9ec752ddb486f302dafa292d9/jupyter_core-5.8.1.tar.gz", hash = "sha256:0a5f9706f70e64786b75acba995988915ebd4601c8a52e534a40b51c95f59941", size = 88923, upload-time = "2025-05-27T07:38:16.655Z" } +sdist = { url = "https://files.pythonhosted.org/packages/02/49/9d1284d0dc65e2c757b74c6687b6d319b02f822ad039e5c512df9194d9dd/jupyter_core-5.9.1.tar.gz", hash = "sha256:4d09aaff303b9566c3ce657f580bd089ff5c91f5f89cf7d8846c3cdf465b5508", size = 89814, upload-time = "2025-10-16T19:19:18.444Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2f/57/6bffd4b20b88da3800c5d691e0337761576ee688eb01299eae865689d2df/jupyter_core-5.8.1-py3-none-any.whl", hash = "sha256:c28d268fc90fb53f1338ded2eb410704c5449a358406e8a948b75706e24863d0", size = 28880, upload-time = "2025-05-27T07:38:15.137Z" }, + { url = "https://files.pythonhosted.org/packages/e7/e7/80988e32bf6f73919a113473a604f5a8f09094de312b9d52b79c2df7612b/jupyter_core-5.9.1-py3-none-any.whl", hash = "sha256:ebf87fdc6073d142e114c72c9e29a9d7ca03fad818c5d300ce2adc1fb0743407", size = 29032, upload-time = "2025-10-16T19:19:16.783Z" }, ] [[package]] @@ -1236,7 +1235,7 @@ wheels = [ [[package]] name = "jupyterlab" -version = "4.4.7" +version = "4.5.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "async-lru" }, @@ -1254,9 +1253,9 @@ dependencies = [ { name = "tornado" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/d0/07/b3beaeb5722d4a55e345a38884c67baebd9cec2269c5309ce494485a5858/jupyterlab-4.4.7.tar.gz", hash = "sha256:8c8e225492f4513ebde9bbbc00a05b651ab9a1f5b0013015d96fabf671c37188", size = 22965570, upload-time = "2025-09-03T13:26:40.461Z" } +sdist = { url = "https://files.pythonhosted.org/packages/09/21/413d142686a4e8f4268d985becbdb4daf060524726248e73be4773786987/jupyterlab-4.5.1.tar.gz", hash = "sha256:09da1ddfbd9eec18b5101dbb8515612aa1e47443321fb99503725a88e93d20d9", size = 23992251, upload-time = "2025-12-15T16:58:59.361Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/7e/01/44f35124896dd5c73b26705c25bb8af2089895b32f057a1e4a3488847333/jupyterlab-4.4.7-py3-none-any.whl", hash = "sha256:808bae6136b507a4d18f04254218bfe71ed8ba399a36ef3280d5f259e69abf80", size = 12291583, upload-time = "2025-09-03T13:26:35.862Z" }, + { url = "https://files.pythonhosted.org/packages/af/c3/acced767eecc11a70c65c45295db5396c4f0c1937874937d5a76d7b177b6/jupyterlab-4.5.1-py3-none-any.whl", hash = "sha256:31b059de96de0754ff1f2ce6279774b6aab8c34d7082e9752db58207c99bd514", size = 12384821, upload-time = "2025-12-15T16:58:55.563Z" }, ] [[package]] @@ -1270,7 +1269,7 @@ wheels = [ [[package]] name = "jupyterlab-server" -version = "2.27.3" +version = "2.28.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "babel" }, @@ -1281,18 +1280,18 @@ dependencies = [ { name = "packaging" }, { name = "requests" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/0a/c9/a883ce65eb27905ce77ace410d83587c82ea64dc85a48d1f7ed52bcfa68d/jupyterlab_server-2.27.3.tar.gz", hash = "sha256:eb36caca59e74471988f0ae25c77945610b887f777255aa21f8065def9e51ed4", size = 76173, upload-time = "2024-07-16T17:02:04.149Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d6/2c/90153f189e421e93c4bb4f9e3f59802a1f01abd2ac5cf40b152d7f735232/jupyterlab_server-2.28.0.tar.gz", hash = "sha256:35baa81898b15f93573e2deca50d11ac0ae407ebb688299d3a5213265033712c", size = 76996, upload-time = "2025-10-22T13:59:18.37Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/54/09/2032e7d15c544a0e3cd831c51d77a8ca57f7555b2e1b2922142eddb02a84/jupyterlab_server-2.27.3-py3-none-any.whl", hash = "sha256:e697488f66c3db49df675158a77b3b017520d772c6e1548c7d9bcc5df7944ee4", size = 59700, upload-time = "2024-07-16T17:02:01.115Z" }, + { url = "https://files.pythonhosted.org/packages/e0/07/a000fe835f76b7e1143242ab1122e6362ef1c03f23f83a045c38859c2ae0/jupyterlab_server-2.28.0-py3-none-any.whl", hash = "sha256:e4355b148fdcf34d312bbbc80f22467d6d20460e8b8736bf235577dd18506968", size = 59830, upload-time = "2025-10-22T13:59:16.767Z" }, ] [[package]] name = "jupyterlab-widgets" -version = "3.0.15" +version = "3.0.16" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b9/7d/160595ca88ee87ac6ba95d82177d29ec60aaa63821d3077babb22ce031a5/jupyterlab_widgets-3.0.15.tar.gz", hash = "sha256:2920888a0c2922351a9202817957a68c07d99673504d6cd37345299e971bb08b", size = 213149, upload-time = "2025-05-05T12:32:31.004Z" } +sdist = { url = "https://files.pythonhosted.org/packages/26/2d/ef58fed122b268c69c0aa099da20bc67657cdfb2e222688d5731bd5b971d/jupyterlab_widgets-3.0.16.tar.gz", hash = "sha256:423da05071d55cf27a9e602216d35a3a65a3e41cdf9c5d3b643b814ce38c19e0", size = 897423, upload-time = "2025-11-01T21:11:29.724Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/43/6a/ca128561b22b60bd5a0c4ea26649e68c8556b82bc70a0c396eebc977fe86/jupyterlab_widgets-3.0.15-py3-none-any.whl", hash = "sha256:d59023d7d7ef71400d51e6fee9a88867f6e65e10a4201605d2d7f3e8f012a31c", size = 216571, upload-time = "2025-05-05T12:32:29.534Z" }, + { url = "https://files.pythonhosted.org/packages/ab/b5/36c712098e6191d1b4e349304ef73a8d06aed77e56ceaac8c0a306c7bda1/jupyterlab_widgets-3.0.16-py3-none-any.whl", hash = "sha256:45fa36d9c6422cf2559198e4db481aa243c7a32d9926b500781c830c80f7ecf8", size = 914926, upload-time = "2025-11-01T21:11:28.008Z" }, ] [[package]] @@ -1379,23 +1378,62 @@ wheels = [ [[package]] name = "lark" -version = "1.3.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/1d/37/a13baf0135f348af608c667633cbe5d13aa2c5c15a56ae9ad3e6cba45ae3/lark-1.3.0.tar.gz", hash = "sha256:9a3839d0ca5e1faf7cfa3460e420e859b66bcbde05b634e73c369c8244c5fa48", size = 259551, upload-time = "2025-09-22T13:45:05.072Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/a8/3e/1c6b43277de64fc3c0333b0e72ab7b52ddaaea205210d60d9b9f83c3d0c7/lark-1.3.0-py3-none-any.whl", hash = "sha256:80661f261fb2584a9828a097a2432efd575af27d20be0fd35d17f0fe37253831", size = 113002, upload-time = "2025-09-22T13:45:03.747Z" }, -] - -[[package]] -name = "license-expression" -version = "30.4.4" +version = "1.3.1" source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "boolean-py" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/40/71/d89bb0e71b1415453980fd32315f2a037aad9f7f70f695c7cec7035feb13/license_expression-30.4.4.tar.gz", hash = "sha256:73448f0aacd8d0808895bdc4b2c8e01a8d67646e4188f887375398c761f340fd", size = 186402, upload-time = "2025-07-22T11:13:32.17Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/af/40/791891d4c0c4dab4c5e187c17261cedc26285fd41541577f900470a45a4d/license_expression-30.4.4-py3-none-any.whl", hash = "sha256:421788fdcadb41f049d2dc934ce666626265aeccefddd25e162a26f23bcbf8a4", size = 120615, upload-time = "2025-07-22T11:13:31.217Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/da/34/28fff3ab31ccff1fd4f6c7c7b0ceb2b6968d8ea4950663eadcb5720591a0/lark-1.3.1.tar.gz", hash = "sha256:b426a7a6d6d53189d318f2b6236ab5d6429eaf09259f1ca33eb716eed10d2905", size = 382732, upload-time = "2025-10-27T18:25:56.653Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/82/3d/14ce75ef66813643812f3093ab17e46d3a206942ce7376d31ec2d36229e7/lark-1.3.1-py3-none-any.whl", hash = "sha256:c629b661023a014c37da873b4ff58a817398d12635d3bbb2c5a03be7fe5d1e12", size = 113151, upload-time = "2025-10-27T18:25:54.882Z" }, +] + +[[package]] +name = "librt" +version = "0.7.4" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/93/e4/b59bdf1197fdf9888452ea4d2048cdad61aef85eb83e99dc52551d7fdc04/librt-0.7.4.tar.gz", hash = "sha256:3871af56c59864d5fd21d1ac001eb2fb3b140d52ba0454720f2e4a19812404ba", size = 145862, upload-time = "2025-12-15T16:52:43.862Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/06/1e/3e61dff6c07a3b400fe907d3164b92b3b3023ef86eac1ee236869dc276f7/librt-0.7.4-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:dc300cb5a5a01947b1ee8099233156fdccd5001739e5f596ecfbc0dab07b5a3b", size = 54708, upload-time = "2025-12-15T16:51:03.752Z" }, + { url = "https://files.pythonhosted.org/packages/87/98/ab2428b0a80d0fd67decaeea84a5ec920e3dd4d95ecfd074c71f51bd7315/librt-0.7.4-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ee8d3323d921e0f6919918a97f9b5445a7dfe647270b2629ec1008aa676c0bc0", size = 56656, upload-time = "2025-12-15T16:51:05.038Z" }, + { url = "https://files.pythonhosted.org/packages/c1/ce/de1fad3a16e4fb5b6605bd6cbe6d0e5207cc8eca58993835749a1da0812b/librt-0.7.4-cp310-cp310-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:95cb80854a355b284c55f79674f6187cc9574df4dc362524e0cce98c89ee8331", size = 161024, upload-time = "2025-12-15T16:51:06.31Z" }, + { url = "https://files.pythonhosted.org/packages/88/00/ddfcdc1147dd7fb68321d7b064b12f0b9101d85f466a46006f86096fde8d/librt-0.7.4-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3ca1caedf8331d8ad6027f93b52d68ed8f8009f5c420c246a46fe9d3be06be0f", size = 169529, upload-time = "2025-12-15T16:51:07.907Z" }, + { url = "https://files.pythonhosted.org/packages/dd/b3/915702c7077df2483b015030d1979404474f490fe9a071e9576f7b26fef6/librt-0.7.4-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c2a6f1236151e6fe1da289351b5b5bce49651c91554ecc7b70a947bced6fe212", size = 183270, upload-time = "2025-12-15T16:51:09.164Z" }, + { url = "https://files.pythonhosted.org/packages/45/19/ab2f217e8ec509fca4ea9e2e5022b9f72c1a7b7195f5a5770d299df807ea/librt-0.7.4-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:7766b57aeebaf3f1dac14fdd4a75c9a61f2ed56d8ebeefe4189db1cb9d2a3783", size = 179038, upload-time = "2025-12-15T16:51:10.538Z" }, + { url = "https://files.pythonhosted.org/packages/10/1c/d40851d187662cf50312ebbc0b277c7478dd78dbaaf5ee94056f1d7f2f83/librt-0.7.4-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:1c4c89fb01157dd0a3bfe9e75cd6253b0a1678922befcd664eca0772a4c6c979", size = 173502, upload-time = "2025-12-15T16:51:11.888Z" }, + { url = "https://files.pythonhosted.org/packages/07/52/d5880835c772b22c38db18660420fa6901fd9e9a433b65f0ba9b0f4da764/librt-0.7.4-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f7fa8beef580091c02b4fd26542de046b2abfe0aaefa02e8bcf68acb7618f2b3", size = 193570, upload-time = "2025-12-15T16:51:13.168Z" }, + { url = "https://files.pythonhosted.org/packages/f1/35/22d3c424b82f86ce019c0addadf001d459dfac8036aecc07fadc5c541053/librt-0.7.4-cp310-cp310-win32.whl", hash = "sha256:543c42fa242faae0466fe72d297976f3c710a357a219b1efde3a0539a68a6997", size = 42596, upload-time = "2025-12-15T16:51:14.422Z" }, + { url = "https://files.pythonhosted.org/packages/95/b1/e7c316ac5fe60ac1fdfe515198087205220803c4cf923ee63e1cb8380b17/librt-0.7.4-cp310-cp310-win_amd64.whl", hash = "sha256:25cc40d8eb63f0a7ea4c8f49f524989b9df901969cb860a2bc0e4bad4b8cb8a8", size = 48972, upload-time = "2025-12-15T16:51:15.516Z" }, + { url = "https://files.pythonhosted.org/packages/84/64/44089b12d8b4714a7f0e2f33fb19285ba87702d4be0829f20b36ebeeee07/librt-0.7.4-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:3485b9bb7dfa66167d5500ffdafdc35415b45f0da06c75eb7df131f3357b174a", size = 54709, upload-time = "2025-12-15T16:51:16.699Z" }, + { url = "https://files.pythonhosted.org/packages/26/ef/6fa39fb5f37002f7d25e0da4f24d41b457582beea9369eeb7e9e73db5508/librt-0.7.4-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:188b4b1a770f7f95ea035d5bbb9d7367248fc9d12321deef78a269ebf46a5729", size = 56663, upload-time = "2025-12-15T16:51:17.856Z" }, + { url = "https://files.pythonhosted.org/packages/9d/e4/cbaca170a13bee2469c90df9e47108610b4422c453aea1aec1779ac36c24/librt-0.7.4-cp311-cp311-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:1b668b1c840183e4e38ed5a99f62fac44c3a3eef16870f7f17cfdfb8b47550ed", size = 161703, upload-time = "2025-12-15T16:51:19.421Z" }, + { url = "https://files.pythonhosted.org/packages/d0/32/0b2296f9cc7e693ab0d0835e355863512e5eac90450c412777bd699c76ae/librt-0.7.4-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0e8f864b521f6cfedb314d171630f827efee08f5c3462bcbc2244ab8e1768cd6", size = 171027, upload-time = "2025-12-15T16:51:20.721Z" }, + { url = "https://files.pythonhosted.org/packages/d8/33/c70b6d40f7342716e5f1353c8da92d9e32708a18cbfa44897a93ec2bf879/librt-0.7.4-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4df7c9def4fc619a9c2ab402d73a0c5b53899abe090e0100323b13ccb5a3dd82", size = 184700, upload-time = "2025-12-15T16:51:22.272Z" }, + { url = "https://files.pythonhosted.org/packages/e4/c8/555c405155da210e4c4113a879d378f54f850dbc7b794e847750a8fadd43/librt-0.7.4-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:f79bc3595b6ed159a1bf0cdc70ed6ebec393a874565cab7088a219cca14da727", size = 180719, upload-time = "2025-12-15T16:51:23.561Z" }, + { url = "https://files.pythonhosted.org/packages/6b/88/34dc1f1461c5613d1b73f0ecafc5316cc50adcc1b334435985b752ed53e5/librt-0.7.4-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:77772a4b8b5f77d47d883846928c36d730b6e612a6388c74cba33ad9eb149c11", size = 174535, upload-time = "2025-12-15T16:51:25.031Z" }, + { url = "https://files.pythonhosted.org/packages/b6/5a/f3fafe80a221626bcedfa9fe5abbf5f04070989d44782f579b2d5920d6d0/librt-0.7.4-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:064a286e6ab0b4c900e228ab4fa9cb3811b4b83d3e0cc5cd816b2d0f548cb61c", size = 195236, upload-time = "2025-12-15T16:51:26.328Z" }, + { url = "https://files.pythonhosted.org/packages/d8/77/5c048d471ce17f4c3a6e08419be19add4d291e2f7067b877437d482622ac/librt-0.7.4-cp311-cp311-win32.whl", hash = "sha256:42da201c47c77b6cc91fc17e0e2b330154428d35d6024f3278aa2683e7e2daf2", size = 42930, upload-time = "2025-12-15T16:51:27.853Z" }, + { url = "https://files.pythonhosted.org/packages/fb/3b/514a86305a12c3d9eac03e424b07cd312c7343a9f8a52719aa079590a552/librt-0.7.4-cp311-cp311-win_amd64.whl", hash = "sha256:d31acb5886c16ae1711741f22504195af46edec8315fe69b77e477682a87a83e", size = 49240, upload-time = "2025-12-15T16:51:29.037Z" }, + { url = "https://files.pythonhosted.org/packages/ba/01/3b7b1914f565926b780a734fac6e9a4d2c7aefe41f4e89357d73697a9457/librt-0.7.4-cp311-cp311-win_arm64.whl", hash = "sha256:114722f35093da080a333b3834fff04ef43147577ed99dd4db574b03a5f7d170", size = 42613, upload-time = "2025-12-15T16:51:30.194Z" }, + { url = "https://files.pythonhosted.org/packages/f3/e7/b805d868d21f425b7e76a0ea71a2700290f2266a4f3c8357fcf73efc36aa/librt-0.7.4-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7dd3b5c37e0fb6666c27cf4e2c88ae43da904f2155c4cfc1e5a2fdce3b9fcf92", size = 55688, upload-time = "2025-12-15T16:51:31.571Z" }, + { url = "https://files.pythonhosted.org/packages/59/5e/69a2b02e62a14cfd5bfd9f1e9adea294d5bcfeea219c7555730e5d068ee4/librt-0.7.4-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a9c5de1928c486201b23ed0cc4ac92e6e07be5cd7f3abc57c88a9cf4f0f32108", size = 57141, upload-time = "2025-12-15T16:51:32.714Z" }, + { url = "https://files.pythonhosted.org/packages/6e/6b/05dba608aae1272b8ea5ff8ef12c47a4a099a04d1e00e28a94687261d403/librt-0.7.4-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:078ae52ffb3f036396cc4aed558e5b61faedd504a3c1f62b8ae34bf95ae39d94", size = 165322, upload-time = "2025-12-15T16:51:33.986Z" }, + { url = "https://files.pythonhosted.org/packages/8f/bc/199533d3fc04a4cda8d7776ee0d79955ab0c64c79ca079366fbc2617e680/librt-0.7.4-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ce58420e25097b2fc201aef9b9f6d65df1eb8438e51154e1a7feb8847e4a55ab", size = 174216, upload-time = "2025-12-15T16:51:35.384Z" }, + { url = "https://files.pythonhosted.org/packages/62/ec/09239b912a45a8ed117cb4a6616d9ff508f5d3131bd84329bf2f8d6564f1/librt-0.7.4-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b719c8730c02a606dc0e8413287e8e94ac2d32a51153b300baf1f62347858fba", size = 189005, upload-time = "2025-12-15T16:51:36.687Z" }, + { url = "https://files.pythonhosted.org/packages/46/2e/e188313d54c02f5b0580dd31476bb4b0177514ff8d2be9f58d4a6dc3a7ba/librt-0.7.4-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3749ef74c170809e6dee68addec9d2458700a8de703de081c888e92a8b015cf9", size = 183960, upload-time = "2025-12-15T16:51:37.977Z" }, + { url = "https://files.pythonhosted.org/packages/eb/84/f1d568d254518463d879161d3737b784137d236075215e56c7c9be191cee/librt-0.7.4-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:b35c63f557653c05b5b1b6559a074dbabe0afee28ee2a05b6c9ba21ad0d16a74", size = 177609, upload-time = "2025-12-15T16:51:40.584Z" }, + { url = "https://files.pythonhosted.org/packages/5d/43/060bbc1c002f0d757c33a1afe6bf6a565f947a04841139508fc7cef6c08b/librt-0.7.4-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:1ef704e01cb6ad39ad7af668d51677557ca7e5d377663286f0ee1b6b27c28e5f", size = 199269, upload-time = "2025-12-15T16:51:41.879Z" }, + { url = "https://files.pythonhosted.org/packages/ff/7f/708f8f02d8012ee9f366c07ea6a92882f48bd06cc1ff16a35e13d0fbfb08/librt-0.7.4-cp312-cp312-win32.whl", hash = "sha256:c66c2b245926ec15188aead25d395091cb5c9df008d3b3207268cd65557d6286", size = 43186, upload-time = "2025-12-15T16:51:43.149Z" }, + { url = "https://files.pythonhosted.org/packages/f1/a5/4e051b061c8b2509be31b2c7ad4682090502c0a8b6406edcf8c6b4fe1ef7/librt-0.7.4-cp312-cp312-win_amd64.whl", hash = "sha256:71a56f4671f7ff723451f26a6131754d7c1809e04e22ebfbac1db8c9e6767a20", size = 49455, upload-time = "2025-12-15T16:51:44.336Z" }, + { url = "https://files.pythonhosted.org/packages/d0/d2/90d84e9f919224a3c1f393af1636d8638f54925fdc6cd5ee47f1548461e5/librt-0.7.4-cp312-cp312-win_arm64.whl", hash = "sha256:419eea245e7ec0fe664eb7e85e7ff97dcdb2513ca4f6b45a8ec4a3346904f95a", size = 42828, upload-time = "2025-12-15T16:51:45.498Z" }, + { url = "https://files.pythonhosted.org/packages/fe/4d/46a53ccfbb39fd0b493fd4496eb76f3ebc15bb3e45d8c2e695a27587edf5/librt-0.7.4-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:d44a1b1ba44cbd2fc3cb77992bef6d6fdb1028849824e1dd5e4d746e1f7f7f0b", size = 55745, upload-time = "2025-12-15T16:51:46.636Z" }, + { url = "https://files.pythonhosted.org/packages/7f/2b/3ac7f5212b1828bf4f979cf87f547db948d3e28421d7a430d4db23346ce4/librt-0.7.4-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:c9cab4b3de1f55e6c30a84c8cee20e4d3b2476f4d547256694a1b0163da4fe32", size = 57166, upload-time = "2025-12-15T16:51:48.219Z" }, + { url = "https://files.pythonhosted.org/packages/e8/99/6523509097cbe25f363795f0c0d1c6a3746e30c2994e25b5aefdab119b21/librt-0.7.4-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:2857c875f1edd1feef3c371fbf830a61b632fb4d1e57160bb1e6a3206e6abe67", size = 165833, upload-time = "2025-12-15T16:51:49.443Z" }, + { url = "https://files.pythonhosted.org/packages/fe/35/323611e59f8fe032649b4fb7e77f746f96eb7588fcbb31af26bae9630571/librt-0.7.4-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b370a77be0a16e1ad0270822c12c21462dc40496e891d3b0caf1617c8cc57e20", size = 174818, upload-time = "2025-12-15T16:51:51.015Z" }, + { url = "https://files.pythonhosted.org/packages/41/e6/40fb2bb21616c6e06b6a64022802228066e9a31618f493e03f6b9661548a/librt-0.7.4-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d05acd46b9a52087bfc50c59dfdf96a2c480a601e8898a44821c7fd676598f74", size = 189607, upload-time = "2025-12-15T16:51:52.671Z" }, + { url = "https://files.pythonhosted.org/packages/32/48/1b47c7d5d28b775941e739ed2bfe564b091c49201b9503514d69e4ed96d7/librt-0.7.4-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:70969229cb23d9c1a80e14225838d56e464dc71fa34c8342c954fc50e7516dee", size = 184585, upload-time = "2025-12-15T16:51:54.027Z" }, + { url = "https://files.pythonhosted.org/packages/75/a6/ee135dfb5d3b54d5d9001dbe483806229c6beac3ee2ba1092582b7efeb1b/librt-0.7.4-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:4450c354b89dbb266730893862dbff06006c9ed5b06b6016d529b2bf644fc681", size = 178249, upload-time = "2025-12-15T16:51:55.248Z" }, + { url = "https://files.pythonhosted.org/packages/04/87/d5b84ec997338be26af982bcd6679be0c1db9a32faadab1cf4bb24f9e992/librt-0.7.4-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:adefe0d48ad35b90b6f361f6ff5a1bd95af80c17d18619c093c60a20e7a5b60c", size = 199851, upload-time = "2025-12-15T16:51:56.933Z" }, + { url = "https://files.pythonhosted.org/packages/86/63/ba1333bf48306fe398e3392a7427ce527f81b0b79d0d91618c4610ce9d15/librt-0.7.4-cp313-cp313-win32.whl", hash = "sha256:21ea710e96c1e050635700695095962a22ea420d4b3755a25e4909f2172b4ff2", size = 43249, upload-time = "2025-12-15T16:51:58.498Z" }, + { url = "https://files.pythonhosted.org/packages/f9/8a/de2c6df06cdfa9308c080e6b060fe192790b6a48a47320b215e860f0e98c/librt-0.7.4-cp313-cp313-win_amd64.whl", hash = "sha256:772e18696cf5a64afee908662fbcb1f907460ddc851336ee3a848ef7684c8e1e", size = 49417, upload-time = "2025-12-15T16:51:59.618Z" }, + { url = "https://files.pythonhosted.org/packages/31/66/8ee0949efc389691381ed686185e43536c20e7ad880c122dd1f31e65c658/librt-0.7.4-cp313-cp313-win_arm64.whl", hash = "sha256:52e34c6af84e12921748c8354aa6acf1912ca98ba60cdaa6920e34793f1a0788", size = 42824, upload-time = "2025-12-15T16:52:00.784Z" }, ] [[package]] @@ -1404,9 +1442,9 @@ version = "4.6.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "scipy", version = "1.15.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "scipy", version = "1.16.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "scipy", version = "1.16.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/68/0b/a2e9f5c5da7ef047cc60cef37f86185088845e8433e54d2e7ed439cce8a3/lightgbm-4.6.0.tar.gz", hash = "sha256:cb1c59720eb569389c0ba74d14f52351b573af489f230032a1c9f314f8bab7fe", size = 1703705, upload-time = "2025-02-15T04:03:03.111Z" } wheels = [ @@ -1419,30 +1457,26 @@ wheels = [ [[package]] name = "llvmlite" -version = "0.45.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/9d/73/4b29b502618766276816f2f2a7cf9017bd3889bc38a49319bee9ad492b75/llvmlite-0.45.0.tar.gz", hash = "sha256:ceb0bcd20da949178bd7ab78af8de73e9f3c483ac46b5bef39f06a4862aa8336", size = 185289, upload-time = "2025-09-18T17:47:14.293Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/02/4c/df303ed13c77ee022ad203c7ec697f96d863735ec76e293916837bb3f8e3/llvmlite-0.45.0-cp310-cp310-macosx_10_15_x86_64.whl", hash = "sha256:3018e5f8547c8b05e736281d5bd23ff86b88ab94697db2beeaa6f3bce9cfc721", size = 43043438, upload-time = "2025-09-18T17:40:14.292Z" }, - { url = "https://files.pythonhosted.org/packages/f8/b9/72d7612e54eda411952c2a2dd43b1ebd422b5cd66a1ff9fcd8a825160ab8/llvmlite-0.45.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ca7b15dc4422551f1b5fb1dbd734d5e8a9416028890d31d4e23a04fbc8a975c4", size = 37253034, upload-time = "2025-09-18T17:42:12.866Z" }, - { url = "https://files.pythonhosted.org/packages/6a/3d/2c0cf2c63107bc4550eb92d830dac85d4b518aea2fe3774a253ffb9aa7c5/llvmlite-0.45.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a9c7343bec403a79248859df75c7945768de70bf547eac8c1cc8b8840e0336ba", size = 56288125, upload-time = "2025-09-18T17:35:06.252Z" }, - { url = "https://files.pythonhosted.org/packages/5c/f3/bddaa88371fa8c2f2361790eba661ba49d0496f00b8bbf9a74c5cd11a7b0/llvmlite-0.45.0-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:56713a25bf81081fc818aa36cbffb70533b3c23291ce0efc17ac8a3b684b8be3", size = 55140875, upload-time = "2025-09-18T17:38:08.277Z" }, - { url = "https://files.pythonhosted.org/packages/55/8a/ac08bfbe0f3ba6080a2cfe74a5f57cede55261c90dba8850f18e95bde1db/llvmlite-0.45.0-cp310-cp310-win_amd64.whl", hash = "sha256:849ba7de7153d8d92bc66577bb951c9baf8d9f67f2521c4f39c78718d471362e", size = 37946101, upload-time = "2025-09-18T17:43:42.729Z" }, - { url = "https://files.pythonhosted.org/packages/03/a4/6a9f9745c80639eee5a6e112de7811ba0a2e9d7f2a6cef226ce54d00d63a/llvmlite-0.45.0-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:9b1b37e00b553e9420d9a2e327e84c5ac65a5690dcacf7fc153014780d97532a", size = 43043438, upload-time = "2025-09-18T17:40:48.769Z" }, - { url = "https://files.pythonhosted.org/packages/9b/8b/1d7d8f5daaaff4eb8e1673f304fbae24ad4b02e15ce1f47602c163486ac0/llvmlite-0.45.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:cd039b8da5514db2729b7c9ae7526cae8da748a540fa3ab721b50c54651d2362", size = 37253033, upload-time = "2025-09-18T17:42:33.206Z" }, - { url = "https://files.pythonhosted.org/packages/e6/95/a13362fe71d1e88bea9e3cc58a3337b3302a3e4af68391df10389f3b7f78/llvmlite-0.45.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c6815d0d3f96de34491d3dc192e11e933e3448ceff0b58572a53f39795996e01", size = 56288124, upload-time = "2025-09-18T17:35:45.017Z" }, - { url = "https://files.pythonhosted.org/packages/2d/cf/4ab3677e11aff8f32573d4bbc617b7707454d47125c86263e189ef576bb1/llvmlite-0.45.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ba79cc2cbdd0f61632ca8e9235fef3657a8aacd636d5775cd13807ceb8265f63", size = 55140874, upload-time = "2025-09-18T17:38:40.018Z" }, - { url = "https://files.pythonhosted.org/packages/92/31/63bbf92c51f49ed2f50c6097ffa11b831246dacd30f9476b8516bde70771/llvmlite-0.45.0-cp311-cp311-win_amd64.whl", hash = "sha256:6188da8e9e3906b167fb64bc84a05e6bf98095d982f45f323bed5def2ba7db1c", size = 37946103, upload-time = "2025-09-18T17:44:08.348Z" }, - { url = "https://files.pythonhosted.org/packages/af/b0/81419371eb6154b7ad5c4ded693fa6c9bbfbc8920f9c3ebacc0747e8bf0b/llvmlite-0.45.0-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:3928119253849e7c9aad4f881feb3e886370bb7ac6eccbc728b35a1be89064cc", size = 43043441, upload-time = "2025-09-18T17:41:21.519Z" }, - { url = "https://files.pythonhosted.org/packages/49/0a/0a2c2cedfbf4bbf61be2db83fe4d7416f234ba2f0e564375f9f45ff7ed7a/llvmlite-0.45.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3e9b5dad694edb9e43904ede037458ee73a18b4e2f227e44fc0f808aceab824", size = 37253035, upload-time = "2025-09-18T17:42:55.189Z" }, - { url = "https://files.pythonhosted.org/packages/d1/ee/6584480d0dcd101bc8800de4d3bfef93cea92161b43903719825f4497449/llvmlite-0.45.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4955635f316e3ffc0271ee7a3da586ae92cd3e70709b6cd59df641e980636d4c", size = 56288125, upload-time = "2025-09-18T17:36:32.038Z" }, - { url = "https://files.pythonhosted.org/packages/10/7b/81c72824f5197154236589cbd4fabd04ae59c57be80b0b401b168deef952/llvmlite-0.45.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5e7497f1b75d741e568bf4a2dfccd5c702d6b5f3d232dd4a59ed851a82e587bd", size = 55140873, upload-time = "2025-09-18T17:39:07.152Z" }, - { url = "https://files.pythonhosted.org/packages/b4/b5/acc977fcd891c0fb155c9edcf3fa8c6cded1d5163625137ef696c5e725e3/llvmlite-0.45.0-cp312-cp312-win_amd64.whl", hash = "sha256:6404f5363986efbe1c7c1afd19da495534e46180466d593ace5a5c042b2f3f94", size = 37946104, upload-time = "2025-09-18T17:44:30.299Z" }, - { url = "https://files.pythonhosted.org/packages/d2/1e/dd09f15cf59eb528101917916291a6021148c356908e34c726e139a95687/llvmlite-0.45.0-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:f719f98e4f3a6292b1a6495500b2cf668d3604907499c483b326da5ce2ff9f01", size = 43043440, upload-time = "2025-09-18T17:41:46.947Z" }, - { url = "https://files.pythonhosted.org/packages/cd/e3/5d43a20dec7561a34f81081612eb860b8ee26233cf44cce7fc39c3aff4e9/llvmlite-0.45.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:4ffa899f7584ef48f1037308d92cb19460a0afb834aa1fe9db9d3e52d0e81a79", size = 37253036, upload-time = "2025-09-18T17:43:18.15Z" }, - { url = "https://files.pythonhosted.org/packages/00/c4/c2e5ade9354908630aec2eeeeacbfe341a96d07e080dc0cd25cbbb9c8c82/llvmlite-0.45.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:2c12fde908967e464b265554143c030ba4dcc2b981a815582d7708a30295018e", size = 56288125, upload-time = "2025-09-18T17:37:32.215Z" }, - { url = "https://files.pythonhosted.org/packages/95/d5/d5aefc379e189d83483d7263efe794f5ee0783ad90be1b09f58b98c738ee/llvmlite-0.45.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:83567cbbf598eb57f108222dfc3dfee065c20a2aa004391360949f2e8ff2b8b4", size = 55140873, upload-time = "2025-09-18T17:39:44.928Z" }, - { url = "https://files.pythonhosted.org/packages/21/16/bac6a35ae77d6f881d2c6b54cbb2df2b07e030e1a66da8041359d09b0d87/llvmlite-0.45.0-cp313-cp313-win_amd64.whl", hash = "sha256:f68890ceb662e874933103e91e239389ff7275c4befba8e43ccd46ae3231b89e", size = 37946102, upload-time = "2025-09-18T17:44:56.051Z" }, +version = "0.46.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/74/cd/08ae687ba099c7e3d21fe2ea536500563ef1943c5105bf6ab4ee3829f68e/llvmlite-0.46.0.tar.gz", hash = "sha256:227c9fd6d09dce2783c18b754b7cd9d9b3b3515210c46acc2d3c5badd9870ceb", size = 193456, upload-time = "2025-12-08T18:15:36.295Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3d/a4/3959e1c61c5ca9db7921e5fd115b344c29b9d57a5dadd87bef97963ca1a5/llvmlite-0.46.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:4323177e936d61ae0f73e653e2e614284d97d14d5dd12579adc92b6c2b0597b0", size = 37232766, upload-time = "2025-12-08T18:14:34.765Z" }, + { url = "https://files.pythonhosted.org/packages/c2/a5/a4d916f1015106e1da876028606a8e87fd5d5c840f98c87bc2d5153b6a2f/llvmlite-0.46.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0a2d461cb89537b7c20feb04c46c32e12d5ad4f0896c9dfc0f60336219ff248e", size = 56275176, upload-time = "2025-12-08T18:14:37.944Z" }, + { url = "https://files.pythonhosted.org/packages/79/7f/a7f2028805dac8c1a6fae7bda4e739b7ebbcd45b29e15bf6d21556fcd3d5/llvmlite-0.46.0-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b1f6595a35b7b39c3518b85a28bf18f45e075264e4b2dce3f0c2a4f232b4a910", size = 55128629, upload-time = "2025-12-08T18:14:41.674Z" }, + { url = "https://files.pythonhosted.org/packages/b2/bc/4689e1ba0c073c196b594471eb21be0aa51d9e64b911728aa13cd85ef0ae/llvmlite-0.46.0-cp310-cp310-win_amd64.whl", hash = "sha256:e7a34d4aa6f9a97ee006b504be6d2b8cb7f755b80ab2f344dda1ef992f828559", size = 38138651, upload-time = "2025-12-08T18:14:45.845Z" }, + { url = "https://files.pythonhosted.org/packages/7a/a1/2ad4b2367915faeebe8447f0a057861f646dbf5fbbb3561db42c65659cf3/llvmlite-0.46.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:82f3d39b16f19aa1a56d5fe625883a6ab600d5cc9ea8906cca70ce94cabba067", size = 37232766, upload-time = "2025-12-08T18:14:48.836Z" }, + { url = "https://files.pythonhosted.org/packages/12/b5/99cf8772fdd846c07da4fd70f07812a3c8fd17ea2409522c946bb0f2b277/llvmlite-0.46.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a3df43900119803bbc52720e758c76f316a9a0f34612a886862dfe0a5591a17e", size = 56275175, upload-time = "2025-12-08T18:14:51.604Z" }, + { url = "https://files.pythonhosted.org/packages/38/f2/ed806f9c003563732da156139c45d970ee435bd0bfa5ed8de87ba972b452/llvmlite-0.46.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:de183fefc8022d21b0aa37fc3e90410bc3524aed8617f0ff76732fc6c3af5361", size = 55128630, upload-time = "2025-12-08T18:14:55.107Z" }, + { url = "https://files.pythonhosted.org/packages/19/0c/8f5a37a65fc9b7b17408508145edd5f86263ad69c19d3574e818f533a0eb/llvmlite-0.46.0-cp311-cp311-win_amd64.whl", hash = "sha256:e8b10bc585c58bdffec9e0c309bb7d51be1f2f15e169a4b4d42f2389e431eb93", size = 38138652, upload-time = "2025-12-08T18:14:58.171Z" }, + { url = "https://files.pythonhosted.org/packages/2b/f8/4db016a5e547d4e054ff2f3b99203d63a497465f81ab78ec8eb2ff7b2304/llvmlite-0.46.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:6b9588ad4c63b4f0175a3984b85494f0c927c6b001e3a246a3a7fb3920d9a137", size = 37232767, upload-time = "2025-12-08T18:15:00.737Z" }, + { url = "https://files.pythonhosted.org/packages/aa/85/4890a7c14b4fa54400945cb52ac3cd88545bbdb973c440f98ca41591cdc5/llvmlite-0.46.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3535bd2bb6a2d7ae4012681ac228e5132cdb75fefb1bcb24e33f2f3e0c865ed4", size = 56275176, upload-time = "2025-12-08T18:15:03.936Z" }, + { url = "https://files.pythonhosted.org/packages/6a/07/3d31d39c1a1a08cd5337e78299fca77e6aebc07c059fbd0033e3edfab45c/llvmlite-0.46.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4cbfd366e60ff87ea6cc62f50bc4cd800ebb13ed4c149466f50cf2163a473d1e", size = 55128630, upload-time = "2025-12-08T18:15:07.196Z" }, + { url = "https://files.pythonhosted.org/packages/2a/6b/d139535d7590a1bba1ceb68751bef22fadaa5b815bbdf0e858e3875726b2/llvmlite-0.46.0-cp312-cp312-win_amd64.whl", hash = "sha256:398b39db462c39563a97b912d4f2866cd37cba60537975a09679b28fbbc0fb38", size = 38138940, upload-time = "2025-12-08T18:15:10.162Z" }, + { url = "https://files.pythonhosted.org/packages/e6/ff/3eba7eb0aed4b6fca37125387cd417e8c458e750621fce56d2c541f67fa8/llvmlite-0.46.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:30b60892d034bc560e0ec6654737aaa74e5ca327bd8114d82136aa071d611172", size = 37232767, upload-time = "2025-12-08T18:15:13.22Z" }, + { url = "https://files.pythonhosted.org/packages/0e/54/737755c0a91558364b9200702c3c9c15d70ed63f9b98a2c32f1c2aa1f3ba/llvmlite-0.46.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:6cc19b051753368a9c9f31dc041299059ee91aceec81bd57b0e385e5d5bf1a54", size = 56275176, upload-time = "2025-12-08T18:15:16.339Z" }, + { url = "https://files.pythonhosted.org/packages/e6/91/14f32e1d70905c1c0aa4e6609ab5d705c3183116ca02ac6df2091868413a/llvmlite-0.46.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:bca185892908f9ede48c0acd547fe4dc1bafefb8a4967d47db6cf664f9332d12", size = 55128629, upload-time = "2025-12-08T18:15:19.493Z" }, + { url = "https://files.pythonhosted.org/packages/4a/a7/d526ae86708cea531935ae777b6dbcabe7db52718e6401e0fb9c5edea80e/llvmlite-0.46.0-cp313-cp313-win_amd64.whl", hash = "sha256:67438fd30e12349ebb054d86a5a1a57fd5e87d264d2451bcfafbbbaa25b82a35", size = 38138941, upload-time = "2025-12-08T18:15:22.536Z" }, ] [[package]] @@ -1457,79 +1491,72 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/d2/f0/834e479e47e499b6478e807fb57b31cc2db696c4db30557bb6f5aea4a90b/mando-0.7.1-py2.py3-none-any.whl", hash = "sha256:26ef1d70928b6057ee3ca12583d73c63e05c49de8972d620c278a7b206581a8a", size = 28149, upload-time = "2022-02-24T08:12:25.24Z" }, ] -[[package]] -name = "markdown-it-py" -version = "4.0.0" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "mdurl" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/5b/f5/4ec618ed16cc4f8fb3b701563655a69816155e79e24a17b651541804721d/markdown_it_py-4.0.0.tar.gz", hash = "sha256:cb0a2b4aa34f932c007117b194e945bd74e0ec24133ceb5bac59009cda1cb9f3", size = 73070, upload-time = "2025-08-11T12:57:52.854Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/94/54/e7d793b573f298e1c9013b8c4dade17d481164aa517d1d7148619c2cedbf/markdown_it_py-4.0.0-py3-none-any.whl", hash = "sha256:87327c59b172c5011896038353a81343b6754500a08cd7a4973bb48c6d578147", size = 87321, upload-time = "2025-08-11T12:57:51.923Z" }, -] - [[package]] name = "markupsafe" -version = "3.0.2" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b2/97/5d42485e71dfc078108a86d6de8fa46db44a1a9295e89c5d6d4a06e23a62/markupsafe-3.0.2.tar.gz", hash = "sha256:ee55d3edf80167e48ea11a923c7386f4669df67d7994554387f84e7d8b0a2bf0", size = 20537, upload-time = "2024-10-18T15:21:54.129Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/04/90/d08277ce111dd22f77149fd1a5d4653eeb3b3eaacbdfcbae5afb2600eebd/MarkupSafe-3.0.2-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:7e94c425039cde14257288fd61dcfb01963e658efbc0ff54f5306b06054700f8", size = 14357, upload-time = "2024-10-18T15:20:51.44Z" }, - { url = "https://files.pythonhosted.org/packages/04/e1/6e2194baeae0bca1fae6629dc0cbbb968d4d941469cbab11a3872edff374/MarkupSafe-3.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:9e2d922824181480953426608b81967de705c3cef4d1af983af849d7bd619158", size = 12393, upload-time = "2024-10-18T15:20:52.426Z" }, - { url = "https://files.pythonhosted.org/packages/1d/69/35fa85a8ece0a437493dc61ce0bb6d459dcba482c34197e3efc829aa357f/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:38a9ef736c01fccdd6600705b09dc574584b89bea478200c5fbf112a6b0d5579", size = 21732, upload-time = "2024-10-18T15:20:53.578Z" }, - { url = "https://files.pythonhosted.org/packages/22/35/137da042dfb4720b638d2937c38a9c2df83fe32d20e8c8f3185dbfef05f7/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:bbcb445fa71794da8f178f0f6d66789a28d7319071af7a496d4d507ed566270d", size = 20866, upload-time = "2024-10-18T15:20:55.06Z" }, - { url = "https://files.pythonhosted.org/packages/29/28/6d029a903727a1b62edb51863232152fd335d602def598dade38996887f0/MarkupSafe-3.0.2-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:57cb5a3cf367aeb1d316576250f65edec5bb3be939e9247ae594b4bcbc317dfb", size = 20964, upload-time = "2024-10-18T15:20:55.906Z" }, - { url = "https://files.pythonhosted.org/packages/cc/cd/07438f95f83e8bc028279909d9c9bd39e24149b0d60053a97b2bc4f8aa51/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:3809ede931876f5b2ec92eef964286840ed3540dadf803dd570c3b7e13141a3b", size = 21977, upload-time = "2024-10-18T15:20:57.189Z" }, - { url = "https://files.pythonhosted.org/packages/29/01/84b57395b4cc062f9c4c55ce0df7d3108ca32397299d9df00fedd9117d3d/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:e07c3764494e3776c602c1e78e298937c3315ccc9043ead7e685b7f2b8d47b3c", size = 21366, upload-time = "2024-10-18T15:20:58.235Z" }, - { url = "https://files.pythonhosted.org/packages/bd/6e/61ebf08d8940553afff20d1fb1ba7294b6f8d279df9fd0c0db911b4bbcfd/MarkupSafe-3.0.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:b424c77b206d63d500bcb69fa55ed8d0e6a3774056bdc4839fc9298a7edca171", size = 21091, upload-time = "2024-10-18T15:20:59.235Z" }, - { url = "https://files.pythonhosted.org/packages/11/23/ffbf53694e8c94ebd1e7e491de185124277964344733c45481f32ede2499/MarkupSafe-3.0.2-cp310-cp310-win32.whl", hash = "sha256:fcabf5ff6eea076f859677f5f0b6b5c1a51e70a376b0579e0eadef8db48c6b50", size = 15065, upload-time = "2024-10-18T15:21:00.307Z" }, - { url = "https://files.pythonhosted.org/packages/44/06/e7175d06dd6e9172d4a69a72592cb3f7a996a9c396eee29082826449bbc3/MarkupSafe-3.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:6af100e168aa82a50e186c82875a5893c5597a0c1ccdb0d8b40240b1f28b969a", size = 15514, upload-time = "2024-10-18T15:21:01.122Z" }, - { url = "https://files.pythonhosted.org/packages/6b/28/bbf83e3f76936960b850435576dd5e67034e200469571be53f69174a2dfd/MarkupSafe-3.0.2-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:9025b4018f3a1314059769c7bf15441064b2207cb3f065e6ea1e7359cb46db9d", size = 14353, upload-time = "2024-10-18T15:21:02.187Z" }, - { url = "https://files.pythonhosted.org/packages/6c/30/316d194b093cde57d448a4c3209f22e3046c5bb2fb0820b118292b334be7/MarkupSafe-3.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:93335ca3812df2f366e80509ae119189886b0f3c2b81325d39efdb84a1e2ae93", size = 12392, upload-time = "2024-10-18T15:21:02.941Z" }, - { url = "https://files.pythonhosted.org/packages/f2/96/9cdafba8445d3a53cae530aaf83c38ec64c4d5427d975c974084af5bc5d2/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2cb8438c3cbb25e220c2ab33bb226559e7afb3baec11c4f218ffa7308603c832", size = 23984, upload-time = "2024-10-18T15:21:03.953Z" }, - { url = "https://files.pythonhosted.org/packages/f1/a4/aefb044a2cd8d7334c8a47d3fb2c9f328ac48cb349468cc31c20b539305f/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a123e330ef0853c6e822384873bef7507557d8e4a082961e1defa947aa59ba84", size = 23120, upload-time = "2024-10-18T15:21:06.495Z" }, - { url = "https://files.pythonhosted.org/packages/8d/21/5e4851379f88f3fad1de30361db501300d4f07bcad047d3cb0449fc51f8c/MarkupSafe-3.0.2-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:1e084f686b92e5b83186b07e8a17fc09e38fff551f3602b249881fec658d3eca", size = 23032, upload-time = "2024-10-18T15:21:07.295Z" }, - { url = "https://files.pythonhosted.org/packages/00/7b/e92c64e079b2d0d7ddf69899c98842f3f9a60a1ae72657c89ce2655c999d/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d8213e09c917a951de9d09ecee036d5c7d36cb6cb7dbaece4c71a60d79fb9798", size = 24057, upload-time = "2024-10-18T15:21:08.073Z" }, - { url = "https://files.pythonhosted.org/packages/f9/ac/46f960ca323037caa0a10662ef97d0a4728e890334fc156b9f9e52bcc4ca/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:5b02fb34468b6aaa40dfc198d813a641e3a63b98c2b05a16b9f80b7ec314185e", size = 23359, upload-time = "2024-10-18T15:21:09.318Z" }, - { url = "https://files.pythonhosted.org/packages/69/84/83439e16197337b8b14b6a5b9c2105fff81d42c2a7c5b58ac7b62ee2c3b1/MarkupSafe-3.0.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:0bff5e0ae4ef2e1ae4fdf2dfd5b76c75e5c2fa4132d05fc1b0dabcd20c7e28c4", size = 23306, upload-time = "2024-10-18T15:21:10.185Z" }, - { url = "https://files.pythonhosted.org/packages/9a/34/a15aa69f01e2181ed8d2b685c0d2f6655d5cca2c4db0ddea775e631918cd/MarkupSafe-3.0.2-cp311-cp311-win32.whl", hash = "sha256:6c89876f41da747c8d3677a2b540fb32ef5715f97b66eeb0c6b66f5e3ef6f59d", size = 15094, upload-time = "2024-10-18T15:21:11.005Z" }, - { url = "https://files.pythonhosted.org/packages/da/b8/3a3bd761922d416f3dc5d00bfbed11f66b1ab89a0c2b6e887240a30b0f6b/MarkupSafe-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:70a87b411535ccad5ef2f1df5136506a10775d267e197e4cf531ced10537bd6b", size = 15521, upload-time = "2024-10-18T15:21:12.911Z" }, - { url = "https://files.pythonhosted.org/packages/22/09/d1f21434c97fc42f09d290cbb6350d44eb12f09cc62c9476effdb33a18aa/MarkupSafe-3.0.2-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:9778bd8ab0a994ebf6f84c2b949e65736d5575320a17ae8984a77fab08db94cf", size = 14274, upload-time = "2024-10-18T15:21:13.777Z" }, - { url = "https://files.pythonhosted.org/packages/6b/b0/18f76bba336fa5aecf79d45dcd6c806c280ec44538b3c13671d49099fdd0/MarkupSafe-3.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:846ade7b71e3536c4e56b386c2a47adf5741d2d8b94ec9dc3e92e5e1ee1e2225", size = 12348, upload-time = "2024-10-18T15:21:14.822Z" }, - { url = "https://files.pythonhosted.org/packages/e0/25/dd5c0f6ac1311e9b40f4af06c78efde0f3b5cbf02502f8ef9501294c425b/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1c99d261bd2d5f6b59325c92c73df481e05e57f19837bdca8413b9eac4bd8028", size = 24149, upload-time = "2024-10-18T15:21:15.642Z" }, - { url = "https://files.pythonhosted.org/packages/f3/f0/89e7aadfb3749d0f52234a0c8c7867877876e0a20b60e2188e9850794c17/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e17c96c14e19278594aa4841ec148115f9c7615a47382ecb6b82bd8fea3ab0c8", size = 23118, upload-time = "2024-10-18T15:21:17.133Z" }, - { url = "https://files.pythonhosted.org/packages/d5/da/f2eeb64c723f5e3777bc081da884b414671982008c47dcc1873d81f625b6/MarkupSafe-3.0.2-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:88416bd1e65dcea10bc7569faacb2c20ce071dd1f87539ca2ab364bf6231393c", size = 22993, upload-time = "2024-10-18T15:21:18.064Z" }, - { url = "https://files.pythonhosted.org/packages/da/0e/1f32af846df486dce7c227fe0f2398dc7e2e51d4a370508281f3c1c5cddc/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:2181e67807fc2fa785d0592dc2d6206c019b9502410671cc905d132a92866557", size = 24178, upload-time = "2024-10-18T15:21:18.859Z" }, - { url = "https://files.pythonhosted.org/packages/c4/f6/bb3ca0532de8086cbff5f06d137064c8410d10779c4c127e0e47d17c0b71/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:52305740fe773d09cffb16f8ed0427942901f00adedac82ec8b67752f58a1b22", size = 23319, upload-time = "2024-10-18T15:21:19.671Z" }, - { url = "https://files.pythonhosted.org/packages/a2/82/8be4c96ffee03c5b4a034e60a31294daf481e12c7c43ab8e34a1453ee48b/MarkupSafe-3.0.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:ad10d3ded218f1039f11a75f8091880239651b52e9bb592ca27de44eed242a48", size = 23352, upload-time = "2024-10-18T15:21:20.971Z" }, - { url = "https://files.pythonhosted.org/packages/51/ae/97827349d3fcffee7e184bdf7f41cd6b88d9919c80f0263ba7acd1bbcb18/MarkupSafe-3.0.2-cp312-cp312-win32.whl", hash = "sha256:0f4ca02bea9a23221c0182836703cbf8930c5e9454bacce27e767509fa286a30", size = 15097, upload-time = "2024-10-18T15:21:22.646Z" }, - { url = "https://files.pythonhosted.org/packages/c1/80/a61f99dc3a936413c3ee4e1eecac96c0da5ed07ad56fd975f1a9da5bc630/MarkupSafe-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:8e06879fc22a25ca47312fbe7c8264eb0b662f6db27cb2d3bbbc74b1df4b9b87", size = 15601, upload-time = "2024-10-18T15:21:23.499Z" }, - { url = "https://files.pythonhosted.org/packages/83/0e/67eb10a7ecc77a0c2bbe2b0235765b98d164d81600746914bebada795e97/MarkupSafe-3.0.2-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ba9527cdd4c926ed0760bc301f6728ef34d841f405abf9d4f959c478421e4efd", size = 14274, upload-time = "2024-10-18T15:21:24.577Z" }, - { url = "https://files.pythonhosted.org/packages/2b/6d/9409f3684d3335375d04e5f05744dfe7e9f120062c9857df4ab490a1031a/MarkupSafe-3.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:f8b3d067f2e40fe93e1ccdd6b2e1d16c43140e76f02fb1319a05cf2b79d99430", size = 12352, upload-time = "2024-10-18T15:21:25.382Z" }, - { url = "https://files.pythonhosted.org/packages/d2/f5/6eadfcd3885ea85fe2a7c128315cc1bb7241e1987443d78c8fe712d03091/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:569511d3b58c8791ab4c2e1285575265991e6d8f8700c7be0e88f86cb0672094", size = 24122, upload-time = "2024-10-18T15:21:26.199Z" }, - { url = "https://files.pythonhosted.org/packages/0c/91/96cf928db8236f1bfab6ce15ad070dfdd02ed88261c2afafd4b43575e9e9/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:15ab75ef81add55874e7ab7055e9c397312385bd9ced94920f2802310c930396", size = 23085, upload-time = "2024-10-18T15:21:27.029Z" }, - { url = "https://files.pythonhosted.org/packages/c2/cf/c9d56af24d56ea04daae7ac0940232d31d5a8354f2b457c6d856b2057d69/MarkupSafe-3.0.2-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:f3818cb119498c0678015754eba762e0d61e5b52d34c8b13d770f0719f7b1d79", size = 22978, upload-time = "2024-10-18T15:21:27.846Z" }, - { url = "https://files.pythonhosted.org/packages/2a/9f/8619835cd6a711d6272d62abb78c033bda638fdc54c4e7f4272cf1c0962b/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:cdb82a876c47801bb54a690c5ae105a46b392ac6099881cdfb9f6e95e4014c6a", size = 24208, upload-time = "2024-10-18T15:21:28.744Z" }, - { url = "https://files.pythonhosted.org/packages/f9/bf/176950a1792b2cd2102b8ffeb5133e1ed984547b75db47c25a67d3359f77/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:cabc348d87e913db6ab4aa100f01b08f481097838bdddf7c7a84b7575b7309ca", size = 23357, upload-time = "2024-10-18T15:21:29.545Z" }, - { url = "https://files.pythonhosted.org/packages/ce/4f/9a02c1d335caabe5c4efb90e1b6e8ee944aa245c1aaaab8e8a618987d816/MarkupSafe-3.0.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:444dcda765c8a838eaae23112db52f1efaf750daddb2d9ca300bcae1039adc5c", size = 23344, upload-time = "2024-10-18T15:21:30.366Z" }, - { url = "https://files.pythonhosted.org/packages/ee/55/c271b57db36f748f0e04a759ace9f8f759ccf22b4960c270c78a394f58be/MarkupSafe-3.0.2-cp313-cp313-win32.whl", hash = "sha256:bcf3e58998965654fdaff38e58584d8937aa3096ab5354d493c77d1fdd66d7a1", size = 15101, upload-time = "2024-10-18T15:21:31.207Z" }, - { url = "https://files.pythonhosted.org/packages/29/88/07df22d2dd4df40aba9f3e402e6dc1b8ee86297dddbad4872bd5e7b0094f/MarkupSafe-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:e6a2a455bd412959b57a172ce6328d2dd1f01cb2135efda2e4576e8a23fa3b0f", size = 15603, upload-time = "2024-10-18T15:21:32.032Z" }, - { url = "https://files.pythonhosted.org/packages/62/6a/8b89d24db2d32d433dffcd6a8779159da109842434f1dd2f6e71f32f738c/MarkupSafe-3.0.2-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:b5a6b3ada725cea8a5e634536b1b01c30bcdcd7f9c6fff4151548d5bf6b3a36c", size = 14510, upload-time = "2024-10-18T15:21:33.625Z" }, - { url = "https://files.pythonhosted.org/packages/7a/06/a10f955f70a2e5a9bf78d11a161029d278eeacbd35ef806c3fd17b13060d/MarkupSafe-3.0.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:a904af0a6162c73e3edcb969eeeb53a63ceeb5d8cf642fade7d39e7963a22ddb", size = 12486, upload-time = "2024-10-18T15:21:34.611Z" }, - { url = "https://files.pythonhosted.org/packages/34/cf/65d4a571869a1a9078198ca28f39fba5fbb910f952f9dbc5220afff9f5e6/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4aa4e5faecf353ed117801a068ebab7b7e09ffb6e1d5e412dc852e0da018126c", size = 25480, upload-time = "2024-10-18T15:21:35.398Z" }, - { url = "https://files.pythonhosted.org/packages/0c/e3/90e9651924c430b885468b56b3d597cabf6d72be4b24a0acd1fa0e12af67/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:c0ef13eaeee5b615fb07c9a7dadb38eac06a0608b41570d8ade51c56539e509d", size = 23914, upload-time = "2024-10-18T15:21:36.231Z" }, - { url = "https://files.pythonhosted.org/packages/66/8c/6c7cf61f95d63bb866db39085150df1f2a5bd3335298f14a66b48e92659c/MarkupSafe-3.0.2-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:d16a81a06776313e817c951135cf7340a3e91e8c1ff2fac444cfd75fffa04afe", size = 23796, upload-time = "2024-10-18T15:21:37.073Z" }, - { url = "https://files.pythonhosted.org/packages/bb/35/cbe9238ec3f47ac9a7c8b3df7a808e7cb50fe149dc7039f5f454b3fba218/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:6381026f158fdb7c72a168278597a5e3a5222e83ea18f543112b2662a9b699c5", size = 25473, upload-time = "2024-10-18T15:21:37.932Z" }, - { url = "https://files.pythonhosted.org/packages/e6/32/7621a4382488aa283cc05e8984a9c219abad3bca087be9ec77e89939ded9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:3d79d162e7be8f996986c064d1c7c817f6df3a77fe3d6859f6f9e7be4b8c213a", size = 24114, upload-time = "2024-10-18T15:21:39.799Z" }, - { url = "https://files.pythonhosted.org/packages/0d/80/0985960e4b89922cb5a0bac0ed39c5b96cbc1a536a99f30e8c220a996ed9/MarkupSafe-3.0.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:131a3c7689c85f5ad20f9f6fb1b866f402c445b220c19fe4308c0b147ccd2ad9", size = 24098, upload-time = "2024-10-18T15:21:40.813Z" }, - { url = "https://files.pythonhosted.org/packages/82/78/fedb03c7d5380df2427038ec8d973587e90561b2d90cd472ce9254cf348b/MarkupSafe-3.0.2-cp313-cp313t-win32.whl", hash = "sha256:ba8062ed2cf21c07a9e295d5b8a2a5ce678b913b45fdf68c32d95d6c1291e0b6", size = 15208, upload-time = "2024-10-18T15:21:41.814Z" }, - { url = "https://files.pythonhosted.org/packages/4f/65/6079a46068dfceaeabb5dcad6d674f5f5c61a6fa5673746f42a9f4c233b3/MarkupSafe-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:e444a31f8db13eb18ada366ab3cf45fd4b31e4db1236a4448f68778c1d1a5a2f", size = 15739, upload-time = "2024-10-18T15:21:42.784Z" }, +version = "3.0.3" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/7e/99/7690b6d4034fffd95959cbe0c02de8deb3098cc577c67bb6a24fe5d7caa7/markupsafe-3.0.3.tar.gz", hash = "sha256:722695808f4b6457b320fdc131280796bdceb04ab50fe1795cd540799ebe1698", size = 80313, upload-time = "2025-09-27T18:37:40.426Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/e8/4b/3541d44f3937ba468b75da9eebcae497dcf67adb65caa16760b0a6807ebb/markupsafe-3.0.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:2f981d352f04553a7171b8e44369f2af4055f888dfb147d55e42d29e29e74559", size = 11631, upload-time = "2025-09-27T18:36:05.558Z" }, + { url = "https://files.pythonhosted.org/packages/98/1b/fbd8eed11021cabd9226c37342fa6ca4e8a98d8188a8d9b66740494960e4/markupsafe-3.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:e1c1493fb6e50ab01d20a22826e57520f1284df32f2d8601fdd90b6304601419", size = 12057, upload-time = "2025-09-27T18:36:07.165Z" }, + { url = "https://files.pythonhosted.org/packages/40/01/e560d658dc0bb8ab762670ece35281dec7b6c1b33f5fbc09ebb57a185519/markupsafe-3.0.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1ba88449deb3de88bd40044603fafffb7bc2b055d626a330323a9ed736661695", size = 22050, upload-time = "2025-09-27T18:36:08.005Z" }, + { url = "https://files.pythonhosted.org/packages/af/cd/ce6e848bbf2c32314c9b237839119c5a564a59725b53157c856e90937b7a/markupsafe-3.0.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f42d0984e947b8adf7dd6dde396e720934d12c506ce84eea8476409563607591", size = 20681, upload-time = "2025-09-27T18:36:08.881Z" }, + { url = "https://files.pythonhosted.org/packages/c9/2a/b5c12c809f1c3045c4d580b035a743d12fcde53cf685dbc44660826308da/markupsafe-3.0.3-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:c0c0b3ade1c0b13b936d7970b1d37a57acde9199dc2aecc4c336773e1d86049c", size = 20705, upload-time = "2025-09-27T18:36:10.131Z" }, + { url = "https://files.pythonhosted.org/packages/cf/e3/9427a68c82728d0a88c50f890d0fc072a1484de2f3ac1ad0bfc1a7214fd5/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:0303439a41979d9e74d18ff5e2dd8c43ed6c6001fd40e5bf2e43f7bd9bbc523f", size = 21524, upload-time = "2025-09-27T18:36:11.324Z" }, + { url = "https://files.pythonhosted.org/packages/bc/36/23578f29e9e582a4d0278e009b38081dbe363c5e7165113fad546918a232/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:d2ee202e79d8ed691ceebae8e0486bd9a2cd4794cec4824e1c99b6f5009502f6", size = 20282, upload-time = "2025-09-27T18:36:12.573Z" }, + { url = "https://files.pythonhosted.org/packages/56/21/dca11354e756ebd03e036bd8ad58d6d7168c80ce1fe5e75218e4945cbab7/markupsafe-3.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:177b5253b2834fe3678cb4a5f0059808258584c559193998be2601324fdeafb1", size = 20745, upload-time = "2025-09-27T18:36:13.504Z" }, + { url = "https://files.pythonhosted.org/packages/87/99/faba9369a7ad6e4d10b6a5fbf71fa2a188fe4a593b15f0963b73859a1bbd/markupsafe-3.0.3-cp310-cp310-win32.whl", hash = "sha256:2a15a08b17dd94c53a1da0438822d70ebcd13f8c3a95abe3a9ef9f11a94830aa", size = 14571, upload-time = "2025-09-27T18:36:14.779Z" }, + { url = "https://files.pythonhosted.org/packages/d6/25/55dc3ab959917602c96985cb1253efaa4ff42f71194bddeb61eb7278b8be/markupsafe-3.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:c4ffb7ebf07cfe8931028e3e4c85f0357459a3f9f9490886198848f4fa002ec8", size = 15056, upload-time = "2025-09-27T18:36:16.125Z" }, + { url = "https://files.pythonhosted.org/packages/d0/9e/0a02226640c255d1da0b8d12e24ac2aa6734da68bff14c05dd53b94a0fc3/markupsafe-3.0.3-cp310-cp310-win_arm64.whl", hash = "sha256:e2103a929dfa2fcaf9bb4e7c091983a49c9ac3b19c9061b6d5427dd7d14d81a1", size = 13932, upload-time = "2025-09-27T18:36:17.311Z" }, + { url = "https://files.pythonhosted.org/packages/08/db/fefacb2136439fc8dd20e797950e749aa1f4997ed584c62cfb8ef7c2be0e/markupsafe-3.0.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1cc7ea17a6824959616c525620e387f6dd30fec8cb44f649e31712db02123dad", size = 11631, upload-time = "2025-09-27T18:36:18.185Z" }, + { url = "https://files.pythonhosted.org/packages/e1/2e/5898933336b61975ce9dc04decbc0a7f2fee78c30353c5efba7f2d6ff27a/markupsafe-3.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:4bd4cd07944443f5a265608cc6aab442e4f74dff8088b0dfc8238647b8f6ae9a", size = 12058, upload-time = "2025-09-27T18:36:19.444Z" }, + { url = "https://files.pythonhosted.org/packages/1d/09/adf2df3699d87d1d8184038df46a9c80d78c0148492323f4693df54e17bb/markupsafe-3.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6b5420a1d9450023228968e7e6a9ce57f65d148ab56d2313fcd589eee96a7a50", size = 24287, upload-time = "2025-09-27T18:36:20.768Z" }, + { url = "https://files.pythonhosted.org/packages/30/ac/0273f6fcb5f42e314c6d8cd99effae6a5354604d461b8d392b5ec9530a54/markupsafe-3.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0bf2a864d67e76e5c9a34dc26ec616a66b9888e25e7b9460e1c76d3293bd9dbf", size = 22940, upload-time = "2025-09-27T18:36:22.249Z" }, + { url = "https://files.pythonhosted.org/packages/19/ae/31c1be199ef767124c042c6c3e904da327a2f7f0cd63a0337e1eca2967a8/markupsafe-3.0.3-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:bc51efed119bc9cfdf792cdeaa4d67e8f6fcccab66ed4bfdd6bde3e59bfcbb2f", size = 21887, upload-time = "2025-09-27T18:36:23.535Z" }, + { url = "https://files.pythonhosted.org/packages/b2/76/7edcab99d5349a4532a459e1fe64f0b0467a3365056ae550d3bcf3f79e1e/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:068f375c472b3e7acbe2d5318dea141359e6900156b5b2ba06a30b169086b91a", size = 23692, upload-time = "2025-09-27T18:36:24.823Z" }, + { url = "https://files.pythonhosted.org/packages/a4/28/6e74cdd26d7514849143d69f0bf2399f929c37dc2b31e6829fd2045b2765/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:7be7b61bb172e1ed687f1754f8e7484f1c8019780f6f6b0786e76bb01c2ae115", size = 21471, upload-time = "2025-09-27T18:36:25.95Z" }, + { url = "https://files.pythonhosted.org/packages/62/7e/a145f36a5c2945673e590850a6f8014318d5577ed7e5920a4b3448e0865d/markupsafe-3.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f9e130248f4462aaa8e2552d547f36ddadbeaa573879158d721bbd33dfe4743a", size = 22923, upload-time = "2025-09-27T18:36:27.109Z" }, + { url = "https://files.pythonhosted.org/packages/0f/62/d9c46a7f5c9adbeeeda52f5b8d802e1094e9717705a645efc71b0913a0a8/markupsafe-3.0.3-cp311-cp311-win32.whl", hash = "sha256:0db14f5dafddbb6d9208827849fad01f1a2609380add406671a26386cdf15a19", size = 14572, upload-time = "2025-09-27T18:36:28.045Z" }, + { url = "https://files.pythonhosted.org/packages/83/8a/4414c03d3f891739326e1783338e48fb49781cc915b2e0ee052aa490d586/markupsafe-3.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:de8a88e63464af587c950061a5e6a67d3632e36df62b986892331d4620a35c01", size = 15077, upload-time = "2025-09-27T18:36:29.025Z" }, + { url = "https://files.pythonhosted.org/packages/35/73/893072b42e6862f319b5207adc9ae06070f095b358655f077f69a35601f0/markupsafe-3.0.3-cp311-cp311-win_arm64.whl", hash = "sha256:3b562dd9e9ea93f13d53989d23a7e775fdfd1066c33494ff43f5418bc8c58a5c", size = 13876, upload-time = "2025-09-27T18:36:29.954Z" }, + { url = "https://files.pythonhosted.org/packages/5a/72/147da192e38635ada20e0a2e1a51cf8823d2119ce8883f7053879c2199b5/markupsafe-3.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d53197da72cc091b024dd97249dfc7794d6a56530370992a5e1a08983ad9230e", size = 11615, upload-time = "2025-09-27T18:36:30.854Z" }, + { url = "https://files.pythonhosted.org/packages/9a/81/7e4e08678a1f98521201c3079f77db69fb552acd56067661f8c2f534a718/markupsafe-3.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1872df69a4de6aead3491198eaf13810b565bdbeec3ae2dc8780f14458ec73ce", size = 12020, upload-time = "2025-09-27T18:36:31.971Z" }, + { url = "https://files.pythonhosted.org/packages/1e/2c/799f4742efc39633a1b54a92eec4082e4f815314869865d876824c257c1e/markupsafe-3.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3a7e8ae81ae39e62a41ec302f972ba6ae23a5c5396c8e60113e9066ef893da0d", size = 24332, upload-time = "2025-09-27T18:36:32.813Z" }, + { url = "https://files.pythonhosted.org/packages/3c/2e/8d0c2ab90a8c1d9a24f0399058ab8519a3279d1bd4289511d74e909f060e/markupsafe-3.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d6dd0be5b5b189d31db7cda48b91d7e0a9795f31430b7f271219ab30f1d3ac9d", size = 22947, upload-time = "2025-09-27T18:36:33.86Z" }, + { url = "https://files.pythonhosted.org/packages/2c/54/887f3092a85238093a0b2154bd629c89444f395618842e8b0c41783898ea/markupsafe-3.0.3-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:94c6f0bb423f739146aec64595853541634bde58b2135f27f61c1ffd1cd4d16a", size = 21962, upload-time = "2025-09-27T18:36:35.099Z" }, + { url = "https://files.pythonhosted.org/packages/c9/2f/336b8c7b6f4a4d95e91119dc8521402461b74a485558d8f238a68312f11c/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:be8813b57049a7dc738189df53d69395eba14fb99345e0a5994914a3864c8a4b", size = 23760, upload-time = "2025-09-27T18:36:36.001Z" }, + { url = "https://files.pythonhosted.org/packages/32/43/67935f2b7e4982ffb50a4d169b724d74b62a3964bc1a9a527f5ac4f1ee2b/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:83891d0e9fb81a825d9a6d61e3f07550ca70a076484292a70fde82c4b807286f", size = 21529, upload-time = "2025-09-27T18:36:36.906Z" }, + { url = "https://files.pythonhosted.org/packages/89/e0/4486f11e51bbba8b0c041098859e869e304d1c261e59244baa3d295d47b7/markupsafe-3.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:77f0643abe7495da77fb436f50f8dab76dbc6e5fd25d39589a0f1fe6548bfa2b", size = 23015, upload-time = "2025-09-27T18:36:37.868Z" }, + { url = "https://files.pythonhosted.org/packages/2f/e1/78ee7a023dac597a5825441ebd17170785a9dab23de95d2c7508ade94e0e/markupsafe-3.0.3-cp312-cp312-win32.whl", hash = "sha256:d88b440e37a16e651bda4c7c2b930eb586fd15ca7406cb39e211fcff3bf3017d", size = 14540, upload-time = "2025-09-27T18:36:38.761Z" }, + { url = "https://files.pythonhosted.org/packages/aa/5b/bec5aa9bbbb2c946ca2733ef9c4ca91c91b6a24580193e891b5f7dbe8e1e/markupsafe-3.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:26a5784ded40c9e318cfc2bdb30fe164bdb8665ded9cd64d500a34fb42067b1c", size = 15105, upload-time = "2025-09-27T18:36:39.701Z" }, + { url = "https://files.pythonhosted.org/packages/e5/f1/216fc1bbfd74011693a4fd837e7026152e89c4bcf3e77b6692fba9923123/markupsafe-3.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:35add3b638a5d900e807944a078b51922212fb3dedb01633a8defc4b01a3c85f", size = 13906, upload-time = "2025-09-27T18:36:40.689Z" }, + { url = "https://files.pythonhosted.org/packages/38/2f/907b9c7bbba283e68f20259574b13d005c121a0fa4c175f9bed27c4597ff/markupsafe-3.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:e1cf1972137e83c5d4c136c43ced9ac51d0e124706ee1c8aa8532c1287fa8795", size = 11622, upload-time = "2025-09-27T18:36:41.777Z" }, + { url = "https://files.pythonhosted.org/packages/9c/d9/5f7756922cdd676869eca1c4e3c0cd0df60ed30199ffd775e319089cb3ed/markupsafe-3.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:116bb52f642a37c115f517494ea5feb03889e04df47eeff5b130b1808ce7c219", size = 12029, upload-time = "2025-09-27T18:36:43.257Z" }, + { url = "https://files.pythonhosted.org/packages/00/07/575a68c754943058c78f30db02ee03a64b3c638586fba6a6dd56830b30a3/markupsafe-3.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:133a43e73a802c5562be9bbcd03d090aa5a1fe899db609c29e8c8d815c5f6de6", size = 24374, upload-time = "2025-09-27T18:36:44.508Z" }, + { url = "https://files.pythonhosted.org/packages/a9/21/9b05698b46f218fc0e118e1f8168395c65c8a2c750ae2bab54fc4bd4e0e8/markupsafe-3.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ccfcd093f13f0f0b7fdd0f198b90053bf7b2f02a3927a30e63f3ccc9df56b676", size = 22980, upload-time = "2025-09-27T18:36:45.385Z" }, + { url = "https://files.pythonhosted.org/packages/7f/71/544260864f893f18b6827315b988c146b559391e6e7e8f7252839b1b846a/markupsafe-3.0.3-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:509fa21c6deb7a7a273d629cf5ec029bc209d1a51178615ddf718f5918992ab9", size = 21990, upload-time = "2025-09-27T18:36:46.916Z" }, + { url = "https://files.pythonhosted.org/packages/c2/28/b50fc2f74d1ad761af2f5dcce7492648b983d00a65b8c0e0cb457c82ebbe/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4afe79fb3de0b7097d81da19090f4df4f8d3a2b3adaa8764138aac2e44f3af1", size = 23784, upload-time = "2025-09-27T18:36:47.884Z" }, + { url = "https://files.pythonhosted.org/packages/ed/76/104b2aa106a208da8b17a2fb72e033a5a9d7073c68f7e508b94916ed47a9/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:795e7751525cae078558e679d646ae45574b47ed6e7771863fcc079a6171a0fc", size = 21588, upload-time = "2025-09-27T18:36:48.82Z" }, + { url = "https://files.pythonhosted.org/packages/b5/99/16a5eb2d140087ebd97180d95249b00a03aa87e29cc224056274f2e45fd6/markupsafe-3.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8485f406a96febb5140bfeca44a73e3ce5116b2501ac54fe953e488fb1d03b12", size = 23041, upload-time = "2025-09-27T18:36:49.797Z" }, + { url = "https://files.pythonhosted.org/packages/19/bc/e7140ed90c5d61d77cea142eed9f9c303f4c4806f60a1044c13e3f1471d0/markupsafe-3.0.3-cp313-cp313-win32.whl", hash = "sha256:bdd37121970bfd8be76c5fb069c7751683bdf373db1ed6c010162b2a130248ed", size = 14543, upload-time = "2025-09-27T18:36:51.584Z" }, + { url = "https://files.pythonhosted.org/packages/05/73/c4abe620b841b6b791f2edc248f556900667a5a1cf023a6646967ae98335/markupsafe-3.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:9a1abfdc021a164803f4d485104931fb8f8c1efd55bc6b748d2f5774e78b62c5", size = 15113, upload-time = "2025-09-27T18:36:52.537Z" }, + { url = "https://files.pythonhosted.org/packages/f0/3a/fa34a0f7cfef23cf9500d68cb7c32dd64ffd58a12b09225fb03dd37d5b80/markupsafe-3.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:7e68f88e5b8799aa49c85cd116c932a1ac15caaa3f5db09087854d218359e485", size = 13911, upload-time = "2025-09-27T18:36:53.513Z" }, + { url = "https://files.pythonhosted.org/packages/e4/d7/e05cd7efe43a88a17a37b3ae96e79a19e846f3f456fe79c57ca61356ef01/markupsafe-3.0.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:218551f6df4868a8d527e3062d0fb968682fe92054e89978594c28e642c43a73", size = 11658, upload-time = "2025-09-27T18:36:54.819Z" }, + { url = "https://files.pythonhosted.org/packages/99/9e/e412117548182ce2148bdeacdda3bb494260c0b0184360fe0d56389b523b/markupsafe-3.0.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:3524b778fe5cfb3452a09d31e7b5adefeea8c5be1d43c4f810ba09f2ceb29d37", size = 12066, upload-time = "2025-09-27T18:36:55.714Z" }, + { url = "https://files.pythonhosted.org/packages/bc/e6/fa0ffcda717ef64a5108eaa7b4f5ed28d56122c9a6d70ab8b72f9f715c80/markupsafe-3.0.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4e885a3d1efa2eadc93c894a21770e4bc67899e3543680313b09f139e149ab19", size = 25639, upload-time = "2025-09-27T18:36:56.908Z" }, + { url = "https://files.pythonhosted.org/packages/96/ec/2102e881fe9d25fc16cb4b25d5f5cde50970967ffa5dddafdb771237062d/markupsafe-3.0.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8709b08f4a89aa7586de0aadc8da56180242ee0ada3999749b183aa23df95025", size = 23569, upload-time = "2025-09-27T18:36:57.913Z" }, + { url = "https://files.pythonhosted.org/packages/4b/30/6f2fce1f1f205fc9323255b216ca8a235b15860c34b6798f810f05828e32/markupsafe-3.0.3-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:b8512a91625c9b3da6f127803b166b629725e68af71f8184ae7e7d54686a56d6", size = 23284, upload-time = "2025-09-27T18:36:58.833Z" }, + { url = "https://files.pythonhosted.org/packages/58/47/4a0ccea4ab9f5dcb6f79c0236d954acb382202721e704223a8aafa38b5c8/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:9b79b7a16f7fedff2495d684f2b59b0457c3b493778c9eed31111be64d58279f", size = 24801, upload-time = "2025-09-27T18:36:59.739Z" }, + { url = "https://files.pythonhosted.org/packages/6a/70/3780e9b72180b6fecb83a4814d84c3bf4b4ae4bf0b19c27196104149734c/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:12c63dfb4a98206f045aa9563db46507995f7ef6d83b2f68eda65c307c6829eb", size = 22769, upload-time = "2025-09-27T18:37:00.719Z" }, + { url = "https://files.pythonhosted.org/packages/98/c5/c03c7f4125180fc215220c035beac6b9cb684bc7a067c84fc69414d315f5/markupsafe-3.0.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:8f71bc33915be5186016f675cd83a1e08523649b0e33efdb898db577ef5bb009", size = 23642, upload-time = "2025-09-27T18:37:01.673Z" }, + { url = "https://files.pythonhosted.org/packages/80/d6/2d1b89f6ca4bff1036499b1e29a1d02d282259f3681540e16563f27ebc23/markupsafe-3.0.3-cp313-cp313t-win32.whl", hash = "sha256:69c0b73548bc525c8cb9a251cddf1931d1db4d2258e9599c28c07ef3580ef354", size = 14612, upload-time = "2025-09-27T18:37:02.639Z" }, + { url = "https://files.pythonhosted.org/packages/2b/98/e48a4bfba0a0ffcf9925fe2d69240bfaa19c6f7507b8cd09c70684a53c1e/markupsafe-3.0.3-cp313-cp313t-win_amd64.whl", hash = "sha256:1b4b79e8ebf6b55351f0d91fe80f893b4743f104bff22e90697db1590e47a218", size = 15200, upload-time = "2025-09-27T18:37:03.582Z" }, + { url = "https://files.pythonhosted.org/packages/0e/72/e3cc540f351f316e9ed0f092757459afbc595824ca724cbc5a5d4263713f/markupsafe-3.0.3-cp313-cp313t-win_arm64.whl", hash = "sha256:ad2cf8aa28b8c020ab2fc8287b0f823d0a7d8630784c31e9ee5edea20f406287", size = 13973, upload-time = "2025-09-27T18:37:04.929Z" }, ] [[package]] name = "matplotlib" -version = "3.10.6" +version = "3.10.8" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "contourpy", version = "1.3.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, @@ -1538,75 +1565,66 @@ dependencies = [ { name = "fonttools" }, { name = "kiwisolver" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "packaging" }, { name = "pillow" }, { name = "pyparsing" }, { name = "python-dateutil" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a0/59/c3e6453a9676ffba145309a73c462bb407f4400de7de3f2b41af70720a3c/matplotlib-3.10.6.tar.gz", hash = "sha256:ec01b645840dd1996df21ee37f208cd8ba57644779fa20464010638013d3203c", size = 34804264, upload-time = "2025-08-30T00:14:25.137Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/da/dc/ab89f7a5efd0cbaaebf2c3cf1881f4cba20c8925bb43f64511059df76895/matplotlib-3.10.6-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:bc7316c306d97463a9866b89d5cc217824e799fa0de346c8f68f4f3d27c8693d", size = 8247159, upload-time = "2025-08-30T00:12:30.507Z" }, - { url = "https://files.pythonhosted.org/packages/30/a5/ddaee1a383ab28174093644fff7438eddb87bf8dbd58f7b85f5cdd6b2485/matplotlib-3.10.6-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:d00932b0d160ef03f59f9c0e16d1e3ac89646f7785165ce6ad40c842db16cc2e", size = 8108011, upload-time = "2025-08-30T00:12:32.771Z" }, - { url = "https://files.pythonhosted.org/packages/75/5b/a53f69bb0522db352b1135bb57cd9fe00fd7252072409392d991d3a755d0/matplotlib-3.10.6-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:8fa4c43d6bfdbfec09c733bca8667de11bfa4970e8324c471f3a3632a0301c15", size = 8680518, upload-time = "2025-08-30T00:12:34.387Z" }, - { url = "https://files.pythonhosted.org/packages/5f/31/e059ddce95f68819b005a2d6820b2d6ed0307827a04598891f00649bed2d/matplotlib-3.10.6-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ea117a9c1627acaa04dbf36265691921b999cbf515a015298e54e1a12c3af837", size = 9514997, upload-time = "2025-08-30T00:12:36.272Z" }, - { url = "https://files.pythonhosted.org/packages/66/d5/28b408a7c0f07b41577ee27e4454fe329e78ca21fe46ae7a27d279165fb5/matplotlib-3.10.6-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:08fc803293b4e1694ee325896030de97f74c141ccff0be886bb5915269247676", size = 9566440, upload-time = "2025-08-30T00:12:41.675Z" }, - { url = "https://files.pythonhosted.org/packages/2d/99/8325b3386b479b1d182ab1a7fd588fd393ff00a99dc04b7cf7d06668cf0f/matplotlib-3.10.6-cp310-cp310-win_amd64.whl", hash = "sha256:2adf92d9b7527fbfb8818e050260f0ebaa460f79d61546374ce73506c9421d09", size = 8108186, upload-time = "2025-08-30T00:12:43.621Z" }, - { url = "https://files.pythonhosted.org/packages/80/d6/5d3665aa44c49005aaacaa68ddea6fcb27345961cd538a98bb0177934ede/matplotlib-3.10.6-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:905b60d1cb0ee604ce65b297b61cf8be9f4e6cfecf95a3fe1c388b5266bc8f4f", size = 8257527, upload-time = "2025-08-30T00:12:45.31Z" }, - { url = "https://files.pythonhosted.org/packages/8c/af/30ddefe19ca67eebd70047dabf50f899eaff6f3c5e6a1a7edaecaf63f794/matplotlib-3.10.6-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:7bac38d816637343e53d7185d0c66677ff30ffb131044a81898b5792c956ba76", size = 8119583, upload-time = "2025-08-30T00:12:47.236Z" }, - { url = "https://files.pythonhosted.org/packages/d3/29/4a8650a3dcae97fa4f375d46efcb25920d67b512186f8a6788b896062a81/matplotlib-3.10.6-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:942a8de2b5bfff1de31d95722f702e2966b8a7e31f4e68f7cd963c7cd8861cf6", size = 8692682, upload-time = "2025-08-30T00:12:48.781Z" }, - { url = "https://files.pythonhosted.org/packages/aa/d3/b793b9cb061cfd5d42ff0f69d1822f8d5dbc94e004618e48a97a8373179a/matplotlib-3.10.6-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a3276c85370bc0dfca051ec65c5817d1e0f8f5ce1b7787528ec8ed2d524bbc2f", size = 9521065, upload-time = "2025-08-30T00:12:50.602Z" }, - { url = "https://files.pythonhosted.org/packages/f7/c5/53de5629f223c1c66668d46ac2621961970d21916a4bc3862b174eb2a88f/matplotlib-3.10.6-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:9df5851b219225731f564e4b9e7f2ac1e13c9e6481f941b5631a0f8e2d9387ce", size = 9576888, upload-time = "2025-08-30T00:12:52.92Z" }, - { url = "https://files.pythonhosted.org/packages/fc/8e/0a18d6d7d2d0a2e66585032a760d13662e5250c784d53ad50434e9560991/matplotlib-3.10.6-cp311-cp311-win_amd64.whl", hash = "sha256:abb5d9478625dd9c9eb51a06d39aae71eda749ae9b3138afb23eb38824026c7e", size = 8115158, upload-time = "2025-08-30T00:12:54.863Z" }, - { url = "https://files.pythonhosted.org/packages/07/b3/1a5107bb66c261e23b9338070702597a2d374e5aa7004b7adfc754fbed02/matplotlib-3.10.6-cp311-cp311-win_arm64.whl", hash = "sha256:886f989ccfae63659183173bb3fced7fd65e9eb793c3cc21c273add368536951", size = 7992444, upload-time = "2025-08-30T00:12:57.067Z" }, - { url = "https://files.pythonhosted.org/packages/ea/1a/7042f7430055d567cc3257ac409fcf608599ab27459457f13772c2d9778b/matplotlib-3.10.6-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:31ca662df6a80bd426f871105fdd69db7543e28e73a9f2afe80de7e531eb2347", size = 8272404, upload-time = "2025-08-30T00:12:59.112Z" }, - { url = "https://files.pythonhosted.org/packages/a9/5d/1d5f33f5b43f4f9e69e6a5fe1fb9090936ae7bc8e2ff6158e7a76542633b/matplotlib-3.10.6-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1678bb61d897bb4ac4757b5ecfb02bfb3fddf7f808000fb81e09c510712fda75", size = 8128262, upload-time = "2025-08-30T00:13:01.141Z" }, - { url = "https://files.pythonhosted.org/packages/67/c3/135fdbbbf84e0979712df58e5e22b4f257b3f5e52a3c4aacf1b8abec0d09/matplotlib-3.10.6-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:56cd2d20842f58c03d2d6e6c1f1cf5548ad6f66b91e1e48f814e4fb5abd1cb95", size = 8697008, upload-time = "2025-08-30T00:13:03.24Z" }, - { url = "https://files.pythonhosted.org/packages/9c/be/c443ea428fb2488a3ea7608714b1bd85a82738c45da21b447dc49e2f8e5d/matplotlib-3.10.6-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:662df55604a2f9a45435566d6e2660e41efe83cd94f4288dfbf1e6d1eae4b0bb", size = 9530166, upload-time = "2025-08-30T00:13:05.951Z" }, - { url = "https://files.pythonhosted.org/packages/a9/35/48441422b044d74034aea2a3e0d1a49023f12150ebc58f16600132b9bbaf/matplotlib-3.10.6-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:08f141d55148cd1fc870c3387d70ca4df16dee10e909b3b038782bd4bda6ea07", size = 9593105, upload-time = "2025-08-30T00:13:08.356Z" }, - { url = "https://files.pythonhosted.org/packages/45/c3/994ef20eb4154ab84cc08d033834555319e4af970165e6c8894050af0b3c/matplotlib-3.10.6-cp312-cp312-win_amd64.whl", hash = "sha256:590f5925c2d650b5c9d813c5b3b5fc53f2929c3f8ef463e4ecfa7e052044fb2b", size = 8122784, upload-time = "2025-08-30T00:13:10.367Z" }, - { url = "https://files.pythonhosted.org/packages/57/b8/5c85d9ae0e40f04e71bedb053aada5d6bab1f9b5399a0937afb5d6b02d98/matplotlib-3.10.6-cp312-cp312-win_arm64.whl", hash = "sha256:f44c8d264a71609c79a78d50349e724f5d5fc3684ead7c2a473665ee63d868aa", size = 7992823, upload-time = "2025-08-30T00:13:12.24Z" }, - { url = "https://files.pythonhosted.org/packages/a0/db/18380e788bb837e724358287b08e223b32bc8dccb3b0c12fa8ca20bc7f3b/matplotlib-3.10.6-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:819e409653c1106c8deaf62e6de6b8611449c2cd9939acb0d7d4e57a3d95cc7a", size = 8273231, upload-time = "2025-08-30T00:13:13.881Z" }, - { url = "https://files.pythonhosted.org/packages/d3/0f/38dd49445b297e0d4f12a322c30779df0d43cb5873c7847df8a82e82ec67/matplotlib-3.10.6-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:59c8ac8382fefb9cb71308dde16a7c487432f5255d8f1fd32473523abecfecdf", size = 8128730, upload-time = "2025-08-30T00:13:15.556Z" }, - { url = "https://files.pythonhosted.org/packages/e5/b8/9eea6630198cb303d131d95d285a024b3b8645b1763a2916fddb44ca8760/matplotlib-3.10.6-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:84e82d9e0fd70c70bc55739defbd8055c54300750cbacf4740c9673a24d6933a", size = 8698539, upload-time = "2025-08-30T00:13:17.297Z" }, - { url = "https://files.pythonhosted.org/packages/71/34/44c7b1f075e1ea398f88aeabcc2907c01b9cc99e2afd560c1d49845a1227/matplotlib-3.10.6-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:25f7a3eb42d6c1c56e89eacd495661fc815ffc08d9da750bca766771c0fd9110", size = 9529702, upload-time = "2025-08-30T00:13:19.248Z" }, - { url = "https://files.pythonhosted.org/packages/b5/7f/e5c2dc9950c7facaf8b461858d1b92c09dd0cf174fe14e21953b3dda06f7/matplotlib-3.10.6-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f9c862d91ec0b7842920a4cfdaaec29662195301914ea54c33e01f1a28d014b2", size = 9593742, upload-time = "2025-08-30T00:13:21.181Z" }, - { url = "https://files.pythonhosted.org/packages/ff/1d/70c28528794f6410ee2856cd729fa1f1756498b8d3126443b0a94e1a8695/matplotlib-3.10.6-cp313-cp313-win_amd64.whl", hash = "sha256:1b53bd6337eba483e2e7d29c5ab10eee644bc3a2491ec67cc55f7b44583ffb18", size = 8122753, upload-time = "2025-08-30T00:13:23.44Z" }, - { url = "https://files.pythonhosted.org/packages/e8/74/0e1670501fc7d02d981564caf7c4df42974464625935424ca9654040077c/matplotlib-3.10.6-cp313-cp313-win_arm64.whl", hash = "sha256:cbd5eb50b7058b2892ce45c2f4e92557f395c9991f5c886d1bb74a1582e70fd6", size = 7992973, upload-time = "2025-08-30T00:13:26.632Z" }, - { url = "https://files.pythonhosted.org/packages/b1/4e/60780e631d73b6b02bd7239f89c451a72970e5e7ec34f621eda55cd9a445/matplotlib-3.10.6-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:acc86dd6e0e695c095001a7fccff158c49e45e0758fdf5dcdbb0103318b59c9f", size = 8316869, upload-time = "2025-08-30T00:13:28.262Z" }, - { url = "https://files.pythonhosted.org/packages/f8/15/baa662374a579413210fc2115d40c503b7360a08e9cc254aa0d97d34b0c1/matplotlib-3.10.6-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:e228cd2ffb8f88b7d0b29e37f68ca9aaf83e33821f24a5ccc4f082dd8396bc27", size = 8178240, upload-time = "2025-08-30T00:13:30.007Z" }, - { url = "https://files.pythonhosted.org/packages/c6/3f/3c38e78d2aafdb8829fcd0857d25aaf9e7dd2dfcf7ec742765b585774931/matplotlib-3.10.6-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:658bc91894adeab669cf4bb4a186d049948262987e80f0857216387d7435d833", size = 8711719, upload-time = "2025-08-30T00:13:31.72Z" }, - { url = "https://files.pythonhosted.org/packages/96/4b/2ec2bbf8cefaa53207cc56118d1fa8a0f9b80642713ea9390235d331ede4/matplotlib-3.10.6-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8913b7474f6dd83ac444c9459c91f7f0f2859e839f41d642691b104e0af056aa", size = 9541422, upload-time = "2025-08-30T00:13:33.611Z" }, - { url = "https://files.pythonhosted.org/packages/83/7d/40255e89b3ef11c7871020563b2dd85f6cb1b4eff17c0f62b6eb14c8fa80/matplotlib-3.10.6-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:091cea22e059b89f6d7d1a18e2c33a7376c26eee60e401d92a4d6726c4e12706", size = 9594068, upload-time = "2025-08-30T00:13:35.833Z" }, - { url = "https://files.pythonhosted.org/packages/f0/a9/0213748d69dc842537a113493e1c27daf9f96bd7cc316f933dc8ec4de985/matplotlib-3.10.6-cp313-cp313t-win_amd64.whl", hash = "sha256:491e25e02a23d7207629d942c666924a6b61e007a48177fdd231a0097b7f507e", size = 8200100, upload-time = "2025-08-30T00:13:37.668Z" }, - { url = "https://files.pythonhosted.org/packages/be/15/79f9988066ce40b8a6f1759a934ea0cde8dc4adc2262255ee1bc98de6ad0/matplotlib-3.10.6-cp313-cp313t-win_arm64.whl", hash = "sha256:3d80d60d4e54cda462e2cd9a086d85cd9f20943ead92f575ce86885a43a565d5", size = 8042142, upload-time = "2025-08-30T00:13:39.426Z" }, - { url = "https://files.pythonhosted.org/packages/17/6f/2551e45bea2938e0363ccdd54fa08dae7605ce782d4332497d31a7b97672/matplotlib-3.10.6-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:13fcd07ccf17e354398358e0307a1f53f5325dca22982556ddb9c52837b5af41", size = 8241220, upload-time = "2025-08-30T00:14:12.888Z" }, - { url = "https://files.pythonhosted.org/packages/54/7e/0f4c6e8b98105fdb162a4efde011af204ca47d7c05d735aff480ebfead1b/matplotlib-3.10.6-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:470fc846d59d1406e34fa4c32ba371039cd12c2fe86801159a965956f2575bd1", size = 8104624, upload-time = "2025-08-30T00:14:14.511Z" }, - { url = "https://files.pythonhosted.org/packages/27/27/c29696702b9317a6ade1ba6f8861e02d7423f18501729203d7a80b686f23/matplotlib-3.10.6-pp310-pypy310_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f7173f8551b88f4ef810a94adae3128c2530e0d07529f7141be7f8d8c365f051", size = 8682271, upload-time = "2025-08-30T00:14:17.273Z" }, - { url = "https://files.pythonhosted.org/packages/12/bb/02c35a51484aae5f49bd29f091286e7af5f3f677a9736c58a92b3c78baeb/matplotlib-3.10.6-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:f2d684c3204fa62421bbf770ddfebc6b50130f9cad65531eeba19236d73bb488", size = 8252296, upload-time = "2025-08-30T00:14:19.49Z" }, - { url = "https://files.pythonhosted.org/packages/7d/85/41701e3092005aee9a2445f5ee3904d9dbd4a7df7a45905ffef29b7ef098/matplotlib-3.10.6-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:6f4a69196e663a41d12a728fab8751177215357906436804217d6d9cf0d4d6cf", size = 8116749, upload-time = "2025-08-30T00:14:21.344Z" }, - { url = "https://files.pythonhosted.org/packages/16/53/8d8fa0ea32a8c8239e04d022f6c059ee5e1b77517769feccd50f1df43d6d/matplotlib-3.10.6-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:4d6ca6ef03dfd269f4ead566ec6f3fb9becf8dab146fb999022ed85ee9f6b3eb", size = 8693933, upload-time = "2025-08-30T00:14:22.942Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/8a/76/d3c6e3a13fe484ebe7718d14e269c9569c4eb0020a968a327acb3b9a8fe6/matplotlib-3.10.8.tar.gz", hash = "sha256:2299372c19d56bcd35cf05a2738308758d32b9eaed2371898d8f5bd33f084aa3", size = 34806269, upload-time = "2025-12-10T22:56:51.155Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/58/be/a30bd917018ad220c400169fba298f2bb7003c8ccbc0c3e24ae2aacad1e8/matplotlib-3.10.8-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:00270d217d6b20d14b584c521f810d60c5c78406dc289859776550df837dcda7", size = 8239828, upload-time = "2025-12-10T22:55:02.313Z" }, + { url = "https://files.pythonhosted.org/packages/58/27/ca01e043c4841078e82cf6e80a6993dfecd315c3d79f5f3153afbb8e1ec6/matplotlib-3.10.8-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:37b3c1cc42aa184b3f738cfa18c1c1d72fd496d85467a6cf7b807936d39aa656", size = 8128050, upload-time = "2025-12-10T22:55:04.997Z" }, + { url = "https://files.pythonhosted.org/packages/cb/aa/7ab67f2b729ae6a91bcf9dcac0affb95fb8c56f7fd2b2af894ae0b0cf6fa/matplotlib-3.10.8-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:ee40c27c795bda6a5292e9cff9890189d32f7e3a0bf04e0e3c9430c4a00c37df", size = 8700452, upload-time = "2025-12-10T22:55:07.47Z" }, + { url = "https://files.pythonhosted.org/packages/73/ae/2d5817b0acee3c49b7e7ccfbf5b273f284957cc8e270adf36375db353190/matplotlib-3.10.8-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:a48f2b74020919552ea25d222d5cc6af9ca3f4eb43a93e14d068457f545c2a17", size = 9534928, upload-time = "2025-12-10T22:55:10.566Z" }, + { url = "https://files.pythonhosted.org/packages/c9/5b/8e66653e9f7c39cb2e5cab25fce4810daffa2bff02cbf5f3077cea9e942c/matplotlib-3.10.8-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f254d118d14a7f99d616271d6c3c27922c092dac11112670b157798b89bf4933", size = 9586377, upload-time = "2025-12-10T22:55:12.362Z" }, + { url = "https://files.pythonhosted.org/packages/e2/e2/fd0bbadf837f81edb0d208ba8f8cb552874c3b16e27cb91a31977d90875d/matplotlib-3.10.8-cp310-cp310-win_amd64.whl", hash = "sha256:f9b587c9c7274c1613a30afabf65a272114cd6cdbe67b3406f818c79d7ab2e2a", size = 8128127, upload-time = "2025-12-10T22:55:14.436Z" }, + { url = "https://files.pythonhosted.org/packages/f8/86/de7e3a1cdcfc941483af70609edc06b83e7c8a0e0dc9ac325200a3f4d220/matplotlib-3.10.8-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:6be43b667360fef5c754dda5d25a32e6307a03c204f3c0fc5468b78fa87b4160", size = 8251215, upload-time = "2025-12-10T22:55:16.175Z" }, + { url = "https://files.pythonhosted.org/packages/fd/14/baad3222f424b19ce6ad243c71de1ad9ec6b2e4eb1e458a48fdc6d120401/matplotlib-3.10.8-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a2b336e2d91a3d7006864e0990c83b216fcdca64b5a6484912902cef87313d78", size = 8139625, upload-time = "2025-12-10T22:55:17.712Z" }, + { url = "https://files.pythonhosted.org/packages/8f/a0/7024215e95d456de5883e6732e708d8187d9753a21d32f8ddb3befc0c445/matplotlib-3.10.8-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:efb30e3baaea72ce5928e32bab719ab4770099079d66726a62b11b1ef7273be4", size = 8712614, upload-time = "2025-12-10T22:55:20.8Z" }, + { url = "https://files.pythonhosted.org/packages/5a/f4/b8347351da9a5b3f41e26cf547252d861f685c6867d179a7c9d60ad50189/matplotlib-3.10.8-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d56a1efd5bfd61486c8bc968fa18734464556f0fb8e51690f4ac25d85cbbbbc2", size = 9540997, upload-time = "2025-12-10T22:55:23.258Z" }, + { url = "https://files.pythonhosted.org/packages/9e/c0/c7b914e297efe0bc36917bf216b2acb91044b91e930e878ae12981e461e5/matplotlib-3.10.8-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:238b7ce5717600615c895050239ec955d91f321c209dd110db988500558e70d6", size = 9596825, upload-time = "2025-12-10T22:55:25.217Z" }, + { url = "https://files.pythonhosted.org/packages/6f/d3/a4bbc01c237ab710a1f22b4da72f4ff6d77eb4c7735ea9811a94ae239067/matplotlib-3.10.8-cp311-cp311-win_amd64.whl", hash = "sha256:18821ace09c763ec93aef5eeff087ee493a24051936d7b9ebcad9662f66501f9", size = 8135090, upload-time = "2025-12-10T22:55:27.162Z" }, + { url = "https://files.pythonhosted.org/packages/89/dd/a0b6588f102beab33ca6f5218b31725216577b2a24172f327eaf6417d5c9/matplotlib-3.10.8-cp311-cp311-win_arm64.whl", hash = "sha256:bab485bcf8b1c7d2060b4fcb6fc368a9e6f4cd754c9c2fea281f4be21df394a2", size = 8012377, upload-time = "2025-12-10T22:55:29.185Z" }, + { url = "https://files.pythonhosted.org/packages/9e/67/f997cdcbb514012eb0d10cd2b4b332667997fb5ebe26b8d41d04962fa0e6/matplotlib-3.10.8-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:64fcc24778ca0404ce0cb7b6b77ae1f4c7231cdd60e6778f999ee05cbd581b9a", size = 8260453, upload-time = "2025-12-10T22:55:30.709Z" }, + { url = "https://files.pythonhosted.org/packages/7e/65/07d5f5c7f7c994f12c768708bd2e17a4f01a2b0f44a1c9eccad872433e2e/matplotlib-3.10.8-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:b9a5ca4ac220a0cdd1ba6bcba3608547117d30468fefce49bb26f55c1a3d5c58", size = 8148321, upload-time = "2025-12-10T22:55:33.265Z" }, + { url = "https://files.pythonhosted.org/packages/3e/f3/c5195b1ae57ef85339fd7285dfb603b22c8b4e79114bae5f4f0fcf688677/matplotlib-3.10.8-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:3ab4aabc72de4ff77b3ec33a6d78a68227bf1123465887f9905ba79184a1cc04", size = 8716944, upload-time = "2025-12-10T22:55:34.922Z" }, + { url = "https://files.pythonhosted.org/packages/00/f9/7638f5cc82ec8a7aa005de48622eecc3ed7c9854b96ba15bd76b7fd27574/matplotlib-3.10.8-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:24d50994d8c5816ddc35411e50a86ab05f575e2530c02752e02538122613371f", size = 9550099, upload-time = "2025-12-10T22:55:36.789Z" }, + { url = "https://files.pythonhosted.org/packages/57/61/78cd5920d35b29fd2a0fe894de8adf672ff52939d2e9b43cb83cd5ce1bc7/matplotlib-3.10.8-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:99eefd13c0dc3b3c1b4d561c1169e65fe47aab7b8158754d7c084088e2329466", size = 9613040, upload-time = "2025-12-10T22:55:38.715Z" }, + { url = "https://files.pythonhosted.org/packages/30/4e/c10f171b6e2f44d9e3a2b96efa38b1677439d79c99357600a62cc1e9594e/matplotlib-3.10.8-cp312-cp312-win_amd64.whl", hash = "sha256:dd80ecb295460a5d9d260df63c43f4afbdd832d725a531f008dad1664f458adf", size = 8142717, upload-time = "2025-12-10T22:55:41.103Z" }, + { url = "https://files.pythonhosted.org/packages/f1/76/934db220026b5fef85f45d51a738b91dea7d70207581063cd9bd8fafcf74/matplotlib-3.10.8-cp312-cp312-win_arm64.whl", hash = "sha256:3c624e43ed56313651bc18a47f838b60d7b8032ed348911c54906b130b20071b", size = 8012751, upload-time = "2025-12-10T22:55:42.684Z" }, + { url = "https://files.pythonhosted.org/packages/3d/b9/15fd5541ef4f5b9a17eefd379356cf12175fe577424e7b1d80676516031a/matplotlib-3.10.8-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:3f2e409836d7f5ac2f1c013110a4d50b9f7edc26328c108915f9075d7d7a91b6", size = 8261076, upload-time = "2025-12-10T22:55:44.648Z" }, + { url = "https://files.pythonhosted.org/packages/8d/a0/2ba3473c1b66b9c74dc7107c67e9008cb1782edbe896d4c899d39ae9cf78/matplotlib-3.10.8-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:56271f3dac49a88d7fca5060f004d9d22b865f743a12a23b1e937a0be4818ee1", size = 8148794, upload-time = "2025-12-10T22:55:46.252Z" }, + { url = "https://files.pythonhosted.org/packages/75/97/a471f1c3eb1fd6f6c24a31a5858f443891d5127e63a7788678d14e249aea/matplotlib-3.10.8-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a0a7f52498f72f13d4a25ea70f35f4cb60642b466cbb0a9be951b5bc3f45a486", size = 8718474, upload-time = "2025-12-10T22:55:47.864Z" }, + { url = "https://files.pythonhosted.org/packages/01/be/cd478f4b66f48256f42927d0acbcd63a26a893136456cd079c0cc24fbabf/matplotlib-3.10.8-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:646d95230efb9ca614a7a594d4fcacde0ac61d25e37dd51710b36477594963ce", size = 9549637, upload-time = "2025-12-10T22:55:50.048Z" }, + { url = "https://files.pythonhosted.org/packages/5d/7c/8dc289776eae5109e268c4fb92baf870678dc048a25d4ac903683b86d5bf/matplotlib-3.10.8-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:f89c151aab2e2e23cb3fe0acad1e8b82841fd265379c4cecd0f3fcb34c15e0f6", size = 9613678, upload-time = "2025-12-10T22:55:52.21Z" }, + { url = "https://files.pythonhosted.org/packages/64/40/37612487cc8a437d4dd261b32ca21fe2d79510fe74af74e1f42becb1bdb8/matplotlib-3.10.8-cp313-cp313-win_amd64.whl", hash = "sha256:e8ea3e2d4066083e264e75c829078f9e149fa119d27e19acd503de65e0b13149", size = 8142686, upload-time = "2025-12-10T22:55:54.253Z" }, + { url = "https://files.pythonhosted.org/packages/66/52/8d8a8730e968185514680c2a6625943f70269509c3dcfc0dcf7d75928cb8/matplotlib-3.10.8-cp313-cp313-win_arm64.whl", hash = "sha256:c108a1d6fa78a50646029cb6d49808ff0fc1330fda87fa6f6250c6b5369b6645", size = 8012917, upload-time = "2025-12-10T22:55:56.268Z" }, + { url = "https://files.pythonhosted.org/packages/b5/27/51fe26e1062f298af5ef66343d8ef460e090a27fea73036c76c35821df04/matplotlib-3.10.8-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:ad3d9833a64cf48cc4300f2b406c3d0f4f4724a91c0bd5640678a6ba7c102077", size = 8305679, upload-time = "2025-12-10T22:55:57.856Z" }, + { url = "https://files.pythonhosted.org/packages/2c/1e/4de865bc591ac8e3062e835f42dd7fe7a93168d519557837f0e37513f629/matplotlib-3.10.8-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:eb3823f11823deade26ce3b9f40dcb4a213da7a670013929f31d5f5ed1055b22", size = 8198336, upload-time = "2025-12-10T22:55:59.371Z" }, + { url = "https://files.pythonhosted.org/packages/c6/cb/2f7b6e75fb4dce87ef91f60cac4f6e34f4c145ab036a22318ec837971300/matplotlib-3.10.8-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d9050fee89a89ed57b4fb2c1bfac9a3d0c57a0d55aed95949eedbc42070fea39", size = 8731653, upload-time = "2025-12-10T22:56:01.032Z" }, + { url = "https://files.pythonhosted.org/packages/46/b3/bd9c57d6ba670a37ab31fb87ec3e8691b947134b201f881665b28cc039ff/matplotlib-3.10.8-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b44d07310e404ba95f8c25aa5536f154c0a8ec473303535949e52eb71d0a1565", size = 9561356, upload-time = "2025-12-10T22:56:02.95Z" }, + { url = "https://files.pythonhosted.org/packages/c0/3d/8b94a481456dfc9dfe6e39e93b5ab376e50998cddfd23f4ae3b431708f16/matplotlib-3.10.8-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:0a33deb84c15ede243aead39f77e990469fff93ad1521163305095b77b72ce4a", size = 9614000, upload-time = "2025-12-10T22:56:05.411Z" }, + { url = "https://files.pythonhosted.org/packages/bd/cd/bc06149fe5585ba800b189a6a654a75f1f127e8aab02fd2be10df7fa500c/matplotlib-3.10.8-cp313-cp313t-win_amd64.whl", hash = "sha256:3a48a78d2786784cc2413e57397981fb45c79e968d99656706018d6e62e57958", size = 8220043, upload-time = "2025-12-10T22:56:07.551Z" }, + { url = "https://files.pythonhosted.org/packages/e3/de/b22cf255abec916562cc04eef457c13e58a1990048de0c0c3604d082355e/matplotlib-3.10.8-cp313-cp313t-win_arm64.whl", hash = "sha256:15d30132718972c2c074cd14638c7f4592bd98719e2308bccea40e0538bc0cb5", size = 8062075, upload-time = "2025-12-10T22:56:09.178Z" }, + { url = "https://files.pythonhosted.org/packages/f5/43/31d59500bb950b0d188e149a2e552040528c13d6e3d6e84d0cccac593dcd/matplotlib-3.10.8-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:f97aeb209c3d2511443f8797e3e5a569aebb040d4f8bc79aa3ee78a8fb9e3dd8", size = 8237252, upload-time = "2025-12-10T22:56:39.529Z" }, + { url = "https://files.pythonhosted.org/packages/0c/2c/615c09984f3c5f907f51c886538ad785cf72e0e11a3225de2c0f9442aecc/matplotlib-3.10.8-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:fb061f596dad3a0f52b60dc6a5dec4a0c300dec41e058a7efe09256188d170b7", size = 8124693, upload-time = "2025-12-10T22:56:41.758Z" }, + { url = "https://files.pythonhosted.org/packages/91/e1/2757277a1c56041e1fc104b51a0f7b9a4afc8eb737865d63cababe30bc61/matplotlib-3.10.8-pp310-pypy310_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:12d90df9183093fcd479f4172ac26b322b1248b15729cb57f42f71f24c7e37a3", size = 8702205, upload-time = "2025-12-10T22:56:43.415Z" }, + { url = "https://files.pythonhosted.org/packages/04/30/3afaa31c757f34b7725ab9d2ba8b48b5e89c2019c003e7d0ead143aabc5a/matplotlib-3.10.8-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:6da7c2ce169267d0d066adcf63758f0604aa6c3eebf67458930f9d9b79ad1db1", size = 8249198, upload-time = "2025-12-10T22:56:45.584Z" }, + { url = "https://files.pythonhosted.org/packages/48/2f/6334aec331f57485a642a7c8be03cb286f29111ae71c46c38b363230063c/matplotlib-3.10.8-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:9153c3292705be9f9c64498a8872118540c3f4123d1a1c840172edf262c8be4a", size = 8136817, upload-time = "2025-12-10T22:56:47.339Z" }, + { url = "https://files.pythonhosted.org/packages/73/e4/6d6f14b2a759c622f191b2d67e9075a3f56aaccb3be4bb9bb6890030d0a0/matplotlib-3.10.8-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:1ae029229a57cd1e8fe542485f27e7ca7b23aa9e8944ddb4985d0bc444f1eca2", size = 8713867, upload-time = "2025-12-10T22:56:48.954Z" }, ] [[package]] name = "matplotlib-inline" -version = "0.1.7" +version = "0.2.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/99/5b/a36a337438a14116b16480db471ad061c36c3694df7c2084a0da7ba538b7/matplotlib_inline-0.1.7.tar.gz", hash = "sha256:8423b23ec666be3d16e16b60bdd8ac4e86e840ebd1dd11a30b9f117f2fa0ab90", size = 8159, upload-time = "2024-04-15T13:44:44.803Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/8f/8e/9ad090d3553c280a8060fbf6e24dc1c0c29704ee7d1c372f0c174aa59285/matplotlib_inline-0.1.7-py3-none-any.whl", hash = "sha256:df192d39a4ff8f21b1895d72e6a13f5fcc5099f00fa84384e0ea28c2cc0653ca", size = 9899, upload-time = "2024-04-15T13:44:43.265Z" }, -] - -[[package]] -name = "mdurl" -version = "0.1.2" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/d6/54/cfe61301667036ec958cb99bd3efefba235e65cdeb9c84d24a8293ba1d90/mdurl-0.1.2.tar.gz", hash = "sha256:bb413d29f5eea38f31dd4754dd7377d4465116fb207585f97bf925588687c1ba", size = 8729, upload-time = "2022-08-14T12:40:10.846Z" } +sdist = { url = "https://files.pythonhosted.org/packages/c7/74/97e72a36efd4ae2bccb3463284300f8953f199b5ffbc04cbbb0ec78f74b1/matplotlib_inline-0.2.1.tar.gz", hash = "sha256:e1ee949c340d771fc39e241ea75683deb94762c8fa5f2927ec57c83c4dffa9fe", size = 8110, upload-time = "2025-10-23T09:00:22.126Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" }, + { url = "https://files.pythonhosted.org/packages/af/33/ee4519fa02ed11a94aef9559552f3b17bb863f2ecfe1a35dc7f548cde231/matplotlib_inline-0.2.1-py3-none-any.whl", hash = "sha256:d56ce5156ba6085e00a9d54fead6ed29a9c47e215cd1bba2e976ef39f5710a76", size = 9516, upload-time = "2025-10-23T09:00:20.675Z" }, ] [[package]] @@ -1704,9 +1722,9 @@ version = "2.0.6" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "networkx", version = "3.4.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "networkx", version = "3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "networkx", version = "3.6.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "packaging" }, { name = "rdkit" }, { name = "six" }, @@ -1716,91 +1734,44 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/f5/e8/7d1dfd89c39554298939cfdd20cc76aeef6c4404ab32fec1965b0192113c/mordredcommunity-2.0.6-py3-none-any.whl", hash = "sha256:116b484a98d1af74025ed308d0922e43ea9b8857e596702a320ef0d4b2db6296", size = 175966, upload-time = "2024-07-08T14:27:54.865Z" }, ] -[[package]] -name = "msgpack" -version = "1.1.1" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/45/b1/ea4f68038a18c77c9467400d166d74c4ffa536f34761f7983a104357e614/msgpack-1.1.1.tar.gz", hash = "sha256:77b79ce34a2bdab2594f490c8e80dd62a02d650b91a75159a63ec413b8d104cd", size = 173555, upload-time = "2025-06-13T06:52:51.324Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/33/52/f30da112c1dc92cf64f57d08a273ac771e7b29dea10b4b30369b2d7e8546/msgpack-1.1.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:353b6fc0c36fde68b661a12949d7d49f8f51ff5fa019c1e47c87c4ff34b080ed", size = 81799, upload-time = "2025-06-13T06:51:37.228Z" }, - { url = "https://files.pythonhosted.org/packages/e4/35/7bfc0def2f04ab4145f7f108e3563f9b4abae4ab0ed78a61f350518cc4d2/msgpack-1.1.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:79c408fcf76a958491b4e3b103d1c417044544b68e96d06432a189b43d1215c8", size = 78278, upload-time = "2025-06-13T06:51:38.534Z" }, - { url = "https://files.pythonhosted.org/packages/e8/c5/df5d6c1c39856bc55f800bf82778fd4c11370667f9b9e9d51b2f5da88f20/msgpack-1.1.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:78426096939c2c7482bf31ef15ca219a9e24460289c00dd0b94411040bb73ad2", size = 402805, upload-time = "2025-06-13T06:51:39.538Z" }, - { url = "https://files.pythonhosted.org/packages/20/8e/0bb8c977efecfe6ea7116e2ed73a78a8d32a947f94d272586cf02a9757db/msgpack-1.1.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8b17ba27727a36cb73aabacaa44b13090feb88a01d012c0f4be70c00f75048b4", size = 408642, upload-time = "2025-06-13T06:51:41.092Z" }, - { url = "https://files.pythonhosted.org/packages/59/a1/731d52c1aeec52006be6d1f8027c49fdc2cfc3ab7cbe7c28335b2910d7b6/msgpack-1.1.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7a17ac1ea6ec3c7687d70201cfda3b1e8061466f28f686c24f627cae4ea8efd0", size = 395143, upload-time = "2025-06-13T06:51:42.575Z" }, - { url = "https://files.pythonhosted.org/packages/2b/92/b42911c52cda2ba67a6418ffa7d08969edf2e760b09015593c8a8a27a97d/msgpack-1.1.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:88d1e966c9235c1d4e2afac21ca83933ba59537e2e2727a999bf3f515ca2af26", size = 395986, upload-time = "2025-06-13T06:51:43.807Z" }, - { url = "https://files.pythonhosted.org/packages/61/dc/8ae165337e70118d4dab651b8b562dd5066dd1e6dd57b038f32ebc3e2f07/msgpack-1.1.1-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:f6d58656842e1b2ddbe07f43f56b10a60f2ba5826164910968f5933e5178af75", size = 402682, upload-time = "2025-06-13T06:51:45.534Z" }, - { url = "https://files.pythonhosted.org/packages/58/27/555851cb98dcbd6ce041df1eacb25ac30646575e9cd125681aa2f4b1b6f1/msgpack-1.1.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:96decdfc4adcbc087f5ea7ebdcfd3dee9a13358cae6e81d54be962efc38f6338", size = 406368, upload-time = "2025-06-13T06:51:46.97Z" }, - { url = "https://files.pythonhosted.org/packages/d4/64/39a26add4ce16f24e99eabb9005e44c663db00e3fce17d4ae1ae9d61df99/msgpack-1.1.1-cp310-cp310-win32.whl", hash = "sha256:6640fd979ca9a212e4bcdf6eb74051ade2c690b862b679bfcb60ae46e6dc4bfd", size = 65004, upload-time = "2025-06-13T06:51:48.582Z" }, - { url = "https://files.pythonhosted.org/packages/7d/18/73dfa3e9d5d7450d39debde5b0d848139f7de23bd637a4506e36c9800fd6/msgpack-1.1.1-cp310-cp310-win_amd64.whl", hash = "sha256:8b65b53204fe1bd037c40c4148d00ef918eb2108d24c9aaa20bc31f9810ce0a8", size = 71548, upload-time = "2025-06-13T06:51:49.558Z" }, - { url = "https://files.pythonhosted.org/packages/7f/83/97f24bf9848af23fe2ba04380388216defc49a8af6da0c28cc636d722502/msgpack-1.1.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:71ef05c1726884e44f8b1d1773604ab5d4d17729d8491403a705e649116c9558", size = 82728, upload-time = "2025-06-13T06:51:50.68Z" }, - { url = "https://files.pythonhosted.org/packages/aa/7f/2eaa388267a78401f6e182662b08a588ef4f3de6f0eab1ec09736a7aaa2b/msgpack-1.1.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:36043272c6aede309d29d56851f8841ba907a1a3d04435e43e8a19928e243c1d", size = 79279, upload-time = "2025-06-13T06:51:51.72Z" }, - { url = "https://files.pythonhosted.org/packages/f8/46/31eb60f4452c96161e4dfd26dbca562b4ec68c72e4ad07d9566d7ea35e8a/msgpack-1.1.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a32747b1b39c3ac27d0670122b57e6e57f28eefb725e0b625618d1b59bf9d1e0", size = 423859, upload-time = "2025-06-13T06:51:52.749Z" }, - { url = "https://files.pythonhosted.org/packages/45/16/a20fa8c32825cc7ae8457fab45670c7a8996d7746ce80ce41cc51e3b2bd7/msgpack-1.1.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8a8b10fdb84a43e50d38057b06901ec9da52baac6983d3f709d8507f3889d43f", size = 429975, upload-time = "2025-06-13T06:51:53.97Z" }, - { url = "https://files.pythonhosted.org/packages/86/ea/6c958e07692367feeb1a1594d35e22b62f7f476f3c568b002a5ea09d443d/msgpack-1.1.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:ba0c325c3f485dc54ec298d8b024e134acf07c10d494ffa24373bea729acf704", size = 413528, upload-time = "2025-06-13T06:51:55.507Z" }, - { url = "https://files.pythonhosted.org/packages/75/05/ac84063c5dae79722bda9f68b878dc31fc3059adb8633c79f1e82c2cd946/msgpack-1.1.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:88daaf7d146e48ec71212ce21109b66e06a98e5e44dca47d853cbfe171d6c8d2", size = 413338, upload-time = "2025-06-13T06:51:57.023Z" }, - { url = "https://files.pythonhosted.org/packages/69/e8/fe86b082c781d3e1c09ca0f4dacd457ede60a13119b6ce939efe2ea77b76/msgpack-1.1.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:d8b55ea20dc59b181d3f47103f113e6f28a5e1c89fd5b67b9140edb442ab67f2", size = 422658, upload-time = "2025-06-13T06:51:58.419Z" }, - { url = "https://files.pythonhosted.org/packages/3b/2b/bafc9924df52d8f3bb7c00d24e57be477f4d0f967c0a31ef5e2225e035c7/msgpack-1.1.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:4a28e8072ae9779f20427af07f53bbb8b4aa81151054e882aee333b158da8752", size = 427124, upload-time = "2025-06-13T06:51:59.969Z" }, - { url = "https://files.pythonhosted.org/packages/a2/3b/1f717e17e53e0ed0b68fa59e9188f3f610c79d7151f0e52ff3cd8eb6b2dc/msgpack-1.1.1-cp311-cp311-win32.whl", hash = "sha256:7da8831f9a0fdb526621ba09a281fadc58ea12701bc709e7b8cbc362feabc295", size = 65016, upload-time = "2025-06-13T06:52:01.294Z" }, - { url = "https://files.pythonhosted.org/packages/48/45/9d1780768d3b249accecc5a38c725eb1e203d44a191f7b7ff1941f7df60c/msgpack-1.1.1-cp311-cp311-win_amd64.whl", hash = "sha256:5fd1b58e1431008a57247d6e7cc4faa41c3607e8e7d4aaf81f7c29ea013cb458", size = 72267, upload-time = "2025-06-13T06:52:02.568Z" }, - { url = "https://files.pythonhosted.org/packages/e3/26/389b9c593eda2b8551b2e7126ad3a06af6f9b44274eb3a4f054d48ff7e47/msgpack-1.1.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:ae497b11f4c21558d95de9f64fff7053544f4d1a17731c866143ed6bb4591238", size = 82359, upload-time = "2025-06-13T06:52:03.909Z" }, - { url = "https://files.pythonhosted.org/packages/ab/65/7d1de38c8a22cf8b1551469159d4b6cf49be2126adc2482de50976084d78/msgpack-1.1.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:33be9ab121df9b6b461ff91baac6f2731f83d9b27ed948c5b9d1978ae28bf157", size = 79172, upload-time = "2025-06-13T06:52:05.246Z" }, - { url = "https://files.pythonhosted.org/packages/0f/bd/cacf208b64d9577a62c74b677e1ada005caa9b69a05a599889d6fc2ab20a/msgpack-1.1.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6f64ae8fe7ffba251fecb8408540c34ee9df1c26674c50c4544d72dbf792e5ce", size = 425013, upload-time = "2025-06-13T06:52:06.341Z" }, - { url = "https://files.pythonhosted.org/packages/4d/ec/fd869e2567cc9c01278a736cfd1697941ba0d4b81a43e0aa2e8d71dab208/msgpack-1.1.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:a494554874691720ba5891c9b0b39474ba43ffb1aaf32a5dac874effb1619e1a", size = 426905, upload-time = "2025-06-13T06:52:07.501Z" }, - { url = "https://files.pythonhosted.org/packages/55/2a/35860f33229075bce803a5593d046d8b489d7ba2fc85701e714fc1aaf898/msgpack-1.1.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:cb643284ab0ed26f6957d969fe0dd8bb17beb567beb8998140b5e38a90974f6c", size = 407336, upload-time = "2025-06-13T06:52:09.047Z" }, - { url = "https://files.pythonhosted.org/packages/8c/16/69ed8f3ada150bf92745fb4921bd621fd2cdf5a42e25eb50bcc57a5328f0/msgpack-1.1.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:d275a9e3c81b1093c060c3837e580c37f47c51eca031f7b5fb76f7b8470f5f9b", size = 409485, upload-time = "2025-06-13T06:52:10.382Z" }, - { url = "https://files.pythonhosted.org/packages/c6/b6/0c398039e4c6d0b2e37c61d7e0e9d13439f91f780686deb8ee64ecf1ae71/msgpack-1.1.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:4fd6b577e4541676e0cc9ddc1709d25014d3ad9a66caa19962c4f5de30fc09ef", size = 412182, upload-time = "2025-06-13T06:52:11.644Z" }, - { url = "https://files.pythonhosted.org/packages/b8/d0/0cf4a6ecb9bc960d624c93effaeaae75cbf00b3bc4a54f35c8507273cda1/msgpack-1.1.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:bb29aaa613c0a1c40d1af111abf025f1732cab333f96f285d6a93b934738a68a", size = 419883, upload-time = "2025-06-13T06:52:12.806Z" }, - { url = "https://files.pythonhosted.org/packages/62/83/9697c211720fa71a2dfb632cad6196a8af3abea56eece220fde4674dc44b/msgpack-1.1.1-cp312-cp312-win32.whl", hash = "sha256:870b9a626280c86cff9c576ec0d9cbcc54a1e5ebda9cd26dab12baf41fee218c", size = 65406, upload-time = "2025-06-13T06:52:14.271Z" }, - { url = "https://files.pythonhosted.org/packages/c0/23/0abb886e80eab08f5e8c485d6f13924028602829f63b8f5fa25a06636628/msgpack-1.1.1-cp312-cp312-win_amd64.whl", hash = "sha256:5692095123007180dca3e788bb4c399cc26626da51629a31d40207cb262e67f4", size = 72558, upload-time = "2025-06-13T06:52:15.252Z" }, - { url = "https://files.pythonhosted.org/packages/a1/38/561f01cf3577430b59b340b51329803d3a5bf6a45864a55f4ef308ac11e3/msgpack-1.1.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:3765afa6bd4832fc11c3749be4ba4b69a0e8d7b728f78e68120a157a4c5d41f0", size = 81677, upload-time = "2025-06-13T06:52:16.64Z" }, - { url = "https://files.pythonhosted.org/packages/09/48/54a89579ea36b6ae0ee001cba8c61f776451fad3c9306cd80f5b5c55be87/msgpack-1.1.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:8ddb2bcfd1a8b9e431c8d6f4f7db0773084e107730ecf3472f1dfe9ad583f3d9", size = 78603, upload-time = "2025-06-13T06:52:17.843Z" }, - { url = "https://files.pythonhosted.org/packages/a0/60/daba2699b308e95ae792cdc2ef092a38eb5ee422f9d2fbd4101526d8a210/msgpack-1.1.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:196a736f0526a03653d829d7d4c5500a97eea3648aebfd4b6743875f28aa2af8", size = 420504, upload-time = "2025-06-13T06:52:18.982Z" }, - { url = "https://files.pythonhosted.org/packages/20/22/2ebae7ae43cd8f2debc35c631172ddf14e2a87ffcc04cf43ff9df9fff0d3/msgpack-1.1.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9d592d06e3cc2f537ceeeb23d38799c6ad83255289bb84c2e5792e5a8dea268a", size = 423749, upload-time = "2025-06-13T06:52:20.211Z" }, - { url = "https://files.pythonhosted.org/packages/40/1b/54c08dd5452427e1179a40b4b607e37e2664bca1c790c60c442c8e972e47/msgpack-1.1.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4df2311b0ce24f06ba253fda361f938dfecd7b961576f9be3f3fbd60e87130ac", size = 404458, upload-time = "2025-06-13T06:52:21.429Z" }, - { url = "https://files.pythonhosted.org/packages/2e/60/6bb17e9ffb080616a51f09928fdd5cac1353c9becc6c4a8abd4e57269a16/msgpack-1.1.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:e4141c5a32b5e37905b5940aacbc59739f036930367d7acce7a64e4dec1f5e0b", size = 405976, upload-time = "2025-06-13T06:52:22.995Z" }, - { url = "https://files.pythonhosted.org/packages/ee/97/88983e266572e8707c1f4b99c8fd04f9eb97b43f2db40e3172d87d8642db/msgpack-1.1.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:b1ce7f41670c5a69e1389420436f41385b1aa2504c3b0c30620764b15dded2e7", size = 408607, upload-time = "2025-06-13T06:52:24.152Z" }, - { url = "https://files.pythonhosted.org/packages/bc/66/36c78af2efaffcc15a5a61ae0df53a1d025f2680122e2a9eb8442fed3ae4/msgpack-1.1.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:4147151acabb9caed4e474c3344181e91ff7a388b888f1e19ea04f7e73dc7ad5", size = 424172, upload-time = "2025-06-13T06:52:25.704Z" }, - { url = "https://files.pythonhosted.org/packages/8c/87/a75eb622b555708fe0427fab96056d39d4c9892b0c784b3a721088c7ee37/msgpack-1.1.1-cp313-cp313-win32.whl", hash = "sha256:500e85823a27d6d9bba1d057c871b4210c1dd6fb01fbb764e37e4e8847376323", size = 65347, upload-time = "2025-06-13T06:52:26.846Z" }, - { url = "https://files.pythonhosted.org/packages/ca/91/7dc28d5e2a11a5ad804cf2b7f7a5fcb1eb5a4966d66a5d2b41aee6376543/msgpack-1.1.1-cp313-cp313-win_amd64.whl", hash = "sha256:6d489fba546295983abd142812bda76b57e33d0b9f5d5b71c09a583285506f69", size = 72341, upload-time = "2025-06-13T06:52:27.835Z" }, -] - [[package]] name = "mypy" -version = "1.18.2" +version = "1.19.1" source = { registry = "https://pypi.org/simple" } dependencies = [ + { name = "librt", marker = "platform_python_implementation != 'PyPy'" }, { name = "mypy-extensions" }, { name = "pathspec" }, { name = "tomli", marker = "python_full_version < '3.11'" }, { name = "typing-extensions" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/c0/77/8f0d0001ffad290cef2f7f216f96c814866248a0b92a722365ed54648e7e/mypy-1.18.2.tar.gz", hash = "sha256:06a398102a5f203d7477b2923dda3634c36727fa5c237d8f859ef90c42a9924b", size = 3448846, upload-time = "2025-09-19T00:11:10.519Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/03/6f/657961a0743cff32e6c0611b63ff1c1970a0b482ace35b069203bf705187/mypy-1.18.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:c1eab0cf6294dafe397c261a75f96dc2c31bffe3b944faa24db5def4e2b0f77c", size = 12807973, upload-time = "2025-09-19T00:10:35.282Z" }, - { url = "https://files.pythonhosted.org/packages/10/e9/420822d4f661f13ca8900f5fa239b40ee3be8b62b32f3357df9a3045a08b/mypy-1.18.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:7a780ca61fc239e4865968ebc5240bb3bf610ef59ac398de9a7421b54e4a207e", size = 11896527, upload-time = "2025-09-19T00:10:55.791Z" }, - { url = "https://files.pythonhosted.org/packages/aa/73/a05b2bbaa7005f4642fcfe40fb73f2b4fb6bb44229bd585b5878e9a87ef8/mypy-1.18.2-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:448acd386266989ef11662ce3c8011fd2a7b632e0ec7d61a98edd8e27472225b", size = 12507004, upload-time = "2025-09-19T00:11:05.411Z" }, - { url = "https://files.pythonhosted.org/packages/4f/01/f6e4b9f0d031c11ccbd6f17da26564f3a0f3c4155af344006434b0a05a9d/mypy-1.18.2-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f9e171c465ad3901dc652643ee4bffa8e9fef4d7d0eece23b428908c77a76a66", size = 13245947, upload-time = "2025-09-19T00:10:46.923Z" }, - { url = "https://files.pythonhosted.org/packages/d7/97/19727e7499bfa1ae0773d06afd30ac66a58ed7437d940c70548634b24185/mypy-1.18.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:592ec214750bc00741af1f80cbf96b5013d81486b7bb24cb052382c19e40b428", size = 13499217, upload-time = "2025-09-19T00:09:39.472Z" }, - { url = "https://files.pythonhosted.org/packages/9f/4f/90dc8c15c1441bf31cf0f9918bb077e452618708199e530f4cbd5cede6ff/mypy-1.18.2-cp310-cp310-win_amd64.whl", hash = "sha256:7fb95f97199ea11769ebe3638c29b550b5221e997c63b14ef93d2e971606ebed", size = 9766753, upload-time = "2025-09-19T00:10:49.161Z" }, - { url = "https://files.pythonhosted.org/packages/88/87/cafd3ae563f88f94eec33f35ff722d043e09832ea8530ef149ec1efbaf08/mypy-1.18.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:807d9315ab9d464125aa9fcf6d84fde6e1dc67da0b6f80e7405506b8ac72bc7f", size = 12731198, upload-time = "2025-09-19T00:09:44.857Z" }, - { url = "https://files.pythonhosted.org/packages/0f/e0/1e96c3d4266a06d4b0197ace5356d67d937d8358e2ee3ffac71faa843724/mypy-1.18.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:776bb00de1778caf4db739c6e83919c1d85a448f71979b6a0edd774ea8399341", size = 11817879, upload-time = "2025-09-19T00:09:47.131Z" }, - { url = "https://files.pythonhosted.org/packages/72/ef/0c9ba89eb03453e76bdac5a78b08260a848c7bfc5d6603634774d9cd9525/mypy-1.18.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1379451880512ffce14505493bd9fe469e0697543717298242574882cf8cdb8d", size = 12427292, upload-time = "2025-09-19T00:10:22.472Z" }, - { url = "https://files.pythonhosted.org/packages/1a/52/ec4a061dd599eb8179d5411d99775bec2a20542505988f40fc2fee781068/mypy-1.18.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1331eb7fd110d60c24999893320967594ff84c38ac6d19e0a76c5fd809a84c86", size = 13163750, upload-time = "2025-09-19T00:09:51.472Z" }, - { url = "https://files.pythonhosted.org/packages/c4/5f/2cf2ceb3b36372d51568f2208c021870fe7834cf3186b653ac6446511839/mypy-1.18.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3ca30b50a51e7ba93b00422e486cbb124f1c56a535e20eff7b2d6ab72b3b2e37", size = 13351827, upload-time = "2025-09-19T00:09:58.311Z" }, - { url = "https://files.pythonhosted.org/packages/c8/7d/2697b930179e7277529eaaec1513f8de622818696857f689e4a5432e5e27/mypy-1.18.2-cp311-cp311-win_amd64.whl", hash = "sha256:664dc726e67fa54e14536f6e1224bcfce1d9e5ac02426d2326e2bb4e081d1ce8", size = 9757983, upload-time = "2025-09-19T00:10:09.071Z" }, - { url = "https://files.pythonhosted.org/packages/07/06/dfdd2bc60c66611dd8335f463818514733bc763e4760dee289dcc33df709/mypy-1.18.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:33eca32dd124b29400c31d7cf784e795b050ace0e1f91b8dc035672725617e34", size = 12908273, upload-time = "2025-09-19T00:10:58.321Z" }, - { url = "https://files.pythonhosted.org/packages/81/14/6a9de6d13a122d5608e1a04130724caf9170333ac5a924e10f670687d3eb/mypy-1.18.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:a3c47adf30d65e89b2dcd2fa32f3aeb5e94ca970d2c15fcb25e297871c8e4764", size = 11920910, upload-time = "2025-09-19T00:10:20.043Z" }, - { url = "https://files.pythonhosted.org/packages/5f/a9/b29de53e42f18e8cc547e38daa9dfa132ffdc64f7250e353f5c8cdd44bee/mypy-1.18.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5d6c838e831a062f5f29d11c9057c6009f60cb294fea33a98422688181fe2893", size = 12465585, upload-time = "2025-09-19T00:10:33.005Z" }, - { url = "https://files.pythonhosted.org/packages/77/ae/6c3d2c7c61ff21f2bee938c917616c92ebf852f015fb55917fd6e2811db2/mypy-1.18.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:01199871b6110a2ce984bde85acd481232d17413868c9807e95c1b0739a58914", size = 13348562, upload-time = "2025-09-19T00:10:11.51Z" }, - { url = "https://files.pythonhosted.org/packages/4d/31/aec68ab3b4aebdf8f36d191b0685d99faa899ab990753ca0fee60fb99511/mypy-1.18.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a2afc0fa0b0e91b4599ddfe0f91e2c26c2b5a5ab263737e998d6817874c5f7c8", size = 13533296, upload-time = "2025-09-19T00:10:06.568Z" }, - { url = "https://files.pythonhosted.org/packages/9f/83/abcb3ad9478fca3ebeb6a5358bb0b22c95ea42b43b7789c7fb1297ca44f4/mypy-1.18.2-cp312-cp312-win_amd64.whl", hash = "sha256:d8068d0afe682c7c4897c0f7ce84ea77f6de953262b12d07038f4d296d547074", size = 9828828, upload-time = "2025-09-19T00:10:28.203Z" }, - { url = "https://files.pythonhosted.org/packages/5f/04/7f462e6fbba87a72bc8097b93f6842499c428a6ff0c81dd46948d175afe8/mypy-1.18.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:07b8b0f580ca6d289e69209ec9d3911b4a26e5abfde32228a288eb79df129fcc", size = 12898728, upload-time = "2025-09-19T00:10:01.33Z" }, - { url = "https://files.pythonhosted.org/packages/99/5b/61ed4efb64f1871b41fd0b82d29a64640f3516078f6c7905b68ab1ad8b13/mypy-1.18.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:ed4482847168439651d3feee5833ccedbf6657e964572706a2adb1f7fa4dfe2e", size = 11910758, upload-time = "2025-09-19T00:10:42.607Z" }, - { url = "https://files.pythonhosted.org/packages/3c/46/d297d4b683cc89a6e4108c4250a6a6b717f5fa96e1a30a7944a6da44da35/mypy-1.18.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c3ad2afadd1e9fea5cf99a45a822346971ede8685cc581ed9cd4d42eaf940986", size = 12475342, upload-time = "2025-09-19T00:11:00.371Z" }, - { url = "https://files.pythonhosted.org/packages/83/45/4798f4d00df13eae3bfdf726c9244bcb495ab5bd588c0eed93a2f2dd67f3/mypy-1.18.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a431a6f1ef14cf8c144c6b14793a23ec4eae3db28277c358136e79d7d062f62d", size = 13338709, upload-time = "2025-09-19T00:11:03.358Z" }, - { url = "https://files.pythonhosted.org/packages/d7/09/479f7358d9625172521a87a9271ddd2441e1dab16a09708f056e97007207/mypy-1.18.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7ab28cc197f1dd77a67e1c6f35cd1f8e8b73ed2217e4fc005f9e6a504e46e7ba", size = 13529806, upload-time = "2025-09-19T00:10:26.073Z" }, - { url = "https://files.pythonhosted.org/packages/71/cf/ac0f2c7e9d0ea3c75cd99dff7aec1c9df4a1376537cb90e4c882267ee7e9/mypy-1.18.2-cp313-cp313-win_amd64.whl", hash = "sha256:0e2785a84b34a72ba55fb5daf079a1003a34c05b22238da94fcae2bbe46f3544", size = 9833262, upload-time = "2025-09-19T00:10:40.035Z" }, - { url = "https://files.pythonhosted.org/packages/87/e3/be76d87158ebafa0309946c4a73831974d4d6ab4f4ef40c3b53a385a66fd/mypy-1.18.2-py3-none-any.whl", hash = "sha256:22a1748707dd62b58d2ae53562ffc4d7f8bcc727e8ac7cbc69c053ddc874d47e", size = 2352367, upload-time = "2025-09-19T00:10:15.489Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/f5/db/4efed9504bc01309ab9c2da7e352cc223569f05478012b5d9ece38fd44d2/mypy-1.19.1.tar.gz", hash = "sha256:19d88bb05303fe63f71dd2c6270daca27cb9401c4ca8255fe50d1d920e0eb9ba", size = 3582404, upload-time = "2025-12-15T05:03:48.42Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/2f/63/e499890d8e39b1ff2df4c0c6ce5d371b6844ee22b8250687a99fd2f657a8/mypy-1.19.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:5f05aa3d375b385734388e844bc01733bd33c644ab48e9684faa54e5389775ec", size = 13101333, upload-time = "2025-12-15T05:03:03.28Z" }, + { url = "https://files.pythonhosted.org/packages/72/4b/095626fc136fba96effc4fd4a82b41d688ab92124f8c4f7564bffe5cf1b0/mypy-1.19.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:022ea7279374af1a5d78dfcab853fe6a536eebfda4b59deab53cd21f6cd9f00b", size = 12164102, upload-time = "2025-12-15T05:02:33.611Z" }, + { url = "https://files.pythonhosted.org/packages/0c/5b/952928dd081bf88a83a5ccd49aaecfcd18fd0d2710c7ff07b8fb6f7032b9/mypy-1.19.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ee4c11e460685c3e0c64a4c5de82ae143622410950d6be863303a1c4ba0e36d6", size = 12765799, upload-time = "2025-12-15T05:03:28.44Z" }, + { url = "https://files.pythonhosted.org/packages/2a/0d/93c2e4a287f74ef11a66fb6d49c7a9f05e47b0a4399040e6719b57f500d2/mypy-1.19.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:de759aafbae8763283b2ee5869c7255391fbc4de3ff171f8f030b5ec48381b74", size = 13522149, upload-time = "2025-12-15T05:02:36.011Z" }, + { url = "https://files.pythonhosted.org/packages/7b/0e/33a294b56aaad2b338d203e3a1d8b453637ac36cb278b45005e0901cf148/mypy-1.19.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:ab43590f9cd5108f41aacf9fca31841142c786827a74ab7cc8a2eacb634e09a1", size = 13810105, upload-time = "2025-12-15T05:02:40.327Z" }, + { url = "https://files.pythonhosted.org/packages/0e/fd/3e82603a0cb66b67c5e7abababce6bf1a929ddf67bf445e652684af5c5a0/mypy-1.19.1-cp310-cp310-win_amd64.whl", hash = "sha256:2899753e2f61e571b3971747e302d5f420c3fd09650e1951e99f823bc3089dac", size = 10057200, upload-time = "2025-12-15T05:02:51.012Z" }, + { url = "https://files.pythonhosted.org/packages/ef/47/6b3ebabd5474d9cdc170d1342fbf9dddc1b0ec13ec90bf9004ee6f391c31/mypy-1.19.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:d8dfc6ab58ca7dda47d9237349157500468e404b17213d44fc1cb77bce532288", size = 13028539, upload-time = "2025-12-15T05:03:44.129Z" }, + { url = "https://files.pythonhosted.org/packages/5c/a6/ac7c7a88a3c9c54334f53a941b765e6ec6c4ebd65d3fe8cdcfbe0d0fd7db/mypy-1.19.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e3f276d8493c3c97930e354b2595a44a21348b320d859fb4a2b9f66da9ed27ab", size = 12083163, upload-time = "2025-12-15T05:03:37.679Z" }, + { url = "https://files.pythonhosted.org/packages/67/af/3afa9cf880aa4a2c803798ac24f1d11ef72a0c8079689fac5cfd815e2830/mypy-1.19.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:2abb24cf3f17864770d18d673c85235ba52456b36a06b6afc1e07c1fdcd3d0e6", size = 12687629, upload-time = "2025-12-15T05:02:31.526Z" }, + { url = "https://files.pythonhosted.org/packages/2d/46/20f8a7114a56484ab268b0ab372461cb3a8f7deed31ea96b83a4e4cfcfca/mypy-1.19.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a009ffa5a621762d0c926a078c2d639104becab69e79538a494bcccb62cc0331", size = 13436933, upload-time = "2025-12-15T05:03:15.606Z" }, + { url = "https://files.pythonhosted.org/packages/5b/f8/33b291ea85050a21f15da910002460f1f445f8007adb29230f0adea279cb/mypy-1.19.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:f7cee03c9a2e2ee26ec07479f38ea9c884e301d42c6d43a19d20fb014e3ba925", size = 13661754, upload-time = "2025-12-15T05:02:26.731Z" }, + { url = "https://files.pythonhosted.org/packages/fd/a3/47cbd4e85bec4335a9cd80cf67dbc02be21b5d4c9c23ad6b95d6c5196bac/mypy-1.19.1-cp311-cp311-win_amd64.whl", hash = "sha256:4b84a7a18f41e167f7995200a1d07a4a6810e89d29859df936f1c3923d263042", size = 10055772, upload-time = "2025-12-15T05:03:26.179Z" }, + { url = "https://files.pythonhosted.org/packages/06/8a/19bfae96f6615aa8a0604915512e0289b1fad33d5909bf7244f02935d33a/mypy-1.19.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:a8174a03289288c1f6c46d55cef02379b478bfbc8e358e02047487cad44c6ca1", size = 13206053, upload-time = "2025-12-15T05:03:46.622Z" }, + { url = "https://files.pythonhosted.org/packages/a5/34/3e63879ab041602154ba2a9f99817bb0c85c4df19a23a1443c8986e4d565/mypy-1.19.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:ffcebe56eb09ff0c0885e750036a095e23793ba6c2e894e7e63f6d89ad51f22e", size = 12219134, upload-time = "2025-12-15T05:03:24.367Z" }, + { url = "https://files.pythonhosted.org/packages/89/cc/2db6f0e95366b630364e09845672dbee0cbf0bbe753a204b29a944967cd9/mypy-1.19.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b64d987153888790bcdb03a6473d321820597ab8dd9243b27a92153c4fa50fd2", size = 12731616, upload-time = "2025-12-15T05:02:44.725Z" }, + { url = "https://files.pythonhosted.org/packages/00/be/dd56c1fd4807bc1eba1cf18b2a850d0de7bacb55e158755eb79f77c41f8e/mypy-1.19.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c35d298c2c4bba75feb2195655dfea8124d855dfd7343bf8b8c055421eaf0cf8", size = 13620847, upload-time = "2025-12-15T05:03:39.633Z" }, + { url = "https://files.pythonhosted.org/packages/6d/42/332951aae42b79329f743bf1da088cd75d8d4d9acc18fbcbd84f26c1af4e/mypy-1.19.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:34c81968774648ab5ac09c29a375fdede03ba253f8f8287847bd480782f73a6a", size = 13834976, upload-time = "2025-12-15T05:03:08.786Z" }, + { url = "https://files.pythonhosted.org/packages/6f/63/e7493e5f90e1e085c562bb06e2eb32cae27c5057b9653348d38b47daaecc/mypy-1.19.1-cp312-cp312-win_amd64.whl", hash = "sha256:b10e7c2cd7870ba4ad9b2d8a6102eb5ffc1f16ca35e3de6bfa390c1113029d13", size = 10118104, upload-time = "2025-12-15T05:03:10.834Z" }, + { url = "https://files.pythonhosted.org/packages/de/9f/a6abae693f7a0c697dbb435aac52e958dc8da44e92e08ba88d2e42326176/mypy-1.19.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:e3157c7594ff2ef1634ee058aafc56a82db665c9438fd41b390f3bde1ab12250", size = 13201927, upload-time = "2025-12-15T05:02:29.138Z" }, + { url = "https://files.pythonhosted.org/packages/9a/a4/45c35ccf6e1c65afc23a069f50e2c66f46bd3798cbe0d680c12d12935caa/mypy-1.19.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:bdb12f69bcc02700c2b47e070238f42cb87f18c0bc1fc4cdb4fb2bc5fd7a3b8b", size = 12206730, upload-time = "2025-12-15T05:03:01.325Z" }, + { url = "https://files.pythonhosted.org/packages/05/bb/cdcf89678e26b187650512620eec8368fded4cfd99cfcb431e4cdfd19dec/mypy-1.19.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f859fb09d9583a985be9a493d5cfc5515b56b08f7447759a0c5deaf68d80506e", size = 12724581, upload-time = "2025-12-15T05:03:20.087Z" }, + { url = "https://files.pythonhosted.org/packages/d1/32/dd260d52babf67bad8e6770f8e1102021877ce0edea106e72df5626bb0ec/mypy-1.19.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:c9a6538e0415310aad77cb94004ca6482330fece18036b5f360b62c45814c4ef", size = 13616252, upload-time = "2025-12-15T05:02:49.036Z" }, + { url = "https://files.pythonhosted.org/packages/71/d0/5e60a9d2e3bd48432ae2b454b7ef2b62a960ab51292b1eda2a95edd78198/mypy-1.19.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:da4869fc5e7f62a88f3fe0b5c919d1d9f7ea3cef92d3689de2823fd27e40aa75", size = 13840848, upload-time = "2025-12-15T05:02:55.95Z" }, + { url = "https://files.pythonhosted.org/packages/98/76/d32051fa65ecf6cc8c6610956473abdc9b4c43301107476ac03559507843/mypy-1.19.1-cp313-cp313-win_amd64.whl", hash = "sha256:016f2246209095e8eda7538944daa1d60e1e8134d98983b9fc1e92c1fc0cb8dd", size = 10135510, upload-time = "2025-12-15T05:02:58.438Z" }, + { url = "https://files.pythonhosted.org/packages/8d/f4/4ce9a05ce5ded1de3ec1c1d96cf9f9504a04e54ce0ed55cfa38619a32b8d/mypy-1.19.1-py3-none-any.whl", hash = "sha256:f1235f5ea01b7db5468d53ece6aaddf1ad0b88d9e7462b86ef96fe04995d7247", size = 2471239, upload-time = "2025-12-15T05:03:07.248Z" }, ] [[package]] @@ -1814,7 +1785,7 @@ wheels = [ [[package]] name = "nbclient" -version = "0.10.2" +version = "0.10.3" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jupyter-client" }, @@ -1822,9 +1793,9 @@ dependencies = [ { name = "nbformat" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/87/66/7ffd18d58eae90d5721f9f39212327695b749e23ad44b3881744eaf4d9e8/nbclient-0.10.2.tar.gz", hash = "sha256:90b7fc6b810630db87a6d0c2250b1f0ab4cf4d3c27a299b0cde78a4ed3fd9193", size = 62424, upload-time = "2024-12-19T10:32:27.164Z" } +sdist = { url = "https://files.pythonhosted.org/packages/8d/f3/1f6cf2ede4b026bc5f0b424cb41adf22f9c804e90a4dbd4fdb42291a35d5/nbclient-0.10.3.tar.gz", hash = "sha256:0baf171ee246e3bb2391da0635e719f27dc77d99aef59e0b04dcb935ee04c575", size = 62564, upload-time = "2025-12-19T15:50:09.331Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/34/6d/e7fa07f03a4a7b221d94b4d586edb754a9b0dc3c9e2c93353e9fa4e0d117/nbclient-0.10.2-py3-none-any.whl", hash = "sha256:4ffee11e788b4a27fabeb7955547e4318a5298f34342a4bfd01f2e1faaeadc3d", size = 25434, upload-time = "2024-12-19T10:32:24.139Z" }, + { url = "https://files.pythonhosted.org/packages/b2/77/0c73678f5260501a271fd7342bee5d639440f2e9e07d590f1100a056d87c/nbclient-0.10.3-py3-none-any.whl", hash = "sha256:39e9bd403504dd2484dd0fd25235bb6a683ce8cd9873356e40d880696adc9e35", size = 25473, upload-time = "2025-12-19T15:50:07.671Z" }, ] [[package]] @@ -1869,19 +1840,21 @@ wheels = [ [[package]] name = "nbsphinx" -version = "0.9.7" +version = "0.9.8" source = { registry = "https://pypi.org/simple" } dependencies = [ - { name = "docutils" }, + { name = "docutils", version = "0.21.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "docutils", version = "0.22.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "jinja2" }, { name = "nbconvert" }, { name = "nbformat" }, - { name = "sphinx" }, + { name = "sphinx", version = "8.1.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "sphinx", version = "9.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "traitlets" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/1e/84/b1856b7651ac34e965aa567a158714c7f3bd42a1b1ce76bf423ffb99872c/nbsphinx-0.9.7.tar.gz", hash = "sha256:abd298a686d55fa894ef697c51d44f24e53aa312dadae38e82920f250a5456fe", size = 180479, upload-time = "2025-03-03T19:46:08.069Z" } +sdist = { url = "https://files.pythonhosted.org/packages/e7/d1/82081750f8a78ad0399c6ed831d42623b891904e8e7b8a75878225cf1dce/nbsphinx-0.9.8.tar.gz", hash = "sha256:d0765908399a8ee2b57be7ae881cf2ea58d66db3af7bbf33e6eb48f83bea5495", size = 417469, upload-time = "2025-11-28T17:41:02.336Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/49/2d/8c8e635bcc6757573d311bb3c5445426382f280da32b8cd6d82d501ef4a4/nbsphinx-0.9.7-py3-none-any.whl", hash = "sha256:7292c3767fea29e405c60743eee5393682a83982ab202ff98f5eb2db02629da8", size = 31660, upload-time = "2025-03-03T19:46:06.581Z" }, + { url = "https://files.pythonhosted.org/packages/03/78/843bcf0cf31f88d2f8a9a063d2d80817b1901657d83d65b89b3aa835732e/nbsphinx-0.9.8-py3-none-any.whl", hash = "sha256:92d95ee91784e56bc633b60b767a6b6f23a0445f891e24641ce3c3f004759ccf", size = 31961, upload-time = "2025-11-28T17:41:00.796Z" }, ] [[package]] @@ -1907,29 +1880,29 @@ wheels = [ [[package]] name = "networkx" -version = "3.5" +version = "3.6.1" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.12'", "python_full_version == '3.11.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/6c/4f/ccdb8ad3a38e583f214547fd2f7ff1fc160c43a75af88e6aec213404b96a/networkx-3.5.tar.gz", hash = "sha256:d4c6f9cf81f52d69230866796b82afbccdec3db7ae4fbd1b65ea750feed50037", size = 2471065, upload-time = "2025-05-29T11:35:07.804Z" } +sdist = { url = "https://files.pythonhosted.org/packages/6a/51/63fe664f3908c97be9d2e4f1158eb633317598cfa6e1fc14af5383f17512/networkx-3.6.1.tar.gz", hash = "sha256:26b7c357accc0c8cde558ad486283728b65b6a95d85ee1cd66bafab4c8168509", size = 2517025, upload-time = "2025-12-08T17:02:39.908Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/eb/8d/776adee7bbf76365fdd7f2552710282c79a4ead5d2a46408c9043a2b70ba/networkx-3.5-py3-none-any.whl", hash = "sha256:0030d386a9a06dee3565298b4a734b68589749a544acbb6c412dc9e2489ec6ec", size = 2034406, upload-time = "2025-05-29T11:35:04.961Z" }, + { url = "https://files.pythonhosted.org/packages/9e/c9/b2622292ea83fbb4ec318f5b9ab867d0a28ab43c5717bb85b0a5f6b3b0a4/networkx-3.6.1-py3-none-any.whl", hash = "sha256:d47fbf302e7d9cbbb9e2555a0d267983d2aa476bac30e90dfbe5669bd57f3762", size = 2068504, upload-time = "2025-12-08T17:02:38.159Z" }, ] [[package]] name = "nodeenv" -version = "1.9.1" +version = "1.10.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/43/16/fc88b08840de0e0a72a2f9d8c6bae36be573e475a6326ae854bcc549fc45/nodeenv-1.9.1.tar.gz", hash = "sha256:6ec12890a2dab7946721edbfbcd91f3319c6ccc9aec47be7c7e6b7011ee6645f", size = 47437, upload-time = "2024-06-04T18:44:11.171Z" } +sdist = { url = "https://files.pythonhosted.org/packages/24/bf/d1bda4f6168e0b2e9e5958945e01910052158313224ada5ce1fb2e1113b8/nodeenv-1.10.0.tar.gz", hash = "sha256:996c191ad80897d076bdfba80a41994c2b47c68e224c542b48feba42ba00f8bb", size = 55611, upload-time = "2025-12-20T14:08:54.006Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/d2/1d/1b658dbd2b9fa9c4c9f32accbfc0205d532c8c6194dc0f2a4c0428e7128a/nodeenv-1.9.1-py2.py3-none-any.whl", hash = "sha256:ba11c9782d29c27c70ffbdda2d7415098754709be8a7056d79a737cd901155c9", size = 22314, upload-time = "2024-06-04T18:44:08.352Z" }, + { url = "https://files.pythonhosted.org/packages/88/b2/d0896bdcdc8d28a7fc5717c305f1a861c26e18c05047949fb371034d98bd/nodeenv-1.10.0-py2.py3-none-any.whl", hash = "sha256:5bb13e3eed2923615535339b3c620e76779af4cb4c6a90deccc9e36b274d3827", size = 23438, upload-time = "2025-12-20T14:08:52.782Z" }, ] [[package]] name = "notebook" -version = "7.4.5" +version = "7.5.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "jupyter-server" }, @@ -1938,9 +1911,9 @@ dependencies = [ { name = "notebook-shim" }, { name = "tornado" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/9f/21/9669982f9569e7478763837e0d35b9fd9f43de0eb5ab5d6ca620b8019cfc/notebook-7.4.5.tar.gz", hash = "sha256:7c2c4ea245913c3ad8ab3e5d36b34a842c06e524556f5c2e1f5d7d08c986615e", size = 13888993, upload-time = "2025-08-05T07:40:56.529Z" } +sdist = { url = "https://files.pythonhosted.org/packages/8a/a9/882707b0aa639e6d7d3e7df4bfbe07479d832e9a8f02d8471002a4ea6d65/notebook-7.5.1.tar.gz", hash = "sha256:b2fb4cef4d47d08c33aecce1c6c6e84be05436fbd791f88fce8df9fbca088b75", size = 14058696, upload-time = "2025-12-16T07:38:59.223Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/fe/c7/207fd1138bd82435d13b6d8640a240be4d855b8ddb41f6bf31aca5be64df/notebook-7.4.5-py3-none-any.whl", hash = "sha256:351635461aca9dad08cf8946a4216f963e2760cc1bf7b1aaaecb23afc33ec046", size = 14295193, upload-time = "2025-08-05T07:40:52.586Z" }, + { url = "https://files.pythonhosted.org/packages/d1/86/ca516cb58ad2cb2064124d31cf0fd8b012fca64bebeb26da2d2ddf03fc79/notebook-7.5.1-py3-none-any.whl", hash = "sha256:f4e2451c19910c33b88709b84537e11f6368c1cdff1aa0c43db701aea535dd44", size = 14468080, upload-time = "2025-12-16T07:38:55.644Z" }, ] [[package]] @@ -1957,35 +1930,31 @@ wheels = [ [[package]] name = "numba" -version = "0.62.0" +version = "0.63.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "llvmlite" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/e5/96/66dae7911cb331e99bf9afe35703317d8da0fad81ff49fed77f4855e4b60/numba-0.62.0.tar.gz", hash = "sha256:2afcc7899dc93fefecbb274a19c592170bc2dbfae02b00f83e305332a9857a5a", size = 2749680, upload-time = "2025-09-18T17:58:11.394Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/74/b3/f60339dda8bfb972aaeb70ccd455d9d66e02b45fa9c7f8464a35710ffeb2/numba-0.62.0-cp310-cp310-macosx_10_15_x86_64.whl", hash = "sha256:3e7eaff7ce35799de4dda09a4cfcf1bb204ad59be5fa29a1efc080c0a72eb6d6", size = 2684282, upload-time = "2025-09-18T17:59:10.448Z" }, - { url = "https://files.pythonhosted.org/packages/df/8a/b89cd39902760f76ddd13b21174686ef07a9930b158033c6963345e9ad2e/numba-0.62.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:a7694c45ddfe5c9a26d05cd2bf378e214ae2d5332601a3c89c94207eb4661166", size = 2687314, upload-time = "2025-09-18T17:59:24.431Z" }, - { url = "https://files.pythonhosted.org/packages/44/45/b8a1582f811e3be786d241126263e9428c1a049cd7ff484b3dbafc8e9561/numba-0.62.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c2f07c6e67e8f54dba62a46a3b72294c5f4333ff703eb8966576ef731cc8ecd7", size = 3444905, upload-time = "2025-09-18T17:58:36.697Z" }, - { url = "https://files.pythonhosted.org/packages/11/92/590568cc0c3268cbebd55b5d8d5a5a73764c58623a4b3d91fa0392da9cf1/numba-0.62.0-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7f77fadaa6592d2a6b9c35bcddc710b22dceca0af9a7037dbc61ff209eaddfa8", size = 3441233, upload-time = "2025-09-18T17:58:55.223Z" }, - { url = "https://files.pythonhosted.org/packages/96/1f/40535d58807177829864a482cfa1a85b3de10068865076fe54f8fce255be/numba-0.62.0-cp310-cp310-win_amd64.whl", hash = "sha256:77050a79f6bc19324c2f6f456c074a49d3de35c8124c91668054e9d62243ac99", size = 2745650, upload-time = "2025-09-18T17:59:37.856Z" }, - { url = "https://files.pythonhosted.org/packages/4d/ba/691508c81c3e8ff6c4a131755556a39a6f73f8aec3750ff8ba7bb9b23585/numba-0.62.0-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:1370708a54281e1dd3e4b73f423f88d3b34b64cf3f5fa0e460a1fbe6bd4e0f3f", size = 2684281, upload-time = "2025-09-18T17:59:14.333Z" }, - { url = "https://files.pythonhosted.org/packages/ae/f0/9c1b0a23e09297e292f1f2deea0b7bbe52b112fb6d9fb46beb1f7016f6d6/numba-0.62.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:6bd7032d6c1e771967fc1d07a499bb10ce1639662451fc0a86089fa8efc420e7", size = 2687331, upload-time = "2025-09-18T17:59:28.232Z" }, - { url = "https://files.pythonhosted.org/packages/ee/77/b497d480abf9c3547b8374e58794532a7e3600a378408e0ff8fbf2532dc9/numba-0.62.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:87cdc476ea1b2feefb7f893a648be2f1e7a04f671f355ac9bbeb007eaf039f8c", size = 3450243, upload-time = "2025-09-18T17:58:41.724Z" }, - { url = "https://files.pythonhosted.org/packages/a4/42/68bcb890bc5e8c254145f4a5f2c7e90ec653b27271780e3eef36086522a4/numba-0.62.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:144a57e504a5423acfc91fcd3be4e6481cb0667ce0bcc6cd3e8bd43a735b58a4", size = 3445595, upload-time = "2025-09-18T17:58:58.989Z" }, - { url = "https://files.pythonhosted.org/packages/5e/8c/889b895f5daafc44cbd7b798f748fd9b9555cb0604fa03004dc535bd8b5c/numba-0.62.0-cp311-cp311-win_amd64.whl", hash = "sha256:499b00e0bd95c83fedf1cbf349b7132a432a90292cbe2014eeaf482ce7c3b9f8", size = 2745535, upload-time = "2025-09-18T17:59:42.001Z" }, - { url = "https://files.pythonhosted.org/packages/5f/cc/8c519b15d51647bd092a3b935e92681c0ec983647bb7ec1b48ca05094eb5/numba-0.62.0-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:82edb589c9607ec2dbe0b2d34793d8c5104daf766277acc49ad7e179f8634fd2", size = 2685349, upload-time = "2025-09-18T17:59:17.651Z" }, - { url = "https://files.pythonhosted.org/packages/b1/0f/992aa8b62b23ebc56db97ac29fa6c8e5b097e30d575745048de4e99364b8/numba-0.62.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:469e042750d5a6aa6847dc89d64de5f0bfaf2208b6d442e4634de3318b7043de", size = 2688140, upload-time = "2025-09-18T17:59:31.191Z" }, - { url = "https://files.pythonhosted.org/packages/0b/1f/a67f3a94f42a3bc90c052f446e4fa1089b513129b8dbf61df74b25ab24ea/numba-0.62.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:2ad2dc2b3583f8f24f35c8ade7e215c44590c9aa757ccba640dd293297cb15bb", size = 3506358, upload-time = "2025-09-18T17:58:46.296Z" }, - { url = "https://files.pythonhosted.org/packages/e0/8a/0c451c2626cbaf6a1c3f3665bd5859671e9f065b9ee9a101fb08659a46e2/numba-0.62.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0266998a842074fc91bfc406dd91c8ee12c196ea834375af6174f62647ffd9b1", size = 3496571, upload-time = "2025-09-18T17:59:03.009Z" }, - { url = "https://files.pythonhosted.org/packages/16/9a/40e66e5992d5365f4f2f636148e3a333eb012e1690cbc0b5d7d296e5d11c/numba-0.62.0-cp312-cp312-win_amd64.whl", hash = "sha256:cbc84e030548a5aad74971eb1a579f69edc7da961d89ef09a5ee1fe01c207795", size = 2745542, upload-time = "2025-09-18T17:59:44.942Z" }, - { url = "https://files.pythonhosted.org/packages/33/ff/dd3047eb05e9bcf5c986885a645d8dd1df509ebf1f9b0091c143b1ebc6b4/numba-0.62.0-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:07e76ac7bcd47156a758df52e9752fdfb94ff5f80b78c4710cabc568d8d3d6ad", size = 2685768, upload-time = "2025-09-18T17:59:21.128Z" }, - { url = "https://files.pythonhosted.org/packages/b9/57/bdc50e30b8fcf387cfe596e42ec4d9b8b3e2121cc1171ecbb990535a9aa9/numba-0.62.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:a972689dad64a7047f555d93ce829fe05ca2519ad0cf7af0071a64145c571039", size = 2688742, upload-time = "2025-09-18T17:59:34.674Z" }, - { url = "https://files.pythonhosted.org/packages/45/1e/e4e3fe4bcd971ea8e5f22f58f4dcce4b9f69c1299ff81f5740e3a007e817/numba-0.62.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f789b1f2997fc34b1b88fcc4481886dcd44afcffbd3e28affedce54aec7fdcc1", size = 3514481, upload-time = "2025-09-18T17:58:51.201Z" }, - { url = "https://files.pythonhosted.org/packages/f0/ac/98205cb536b756a3b9d2d198df8deee32cb4ec01740af77715c67f84c402/numba-0.62.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:516525981f19f36d3a0bada0fb7479cf0bf925b5e389d03aac87f3758c5cfb9e", size = 3503501, upload-time = "2025-09-18T17:59:06.568Z" }, - { url = "https://files.pythonhosted.org/packages/98/a2/3a9eb747d77693054504540e9da0640c169dd97e3e268c1150bf55a22b97/numba-0.62.0-cp313-cp313-win_amd64.whl", hash = "sha256:591a9c485904f219a129b0493f89d27de24286fb66dd5a577b11edc62fc78db4", size = 2745529, upload-time = "2025-09-18T17:59:47.496Z" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/dc/60/0145d479b2209bd8fdae5f44201eceb8ce5a23e0ed54c71f57db24618665/numba-0.63.1.tar.gz", hash = "sha256:b320aa675d0e3b17b40364935ea52a7b1c670c9037c39cf92c49502a75902f4b", size = 2761666, upload-time = "2025-12-10T02:57:39.002Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5e/ce/5283d4ffa568f795bb0fd61ee1f0efc0c6094b94209259167fc8d4276bde/numba-0.63.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:c6d6bf5bf00f7db629305caaec82a2ffb8abe2bf45eaad0d0738dc7de4113779", size = 2680810, upload-time = "2025-12-10T02:56:55.269Z" }, + { url = "https://files.pythonhosted.org/packages/0f/72/a8bda517e26d912633b32626333339b7c769ea73a5c688365ea5f88fd07e/numba-0.63.1-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:08653d0dfc9cc9c4c9a8fba29ceb1f2d5340c3b86c4a7e5e07e42b643bc6a2f4", size = 3739735, upload-time = "2025-12-10T02:56:57.922Z" }, + { url = "https://files.pythonhosted.org/packages/ca/17/1913b7c1173b2db30fb7a9696892a7c4c59aeee777a9af6859e9e01bac51/numba-0.63.1-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f09eebf5650246ce2a4e9a8d38270e2d4b0b0ae978103bafb38ed7adc5ea906e", size = 3446707, upload-time = "2025-12-10T02:56:59.837Z" }, + { url = "https://files.pythonhosted.org/packages/b4/77/703db56c3061e9fdad5e79c91452947fdeb2ec0bdfe4affe9b144e7025e0/numba-0.63.1-cp310-cp310-win_amd64.whl", hash = "sha256:f8bba17421d865d8c0f7be2142754ebce53e009daba41c44cf6909207d1a8d7d", size = 2747374, upload-time = "2025-12-10T02:57:07.908Z" }, + { url = "https://files.pythonhosted.org/packages/70/90/5f8614c165d2e256fbc6c57028519db6f32e4982475a372bbe550ea0454c/numba-0.63.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:b33db00f18ccc790ee9911ce03fcdfe9d5124637d1ecc266f5ae0df06e02fec3", size = 2680501, upload-time = "2025-12-10T02:57:09.797Z" }, + { url = "https://files.pythonhosted.org/packages/dc/9d/d0afc4cf915edd8eadd9b2ab5b696242886ee4f97720d9322650d66a88c6/numba-0.63.1-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7d31ea186a78a7c0f6b1b2a3fe68057fdb291b045c52d86232b5383b6cf4fc25", size = 3744945, upload-time = "2025-12-10T02:57:11.697Z" }, + { url = "https://files.pythonhosted.org/packages/05/a9/d82f38f2ab73f3be6f838a826b545b80339762ee8969c16a8bf1d39395a8/numba-0.63.1-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ed3bb2fbdb651d6aac394388130a7001aab6f4541837123a4b4ab8b02716530c", size = 3450827, upload-time = "2025-12-10T02:57:13.709Z" }, + { url = "https://files.pythonhosted.org/packages/18/3f/a9b106e93c5bd7434e65f044bae0d204e20aa7f7f85d72ceb872c7c04216/numba-0.63.1-cp311-cp311-win_amd64.whl", hash = "sha256:1ecbff7688f044b1601be70113e2fb1835367ee0b28ffa8f3adf3a05418c5c87", size = 2747262, upload-time = "2025-12-10T02:57:15.664Z" }, + { url = "https://files.pythonhosted.org/packages/14/9c/c0974cd3d00ff70d30e8ff90522ba5fbb2bcee168a867d2321d8d0457676/numba-0.63.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:2819cd52afa5d8d04e057bdfd54367575105f8829350d8fb5e4066fb7591cc71", size = 2680981, upload-time = "2025-12-10T02:57:17.579Z" }, + { url = "https://files.pythonhosted.org/packages/cb/70/ea2bc45205f206b7a24ee68a159f5097c9ca7e6466806e7c213587e0c2b1/numba-0.63.1-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5cfd45dbd3d409e713b1ccfdc2ee72ca82006860254429f4ef01867fdba5845f", size = 3801656, upload-time = "2025-12-10T02:57:19.106Z" }, + { url = "https://files.pythonhosted.org/packages/0d/82/4f4ba4fd0f99825cbf3cdefd682ca3678be1702b63362011de6e5f71f831/numba-0.63.1-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:69a599df6976c03b7ecf15d05302696f79f7e6d10d620367407517943355bcb0", size = 3501857, upload-time = "2025-12-10T02:57:20.721Z" }, + { url = "https://files.pythonhosted.org/packages/af/fd/6540456efa90b5f6604a86ff50dabefb187e43557e9081adcad3be44f048/numba-0.63.1-cp312-cp312-win_amd64.whl", hash = "sha256:bbad8c63e4fc7eb3cdb2c2da52178e180419f7969f9a685f283b313a70b92af3", size = 2750282, upload-time = "2025-12-10T02:57:22.474Z" }, + { url = "https://files.pythonhosted.org/packages/57/f7/e19e6eff445bec52dde5bed1ebb162925a8e6f988164f1ae4b3475a73680/numba-0.63.1-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:0bd4fd820ef7442dcc07da184c3f54bb41d2bdb7b35bacf3448e73d081f730dc", size = 2680954, upload-time = "2025-12-10T02:57:24.145Z" }, + { url = "https://files.pythonhosted.org/packages/e9/6c/1e222edba1e20e6b113912caa9b1665b5809433cbcb042dfd133c6f1fd38/numba-0.63.1-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:53de693abe4be3bd4dee38e1c55f01c55ff644a6a3696a3670589e6e4c39cde2", size = 3809736, upload-time = "2025-12-10T02:57:25.836Z" }, + { url = "https://files.pythonhosted.org/packages/76/0a/590bad11a8b3feeac30a24d01198d46bdb76ad15c70d3a530691ce3cae58/numba-0.63.1-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:81227821a72a763c3d4ac290abbb4371d855b59fdf85d5af22a47c0e86bf8c7e", size = 3508854, upload-time = "2025-12-10T02:57:27.438Z" }, + { url = "https://files.pythonhosted.org/packages/4e/f5/3800384a24eed1e4d524669cdbc0b9b8a628800bb1e90d7bd676e5f22581/numba-0.63.1-cp313-cp313-win_amd64.whl", hash = "sha256:eb227b07c2ac37b09432a9bda5142047a2d1055646e089d4a240a2643e508102", size = 2750228, upload-time = "2025-12-10T02:57:30.36Z" }, ] [[package]] @@ -2055,83 +2024,123 @@ wheels = [ [[package]] name = "numpy" -version = "2.3.3" +version = "2.3.5" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.12'", "python_full_version == '3.11.*'", ] -sdist = { url = "https://files.pythonhosted.org/packages/d0/19/95b3d357407220ed24c139018d2518fab0a61a948e68286a25f1a4d049ff/numpy-2.3.3.tar.gz", hash = "sha256:ddc7c39727ba62b80dfdbedf400d1c10ddfa8eefbd7ec8dcb118be8b56d31029", size = 20576648, upload-time = "2025-09-09T16:54:12.543Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/7a/45/e80d203ef6b267aa29b22714fb558930b27960a0c5ce3c19c999232bb3eb/numpy-2.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:0ffc4f5caba7dfcbe944ed674b7eef683c7e94874046454bb79ed7ee0236f59d", size = 21259253, upload-time = "2025-09-09T15:56:02.094Z" }, - { url = "https://files.pythonhosted.org/packages/52/18/cf2c648fccf339e59302e00e5f2bc87725a3ce1992f30f3f78c9044d7c43/numpy-2.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:e7e946c7170858a0295f79a60214424caac2ffdb0063d4d79cb681f9aa0aa569", size = 14450980, upload-time = "2025-09-09T15:56:05.926Z" }, - { url = "https://files.pythonhosted.org/packages/93/fb/9af1082bec870188c42a1c239839915b74a5099c392389ff04215dcee812/numpy-2.3.3-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:cd4260f64bc794c3390a63bf0728220dd1a68170c169088a1e0dfa2fde1be12f", size = 5379709, upload-time = "2025-09-09T15:56:07.95Z" }, - { url = "https://files.pythonhosted.org/packages/75/0f/bfd7abca52bcbf9a4a65abc83fe18ef01ccdeb37bfb28bbd6ad613447c79/numpy-2.3.3-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:f0ddb4b96a87b6728df9362135e764eac3cfa674499943ebc44ce96c478ab125", size = 6913923, upload-time = "2025-09-09T15:56:09.443Z" }, - { url = "https://files.pythonhosted.org/packages/79/55/d69adad255e87ab7afda1caf93ca997859092afeb697703e2f010f7c2e55/numpy-2.3.3-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:afd07d377f478344ec6ca2b8d4ca08ae8bd44706763d1efb56397de606393f48", size = 14589591, upload-time = "2025-09-09T15:56:11.234Z" }, - { url = "https://files.pythonhosted.org/packages/10/a2/010b0e27ddeacab7839957d7a8f00e91206e0c2c47abbb5f35a2630e5387/numpy-2.3.3-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bc92a5dedcc53857249ca51ef29f5e5f2f8c513e22cfb90faeb20343b8c6f7a6", size = 16938714, upload-time = "2025-09-09T15:56:14.637Z" }, - { url = "https://files.pythonhosted.org/packages/1c/6b/12ce8ede632c7126eb2762b9e15e18e204b81725b81f35176eac14dc5b82/numpy-2.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:7af05ed4dc19f308e1d9fc759f36f21921eb7bbfc82843eeec6b2a2863a0aefa", size = 16370592, upload-time = "2025-09-09T15:56:17.285Z" }, - { url = "https://files.pythonhosted.org/packages/b4/35/aba8568b2593067bb6a8fe4c52babb23b4c3b9c80e1b49dff03a09925e4a/numpy-2.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:433bf137e338677cebdd5beac0199ac84712ad9d630b74eceeb759eaa45ddf30", size = 18884474, upload-time = "2025-09-09T15:56:20.943Z" }, - { url = "https://files.pythonhosted.org/packages/45/fa/7f43ba10c77575e8be7b0138d107e4f44ca4a1ef322cd16980ea3e8b8222/numpy-2.3.3-cp311-cp311-win32.whl", hash = "sha256:eb63d443d7b4ffd1e873f8155260d7f58e7e4b095961b01c91062935c2491e57", size = 6599794, upload-time = "2025-09-09T15:56:23.258Z" }, - { url = "https://files.pythonhosted.org/packages/0a/a2/a4f78cb2241fe5664a22a10332f2be886dcdea8784c9f6a01c272da9b426/numpy-2.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:ec9d249840f6a565f58d8f913bccac2444235025bbb13e9a4681783572ee3caa", size = 13088104, upload-time = "2025-09-09T15:56:25.476Z" }, - { url = "https://files.pythonhosted.org/packages/79/64/e424e975adbd38282ebcd4891661965b78783de893b381cbc4832fb9beb2/numpy-2.3.3-cp311-cp311-win_arm64.whl", hash = "sha256:74c2a948d02f88c11a3c075d9733f1ae67d97c6bdb97f2bb542f980458b257e7", size = 10460772, upload-time = "2025-09-09T15:56:27.679Z" }, - { url = "https://files.pythonhosted.org/packages/51/5d/bb7fc075b762c96329147799e1bcc9176ab07ca6375ea976c475482ad5b3/numpy-2.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:cfdd09f9c84a1a934cde1eec2267f0a43a7cd44b2cca4ff95b7c0d14d144b0bf", size = 20957014, upload-time = "2025-09-09T15:56:29.966Z" }, - { url = "https://files.pythonhosted.org/packages/6b/0e/c6211bb92af26517acd52125a237a92afe9c3124c6a68d3b9f81b62a0568/numpy-2.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:cb32e3cf0f762aee47ad1ddc6672988f7f27045b0783c887190545baba73aa25", size = 14185220, upload-time = "2025-09-09T15:56:32.175Z" }, - { url = "https://files.pythonhosted.org/packages/22/f2/07bb754eb2ede9073f4054f7c0286b0d9d2e23982e090a80d478b26d35ca/numpy-2.3.3-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:396b254daeb0a57b1fe0ecb5e3cff6fa79a380fa97c8f7781a6d08cd429418fe", size = 5113918, upload-time = "2025-09-09T15:56:34.175Z" }, - { url = "https://files.pythonhosted.org/packages/81/0a/afa51697e9fb74642f231ea36aca80fa17c8fb89f7a82abd5174023c3960/numpy-2.3.3-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:067e3d7159a5d8f8a0b46ee11148fc35ca9b21f61e3c49fbd0a027450e65a33b", size = 6647922, upload-time = "2025-09-09T15:56:36.149Z" }, - { url = "https://files.pythonhosted.org/packages/5d/f5/122d9cdb3f51c520d150fef6e87df9279e33d19a9611a87c0d2cf78a89f4/numpy-2.3.3-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1c02d0629d25d426585fb2e45a66154081b9fa677bc92a881ff1d216bc9919a8", size = 14281991, upload-time = "2025-09-09T15:56:40.548Z" }, - { url = "https://files.pythonhosted.org/packages/51/64/7de3c91e821a2debf77c92962ea3fe6ac2bc45d0778c1cbe15d4fce2fd94/numpy-2.3.3-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d9192da52b9745f7f0766531dcfa978b7763916f158bb63bdb8a1eca0068ab20", size = 16641643, upload-time = "2025-09-09T15:56:43.343Z" }, - { url = "https://files.pythonhosted.org/packages/30/e4/961a5fa681502cd0d68907818b69f67542695b74e3ceaa513918103b7e80/numpy-2.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:cd7de500a5b66319db419dc3c345244404a164beae0d0937283b907d8152e6ea", size = 16056787, upload-time = "2025-09-09T15:56:46.141Z" }, - { url = "https://files.pythonhosted.org/packages/99/26/92c912b966e47fbbdf2ad556cb17e3a3088e2e1292b9833be1dfa5361a1a/numpy-2.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:93d4962d8f82af58f0b2eb85daaf1b3ca23fe0a85d0be8f1f2b7bb46034e56d7", size = 18579598, upload-time = "2025-09-09T15:56:49.844Z" }, - { url = "https://files.pythonhosted.org/packages/17/b6/fc8f82cb3520768718834f310c37d96380d9dc61bfdaf05fe5c0b7653e01/numpy-2.3.3-cp312-cp312-win32.whl", hash = "sha256:5534ed6b92f9b7dca6c0a19d6df12d41c68b991cef051d108f6dbff3babc4ebf", size = 6320800, upload-time = "2025-09-09T15:56:52.499Z" }, - { url = "https://files.pythonhosted.org/packages/32/ee/de999f2625b80d043d6d2d628c07d0d5555a677a3cf78fdf868d409b8766/numpy-2.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:497d7cad08e7092dba36e3d296fe4c97708c93daf26643a1ae4b03f6294d30eb", size = 12786615, upload-time = "2025-09-09T15:56:54.422Z" }, - { url = "https://files.pythonhosted.org/packages/49/6e/b479032f8a43559c383acb20816644f5f91c88f633d9271ee84f3b3a996c/numpy-2.3.3-cp312-cp312-win_arm64.whl", hash = "sha256:ca0309a18d4dfea6fc6262a66d06c26cfe4640c3926ceec90e57791a82b6eee5", size = 10195936, upload-time = "2025-09-09T15:56:56.541Z" }, - { url = "https://files.pythonhosted.org/packages/7d/b9/984c2b1ee61a8b803bf63582b4ac4242cf76e2dbd663efeafcb620cc0ccb/numpy-2.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f5415fb78995644253370985342cd03572ef8620b934da27d77377a2285955bf", size = 20949588, upload-time = "2025-09-09T15:56:59.087Z" }, - { url = "https://files.pythonhosted.org/packages/a6/e4/07970e3bed0b1384d22af1e9912527ecbeb47d3b26e9b6a3bced068b3bea/numpy-2.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d00de139a3324e26ed5b95870ce63be7ec7352171bc69a4cf1f157a48e3eb6b7", size = 14177802, upload-time = "2025-09-09T15:57:01.73Z" }, - { url = "https://files.pythonhosted.org/packages/35/c7/477a83887f9de61f1203bad89cf208b7c19cc9fef0cebef65d5a1a0619f2/numpy-2.3.3-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:9dc13c6a5829610cc07422bc74d3ac083bd8323f14e2827d992f9e52e22cd6a6", size = 5106537, upload-time = "2025-09-09T15:57:03.765Z" }, - { url = "https://files.pythonhosted.org/packages/52/47/93b953bd5866a6f6986344d045a207d3f1cfbad99db29f534ea9cee5108c/numpy-2.3.3-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:d79715d95f1894771eb4e60fb23f065663b2298f7d22945d66877aadf33d00c7", size = 6640743, upload-time = "2025-09-09T15:57:07.921Z" }, - { url = "https://files.pythonhosted.org/packages/23/83/377f84aaeb800b64c0ef4de58b08769e782edcefa4fea712910b6f0afd3c/numpy-2.3.3-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:952cfd0748514ea7c3afc729a0fc639e61655ce4c55ab9acfab14bda4f402b4c", size = 14278881, upload-time = "2025-09-09T15:57:11.349Z" }, - { url = "https://files.pythonhosted.org/packages/9a/a5/bf3db6e66c4b160d6ea10b534c381a1955dfab34cb1017ea93aa33c70ed3/numpy-2.3.3-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:5b83648633d46f77039c29078751f80da65aa64d5622a3cd62aaef9d835b6c93", size = 16636301, upload-time = "2025-09-09T15:57:14.245Z" }, - { url = "https://files.pythonhosted.org/packages/a2/59/1287924242eb4fa3f9b3a2c30400f2e17eb2707020d1c5e3086fe7330717/numpy-2.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:b001bae8cea1c7dfdb2ae2b017ed0a6f2102d7a70059df1e338e307a4c78a8ae", size = 16053645, upload-time = "2025-09-09T15:57:16.534Z" }, - { url = "https://files.pythonhosted.org/packages/e6/93/b3d47ed882027c35e94ac2320c37e452a549f582a5e801f2d34b56973c97/numpy-2.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:8e9aced64054739037d42fb84c54dd38b81ee238816c948c8f3ed134665dcd86", size = 18578179, upload-time = "2025-09-09T15:57:18.883Z" }, - { url = "https://files.pythonhosted.org/packages/20/d9/487a2bccbf7cc9d4bfc5f0f197761a5ef27ba870f1e3bbb9afc4bbe3fcc2/numpy-2.3.3-cp313-cp313-win32.whl", hash = "sha256:9591e1221db3f37751e6442850429b3aabf7026d3b05542d102944ca7f00c8a8", size = 6312250, upload-time = "2025-09-09T15:57:21.296Z" }, - { url = "https://files.pythonhosted.org/packages/1b/b5/263ebbbbcede85028f30047eab3d58028d7ebe389d6493fc95ae66c636ab/numpy-2.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:f0dadeb302887f07431910f67a14d57209ed91130be0adea2f9793f1a4f817cf", size = 12783269, upload-time = "2025-09-09T15:57:23.034Z" }, - { url = "https://files.pythonhosted.org/packages/fa/75/67b8ca554bbeaaeb3fac2e8bce46967a5a06544c9108ec0cf5cece559b6c/numpy-2.3.3-cp313-cp313-win_arm64.whl", hash = "sha256:3c7cf302ac6e0b76a64c4aecf1a09e51abd9b01fc7feee80f6c43e3ab1b1dbc5", size = 10195314, upload-time = "2025-09-09T15:57:25.045Z" }, - { url = "https://files.pythonhosted.org/packages/11/d0/0d1ddec56b162042ddfafeeb293bac672de9b0cfd688383590090963720a/numpy-2.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:eda59e44957d272846bb407aad19f89dc6f58fecf3504bd144f4c5cf81a7eacc", size = 21048025, upload-time = "2025-09-09T15:57:27.257Z" }, - { url = "https://files.pythonhosted.org/packages/36/9e/1996ca6b6d00415b6acbdd3c42f7f03ea256e2c3f158f80bd7436a8a19f3/numpy-2.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:823d04112bc85ef5c4fda73ba24e6096c8f869931405a80aa8b0e604510a26bc", size = 14301053, upload-time = "2025-09-09T15:57:30.077Z" }, - { url = "https://files.pythonhosted.org/packages/05/24/43da09aa764c68694b76e84b3d3f0c44cb7c18cdc1ba80e48b0ac1d2cd39/numpy-2.3.3-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:40051003e03db4041aa325da2a0971ba41cf65714e65d296397cc0e32de6018b", size = 5229444, upload-time = "2025-09-09T15:57:32.733Z" }, - { url = "https://files.pythonhosted.org/packages/bc/14/50ffb0f22f7218ef8af28dd089f79f68289a7a05a208db9a2c5dcbe123c1/numpy-2.3.3-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:6ee9086235dd6ab7ae75aba5662f582a81ced49f0f1c6de4260a78d8f2d91a19", size = 6738039, upload-time = "2025-09-09T15:57:34.328Z" }, - { url = "https://files.pythonhosted.org/packages/55/52/af46ac0795e09657d45a7f4db961917314377edecf66db0e39fa7ab5c3d3/numpy-2.3.3-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:94fcaa68757c3e2e668ddadeaa86ab05499a70725811e582b6a9858dd472fb30", size = 14352314, upload-time = "2025-09-09T15:57:36.255Z" }, - { url = "https://files.pythonhosted.org/packages/a7/b1/dc226b4c90eb9f07a3fff95c2f0db3268e2e54e5cce97c4ac91518aee71b/numpy-2.3.3-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:da1a74b90e7483d6ce5244053399a614b1d6b7bc30a60d2f570e5071f8959d3e", size = 16701722, upload-time = "2025-09-09T15:57:38.622Z" }, - { url = "https://files.pythonhosted.org/packages/9d/9d/9d8d358f2eb5eced14dba99f110d83b5cd9a4460895230f3b396ad19a323/numpy-2.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:2990adf06d1ecee3b3dcbb4977dfab6e9f09807598d647f04d385d29e7a3c3d3", size = 16132755, upload-time = "2025-09-09T15:57:41.16Z" }, - { url = "https://files.pythonhosted.org/packages/b6/27/b3922660c45513f9377b3fb42240bec63f203c71416093476ec9aa0719dc/numpy-2.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:ed635ff692483b8e3f0fcaa8e7eb8a75ee71aa6d975388224f70821421800cea", size = 18651560, upload-time = "2025-09-09T15:57:43.459Z" }, - { url = "https://files.pythonhosted.org/packages/5b/8e/3ab61a730bdbbc201bb245a71102aa609f0008b9ed15255500a99cd7f780/numpy-2.3.3-cp313-cp313t-win32.whl", hash = "sha256:a333b4ed33d8dc2b373cc955ca57babc00cd6f9009991d9edc5ddbc1bac36bcd", size = 6442776, upload-time = "2025-09-09T15:57:45.793Z" }, - { url = "https://files.pythonhosted.org/packages/1c/3a/e22b766b11f6030dc2decdeff5c2fb1610768055603f9f3be88b6d192fb2/numpy-2.3.3-cp313-cp313t-win_amd64.whl", hash = "sha256:4384a169c4d8f97195980815d6fcad04933a7e1ab3b530921c3fef7a1c63426d", size = 12927281, upload-time = "2025-09-09T15:57:47.492Z" }, - { url = "https://files.pythonhosted.org/packages/7b/42/c2e2bc48c5e9b2a83423f99733950fbefd86f165b468a3d85d52b30bf782/numpy-2.3.3-cp313-cp313t-win_arm64.whl", hash = "sha256:75370986cc0bc66f4ce5110ad35aae6d182cc4ce6433c40ad151f53690130bf1", size = 10265275, upload-time = "2025-09-09T15:57:49.647Z" }, - { url = "https://files.pythonhosted.org/packages/b8/f2/7e0a37cfced2644c9563c529f29fa28acbd0960dde32ece683aafa6f4949/numpy-2.3.3-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:1e02c7159791cd481e1e6d5ddd766b62a4d5acf8df4d4d1afe35ee9c5c33a41e", size = 21131019, upload-time = "2025-09-09T15:58:42.838Z" }, - { url = "https://files.pythonhosted.org/packages/1a/7e/3291f505297ed63831135a6cc0f474da0c868a1f31b0dd9a9f03a7a0d2ed/numpy-2.3.3-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:dca2d0fc80b3893ae72197b39f69d55a3cd8b17ea1b50aa4c62de82419936150", size = 14376288, upload-time = "2025-09-09T15:58:45.425Z" }, - { url = "https://files.pythonhosted.org/packages/bf/4b/ae02e985bdeee73d7b5abdefeb98aef1207e96d4c0621ee0cf228ddfac3c/numpy-2.3.3-pp311-pypy311_pp73-macosx_14_0_arm64.whl", hash = "sha256:99683cbe0658f8271b333a1b1b4bb3173750ad59c0c61f5bbdc5b318918fffe3", size = 5305425, upload-time = "2025-09-09T15:58:48.6Z" }, - { url = "https://files.pythonhosted.org/packages/8b/eb/9df215d6d7250db32007941500dc51c48190be25f2401d5b2b564e467247/numpy-2.3.3-pp311-pypy311_pp73-macosx_14_0_x86_64.whl", hash = "sha256:d9d537a39cc9de668e5cd0e25affb17aec17b577c6b3ae8a3d866b479fbe88d0", size = 6819053, upload-time = "2025-09-09T15:58:50.401Z" }, - { url = "https://files.pythonhosted.org/packages/57/62/208293d7d6b2a8998a4a1f23ac758648c3c32182d4ce4346062018362e29/numpy-2.3.3-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8596ba2f8af5f93b01d97563832686d20206d303024777f6dfc2e7c7c3f1850e", size = 14420354, upload-time = "2025-09-09T15:58:52.704Z" }, - { url = "https://files.pythonhosted.org/packages/ed/0c/8e86e0ff7072e14a71b4c6af63175e40d1e7e933ce9b9e9f765a95b4e0c3/numpy-2.3.3-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:e1ec5615b05369925bd1125f27df33f3b6c8bc10d788d5999ecd8769a1fa04db", size = 16760413, upload-time = "2025-09-09T15:58:55.027Z" }, - { url = "https://files.pythonhosted.org/packages/af/11/0cc63f9f321ccf63886ac203336777140011fb669e739da36d8db3c53b98/numpy-2.3.3-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:2e267c7da5bf7309670523896df97f93f6e469fb931161f483cd6882b3b1a5dc", size = 12971844, upload-time = "2025-09-09T15:58:57.359Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/76/65/21b3bc86aac7b8f2862db1e808f1ea22b028e30a225a34a5ede9bf8678f2/numpy-2.3.5.tar.gz", hash = "sha256:784db1dcdab56bf0517743e746dfb0f885fc68d948aba86eeec2cba234bdf1c0", size = 20584950, upload-time = "2025-11-16T22:52:42.067Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/43/77/84dd1d2e34d7e2792a236ba180b5e8fcc1e3e414e761ce0253f63d7f572e/numpy-2.3.5-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:de5672f4a7b200c15a4127042170a694d4df43c992948f5e1af57f0174beed10", size = 17034641, upload-time = "2025-11-16T22:49:19.336Z" }, + { url = "https://files.pythonhosted.org/packages/2a/ea/25e26fa5837106cde46ae7d0b667e20f69cbbc0efd64cba8221411ab26ae/numpy-2.3.5-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:acfd89508504a19ed06ef963ad544ec6664518c863436306153e13e94605c218", size = 12528324, upload-time = "2025-11-16T22:49:22.582Z" }, + { url = "https://files.pythonhosted.org/packages/4d/1a/e85f0eea4cf03d6a0228f5c0256b53f2df4bc794706e7df019fc622e47f1/numpy-2.3.5-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:ffe22d2b05504f786c867c8395de703937f934272eb67586817b46188b4ded6d", size = 5356872, upload-time = "2025-11-16T22:49:25.408Z" }, + { url = "https://files.pythonhosted.org/packages/5c/bb/35ef04afd567f4c989c2060cde39211e4ac5357155c1833bcd1166055c61/numpy-2.3.5-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:872a5cf366aec6bb1147336480fef14c9164b154aeb6542327de4970282cd2f5", size = 6893148, upload-time = "2025-11-16T22:49:27.549Z" }, + { url = "https://files.pythonhosted.org/packages/f2/2b/05bbeb06e2dff5eab512dfc678b1cc5ee94d8ac5956a0885c64b6b26252b/numpy-2.3.5-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3095bdb8dd297e5920b010e96134ed91d852d81d490e787beca7e35ae1d89cf7", size = 14557282, upload-time = "2025-11-16T22:49:30.964Z" }, + { url = "https://files.pythonhosted.org/packages/65/fb/2b23769462b34398d9326081fad5655198fcf18966fcb1f1e49db44fbf31/numpy-2.3.5-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8cba086a43d54ca804ce711b2a940b16e452807acebe7852ff327f1ecd49b0d4", size = 16897903, upload-time = "2025-11-16T22:49:34.191Z" }, + { url = "https://files.pythonhosted.org/packages/ac/14/085f4cf05fc3f1e8aa95e85404e984ffca9b2275a5dc2b1aae18a67538b8/numpy-2.3.5-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:6cf9b429b21df6b99f4dee7a1218b8b7ffbbe7df8764dc0bd60ce8a0708fed1e", size = 16341672, upload-time = "2025-11-16T22:49:37.2Z" }, + { url = "https://files.pythonhosted.org/packages/6f/3b/1f73994904142b2aa290449b3bb99772477b5fd94d787093e4f24f5af763/numpy-2.3.5-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:396084a36abdb603546b119d96528c2f6263921c50df3c8fd7cb28873a237748", size = 18838896, upload-time = "2025-11-16T22:49:39.727Z" }, + { url = "https://files.pythonhosted.org/packages/cd/b9/cf6649b2124f288309ffc353070792caf42ad69047dcc60da85ee85fea58/numpy-2.3.5-cp311-cp311-win32.whl", hash = "sha256:b0c7088a73aef3d687c4deef8452a3ac7c1be4e29ed8bf3b366c8111128ac60c", size = 6563608, upload-time = "2025-11-16T22:49:42.079Z" }, + { url = "https://files.pythonhosted.org/packages/aa/44/9fe81ae1dcc29c531843852e2874080dc441338574ccc4306b39e2ff6e59/numpy-2.3.5-cp311-cp311-win_amd64.whl", hash = "sha256:a414504bef8945eae5f2d7cb7be2d4af77c5d1cb5e20b296c2c25b61dff2900c", size = 13078442, upload-time = "2025-11-16T22:49:43.99Z" }, + { url = "https://files.pythonhosted.org/packages/6d/a7/f99a41553d2da82a20a2f22e93c94f928e4490bb447c9ff3c4ff230581d3/numpy-2.3.5-cp311-cp311-win_arm64.whl", hash = "sha256:0cd00b7b36e35398fa2d16af7b907b65304ef8bb4817a550e06e5012929830fa", size = 10458555, upload-time = "2025-11-16T22:49:47.092Z" }, + { url = "https://files.pythonhosted.org/packages/44/37/e669fe6cbb2b96c62f6bbedc6a81c0f3b7362f6a59230b23caa673a85721/numpy-2.3.5-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:74ae7b798248fe62021dbf3c914245ad45d1a6b0cb4a29ecb4b31d0bfbc4cc3e", size = 16733873, upload-time = "2025-11-16T22:49:49.84Z" }, + { url = "https://files.pythonhosted.org/packages/c5/65/df0db6c097892c9380851ab9e44b52d4f7ba576b833996e0080181c0c439/numpy-2.3.5-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:ee3888d9ff7c14604052b2ca5535a30216aa0a58e948cdd3eeb8d3415f638769", size = 12259838, upload-time = "2025-11-16T22:49:52.863Z" }, + { url = "https://files.pythonhosted.org/packages/5b/e1/1ee06e70eb2136797abe847d386e7c0e830b67ad1d43f364dd04fa50d338/numpy-2.3.5-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:612a95a17655e213502f60cfb9bf9408efdc9eb1d5f50535cc6eb365d11b42b5", size = 5088378, upload-time = "2025-11-16T22:49:55.055Z" }, + { url = "https://files.pythonhosted.org/packages/6d/9c/1ca85fb86708724275103b81ec4cf1ac1d08f465368acfc8da7ab545bdae/numpy-2.3.5-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:3101e5177d114a593d79dd79658650fe28b5a0d8abeb8ce6f437c0e6df5be1a4", size = 6628559, upload-time = "2025-11-16T22:49:57.371Z" }, + { url = "https://files.pythonhosted.org/packages/74/78/fcd41e5a0ce4f3f7b003da85825acddae6d7ecb60cf25194741b036ca7d6/numpy-2.3.5-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8b973c57ff8e184109db042c842423ff4f60446239bd585a5131cc47f06f789d", size = 14250702, upload-time = "2025-11-16T22:49:59.632Z" }, + { url = "https://files.pythonhosted.org/packages/b6/23/2a1b231b8ff672b4c450dac27164a8b2ca7d9b7144f9c02d2396518352eb/numpy-2.3.5-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0d8163f43acde9a73c2a33605353a4f1bc4798745a8b1d73183b28e5b435ae28", size = 16606086, upload-time = "2025-11-16T22:50:02.127Z" }, + { url = "https://files.pythonhosted.org/packages/a0/c5/5ad26fbfbe2012e190cc7d5003e4d874b88bb18861d0829edc140a713021/numpy-2.3.5-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:51c1e14eb1e154ebd80e860722f9e6ed6ec89714ad2db2d3aa33c31d7c12179b", size = 16025985, upload-time = "2025-11-16T22:50:04.536Z" }, + { url = "https://files.pythonhosted.org/packages/d2/fa/dd48e225c46c819288148d9d060b047fd2a6fb1eb37eae25112ee4cb4453/numpy-2.3.5-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:b46b4ec24f7293f23adcd2d146960559aaf8020213de8ad1909dba6c013bf89c", size = 18542976, upload-time = "2025-11-16T22:50:07.557Z" }, + { url = "https://files.pythonhosted.org/packages/05/79/ccbd23a75862d95af03d28b5c6901a1b7da4803181513d52f3b86ed9446e/numpy-2.3.5-cp312-cp312-win32.whl", hash = "sha256:3997b5b3c9a771e157f9aae01dd579ee35ad7109be18db0e85dbdbe1de06e952", size = 6285274, upload-time = "2025-11-16T22:50:10.746Z" }, + { url = "https://files.pythonhosted.org/packages/2d/57/8aeaf160312f7f489dea47ab61e430b5cb051f59a98ae68b7133ce8fa06a/numpy-2.3.5-cp312-cp312-win_amd64.whl", hash = "sha256:86945f2ee6d10cdfd67bcb4069c1662dd711f7e2a4343db5cecec06b87cf31aa", size = 12782922, upload-time = "2025-11-16T22:50:12.811Z" }, + { url = "https://files.pythonhosted.org/packages/78/a6/aae5cc2ca78c45e64b9ef22f089141d661516856cf7c8a54ba434576900d/numpy-2.3.5-cp312-cp312-win_arm64.whl", hash = "sha256:f28620fe26bee16243be2b7b874da327312240a7cdc38b769a697578d2100013", size = 10194667, upload-time = "2025-11-16T22:50:16.16Z" }, + { url = "https://files.pythonhosted.org/packages/db/69/9cde09f36da4b5a505341180a3f2e6fadc352fd4d2b7096ce9778db83f1a/numpy-2.3.5-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:d0f23b44f57077c1ede8c5f26b30f706498b4862d3ff0a7298b8411dd2f043ff", size = 16728251, upload-time = "2025-11-16T22:50:19.013Z" }, + { url = "https://files.pythonhosted.org/packages/79/fb/f505c95ceddd7027347b067689db71ca80bd5ecc926f913f1a23e65cf09b/numpy-2.3.5-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:aa5bc7c5d59d831d9773d1170acac7893ce3a5e130540605770ade83280e7188", size = 12254652, upload-time = "2025-11-16T22:50:21.487Z" }, + { url = "https://files.pythonhosted.org/packages/78/da/8c7738060ca9c31b30e9301ee0cf6c5ffdbf889d9593285a1cead337f9a5/numpy-2.3.5-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:ccc933afd4d20aad3c00bcef049cb40049f7f196e0397f1109dba6fed63267b0", size = 5083172, upload-time = "2025-11-16T22:50:24.562Z" }, + { url = "https://files.pythonhosted.org/packages/a4/b4/ee5bb2537fb9430fd2ef30a616c3672b991a4129bb1c7dcc42aa0abbe5d7/numpy-2.3.5-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:afaffc4393205524af9dfa400fa250143a6c3bc646c08c9f5e25a9f4b4d6a903", size = 6622990, upload-time = "2025-11-16T22:50:26.47Z" }, + { url = "https://files.pythonhosted.org/packages/95/03/dc0723a013c7d7c19de5ef29e932c3081df1c14ba582b8b86b5de9db7f0f/numpy-2.3.5-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9c75442b2209b8470d6d5d8b1c25714270686f14c749028d2199c54e29f20b4d", size = 14248902, upload-time = "2025-11-16T22:50:28.861Z" }, + { url = "https://files.pythonhosted.org/packages/f5/10/ca162f45a102738958dcec8023062dad0cbc17d1ab99d68c4e4a6c45fb2b/numpy-2.3.5-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:11e06aa0af8c0f05104d56450d6093ee639e15f24ecf62d417329d06e522e017", size = 16597430, upload-time = "2025-11-16T22:50:31.56Z" }, + { url = "https://files.pythonhosted.org/packages/2a/51/c1e29be863588db58175175f057286900b4b3327a1351e706d5e0f8dd679/numpy-2.3.5-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ed89927b86296067b4f81f108a2271d8926467a8868e554eaf370fc27fa3ccaf", size = 16024551, upload-time = "2025-11-16T22:50:34.242Z" }, + { url = "https://files.pythonhosted.org/packages/83/68/8236589d4dbb87253d28259d04d9b814ec0ecce7cb1c7fed29729f4c3a78/numpy-2.3.5-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:51c55fe3451421f3a6ef9a9c1439e82101c57a2c9eab9feb196a62b1a10b58ce", size = 18533275, upload-time = "2025-11-16T22:50:37.651Z" }, + { url = "https://files.pythonhosted.org/packages/40/56/2932d75b6f13465239e3b7b7e511be27f1b8161ca2510854f0b6e521c395/numpy-2.3.5-cp313-cp313-win32.whl", hash = "sha256:1978155dd49972084bd6ef388d66ab70f0c323ddee6f693d539376498720fb7e", size = 6277637, upload-time = "2025-11-16T22:50:40.11Z" }, + { url = "https://files.pythonhosted.org/packages/0c/88/e2eaa6cffb115b85ed7c7c87775cb8bcf0816816bc98ca8dbfa2ee33fe6e/numpy-2.3.5-cp313-cp313-win_amd64.whl", hash = "sha256:00dc4e846108a382c5869e77c6ed514394bdeb3403461d25a829711041217d5b", size = 12779090, upload-time = "2025-11-16T22:50:42.503Z" }, + { url = "https://files.pythonhosted.org/packages/8f/88/3f41e13a44ebd4034ee17baa384acac29ba6a4fcc2aca95f6f08ca0447d1/numpy-2.3.5-cp313-cp313-win_arm64.whl", hash = "sha256:0472f11f6ec23a74a906a00b48a4dcf3849209696dff7c189714511268d103ae", size = 10194710, upload-time = "2025-11-16T22:50:44.971Z" }, + { url = "https://files.pythonhosted.org/packages/13/cb/71744144e13389d577f867f745b7df2d8489463654a918eea2eeb166dfc9/numpy-2.3.5-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:414802f3b97f3c1eef41e530aaba3b3c1620649871d8cb38c6eaff034c2e16bd", size = 16827292, upload-time = "2025-11-16T22:50:47.715Z" }, + { url = "https://files.pythonhosted.org/packages/71/80/ba9dc6f2a4398e7f42b708a7fdc841bb638d353be255655498edbf9a15a8/numpy-2.3.5-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5ee6609ac3604fa7780e30a03e5e241a7956f8e2fcfe547d51e3afa5247ac47f", size = 12378897, upload-time = "2025-11-16T22:50:51.327Z" }, + { url = "https://files.pythonhosted.org/packages/2e/6d/db2151b9f64264bcceccd51741aa39b50150de9b602d98ecfe7e0c4bff39/numpy-2.3.5-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:86d835afea1eaa143012a2d7a3f45a3adce2d7adc8b4961f0b362214d800846a", size = 5207391, upload-time = "2025-11-16T22:50:54.542Z" }, + { url = "https://files.pythonhosted.org/packages/80/ae/429bacace5ccad48a14c4ae5332f6aa8ab9f69524193511d60ccdfdc65fa/numpy-2.3.5-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:30bc11310e8153ca664b14c5f1b73e94bd0503681fcf136a163de856f3a50139", size = 6721275, upload-time = "2025-11-16T22:50:56.794Z" }, + { url = "https://files.pythonhosted.org/packages/74/5b/1919abf32d8722646a38cd527bc3771eb229a32724ee6ba340ead9b92249/numpy-2.3.5-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1062fde1dcf469571705945b0f221b73928f34a20c904ffb45db101907c3454e", size = 14306855, upload-time = "2025-11-16T22:50:59.208Z" }, + { url = "https://files.pythonhosted.org/packages/a5/87/6831980559434973bebc30cd9c1f21e541a0f2b0c280d43d3afd909b66d0/numpy-2.3.5-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ce581db493ea1a96c0556360ede6607496e8bf9b3a8efa66e06477267bc831e9", size = 16657359, upload-time = "2025-11-16T22:51:01.991Z" }, + { url = "https://files.pythonhosted.org/packages/dd/91/c797f544491ee99fd00495f12ebb7802c440c1915811d72ac5b4479a3356/numpy-2.3.5-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:cc8920d2ec5fa99875b670bb86ddeb21e295cb07aa331810d9e486e0b969d946", size = 16093374, upload-time = "2025-11-16T22:51:05.291Z" }, + { url = "https://files.pythonhosted.org/packages/74/a6/54da03253afcbe7a72785ec4da9c69fb7a17710141ff9ac5fcb2e32dbe64/numpy-2.3.5-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:9ee2197ef8c4f0dfe405d835f3b6a14f5fee7782b5de51ba06fb65fc9b36e9f1", size = 18594587, upload-time = "2025-11-16T22:51:08.585Z" }, + { url = "https://files.pythonhosted.org/packages/80/e9/aff53abbdd41b0ecca94285f325aff42357c6b5abc482a3fcb4994290b18/numpy-2.3.5-cp313-cp313t-win32.whl", hash = "sha256:70b37199913c1bd300ff6e2693316c6f869c7ee16378faf10e4f5e3275b299c3", size = 6405940, upload-time = "2025-11-16T22:51:11.541Z" }, + { url = "https://files.pythonhosted.org/packages/d5/81/50613fec9d4de5480de18d4f8ef59ad7e344d497edbef3cfd80f24f98461/numpy-2.3.5-cp313-cp313t-win_amd64.whl", hash = "sha256:b501b5fa195cc9e24fe102f21ec0a44dffc231d2af79950b451e0d99cea02234", size = 12920341, upload-time = "2025-11-16T22:51:14.312Z" }, + { url = "https://files.pythonhosted.org/packages/bb/ab/08fd63b9a74303947f34f0bd7c5903b9c5532c2d287bead5bdf4c556c486/numpy-2.3.5-cp313-cp313t-win_arm64.whl", hash = "sha256:a80afd79f45f3c4a7d341f13acbe058d1ca8ac017c165d3fa0d3de6bc1a079d7", size = 10262507, upload-time = "2025-11-16T22:51:16.846Z" }, + { url = "https://files.pythonhosted.org/packages/c6/65/f9dea8e109371ade9c782b4e4756a82edf9d3366bca495d84d79859a0b79/numpy-2.3.5-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:f0963b55cdd70fad460fa4c1341f12f976bb26cb66021a5580329bd498988310", size = 16910689, upload-time = "2025-11-16T22:52:23.247Z" }, + { url = "https://files.pythonhosted.org/packages/00/4f/edb00032a8fb92ec0a679d3830368355da91a69cab6f3e9c21b64d0bb986/numpy-2.3.5-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:f4255143f5160d0de972d28c8f9665d882b5f61309d8362fdd3e103cf7bf010c", size = 12457053, upload-time = "2025-11-16T22:52:26.367Z" }, + { url = "https://files.pythonhosted.org/packages/16/a4/e8a53b5abd500a63836a29ebe145fc1ab1f2eefe1cfe59276020373ae0aa/numpy-2.3.5-pp311-pypy311_pp73-macosx_14_0_arm64.whl", hash = "sha256:a4b9159734b326535f4dd01d947f919c6eefd2d9827466a696c44ced82dfbc18", size = 5285635, upload-time = "2025-11-16T22:52:29.266Z" }, + { url = "https://files.pythonhosted.org/packages/a3/2f/37eeb9014d9c8b3e9c55bc599c68263ca44fdbc12a93e45a21d1d56df737/numpy-2.3.5-pp311-pypy311_pp73-macosx_14_0_x86_64.whl", hash = "sha256:2feae0d2c91d46e59fcd62784a3a83b3fb677fead592ce51b5a6fbb4f95965ff", size = 6801770, upload-time = "2025-11-16T22:52:31.421Z" }, + { url = "https://files.pythonhosted.org/packages/7d/e4/68d2f474df2cb671b2b6c2986a02e520671295647dad82484cde80ca427b/numpy-2.3.5-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ffac52f28a7849ad7576293c0cb7b9f08304e8f7d738a8cb8a90ec4c55a998eb", size = 14391768, upload-time = "2025-11-16T22:52:33.593Z" }, + { url = "https://files.pythonhosted.org/packages/b8/50/94ccd8a2b141cb50651fddd4f6a48874acb3c91c8f0842b08a6afc4b0b21/numpy-2.3.5-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:63c0e9e7eea69588479ebf4a8a270d5ac22763cc5854e9a7eae952a3908103f7", size = 16729263, upload-time = "2025-11-16T22:52:36.369Z" }, + { url = "https://files.pythonhosted.org/packages/2d/ee/346fa473e666fe14c52fcdd19ec2424157290a032d4c41f98127bfb31ac7/numpy-2.3.5-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:f16417ec91f12f814b10bafe79ef77e70113a2f5f7018640e7425ff979253425", size = 12967213, upload-time = "2025-11-16T22:52:39.38Z" }, +] + +[[package]] +name = "numpy-typing-compat" +version = "20251206.2.3" +source = { registry = "https://pypi.org/simple" } +dependencies = [ + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/77/83/dd90774d6685664cbe5525645a50c4e6c7454207aee552918790e879137f/numpy_typing_compat-20251206.2.3.tar.gz", hash = "sha256:18e00e0f4f2040fe98574890248848c7c6831a975562794da186cf4f3c90b935", size = 5009, upload-time = "2025-12-06T20:02:04.177Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/48/6f/dde8e2a79a3b6cbc31bc1037c1a1dbc07c90d52d946851bd7cba67e730a8/numpy_typing_compat-20251206.2.3-py3-none-any.whl", hash = "sha256:bfa2e4c4945413e84552cbd34a6d368c88a06a54a896e77ced760521b08f0f61", size = 6300, upload-time = "2025-12-06T20:01:56.664Z" }, +] + +[[package]] +name = "optype" +version = "0.9.3" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.11'", +] +dependencies = [ + { name = "typing-extensions", marker = "python_full_version < '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/88/3c/9d59b0167458b839273ad0c4fc5f62f787058d8f5aed7f71294963a99471/optype-0.9.3.tar.gz", hash = "sha256:5f09d74127d316053b26971ce441a4df01f3a01943601d3712dd6f34cdfbaf48", size = 96143, upload-time = "2025-03-31T17:00:08.392Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/73/d8/ac50e2982bdc2d3595dc2bfe3c7e5a0574b5e407ad82d70b5f3707009671/optype-0.9.3-py3-none-any.whl", hash = "sha256:2935c033265938d66cc4198b0aca865572e635094e60e6e79522852f029d9e8d", size = 84357, upload-time = "2025-03-31T17:00:06.464Z" }, ] [[package]] -name = "overrides" -version = "7.7.0" +name = "optype" +version = "0.15.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/36/86/b585f53236dec60aba864e050778b25045f857e17f6e5ea0ae95fe80edd2/overrides-7.7.0.tar.gz", hash = "sha256:55158fa3d93b98cc75299b1e67078ad9003ca27945c76162c1c0766d6f91820a", size = 22812, upload-time = "2024-01-27T21:01:33.423Z" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +dependencies = [ + { name = "typing-extensions", marker = "python_full_version >= '3.11' and python_full_version < '3.13'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/d7/93/6b9e43138ce36fbad134bd1a50460a7bbda61105b5a964e4cf773fe4d845/optype-0.15.0.tar.gz", hash = "sha256:457d6ca9e7da19967ec16d42bdf94e240b33b5d70a56fbbf5b427e5ea39cf41e", size = 99978, upload-time = "2025-12-08T12:32:41.422Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/2c/ab/fc8290c6a4c722e5514d80f62b2dc4c4df1a68a41d1364e625c35990fcf3/overrides-7.7.0-py3-none-any.whl", hash = "sha256:c7ed9d062f78b8e4c1a7b70bd8796b35ead4d9f510227ef9c5dc7626c60d7e49", size = 17832, upload-time = "2024-01-27T21:01:31.393Z" }, + { url = "https://files.pythonhosted.org/packages/07/8b/93f6c496fc5da062fd7e7c4745b5a8dd09b7b576c626075844fe97951a7d/optype-0.15.0-py3-none-any.whl", hash = "sha256:caba40ece9ea39b499fa76c036a82e0d452a432dd4dd3e8e0d30892be2e8c76c", size = 88716, upload-time = "2025-12-08T12:32:39.669Z" }, +] + +[package.optional-dependencies] +numpy = [ + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy-typing-compat", marker = "python_full_version >= '3.11'" }, ] [[package]] -name = "packageurl-python" -version = "0.17.5" +name = "overrides" +version = "7.7.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/3a/f0/de0ac00a4484c0d87b71e3d9985518278d89797fa725e90abd3453bccb42/packageurl_python-0.17.5.tar.gz", hash = "sha256:a7be3f3ba70d705f738ace9bf6124f31920245a49fa69d4b416da7037dd2de61", size = 43832, upload-time = "2025-08-06T14:08:20.235Z" } +sdist = { url = "https://files.pythonhosted.org/packages/36/86/b585f53236dec60aba864e050778b25045f857e17f6e5ea0ae95fe80edd2/overrides-7.7.0.tar.gz", hash = "sha256:55158fa3d93b98cc75299b1e67078ad9003ca27945c76162c1c0766d6f91820a", size = 22812, upload-time = "2024-01-27T21:01:33.423Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/be/78/9dbb7d2ef240d20caf6f79c0f66866737c9d0959601fd783ff635d1d019d/packageurl_python-0.17.5-py3-none-any.whl", hash = "sha256:f0e55452ab37b5c192c443de1458e3f3b4d8ac27f747df6e8c48adeab081d321", size = 30544, upload-time = "2025-08-06T14:08:19.055Z" }, + { url = "https://files.pythonhosted.org/packages/2c/ab/fc8290c6a4c722e5514d80f62b2dc4c4df1a68a41d1364e625c35990fcf3/overrides-7.7.0-py3-none-any.whl", hash = "sha256:c7ed9d062f78b8e4c1a7b70bd8796b35ead4d9f510227ef9c5dc7626c60d7e49", size = 17832, upload-time = "2024-01-27T21:01:31.393Z" }, ] [[package]] @@ -2145,65 +2154,65 @@ wheels = [ [[package]] name = "pandas" -version = "2.3.2" +version = "2.3.3" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "python-dateutil" }, { name = "pytz" }, { name = "tzdata" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/79/8e/0e90233ac205ad182bd6b422532695d2b9414944a280488105d598c70023/pandas-2.3.2.tar.gz", hash = "sha256:ab7b58f8f82706890924ccdfb5f48002b83d2b5a3845976a9fb705d36c34dcdb", size = 4488684, upload-time = "2025-08-21T10:28:29.257Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/2e/16/a8eeb70aad84ccbf14076793f90e0031eded63c1899aeae9fdfbf37881f4/pandas-2.3.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:52bc29a946304c360561974c6542d1dd628ddafa69134a7131fdfd6a5d7a1a35", size = 11539648, upload-time = "2025-08-21T10:26:36.236Z" }, - { url = "https://files.pythonhosted.org/packages/47/f1/c5bdaea13bf3708554d93e948b7ea74121ce6e0d59537ca4c4f77731072b/pandas-2.3.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:220cc5c35ffaa764dd5bb17cf42df283b5cb7fdf49e10a7b053a06c9cb48ee2b", size = 10786923, upload-time = "2025-08-21T10:26:40.518Z" }, - { url = "https://files.pythonhosted.org/packages/bb/10/811fa01476d29ffed692e735825516ad0e56d925961819e6126b4ba32147/pandas-2.3.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:42c05e15111221384019897df20c6fe893b2f697d03c811ee67ec9e0bb5a3424", size = 11726241, upload-time = "2025-08-21T10:26:43.175Z" }, - { url = "https://files.pythonhosted.org/packages/c4/6a/40b043b06e08df1ea1b6d20f0e0c2f2c4ec8c4f07d1c92948273d943a50b/pandas-2.3.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:cc03acc273c5515ab69f898df99d9d4f12c4d70dbfc24c3acc6203751d0804cf", size = 12349533, upload-time = "2025-08-21T10:26:46.611Z" }, - { url = "https://files.pythonhosted.org/packages/e2/ea/2e081a2302e41a9bca7056659fdd2b85ef94923723e41665b42d65afd347/pandas-2.3.2-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:d25c20a03e8870f6339bcf67281b946bd20b86f1a544ebbebb87e66a8d642cba", size = 13202407, upload-time = "2025-08-21T10:26:49.068Z" }, - { url = "https://files.pythonhosted.org/packages/f4/12/7ff9f6a79e2ee8869dcf70741ef998b97ea20050fe25f83dc759764c1e32/pandas-2.3.2-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:21bb612d148bb5860b7eb2c10faacf1a810799245afd342cf297d7551513fbb6", size = 13837212, upload-time = "2025-08-21T10:26:51.832Z" }, - { url = "https://files.pythonhosted.org/packages/d8/df/5ab92fcd76455a632b3db34a746e1074d432c0cdbbd28d7cd1daba46a75d/pandas-2.3.2-cp310-cp310-win_amd64.whl", hash = "sha256:b62d586eb25cb8cb70a5746a378fc3194cb7f11ea77170d59f889f5dfe3cec7a", size = 11338099, upload-time = "2025-08-21T10:26:54.382Z" }, - { url = "https://files.pythonhosted.org/packages/7a/59/f3e010879f118c2d400902d2d871c2226cef29b08c09fb8dc41111730400/pandas-2.3.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:1333e9c299adcbb68ee89a9bb568fc3f20f9cbb419f1dd5225071e6cddb2a743", size = 11563308, upload-time = "2025-08-21T10:26:56.656Z" }, - { url = "https://files.pythonhosted.org/packages/38/18/48f10f1cc5c397af59571d638d211f494dba481f449c19adbd282aa8f4ca/pandas-2.3.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:76972bcbd7de8e91ad5f0ca884a9f2c477a2125354af624e022c49e5bd0dfff4", size = 10820319, upload-time = "2025-08-21T10:26:59.162Z" }, - { url = "https://files.pythonhosted.org/packages/95/3b/1e9b69632898b048e223834cd9702052bcf06b15e1ae716eda3196fb972e/pandas-2.3.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b98bdd7c456a05eef7cd21fd6b29e3ca243591fe531c62be94a2cc987efb5ac2", size = 11790097, upload-time = "2025-08-21T10:27:02.204Z" }, - { url = "https://files.pythonhosted.org/packages/8b/ef/0e2ffb30b1f7fbc9a588bd01e3c14a0d96854d09a887e15e30cc19961227/pandas-2.3.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:1d81573b3f7db40d020983f78721e9bfc425f411e616ef019a10ebf597aedb2e", size = 12397958, upload-time = "2025-08-21T10:27:05.409Z" }, - { url = "https://files.pythonhosted.org/packages/23/82/e6b85f0d92e9afb0e7f705a51d1399b79c7380c19687bfbf3d2837743249/pandas-2.3.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:e190b738675a73b581736cc8ec71ae113d6c3768d0bd18bffa5b9a0927b0b6ea", size = 13225600, upload-time = "2025-08-21T10:27:07.791Z" }, - { url = "https://files.pythonhosted.org/packages/e8/f1/f682015893d9ed51611948bd83683670842286a8edd4f68c2c1c3b231eef/pandas-2.3.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:c253828cb08f47488d60f43c5fc95114c771bbfff085da54bfc79cb4f9e3a372", size = 13879433, upload-time = "2025-08-21T10:27:10.347Z" }, - { url = "https://files.pythonhosted.org/packages/a7/e7/ae86261695b6c8a36d6a4c8d5f9b9ede8248510d689a2f379a18354b37d7/pandas-2.3.2-cp311-cp311-win_amd64.whl", hash = "sha256:9467697b8083f9667b212633ad6aa4ab32436dcbaf4cd57325debb0ddef2012f", size = 11336557, upload-time = "2025-08-21T10:27:12.983Z" }, - { url = "https://files.pythonhosted.org/packages/ec/db/614c20fb7a85a14828edd23f1c02db58a30abf3ce76f38806155d160313c/pandas-2.3.2-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:3fbb977f802156e7a3f829e9d1d5398f6192375a3e2d1a9ee0803e35fe70a2b9", size = 11587652, upload-time = "2025-08-21T10:27:15.888Z" }, - { url = "https://files.pythonhosted.org/packages/99/b0/756e52f6582cade5e746f19bad0517ff27ba9c73404607c0306585c201b3/pandas-2.3.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1b9b52693123dd234b7c985c68b709b0b009f4521000d0525f2b95c22f15944b", size = 10717686, upload-time = "2025-08-21T10:27:18.486Z" }, - { url = "https://files.pythonhosted.org/packages/37/4c/dd5ccc1e357abfeee8353123282de17997f90ff67855f86154e5a13b81e5/pandas-2.3.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0bd281310d4f412733f319a5bc552f86d62cddc5f51d2e392c8787335c994175", size = 11278722, upload-time = "2025-08-21T10:27:21.149Z" }, - { url = "https://files.pythonhosted.org/packages/d3/a4/f7edcfa47e0a88cda0be8b068a5bae710bf264f867edfdf7b71584ace362/pandas-2.3.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:96d31a6b4354e3b9b8a2c848af75d31da390657e3ac6f30c05c82068b9ed79b9", size = 11987803, upload-time = "2025-08-21T10:27:23.767Z" }, - { url = "https://files.pythonhosted.org/packages/f6/61/1bce4129f93ab66f1c68b7ed1c12bac6a70b1b56c5dab359c6bbcd480b52/pandas-2.3.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:df4df0b9d02bb873a106971bb85d448378ef14b86ba96f035f50bbd3688456b4", size = 12766345, upload-time = "2025-08-21T10:27:26.6Z" }, - { url = "https://files.pythonhosted.org/packages/8e/46/80d53de70fee835531da3a1dae827a1e76e77a43ad22a8cd0f8142b61587/pandas-2.3.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:213a5adf93d020b74327cb2c1b842884dbdd37f895f42dcc2f09d451d949f811", size = 13439314, upload-time = "2025-08-21T10:27:29.213Z" }, - { url = "https://files.pythonhosted.org/packages/28/30/8114832daff7489f179971dbc1d854109b7f4365a546e3ea75b6516cea95/pandas-2.3.2-cp312-cp312-win_amd64.whl", hash = "sha256:8c13b81a9347eb8c7548f53fd9a4f08d4dfe996836543f805c987bafa03317ae", size = 10983326, upload-time = "2025-08-21T10:27:31.901Z" }, - { url = "https://files.pythonhosted.org/packages/27/64/a2f7bf678af502e16b472527735d168b22b7824e45a4d7e96a4fbb634b59/pandas-2.3.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0c6ecbac99a354a051ef21c5307601093cb9e0f4b1855984a084bfec9302699e", size = 11531061, upload-time = "2025-08-21T10:27:34.647Z" }, - { url = "https://files.pythonhosted.org/packages/54/4c/c3d21b2b7769ef2f4c2b9299fcadd601efa6729f1357a8dbce8dd949ed70/pandas-2.3.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:c6f048aa0fd080d6a06cc7e7537c09b53be6642d330ac6f54a600c3ace857ee9", size = 10668666, upload-time = "2025-08-21T10:27:37.203Z" }, - { url = "https://files.pythonhosted.org/packages/50/e2/f775ba76ecfb3424d7f5862620841cf0edb592e9abd2d2a5387d305fe7a8/pandas-2.3.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0064187b80a5be6f2f9c9d6bdde29372468751dfa89f4211a3c5871854cfbf7a", size = 11332835, upload-time = "2025-08-21T10:27:40.188Z" }, - { url = "https://files.pythonhosted.org/packages/8f/52/0634adaace9be2d8cac9ef78f05c47f3a675882e068438b9d7ec7ef0c13f/pandas-2.3.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:4ac8c320bded4718b298281339c1a50fb00a6ba78cb2a63521c39bec95b0209b", size = 12057211, upload-time = "2025-08-21T10:27:43.117Z" }, - { url = "https://files.pythonhosted.org/packages/0b/9d/2df913f14b2deb9c748975fdb2491da1a78773debb25abbc7cbc67c6b549/pandas-2.3.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:114c2fe4f4328cf98ce5716d1532f3ab79c5919f95a9cfee81d9140064a2e4d6", size = 12749277, upload-time = "2025-08-21T10:27:45.474Z" }, - { url = "https://files.pythonhosted.org/packages/87/af/da1a2417026bd14d98c236dba88e39837182459d29dcfcea510b2ac9e8a1/pandas-2.3.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:48fa91c4dfb3b2b9bfdb5c24cd3567575f4e13f9636810462ffed8925352be5a", size = 13415256, upload-time = "2025-08-21T10:27:49.885Z" }, - { url = "https://files.pythonhosted.org/packages/22/3c/f2af1ce8840ef648584a6156489636b5692c162771918aa95707c165ad2b/pandas-2.3.2-cp313-cp313-win_amd64.whl", hash = "sha256:12d039facec710f7ba305786837d0225a3444af7bbd9c15c32ca2d40d157ed8b", size = 10982579, upload-time = "2025-08-21T10:28:08.435Z" }, - { url = "https://files.pythonhosted.org/packages/f3/98/8df69c4097a6719e357dc249bf437b8efbde808038268e584421696cbddf/pandas-2.3.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:c624b615ce97864eb588779ed4046186f967374185c047070545253a52ab2d57", size = 12028163, upload-time = "2025-08-21T10:27:52.232Z" }, - { url = "https://files.pythonhosted.org/packages/0e/23/f95cbcbea319f349e10ff90db488b905c6883f03cbabd34f6b03cbc3c044/pandas-2.3.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:0cee69d583b9b128823d9514171cabb6861e09409af805b54459bd0c821a35c2", size = 11391860, upload-time = "2025-08-21T10:27:54.673Z" }, - { url = "https://files.pythonhosted.org/packages/ad/1b/6a984e98c4abee22058aa75bfb8eb90dce58cf8d7296f8bc56c14bc330b0/pandas-2.3.2-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2319656ed81124982900b4c37f0e0c58c015af9a7bbc62342ba5ad07ace82ba9", size = 11309830, upload-time = "2025-08-21T10:27:56.957Z" }, - { url = "https://files.pythonhosted.org/packages/15/d5/f0486090eb18dd8710bf60afeaf638ba6817047c0c8ae5c6a25598665609/pandas-2.3.2-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b37205ad6f00d52f16b6d09f406434ba928c1a1966e2771006a9033c736d30d2", size = 11883216, upload-time = "2025-08-21T10:27:59.302Z" }, - { url = "https://files.pythonhosted.org/packages/10/86/692050c119696da19e20245bbd650d8dfca6ceb577da027c3a73c62a047e/pandas-2.3.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:837248b4fc3a9b83b9c6214699a13f069dc13510a6a6d7f9ba33145d2841a012", size = 12699743, upload-time = "2025-08-21T10:28:02.447Z" }, - { url = "https://files.pythonhosted.org/packages/cd/d7/612123674d7b17cf345aad0a10289b2a384bff404e0463a83c4a3a59d205/pandas-2.3.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:d2c3554bd31b731cd6490d94a28f3abb8dd770634a9e06eb6d2911b9827db370", size = 13186141, upload-time = "2025-08-21T10:28:05.377Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/33/01/d40b85317f86cf08d853a4f495195c73815fdf205eef3993821720274518/pandas-2.3.3.tar.gz", hash = "sha256:e05e1af93b977f7eafa636d043f9f94c7ee3ac81af99c13508215942e64c993b", size = 4495223, upload-time = "2025-09-29T23:34:51.853Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/3d/f7/f425a00df4fcc22b292c6895c6831c0c8ae1d9fac1e024d16f98a9ce8749/pandas-2.3.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:376c6446ae31770764215a6c937f72d917f214b43560603cd60da6408f183b6c", size = 11555763, upload-time = "2025-09-29T23:16:53.287Z" }, + { url = "https://files.pythonhosted.org/packages/13/4f/66d99628ff8ce7857aca52fed8f0066ce209f96be2fede6cef9f84e8d04f/pandas-2.3.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:e19d192383eab2f4ceb30b412b22ea30690c9e618f78870357ae1d682912015a", size = 10801217, upload-time = "2025-09-29T23:17:04.522Z" }, + { url = "https://files.pythonhosted.org/packages/1d/03/3fc4a529a7710f890a239cc496fc6d50ad4a0995657dccc1d64695adb9f4/pandas-2.3.3-cp310-cp310-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5caf26f64126b6c7aec964f74266f435afef1c1b13da3b0636c7518a1fa3e2b1", size = 12148791, upload-time = "2025-09-29T23:17:18.444Z" }, + { url = "https://files.pythonhosted.org/packages/40/a8/4dac1f8f8235e5d25b9955d02ff6f29396191d4e665d71122c3722ca83c5/pandas-2.3.3-cp310-cp310-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:dd7478f1463441ae4ca7308a70e90b33470fa593429f9d4c578dd00d1fa78838", size = 12769373, upload-time = "2025-09-29T23:17:35.846Z" }, + { url = "https://files.pythonhosted.org/packages/df/91/82cc5169b6b25440a7fc0ef3a694582418d875c8e3ebf796a6d6470aa578/pandas-2.3.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:4793891684806ae50d1288c9bae9330293ab4e083ccd1c5e383c34549c6e4250", size = 13200444, upload-time = "2025-09-29T23:17:49.341Z" }, + { url = "https://files.pythonhosted.org/packages/10/ae/89b3283800ab58f7af2952704078555fa60c807fff764395bb57ea0b0dbd/pandas-2.3.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:28083c648d9a99a5dd035ec125d42439c6c1c525098c58af0fc38dd1a7a1b3d4", size = 13858459, upload-time = "2025-09-29T23:18:03.722Z" }, + { url = "https://files.pythonhosted.org/packages/85/72/530900610650f54a35a19476eca5104f38555afccda1aa11a92ee14cb21d/pandas-2.3.3-cp310-cp310-win_amd64.whl", hash = "sha256:503cf027cf9940d2ceaa1a93cfb5f8c8c7e6e90720a2850378f0b3f3b1e06826", size = 11346086, upload-time = "2025-09-29T23:18:18.505Z" }, + { url = "https://files.pythonhosted.org/packages/c1/fa/7ac648108144a095b4fb6aa3de1954689f7af60a14cf25583f4960ecb878/pandas-2.3.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:602b8615ebcc4a0c1751e71840428ddebeb142ec02c786e8ad6b1ce3c8dec523", size = 11578790, upload-time = "2025-09-29T23:18:30.065Z" }, + { url = "https://files.pythonhosted.org/packages/9b/35/74442388c6cf008882d4d4bdfc4109be87e9b8b7ccd097ad1e7f006e2e95/pandas-2.3.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:8fe25fc7b623b0ef6b5009149627e34d2a4657e880948ec3c840e9402e5c1b45", size = 10833831, upload-time = "2025-09-29T23:38:56.071Z" }, + { url = "https://files.pythonhosted.org/packages/fe/e4/de154cbfeee13383ad58d23017da99390b91d73f8c11856f2095e813201b/pandas-2.3.3-cp311-cp311-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b468d3dad6ff947df92dcb32ede5b7bd41a9b3cceef0a30ed925f6d01fb8fa66", size = 12199267, upload-time = "2025-09-29T23:18:41.627Z" }, + { url = "https://files.pythonhosted.org/packages/bf/c9/63f8d545568d9ab91476b1818b4741f521646cbdd151c6efebf40d6de6f7/pandas-2.3.3-cp311-cp311-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b98560e98cb334799c0b07ca7967ac361a47326e9b4e5a7dfb5ab2b1c9d35a1b", size = 12789281, upload-time = "2025-09-29T23:18:56.834Z" }, + { url = "https://files.pythonhosted.org/packages/f2/00/a5ac8c7a0e67fd1a6059e40aa08fa1c52cc00709077d2300e210c3ce0322/pandas-2.3.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37b5848ba49824e5c30bedb9c830ab9b7751fd049bc7914533e01c65f79791", size = 13240453, upload-time = "2025-09-29T23:19:09.247Z" }, + { url = "https://files.pythonhosted.org/packages/27/4d/5c23a5bc7bd209231618dd9e606ce076272c9bc4f12023a70e03a86b4067/pandas-2.3.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:db4301b2d1f926ae677a751eb2bd0e8c5f5319c9cb3f88b0becbbb0b07b34151", size = 13890361, upload-time = "2025-09-29T23:19:25.342Z" }, + { url = "https://files.pythonhosted.org/packages/8e/59/712db1d7040520de7a4965df15b774348980e6df45c129b8c64d0dbe74ef/pandas-2.3.3-cp311-cp311-win_amd64.whl", hash = "sha256:f086f6fe114e19d92014a1966f43a3e62285109afe874f067f5abbdcbb10e59c", size = 11348702, upload-time = "2025-09-29T23:19:38.296Z" }, + { url = "https://files.pythonhosted.org/packages/9c/fb/231d89e8637c808b997d172b18e9d4a4bc7bf31296196c260526055d1ea0/pandas-2.3.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:6d21f6d74eb1725c2efaa71a2bfc661a0689579b58e9c0ca58a739ff0b002b53", size = 11597846, upload-time = "2025-09-29T23:19:48.856Z" }, + { url = "https://files.pythonhosted.org/packages/5c/bd/bf8064d9cfa214294356c2d6702b716d3cf3bb24be59287a6a21e24cae6b/pandas-2.3.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:3fd2f887589c7aa868e02632612ba39acb0b8948faf5cc58f0850e165bd46f35", size = 10729618, upload-time = "2025-09-29T23:39:08.659Z" }, + { url = "https://files.pythonhosted.org/packages/57/56/cf2dbe1a3f5271370669475ead12ce77c61726ffd19a35546e31aa8edf4e/pandas-2.3.3-cp312-cp312-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ecaf1e12bdc03c86ad4a7ea848d66c685cb6851d807a26aa245ca3d2017a1908", size = 11737212, upload-time = "2025-09-29T23:19:59.765Z" }, + { url = "https://files.pythonhosted.org/packages/e5/63/cd7d615331b328e287d8233ba9fdf191a9c2d11b6af0c7a59cfcec23de68/pandas-2.3.3-cp312-cp312-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b3d11d2fda7eb164ef27ffc14b4fcab16a80e1ce67e9f57e19ec0afaf715ba89", size = 12362693, upload-time = "2025-09-29T23:20:14.098Z" }, + { url = "https://files.pythonhosted.org/packages/a6/de/8b1895b107277d52f2b42d3a6806e69cfef0d5cf1d0ba343470b9d8e0a04/pandas-2.3.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:a68e15f780eddf2b07d242e17a04aa187a7ee12b40b930bfdd78070556550e98", size = 12771002, upload-time = "2025-09-29T23:20:26.76Z" }, + { url = "https://files.pythonhosted.org/packages/87/21/84072af3187a677c5893b170ba2c8fbe450a6ff911234916da889b698220/pandas-2.3.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:371a4ab48e950033bcf52b6527eccb564f52dc826c02afd9a1bc0ab731bba084", size = 13450971, upload-time = "2025-09-29T23:20:41.344Z" }, + { url = "https://files.pythonhosted.org/packages/86/41/585a168330ff063014880a80d744219dbf1dd7a1c706e75ab3425a987384/pandas-2.3.3-cp312-cp312-win_amd64.whl", hash = "sha256:a16dcec078a01eeef8ee61bf64074b4e524a2a3f4b3be9326420cabe59c4778b", size = 10992722, upload-time = "2025-09-29T23:20:54.139Z" }, + { url = "https://files.pythonhosted.org/packages/cd/4b/18b035ee18f97c1040d94debd8f2e737000ad70ccc8f5513f4eefad75f4b/pandas-2.3.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:56851a737e3470de7fa88e6131f41281ed440d29a9268dcbf0002da5ac366713", size = 11544671, upload-time = "2025-09-29T23:21:05.024Z" }, + { url = "https://files.pythonhosted.org/packages/31/94/72fac03573102779920099bcac1c3b05975c2cb5f01eac609faf34bed1ca/pandas-2.3.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:bdcd9d1167f4885211e401b3036c0c8d9e274eee67ea8d0758a256d60704cfe8", size = 10680807, upload-time = "2025-09-29T23:21:15.979Z" }, + { url = "https://files.pythonhosted.org/packages/16/87/9472cf4a487d848476865321de18cc8c920b8cab98453ab79dbbc98db63a/pandas-2.3.3-cp313-cp313-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e32e7cc9af0f1cc15548288a51a3b681cc2a219faa838e995f7dc53dbab1062d", size = 11709872, upload-time = "2025-09-29T23:21:27.165Z" }, + { url = "https://files.pythonhosted.org/packages/15/07/284f757f63f8a8d69ed4472bfd85122bd086e637bf4ed09de572d575a693/pandas-2.3.3-cp313-cp313-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:318d77e0e42a628c04dc56bcef4b40de67918f7041c2b061af1da41dcff670ac", size = 12306371, upload-time = "2025-09-29T23:21:40.532Z" }, + { url = "https://files.pythonhosted.org/packages/33/81/a3afc88fca4aa925804a27d2676d22dcd2031c2ebe08aabd0ae55b9ff282/pandas-2.3.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:4e0a175408804d566144e170d0476b15d78458795bb18f1304fb94160cabf40c", size = 12765333, upload-time = "2025-09-29T23:21:55.77Z" }, + { url = "https://files.pythonhosted.org/packages/8d/0f/b4d4ae743a83742f1153464cf1a8ecfafc3ac59722a0b5c8602310cb7158/pandas-2.3.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:93c2d9ab0fc11822b5eece72ec9587e172f63cff87c00b062f6e37448ced4493", size = 13418120, upload-time = "2025-09-29T23:22:10.109Z" }, + { url = "https://files.pythonhosted.org/packages/4f/c7/e54682c96a895d0c808453269e0b5928a07a127a15704fedb643e9b0a4c8/pandas-2.3.3-cp313-cp313-win_amd64.whl", hash = "sha256:f8bfc0e12dc78f777f323f55c58649591b2cd0c43534e8355c51d3fede5f4dee", size = 10993991, upload-time = "2025-09-29T23:25:04.889Z" }, + { url = "https://files.pythonhosted.org/packages/f9/ca/3f8d4f49740799189e1395812f3bf23b5e8fc7c190827d55a610da72ce55/pandas-2.3.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:75ea25f9529fdec2d2e93a42c523962261e567d250b0013b16210e1d40d7c2e5", size = 12048227, upload-time = "2025-09-29T23:22:24.343Z" }, + { url = "https://files.pythonhosted.org/packages/0e/5a/f43efec3e8c0cc92c4663ccad372dbdff72b60bdb56b2749f04aa1d07d7e/pandas-2.3.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:74ecdf1d301e812db96a465a525952f4dde225fdb6d8e5a521d47e1f42041e21", size = 11411056, upload-time = "2025-09-29T23:22:37.762Z" }, + { url = "https://files.pythonhosted.org/packages/46/b1/85331edfc591208c9d1a63a06baa67b21d332e63b7a591a5ba42a10bb507/pandas-2.3.3-cp313-cp313t-manylinux_2_24_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:6435cb949cb34ec11cc9860246ccb2fdc9ecd742c12d3304989017d53f039a78", size = 11645189, upload-time = "2025-09-29T23:22:51.688Z" }, + { url = "https://files.pythonhosted.org/packages/44/23/78d645adc35d94d1ac4f2a3c4112ab6f5b8999f4898b8cdf01252f8df4a9/pandas-2.3.3-cp313-cp313t-manylinux_2_24_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:900f47d8f20860de523a1ac881c4c36d65efcb2eb850e6948140fa781736e110", size = 12121912, upload-time = "2025-09-29T23:23:05.042Z" }, + { url = "https://files.pythonhosted.org/packages/53/da/d10013df5e6aaef6b425aa0c32e1fc1f3e431e4bcabd420517dceadce354/pandas-2.3.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a45c765238e2ed7d7c608fc5bc4a6f88b642f2f01e70c0c23d2224dd21829d86", size = 12712160, upload-time = "2025-09-29T23:23:28.57Z" }, + { url = "https://files.pythonhosted.org/packages/bd/17/e756653095a083d8a37cbd816cb87148debcfcd920129b25f99dd8d04271/pandas-2.3.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:c4fc4c21971a1a9f4bdb4c73978c7f7256caa3e62b323f70d6cb80db583350bc", size = 13199233, upload-time = "2025-09-29T23:24:24.876Z" }, ] [[package]] name = "pandas-flavor" -version = "0.7.0" +version = "0.8.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "pandas" }, { name = "xarray", version = "2025.6.1", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "xarray", version = "2025.9.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "xarray", version = "2025.12.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/f4/f3/be418c6244854bf66e3ec08c996a4b2b666536f2d09c1b9f2de8dd0eff73/pandas_flavor-0.7.0.tar.gz", hash = "sha256:617bf9f96902017afc9bd284f611592bce91806d3c7ae34ad64f6edab3edaf7e", size = 11057, upload-time = "2025-04-11T04:00:12.388Z" } +sdist = { url = "https://files.pythonhosted.org/packages/86/60/901bacfcc4e67499e37198ad199fb7c113b06814148f7f4822816467a925/pandas_flavor-0.8.1.tar.gz", hash = "sha256:255fa5851833ee0132c4fdd6c1565ec1e938a8c2671c37e408006da6b2bdc366", size = 98266, upload-time = "2025-11-22T11:03:11.209Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5d/e6/71ed4d95676098159b533c4a4c424cf453fec9614edaff1a0633fe228eef/pandas_flavor-0.7.0-py3-none-any.whl", hash = "sha256:7ee81e834b111e424679776f49c51abcffec88203b3ff0df2c9cb75550e06b1a", size = 8375, upload-time = "2025-04-11T04:00:11.182Z" }, + { url = "https://files.pythonhosted.org/packages/30/04/b57109ac39c90054ca8239daa61f619042b73406309c33df06d3b73a48a7/pandas_flavor-0.8.1-py3-none-any.whl", hash = "sha256:6a74c48a7014e27117a164b687c23ca9f7da46c5b198a516ab4ebaa22435292b", size = 8528, upload-time = "2025-11-22T11:03:10.368Z" }, ] [[package]] @@ -2247,145 +2256,84 @@ wheels = [ [[package]] name = "pillow" -version = "11.3.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/f3/0d/d0d6dea55cd152ce3d6767bb38a8fc10e33796ba4ba210cbab9354b6d238/pillow-11.3.0.tar.gz", hash = "sha256:3828ee7586cd0b2091b6209e5ad53e20d0649bbe87164a459d0676e035e8f523", size = 47113069, upload-time = "2025-07-01T09:16:30.666Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/4c/5d/45a3553a253ac8763f3561371432a90bdbe6000fbdcf1397ffe502aa206c/pillow-11.3.0-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:1b9c17fd4ace828b3003dfd1e30bff24863e0eb59b535e8f80194d9cc7ecf860", size = 5316554, upload-time = "2025-07-01T09:13:39.342Z" }, - { url = "https://files.pythonhosted.org/packages/7c/c8/67c12ab069ef586a25a4a79ced553586748fad100c77c0ce59bb4983ac98/pillow-11.3.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:65dc69160114cdd0ca0f35cb434633c75e8e7fad4cf855177a05bf38678f73ad", size = 4686548, upload-time = "2025-07-01T09:13:41.835Z" }, - { url = "https://files.pythonhosted.org/packages/2f/bd/6741ebd56263390b382ae4c5de02979af7f8bd9807346d068700dd6d5cf9/pillow-11.3.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7107195ddc914f656c7fc8e4a5e1c25f32e9236ea3ea860f257b0436011fddd0", size = 5859742, upload-time = "2025-07-03T13:09:47.439Z" }, - { url = "https://files.pythonhosted.org/packages/ca/0b/c412a9e27e1e6a829e6ab6c2dca52dd563efbedf4c9c6aa453d9a9b77359/pillow-11.3.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:cc3e831b563b3114baac7ec2ee86819eb03caa1a2cef0b481a5675b59c4fe23b", size = 7633087, upload-time = "2025-07-03T13:09:51.796Z" }, - { url = "https://files.pythonhosted.org/packages/59/9d/9b7076aaf30f5dd17e5e5589b2d2f5a5d7e30ff67a171eb686e4eecc2adf/pillow-11.3.0-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:f1f182ebd2303acf8c380a54f615ec883322593320a9b00438eb842c1f37ae50", size = 5963350, upload-time = "2025-07-01T09:13:43.865Z" }, - { url = "https://files.pythonhosted.org/packages/f0/16/1a6bf01fb622fb9cf5c91683823f073f053005c849b1f52ed613afcf8dae/pillow-11.3.0-cp310-cp310-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4445fa62e15936a028672fd48c4c11a66d641d2c05726c7ec1f8ba6a572036ae", size = 6631840, upload-time = "2025-07-01T09:13:46.161Z" }, - { url = "https://files.pythonhosted.org/packages/7b/e6/6ff7077077eb47fde78739e7d570bdcd7c10495666b6afcd23ab56b19a43/pillow-11.3.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:71f511f6b3b91dd543282477be45a033e4845a40278fa8dcdbfdb07109bf18f9", size = 6074005, upload-time = "2025-07-01T09:13:47.829Z" }, - { url = "https://files.pythonhosted.org/packages/c3/3a/b13f36832ea6d279a697231658199e0a03cd87ef12048016bdcc84131601/pillow-11.3.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:040a5b691b0713e1f6cbe222e0f4f74cd233421e105850ae3b3c0ceda520f42e", size = 6708372, upload-time = "2025-07-01T09:13:52.145Z" }, - { url = "https://files.pythonhosted.org/packages/6c/e4/61b2e1a7528740efbc70b3d581f33937e38e98ef3d50b05007267a55bcb2/pillow-11.3.0-cp310-cp310-win32.whl", hash = "sha256:89bd777bc6624fe4115e9fac3352c79ed60f3bb18651420635f26e643e3dd1f6", size = 6277090, upload-time = "2025-07-01T09:13:53.915Z" }, - { url = "https://files.pythonhosted.org/packages/a9/d3/60c781c83a785d6afbd6a326ed4d759d141de43aa7365725cbcd65ce5e54/pillow-11.3.0-cp310-cp310-win_amd64.whl", hash = "sha256:19d2ff547c75b8e3ff46f4d9ef969a06c30ab2d4263a9e287733aa8b2429ce8f", size = 6985988, upload-time = "2025-07-01T09:13:55.699Z" }, - { url = "https://files.pythonhosted.org/packages/9f/28/4f4a0203165eefb3763939c6789ba31013a2e90adffb456610f30f613850/pillow-11.3.0-cp310-cp310-win_arm64.whl", hash = "sha256:819931d25e57b513242859ce1876c58c59dc31587847bf74cfe06b2e0cb22d2f", size = 2422899, upload-time = "2025-07-01T09:13:57.497Z" }, - { url = "https://files.pythonhosted.org/packages/db/26/77f8ed17ca4ffd60e1dcd220a6ec6d71210ba398cfa33a13a1cd614c5613/pillow-11.3.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:1cd110edf822773368b396281a2293aeb91c90a2db00d78ea43e7e861631b722", size = 5316531, upload-time = "2025-07-01T09:13:59.203Z" }, - { url = "https://files.pythonhosted.org/packages/cb/39/ee475903197ce709322a17a866892efb560f57900d9af2e55f86db51b0a5/pillow-11.3.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:9c412fddd1b77a75aa904615ebaa6001f169b26fd467b4be93aded278266b288", size = 4686560, upload-time = "2025-07-01T09:14:01.101Z" }, - { url = "https://files.pythonhosted.org/packages/d5/90/442068a160fd179938ba55ec8c97050a612426fae5ec0a764e345839f76d/pillow-11.3.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7d1aa4de119a0ecac0a34a9c8bde33f34022e2e8f99104e47a3ca392fd60e37d", size = 5870978, upload-time = "2025-07-03T13:09:55.638Z" }, - { url = "https://files.pythonhosted.org/packages/13/92/dcdd147ab02daf405387f0218dcf792dc6dd5b14d2573d40b4caeef01059/pillow-11.3.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:91da1d88226663594e3f6b4b8c3c8d85bd504117d043740a8e0ec449087cc494", size = 7641168, upload-time = "2025-07-03T13:10:00.37Z" }, - { url = "https://files.pythonhosted.org/packages/6e/db/839d6ba7fd38b51af641aa904e2960e7a5644d60ec754c046b7d2aee00e5/pillow-11.3.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:643f189248837533073c405ec2f0bb250ba54598cf80e8c1e043381a60632f58", size = 5973053, upload-time = "2025-07-01T09:14:04.491Z" }, - { url = "https://files.pythonhosted.org/packages/f2/2f/d7675ecae6c43e9f12aa8d58b6012683b20b6edfbdac7abcb4e6af7a3784/pillow-11.3.0-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:106064daa23a745510dabce1d84f29137a37224831d88eb4ce94bb187b1d7e5f", size = 6640273, upload-time = "2025-07-01T09:14:06.235Z" }, - { url = "https://files.pythonhosted.org/packages/45/ad/931694675ede172e15b2ff03c8144a0ddaea1d87adb72bb07655eaffb654/pillow-11.3.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:cd8ff254faf15591e724dc7c4ddb6bf4793efcbe13802a4ae3e863cd300b493e", size = 6082043, upload-time = "2025-07-01T09:14:07.978Z" }, - { url = "https://files.pythonhosted.org/packages/3a/04/ba8f2b11fc80d2dd462d7abec16351b45ec99cbbaea4387648a44190351a/pillow-11.3.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:932c754c2d51ad2b2271fd01c3d121daaa35e27efae2a616f77bf164bc0b3e94", size = 6715516, upload-time = "2025-07-01T09:14:10.233Z" }, - { url = "https://files.pythonhosted.org/packages/48/59/8cd06d7f3944cc7d892e8533c56b0acb68399f640786313275faec1e3b6f/pillow-11.3.0-cp311-cp311-win32.whl", hash = "sha256:b4b8f3efc8d530a1544e5962bd6b403d5f7fe8b9e08227c6b255f98ad82b4ba0", size = 6274768, upload-time = "2025-07-01T09:14:11.921Z" }, - { url = "https://files.pythonhosted.org/packages/f1/cc/29c0f5d64ab8eae20f3232da8f8571660aa0ab4b8f1331da5c2f5f9a938e/pillow-11.3.0-cp311-cp311-win_amd64.whl", hash = "sha256:1a992e86b0dd7aeb1f053cd506508c0999d710a8f07b4c791c63843fc6a807ac", size = 6986055, upload-time = "2025-07-01T09:14:13.623Z" }, - { url = "https://files.pythonhosted.org/packages/c6/df/90bd886fabd544c25addd63e5ca6932c86f2b701d5da6c7839387a076b4a/pillow-11.3.0-cp311-cp311-win_arm64.whl", hash = "sha256:30807c931ff7c095620fe04448e2c2fc673fcbb1ffe2a7da3fb39613489b1ddd", size = 2423079, upload-time = "2025-07-01T09:14:15.268Z" }, - { url = "https://files.pythonhosted.org/packages/40/fe/1bc9b3ee13f68487a99ac9529968035cca2f0a51ec36892060edcc51d06a/pillow-11.3.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:fdae223722da47b024b867c1ea0be64e0df702c5e0a60e27daad39bf960dd1e4", size = 5278800, upload-time = "2025-07-01T09:14:17.648Z" }, - { url = "https://files.pythonhosted.org/packages/2c/32/7e2ac19b5713657384cec55f89065fb306b06af008cfd87e572035b27119/pillow-11.3.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:921bd305b10e82b4d1f5e802b6850677f965d8394203d182f078873851dada69", size = 4686296, upload-time = "2025-07-01T09:14:19.828Z" }, - { url = "https://files.pythonhosted.org/packages/8e/1e/b9e12bbe6e4c2220effebc09ea0923a07a6da1e1f1bfbc8d7d29a01ce32b/pillow-11.3.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:eb76541cba2f958032d79d143b98a3a6b3ea87f0959bbe256c0b5e416599fd5d", size = 5871726, upload-time = "2025-07-03T13:10:04.448Z" }, - { url = "https://files.pythonhosted.org/packages/8d/33/e9200d2bd7ba00dc3ddb78df1198a6e80d7669cce6c2bdbeb2530a74ec58/pillow-11.3.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:67172f2944ebba3d4a7b54f2e95c786a3a50c21b88456329314caaa28cda70f6", size = 7644652, upload-time = "2025-07-03T13:10:10.391Z" }, - { url = "https://files.pythonhosted.org/packages/41/f1/6f2427a26fc683e00d985bc391bdd76d8dd4e92fac33d841127eb8fb2313/pillow-11.3.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:97f07ed9f56a3b9b5f49d3661dc9607484e85c67e27f3e8be2c7d28ca032fec7", size = 5977787, upload-time = "2025-07-01T09:14:21.63Z" }, - { url = "https://files.pythonhosted.org/packages/e4/c9/06dd4a38974e24f932ff5f98ea3c546ce3f8c995d3f0985f8e5ba48bba19/pillow-11.3.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:676b2815362456b5b3216b4fd5bd89d362100dc6f4945154ff172e206a22c024", size = 6645236, upload-time = "2025-07-01T09:14:23.321Z" }, - { url = "https://files.pythonhosted.org/packages/40/e7/848f69fb79843b3d91241bad658e9c14f39a32f71a301bcd1d139416d1be/pillow-11.3.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:3e184b2f26ff146363dd07bde8b711833d7b0202e27d13540bfe2e35a323a809", size = 6086950, upload-time = "2025-07-01T09:14:25.237Z" }, - { url = "https://files.pythonhosted.org/packages/0b/1a/7cff92e695a2a29ac1958c2a0fe4c0b2393b60aac13b04a4fe2735cad52d/pillow-11.3.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:6be31e3fc9a621e071bc17bb7de63b85cbe0bfae91bb0363c893cbe67247780d", size = 6723358, upload-time = "2025-07-01T09:14:27.053Z" }, - { url = "https://files.pythonhosted.org/packages/26/7d/73699ad77895f69edff76b0f332acc3d497f22f5d75e5360f78cbcaff248/pillow-11.3.0-cp312-cp312-win32.whl", hash = "sha256:7b161756381f0918e05e7cb8a371fff367e807770f8fe92ecb20d905d0e1c149", size = 6275079, upload-time = "2025-07-01T09:14:30.104Z" }, - { url = "https://files.pythonhosted.org/packages/8c/ce/e7dfc873bdd9828f3b6e5c2bbb74e47a98ec23cc5c74fc4e54462f0d9204/pillow-11.3.0-cp312-cp312-win_amd64.whl", hash = "sha256:a6444696fce635783440b7f7a9fc24b3ad10a9ea3f0ab66c5905be1c19ccf17d", size = 6986324, upload-time = "2025-07-01T09:14:31.899Z" }, - { url = "https://files.pythonhosted.org/packages/16/8f/b13447d1bf0b1f7467ce7d86f6e6edf66c0ad7cf44cf5c87a37f9bed9936/pillow-11.3.0-cp312-cp312-win_arm64.whl", hash = "sha256:2aceea54f957dd4448264f9bf40875da0415c83eb85f55069d89c0ed436e3542", size = 2423067, upload-time = "2025-07-01T09:14:33.709Z" }, - { url = "https://files.pythonhosted.org/packages/1e/93/0952f2ed8db3a5a4c7a11f91965d6184ebc8cd7cbb7941a260d5f018cd2d/pillow-11.3.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:1c627742b539bba4309df89171356fcb3cc5a9178355b2727d1b74a6cf155fbd", size = 2128328, upload-time = "2025-07-01T09:14:35.276Z" }, - { url = "https://files.pythonhosted.org/packages/4b/e8/100c3d114b1a0bf4042f27e0f87d2f25e857e838034e98ca98fe7b8c0a9c/pillow-11.3.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:30b7c02f3899d10f13d7a48163c8969e4e653f8b43416d23d13d1bbfdc93b9f8", size = 2170652, upload-time = "2025-07-01T09:14:37.203Z" }, - { url = "https://files.pythonhosted.org/packages/aa/86/3f758a28a6e381758545f7cdb4942e1cb79abd271bea932998fc0db93cb6/pillow-11.3.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:7859a4cc7c9295f5838015d8cc0a9c215b77e43d07a25e460f35cf516df8626f", size = 2227443, upload-time = "2025-07-01T09:14:39.344Z" }, - { url = "https://files.pythonhosted.org/packages/01/f4/91d5b3ffa718df2f53b0dc109877993e511f4fd055d7e9508682e8aba092/pillow-11.3.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:ec1ee50470b0d050984394423d96325b744d55c701a439d2bd66089bff963d3c", size = 5278474, upload-time = "2025-07-01T09:14:41.843Z" }, - { url = "https://files.pythonhosted.org/packages/f9/0e/37d7d3eca6c879fbd9dba21268427dffda1ab00d4eb05b32923d4fbe3b12/pillow-11.3.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:7db51d222548ccfd274e4572fdbf3e810a5e66b00608862f947b163e613b67dd", size = 4686038, upload-time = "2025-07-01T09:14:44.008Z" }, - { url = "https://files.pythonhosted.org/packages/ff/b0/3426e5c7f6565e752d81221af9d3676fdbb4f352317ceafd42899aaf5d8a/pillow-11.3.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:2d6fcc902a24ac74495df63faad1884282239265c6839a0a6416d33faedfae7e", size = 5864407, upload-time = "2025-07-03T13:10:15.628Z" }, - { url = "https://files.pythonhosted.org/packages/fc/c1/c6c423134229f2a221ee53f838d4be9d82bab86f7e2f8e75e47b6bf6cd77/pillow-11.3.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f0f5d8f4a08090c6d6d578351a2b91acf519a54986c055af27e7a93feae6d3f1", size = 7639094, upload-time = "2025-07-03T13:10:21.857Z" }, - { url = "https://files.pythonhosted.org/packages/ba/c9/09e6746630fe6372c67c648ff9deae52a2bc20897d51fa293571977ceb5d/pillow-11.3.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c37d8ba9411d6003bba9e518db0db0c58a680ab9fe5179f040b0463644bc9805", size = 5973503, upload-time = "2025-07-01T09:14:45.698Z" }, - { url = "https://files.pythonhosted.org/packages/d5/1c/a2a29649c0b1983d3ef57ee87a66487fdeb45132df66ab30dd37f7dbe162/pillow-11.3.0-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:13f87d581e71d9189ab21fe0efb5a23e9f28552d5be6979e84001d3b8505abe8", size = 6642574, upload-time = "2025-07-01T09:14:47.415Z" }, - { url = "https://files.pythonhosted.org/packages/36/de/d5cc31cc4b055b6c6fd990e3e7f0f8aaf36229a2698501bcb0cdf67c7146/pillow-11.3.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:023f6d2d11784a465f09fd09a34b150ea4672e85fb3d05931d89f373ab14abb2", size = 6084060, upload-time = "2025-07-01T09:14:49.636Z" }, - { url = "https://files.pythonhosted.org/packages/d5/ea/502d938cbaeec836ac28a9b730193716f0114c41325db428e6b280513f09/pillow-11.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:45dfc51ac5975b938e9809451c51734124e73b04d0f0ac621649821a63852e7b", size = 6721407, upload-time = "2025-07-01T09:14:51.962Z" }, - { url = "https://files.pythonhosted.org/packages/45/9c/9c5e2a73f125f6cbc59cc7087c8f2d649a7ae453f83bd0362ff7c9e2aee2/pillow-11.3.0-cp313-cp313-win32.whl", hash = "sha256:a4d336baed65d50d37b88ca5b60c0fa9d81e3a87d4a7930d3880d1624d5b31f3", size = 6273841, upload-time = "2025-07-01T09:14:54.142Z" }, - { url = "https://files.pythonhosted.org/packages/23/85/397c73524e0cd212067e0c969aa245b01d50183439550d24d9f55781b776/pillow-11.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:0bce5c4fd0921f99d2e858dc4d4d64193407e1b99478bc5cacecba2311abde51", size = 6978450, upload-time = "2025-07-01T09:14:56.436Z" }, - { url = "https://files.pythonhosted.org/packages/17/d2/622f4547f69cd173955194b78e4d19ca4935a1b0f03a302d655c9f6aae65/pillow-11.3.0-cp313-cp313-win_arm64.whl", hash = "sha256:1904e1264881f682f02b7f8167935cce37bc97db457f8e7849dc3a6a52b99580", size = 2423055, upload-time = "2025-07-01T09:14:58.072Z" }, - { url = "https://files.pythonhosted.org/packages/dd/80/a8a2ac21dda2e82480852978416cfacd439a4b490a501a288ecf4fe2532d/pillow-11.3.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:4c834a3921375c48ee6b9624061076bc0a32a60b5532b322cc0ea64e639dd50e", size = 5281110, upload-time = "2025-07-01T09:14:59.79Z" }, - { url = "https://files.pythonhosted.org/packages/44/d6/b79754ca790f315918732e18f82a8146d33bcd7f4494380457ea89eb883d/pillow-11.3.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:5e05688ccef30ea69b9317a9ead994b93975104a677a36a8ed8106be9260aa6d", size = 4689547, upload-time = "2025-07-01T09:15:01.648Z" }, - { url = "https://files.pythonhosted.org/packages/49/20/716b8717d331150cb00f7fdd78169c01e8e0c219732a78b0e59b6bdb2fd6/pillow-11.3.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:1019b04af07fc0163e2810167918cb5add8d74674b6267616021ab558dc98ced", size = 5901554, upload-time = "2025-07-03T13:10:27.018Z" }, - { url = "https://files.pythonhosted.org/packages/74/cf/a9f3a2514a65bb071075063a96f0a5cf949c2f2fce683c15ccc83b1c1cab/pillow-11.3.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f944255db153ebb2b19c51fe85dd99ef0ce494123f21b9db4877ffdfc5590c7c", size = 7669132, upload-time = "2025-07-03T13:10:33.01Z" }, - { url = "https://files.pythonhosted.org/packages/98/3c/da78805cbdbee9cb43efe8261dd7cc0b4b93f2ac79b676c03159e9db2187/pillow-11.3.0-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1f85acb69adf2aaee8b7da124efebbdb959a104db34d3a2cb0f3793dbae422a8", size = 6005001, upload-time = "2025-07-01T09:15:03.365Z" }, - { url = "https://files.pythonhosted.org/packages/6c/fa/ce044b91faecf30e635321351bba32bab5a7e034c60187fe9698191aef4f/pillow-11.3.0-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:05f6ecbeff5005399bb48d198f098a9b4b6bdf27b8487c7f38ca16eeb070cd59", size = 6668814, upload-time = "2025-07-01T09:15:05.655Z" }, - { url = "https://files.pythonhosted.org/packages/7b/51/90f9291406d09bf93686434f9183aba27b831c10c87746ff49f127ee80cb/pillow-11.3.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:a7bc6e6fd0395bc052f16b1a8670859964dbd7003bd0af2ff08342eb6e442cfe", size = 6113124, upload-time = "2025-07-01T09:15:07.358Z" }, - { url = "https://files.pythonhosted.org/packages/cd/5a/6fec59b1dfb619234f7636d4157d11fb4e196caeee220232a8d2ec48488d/pillow-11.3.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:83e1b0161c9d148125083a35c1c5a89db5b7054834fd4387499e06552035236c", size = 6747186, upload-time = "2025-07-01T09:15:09.317Z" }, - { url = "https://files.pythonhosted.org/packages/49/6b/00187a044f98255225f172de653941e61da37104a9ea60e4f6887717e2b5/pillow-11.3.0-cp313-cp313t-win32.whl", hash = "sha256:2a3117c06b8fb646639dce83694f2f9eac405472713fcb1ae887469c0d4f6788", size = 6277546, upload-time = "2025-07-01T09:15:11.311Z" }, - { url = "https://files.pythonhosted.org/packages/e8/5c/6caaba7e261c0d75bab23be79f1d06b5ad2a2ae49f028ccec801b0e853d6/pillow-11.3.0-cp313-cp313t-win_amd64.whl", hash = "sha256:857844335c95bea93fb39e0fa2726b4d9d758850b34075a7e3ff4f4fa3aa3b31", size = 6985102, upload-time = "2025-07-01T09:15:13.164Z" }, - { url = "https://files.pythonhosted.org/packages/f3/7e/b623008460c09a0cb38263c93b828c666493caee2eb34ff67f778b87e58c/pillow-11.3.0-cp313-cp313t-win_arm64.whl", hash = "sha256:8797edc41f3e8536ae4b10897ee2f637235c94f27404cac7297f7b607dd0716e", size = 2424803, upload-time = "2025-07-01T09:15:15.695Z" }, - { url = "https://files.pythonhosted.org/packages/6f/8b/209bd6b62ce8367f47e68a218bffac88888fdf2c9fcf1ecadc6c3ec1ebc7/pillow-11.3.0-pp310-pypy310_pp73-macosx_10_15_x86_64.whl", hash = "sha256:3cee80663f29e3843b68199b9d6f4f54bd1d4a6b59bdd91bceefc51238bcb967", size = 5270556, upload-time = "2025-07-01T09:16:09.961Z" }, - { url = "https://files.pythonhosted.org/packages/2e/e6/231a0b76070c2cfd9e260a7a5b504fb72da0a95279410fa7afd99d9751d6/pillow-11.3.0-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:b5f56c3f344f2ccaf0dd875d3e180f631dc60a51b314295a3e681fe8cf851fbe", size = 4654625, upload-time = "2025-07-01T09:16:11.913Z" }, - { url = "https://files.pythonhosted.org/packages/13/f4/10cf94fda33cb12765f2397fc285fa6d8eb9c29de7f3185165b702fc7386/pillow-11.3.0-pp310-pypy310_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:e67d793d180c9df62f1f40aee3accca4829d3794c95098887edc18af4b8b780c", size = 4874207, upload-time = "2025-07-03T13:11:10.201Z" }, - { url = "https://files.pythonhosted.org/packages/72/c9/583821097dc691880c92892e8e2d41fe0a5a3d6021f4963371d2f6d57250/pillow-11.3.0-pp310-pypy310_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:d000f46e2917c705e9fb93a3606ee4a819d1e3aa7a9b442f6444f07e77cf5e25", size = 6583939, upload-time = "2025-07-03T13:11:15.68Z" }, - { url = "https://files.pythonhosted.org/packages/3b/8e/5c9d410f9217b12320efc7c413e72693f48468979a013ad17fd690397b9a/pillow-11.3.0-pp310-pypy310_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:527b37216b6ac3a12d7838dc3bd75208ec57c1c6d11ef01902266a5a0c14fc27", size = 4957166, upload-time = "2025-07-01T09:16:13.74Z" }, - { url = "https://files.pythonhosted.org/packages/62/bb/78347dbe13219991877ffb3a91bf09da8317fbfcd4b5f9140aeae020ad71/pillow-11.3.0-pp310-pypy310_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:be5463ac478b623b9dd3937afd7fb7ab3d79dd290a28e2b6df292dc75063eb8a", size = 5581482, upload-time = "2025-07-01T09:16:16.107Z" }, - { url = "https://files.pythonhosted.org/packages/d9/28/1000353d5e61498aaeaaf7f1e4b49ddb05f2c6575f9d4f9f914a3538b6e1/pillow-11.3.0-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:8dc70ca24c110503e16918a658b869019126ecfe03109b754c402daff12b3d9f", size = 6984596, upload-time = "2025-07-01T09:16:18.07Z" }, - { url = "https://files.pythonhosted.org/packages/9e/e3/6fa84033758276fb31da12e5fb66ad747ae83b93c67af17f8c6ff4cc8f34/pillow-11.3.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:7c8ec7a017ad1bd562f93dbd8505763e688d388cde6e4a010ae1486916e713e6", size = 5270566, upload-time = "2025-07-01T09:16:19.801Z" }, - { url = "https://files.pythonhosted.org/packages/5b/ee/e8d2e1ab4892970b561e1ba96cbd59c0d28cf66737fc44abb2aec3795a4e/pillow-11.3.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:9ab6ae226de48019caa8074894544af5b53a117ccb9d3b3dcb2871464c829438", size = 4654618, upload-time = "2025-07-01T09:16:21.818Z" }, - { url = "https://files.pythonhosted.org/packages/f2/6d/17f80f4e1f0761f02160fc433abd4109fa1548dcfdca46cfdadaf9efa565/pillow-11.3.0-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:fe27fb049cdcca11f11a7bfda64043c37b30e6b91f10cb5bab275806c32f6ab3", size = 4874248, upload-time = "2025-07-03T13:11:20.738Z" }, - { url = "https://files.pythonhosted.org/packages/de/5f/c22340acd61cef960130585bbe2120e2fd8434c214802f07e8c03596b17e/pillow-11.3.0-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:465b9e8844e3c3519a983d58b80be3f668e2a7a5db97f2784e7079fbc9f9822c", size = 6583963, upload-time = "2025-07-03T13:11:26.283Z" }, - { url = "https://files.pythonhosted.org/packages/31/5e/03966aedfbfcbb4d5f8aa042452d3361f325b963ebbadddac05b122e47dd/pillow-11.3.0-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5418b53c0d59b3824d05e029669efa023bbef0f3e92e75ec8428f3799487f361", size = 4957170, upload-time = "2025-07-01T09:16:23.762Z" }, - { url = "https://files.pythonhosted.org/packages/cc/2d/e082982aacc927fc2cab48e1e731bdb1643a1406acace8bed0900a61464e/pillow-11.3.0-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:504b6f59505f08ae014f724b6207ff6222662aab5cc9542577fb084ed0676ac7", size = 5581505, upload-time = "2025-07-01T09:16:25.593Z" }, - { url = "https://files.pythonhosted.org/packages/34/e7/ae39f538fd6844e982063c3a5e4598b8ced43b9633baa3a85ef33af8c05c/pillow-11.3.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:c84d689db21a1c397d001aa08241044aa2069e7587b398c8cc63020390b1c1b8", size = 6984598, upload-time = "2025-07-01T09:16:27.732Z" }, -] - -[[package]] -name = "pip" -version = "25.2" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/20/16/650289cd3f43d5a2fadfd98c68bd1e1e7f2550a1a5326768cddfbcedb2c5/pip-25.2.tar.gz", hash = "sha256:578283f006390f85bb6282dffb876454593d637f5d1be494b5202ce4877e71f2", size = 1840021, upload-time = "2025-07-30T21:50:15.401Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/b7/3f/945ef7ab14dc4f9d7f40288d2df998d1837ee0888ec3659c813487572faa/pip-25.2-py3-none-any.whl", hash = "sha256:6d67a2b4e7f14d8b31b8b52648866fa717f45a1eb70e83002f4331d07e953717", size = 1752557, upload-time = "2025-07-30T21:50:13.323Z" }, -] - -[[package]] -name = "pip-api" -version = "0.0.34" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "pip" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/b9/f1/ee85f8c7e82bccf90a3c7aad22863cc6e20057860a1361083cd2adacb92e/pip_api-0.0.34.tar.gz", hash = "sha256:9b75e958f14c5a2614bae415f2adf7eeb54d50a2cfbe7e24fd4826471bac3625", size = 123017, upload-time = "2024-07-09T20:32:30.641Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/91/f7/ebf5003e1065fd00b4cbef53bf0a65c3d3e1b599b676d5383ccb7a8b88ba/pip_api-0.0.34-py3-none-any.whl", hash = "sha256:8b2d7d7c37f2447373aa2cf8b1f60a2f2b27a84e1e9e0294a3f6ef10eb3ba6bb", size = 120369, upload-time = "2024-07-09T20:32:29.099Z" }, -] - -[[package]] -name = "pip-audit" -version = "2.9.0" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "cachecontrol", extra = ["filecache"] }, - { name = "cyclonedx-python-lib" }, - { name = "packaging" }, - { name = "pip-api" }, - { name = "pip-requirements-parser" }, - { name = "platformdirs" }, - { name = "requests" }, - { name = "rich" }, - { name = "toml" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/cc/7f/28fad19a9806f796f13192ab6974c07c4a04d9cbb8e30dd895c3c11ce7ee/pip_audit-2.9.0.tar.gz", hash = "sha256:0b998410b58339d7a231e5aa004326a294e4c7c6295289cdc9d5e1ef07b1f44d", size = 52089, upload-time = "2025-04-07T16:45:23.679Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/43/9e/f4dfd9d3dadb6d6dc9406f1111062f871e2e248ed7b584cca6020baf2ac1/pip_audit-2.9.0-py3-none-any.whl", hash = "sha256:348b16e60895749a0839875d7cc27ebd692e1584ebe5d5cb145941c8e25a80bd", size = 58634, upload-time = "2025-04-07T16:45:22.056Z" }, -] - -[[package]] -name = "pip-requirements-parser" -version = "32.0.1" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "packaging" }, - { name = "pyparsing" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/5e/2a/63b574101850e7f7b306ddbdb02cb294380d37948140eecd468fae392b54/pip-requirements-parser-32.0.1.tar.gz", hash = "sha256:b4fa3a7a0be38243123cf9d1f3518da10c51bdb165a2b2985566247f9155a7d3", size = 209359, upload-time = "2022-12-21T15:25:22.732Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/54/d0/d04f1d1e064ac901439699ee097f58688caadea42498ec9c4b4ad2ef84ab/pip_requirements_parser-32.0.1-py3-none-any.whl", hash = "sha256:4659bc2a667783e7a15d190f6fccf8b2486685b6dba4c19c3876314769c57526", size = 35648, upload-time = "2022-12-21T15:25:21.046Z" }, +version = "12.0.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/5a/b0/cace85a1b0c9775a9f8f5d5423c8261c858760e2466c79b2dd184638b056/pillow-12.0.0.tar.gz", hash = "sha256:87d4f8125c9988bfbed67af47dd7a953e2fc7b0cc1e7800ec6d2080d490bb353", size = 47008828, upload-time = "2025-10-15T18:24:14.008Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5d/08/26e68b6b5da219c2a2cb7b563af008b53bb8e6b6fcb3fa40715fcdb2523a/pillow-12.0.0-cp310-cp310-macosx_10_10_x86_64.whl", hash = "sha256:3adfb466bbc544b926d50fe8f4a4e6abd8c6bffd28a26177594e6e9b2b76572b", size = 5289809, upload-time = "2025-10-15T18:21:27.791Z" }, + { url = "https://files.pythonhosted.org/packages/cb/e9/4e58fb097fb74c7b4758a680aacd558810a417d1edaa7000142976ef9d2f/pillow-12.0.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:1ac11e8ea4f611c3c0147424eae514028b5e9077dd99ab91e1bd7bc33ff145e1", size = 4650606, upload-time = "2025-10-15T18:21:29.823Z" }, + { url = "https://files.pythonhosted.org/packages/4b/e0/1fa492aa9f77b3bc6d471c468e62bfea1823056bf7e5e4f1914d7ab2565e/pillow-12.0.0-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:d49e2314c373f4c2b39446fb1a45ed333c850e09d0c59ac79b72eb3b95397363", size = 6221023, upload-time = "2025-10-15T18:21:31.415Z" }, + { url = "https://files.pythonhosted.org/packages/c1/09/4de7cd03e33734ccd0c876f0251401f1314e819cbfd89a0fcb6e77927cc6/pillow-12.0.0-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c7b2a63fd6d5246349f3d3f37b14430d73ee7e8173154461785e43036ffa96ca", size = 8024937, upload-time = "2025-10-15T18:21:33.453Z" }, + { url = "https://files.pythonhosted.org/packages/2e/69/0688e7c1390666592876d9d474f5e135abb4acb39dcb583c4dc5490f1aff/pillow-12.0.0-cp310-cp310-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d64317d2587c70324b79861babb9c09f71fbb780bad212018874b2c013d8600e", size = 6334139, upload-time = "2025-10-15T18:21:35.395Z" }, + { url = "https://files.pythonhosted.org/packages/ed/1c/880921e98f525b9b44ce747ad1ea8f73fd7e992bafe3ca5e5644bf433dea/pillow-12.0.0-cp310-cp310-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:d77153e14b709fd8b8af6f66a3afbb9ed6e9fc5ccf0b6b7e1ced7b036a228782", size = 7026074, upload-time = "2025-10-15T18:21:37.219Z" }, + { url = "https://files.pythonhosted.org/packages/28/03/96f718331b19b355610ef4ebdbbde3557c726513030665071fd025745671/pillow-12.0.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:32ed80ea8a90ee3e6fa08c21e2e091bba6eda8eccc83dbc34c95169507a91f10", size = 6448852, upload-time = "2025-10-15T18:21:39.168Z" }, + { url = "https://files.pythonhosted.org/packages/3a/a0/6a193b3f0cc9437b122978d2c5cbce59510ccf9a5b48825096ed7472da2f/pillow-12.0.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:c828a1ae702fc712978bda0320ba1b9893d99be0badf2647f693cc01cf0f04fa", size = 7117058, upload-time = "2025-10-15T18:21:40.997Z" }, + { url = "https://files.pythonhosted.org/packages/a7/c4/043192375eaa4463254e8e61f0e2ec9a846b983929a8d0a7122e0a6d6fff/pillow-12.0.0-cp310-cp310-win32.whl", hash = "sha256:bd87e140e45399c818fac4247880b9ce719e4783d767e030a883a970be632275", size = 6295431, upload-time = "2025-10-15T18:21:42.518Z" }, + { url = "https://files.pythonhosted.org/packages/92/c6/c2f2fc7e56301c21827e689bb8b0b465f1b52878b57471a070678c0c33cd/pillow-12.0.0-cp310-cp310-win_amd64.whl", hash = "sha256:455247ac8a4cfb7b9bc45b7e432d10421aea9fc2e74d285ba4072688a74c2e9d", size = 7000412, upload-time = "2025-10-15T18:21:44.404Z" }, + { url = "https://files.pythonhosted.org/packages/b2/d2/5f675067ba82da7a1c238a73b32e3fd78d67f9d9f80fbadd33a40b9c0481/pillow-12.0.0-cp310-cp310-win_arm64.whl", hash = "sha256:6ace95230bfb7cd79ef66caa064bbe2f2a1e63d93471c3a2e1f1348d9f22d6b7", size = 2435903, upload-time = "2025-10-15T18:21:46.29Z" }, + { url = "https://files.pythonhosted.org/packages/0e/5a/a2f6773b64edb921a756eb0729068acad9fc5208a53f4a349396e9436721/pillow-12.0.0-cp311-cp311-macosx_10_10_x86_64.whl", hash = "sha256:0fd00cac9c03256c8b2ff58f162ebcd2587ad3e1f2e397eab718c47e24d231cc", size = 5289798, upload-time = "2025-10-15T18:21:47.763Z" }, + { url = "https://files.pythonhosted.org/packages/2e/05/069b1f8a2e4b5a37493da6c5868531c3f77b85e716ad7a590ef87d58730d/pillow-12.0.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:a3475b96f5908b3b16c47533daaa87380c491357d197564e0ba34ae75c0f3257", size = 4650589, upload-time = "2025-10-15T18:21:49.515Z" }, + { url = "https://files.pythonhosted.org/packages/61/e3/2c820d6e9a36432503ead175ae294f96861b07600a7156154a086ba7111a/pillow-12.0.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:110486b79f2d112cf6add83b28b627e369219388f64ef2f960fef9ebaf54c642", size = 6230472, upload-time = "2025-10-15T18:21:51.052Z" }, + { url = "https://files.pythonhosted.org/packages/4f/89/63427f51c64209c5e23d4d52071c8d0f21024d3a8a487737caaf614a5795/pillow-12.0.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:5269cc1caeedb67e6f7269a42014f381f45e2e7cd42d834ede3c703a1d915fe3", size = 8033887, upload-time = "2025-10-15T18:21:52.604Z" }, + { url = "https://files.pythonhosted.org/packages/f6/1b/c9711318d4901093c15840f268ad649459cd81984c9ec9887756cca049a5/pillow-12.0.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:aa5129de4e174daccbc59d0a3b6d20eaf24417d59851c07ebb37aeb02947987c", size = 6343964, upload-time = "2025-10-15T18:21:54.619Z" }, + { url = "https://files.pythonhosted.org/packages/41/1e/db9470f2d030b4995083044cd8738cdd1bf773106819f6d8ba12597d5352/pillow-12.0.0-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bee2a6db3a7242ea309aa7ee8e2780726fed67ff4e5b40169f2c940e7eb09227", size = 7034756, upload-time = "2025-10-15T18:21:56.151Z" }, + { url = "https://files.pythonhosted.org/packages/cc/b0/6177a8bdd5ee4ed87cba2de5a3cc1db55ffbbec6176784ce5bb75aa96798/pillow-12.0.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:90387104ee8400a7b4598253b4c406f8958f59fcf983a6cea2b50d59f7d63d0b", size = 6458075, upload-time = "2025-10-15T18:21:57.759Z" }, + { url = "https://files.pythonhosted.org/packages/bc/5e/61537aa6fa977922c6a03253a0e727e6e4a72381a80d63ad8eec350684f2/pillow-12.0.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:bc91a56697869546d1b8f0a3ff35224557ae7f881050e99f615e0119bf934b4e", size = 7125955, upload-time = "2025-10-15T18:21:59.372Z" }, + { url = "https://files.pythonhosted.org/packages/1f/3d/d5033539344ee3cbd9a4d69e12e63ca3a44a739eb2d4c8da350a3d38edd7/pillow-12.0.0-cp311-cp311-win32.whl", hash = "sha256:27f95b12453d165099c84f8a8bfdfd46b9e4bda9e0e4b65f0635430027f55739", size = 6298440, upload-time = "2025-10-15T18:22:00.982Z" }, + { url = "https://files.pythonhosted.org/packages/4d/42/aaca386de5cc8bd8a0254516957c1f265e3521c91515b16e286c662854c4/pillow-12.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:b583dc9070312190192631373c6c8ed277254aa6e6084b74bdd0a6d3b221608e", size = 6999256, upload-time = "2025-10-15T18:22:02.617Z" }, + { url = "https://files.pythonhosted.org/packages/ba/f1/9197c9c2d5708b785f631a6dfbfa8eb3fb9672837cb92ae9af812c13b4ed/pillow-12.0.0-cp311-cp311-win_arm64.whl", hash = "sha256:759de84a33be3b178a64c8ba28ad5c135900359e85fb662bc6e403ad4407791d", size = 2436025, upload-time = "2025-10-15T18:22:04.598Z" }, + { url = "https://files.pythonhosted.org/packages/2c/90/4fcce2c22caf044e660a198d740e7fbc14395619e3cb1abad12192c0826c/pillow-12.0.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:53561a4ddc36facb432fae7a9d8afbfaf94795414f5cdc5fc52f28c1dca90371", size = 5249377, upload-time = "2025-10-15T18:22:05.993Z" }, + { url = "https://files.pythonhosted.org/packages/fd/e0/ed960067543d080691d47d6938ebccbf3976a931c9567ab2fbfab983a5dd/pillow-12.0.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:71db6b4c1653045dacc1585c1b0d184004f0d7e694c7b34ac165ca70c0838082", size = 4650343, upload-time = "2025-10-15T18:22:07.718Z" }, + { url = "https://files.pythonhosted.org/packages/e7/a1/f81fdeddcb99c044bf7d6faa47e12850f13cee0849537a7d27eeab5534d4/pillow-12.0.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:2fa5f0b6716fc88f11380b88b31fe591a06c6315e955c096c35715788b339e3f", size = 6232981, upload-time = "2025-10-15T18:22:09.287Z" }, + { url = "https://files.pythonhosted.org/packages/88/e1/9098d3ce341a8750b55b0e00c03f1630d6178f38ac191c81c97a3b047b44/pillow-12.0.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:82240051c6ca513c616f7f9da06e871f61bfd7805f566275841af15015b8f98d", size = 8041399, upload-time = "2025-10-15T18:22:10.872Z" }, + { url = "https://files.pythonhosted.org/packages/a7/62/a22e8d3b602ae8cc01446d0c57a54e982737f44b6f2e1e019a925143771d/pillow-12.0.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:55f818bd74fe2f11d4d7cbc65880a843c4075e0ac7226bc1a23261dbea531953", size = 6347740, upload-time = "2025-10-15T18:22:12.769Z" }, + { url = "https://files.pythonhosted.org/packages/4f/87/424511bdcd02c8d7acf9f65caa09f291a519b16bd83c3fb3374b3d4ae951/pillow-12.0.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b87843e225e74576437fd5b6a4c2205d422754f84a06942cfaf1dc32243e45a8", size = 7040201, upload-time = "2025-10-15T18:22:14.813Z" }, + { url = "https://files.pythonhosted.org/packages/dc/4d/435c8ac688c54d11755aedfdd9f29c9eeddf68d150fe42d1d3dbd2365149/pillow-12.0.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:c607c90ba67533e1b2355b821fef6764d1dd2cbe26b8c1005ae84f7aea25ff79", size = 6462334, upload-time = "2025-10-15T18:22:16.375Z" }, + { url = "https://files.pythonhosted.org/packages/2b/f2/ad34167a8059a59b8ad10bc5c72d4d9b35acc6b7c0877af8ac885b5f2044/pillow-12.0.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:21f241bdd5080a15bc86d3466a9f6074a9c2c2b314100dd896ac81ee6db2f1ba", size = 7134162, upload-time = "2025-10-15T18:22:17.996Z" }, + { url = "https://files.pythonhosted.org/packages/0c/b1/a7391df6adacf0a5c2cf6ac1cf1fcc1369e7d439d28f637a847f8803beb3/pillow-12.0.0-cp312-cp312-win32.whl", hash = "sha256:dd333073e0cacdc3089525c7df7d39b211bcdf31fc2824e49d01c6b6187b07d0", size = 6298769, upload-time = "2025-10-15T18:22:19.923Z" }, + { url = "https://files.pythonhosted.org/packages/a2/0b/d87733741526541c909bbf159e338dcace4f982daac6e5a8d6be225ca32d/pillow-12.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:9fe611163f6303d1619bbcb653540a4d60f9e55e622d60a3108be0d5b441017a", size = 7001107, upload-time = "2025-10-15T18:22:21.644Z" }, + { url = "https://files.pythonhosted.org/packages/bc/96/aaa61ce33cc98421fb6088af2a03be4157b1e7e0e87087c888e2370a7f45/pillow-12.0.0-cp312-cp312-win_arm64.whl", hash = "sha256:7dfb439562f234f7d57b1ac6bc8fe7f838a4bd49c79230e0f6a1da93e82f1fad", size = 2436012, upload-time = "2025-10-15T18:22:23.621Z" }, + { url = "https://files.pythonhosted.org/packages/62/f2/de993bb2d21b33a98d031ecf6a978e4b61da207bef02f7b43093774c480d/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:0869154a2d0546545cde61d1789a6524319fc1897d9ee31218eae7a60ccc5643", size = 4045493, upload-time = "2025-10-15T18:22:25.758Z" }, + { url = "https://files.pythonhosted.org/packages/0e/b6/bc8d0c4c9f6f111a783d045310945deb769b806d7574764234ffd50bc5ea/pillow-12.0.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:a7921c5a6d31b3d756ec980f2f47c0cfdbce0fc48c22a39347a895f41f4a6ea4", size = 4120461, upload-time = "2025-10-15T18:22:27.286Z" }, + { url = "https://files.pythonhosted.org/packages/5d/57/d60d343709366a353dc56adb4ee1e7d8a2cc34e3fbc22905f4167cfec119/pillow-12.0.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:1ee80a59f6ce048ae13cda1abf7fbd2a34ab9ee7d401c46be3ca685d1999a399", size = 3576912, upload-time = "2025-10-15T18:22:28.751Z" }, + { url = "https://files.pythonhosted.org/packages/a4/a4/a0a31467e3f83b94d37568294b01d22b43ae3c5d85f2811769b9c66389dd/pillow-12.0.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:c50f36a62a22d350c96e49ad02d0da41dbd17ddc2e29750dbdba4323f85eb4a5", size = 5249132, upload-time = "2025-10-15T18:22:30.641Z" }, + { url = "https://files.pythonhosted.org/packages/83/06/48eab21dd561de2914242711434c0c0eb992ed08ff3f6107a5f44527f5e9/pillow-12.0.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:5193fde9a5f23c331ea26d0cf171fbf67e3f247585f50c08b3e205c7aeb4589b", size = 4650099, upload-time = "2025-10-15T18:22:32.73Z" }, + { url = "https://files.pythonhosted.org/packages/fc/bd/69ed99fd46a8dba7c1887156d3572fe4484e3f031405fcc5a92e31c04035/pillow-12.0.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:bde737cff1a975b70652b62d626f7785e0480918dece11e8fef3c0cf057351c3", size = 6230808, upload-time = "2025-10-15T18:22:34.337Z" }, + { url = "https://files.pythonhosted.org/packages/ea/94/8fad659bcdbf86ed70099cb60ae40be6acca434bbc8c4c0d4ef356d7e0de/pillow-12.0.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:a6597ff2b61d121172f5844b53f21467f7082f5fb385a9a29c01414463f93b07", size = 8037804, upload-time = "2025-10-15T18:22:36.402Z" }, + { url = "https://files.pythonhosted.org/packages/20/39/c685d05c06deecfd4e2d1950e9a908aa2ca8bc4e6c3b12d93b9cafbd7837/pillow-12.0.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0b817e7035ea7f6b942c13aa03bb554fc44fea70838ea21f8eb31c638326584e", size = 6345553, upload-time = "2025-10-15T18:22:38.066Z" }, + { url = "https://files.pythonhosted.org/packages/38/57/755dbd06530a27a5ed74f8cb0a7a44a21722ebf318edbe67ddbd7fb28f88/pillow-12.0.0-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:f4f1231b7dec408e8670264ce63e9c71409d9583dd21d32c163e25213ee2a344", size = 7037729, upload-time = "2025-10-15T18:22:39.769Z" }, + { url = "https://files.pythonhosted.org/packages/ca/b6/7e94f4c41d238615674d06ed677c14883103dce1c52e4af16f000338cfd7/pillow-12.0.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:6e51b71417049ad6ab14c49608b4a24d8fb3fe605e5dfabfe523b58064dc3d27", size = 6459789, upload-time = "2025-10-15T18:22:41.437Z" }, + { url = "https://files.pythonhosted.org/packages/9c/14/4448bb0b5e0f22dd865290536d20ec8a23b64e2d04280b89139f09a36bb6/pillow-12.0.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:d120c38a42c234dc9a8c5de7ceaaf899cf33561956acb4941653f8bdc657aa79", size = 7130917, upload-time = "2025-10-15T18:22:43.152Z" }, + { url = "https://files.pythonhosted.org/packages/dd/ca/16c6926cc1c015845745d5c16c9358e24282f1e588237a4c36d2b30f182f/pillow-12.0.0-cp313-cp313-win32.whl", hash = "sha256:4cc6b3b2efff105c6a1656cfe59da4fdde2cda9af1c5e0b58529b24525d0a098", size = 6302391, upload-time = "2025-10-15T18:22:44.753Z" }, + { url = "https://files.pythonhosted.org/packages/6d/2a/dd43dcfd6dae9b6a49ee28a8eedb98c7d5ff2de94a5d834565164667b97b/pillow-12.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:4cf7fed4b4580601c4345ceb5d4cbf5a980d030fd5ad07c4d2ec589f95f09905", size = 7007477, upload-time = "2025-10-15T18:22:46.838Z" }, + { url = "https://files.pythonhosted.org/packages/77/f0/72ea067f4b5ae5ead653053212af05ce3705807906ba3f3e8f58ddf617e6/pillow-12.0.0-cp313-cp313-win_arm64.whl", hash = "sha256:9f0b04c6b8584c2c193babcccc908b38ed29524b29dd464bc8801bf10d746a3a", size = 2435918, upload-time = "2025-10-15T18:22:48.399Z" }, + { url = "https://files.pythonhosted.org/packages/f5/5e/9046b423735c21f0487ea6cb5b10f89ea8f8dfbe32576fe052b5ba9d4e5b/pillow-12.0.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:7fa22993bac7b77b78cae22bad1e2a987ddf0d9015c63358032f84a53f23cdc3", size = 5251406, upload-time = "2025-10-15T18:22:49.905Z" }, + { url = "https://files.pythonhosted.org/packages/12/66/982ceebcdb13c97270ef7a56c3969635b4ee7cd45227fa707c94719229c5/pillow-12.0.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:f135c702ac42262573fe9714dfe99c944b4ba307af5eb507abef1667e2cbbced", size = 4653218, upload-time = "2025-10-15T18:22:51.587Z" }, + { url = "https://files.pythonhosted.org/packages/16/b3/81e625524688c31859450119bf12674619429cab3119eec0e30a7a1029cb/pillow-12.0.0-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:c85de1136429c524e55cfa4e033b4a7940ac5c8ee4d9401cc2d1bf48154bbc7b", size = 6266564, upload-time = "2025-10-15T18:22:53.215Z" }, + { url = "https://files.pythonhosted.org/packages/98/59/dfb38f2a41240d2408096e1a76c671d0a105a4a8471b1871c6902719450c/pillow-12.0.0-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:38df9b4bfd3db902c9c2bd369bcacaf9d935b2fff73709429d95cc41554f7b3d", size = 8069260, upload-time = "2025-10-15T18:22:54.933Z" }, + { url = "https://files.pythonhosted.org/packages/dc/3d/378dbea5cd1874b94c312425ca77b0f47776c78e0df2df751b820c8c1d6c/pillow-12.0.0-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:7d87ef5795da03d742bf49439f9ca4d027cde49c82c5371ba52464aee266699a", size = 6379248, upload-time = "2025-10-15T18:22:56.605Z" }, + { url = "https://files.pythonhosted.org/packages/84/b0/d525ef47d71590f1621510327acec75ae58c721dc071b17d8d652ca494d8/pillow-12.0.0-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:aff9e4d82d082ff9513bdd6acd4f5bd359f5b2c870907d2b0a9c5e10d40c88fe", size = 7066043, upload-time = "2025-10-15T18:22:58.53Z" }, + { url = "https://files.pythonhosted.org/packages/61/2c/aced60e9cf9d0cde341d54bf7932c9ffc33ddb4a1595798b3a5150c7ec4e/pillow-12.0.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:8d8ca2b210ada074d57fcee40c30446c9562e542fc46aedc19baf758a93532ee", size = 6490915, upload-time = "2025-10-15T18:23:00.582Z" }, + { url = "https://files.pythonhosted.org/packages/ef/26/69dcb9b91f4e59f8f34b2332a4a0a951b44f547c4ed39d3e4dcfcff48f89/pillow-12.0.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:99a7f72fb6249302aa62245680754862a44179b545ded638cf1fef59befb57ef", size = 7157998, upload-time = "2025-10-15T18:23:02.627Z" }, + { url = "https://files.pythonhosted.org/packages/61/2b/726235842220ca95fa441ddf55dd2382b52ab5b8d9c0596fe6b3f23dafe8/pillow-12.0.0-cp313-cp313t-win32.whl", hash = "sha256:4078242472387600b2ce8d93ade8899c12bf33fa89e55ec89fe126e9d6d5d9e9", size = 6306201, upload-time = "2025-10-15T18:23:04.709Z" }, + { url = "https://files.pythonhosted.org/packages/c0/3d/2afaf4e840b2df71344ababf2f8edd75a705ce500e5dc1e7227808312ae1/pillow-12.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:2c54c1a783d6d60595d3514f0efe9b37c8808746a66920315bfd34a938d7994b", size = 7013165, upload-time = "2025-10-15T18:23:06.46Z" }, + { url = "https://files.pythonhosted.org/packages/6f/75/3fa09aa5cf6ed04bee3fa575798ddf1ce0bace8edb47249c798077a81f7f/pillow-12.0.0-cp313-cp313t-win_arm64.whl", hash = "sha256:26d9f7d2b604cd23aba3e9faf795787456ac25634d82cd060556998e39c6fa47", size = 2437834, upload-time = "2025-10-15T18:23:08.194Z" }, + { url = "https://files.pythonhosted.org/packages/1d/b3/582327e6c9f86d037b63beebe981425d6811104cb443e8193824ef1a2f27/pillow-12.0.0-pp311-pypy311_pp73-macosx_10_15_x86_64.whl", hash = "sha256:b22bd8c974942477156be55a768f7aa37c46904c175be4e158b6a86e3a6b7ca8", size = 5215068, upload-time = "2025-10-15T18:23:59.594Z" }, + { url = "https://files.pythonhosted.org/packages/fd/d6/67748211d119f3b6540baf90f92fae73ae51d5217b171b0e8b5f7e5d558f/pillow-12.0.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:805ebf596939e48dbb2e4922a1d3852cfc25c38160751ce02da93058b48d252a", size = 4614994, upload-time = "2025-10-15T18:24:01.669Z" }, + { url = "https://files.pythonhosted.org/packages/2d/e1/f8281e5d844c41872b273b9f2c34a4bf64ca08905668c8ae730eedc7c9fa/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:cae81479f77420d217def5f54b5b9d279804d17e982e0f2fa19b1d1e14ab5197", size = 5246639, upload-time = "2025-10-15T18:24:03.403Z" }, + { url = "https://files.pythonhosted.org/packages/94/5a/0d8ab8ffe8a102ff5df60d0de5af309015163bf710c7bb3e8311dd3b3ad0/pillow-12.0.0-pp311-pypy311_pp73-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:aeaefa96c768fc66818730b952a862235d68825c178f1b3ffd4efd7ad2edcb7c", size = 6986839, upload-time = "2025-10-15T18:24:05.344Z" }, + { url = "https://files.pythonhosted.org/packages/20/2e/3434380e8110b76cd9eb00a363c484b050f949b4bbe84ba770bb8508a02c/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:09f2d0abef9e4e2f349305a4f8cc784a8a6c2f58a8c4892eea13b10a943bd26e", size = 5313505, upload-time = "2025-10-15T18:24:07.137Z" }, + { url = "https://files.pythonhosted.org/packages/57/ca/5a9d38900d9d74785141d6580950fe705de68af735ff6e727cb911b64740/pillow-12.0.0-pp311-pypy311_pp73-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:bdee52571a343d721fb2eb3b090a82d959ff37fc631e3f70422e0c2e029f3e76", size = 5963654, upload-time = "2025-10-15T18:24:09.579Z" }, + { url = "https://files.pythonhosted.org/packages/95/7e/f896623c3c635a90537ac093c6a618ebe1a90d87206e42309cb5d98a1b9e/pillow-12.0.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:b290fd8aa38422444d4b50d579de197557f182ef1068b75f5aa8558638b8d0a5", size = 6997850, upload-time = "2025-10-15T18:24:11.495Z" }, ] [[package]] name = "platformdirs" -version = "4.4.0" +version = "4.5.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/23/e8/21db9c9987b0e728855bd57bff6984f67952bea55d6f75e055c46b5383e8/platformdirs-4.4.0.tar.gz", hash = "sha256:ca753cf4d81dc309bc67b0ea38fd15dc97bc30ce419a7f58d13eb3bf14c4febf", size = 21634, upload-time = "2025-08-26T14:32:04.268Z" } +sdist = { url = "https://files.pythonhosted.org/packages/cf/86/0248f086a84f01b37aaec0fa567b397df1a119f73c16f6c7a9aac73ea309/platformdirs-4.5.1.tar.gz", hash = "sha256:61d5cdcc6065745cdd94f0f878977f8de9437be93de97c1c12f853c9c0cdcbda", size = 21715, upload-time = "2025-12-05T13:52:58.638Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/40/4b/2028861e724d3bd36227adfa20d3fd24c3fc6d52032f4a93c133be5d17ce/platformdirs-4.4.0-py3-none-any.whl", hash = "sha256:abd01743f24e5287cd7a5db3752faf1a2d65353f38ec26d98e25a6db65958c85", size = 18654, upload-time = "2025-08-26T14:32:02.735Z" }, + { url = "https://files.pythonhosted.org/packages/cb/28/3bfe2fa5a7b9c46fe7e13c97bda14c895fb10fa2ebf1d0abb90e0cea7ee1/platformdirs-4.5.1-py3-none-any.whl", hash = "sha256:d03afa3963c806a9bed9d5125c8f4cb2fdaf74a55ab60e5d59b3fde758104d31", size = 18731, upload-time = "2025-12-05T13:52:56.823Z" }, ] [[package]] @@ -2399,7 +2347,7 @@ wheels = [ [[package]] name = "pre-commit" -version = "4.3.0" +version = "4.5.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "cfgv" }, @@ -2408,9 +2356,9 @@ dependencies = [ { name = "pyyaml" }, { name = "virtualenv" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/ff/29/7cf5bbc236333876e4b41f56e06857a87937ce4bf91e117a6991a2dbb02a/pre_commit-4.3.0.tar.gz", hash = "sha256:499fe450cc9d42e9d58e606262795ecb64dd05438943c62b66f6a8673da30b16", size = 193792, upload-time = "2025-08-09T18:56:14.651Z" } +sdist = { url = "https://files.pythonhosted.org/packages/40/f1/6d86a29246dfd2e9b6237f0b5823717f60cad94d47ddc26afa916d21f525/pre_commit-4.5.1.tar.gz", hash = "sha256:eb545fcff725875197837263e977ea257a402056661f09dae08e4b149b030a61", size = 198232, upload-time = "2025-12-16T21:14:33.552Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5b/a5/987a405322d78a73b66e39e4a90e4ef156fd7141bf71df987e50717c321b/pre_commit-4.3.0-py2.py3-none-any.whl", hash = "sha256:2b0747ad7e6e967169136edffee14c16e148a778a54e4f967921aa1ebf2308d8", size = 220965, upload-time = "2025-08-09T18:56:13.192Z" }, + { url = "https://files.pythonhosted.org/packages/5d/19/fd3ef348460c80af7bb4669ea7926651d1f95c23ff2df18b9d24bab4f3fa/pre_commit-4.5.1-py2.py3-none-any.whl", hash = "sha256:3b3afd891e97337708c1674210f8eba659b52a38ea5f822ff142d10786221f77", size = 226437, upload-time = "2025-12-16T21:14:32.409Z" }, ] [[package]] @@ -2436,18 +2384,22 @@ wheels = [ [[package]] name = "psutil" -version = "7.1.0" +version = "7.1.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/b3/31/4723d756b59344b643542936e37a31d1d3204bcdc42a7daa8ee9eb06fb50/psutil-7.1.0.tar.gz", hash = "sha256:655708b3c069387c8b77b072fc429a57d0e214221d01c0a772df7dfedcb3bcd2", size = 497660, upload-time = "2025-09-17T20:14:52.902Z" } +sdist = { url = "https://files.pythonhosted.org/packages/e1/88/bdd0a41e5857d5d703287598cbf08dad90aed56774ea52ae071bae9071b6/psutil-7.1.3.tar.gz", hash = "sha256:6c86281738d77335af7aec228328e944b30930899ea760ecf33a4dba66be5e74", size = 489059, upload-time = "2025-11-02T12:25:54.619Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/46/62/ce4051019ee20ce0ed74432dd73a5bb087a6704284a470bb8adff69a0932/psutil-7.1.0-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:76168cef4397494250e9f4e73eb3752b146de1dd950040b29186d0cce1d5ca13", size = 245242, upload-time = "2025-09-17T20:14:56.126Z" }, - { url = "https://files.pythonhosted.org/packages/38/61/f76959fba841bf5b61123fbf4b650886dc4094c6858008b5bf73d9057216/psutil-7.1.0-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:5d007560c8c372efdff9e4579c2846d71de737e4605f611437255e81efcca2c5", size = 246682, upload-time = "2025-09-17T20:14:58.25Z" }, - { url = "https://files.pythonhosted.org/packages/88/7a/37c99d2e77ec30d63398ffa6a660450b8a62517cabe44b3e9bae97696e8d/psutil-7.1.0-cp36-abi3-manylinux_2_12_i686.manylinux2010_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:22e4454970b32472ce7deaa45d045b34d3648ce478e26a04c7e858a0a6e75ff3", size = 287994, upload-time = "2025-09-17T20:14:59.901Z" }, - { url = "https://files.pythonhosted.org/packages/9d/de/04c8c61232f7244aa0a4b9a9fbd63a89d5aeaf94b2fc9d1d16e2faa5cbb0/psutil-7.1.0-cp36-abi3-manylinux_2_12_x86_64.manylinux2010_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:8c70e113920d51e89f212dd7be06219a9b88014e63a4cec69b684c327bc474e3", size = 291163, upload-time = "2025-09-17T20:15:01.481Z" }, - { url = "https://files.pythonhosted.org/packages/f4/58/c4f976234bf6d4737bc8c02a81192f045c307b72cf39c9e5c5a2d78927f6/psutil-7.1.0-cp36-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:7d4a113425c037300de3ac8b331637293da9be9713855c4fc9d2d97436d7259d", size = 293625, upload-time = "2025-09-17T20:15:04.492Z" }, - { url = "https://files.pythonhosted.org/packages/79/87/157c8e7959ec39ced1b11cc93c730c4fb7f9d408569a6c59dbd92ceb35db/psutil-7.1.0-cp37-abi3-win32.whl", hash = "sha256:09ad740870c8d219ed8daae0ad3b726d3bf9a028a198e7f3080f6a1888b99bca", size = 244812, upload-time = "2025-09-17T20:15:07.462Z" }, - { url = "https://files.pythonhosted.org/packages/bf/e9/b44c4f697276a7a95b8e94d0e320a7bf7f3318521b23de69035540b39838/psutil-7.1.0-cp37-abi3-win_amd64.whl", hash = "sha256:57f5e987c36d3146c0dd2528cd42151cf96cd359b9d67cfff836995cc5df9a3d", size = 247965, upload-time = "2025-09-17T20:15:09.673Z" }, - { url = "https://files.pythonhosted.org/packages/26/65/1070a6e3c036f39142c2820c4b52e9243246fcfc3f96239ac84472ba361e/psutil-7.1.0-cp37-abi3-win_arm64.whl", hash = "sha256:6937cb68133e7c97b6cc9649a570c9a18ba0efebed46d8c5dae4c07fa1b67a07", size = 244971, upload-time = "2025-09-17T20:15:12.262Z" }, + { url = "https://files.pythonhosted.org/packages/bd/93/0c49e776b8734fef56ec9c5c57f923922f2cf0497d62e0f419465f28f3d0/psutil-7.1.3-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:0005da714eee687b4b8decd3d6cc7c6db36215c9e74e5ad2264b90c3df7d92dc", size = 239751, upload-time = "2025-11-02T12:25:58.161Z" }, + { url = "https://files.pythonhosted.org/packages/6f/8d/b31e39c769e70780f007969815195a55c81a63efebdd4dbe9e7a113adb2f/psutil-7.1.3-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:19644c85dcb987e35eeeaefdc3915d059dac7bd1167cdcdbf27e0ce2df0c08c0", size = 240368, upload-time = "2025-11-02T12:26:00.491Z" }, + { url = "https://files.pythonhosted.org/packages/62/61/23fd4acc3c9eebbf6b6c78bcd89e5d020cfde4acf0a9233e9d4e3fa698b4/psutil-7.1.3-cp313-cp313t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:95ef04cf2e5ba0ab9eaafc4a11eaae91b44f4ef5541acd2ee91d9108d00d59a7", size = 287134, upload-time = "2025-11-02T12:26:02.613Z" }, + { url = "https://files.pythonhosted.org/packages/30/1c/f921a009ea9ceb51aa355cb0cc118f68d354db36eae18174bab63affb3e6/psutil-7.1.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:1068c303be3a72f8e18e412c5b2a8f6d31750fb152f9cb106b54090296c9d251", size = 289904, upload-time = "2025-11-02T12:26:05.207Z" }, + { url = "https://files.pythonhosted.org/packages/a6/82/62d68066e13e46a5116df187d319d1724b3f437ddd0f958756fc052677f4/psutil-7.1.3-cp313-cp313t-win_amd64.whl", hash = "sha256:18349c5c24b06ac5612c0428ec2a0331c26443d259e2a0144a9b24b4395b58fa", size = 249642, upload-time = "2025-11-02T12:26:07.447Z" }, + { url = "https://files.pythonhosted.org/packages/df/ad/c1cd5fe965c14a0392112f68362cfceb5230819dbb5b1888950d18a11d9f/psutil-7.1.3-cp313-cp313t-win_arm64.whl", hash = "sha256:c525ffa774fe4496282fb0b1187725793de3e7c6b29e41562733cae9ada151ee", size = 245518, upload-time = "2025-11-02T12:26:09.719Z" }, + { url = "https://files.pythonhosted.org/packages/ef/94/46b9154a800253e7ecff5aaacdf8ebf43db99de4a2dfa18575b02548654e/psutil-7.1.3-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2bdbcd0e58ca14996a42adf3621a6244f1bb2e2e528886959c72cf1e326677ab", size = 238359, upload-time = "2025-11-02T12:26:25.284Z" }, + { url = "https://files.pythonhosted.org/packages/68/3a/9f93cff5c025029a36d9a92fef47220ab4692ee7f2be0fba9f92813d0cb8/psutil-7.1.3-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:bc31fa00f1fbc3c3802141eede66f3a2d51d89716a194bf2cd6fc68310a19880", size = 239171, upload-time = "2025-11-02T12:26:27.23Z" }, + { url = "https://files.pythonhosted.org/packages/ce/b1/5f49af514f76431ba4eea935b8ad3725cdeb397e9245ab919dbc1d1dc20f/psutil-7.1.3-cp36-abi3-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:3bb428f9f05c1225a558f53e30ccbad9930b11c3fc206836242de1091d3e7dd3", size = 263261, upload-time = "2025-11-02T12:26:29.48Z" }, + { url = "https://files.pythonhosted.org/packages/e0/95/992c8816a74016eb095e73585d747e0a8ea21a061ed3689474fabb29a395/psutil-7.1.3-cp36-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:56d974e02ca2c8eb4812c3f76c30e28836fffc311d55d979f1465c1feeb2b68b", size = 264635, upload-time = "2025-11-02T12:26:31.74Z" }, + { url = "https://files.pythonhosted.org/packages/55/4c/c3ed1a622b6ae2fd3c945a366e64eb35247a31e4db16cf5095e269e8eb3c/psutil-7.1.3-cp37-abi3-win_amd64.whl", hash = "sha256:f39c2c19fe824b47484b96f9692932248a54c43799a84282cfe58d05a6449efd", size = 247633, upload-time = "2025-11-02T12:26:33.887Z" }, + { url = "https://files.pythonhosted.org/packages/c9/ad/33b2ccec09bf96c2b2ef3f9a6f66baac8253d7565d8839e024a6b905d45d/psutil-7.1.3-cp37-abi3-win_arm64.whl", hash = "sha256:bd0d69cee829226a761e92f28140bec9a5ee9d5b4fb4b0cc589068dbfff559b1", size = 244608, upload-time = "2025-11-02T12:26:36.136Z" }, ] [[package]] @@ -2468,18 +2420,6 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/8e/37/efad0257dc6e593a18957422533ff0f87ede7c9c6ea010a2177d738fb82f/pure_eval-0.2.3-py3-none-any.whl", hash = "sha256:1db8e35b67b3d218d818ae653e27f06c3aa420901fa7b081ca98cbedc874e0d0", size = 11842, upload-time = "2024-07-21T12:58:20.04Z" }, ] -[[package]] -name = "py-serializable" -version = "2.1.0" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "defusedxml" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/73/21/d250cfca8ff30c2e5a7447bc13861541126ce9bd4426cd5d0c9f08b5547d/py_serializable-2.1.0.tar.gz", hash = "sha256:9d5db56154a867a9b897c0163b33a793c804c80cee984116d02d49e4578fc103", size = 52368, upload-time = "2025-07-21T09:56:48.07Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/9b/bf/7595e817906a29453ba4d99394e781b6fabe55d21f3c15d240f85dd06bb1/py_serializable-2.1.0-py3-none-any.whl", hash = "sha256:b56d5d686b5a03ba4f4db5e769dc32336e142fc3bd4d68a8c25579ebb0a67304", size = 23045, upload-time = "2025-07-21T09:56:46.848Z" }, -] - [[package]] name = "pycparser" version = "2.23" @@ -2497,9 +2437,11 @@ dependencies = [ { name = "accessible-pygments" }, { name = "babel" }, { name = "beautifulsoup4" }, - { name = "docutils" }, + { name = "docutils", version = "0.21.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "docutils", version = "0.22.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "pygments" }, - { name = "sphinx" }, + { name = "sphinx", version = "8.1.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "sphinx", version = "9.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "typing-extensions" }, ] sdist = { url = "https://files.pythonhosted.org/packages/00/20/bb50f9de3a6de69e6abd6b087b52fa2418a0418b19597601605f855ad044/pydata_sphinx_theme-0.16.1.tar.gz", hash = "sha256:a08b7f0b7f70387219dc659bff0893a7554d5eb39b59d3b8ef37b8401b7642d7", size = 2412693, upload-time = "2024-12-17T10:53:39.537Z" } @@ -2527,7 +2469,7 @@ wheels = [ [[package]] name = "pytest" -version = "8.4.2" +version = "9.0.2" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "colorama", marker = "sys_platform == 'win32'" }, @@ -2538,9 +2480,9 @@ dependencies = [ { name = "pygments" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/a3/5c/00a0e072241553e1a7496d638deababa67c5058571567b92a7eaa258397c/pytest-8.4.2.tar.gz", hash = "sha256:86c0d0b93306b961d58d62a4db4879f27fe25513d4b969df351abdddb3c30e01", size = 1519618, upload-time = "2025-09-04T14:34:22.711Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d1/db/7ef3487e0fb0049ddb5ce41d3a49c235bf9ad299b6a25d5780a89f19230f/pytest-9.0.2.tar.gz", hash = "sha256:75186651a92bd89611d1d9fc20f0b4345fd827c41ccd5c299a868a05d70edf11", size = 1568901, upload-time = "2025-12-06T21:30:51.014Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a8/a4/20da314d277121d6534b3a980b29035dcd51e6744bd79075a6ce8fa4eb8d/pytest-8.4.2-py3-none-any.whl", hash = "sha256:872f880de3fc3a5bdc88a11b39c9710c3497a547cfa9320bc3c5e62fbf272e79", size = 365750, upload-time = "2025-09-04T14:34:20.226Z" }, + { url = "https://files.pythonhosted.org/packages/3b/ab/b3226f0bd7cdcf710fbede2b3548584366da3b19b5021e74f5bde2a8fa3f/pytest-9.0.2-py3-none-any.whl", hash = "sha256:711ffd45bf766d5264d487b917733b453d917afd2b0ad65223959f59089f875b", size = 374801, upload-time = "2025-12-06T21:30:49.154Z" }, ] [[package]] @@ -2559,15 +2501,15 @@ wheels = [ [[package]] name = "pytest-rerunfailures" -version = "16.0.1" +version = "16.1" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "packaging" }, { name = "pytest" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/26/53/a543a76f922a5337d10df22441af8bf68f1b421cadf9aedf8a77943b81f6/pytest_rerunfailures-16.0.1.tar.gz", hash = "sha256:ed4b3a6e7badb0a720ddd93f9de1e124ba99a0cb13bc88561b3c168c16062559", size = 27612, upload-time = "2025-09-02T06:48:25.193Z" } +sdist = { url = "https://files.pythonhosted.org/packages/de/04/71e9520551fc8fe2cf5c1a1842e4e600265b0815f2016b7c27ec85688682/pytest_rerunfailures-16.1.tar.gz", hash = "sha256:c38b266db8a808953ebd71ac25c381cb1981a78ff9340a14bcb9f1b9bff1899e", size = 30889, upload-time = "2025-10-10T07:06:01.238Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/38/73/67dc14cda1942914e70fbb117fceaf11e259362c517bdadd76b0dd752524/pytest_rerunfailures-16.0.1-py3-none-any.whl", hash = "sha256:0bccc0e3b0e3388275c25a100f7077081318196569a121217688ed05e58984b9", size = 13610, upload-time = "2025-09-02T06:48:23.615Z" }, + { url = "https://files.pythonhosted.org/packages/77/54/60eabb34445e3db3d3d874dc1dfa72751bfec3265bd611cb13c8b290adea/pytest_rerunfailures-16.1-py3-none-any.whl", hash = "sha256:5d11b12c0ca9a1665b5054052fcc1084f8deadd9328962745ef6b04e26382e86", size = 14093, upload-time = "2025-10-10T07:06:00.019Z" }, ] [[package]] @@ -2584,11 +2526,11 @@ wheels = [ [[package]] name = "python-json-logger" -version = "3.3.0" +version = "4.0.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/9e/de/d3144a0bceede957f961e975f3752760fbe390d57fbe194baf709d8f1f7b/python_json_logger-3.3.0.tar.gz", hash = "sha256:12b7e74b17775e7d565129296105bbe3910842d9d0eb083fc83a6a617aa8df84", size = 16642, upload-time = "2025-03-07T07:08:27.301Z" } +sdist = { url = "https://files.pythonhosted.org/packages/29/bf/eca6a3d43db1dae7070f70e160ab20b807627ba953663ba07928cdd3dc58/python_json_logger-4.0.0.tar.gz", hash = "sha256:f58e68eb46e1faed27e0f574a55a0455eecd7b8a5b88b85a784519ba3cff047f", size = 17683, upload-time = "2025-10-06T04:15:18.984Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/08/20/0f2523b9e50a8052bc6a8b732dfc8568abbdc42010aef03a2d750bdab3b2/python_json_logger-3.3.0-py3-none-any.whl", hash = "sha256:dd980fae8cffb24c13caf6e158d3d61c0d6d22342f932cb6e9deedab3d35eec7", size = 15163, upload-time = "2025-03-07T07:08:25.627Z" }, + { url = "https://files.pythonhosted.org/packages/51/e5/fecf13f06e5e5f67e8837d777d1bc43fac0ed2b77a676804df5c34744727/python_json_logger-4.0.0-py3-none-any.whl", hash = "sha256:af09c9daf6a813aa4cc7180395f50f2a9e5fa056034c9953aec92e381c5ba1e2", size = 15548, upload-time = "2025-10-06T04:15:17.553Z" }, ] [[package]] @@ -2600,80 +2542,63 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/81/c4/34e93fe5f5429d7570ec1fa436f1986fb1f00c3e0f43a589fe2bbcd22c3f/pytz-2025.2-py2.py3-none-any.whl", hash = "sha256:5ddf76296dd8c44c26eb8f4b6f35488f3ccbf6fbbd7adee0b7262d43f0ec2f00", size = 509225, upload-time = "2025-03-25T02:24:58.468Z" }, ] -[[package]] -name = "pywin32" -version = "311" -source = { registry = "https://pypi.org/simple" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/7b/40/44efbb0dfbd33aca6a6483191dae0716070ed99e2ecb0c53683f400a0b4f/pywin32-311-cp310-cp310-win32.whl", hash = "sha256:d03ff496d2a0cd4a5893504789d4a15399133fe82517455e78bad62efbb7f0a3", size = 8760432, upload-time = "2025-07-14T20:13:05.9Z" }, - { url = "https://files.pythonhosted.org/packages/5e/bf/360243b1e953bd254a82f12653974be395ba880e7ec23e3731d9f73921cc/pywin32-311-cp310-cp310-win_amd64.whl", hash = "sha256:797c2772017851984b97180b0bebe4b620bb86328e8a884bb626156295a63b3b", size = 9590103, upload-time = "2025-07-14T20:13:07.698Z" }, - { url = "https://files.pythonhosted.org/packages/57/38/d290720e6f138086fb3d5ffe0b6caa019a791dd57866940c82e4eeaf2012/pywin32-311-cp310-cp310-win_arm64.whl", hash = "sha256:0502d1facf1fed4839a9a51ccbcc63d952cf318f78ffc00a7e78528ac27d7a2b", size = 8778557, upload-time = "2025-07-14T20:13:11.11Z" }, - { url = "https://files.pythonhosted.org/packages/7c/af/449a6a91e5d6db51420875c54f6aff7c97a86a3b13a0b4f1a5c13b988de3/pywin32-311-cp311-cp311-win32.whl", hash = "sha256:184eb5e436dea364dcd3d2316d577d625c0351bf237c4e9a5fabbcfa5a58b151", size = 8697031, upload-time = "2025-07-14T20:13:13.266Z" }, - { url = "https://files.pythonhosted.org/packages/51/8f/9bb81dd5bb77d22243d33c8397f09377056d5c687aa6d4042bea7fbf8364/pywin32-311-cp311-cp311-win_amd64.whl", hash = "sha256:3ce80b34b22b17ccbd937a6e78e7225d80c52f5ab9940fe0506a1a16f3dab503", size = 9508308, upload-time = "2025-07-14T20:13:15.147Z" }, - { url = "https://files.pythonhosted.org/packages/44/7b/9c2ab54f74a138c491aba1b1cd0795ba61f144c711daea84a88b63dc0f6c/pywin32-311-cp311-cp311-win_arm64.whl", hash = "sha256:a733f1388e1a842abb67ffa8e7aad0e70ac519e09b0f6a784e65a136ec7cefd2", size = 8703930, upload-time = "2025-07-14T20:13:16.945Z" }, - { url = "https://files.pythonhosted.org/packages/e7/ab/01ea1943d4eba0f850c3c61e78e8dd59757ff815ff3ccd0a84de5f541f42/pywin32-311-cp312-cp312-win32.whl", hash = "sha256:750ec6e621af2b948540032557b10a2d43b0cee2ae9758c54154d711cc852d31", size = 8706543, upload-time = "2025-07-14T20:13:20.765Z" }, - { url = "https://files.pythonhosted.org/packages/d1/a8/a0e8d07d4d051ec7502cd58b291ec98dcc0c3fff027caad0470b72cfcc2f/pywin32-311-cp312-cp312-win_amd64.whl", hash = "sha256:b8c095edad5c211ff31c05223658e71bf7116daa0ecf3ad85f3201ea3190d067", size = 9495040, upload-time = "2025-07-14T20:13:22.543Z" }, - { url = "https://files.pythonhosted.org/packages/ba/3a/2ae996277b4b50f17d61f0603efd8253cb2d79cc7ae159468007b586396d/pywin32-311-cp312-cp312-win_arm64.whl", hash = "sha256:e286f46a9a39c4a18b319c28f59b61de793654af2f395c102b4f819e584b5852", size = 8710102, upload-time = "2025-07-14T20:13:24.682Z" }, - { url = "https://files.pythonhosted.org/packages/a5/be/3fd5de0979fcb3994bfee0d65ed8ca9506a8a1260651b86174f6a86f52b3/pywin32-311-cp313-cp313-win32.whl", hash = "sha256:f95ba5a847cba10dd8c4d8fefa9f2a6cf283b8b88ed6178fa8a6c1ab16054d0d", size = 8705700, upload-time = "2025-07-14T20:13:26.471Z" }, - { url = "https://files.pythonhosted.org/packages/e3/28/e0a1909523c6890208295a29e05c2adb2126364e289826c0a8bc7297bd5c/pywin32-311-cp313-cp313-win_amd64.whl", hash = "sha256:718a38f7e5b058e76aee1c56ddd06908116d35147e133427e59a3983f703a20d", size = 9494700, upload-time = "2025-07-14T20:13:28.243Z" }, - { url = "https://files.pythonhosted.org/packages/04/bf/90339ac0f55726dce7d794e6d79a18a91265bdf3aa70b6b9ca52f35e022a/pywin32-311-cp313-cp313-win_arm64.whl", hash = "sha256:7b4075d959648406202d92a2310cb990fea19b535c7f4a78d3f5e10b926eeb8a", size = 8709318, upload-time = "2025-07-14T20:13:30.348Z" }, -] - [[package]] name = "pywinpty" -version = "3.0.0" +version = "3.0.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/06/df/429cc505dc5f77ab0612c4b60bca2e3dcc81f6c321844ee017d6dc0f4a95/pywinpty-3.0.0.tar.gz", hash = "sha256:68f70e68a9f0766ffdea3fc500351cb7b9b012bcb8239a411f7ff0fc8f86dcb1", size = 28551, upload-time = "2025-08-12T20:33:46.506Z" } +sdist = { url = "https://files.pythonhosted.org/packages/f3/bb/a7cc2967c5c4eceb6cc49cfe39447d4bfc56e6c865e7c2249b6eb978935f/pywinpty-3.0.2.tar.gz", hash = "sha256:1505cc4cb248af42cb6285a65c9c2086ee9e7e574078ee60933d5d7fa86fb004", size = 30669, upload-time = "2025-10-03T21:16:29.205Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/15/f9/13d62974debb0c74ce3fa3d96b32cee6fce4f2d634789217e67aebf339f6/pywinpty-3.0.0-cp310-cp310-win_amd64.whl", hash = "sha256:327b6034e0dc38352c1c99a7c0b3e54941b4e506a5f21acce63609cd2ab6cce2", size = 2050843, upload-time = "2025-08-12T20:36:11.134Z" }, - { url = "https://files.pythonhosted.org/packages/d6/34/30727e8a97709f5033277457df9a293ccddf34d6eb7528e6a1e910265307/pywinpty-3.0.0-cp311-cp311-win_amd64.whl", hash = "sha256:29daa71ac5dcbe1496ef99f4cde85a732b1f0a3b71405d42177dbcf9ee405e5a", size = 2051048, upload-time = "2025-08-12T20:37:18.488Z" }, - { url = "https://files.pythonhosted.org/packages/76/d9/bd2249815c305ef8f879b326db1fe1effc8e5f22bd88e522b4b55231aa6f/pywinpty-3.0.0-cp312-cp312-win_amd64.whl", hash = "sha256:1e0c4b01e5b03b1531d7c5d0e044b8c66dd0288c6d2b661820849f2a8d91aec3", size = 2051564, upload-time = "2025-08-12T20:37:09.128Z" }, - { url = "https://files.pythonhosted.org/packages/e2/77/358b1a97c1d0714f288949372ec64a70884a7eceb3f887042b9ae0bea388/pywinpty-3.0.0-cp313-cp313-win_amd64.whl", hash = "sha256:828cbe756b7e3d25d886fbd5691a1d523cd59c5fb79286bb32bb75c5221e7ba1", size = 2050856, upload-time = "2025-08-12T20:36:09.117Z" }, - { url = "https://files.pythonhosted.org/packages/8f/6c/4249cfb4eb4fdad2c76bc96db0642a40111847c375b92e5b9f4bf289ddd6/pywinpty-3.0.0-cp313-cp313t-win_amd64.whl", hash = "sha256:de0cbe27b96e5a2cebd86c4a6b8b4139f978d9c169d44a8edc7e30e88e5d7a69", size = 2050082, upload-time = "2025-08-12T20:36:28.591Z" }, + { url = "https://files.pythonhosted.org/packages/3e/f5/b17ae550841949c217ad557ee445b4a14e9c0b506ae51ee087eff53428a6/pywinpty-3.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:65db57fd3387d71e8372b6a54269cbcd0f6dfa6d4616a29e0af749ec19f5c558", size = 2050330, upload-time = "2025-10-03T21:20:15.656Z" }, + { url = "https://files.pythonhosted.org/packages/a6/a1/409c1651c9f874d598c10f51ff586c416625601df4bca315d08baec4c3e3/pywinpty-3.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:327790d70e4c841ebd9d0f295a780177149aeb405bca44c7115a3de5c2054b23", size = 2050304, upload-time = "2025-10-03T21:19:29.466Z" }, + { url = "https://files.pythonhosted.org/packages/02/4e/1098484e042c9485f56f16eb2b69b43b874bd526044ee401512234cf9e04/pywinpty-3.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:99fdd9b455f0ad6419aba6731a7a0d2f88ced83c3c94a80ff9533d95fa8d8a9e", size = 2050391, upload-time = "2025-10-03T21:19:01.642Z" }, + { url = "https://files.pythonhosted.org/packages/fc/19/b757fe28008236a4a713e813283721b8a40aa60cd7d3f83549f2e25a3155/pywinpty-3.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:18f78b81e4cfee6aabe7ea8688441d30247b73e52cd9657138015c5f4ee13a51", size = 2050057, upload-time = "2025-10-03T21:19:26.732Z" }, + { url = "https://files.pythonhosted.org/packages/cb/44/cbae12ecf6f4fa4129c36871fd09c6bef4f98d5f625ecefb5e2449765508/pywinpty-3.0.2-cp313-cp313t-win_amd64.whl", hash = "sha256:663383ecfab7fc382cc97ea5c4f7f0bb32c2f889259855df6ea34e5df42d305b", size = 2049874, upload-time = "2025-10-03T21:18:53.923Z" }, ] [[package]] name = "pyyaml" -version = "6.0.2" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/54/ed/79a089b6be93607fa5cdaedf301d7dfb23af5f25c398d5ead2525b063e17/pyyaml-6.0.2.tar.gz", hash = "sha256:d584d9ec91ad65861cc08d42e834324ef890a082e591037abe114850ff7bbc3e", size = 130631, upload-time = "2024-08-06T20:33:50.674Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/9b/95/a3fac87cb7158e231b5a6012e438c647e1a87f09f8e0d123acec8ab8bf71/PyYAML-6.0.2-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:0a9a2848a5b7feac301353437eb7d5957887edbf81d56e903999a75a3d743086", size = 184199, upload-time = "2024-08-06T20:31:40.178Z" }, - { url = "https://files.pythonhosted.org/packages/c7/7a/68bd47624dab8fd4afbfd3c48e3b79efe09098ae941de5b58abcbadff5cb/PyYAML-6.0.2-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:29717114e51c84ddfba879543fb232a6ed60086602313ca38cce623c1d62cfbf", size = 171758, upload-time = "2024-08-06T20:31:42.173Z" }, - { url = "https://files.pythonhosted.org/packages/49/ee/14c54df452143b9ee9f0f29074d7ca5516a36edb0b4cc40c3f280131656f/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:8824b5a04a04a047e72eea5cec3bc266db09e35de6bdfe34c9436ac5ee27d237", size = 718463, upload-time = "2024-08-06T20:31:44.263Z" }, - { url = "https://files.pythonhosted.org/packages/4d/61/de363a97476e766574650d742205be468921a7b532aa2499fcd886b62530/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7c36280e6fb8385e520936c3cb3b8042851904eba0e58d277dca80a5cfed590b", size = 719280, upload-time = "2024-08-06T20:31:50.199Z" }, - { url = "https://files.pythonhosted.org/packages/6b/4e/1523cb902fd98355e2e9ea5e5eb237cbc5f3ad5f3075fa65087aa0ecb669/PyYAML-6.0.2-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:ec031d5d2feb36d1d1a24380e4db6d43695f3748343d99434e6f5f9156aaa2ed", size = 751239, upload-time = "2024-08-06T20:31:52.292Z" }, - { url = "https://files.pythonhosted.org/packages/b7/33/5504b3a9a4464893c32f118a9cc045190a91637b119a9c881da1cf6b7a72/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_aarch64.whl", hash = "sha256:936d68689298c36b53b29f23c6dbb74de12b4ac12ca6cfe0e047bedceea56180", size = 695802, upload-time = "2024-08-06T20:31:53.836Z" }, - { url = "https://files.pythonhosted.org/packages/5c/20/8347dcabd41ef3a3cdc4f7b7a2aff3d06598c8779faa189cdbf878b626a4/PyYAML-6.0.2-cp310-cp310-musllinux_1_1_x86_64.whl", hash = "sha256:23502f431948090f597378482b4812b0caae32c22213aecf3b55325e049a6c68", size = 720527, upload-time = "2024-08-06T20:31:55.565Z" }, - { url = "https://files.pythonhosted.org/packages/be/aa/5afe99233fb360d0ff37377145a949ae258aaab831bde4792b32650a4378/PyYAML-6.0.2-cp310-cp310-win32.whl", hash = "sha256:2e99c6826ffa974fe6e27cdb5ed0021786b03fc98e5ee3c5bfe1fd5015f42b99", size = 144052, upload-time = "2024-08-06T20:31:56.914Z" }, - { url = "https://files.pythonhosted.org/packages/b5/84/0fa4b06f6d6c958d207620fc60005e241ecedceee58931bb20138e1e5776/PyYAML-6.0.2-cp310-cp310-win_amd64.whl", hash = "sha256:a4d3091415f010369ae4ed1fc6b79def9416358877534caf6a0fdd2146c87a3e", size = 161774, upload-time = "2024-08-06T20:31:58.304Z" }, - { url = "https://files.pythonhosted.org/packages/f8/aa/7af4e81f7acba21a4c6be026da38fd2b872ca46226673c89a758ebdc4fd2/PyYAML-6.0.2-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:cc1c1159b3d456576af7a3e4d1ba7e6924cb39de8f67111c735f6fc832082774", size = 184612, upload-time = "2024-08-06T20:32:03.408Z" }, - { url = "https://files.pythonhosted.org/packages/8b/62/b9faa998fd185f65c1371643678e4d58254add437edb764a08c5a98fb986/PyYAML-6.0.2-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:1e2120ef853f59c7419231f3bf4e7021f1b936f6ebd222406c3b60212205d2ee", size = 172040, upload-time = "2024-08-06T20:32:04.926Z" }, - { url = "https://files.pythonhosted.org/packages/ad/0c/c804f5f922a9a6563bab712d8dcc70251e8af811fce4524d57c2c0fd49a4/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:5d225db5a45f21e78dd9358e58a98702a0302f2659a3c6cd320564b75b86f47c", size = 736829, upload-time = "2024-08-06T20:32:06.459Z" }, - { url = "https://files.pythonhosted.org/packages/51/16/6af8d6a6b210c8e54f1406a6b9481febf9c64a3109c541567e35a49aa2e7/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:5ac9328ec4831237bec75defaf839f7d4564be1e6b25ac710bd1a96321cc8317", size = 764167, upload-time = "2024-08-06T20:32:08.338Z" }, - { url = "https://files.pythonhosted.org/packages/75/e4/2c27590dfc9992f73aabbeb9241ae20220bd9452df27483b6e56d3975cc5/PyYAML-6.0.2-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3ad2a3decf9aaba3d29c8f537ac4b243e36bef957511b4766cb0057d32b0be85", size = 762952, upload-time = "2024-08-06T20:32:14.124Z" }, - { url = "https://files.pythonhosted.org/packages/9b/97/ecc1abf4a823f5ac61941a9c00fe501b02ac3ab0e373c3857f7d4b83e2b6/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_aarch64.whl", hash = "sha256:ff3824dc5261f50c9b0dfb3be22b4567a6f938ccce4587b38952d85fd9e9afe4", size = 735301, upload-time = "2024-08-06T20:32:16.17Z" }, - { url = "https://files.pythonhosted.org/packages/45/73/0f49dacd6e82c9430e46f4a027baa4ca205e8b0a9dce1397f44edc23559d/PyYAML-6.0.2-cp311-cp311-musllinux_1_1_x86_64.whl", hash = "sha256:797b4f722ffa07cc8d62053e4cff1486fa6dc094105d13fea7b1de7d8bf71c9e", size = 756638, upload-time = "2024-08-06T20:32:18.555Z" }, - { url = "https://files.pythonhosted.org/packages/22/5f/956f0f9fc65223a58fbc14459bf34b4cc48dec52e00535c79b8db361aabd/PyYAML-6.0.2-cp311-cp311-win32.whl", hash = "sha256:11d8f3dd2b9c1207dcaf2ee0bbbfd5991f571186ec9cc78427ba5bd32afae4b5", size = 143850, upload-time = "2024-08-06T20:32:19.889Z" }, - { url = "https://files.pythonhosted.org/packages/ed/23/8da0bbe2ab9dcdd11f4f4557ccaf95c10b9811b13ecced089d43ce59c3c8/PyYAML-6.0.2-cp311-cp311-win_amd64.whl", hash = "sha256:e10ce637b18caea04431ce14fabcf5c64a1c61ec9c56b071a4b7ca131ca52d44", size = 161980, upload-time = "2024-08-06T20:32:21.273Z" }, - { url = "https://files.pythonhosted.org/packages/86/0c/c581167fc46d6d6d7ddcfb8c843a4de25bdd27e4466938109ca68492292c/PyYAML-6.0.2-cp312-cp312-macosx_10_9_x86_64.whl", hash = "sha256:c70c95198c015b85feafc136515252a261a84561b7b1d51e3384e0655ddf25ab", size = 183873, upload-time = "2024-08-06T20:32:25.131Z" }, - { url = "https://files.pythonhosted.org/packages/a8/0c/38374f5bb272c051e2a69281d71cba6fdb983413e6758b84482905e29a5d/PyYAML-6.0.2-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:ce826d6ef20b1bc864f0a68340c8b3287705cae2f8b4b1d932177dcc76721725", size = 173302, upload-time = "2024-08-06T20:32:26.511Z" }, - { url = "https://files.pythonhosted.org/packages/c3/93/9916574aa8c00aa06bbac729972eb1071d002b8e158bd0e83a3b9a20a1f7/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:1f71ea527786de97d1a0cc0eacd1defc0985dcf6b3f17bb77dcfc8c34bec4dc5", size = 739154, upload-time = "2024-08-06T20:32:28.363Z" }, - { url = "https://files.pythonhosted.org/packages/95/0f/b8938f1cbd09739c6da569d172531567dbcc9789e0029aa070856f123984/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:9b22676e8097e9e22e36d6b7bda33190d0d400f345f23d4065d48f4ca7ae0425", size = 766223, upload-time = "2024-08-06T20:32:30.058Z" }, - { url = "https://files.pythonhosted.org/packages/b9/2b/614b4752f2e127db5cc206abc23a8c19678e92b23c3db30fc86ab731d3bd/PyYAML-6.0.2-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:80bab7bfc629882493af4aa31a4cfa43a4c57c83813253626916b8c7ada83476", size = 767542, upload-time = "2024-08-06T20:32:31.881Z" }, - { url = "https://files.pythonhosted.org/packages/d4/00/dd137d5bcc7efea1836d6264f049359861cf548469d18da90cd8216cf05f/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:0833f8694549e586547b576dcfaba4a6b55b9e96098b36cdc7ebefe667dfed48", size = 731164, upload-time = "2024-08-06T20:32:37.083Z" }, - { url = "https://files.pythonhosted.org/packages/c9/1f/4f998c900485e5c0ef43838363ba4a9723ac0ad73a9dc42068b12aaba4e4/PyYAML-6.0.2-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:8b9c7197f7cb2738065c481a0461e50ad02f18c78cd75775628afb4d7137fb3b", size = 756611, upload-time = "2024-08-06T20:32:38.898Z" }, - { url = "https://files.pythonhosted.org/packages/df/d1/f5a275fdb252768b7a11ec63585bc38d0e87c9e05668a139fea92b80634c/PyYAML-6.0.2-cp312-cp312-win32.whl", hash = "sha256:ef6107725bd54b262d6dedcc2af448a266975032bc85ef0172c5f059da6325b4", size = 140591, upload-time = "2024-08-06T20:32:40.241Z" }, - { url = "https://files.pythonhosted.org/packages/0c/e8/4f648c598b17c3d06e8753d7d13d57542b30d56e6c2dedf9c331ae56312e/PyYAML-6.0.2-cp312-cp312-win_amd64.whl", hash = "sha256:7e7401d0de89a9a855c839bc697c079a4af81cf878373abd7dc625847d25cbd8", size = 156338, upload-time = "2024-08-06T20:32:41.93Z" }, - { url = "https://files.pythonhosted.org/packages/ef/e3/3af305b830494fa85d95f6d95ef7fa73f2ee1cc8ef5b495c7c3269fb835f/PyYAML-6.0.2-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:efdca5630322a10774e8e98e1af481aad470dd62c3170801852d752aa7a783ba", size = 181309, upload-time = "2024-08-06T20:32:43.4Z" }, - { url = "https://files.pythonhosted.org/packages/45/9f/3b1c20a0b7a3200524eb0076cc027a970d320bd3a6592873c85c92a08731/PyYAML-6.0.2-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:50187695423ffe49e2deacb8cd10510bc361faac997de9efef88badc3bb9e2d1", size = 171679, upload-time = "2024-08-06T20:32:44.801Z" }, - { url = "https://files.pythonhosted.org/packages/7c/9a/337322f27005c33bcb656c655fa78325b730324c78620e8328ae28b64d0c/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:0ffe8360bab4910ef1b9e87fb812d8bc0a308b0d0eef8c8f44e0254ab3b07133", size = 733428, upload-time = "2024-08-06T20:32:46.432Z" }, - { url = "https://files.pythonhosted.org/packages/a3/69/864fbe19e6c18ea3cc196cbe5d392175b4cf3d5d0ac1403ec3f2d237ebb5/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:17e311b6c678207928d649faa7cb0d7b4c26a0ba73d41e99c4fff6b6c3276484", size = 763361, upload-time = "2024-08-06T20:32:51.188Z" }, - { url = "https://files.pythonhosted.org/packages/04/24/b7721e4845c2f162d26f50521b825fb061bc0a5afcf9a386840f23ea19fa/PyYAML-6.0.2-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:70b189594dbe54f75ab3a1acec5f1e3faa7e8cf2f1e08d9b561cb41b845f69d5", size = 759523, upload-time = "2024-08-06T20:32:53.019Z" }, - { url = "https://files.pythonhosted.org/packages/2b/b2/e3234f59ba06559c6ff63c4e10baea10e5e7df868092bf9ab40e5b9c56b6/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:41e4e3953a79407c794916fa277a82531dd93aad34e29c2a514c2c0c5fe971cc", size = 726660, upload-time = "2024-08-06T20:32:54.708Z" }, - { url = "https://files.pythonhosted.org/packages/fe/0f/25911a9f080464c59fab9027482f822b86bf0608957a5fcc6eaac85aa515/PyYAML-6.0.2-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:68ccc6023a3400877818152ad9a1033e3db8625d899c72eacb5a668902e4d652", size = 751597, upload-time = "2024-08-06T20:32:56.985Z" }, - { url = "https://files.pythonhosted.org/packages/14/0d/e2c3b43bbce3cf6bd97c840b46088a3031085179e596d4929729d8d68270/PyYAML-6.0.2-cp313-cp313-win32.whl", hash = "sha256:bc2fa7c6b47d6bc618dd7fb02ef6fdedb1090ec036abab80d4681424b84c1183", size = 140527, upload-time = "2024-08-06T20:33:03.001Z" }, - { url = "https://files.pythonhosted.org/packages/fa/de/02b54f42487e3d3c6efb3f89428677074ca7bf43aae402517bc7cca949f3/PyYAML-6.0.2-cp313-cp313-win_amd64.whl", hash = "sha256:8388ee1976c416731879ac16da0aff3f63b286ffdd57cdeb95f3f2e085687563", size = 156446, upload-time = "2024-08-06T20:33:04.33Z" }, +version = "6.0.3" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/05/8e/961c0007c59b8dd7729d542c61a4d537767a59645b82a0b521206e1e25c2/pyyaml-6.0.3.tar.gz", hash = "sha256:d76623373421df22fb4cf8817020cbb7ef15c725b9d5e45f17e189bfc384190f", size = 130960, upload-time = "2025-09-25T21:33:16.546Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/f4/a0/39350dd17dd6d6c6507025c0e53aef67a9293a6d37d3511f23ea510d5800/pyyaml-6.0.3-cp310-cp310-macosx_10_13_x86_64.whl", hash = "sha256:214ed4befebe12df36bcc8bc2b64b396ca31be9304b8f59e25c11cf94a4c033b", size = 184227, upload-time = "2025-09-25T21:31:46.04Z" }, + { url = "https://files.pythonhosted.org/packages/05/14/52d505b5c59ce73244f59c7a50ecf47093ce4765f116cdb98286a71eeca2/pyyaml-6.0.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:02ea2dfa234451bbb8772601d7b8e426c2bfa197136796224e50e35a78777956", size = 174019, upload-time = "2025-09-25T21:31:47.706Z" }, + { url = "https://files.pythonhosted.org/packages/43/f7/0e6a5ae5599c838c696adb4e6330a59f463265bfa1e116cfd1fbb0abaaae/pyyaml-6.0.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b30236e45cf30d2b8e7b3e85881719e98507abed1011bf463a8fa23e9c3e98a8", size = 740646, upload-time = "2025-09-25T21:31:49.21Z" }, + { url = "https://files.pythonhosted.org/packages/2f/3a/61b9db1d28f00f8fd0ae760459a5c4bf1b941baf714e207b6eb0657d2578/pyyaml-6.0.3-cp310-cp310-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:66291b10affd76d76f54fad28e22e51719ef9ba22b29e1d7d03d6777a9174198", size = 840793, upload-time = "2025-09-25T21:31:50.735Z" }, + { url = "https://files.pythonhosted.org/packages/7a/1e/7acc4f0e74c4b3d9531e24739e0ab832a5edf40e64fbae1a9c01941cabd7/pyyaml-6.0.3-cp310-cp310-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:9c7708761fccb9397fe64bbc0395abcae8c4bf7b0eac081e12b809bf47700d0b", size = 770293, upload-time = "2025-09-25T21:31:51.828Z" }, + { url = "https://files.pythonhosted.org/packages/8b/ef/abd085f06853af0cd59fa5f913d61a8eab65d7639ff2a658d18a25d6a89d/pyyaml-6.0.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:418cf3f2111bc80e0933b2cd8cd04f286338bb88bdc7bc8e6dd775ebde60b5e0", size = 732872, upload-time = "2025-09-25T21:31:53.282Z" }, + { url = "https://files.pythonhosted.org/packages/1f/15/2bc9c8faf6450a8b3c9fc5448ed869c599c0a74ba2669772b1f3a0040180/pyyaml-6.0.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:5e0b74767e5f8c593e8c9b5912019159ed0533c70051e9cce3e8b6aa699fcd69", size = 758828, upload-time = "2025-09-25T21:31:54.807Z" }, + { url = "https://files.pythonhosted.org/packages/a3/00/531e92e88c00f4333ce359e50c19b8d1de9fe8d581b1534e35ccfbc5f393/pyyaml-6.0.3-cp310-cp310-win32.whl", hash = "sha256:28c8d926f98f432f88adc23edf2e6d4921ac26fb084b028c733d01868d19007e", size = 142415, upload-time = "2025-09-25T21:31:55.885Z" }, + { url = "https://files.pythonhosted.org/packages/2a/fa/926c003379b19fca39dd4634818b00dec6c62d87faf628d1394e137354d4/pyyaml-6.0.3-cp310-cp310-win_amd64.whl", hash = "sha256:bdb2c67c6c1390b63c6ff89f210c8fd09d9a1217a465701eac7316313c915e4c", size = 158561, upload-time = "2025-09-25T21:31:57.406Z" }, + { url = "https://files.pythonhosted.org/packages/6d/16/a95b6757765b7b031c9374925bb718d55e0a9ba8a1b6a12d25962ea44347/pyyaml-6.0.3-cp311-cp311-macosx_10_13_x86_64.whl", hash = "sha256:44edc647873928551a01e7a563d7452ccdebee747728c1080d881d68af7b997e", size = 185826, upload-time = "2025-09-25T21:31:58.655Z" }, + { url = "https://files.pythonhosted.org/packages/16/19/13de8e4377ed53079ee996e1ab0a9c33ec2faf808a4647b7b4c0d46dd239/pyyaml-6.0.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:652cb6edd41e718550aad172851962662ff2681490a8a711af6a4d288dd96824", size = 175577, upload-time = "2025-09-25T21:32:00.088Z" }, + { url = "https://files.pythonhosted.org/packages/0c/62/d2eb46264d4b157dae1275b573017abec435397aa59cbcdab6fc978a8af4/pyyaml-6.0.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:10892704fc220243f5305762e276552a0395f7beb4dbf9b14ec8fd43b57f126c", size = 775556, upload-time = "2025-09-25T21:32:01.31Z" }, + { url = "https://files.pythonhosted.org/packages/10/cb/16c3f2cf3266edd25aaa00d6c4350381c8b012ed6f5276675b9eba8d9ff4/pyyaml-6.0.3-cp311-cp311-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:850774a7879607d3a6f50d36d04f00ee69e7fc816450e5f7e58d7f17f1ae5c00", size = 882114, upload-time = "2025-09-25T21:32:03.376Z" }, + { url = "https://files.pythonhosted.org/packages/71/60/917329f640924b18ff085ab889a11c763e0b573da888e8404ff486657602/pyyaml-6.0.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:b8bb0864c5a28024fac8a632c443c87c5aa6f215c0b126c449ae1a150412f31d", size = 806638, upload-time = "2025-09-25T21:32:04.553Z" }, + { url = "https://files.pythonhosted.org/packages/dd/6f/529b0f316a9fd167281a6c3826b5583e6192dba792dd55e3203d3f8e655a/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:1d37d57ad971609cf3c53ba6a7e365e40660e3be0e5175fa9f2365a379d6095a", size = 767463, upload-time = "2025-09-25T21:32:06.152Z" }, + { url = "https://files.pythonhosted.org/packages/f2/6a/b627b4e0c1dd03718543519ffb2f1deea4a1e6d42fbab8021936a4d22589/pyyaml-6.0.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:37503bfbfc9d2c40b344d06b2199cf0e96e97957ab1c1b546fd4f87e53e5d3e4", size = 794986, upload-time = "2025-09-25T21:32:07.367Z" }, + { url = "https://files.pythonhosted.org/packages/45/91/47a6e1c42d9ee337c4839208f30d9f09caa9f720ec7582917b264defc875/pyyaml-6.0.3-cp311-cp311-win32.whl", hash = "sha256:8098f252adfa6c80ab48096053f512f2321f0b998f98150cea9bd23d83e1467b", size = 142543, upload-time = "2025-09-25T21:32:08.95Z" }, + { url = "https://files.pythonhosted.org/packages/da/e3/ea007450a105ae919a72393cb06f122f288ef60bba2dc64b26e2646fa315/pyyaml-6.0.3-cp311-cp311-win_amd64.whl", hash = "sha256:9f3bfb4965eb874431221a3ff3fdcddc7e74e3b07799e0e84ca4a0f867d449bf", size = 158763, upload-time = "2025-09-25T21:32:09.96Z" }, + { url = "https://files.pythonhosted.org/packages/d1/33/422b98d2195232ca1826284a76852ad5a86fe23e31b009c9886b2d0fb8b2/pyyaml-6.0.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:7f047e29dcae44602496db43be01ad42fc6f1cc0d8cd6c83d342306c32270196", size = 182063, upload-time = "2025-09-25T21:32:11.445Z" }, + { url = "https://files.pythonhosted.org/packages/89/a0/6cf41a19a1f2f3feab0e9c0b74134aa2ce6849093d5517a0c550fe37a648/pyyaml-6.0.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:fc09d0aa354569bc501d4e787133afc08552722d3ab34836a80547331bb5d4a0", size = 173973, upload-time = "2025-09-25T21:32:12.492Z" }, + { url = "https://files.pythonhosted.org/packages/ed/23/7a778b6bd0b9a8039df8b1b1d80e2e2ad78aa04171592c8a5c43a56a6af4/pyyaml-6.0.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:9149cad251584d5fb4981be1ecde53a1ca46c891a79788c0df828d2f166bda28", size = 775116, upload-time = "2025-09-25T21:32:13.652Z" }, + { url = "https://files.pythonhosted.org/packages/65/30/d7353c338e12baef4ecc1b09e877c1970bd3382789c159b4f89d6a70dc09/pyyaml-6.0.3-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:5fdec68f91a0c6739b380c83b951e2c72ac0197ace422360e6d5a959d8d97b2c", size = 844011, upload-time = "2025-09-25T21:32:15.21Z" }, + { url = "https://files.pythonhosted.org/packages/8b/9d/b3589d3877982d4f2329302ef98a8026e7f4443c765c46cfecc8858c6b4b/pyyaml-6.0.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ba1cc08a7ccde2d2ec775841541641e4548226580ab850948cbfda66a1befcdc", size = 807870, upload-time = "2025-09-25T21:32:16.431Z" }, + { url = "https://files.pythonhosted.org/packages/05/c0/b3be26a015601b822b97d9149ff8cb5ead58c66f981e04fedf4e762f4bd4/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:8dc52c23056b9ddd46818a57b78404882310fb473d63f17b07d5c40421e47f8e", size = 761089, upload-time = "2025-09-25T21:32:17.56Z" }, + { url = "https://files.pythonhosted.org/packages/be/8e/98435a21d1d4b46590d5459a22d88128103f8da4c2d4cb8f14f2a96504e1/pyyaml-6.0.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:41715c910c881bc081f1e8872880d3c650acf13dfa8214bad49ed4cede7c34ea", size = 790181, upload-time = "2025-09-25T21:32:18.834Z" }, + { url = "https://files.pythonhosted.org/packages/74/93/7baea19427dcfbe1e5a372d81473250b379f04b1bd3c4c5ff825e2327202/pyyaml-6.0.3-cp312-cp312-win32.whl", hash = "sha256:96b533f0e99f6579b3d4d4995707cf36df9100d67e0c8303a0c55b27b5f99bc5", size = 137658, upload-time = "2025-09-25T21:32:20.209Z" }, + { url = "https://files.pythonhosted.org/packages/86/bf/899e81e4cce32febab4fb42bb97dcdf66bc135272882d1987881a4b519e9/pyyaml-6.0.3-cp312-cp312-win_amd64.whl", hash = "sha256:5fcd34e47f6e0b794d17de1b4ff496c00986e1c83f7ab2fb8fcfe9616ff7477b", size = 154003, upload-time = "2025-09-25T21:32:21.167Z" }, + { url = "https://files.pythonhosted.org/packages/1a/08/67bd04656199bbb51dbed1439b7f27601dfb576fb864099c7ef0c3e55531/pyyaml-6.0.3-cp312-cp312-win_arm64.whl", hash = "sha256:64386e5e707d03a7e172c0701abfb7e10f0fb753ee1d773128192742712a98fd", size = 140344, upload-time = "2025-09-25T21:32:22.617Z" }, + { url = "https://files.pythonhosted.org/packages/d1/11/0fd08f8192109f7169db964b5707a2f1e8b745d4e239b784a5a1dd80d1db/pyyaml-6.0.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:8da9669d359f02c0b91ccc01cac4a67f16afec0dac22c2ad09f46bee0697eba8", size = 181669, upload-time = "2025-09-25T21:32:23.673Z" }, + { url = "https://files.pythonhosted.org/packages/b1/16/95309993f1d3748cd644e02e38b75d50cbc0d9561d21f390a76242ce073f/pyyaml-6.0.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:2283a07e2c21a2aa78d9c4442724ec1eb15f5e42a723b99cb3d822d48f5f7ad1", size = 173252, upload-time = "2025-09-25T21:32:25.149Z" }, + { url = "https://files.pythonhosted.org/packages/50/31/b20f376d3f810b9b2371e72ef5adb33879b25edb7a6d072cb7ca0c486398/pyyaml-6.0.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ee2922902c45ae8ccada2c5b501ab86c36525b883eff4255313a253a3160861c", size = 767081, upload-time = "2025-09-25T21:32:26.575Z" }, + { url = "https://files.pythonhosted.org/packages/49/1e/a55ca81e949270d5d4432fbbd19dfea5321eda7c41a849d443dc92fd1ff7/pyyaml-6.0.3-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:a33284e20b78bd4a18c8c2282d549d10bc8408a2a7ff57653c0cf0b9be0afce5", size = 841159, upload-time = "2025-09-25T21:32:27.727Z" }, + { url = "https://files.pythonhosted.org/packages/74/27/e5b8f34d02d9995b80abcef563ea1f8b56d20134d8f4e5e81733b1feceb2/pyyaml-6.0.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:0f29edc409a6392443abf94b9cf89ce99889a1dd5376d94316ae5145dfedd5d6", size = 801626, upload-time = "2025-09-25T21:32:28.878Z" }, + { url = "https://files.pythonhosted.org/packages/f9/11/ba845c23988798f40e52ba45f34849aa8a1f2d4af4b798588010792ebad6/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:f7057c9a337546edc7973c0d3ba84ddcdf0daa14533c2065749c9075001090e6", size = 753613, upload-time = "2025-09-25T21:32:30.178Z" }, + { url = "https://files.pythonhosted.org/packages/3d/e0/7966e1a7bfc0a45bf0a7fb6b98ea03fc9b8d84fa7f2229e9659680b69ee3/pyyaml-6.0.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eda16858a3cab07b80edaf74336ece1f986ba330fdb8ee0d6c0d68fe82bc96be", size = 794115, upload-time = "2025-09-25T21:32:31.353Z" }, + { url = "https://files.pythonhosted.org/packages/de/94/980b50a6531b3019e45ddeada0626d45fa85cbe22300844a7983285bed3b/pyyaml-6.0.3-cp313-cp313-win32.whl", hash = "sha256:d0eae10f8159e8fdad514efdc92d74fd8d682c933a6dd088030f3834bc8e6b26", size = 137427, upload-time = "2025-09-25T21:32:32.58Z" }, + { url = "https://files.pythonhosted.org/packages/97/c9/39d5b874e8b28845e4ec2202b5da735d0199dbe5b8fb85f91398814a9a46/pyyaml-6.0.3-cp313-cp313-win_amd64.whl", hash = "sha256:79005a0d97d5ddabfeeea4cf676af11e647e41d81c9a7722a193022accdb6b7c", size = 154090, upload-time = "2025-09-25T21:32:33.659Z" }, + { url = "https://files.pythonhosted.org/packages/73/e8/2bdf3ca2090f68bb3d75b44da7bbc71843b19c9f2b9cb9b0f4ab7a5a4329/pyyaml-6.0.3-cp313-cp313-win_arm64.whl", hash = "sha256:5498cd1645aa724a7c71c8f378eb29ebe23da2fc0d7a08071d89469bf1d2defb", size = 140246, upload-time = "2025-09-25T21:32:34.663Z" }, ] [[package]] @@ -2758,7 +2683,7 @@ version = "2025.3.6" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "pillow" }, ] wheels = [ @@ -2786,16 +2711,16 @@ wheels = [ [[package]] name = "referencing" -version = "0.36.2" +version = "0.37.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "attrs" }, { name = "rpds-py" }, { name = "typing-extensions", marker = "python_full_version < '3.13'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/2f/db/98b5c277be99dd18bfd91dd04e1b759cad18d1a338188c936e92f921c7e2/referencing-0.36.2.tar.gz", hash = "sha256:df2e89862cd09deabbdba16944cc3f10feb6b3e6f18e902f7cc25609a34775aa", size = 74744, upload-time = "2025-01-25T08:48:16.138Z" } +sdist = { url = "https://files.pythonhosted.org/packages/22/f5/df4e9027acead3ecc63e50fe1e36aca1523e1719559c499951bb4b53188f/referencing-0.37.0.tar.gz", hash = "sha256:44aefc3142c5b842538163acb373e24cce6632bd54bdb01b21ad5863489f50d8", size = 78036, upload-time = "2025-10-13T15:30:48.871Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/c1/b1/3baf80dc6d2b7bc27a95a67752d0208e410351e3feb4eb78de5f77454d8d/referencing-0.36.2-py3-none-any.whl", hash = "sha256:e8699adbbf8b5c7de96d8ffa0eb5c158b3beafce084968e2ea8bb08c6794dcd0", size = 26775, upload-time = "2025-01-25T08:48:14.241Z" }, + { url = "https://files.pythonhosted.org/packages/2c/58/ca301544e1fa93ed4f80d724bf5b194f6e4b945841c5bfd555878eea9fcb/referencing-0.37.0-py3-none-any.whl", hash = "sha256:381329a9f99628c9069361716891d34ad94af76e461dcb0335825aecc7692231", size = 26766, upload-time = "2025-10-13T15:30:47.625Z" }, ] [[package]] @@ -2847,148 +2772,131 @@ wheels = [ ] [[package]] -name = "rich" -version = "14.1.0" +name = "roman-numerals" +version = "4.1.0" source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "markdown-it-py" }, - { name = "pygments" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/fe/75/af448d8e52bf1d8fa6a9d089ca6c07ff4453d86c65c145d0a300bb073b9b/rich-14.1.0.tar.gz", hash = "sha256:e497a48b844b0320d45007cdebfeaeed8db2a4f4bcf49f15e455cfc4af11eaa8", size = 224441, upload-time = "2025-07-25T07:32:58.125Z" } +sdist = { url = "https://files.pythonhosted.org/packages/ae/f9/41dc953bbeb056c17d5f7a519f50fdf010bd0553be2d630bc69d1e022703/roman_numerals-4.1.0.tar.gz", hash = "sha256:1af8b147eb1405d5839e78aeb93131690495fe9da5c91856cb33ad55a7f1e5b2", size = 9077, upload-time = "2025-12-17T18:25:34.381Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e3/30/3c4d035596d3cf444529e0b2953ad0466f6049528a879d27534700580395/rich-14.1.0-py3-none-any.whl", hash = "sha256:536f5f1785986d6dbdea3c75205c473f970777b4a0d6c6dd1b696aa05a3fa04f", size = 243368, upload-time = "2025-07-25T07:32:56.73Z" }, + { url = "https://files.pythonhosted.org/packages/04/54/6f679c435d28e0a568d8e8a7c0a93a09010818634c3c3907fc98d8983770/roman_numerals-4.1.0-py3-none-any.whl", hash = "sha256:647ba99caddc2cc1e55a51e4360689115551bf4476d90e8162cf8c345fe233c7", size = 7676, upload-time = "2025-12-17T18:25:33.098Z" }, ] [[package]] name = "rpds-py" -version = "0.27.1" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e9/dd/2c0cbe774744272b0ae725f44032c77bdcab6e8bcf544bffa3b6e70c8dba/rpds_py-0.27.1.tar.gz", hash = "sha256:26a1c73171d10b7acccbded82bf6a586ab8203601e565badc74bbbf8bc5a10f8", size = 27479, upload-time = "2025-08-27T12:16:36.024Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/a5/ed/3aef893e2dd30e77e35d20d4ddb45ca459db59cead748cad9796ad479411/rpds_py-0.27.1-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:68afeec26d42ab3b47e541b272166a0b4400313946871cba3ed3a4fc0cab1cef", size = 371606, upload-time = "2025-08-27T12:12:25.189Z" }, - { url = "https://files.pythonhosted.org/packages/6d/82/9818b443e5d3eb4c83c3994561387f116aae9833b35c484474769c4a8faf/rpds_py-0.27.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:74e5b2f7bb6fa38b1b10546d27acbacf2a022a8b5543efb06cfebc72a59c85be", size = 353452, upload-time = "2025-08-27T12:12:27.433Z" }, - { url = "https://files.pythonhosted.org/packages/99/c7/d2a110ffaaa397fc6793a83c7bd3545d9ab22658b7cdff05a24a4535cc45/rpds_py-0.27.1-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:9024de74731df54546fab0bfbcdb49fae19159ecaecfc8f37c18d2c7e2c0bd61", size = 381519, upload-time = "2025-08-27T12:12:28.719Z" }, - { url = "https://files.pythonhosted.org/packages/5a/bc/e89581d1f9d1be7d0247eaef602566869fdc0d084008ba139e27e775366c/rpds_py-0.27.1-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:31d3ebadefcd73b73928ed0b2fd696f7fefda8629229f81929ac9c1854d0cffb", size = 394424, upload-time = "2025-08-27T12:12:30.207Z" }, - { url = "https://files.pythonhosted.org/packages/ac/2e/36a6861f797530e74bb6ed53495f8741f1ef95939eed01d761e73d559067/rpds_py-0.27.1-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:b2e7f8f169d775dd9092a1743768d771f1d1300453ddfe6325ae3ab5332b4657", size = 523467, upload-time = "2025-08-27T12:12:31.808Z" }, - { url = "https://files.pythonhosted.org/packages/c4/59/c1bc2be32564fa499f988f0a5c6505c2f4746ef96e58e4d7de5cf923d77e/rpds_py-0.27.1-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3d905d16f77eb6ab2e324e09bfa277b4c8e5e6b8a78a3e7ff8f3cdf773b4c013", size = 402660, upload-time = "2025-08-27T12:12:33.444Z" }, - { url = "https://files.pythonhosted.org/packages/0a/ec/ef8bf895f0628dd0a59e54d81caed6891663cb9c54a0f4bb7da918cb88cf/rpds_py-0.27.1-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:50c946f048209e6362e22576baea09193809f87687a95a8db24e5fbdb307b93a", size = 384062, upload-time = "2025-08-27T12:12:34.857Z" }, - { url = "https://files.pythonhosted.org/packages/69/f7/f47ff154be8d9a5e691c083a920bba89cef88d5247c241c10b9898f595a1/rpds_py-0.27.1-cp310-cp310-manylinux_2_31_riscv64.whl", hash = "sha256:3deab27804d65cd8289eb814c2c0e807c4b9d9916c9225e363cb0cf875eb67c1", size = 401289, upload-time = "2025-08-27T12:12:36.085Z" }, - { url = "https://files.pythonhosted.org/packages/3b/d9/ca410363efd0615814ae579f6829cafb39225cd63e5ea5ed1404cb345293/rpds_py-0.27.1-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:8b61097f7488de4be8244c89915da8ed212832ccf1e7c7753a25a394bf9b1f10", size = 417718, upload-time = "2025-08-27T12:12:37.401Z" }, - { url = "https://files.pythonhosted.org/packages/e3/a0/8cb5c2ff38340f221cc067cc093d1270e10658ba4e8d263df923daa18e86/rpds_py-0.27.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:8a3f29aba6e2d7d90528d3c792555a93497fe6538aa65eb675b44505be747808", size = 558333, upload-time = "2025-08-27T12:12:38.672Z" }, - { url = "https://files.pythonhosted.org/packages/6f/8c/1b0de79177c5d5103843774ce12b84caa7164dfc6cd66378768d37db11bf/rpds_py-0.27.1-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:dd6cd0485b7d347304067153a6dc1d73f7d4fd995a396ef32a24d24b8ac63ac8", size = 589127, upload-time = "2025-08-27T12:12:41.48Z" }, - { url = "https://files.pythonhosted.org/packages/c8/5e/26abb098d5e01266b0f3a2488d299d19ccc26849735d9d2b95c39397e945/rpds_py-0.27.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:6f4461bf931108c9fa226ffb0e257c1b18dc2d44cd72b125bec50ee0ab1248a9", size = 554899, upload-time = "2025-08-27T12:12:42.925Z" }, - { url = "https://files.pythonhosted.org/packages/de/41/905cc90ced13550db017f8f20c6d8e8470066c5738ba480d7ba63e3d136b/rpds_py-0.27.1-cp310-cp310-win32.whl", hash = "sha256:ee5422d7fb21f6a00c1901bf6559c49fee13a5159d0288320737bbf6585bd3e4", size = 217450, upload-time = "2025-08-27T12:12:44.813Z" }, - { url = "https://files.pythonhosted.org/packages/75/3d/6bef47b0e253616ccdf67c283e25f2d16e18ccddd38f92af81d5a3420206/rpds_py-0.27.1-cp310-cp310-win_amd64.whl", hash = "sha256:3e039aabf6d5f83c745d5f9a0a381d031e9ed871967c0a5c38d201aca41f3ba1", size = 228447, upload-time = "2025-08-27T12:12:46.204Z" }, - { url = "https://files.pythonhosted.org/packages/b5/c1/7907329fbef97cbd49db6f7303893bd1dd5a4a3eae415839ffdfb0762cae/rpds_py-0.27.1-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:be898f271f851f68b318872ce6ebebbc62f303b654e43bf72683dbdc25b7c881", size = 371063, upload-time = "2025-08-27T12:12:47.856Z" }, - { url = "https://files.pythonhosted.org/packages/11/94/2aab4bc86228bcf7c48760990273653a4900de89c7537ffe1b0d6097ed39/rpds_py-0.27.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:62ac3d4e3e07b58ee0ddecd71d6ce3b1637de2d373501412df395a0ec5f9beb5", size = 353210, upload-time = "2025-08-27T12:12:49.187Z" }, - { url = "https://files.pythonhosted.org/packages/3a/57/f5eb3ecf434342f4f1a46009530e93fd201a0b5b83379034ebdb1d7c1a58/rpds_py-0.27.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4708c5c0ceb2d034f9991623631d3d23cb16e65c83736ea020cdbe28d57c0a0e", size = 381636, upload-time = "2025-08-27T12:12:50.492Z" }, - { url = "https://files.pythonhosted.org/packages/ae/f4/ef95c5945e2ceb5119571b184dd5a1cc4b8541bbdf67461998cfeac9cb1e/rpds_py-0.27.1-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:abfa1171a9952d2e0002aba2ad3780820b00cc3d9c98c6630f2e93271501f66c", size = 394341, upload-time = "2025-08-27T12:12:52.024Z" }, - { url = "https://files.pythonhosted.org/packages/5a/7e/4bd610754bf492d398b61725eb9598ddd5eb86b07d7d9483dbcd810e20bc/rpds_py-0.27.1-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:4b507d19f817ebaca79574b16eb2ae412e5c0835542c93fe9983f1e432aca195", size = 523428, upload-time = "2025-08-27T12:12:53.779Z" }, - { url = "https://files.pythonhosted.org/packages/9f/e5/059b9f65a8c9149361a8b75094864ab83b94718344db511fd6117936ed2a/rpds_py-0.27.1-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:168b025f8fd8d8d10957405f3fdcef3dc20f5982d398f90851f4abc58c566c52", size = 402923, upload-time = "2025-08-27T12:12:55.15Z" }, - { url = "https://files.pythonhosted.org/packages/f5/48/64cabb7daced2968dd08e8a1b7988bf358d7bd5bcd5dc89a652f4668543c/rpds_py-0.27.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:cb56c6210ef77caa58e16e8c17d35c63fe3f5b60fd9ba9d424470c3400bcf9ed", size = 384094, upload-time = "2025-08-27T12:12:57.194Z" }, - { url = "https://files.pythonhosted.org/packages/ae/e1/dc9094d6ff566bff87add8a510c89b9e158ad2ecd97ee26e677da29a9e1b/rpds_py-0.27.1-cp311-cp311-manylinux_2_31_riscv64.whl", hash = "sha256:d252f2d8ca0195faa707f8eb9368955760880b2b42a8ee16d382bf5dd807f89a", size = 401093, upload-time = "2025-08-27T12:12:58.985Z" }, - { url = "https://files.pythonhosted.org/packages/37/8e/ac8577e3ecdd5593e283d46907d7011618994e1d7ab992711ae0f78b9937/rpds_py-0.27.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:6e5e54da1e74b91dbc7996b56640f79b195d5925c2b78efaa8c5d53e1d88edde", size = 417969, upload-time = "2025-08-27T12:13:00.367Z" }, - { url = "https://files.pythonhosted.org/packages/66/6d/87507430a8f74a93556fe55c6485ba9c259949a853ce407b1e23fea5ba31/rpds_py-0.27.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:ffce0481cc6e95e5b3f0a47ee17ffbd234399e6d532f394c8dce320c3b089c21", size = 558302, upload-time = "2025-08-27T12:13:01.737Z" }, - { url = "https://files.pythonhosted.org/packages/3a/bb/1db4781ce1dda3eecc735e3152659a27b90a02ca62bfeea17aee45cc0fbc/rpds_py-0.27.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:a205fdfe55c90c2cd8e540ca9ceba65cbe6629b443bc05db1f590a3db8189ff9", size = 589259, upload-time = "2025-08-27T12:13:03.127Z" }, - { url = "https://files.pythonhosted.org/packages/7b/0e/ae1c8943d11a814d01b482e1f8da903f88047a962dff9bbdadf3bd6e6fd1/rpds_py-0.27.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:689fb5200a749db0415b092972e8eba85847c23885c8543a8b0f5c009b1a5948", size = 554983, upload-time = "2025-08-27T12:13:04.516Z" }, - { url = "https://files.pythonhosted.org/packages/b2/d5/0b2a55415931db4f112bdab072443ff76131b5ac4f4dc98d10d2d357eb03/rpds_py-0.27.1-cp311-cp311-win32.whl", hash = "sha256:3182af66048c00a075010bc7f4860f33913528a4b6fc09094a6e7598e462fe39", size = 217154, upload-time = "2025-08-27T12:13:06.278Z" }, - { url = "https://files.pythonhosted.org/packages/24/75/3b7ffe0d50dc86a6a964af0d1cc3a4a2cdf437cb7b099a4747bbb96d1819/rpds_py-0.27.1-cp311-cp311-win_amd64.whl", hash = "sha256:b4938466c6b257b2f5c4ff98acd8128ec36b5059e5c8f8372d79316b1c36bb15", size = 228627, upload-time = "2025-08-27T12:13:07.625Z" }, - { url = "https://files.pythonhosted.org/packages/8d/3f/4fd04c32abc02c710f09a72a30c9a55ea3cc154ef8099078fd50a0596f8e/rpds_py-0.27.1-cp311-cp311-win_arm64.whl", hash = "sha256:2f57af9b4d0793e53266ee4325535a31ba48e2f875da81a9177c9926dfa60746", size = 220998, upload-time = "2025-08-27T12:13:08.972Z" }, - { url = "https://files.pythonhosted.org/packages/bd/fe/38de28dee5df58b8198c743fe2bea0c785c6d40941b9950bac4cdb71a014/rpds_py-0.27.1-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:ae2775c1973e3c30316892737b91f9283f9908e3cc7625b9331271eaaed7dc90", size = 361887, upload-time = "2025-08-27T12:13:10.233Z" }, - { url = "https://files.pythonhosted.org/packages/7c/9a/4b6c7eedc7dd90986bf0fab6ea2a091ec11c01b15f8ba0a14d3f80450468/rpds_py-0.27.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:2643400120f55c8a96f7c9d858f7be0c88d383cd4653ae2cf0d0c88f668073e5", size = 345795, upload-time = "2025-08-27T12:13:11.65Z" }, - { url = "https://files.pythonhosted.org/packages/6f/0e/e650e1b81922847a09cca820237b0edee69416a01268b7754d506ade11ad/rpds_py-0.27.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:16323f674c089b0360674a4abd28d5042947d54ba620f72514d69be4ff64845e", size = 385121, upload-time = "2025-08-27T12:13:13.008Z" }, - { url = "https://files.pythonhosted.org/packages/1b/ea/b306067a712988e2bff00dcc7c8f31d26c29b6d5931b461aa4b60a013e33/rpds_py-0.27.1-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:9a1f4814b65eacac94a00fc9a526e3fdafd78e439469644032032d0d63de4881", size = 398976, upload-time = "2025-08-27T12:13:14.368Z" }, - { url = "https://files.pythonhosted.org/packages/2c/0a/26dc43c8840cb8fe239fe12dbc8d8de40f2365e838f3d395835dde72f0e5/rpds_py-0.27.1-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:7ba32c16b064267b22f1850a34051121d423b6f7338a12b9459550eb2096e7ec", size = 525953, upload-time = "2025-08-27T12:13:15.774Z" }, - { url = "https://files.pythonhosted.org/packages/22/14/c85e8127b573aaf3a0cbd7fbb8c9c99e735a4a02180c84da2a463b766e9e/rpds_py-0.27.1-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:e5c20f33fd10485b80f65e800bbe5f6785af510b9f4056c5a3c612ebc83ba6cb", size = 407915, upload-time = "2025-08-27T12:13:17.379Z" }, - { url = "https://files.pythonhosted.org/packages/ed/7b/8f4fee9ba1fb5ec856eb22d725a4efa3deb47f769597c809e03578b0f9d9/rpds_py-0.27.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:466bfe65bd932da36ff279ddd92de56b042f2266d752719beb97b08526268ec5", size = 386883, upload-time = "2025-08-27T12:13:18.704Z" }, - { url = "https://files.pythonhosted.org/packages/86/47/28fa6d60f8b74fcdceba81b272f8d9836ac0340570f68f5df6b41838547b/rpds_py-0.27.1-cp312-cp312-manylinux_2_31_riscv64.whl", hash = "sha256:41e532bbdcb57c92ba3be62c42e9f096431b4cf478da9bc3bc6ce5c38ab7ba7a", size = 405699, upload-time = "2025-08-27T12:13:20.089Z" }, - { url = "https://files.pythonhosted.org/packages/d0/fd/c5987b5e054548df56953a21fe2ebed51fc1ec7c8f24fd41c067b68c4a0a/rpds_py-0.27.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:f149826d742b406579466283769a8ea448eed82a789af0ed17b0cd5770433444", size = 423713, upload-time = "2025-08-27T12:13:21.436Z" }, - { url = "https://files.pythonhosted.org/packages/ac/ba/3c4978b54a73ed19a7d74531be37a8bcc542d917c770e14d372b8daea186/rpds_py-0.27.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:80c60cfb5310677bd67cb1e85a1e8eb52e12529545441b43e6f14d90b878775a", size = 562324, upload-time = "2025-08-27T12:13:22.789Z" }, - { url = "https://files.pythonhosted.org/packages/b5/6c/6943a91768fec16db09a42b08644b960cff540c66aab89b74be6d4a144ba/rpds_py-0.27.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:7ee6521b9baf06085f62ba9c7a3e5becffbc32480d2f1b351559c001c38ce4c1", size = 593646, upload-time = "2025-08-27T12:13:24.122Z" }, - { url = "https://files.pythonhosted.org/packages/11/73/9d7a8f4be5f4396f011a6bb7a19fe26303a0dac9064462f5651ced2f572f/rpds_py-0.27.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a512c8263249a9d68cac08b05dd59d2b3f2061d99b322813cbcc14c3c7421998", size = 558137, upload-time = "2025-08-27T12:13:25.557Z" }, - { url = "https://files.pythonhosted.org/packages/6e/96/6772cbfa0e2485bcceef8071de7821f81aeac8bb45fbfd5542a3e8108165/rpds_py-0.27.1-cp312-cp312-win32.whl", hash = "sha256:819064fa048ba01b6dadc5116f3ac48610435ac9a0058bbde98e569f9e785c39", size = 221343, upload-time = "2025-08-27T12:13:26.967Z" }, - { url = "https://files.pythonhosted.org/packages/67/b6/c82f0faa9af1c6a64669f73a17ee0eeef25aff30bb9a1c318509efe45d84/rpds_py-0.27.1-cp312-cp312-win_amd64.whl", hash = "sha256:d9199717881f13c32c4046a15f024971a3b78ad4ea029e8da6b86e5aa9cf4594", size = 232497, upload-time = "2025-08-27T12:13:28.326Z" }, - { url = "https://files.pythonhosted.org/packages/e1/96/2817b44bd2ed11aebacc9251da03689d56109b9aba5e311297b6902136e2/rpds_py-0.27.1-cp312-cp312-win_arm64.whl", hash = "sha256:33aa65b97826a0e885ef6e278fbd934e98cdcfed80b63946025f01e2f5b29502", size = 222790, upload-time = "2025-08-27T12:13:29.71Z" }, - { url = "https://files.pythonhosted.org/packages/cc/77/610aeee8d41e39080c7e14afa5387138e3c9fa9756ab893d09d99e7d8e98/rpds_py-0.27.1-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:e4b9fcfbc021633863a37e92571d6f91851fa656f0180246e84cbd8b3f6b329b", size = 361741, upload-time = "2025-08-27T12:13:31.039Z" }, - { url = "https://files.pythonhosted.org/packages/3a/fc/c43765f201c6a1c60be2043cbdb664013def52460a4c7adace89d6682bf4/rpds_py-0.27.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:1441811a96eadca93c517d08df75de45e5ffe68aa3089924f963c782c4b898cf", size = 345574, upload-time = "2025-08-27T12:13:32.902Z" }, - { url = "https://files.pythonhosted.org/packages/20/42/ee2b2ca114294cd9847d0ef9c26d2b0851b2e7e00bf14cc4c0b581df0fc3/rpds_py-0.27.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:55266dafa22e672f5a4f65019015f90336ed31c6383bd53f5e7826d21a0e0b83", size = 385051, upload-time = "2025-08-27T12:13:34.228Z" }, - { url = "https://files.pythonhosted.org/packages/fd/e8/1e430fe311e4799e02e2d1af7c765f024e95e17d651612425b226705f910/rpds_py-0.27.1-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d78827d7ac08627ea2c8e02c9e5b41180ea5ea1f747e9db0915e3adf36b62dcf", size = 398395, upload-time = "2025-08-27T12:13:36.132Z" }, - { url = "https://files.pythonhosted.org/packages/82/95/9dc227d441ff2670651c27a739acb2535ccaf8b351a88d78c088965e5996/rpds_py-0.27.1-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ae92443798a40a92dc5f0b01d8a7c93adde0c4dc965310a29ae7c64d72b9fad2", size = 524334, upload-time = "2025-08-27T12:13:37.562Z" }, - { url = "https://files.pythonhosted.org/packages/87/01/a670c232f401d9ad461d9a332aa4080cd3cb1d1df18213dbd0d2a6a7ab51/rpds_py-0.27.1-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:c46c9dd2403b66a2a3b9720ec4b74d4ab49d4fabf9f03dfdce2d42af913fe8d0", size = 407691, upload-time = "2025-08-27T12:13:38.94Z" }, - { url = "https://files.pythonhosted.org/packages/03/36/0a14aebbaa26fe7fab4780c76f2239e76cc95a0090bdb25e31d95c492fcd/rpds_py-0.27.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2efe4eb1d01b7f5f1939f4ef30ecea6c6b3521eec451fb93191bf84b2a522418", size = 386868, upload-time = "2025-08-27T12:13:40.192Z" }, - { url = "https://files.pythonhosted.org/packages/3b/03/8c897fb8b5347ff6c1cc31239b9611c5bf79d78c984430887a353e1409a1/rpds_py-0.27.1-cp313-cp313-manylinux_2_31_riscv64.whl", hash = "sha256:15d3b4d83582d10c601f481eca29c3f138d44c92187d197aff663a269197c02d", size = 405469, upload-time = "2025-08-27T12:13:41.496Z" }, - { url = "https://files.pythonhosted.org/packages/da/07/88c60edc2df74850d496d78a1fdcdc7b54360a7f610a4d50008309d41b94/rpds_py-0.27.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:4ed2e16abbc982a169d30d1a420274a709949e2cbdef119fe2ec9d870b42f274", size = 422125, upload-time = "2025-08-27T12:13:42.802Z" }, - { url = "https://files.pythonhosted.org/packages/6b/86/5f4c707603e41b05f191a749984f390dabcbc467cf833769b47bf14ba04f/rpds_py-0.27.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a75f305c9b013289121ec0f1181931975df78738cdf650093e6b86d74aa7d8dd", size = 562341, upload-time = "2025-08-27T12:13:44.472Z" }, - { url = "https://files.pythonhosted.org/packages/b2/92/3c0cb2492094e3cd9baf9e49bbb7befeceb584ea0c1a8b5939dca4da12e5/rpds_py-0.27.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:67ce7620704745881a3d4b0ada80ab4d99df390838839921f99e63c474f82cf2", size = 592511, upload-time = "2025-08-27T12:13:45.898Z" }, - { url = "https://files.pythonhosted.org/packages/10/bb/82e64fbb0047c46a168faa28d0d45a7851cd0582f850b966811d30f67ad8/rpds_py-0.27.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9d992ac10eb86d9b6f369647b6a3f412fc0075cfd5d799530e84d335e440a002", size = 557736, upload-time = "2025-08-27T12:13:47.408Z" }, - { url = "https://files.pythonhosted.org/packages/00/95/3c863973d409210da7fb41958172c6b7dbe7fc34e04d3cc1f10bb85e979f/rpds_py-0.27.1-cp313-cp313-win32.whl", hash = "sha256:4f75e4bd8ab8db624e02c8e2fc4063021b58becdbe6df793a8111d9343aec1e3", size = 221462, upload-time = "2025-08-27T12:13:48.742Z" }, - { url = "https://files.pythonhosted.org/packages/ce/2c/5867b14a81dc217b56d95a9f2a40fdbc56a1ab0181b80132beeecbd4b2d6/rpds_py-0.27.1-cp313-cp313-win_amd64.whl", hash = "sha256:f9025faafc62ed0b75a53e541895ca272815bec18abe2249ff6501c8f2e12b83", size = 232034, upload-time = "2025-08-27T12:13:50.11Z" }, - { url = "https://files.pythonhosted.org/packages/c7/78/3958f3f018c01923823f1e47f1cc338e398814b92d83cd278364446fac66/rpds_py-0.27.1-cp313-cp313-win_arm64.whl", hash = "sha256:ed10dc32829e7d222b7d3b93136d25a406ba9788f6a7ebf6809092da1f4d279d", size = 222392, upload-time = "2025-08-27T12:13:52.587Z" }, - { url = "https://files.pythonhosted.org/packages/01/76/1cdf1f91aed5c3a7bf2eba1f1c4e4d6f57832d73003919a20118870ea659/rpds_py-0.27.1-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:92022bbbad0d4426e616815b16bc4127f83c9a74940e1ccf3cfe0b387aba0228", size = 358355, upload-time = "2025-08-27T12:13:54.012Z" }, - { url = "https://files.pythonhosted.org/packages/c3/6f/bf142541229374287604caf3bb2a4ae17f0a580798fd72d3b009b532db4e/rpds_py-0.27.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:47162fdab9407ec3f160805ac3e154df042e577dd53341745fc7fb3f625e6d92", size = 342138, upload-time = "2025-08-27T12:13:55.791Z" }, - { url = "https://files.pythonhosted.org/packages/1a/77/355b1c041d6be40886c44ff5e798b4e2769e497b790f0f7fd1e78d17e9a8/rpds_py-0.27.1-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:fb89bec23fddc489e5d78b550a7b773557c9ab58b7946154a10a6f7a214a48b2", size = 380247, upload-time = "2025-08-27T12:13:57.683Z" }, - { url = "https://files.pythonhosted.org/packages/d6/a4/d9cef5c3946ea271ce2243c51481971cd6e34f21925af2783dd17b26e815/rpds_py-0.27.1-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e48af21883ded2b3e9eb48cb7880ad8598b31ab752ff3be6457001d78f416723", size = 390699, upload-time = "2025-08-27T12:13:59.137Z" }, - { url = "https://files.pythonhosted.org/packages/3a/06/005106a7b8c6c1a7e91b73169e49870f4af5256119d34a361ae5240a0c1d/rpds_py-0.27.1-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:6f5b7bd8e219ed50299e58551a410b64daafb5017d54bbe822e003856f06a802", size = 521852, upload-time = "2025-08-27T12:14:00.583Z" }, - { url = "https://files.pythonhosted.org/packages/e5/3e/50fb1dac0948e17a02eb05c24510a8fe12d5ce8561c6b7b7d1339ab7ab9c/rpds_py-0.27.1-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:08f1e20bccf73b08d12d804d6e1c22ca5530e71659e6673bce31a6bb71c1e73f", size = 402582, upload-time = "2025-08-27T12:14:02.034Z" }, - { url = "https://files.pythonhosted.org/packages/cb/b0/f4e224090dc5b0ec15f31a02d746ab24101dd430847c4d99123798661bfc/rpds_py-0.27.1-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0dc5dceeaefcc96dc192e3a80bbe1d6c410c469e97bdd47494a7d930987f18b2", size = 384126, upload-time = "2025-08-27T12:14:03.437Z" }, - { url = "https://files.pythonhosted.org/packages/54/77/ac339d5f82b6afff1df8f0fe0d2145cc827992cb5f8eeb90fc9f31ef7a63/rpds_py-0.27.1-cp313-cp313t-manylinux_2_31_riscv64.whl", hash = "sha256:d76f9cc8665acdc0c9177043746775aa7babbf479b5520b78ae4002d889f5c21", size = 399486, upload-time = "2025-08-27T12:14:05.443Z" }, - { url = "https://files.pythonhosted.org/packages/d6/29/3e1c255eee6ac358c056a57d6d6869baa00a62fa32eea5ee0632039c50a3/rpds_py-0.27.1-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:134fae0e36022edad8290a6661edf40c023562964efea0cc0ec7f5d392d2aaef", size = 414832, upload-time = "2025-08-27T12:14:06.902Z" }, - { url = "https://files.pythonhosted.org/packages/3f/db/6d498b844342deb3fa1d030598db93937a9964fcf5cb4da4feb5f17be34b/rpds_py-0.27.1-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:eb11a4f1b2b63337cfd3b4d110af778a59aae51c81d195768e353d8b52f88081", size = 557249, upload-time = "2025-08-27T12:14:08.37Z" }, - { url = "https://files.pythonhosted.org/packages/60/f3/690dd38e2310b6f68858a331399b4d6dbb9132c3e8ef8b4333b96caf403d/rpds_py-0.27.1-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:13e608ac9f50a0ed4faec0e90ece76ae33b34c0e8656e3dceb9a7db994c692cd", size = 587356, upload-time = "2025-08-27T12:14:10.034Z" }, - { url = "https://files.pythonhosted.org/packages/86/e3/84507781cccd0145f35b1dc32c72675200c5ce8d5b30f813e49424ef68fc/rpds_py-0.27.1-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:dd2135527aa40f061350c3f8f89da2644de26cd73e4de458e79606384f4f68e7", size = 555300, upload-time = "2025-08-27T12:14:11.783Z" }, - { url = "https://files.pythonhosted.org/packages/e5/ee/375469849e6b429b3516206b4580a79e9ef3eb12920ddbd4492b56eaacbe/rpds_py-0.27.1-cp313-cp313t-win32.whl", hash = "sha256:3020724ade63fe320a972e2ffd93b5623227e684315adce194941167fee02688", size = 216714, upload-time = "2025-08-27T12:14:13.629Z" }, - { url = "https://files.pythonhosted.org/packages/21/87/3fc94e47c9bd0742660e84706c311a860dcae4374cf4a03c477e23ce605a/rpds_py-0.27.1-cp313-cp313t-win_amd64.whl", hash = "sha256:8ee50c3e41739886606388ba3ab3ee2aae9f35fb23f833091833255a31740797", size = 228943, upload-time = "2025-08-27T12:14:14.937Z" }, - { url = "https://files.pythonhosted.org/packages/d5/63/b7cc415c345625d5e62f694ea356c58fb964861409008118f1245f8c3347/rpds_py-0.27.1-pp310-pypy310_pp73-macosx_10_12_x86_64.whl", hash = "sha256:7ba22cb9693df986033b91ae1d7a979bc399237d45fccf875b76f62bb9e52ddf", size = 371360, upload-time = "2025-08-27T12:15:29.218Z" }, - { url = "https://files.pythonhosted.org/packages/e5/8c/12e1b24b560cf378b8ffbdb9dc73abd529e1adcfcf82727dfd29c4a7b88d/rpds_py-0.27.1-pp310-pypy310_pp73-macosx_11_0_arm64.whl", hash = "sha256:5b640501be9288c77738b5492b3fd3abc4ba95c50c2e41273c8a1459f08298d3", size = 353933, upload-time = "2025-08-27T12:15:30.837Z" }, - { url = "https://files.pythonhosted.org/packages/9b/85/1bb2210c1f7a1b99e91fea486b9f0f894aa5da3a5ec7097cbad7dec6d40f/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:fb08b65b93e0c6dd70aac7f7890a9c0938d5ec71d5cb32d45cf844fb8ae47636", size = 382962, upload-time = "2025-08-27T12:15:32.348Z" }, - { url = "https://files.pythonhosted.org/packages/cc/c9/a839b9f219cf80ed65f27a7f5ddbb2809c1b85c966020ae2dff490e0b18e/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:d7ff07d696a7a38152ebdb8212ca9e5baab56656749f3d6004b34ab726b550b8", size = 394412, upload-time = "2025-08-27T12:15:33.839Z" }, - { url = "https://files.pythonhosted.org/packages/02/2d/b1d7f928b0b1f4fc2e0133e8051d199b01d7384875adc63b6ddadf3de7e5/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:fb7c72262deae25366e3b6c0c0ba46007967aea15d1eea746e44ddba8ec58dcc", size = 523972, upload-time = "2025-08-27T12:15:35.377Z" }, - { url = "https://files.pythonhosted.org/packages/a9/af/2cbf56edd2d07716df1aec8a726b3159deb47cb5c27e1e42b71d705a7c2f/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:7b002cab05d6339716b03a4a3a2ce26737f6231d7b523f339fa061d53368c9d8", size = 403273, upload-time = "2025-08-27T12:15:37.051Z" }, - { url = "https://files.pythonhosted.org/packages/c0/93/425e32200158d44ff01da5d9612c3b6711fe69f606f06e3895511f17473b/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:23f6b69d1c26c4704fec01311963a41d7de3ee0570a84ebde4d544e5a1859ffc", size = 385278, upload-time = "2025-08-27T12:15:38.571Z" }, - { url = "https://files.pythonhosted.org/packages/eb/1a/1a04a915ecd0551bfa9e77b7672d1937b4b72a0fc204a17deef76001cfb2/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_31_riscv64.whl", hash = "sha256:530064db9146b247351f2a0250b8f00b289accea4596a033e94be2389977de71", size = 402084, upload-time = "2025-08-27T12:15:40.529Z" }, - { url = "https://files.pythonhosted.org/packages/51/f7/66585c0fe5714368b62951d2513b684e5215beaceab2c6629549ddb15036/rpds_py-0.27.1-pp310-pypy310_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:7b90b0496570bd6b0321724a330d8b545827c4df2034b6ddfc5f5275f55da2ad", size = 419041, upload-time = "2025-08-27T12:15:42.191Z" }, - { url = "https://files.pythonhosted.org/packages/8e/7e/83a508f6b8e219bba2d4af077c35ba0e0cdd35a751a3be6a7cba5a55ad71/rpds_py-0.27.1-pp310-pypy310_pp73-musllinux_1_2_aarch64.whl", hash = "sha256:879b0e14a2da6a1102a3fc8af580fc1ead37e6d6692a781bd8c83da37429b5ab", size = 560084, upload-time = "2025-08-27T12:15:43.839Z" }, - { url = "https://files.pythonhosted.org/packages/66/66/bb945683b958a1b19eb0fe715594630d0f36396ebdef4d9b89c2fa09aa56/rpds_py-0.27.1-pp310-pypy310_pp73-musllinux_1_2_i686.whl", hash = "sha256:0d807710df3b5faa66c731afa162ea29717ab3be17bdc15f90f2d9f183da4059", size = 590115, upload-time = "2025-08-27T12:15:46.647Z" }, - { url = "https://files.pythonhosted.org/packages/12/00/ccfaafaf7db7e7adace915e5c2f2c2410e16402561801e9c7f96683002d3/rpds_py-0.27.1-pp310-pypy310_pp73-musllinux_1_2_x86_64.whl", hash = "sha256:3adc388fc3afb6540aec081fa59e6e0d3908722771aa1e37ffe22b220a436f0b", size = 556561, upload-time = "2025-08-27T12:15:48.219Z" }, - { url = "https://files.pythonhosted.org/packages/e1/b7/92b6ed9aad103bfe1c45df98453dfae40969eef2cb6c6239c58d7e96f1b3/rpds_py-0.27.1-pp310-pypy310_pp73-win_amd64.whl", hash = "sha256:c796c0c1cc68cb08b0284db4229f5af76168172670c74908fdbd4b7d7f515819", size = 229125, upload-time = "2025-08-27T12:15:49.956Z" }, - { url = "https://files.pythonhosted.org/packages/0c/ed/e1fba02de17f4f76318b834425257c8ea297e415e12c68b4361f63e8ae92/rpds_py-0.27.1-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:cdfe4bb2f9fe7458b7453ad3c33e726d6d1c7c0a72960bcc23800d77384e42df", size = 371402, upload-time = "2025-08-27T12:15:51.561Z" }, - { url = "https://files.pythonhosted.org/packages/af/7c/e16b959b316048b55585a697e94add55a4ae0d984434d279ea83442e460d/rpds_py-0.27.1-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:8fabb8fd848a5f75a2324e4a84501ee3a5e3c78d8603f83475441866e60b94a3", size = 354084, upload-time = "2025-08-27T12:15:53.219Z" }, - { url = "https://files.pythonhosted.org/packages/de/c1/ade645f55de76799fdd08682d51ae6724cb46f318573f18be49b1e040428/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:eda8719d598f2f7f3e0f885cba8646644b55a187762bec091fa14a2b819746a9", size = 383090, upload-time = "2025-08-27T12:15:55.158Z" }, - { url = "https://files.pythonhosted.org/packages/1f/27/89070ca9b856e52960da1472efcb6c20ba27cfe902f4f23ed095b9cfc61d/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:3c64d07e95606ec402a0a1c511fe003873fa6af630bda59bac77fac8b4318ebc", size = 394519, upload-time = "2025-08-27T12:15:57.238Z" }, - { url = "https://files.pythonhosted.org/packages/b3/28/be120586874ef906aa5aeeae95ae8df4184bc757e5b6bd1c729ccff45ed5/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:93a2ed40de81bcff59aabebb626562d48332f3d028ca2036f1d23cbb52750be4", size = 523817, upload-time = "2025-08-27T12:15:59.237Z" }, - { url = "https://files.pythonhosted.org/packages/a8/ef/70cc197bc11cfcde02a86f36ac1eed15c56667c2ebddbdb76a47e90306da/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:387ce8c44ae94e0ec50532d9cb0edce17311024c9794eb196b90e1058aadeb66", size = 403240, upload-time = "2025-08-27T12:16:00.923Z" }, - { url = "https://files.pythonhosted.org/packages/cf/35/46936cca449f7f518f2f4996e0e8344db4b57e2081e752441154089d2a5f/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:aaf94f812c95b5e60ebaf8bfb1898a7d7cb9c1af5744d4a67fa47796e0465d4e", size = 385194, upload-time = "2025-08-27T12:16:02.802Z" }, - { url = "https://files.pythonhosted.org/packages/e1/62/29c0d3e5125c3270b51415af7cbff1ec587379c84f55a5761cc9efa8cd06/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_31_riscv64.whl", hash = "sha256:4848ca84d6ded9b58e474dfdbad4b8bfb450344c0551ddc8d958bf4b36aa837c", size = 402086, upload-time = "2025-08-27T12:16:04.806Z" }, - { url = "https://files.pythonhosted.org/packages/8f/66/03e1087679227785474466fdd04157fb793b3b76e3fcf01cbf4c693c1949/rpds_py-0.27.1-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:2bde09cbcf2248b73c7c323be49b280180ff39fadcfe04e7b6f54a678d02a7cf", size = 419272, upload-time = "2025-08-27T12:16:06.471Z" }, - { url = "https://files.pythonhosted.org/packages/6a/24/e3e72d265121e00b063aef3e3501e5b2473cf1b23511d56e529531acf01e/rpds_py-0.27.1-pp311-pypy311_pp73-musllinux_1_2_aarch64.whl", hash = "sha256:94c44ee01fd21c9058f124d2d4f0c9dc7634bec93cd4b38eefc385dabe71acbf", size = 560003, upload-time = "2025-08-27T12:16:08.06Z" }, - { url = "https://files.pythonhosted.org/packages/26/ca/f5a344c534214cc2d41118c0699fffbdc2c1bc7046f2a2b9609765ab9c92/rpds_py-0.27.1-pp311-pypy311_pp73-musllinux_1_2_i686.whl", hash = "sha256:df8b74962e35c9249425d90144e721eed198e6555a0e22a563d29fe4486b51f6", size = 590482, upload-time = "2025-08-27T12:16:10.137Z" }, - { url = "https://files.pythonhosted.org/packages/ce/08/4349bdd5c64d9d193c360aa9db89adeee6f6682ab8825dca0a3f535f434f/rpds_py-0.27.1-pp311-pypy311_pp73-musllinux_1_2_x86_64.whl", hash = "sha256:dc23e6820e3b40847e2f4a7726462ba0cf53089512abe9ee16318c366494c17a", size = 556523, upload-time = "2025-08-27T12:16:12.188Z" }, +version = "0.30.0" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/20/af/3f2f423103f1113b36230496629986e0ef7e199d2aa8392452b484b38ced/rpds_py-0.30.0.tar.gz", hash = "sha256:dd8ff7cf90014af0c0f787eea34794ebf6415242ee1d6fa91eaba725cc441e84", size = 69469, upload-time = "2025-11-30T20:24:38.837Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/06/0c/0c411a0ec64ccb6d104dcabe0e713e05e153a9a2c3c2bd2b32ce412166fe/rpds_py-0.30.0-cp310-cp310-macosx_10_12_x86_64.whl", hash = "sha256:679ae98e00c0e8d68a7fda324e16b90fd5260945b45d3b824c892cec9eea3288", size = 370490, upload-time = "2025-11-30T20:21:33.256Z" }, + { url = "https://files.pythonhosted.org/packages/19/6a/4ba3d0fb7297ebae71171822554abe48d7cab29c28b8f9f2c04b79988c05/rpds_py-0.30.0-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:4cc2206b76b4f576934f0ed374b10d7ca5f457858b157ca52064bdfc26b9fc00", size = 359751, upload-time = "2025-11-30T20:21:34.591Z" }, + { url = "https://files.pythonhosted.org/packages/cd/7c/e4933565ef7f7a0818985d87c15d9d273f1a649afa6a52ea35ad011195ea/rpds_py-0.30.0-cp310-cp310-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:389a2d49eded1896c3d48b0136ead37c48e221b391c052fba3f4055c367f60a6", size = 389696, upload-time = "2025-11-30T20:21:36.122Z" }, + { url = "https://files.pythonhosted.org/packages/5e/01/6271a2511ad0815f00f7ed4390cf2567bec1d4b1da39e2c27a41e6e3b4de/rpds_py-0.30.0-cp310-cp310-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:32c8528634e1bf7121f3de08fa85b138f4e0dc47657866630611b03967f041d7", size = 403136, upload-time = "2025-11-30T20:21:37.728Z" }, + { url = "https://files.pythonhosted.org/packages/55/64/c857eb7cd7541e9b4eee9d49c196e833128a55b89a9850a9c9ac33ccf897/rpds_py-0.30.0-cp310-cp310-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f207f69853edd6f6700b86efb84999651baf3789e78a466431df1331608e5324", size = 524699, upload-time = "2025-11-30T20:21:38.92Z" }, + { url = "https://files.pythonhosted.org/packages/9c/ed/94816543404078af9ab26159c44f9e98e20fe47e2126d5d32c9d9948d10a/rpds_py-0.30.0-cp310-cp310-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:67b02ec25ba7a9e8fa74c63b6ca44cf5707f2fbfadae3ee8e7494297d56aa9df", size = 412022, upload-time = "2025-11-30T20:21:40.407Z" }, + { url = "https://files.pythonhosted.org/packages/61/b5/707f6cf0066a6412aacc11d17920ea2e19e5b2f04081c64526eb35b5c6e7/rpds_py-0.30.0-cp310-cp310-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:0c0e95f6819a19965ff420f65578bacb0b00f251fefe2c8b23347c37174271f3", size = 390522, upload-time = "2025-11-30T20:21:42.17Z" }, + { url = "https://files.pythonhosted.org/packages/13/4e/57a85fda37a229ff4226f8cbcf09f2a455d1ed20e802ce5b2b4a7f5ed053/rpds_py-0.30.0-cp310-cp310-manylinux_2_31_riscv64.whl", hash = "sha256:a452763cc5198f2f98898eb98f7569649fe5da666c2dc6b5ddb10fde5a574221", size = 404579, upload-time = "2025-11-30T20:21:43.769Z" }, + { url = "https://files.pythonhosted.org/packages/f9/da/c9339293513ec680a721e0e16bf2bac3db6e5d7e922488de471308349bba/rpds_py-0.30.0-cp310-cp310-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:e0b65193a413ccc930671c55153a03ee57cecb49e6227204b04fae512eb657a7", size = 421305, upload-time = "2025-11-30T20:21:44.994Z" }, + { url = "https://files.pythonhosted.org/packages/f9/be/522cb84751114f4ad9d822ff5a1aa3c98006341895d5f084779b99596e5c/rpds_py-0.30.0-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:858738e9c32147f78b3ac24dc0edb6610000e56dc0f700fd5f651d0a0f0eb9ff", size = 572503, upload-time = "2025-11-30T20:21:46.91Z" }, + { url = "https://files.pythonhosted.org/packages/a2/9b/de879f7e7ceddc973ea6e4629e9b380213a6938a249e94b0cdbcc325bb66/rpds_py-0.30.0-cp310-cp310-musllinux_1_2_i686.whl", hash = "sha256:da279aa314f00acbb803da1e76fa18666778e8a8f83484fba94526da5de2cba7", size = 598322, upload-time = "2025-11-30T20:21:48.709Z" }, + { url = "https://files.pythonhosted.org/packages/48/ac/f01fc22efec3f37d8a914fc1b2fb9bcafd56a299edbe96406f3053edea5a/rpds_py-0.30.0-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:7c64d38fb49b6cdeda16ab49e35fe0da2e1e9b34bc38bd78386530f218b37139", size = 560792, upload-time = "2025-11-30T20:21:50.024Z" }, + { url = "https://files.pythonhosted.org/packages/e2/da/4e2b19d0f131f35b6146425f846563d0ce036763e38913d917187307a671/rpds_py-0.30.0-cp310-cp310-win32.whl", hash = "sha256:6de2a32a1665b93233cde140ff8b3467bdb9e2af2b91079f0333a0974d12d464", size = 221901, upload-time = "2025-11-30T20:21:51.32Z" }, + { url = "https://files.pythonhosted.org/packages/96/cb/156d7a5cf4f78a7cc571465d8aec7a3c447c94f6749c5123f08438bcf7bc/rpds_py-0.30.0-cp310-cp310-win_amd64.whl", hash = "sha256:1726859cd0de969f88dc8673bdd954185b9104e05806be64bcd87badbe313169", size = 235823, upload-time = "2025-11-30T20:21:52.505Z" }, + { url = "https://files.pythonhosted.org/packages/4d/6e/f964e88b3d2abee2a82c1ac8366da848fce1c6d834dc2132c3fda3970290/rpds_py-0.30.0-cp311-cp311-macosx_10_12_x86_64.whl", hash = "sha256:a2bffea6a4ca9f01b3f8e548302470306689684e61602aa3d141e34da06cf425", size = 370157, upload-time = "2025-11-30T20:21:53.789Z" }, + { url = "https://files.pythonhosted.org/packages/94/ba/24e5ebb7c1c82e74c4e4f33b2112a5573ddc703915b13a073737b59b86e0/rpds_py-0.30.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:dc4f992dfe1e2bc3ebc7444f6c7051b4bc13cd8e33e43511e8ffd13bf407010d", size = 359676, upload-time = "2025-11-30T20:21:55.475Z" }, + { url = "https://files.pythonhosted.org/packages/84/86/04dbba1b087227747d64d80c3b74df946b986c57af0a9f0c98726d4d7a3b/rpds_py-0.30.0-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:422c3cb9856d80b09d30d2eb255d0754b23e090034e1deb4083f8004bd0761e4", size = 389938, upload-time = "2025-11-30T20:21:57.079Z" }, + { url = "https://files.pythonhosted.org/packages/42/bb/1463f0b1722b7f45431bdd468301991d1328b16cffe0b1c2918eba2c4eee/rpds_py-0.30.0-cp311-cp311-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:07ae8a593e1c3c6b82ca3292efbe73c30b61332fd612e05abee07c79359f292f", size = 402932, upload-time = "2025-11-30T20:21:58.47Z" }, + { url = "https://files.pythonhosted.org/packages/99/ee/2520700a5c1f2d76631f948b0736cdf9b0acb25abd0ca8e889b5c62ac2e3/rpds_py-0.30.0-cp311-cp311-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:12f90dd7557b6bd57f40abe7747e81e0c0b119bef015ea7726e69fe550e394a4", size = 525830, upload-time = "2025-11-30T20:21:59.699Z" }, + { url = "https://files.pythonhosted.org/packages/e0/ad/bd0331f740f5705cc555a5e17fdf334671262160270962e69a2bdef3bf76/rpds_py-0.30.0-cp311-cp311-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:99b47d6ad9a6da00bec6aabe5a6279ecd3c06a329d4aa4771034a21e335c3a97", size = 412033, upload-time = "2025-11-30T20:22:00.991Z" }, + { url = "https://files.pythonhosted.org/packages/f8/1e/372195d326549bb51f0ba0f2ecb9874579906b97e08880e7a65c3bef1a99/rpds_py-0.30.0-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:33f559f3104504506a44bb666b93a33f5d33133765b0c216a5bf2f1e1503af89", size = 390828, upload-time = "2025-11-30T20:22:02.723Z" }, + { url = "https://files.pythonhosted.org/packages/ab/2b/d88bb33294e3e0c76bc8f351a3721212713629ffca1700fa94979cb3eae8/rpds_py-0.30.0-cp311-cp311-manylinux_2_31_riscv64.whl", hash = "sha256:946fe926af6e44f3697abbc305ea168c2c31d3e3ef1058cf68f379bf0335a78d", size = 404683, upload-time = "2025-11-30T20:22:04.367Z" }, + { url = "https://files.pythonhosted.org/packages/50/32/c759a8d42bcb5289c1fac697cd92f6fe01a018dd937e62ae77e0e7f15702/rpds_py-0.30.0-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:495aeca4b93d465efde585977365187149e75383ad2684f81519f504f5c13038", size = 421583, upload-time = "2025-11-30T20:22:05.814Z" }, + { url = "https://files.pythonhosted.org/packages/2b/81/e729761dbd55ddf5d84ec4ff1f47857f4374b0f19bdabfcf929164da3e24/rpds_py-0.30.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d9a0ca5da0386dee0655b4ccdf46119df60e0f10da268d04fe7cc87886872ba7", size = 572496, upload-time = "2025-11-30T20:22:07.713Z" }, + { url = "https://files.pythonhosted.org/packages/14/f6/69066a924c3557c9c30baa6ec3a0aa07526305684c6f86c696b08860726c/rpds_py-0.30.0-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:8d6d1cc13664ec13c1b84241204ff3b12f9bb82464b8ad6e7a5d3486975c2eed", size = 598669, upload-time = "2025-11-30T20:22:09.312Z" }, + { url = "https://files.pythonhosted.org/packages/5f/48/905896b1eb8a05630d20333d1d8ffd162394127b74ce0b0784ae04498d32/rpds_py-0.30.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3896fa1be39912cf0757753826bc8bdc8ca331a28a7c4ae46b7a21280b06bb85", size = 561011, upload-time = "2025-11-30T20:22:11.309Z" }, + { url = "https://files.pythonhosted.org/packages/22/16/cd3027c7e279d22e5eb431dd3c0fbc677bed58797fe7581e148f3f68818b/rpds_py-0.30.0-cp311-cp311-win32.whl", hash = "sha256:55f66022632205940f1827effeff17c4fa7ae1953d2b74a8581baaefb7d16f8c", size = 221406, upload-time = "2025-11-30T20:22:13.101Z" }, + { url = "https://files.pythonhosted.org/packages/fa/5b/e7b7aa136f28462b344e652ee010d4de26ee9fd16f1bfd5811f5153ccf89/rpds_py-0.30.0-cp311-cp311-win_amd64.whl", hash = "sha256:a51033ff701fca756439d641c0ad09a41d9242fa69121c7d8769604a0a629825", size = 236024, upload-time = "2025-11-30T20:22:14.853Z" }, + { url = "https://files.pythonhosted.org/packages/14/a6/364bba985e4c13658edb156640608f2c9e1d3ea3c81b27aa9d889fff0e31/rpds_py-0.30.0-cp311-cp311-win_arm64.whl", hash = "sha256:47b0ef6231c58f506ef0b74d44e330405caa8428e770fec25329ed2cb971a229", size = 229069, upload-time = "2025-11-30T20:22:16.577Z" }, + { url = "https://files.pythonhosted.org/packages/03/e7/98a2f4ac921d82f33e03f3835f5bf3a4a40aa1bfdc57975e74a97b2b4bdd/rpds_py-0.30.0-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:a161f20d9a43006833cd7068375a94d035714d73a172b681d8881820600abfad", size = 375086, upload-time = "2025-11-30T20:22:17.93Z" }, + { url = "https://files.pythonhosted.org/packages/4d/a1/bca7fd3d452b272e13335db8d6b0b3ecde0f90ad6f16f3328c6fb150c889/rpds_py-0.30.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:6abc8880d9d036ecaafe709079969f56e876fcf107f7a8e9920ba6d5a3878d05", size = 359053, upload-time = "2025-11-30T20:22:19.297Z" }, + { url = "https://files.pythonhosted.org/packages/65/1c/ae157e83a6357eceff62ba7e52113e3ec4834a84cfe07fa4b0757a7d105f/rpds_py-0.30.0-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ca28829ae5f5d569bb62a79512c842a03a12576375d5ece7d2cadf8abe96ec28", size = 390763, upload-time = "2025-11-30T20:22:21.661Z" }, + { url = "https://files.pythonhosted.org/packages/d4/36/eb2eb8515e2ad24c0bd43c3ee9cd74c33f7ca6430755ccdb240fd3144c44/rpds_py-0.30.0-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:a1010ed9524c73b94d15919ca4d41d8780980e1765babf85f9a2f90d247153dd", size = 408951, upload-time = "2025-11-30T20:22:23.408Z" }, + { url = "https://files.pythonhosted.org/packages/d6/65/ad8dc1784a331fabbd740ef6f71ce2198c7ed0890dab595adb9ea2d775a1/rpds_py-0.30.0-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:f8d1736cfb49381ba528cd5baa46f82fdc65c06e843dab24dd70b63d09121b3f", size = 514622, upload-time = "2025-11-30T20:22:25.16Z" }, + { url = "https://files.pythonhosted.org/packages/63/8e/0cfa7ae158e15e143fe03993b5bcd743a59f541f5952e1546b1ac1b5fd45/rpds_py-0.30.0-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:d948b135c4693daff7bc2dcfc4ec57237a29bd37e60c2fabf5aff2bbacf3e2f1", size = 414492, upload-time = "2025-11-30T20:22:26.505Z" }, + { url = "https://files.pythonhosted.org/packages/60/1b/6f8f29f3f995c7ffdde46a626ddccd7c63aefc0efae881dc13b6e5d5bb16/rpds_py-0.30.0-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:47f236970bccb2233267d89173d3ad2703cd36a0e2a6e92d0560d333871a3d23", size = 394080, upload-time = "2025-11-30T20:22:27.934Z" }, + { url = "https://files.pythonhosted.org/packages/6d/d5/a266341051a7a3ca2f4b750a3aa4abc986378431fc2da508c5034d081b70/rpds_py-0.30.0-cp312-cp312-manylinux_2_31_riscv64.whl", hash = "sha256:2e6ecb5a5bcacf59c3f912155044479af1d0b6681280048b338b28e364aca1f6", size = 408680, upload-time = "2025-11-30T20:22:29.341Z" }, + { url = "https://files.pythonhosted.org/packages/10/3b/71b725851df9ab7a7a4e33cf36d241933da66040d195a84781f49c50490c/rpds_py-0.30.0-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:a8fa71a2e078c527c3e9dc9fc5a98c9db40bcc8a92b4e8858e36d329f8684b51", size = 423589, upload-time = "2025-11-30T20:22:31.469Z" }, + { url = "https://files.pythonhosted.org/packages/00/2b/e59e58c544dc9bd8bd8384ecdb8ea91f6727f0e37a7131baeff8d6f51661/rpds_py-0.30.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:73c67f2db7bc334e518d097c6d1e6fed021bbc9b7d678d6cc433478365d1d5f5", size = 573289, upload-time = "2025-11-30T20:22:32.997Z" }, + { url = "https://files.pythonhosted.org/packages/da/3e/a18e6f5b460893172a7d6a680e86d3b6bc87a54c1f0b03446a3c8c7b588f/rpds_py-0.30.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:5ba103fb455be00f3b1c2076c9d4264bfcb037c976167a6047ed82f23153f02e", size = 599737, upload-time = "2025-11-30T20:22:34.419Z" }, + { url = "https://files.pythonhosted.org/packages/5c/e2/714694e4b87b85a18e2c243614974413c60aa107fd815b8cbc42b873d1d7/rpds_py-0.30.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:7cee9c752c0364588353e627da8a7e808a66873672bcb5f52890c33fd965b394", size = 563120, upload-time = "2025-11-30T20:22:35.903Z" }, + { url = "https://files.pythonhosted.org/packages/6f/ab/d5d5e3bcedb0a77f4f613706b750e50a5a3ba1c15ccd3665ecc636c968fd/rpds_py-0.30.0-cp312-cp312-win32.whl", hash = "sha256:1ab5b83dbcf55acc8b08fc62b796ef672c457b17dbd7820a11d6c52c06839bdf", size = 223782, upload-time = "2025-11-30T20:22:37.271Z" }, + { url = "https://files.pythonhosted.org/packages/39/3b/f786af9957306fdc38a74cef405b7b93180f481fb48453a114bb6465744a/rpds_py-0.30.0-cp312-cp312-win_amd64.whl", hash = "sha256:a090322ca841abd453d43456ac34db46e8b05fd9b3b4ac0c78bcde8b089f959b", size = 240463, upload-time = "2025-11-30T20:22:39.021Z" }, + { url = "https://files.pythonhosted.org/packages/f3/d2/b91dc748126c1559042cfe41990deb92c4ee3e2b415f6b5234969ffaf0cc/rpds_py-0.30.0-cp312-cp312-win_arm64.whl", hash = "sha256:669b1805bd639dd2989b281be2cfd951c6121b65e729d9b843e9639ef1fd555e", size = 230868, upload-time = "2025-11-30T20:22:40.493Z" }, + { url = "https://files.pythonhosted.org/packages/ed/dc/d61221eb88ff410de3c49143407f6f3147acf2538c86f2ab7ce65ae7d5f9/rpds_py-0.30.0-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:f83424d738204d9770830d35290ff3273fbb02b41f919870479fab14b9d303b2", size = 374887, upload-time = "2025-11-30T20:22:41.812Z" }, + { url = "https://files.pythonhosted.org/packages/fd/32/55fb50ae104061dbc564ef15cc43c013dc4a9f4527a1f4d99baddf56fe5f/rpds_py-0.30.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:e7536cd91353c5273434b4e003cbda89034d67e7710eab8761fd918ec6c69cf8", size = 358904, upload-time = "2025-11-30T20:22:43.479Z" }, + { url = "https://files.pythonhosted.org/packages/58/70/faed8186300e3b9bdd138d0273109784eea2396c68458ed580f885dfe7ad/rpds_py-0.30.0-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:2771c6c15973347f50fece41fc447c054b7ac2ae0502388ce3b6738cd366e3d4", size = 389945, upload-time = "2025-11-30T20:22:44.819Z" }, + { url = "https://files.pythonhosted.org/packages/bd/a8/073cac3ed2c6387df38f71296d002ab43496a96b92c823e76f46b8af0543/rpds_py-0.30.0-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:0a59119fc6e3f460315fe9d08149f8102aa322299deaa5cab5b40092345c2136", size = 407783, upload-time = "2025-11-30T20:22:46.103Z" }, + { url = "https://files.pythonhosted.org/packages/77/57/5999eb8c58671f1c11eba084115e77a8899d6e694d2a18f69f0ba471ec8b/rpds_py-0.30.0-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:76fec018282b4ead0364022e3c54b60bf368b9d926877957a8624b58419169b7", size = 515021, upload-time = "2025-11-30T20:22:47.458Z" }, + { url = "https://files.pythonhosted.org/packages/e0/af/5ab4833eadc36c0a8ed2bc5c0de0493c04f6c06de223170bd0798ff98ced/rpds_py-0.30.0-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:692bef75a5525db97318e8cd061542b5a79812d711ea03dbc1f6f8dbb0c5f0d2", size = 414589, upload-time = "2025-11-30T20:22:48.872Z" }, + { url = "https://files.pythonhosted.org/packages/b7/de/f7192e12b21b9e9a68a6d0f249b4af3fdcdff8418be0767a627564afa1f1/rpds_py-0.30.0-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9027da1ce107104c50c81383cae773ef5c24d296dd11c99e2629dbd7967a20c6", size = 394025, upload-time = "2025-11-30T20:22:50.196Z" }, + { url = "https://files.pythonhosted.org/packages/91/c4/fc70cd0249496493500e7cc2de87504f5aa6509de1e88623431fec76d4b6/rpds_py-0.30.0-cp313-cp313-manylinux_2_31_riscv64.whl", hash = "sha256:9cf69cdda1f5968a30a359aba2f7f9aa648a9ce4b580d6826437f2b291cfc86e", size = 408895, upload-time = "2025-11-30T20:22:51.87Z" }, + { url = "https://files.pythonhosted.org/packages/58/95/d9275b05ab96556fefff73a385813eb66032e4c99f411d0795372d9abcea/rpds_py-0.30.0-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:a4796a717bf12b9da9d3ad002519a86063dcac8988b030e405704ef7d74d2d9d", size = 422799, upload-time = "2025-11-30T20:22:53.341Z" }, + { url = "https://files.pythonhosted.org/packages/06/c1/3088fc04b6624eb12a57eb814f0d4997a44b0d208d6cace713033ff1a6ba/rpds_py-0.30.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:5d4c2aa7c50ad4728a094ebd5eb46c452e9cb7edbfdb18f9e1221f597a73e1e7", size = 572731, upload-time = "2025-11-30T20:22:54.778Z" }, + { url = "https://files.pythonhosted.org/packages/d8/42/c612a833183b39774e8ac8fecae81263a68b9583ee343db33ab571a7ce55/rpds_py-0.30.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:ba81a9203d07805435eb06f536d95a266c21e5b2dfbf6517748ca40c98d19e31", size = 599027, upload-time = "2025-11-30T20:22:56.212Z" }, + { url = "https://files.pythonhosted.org/packages/5f/60/525a50f45b01d70005403ae0e25f43c0384369ad24ffe46e8d9068b50086/rpds_py-0.30.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:945dccface01af02675628334f7cf49c2af4c1c904748efc5cf7bbdf0b579f95", size = 563020, upload-time = "2025-11-30T20:22:58.2Z" }, + { url = "https://files.pythonhosted.org/packages/0b/5d/47c4655e9bcd5ca907148535c10e7d489044243cc9941c16ed7cd53be91d/rpds_py-0.30.0-cp313-cp313-win32.whl", hash = "sha256:b40fb160a2db369a194cb27943582b38f79fc4887291417685f3ad693c5a1d5d", size = 223139, upload-time = "2025-11-30T20:23:00.209Z" }, + { url = "https://files.pythonhosted.org/packages/f2/e1/485132437d20aa4d3e1d8b3fb5a5e65aa8139f1e097080c2a8443201742c/rpds_py-0.30.0-cp313-cp313-win_amd64.whl", hash = "sha256:806f36b1b605e2d6a72716f321f20036b9489d29c51c91f4dd29a3e3afb73b15", size = 240224, upload-time = "2025-11-30T20:23:02.008Z" }, + { url = "https://files.pythonhosted.org/packages/24/95/ffd128ed1146a153d928617b0ef673960130be0009c77d8fbf0abe306713/rpds_py-0.30.0-cp313-cp313-win_arm64.whl", hash = "sha256:d96c2086587c7c30d44f31f42eae4eac89b60dabbac18c7669be3700f13c3ce1", size = 230645, upload-time = "2025-11-30T20:23:03.43Z" }, + { url = "https://files.pythonhosted.org/packages/ff/1b/b10de890a0def2a319a2626334a7f0ae388215eb60914dbac8a3bae54435/rpds_py-0.30.0-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:eb0b93f2e5c2189ee831ee43f156ed34e2a89a78a66b98cadad955972548be5a", size = 364443, upload-time = "2025-11-30T20:23:04.878Z" }, + { url = "https://files.pythonhosted.org/packages/0d/bf/27e39f5971dc4f305a4fb9c672ca06f290f7c4e261c568f3dea16a410d47/rpds_py-0.30.0-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:922e10f31f303c7c920da8981051ff6d8c1a56207dbdf330d9047f6d30b70e5e", size = 353375, upload-time = "2025-11-30T20:23:06.342Z" }, + { url = "https://files.pythonhosted.org/packages/40/58/442ada3bba6e8e6615fc00483135c14a7538d2ffac30e2d933ccf6852232/rpds_py-0.30.0-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:cdc62c8286ba9bf7f47befdcea13ea0e26bf294bda99758fd90535cbaf408000", size = 383850, upload-time = "2025-11-30T20:23:07.825Z" }, + { url = "https://files.pythonhosted.org/packages/14/14/f59b0127409a33c6ef6f5c1ebd5ad8e32d7861c9c7adfa9a624fc3889f6c/rpds_py-0.30.0-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:47f9a91efc418b54fb8190a6b4aa7813a23fb79c51f4bb84e418f5476c38b8db", size = 392812, upload-time = "2025-11-30T20:23:09.228Z" }, + { url = "https://files.pythonhosted.org/packages/b3/66/e0be3e162ac299b3a22527e8913767d869e6cc75c46bd844aa43fb81ab62/rpds_py-0.30.0-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:1f3587eb9b17f3789ad50824084fa6f81921bbf9a795826570bda82cb3ed91f2", size = 517841, upload-time = "2025-11-30T20:23:11.186Z" }, + { url = "https://files.pythonhosted.org/packages/3d/55/fa3b9cf31d0c963ecf1ba777f7cf4b2a2c976795ac430d24a1f43d25a6ba/rpds_py-0.30.0-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:39c02563fc592411c2c61d26b6c5fe1e51eaa44a75aa2c8735ca88b0d9599daa", size = 408149, upload-time = "2025-11-30T20:23:12.864Z" }, + { url = "https://files.pythonhosted.org/packages/60/ca/780cf3b1a32b18c0f05c441958d3758f02544f1d613abf9488cd78876378/rpds_py-0.30.0-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:51a1234d8febafdfd33a42d97da7a43f5dcb120c1060e352a3fbc0c6d36e2083", size = 383843, upload-time = "2025-11-30T20:23:14.638Z" }, + { url = "https://files.pythonhosted.org/packages/82/86/d5f2e04f2aa6247c613da0c1dd87fcd08fa17107e858193566048a1e2f0a/rpds_py-0.30.0-cp313-cp313t-manylinux_2_31_riscv64.whl", hash = "sha256:eb2c4071ab598733724c08221091e8d80e89064cd472819285a9ab0f24bcedb9", size = 396507, upload-time = "2025-11-30T20:23:16.105Z" }, + { url = "https://files.pythonhosted.org/packages/4b/9a/453255d2f769fe44e07ea9785c8347edaf867f7026872e76c1ad9f7bed92/rpds_py-0.30.0-cp313-cp313t-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:6bdfdb946967d816e6adf9a3d8201bfad269c67efe6cefd7093ef959683c8de0", size = 414949, upload-time = "2025-11-30T20:23:17.539Z" }, + { url = "https://files.pythonhosted.org/packages/a3/31/622a86cdc0c45d6df0e9ccb6becdba5074735e7033c20e401a6d9d0e2ca0/rpds_py-0.30.0-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:c77afbd5f5250bf27bf516c7c4a016813eb2d3e116139aed0096940c5982da94", size = 565790, upload-time = "2025-11-30T20:23:19.029Z" }, + { url = "https://files.pythonhosted.org/packages/1c/5d/15bbf0fb4a3f58a3b1c67855ec1efcc4ceaef4e86644665fff03e1b66d8d/rpds_py-0.30.0-cp313-cp313t-musllinux_1_2_i686.whl", hash = "sha256:61046904275472a76c8c90c9ccee9013d70a6d0f73eecefd38c1ae7c39045a08", size = 590217, upload-time = "2025-11-30T20:23:20.885Z" }, + { url = "https://files.pythonhosted.org/packages/6d/61/21b8c41f68e60c8cc3b2e25644f0e3681926020f11d06ab0b78e3c6bbff1/rpds_py-0.30.0-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:4c5f36a861bc4b7da6516dbdf302c55313afa09b81931e8280361a4f6c9a2d27", size = 555806, upload-time = "2025-11-30T20:23:22.488Z" }, + { url = "https://files.pythonhosted.org/packages/f9/39/7e067bb06c31de48de3eb200f9fc7c58982a4d3db44b07e73963e10d3be9/rpds_py-0.30.0-cp313-cp313t-win32.whl", hash = "sha256:3d4a69de7a3e50ffc214ae16d79d8fbb0922972da0356dcf4d0fdca2878559c6", size = 211341, upload-time = "2025-11-30T20:23:24.449Z" }, + { url = "https://files.pythonhosted.org/packages/0a/4d/222ef0b46443cf4cf46764d9c630f3fe4abaa7245be9417e56e9f52b8f65/rpds_py-0.30.0-cp313-cp313t-win_amd64.whl", hash = "sha256:f14fc5df50a716f7ece6a80b6c78bb35ea2ca47c499e422aa4463455dd96d56d", size = 225768, upload-time = "2025-11-30T20:23:25.908Z" }, + { url = "https://files.pythonhosted.org/packages/69/71/3f34339ee70521864411f8b6992e7ab13ac30d8e4e3309e07c7361767d91/rpds_py-0.30.0-pp311-pypy311_pp73-macosx_10_12_x86_64.whl", hash = "sha256:c2262bdba0ad4fc6fb5545660673925c2d2a5d9e2e0fb603aad545427be0fc58", size = 372292, upload-time = "2025-11-30T20:24:16.537Z" }, + { url = "https://files.pythonhosted.org/packages/57/09/f183df9b8f2d66720d2ef71075c59f7e1b336bec7ee4c48f0a2b06857653/rpds_py-0.30.0-pp311-pypy311_pp73-macosx_11_0_arm64.whl", hash = "sha256:ee6af14263f25eedc3bb918a3c04245106a42dfd4f5c2285ea6f997b1fc3f89a", size = 362128, upload-time = "2025-11-30T20:24:18.086Z" }, + { url = "https://files.pythonhosted.org/packages/7a/68/5c2594e937253457342e078f0cc1ded3dd7b2ad59afdbf2d354869110a02/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:3adbb8179ce342d235c31ab8ec511e66c73faa27a47e076ccc92421add53e2bb", size = 391542, upload-time = "2025-11-30T20:24:20.092Z" }, + { url = "https://files.pythonhosted.org/packages/49/5c/31ef1afd70b4b4fbdb2800249f34c57c64beb687495b10aec0365f53dfc4/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:250fa00e9543ac9b97ac258bd37367ff5256666122c2d0f2bc97577c60a1818c", size = 404004, upload-time = "2025-11-30T20:24:22.231Z" }, + { url = "https://files.pythonhosted.org/packages/e3/63/0cfbea38d05756f3440ce6534d51a491d26176ac045e2707adc99bb6e60a/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:9854cf4f488b3d57b9aaeb105f06d78e5529d3145b1e4a41750167e8c213c6d3", size = 527063, upload-time = "2025-11-30T20:24:24.302Z" }, + { url = "https://files.pythonhosted.org/packages/42/e6/01e1f72a2456678b0f618fc9a1a13f882061690893c192fcad9f2926553a/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:993914b8e560023bc0a8bf742c5f303551992dcb85e247b1e5c7f4a7d145bda5", size = 413099, upload-time = "2025-11-30T20:24:25.916Z" }, + { url = "https://files.pythonhosted.org/packages/b8/25/8df56677f209003dcbb180765520c544525e3ef21ea72279c98b9aa7c7fb/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:58edca431fb9b29950807e301826586e5bbf24163677732429770a697ffe6738", size = 392177, upload-time = "2025-11-30T20:24:27.834Z" }, + { url = "https://files.pythonhosted.org/packages/4a/b4/0a771378c5f16f8115f796d1f437950158679bcd2a7c68cf251cfb00ed5b/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_31_riscv64.whl", hash = "sha256:dea5b552272a944763b34394d04577cf0f9bd013207bc32323b5a89a53cf9c2f", size = 406015, upload-time = "2025-11-30T20:24:29.457Z" }, + { url = "https://files.pythonhosted.org/packages/36/d8/456dbba0af75049dc6f63ff295a2f92766b9d521fa00de67a2bd6427d57a/rpds_py-0.30.0-pp311-pypy311_pp73-manylinux_2_5_i686.manylinux1_i686.whl", hash = "sha256:ba3af48635eb83d03f6c9735dfb21785303e73d22ad03d489e88adae6eab8877", size = 423736, upload-time = "2025-11-30T20:24:31.22Z" }, + { url = "https://files.pythonhosted.org/packages/13/64/b4d76f227d5c45a7e0b796c674fd81b0a6c4fbd48dc29271857d8219571c/rpds_py-0.30.0-pp311-pypy311_pp73-musllinux_1_2_aarch64.whl", hash = "sha256:dff13836529b921e22f15cb099751209a60009731a68519630a24d61f0b1b30a", size = 573981, upload-time = "2025-11-30T20:24:32.934Z" }, + { url = "https://files.pythonhosted.org/packages/20/91/092bacadeda3edf92bf743cc96a7be133e13a39cdbfd7b5082e7ab638406/rpds_py-0.30.0-pp311-pypy311_pp73-musllinux_1_2_i686.whl", hash = "sha256:1b151685b23929ab7beec71080a8889d4d6d9fa9a983d213f07121205d48e2c4", size = 599782, upload-time = "2025-11-30T20:24:35.169Z" }, + { url = "https://files.pythonhosted.org/packages/d1/b7/b95708304cd49b7b6f82fdd039f1748b66ec2b21d6a45180910802f1abf1/rpds_py-0.30.0-pp311-pypy311_pp73-musllinux_1_2_x86_64.whl", hash = "sha256:ac37f9f516c51e5753f27dfdef11a88330f04de2d564be3991384b2f3535d02e", size = 562191, upload-time = "2025-11-30T20:24:36.853Z" }, ] [[package]] name = "ruff" -version = "0.13.1" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/ab/33/c8e89216845615d14d2d42ba2bee404e7206a8db782f33400754f3799f05/ruff-0.13.1.tar.gz", hash = "sha256:88074c3849087f153d4bb22e92243ad4c1b366d7055f98726bc19aa08dc12d51", size = 5397987, upload-time = "2025-09-18T19:52:44.33Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/f3/41/ca37e340938f45cfb8557a97a5c347e718ef34702546b174e5300dbb1f28/ruff-0.13.1-py3-none-linux_armv6l.whl", hash = "sha256:b2abff595cc3cbfa55e509d89439b5a09a6ee3c252d92020bd2de240836cf45b", size = 12304308, upload-time = "2025-09-18T19:51:56.253Z" }, - { url = "https://files.pythonhosted.org/packages/ff/84/ba378ef4129415066c3e1c80d84e539a0d52feb250685091f874804f28af/ruff-0.13.1-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:4ee9f4249bf7f8bb3984c41bfaf6a658162cdb1b22e3103eabc7dd1dc5579334", size = 12937258, upload-time = "2025-09-18T19:52:00.184Z" }, - { url = "https://files.pythonhosted.org/packages/8d/b6/ec5e4559ae0ad955515c176910d6d7c93edcbc0ed1a3195a41179c58431d/ruff-0.13.1-py3-none-macosx_11_0_arm64.whl", hash = "sha256:5c5da4af5f6418c07d75e6f3224e08147441f5d1eac2e6ce10dcce5e616a3bae", size = 12214554, upload-time = "2025-09-18T19:52:02.753Z" }, - { url = "https://files.pythonhosted.org/packages/70/d6/cb3e3b4f03b9b0c4d4d8f06126d34b3394f6b4d764912fe80a1300696ef6/ruff-0.13.1-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:80524f84a01355a59a93cef98d804e2137639823bcee2931f5028e71134a954e", size = 12448181, upload-time = "2025-09-18T19:52:05.279Z" }, - { url = "https://files.pythonhosted.org/packages/d2/ea/bf60cb46d7ade706a246cd3fb99e4cfe854efa3dfbe530d049c684da24ff/ruff-0.13.1-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:ff7f5ce8d7988767dd46a148192a14d0f48d1baea733f055d9064875c7d50389", size = 12104599, upload-time = "2025-09-18T19:52:07.497Z" }, - { url = "https://files.pythonhosted.org/packages/2d/3e/05f72f4c3d3a69e65d55a13e1dd1ade76c106d8546e7e54501d31f1dc54a/ruff-0.13.1-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c55d84715061f8b05469cdc9a446aa6c7294cd4bd55e86a89e572dba14374f8c", size = 13791178, upload-time = "2025-09-18T19:52:10.189Z" }, - { url = "https://files.pythonhosted.org/packages/81/e7/01b1fc403dd45d6cfe600725270ecc6a8f8a48a55bc6521ad820ed3ceaf8/ruff-0.13.1-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:ac57fed932d90fa1624c946dc67a0a3388d65a7edc7d2d8e4ca7bddaa789b3b0", size = 14814474, upload-time = "2025-09-18T19:52:12.866Z" }, - { url = "https://files.pythonhosted.org/packages/fa/92/d9e183d4ed6185a8df2ce9faa3f22e80e95b5f88d9cc3d86a6d94331da3f/ruff-0.13.1-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:c366a71d5b4f41f86a008694f7a0d75fe409ec298685ff72dc882f882d532e36", size = 14217531, upload-time = "2025-09-18T19:52:15.245Z" }, - { url = "https://files.pythonhosted.org/packages/3b/4a/6ddb1b11d60888be224d721e01bdd2d81faaf1720592858ab8bac3600466/ruff-0.13.1-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f4ea9d1b5ad3e7a83ee8ebb1229c33e5fe771e833d6d3dcfca7b77d95b060d38", size = 13265267, upload-time = "2025-09-18T19:52:17.649Z" }, - { url = "https://files.pythonhosted.org/packages/81/98/3f1d18a8d9ea33ef2ad508f0417fcb182c99b23258ec5e53d15db8289809/ruff-0.13.1-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:b0f70202996055b555d3d74b626406476cc692f37b13bac8828acff058c9966a", size = 13243120, upload-time = "2025-09-18T19:52:20.332Z" }, - { url = "https://files.pythonhosted.org/packages/8d/86/b6ce62ce9c12765fa6c65078d1938d2490b2b1d9273d0de384952b43c490/ruff-0.13.1-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:f8cff7a105dad631085d9505b491db33848007d6b487c3c1979dd8d9b2963783", size = 13443084, upload-time = "2025-09-18T19:52:23.032Z" }, - { url = "https://files.pythonhosted.org/packages/a1/6e/af7943466a41338d04503fb5a81b2fd07251bd272f546622e5b1599a7976/ruff-0.13.1-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:9761e84255443316a258dd7dfbd9bfb59c756e52237ed42494917b2577697c6a", size = 12295105, upload-time = "2025-09-18T19:52:25.263Z" }, - { url = "https://files.pythonhosted.org/packages/3f/97/0249b9a24f0f3ebd12f007e81c87cec6d311de566885e9309fcbac5b24cc/ruff-0.13.1-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:3d376a88c3102ef228b102211ef4a6d13df330cb0f5ca56fdac04ccec2a99700", size = 12072284, upload-time = "2025-09-18T19:52:27.478Z" }, - { url = "https://files.pythonhosted.org/packages/f6/85/0b64693b2c99d62ae65236ef74508ba39c3febd01466ef7f354885e5050c/ruff-0.13.1-py3-none-musllinux_1_2_i686.whl", hash = "sha256:cbefd60082b517a82c6ec8836989775ac05f8991715d228b3c1d86ccc7df7dae", size = 12970314, upload-time = "2025-09-18T19:52:30.212Z" }, - { url = "https://files.pythonhosted.org/packages/96/fc/342e9f28179915d28b3747b7654f932ca472afbf7090fc0c4011e802f494/ruff-0.13.1-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:dd16b9a5a499fe73f3c2ef09a7885cb1d97058614d601809d37c422ed1525317", size = 13422360, upload-time = "2025-09-18T19:52:32.676Z" }, - { url = "https://files.pythonhosted.org/packages/37/54/6177a0dc10bce6f43e392a2192e6018755473283d0cf43cc7e6afc182aea/ruff-0.13.1-py3-none-win32.whl", hash = "sha256:55e9efa692d7cb18580279f1fbb525146adc401f40735edf0aaeabd93099f9a0", size = 12178448, upload-time = "2025-09-18T19:52:35.545Z" }, - { url = "https://files.pythonhosted.org/packages/64/51/c6a3a33d9938007b8bdc8ca852ecc8d810a407fb513ab08e34af12dc7c24/ruff-0.13.1-py3-none-win_amd64.whl", hash = "sha256:3a3fb595287ee556de947183489f636b9f76a72f0fa9c028bdcabf5bab2cc5e5", size = 13286458, upload-time = "2025-09-18T19:52:38.198Z" }, - { url = "https://files.pythonhosted.org/packages/fd/04/afc078a12cf68592345b1e2d6ecdff837d286bac023d7a22c54c7a698c5b/ruff-0.13.1-py3-none-win_arm64.whl", hash = "sha256:c0bae9ffd92d54e03c2bf266f466da0a65e145f298ee5b5846ed435f6a00518a", size = 12437893, upload-time = "2025-09-18T19:52:41.283Z" }, +version = "0.14.10" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/57/08/52232a877978dd8f9cf2aeddce3e611b40a63287dfca29b6b8da791f5e8d/ruff-0.14.10.tar.gz", hash = "sha256:9a2e830f075d1a42cd28420d7809ace390832a490ed0966fe373ba288e77aaf4", size = 5859763, upload-time = "2025-12-18T19:28:57.98Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/60/01/933704d69f3f05ee16ef11406b78881733c186fe14b6a46b05cfcaf6d3b2/ruff-0.14.10-py3-none-linux_armv6l.whl", hash = "sha256:7a3ce585f2ade3e1f29ec1b92df13e3da262178df8c8bdf876f48fa0e8316c49", size = 13527080, upload-time = "2025-12-18T19:29:25.642Z" }, + { url = "https://files.pythonhosted.org/packages/df/58/a0349197a7dfa603ffb7f5b0470391efa79ddc327c1e29c4851e85b09cc5/ruff-0.14.10-py3-none-macosx_10_12_x86_64.whl", hash = "sha256:674f9be9372907f7257c51f1d4fc902cb7cf014b9980152b802794317941f08f", size = 13797320, upload-time = "2025-12-18T19:29:02.571Z" }, + { url = "https://files.pythonhosted.org/packages/7b/82/36be59f00a6082e38c23536df4e71cdbc6af8d7c707eade97fcad5c98235/ruff-0.14.10-py3-none-macosx_11_0_arm64.whl", hash = "sha256:d85713d522348837ef9df8efca33ccb8bd6fcfc86a2cde3ccb4bc9d28a18003d", size = 12918434, upload-time = "2025-12-18T19:28:51.202Z" }, + { url = "https://files.pythonhosted.org/packages/a6/00/45c62a7f7e34da92a25804f813ebe05c88aa9e0c25e5cb5a7d23dd7450e3/ruff-0.14.10-py3-none-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:6987ebe0501ae4f4308d7d24e2d0fe3d7a98430f5adfd0f1fead050a740a3a77", size = 13371961, upload-time = "2025-12-18T19:29:04.991Z" }, + { url = "https://files.pythonhosted.org/packages/40/31/a5906d60f0405f7e57045a70f2d57084a93ca7425f22e1d66904769d1628/ruff-0.14.10-py3-none-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:16a01dfb7b9e4eee556fbfd5392806b1b8550c9b4a9f6acd3dbe6812b193c70a", size = 13275629, upload-time = "2025-12-18T19:29:21.381Z" }, + { url = "https://files.pythonhosted.org/packages/3e/60/61c0087df21894cf9d928dc04bcd4fb10e8b2e8dca7b1a276ba2155b2002/ruff-0.14.10-py3-none-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:7165d31a925b7a294465fa81be8c12a0e9b60fb02bf177e79067c867e71f8b1f", size = 14029234, upload-time = "2025-12-18T19:29:00.132Z" }, + { url = "https://files.pythonhosted.org/packages/44/84/77d911bee3b92348b6e5dab5a0c898d87084ea03ac5dc708f46d88407def/ruff-0.14.10-py3-none-manylinux_2_17_ppc64.manylinux2014_ppc64.whl", hash = "sha256:c561695675b972effb0c0a45db233f2c816ff3da8dcfbe7dfc7eed625f218935", size = 15449890, upload-time = "2025-12-18T19:28:53.573Z" }, + { url = "https://files.pythonhosted.org/packages/e9/36/480206eaefa24a7ec321582dda580443a8f0671fdbf6b1c80e9c3e93a16a/ruff-0.14.10-py3-none-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:4bb98fcbbc61725968893682fd4df8966a34611239c9fd07a1f6a07e7103d08e", size = 15123172, upload-time = "2025-12-18T19:29:23.453Z" }, + { url = "https://files.pythonhosted.org/packages/5c/38/68e414156015ba80cef5473d57919d27dfb62ec804b96180bafdeaf0e090/ruff-0.14.10-py3-none-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:f24b47993a9d8cb858429e97bdf8544c78029f09b520af615c1d261bf827001d", size = 14460260, upload-time = "2025-12-18T19:29:27.808Z" }, + { url = "https://files.pythonhosted.org/packages/b3/19/9e050c0dca8aba824d67cc0db69fb459c28d8cd3f6855b1405b3f29cc91d/ruff-0.14.10-py3-none-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:59aabd2e2c4fd614d2862e7939c34a532c04f1084476d6833dddef4afab87e9f", size = 14229978, upload-time = "2025-12-18T19:29:11.32Z" }, + { url = "https://files.pythonhosted.org/packages/51/eb/e8dd1dd6e05b9e695aa9dd420f4577debdd0f87a5ff2fedda33c09e9be8c/ruff-0.14.10-py3-none-manylinux_2_31_riscv64.whl", hash = "sha256:213db2b2e44be8625002dbea33bb9c60c66ea2c07c084a00d55732689d697a7f", size = 14338036, upload-time = "2025-12-18T19:29:09.184Z" }, + { url = "https://files.pythonhosted.org/packages/6a/12/f3e3a505db7c19303b70af370d137795fcfec136d670d5de5391e295c134/ruff-0.14.10-py3-none-musllinux_1_2_aarch64.whl", hash = "sha256:b914c40ab64865a17a9a5b67911d14df72346a634527240039eb3bd650e5979d", size = 13264051, upload-time = "2025-12-18T19:29:13.431Z" }, + { url = "https://files.pythonhosted.org/packages/08/64/8c3a47eaccfef8ac20e0484e68e0772013eb85802f8a9f7603ca751eb166/ruff-0.14.10-py3-none-musllinux_1_2_armv7l.whl", hash = "sha256:1484983559f026788e3a5c07c81ef7d1e97c1c78ed03041a18f75df104c45405", size = 13283998, upload-time = "2025-12-18T19:29:06.994Z" }, + { url = "https://files.pythonhosted.org/packages/12/84/534a5506f4074e5cc0529e5cd96cfc01bb480e460c7edf5af70d2bcae55e/ruff-0.14.10-py3-none-musllinux_1_2_i686.whl", hash = "sha256:c70427132db492d25f982fffc8d6c7535cc2fd2c83fc8888f05caaa248521e60", size = 13601891, upload-time = "2025-12-18T19:28:55.811Z" }, + { url = "https://files.pythonhosted.org/packages/0d/1e/14c916087d8598917dbad9b2921d340f7884824ad6e9c55de948a93b106d/ruff-0.14.10-py3-none-musllinux_1_2_x86_64.whl", hash = "sha256:5bcf45b681e9f1ee6445d317ce1fa9d6cba9a6049542d1c3d5b5958986be8830", size = 14336660, upload-time = "2025-12-18T19:29:16.531Z" }, + { url = "https://files.pythonhosted.org/packages/f2/1c/d7b67ab43f30013b47c12b42d1acd354c195351a3f7a1d67f59e54227ede/ruff-0.14.10-py3-none-win32.whl", hash = "sha256:104c49fc7ab73f3f3a758039adea978869a918f31b73280db175b43a2d9b51d6", size = 13196187, upload-time = "2025-12-18T19:29:19.006Z" }, + { url = "https://files.pythonhosted.org/packages/fb/9c/896c862e13886fae2af961bef3e6312db9ebc6adc2b156fe95e615dee8c1/ruff-0.14.10-py3-none-win_amd64.whl", hash = "sha256:466297bd73638c6bdf06485683e812db1c00c7ac96d4ddd0294a338c62fdc154", size = 14661283, upload-time = "2025-12-18T19:29:30.16Z" }, + { url = "https://files.pythonhosted.org/packages/74/31/b0e29d572670dca3674eeee78e418f20bdf97fa8aa9ea71380885e175ca0/ruff-0.14.10-py3-none-win_arm64.whl", hash = "sha256:e51d046cf6dda98a4633b8a8a771451107413b0f07183b2bef03f075599e44e6", size = 13729839, upload-time = "2025-12-18T19:28:48.636Z" }, ] [[package]] @@ -3003,12 +2911,13 @@ dependencies = [ { name = "mordredcommunity" }, { name = "numba" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "pandas" }, { name = "rdkit" }, - { name = "scikit-learn" }, + { name = "scikit-learn", version = "1.7.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "scikit-learn", version = "1.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "scipy", version = "1.15.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "scipy", version = "1.16.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "scipy", version = "1.16.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "tqdm" }, ] @@ -3017,22 +2926,25 @@ dev = [ { name = "coverage" }, { name = "jupyter" }, { name = "mypy" }, - { name = "pip-audit" }, { name = "pre-commit" }, { name = "pytest" }, { name = "pytest-cov" }, { name = "pytest-rerunfailures" }, { name = "ruff" }, + { name = "scipy-stubs", version = "1.15.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "scipy-stubs", version = "1.16.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "setuptools" }, { name = "xenon" }, ] docs = [ { name = "ipython", version = "8.37.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "ipython", version = "9.5.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "ipython", version = "9.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "nbsphinx" }, { name = "pydata-sphinx-theme" }, - { name = "scikit-learn" }, - { name = "sphinx" }, + { name = "scikit-learn", version = "1.7.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "scikit-learn", version = "1.8.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "sphinx", version = "8.1.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "sphinx", version = "9.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "sphinx-copybutton" }, ] eval = [ @@ -3041,7 +2953,6 @@ eval = [ ] test = [ { name = "mypy" }, - { name = "pip-audit" }, { name = "pre-commit" }, { name = "pytest" }, { name = "pytest-rerunfailures" }, @@ -3070,12 +2981,12 @@ dev = [ { name = "coverage" }, { name = "jupyter" }, { name = "mypy" }, - { name = "pip-audit" }, { name = "pre-commit" }, { name = "pytest" }, { name = "pytest-cov" }, { name = "pytest-rerunfailures" }, { name = "ruff" }, + { name = "scipy-stubs" }, { name = "setuptools", specifier = ">=80" }, { name = "xenon" }, ] @@ -3093,7 +3004,6 @@ eval = [ ] test = [ { name = "mypy" }, - { name = "pip-audit" }, { name = "pre-commit" }, { name = "pytest" }, { name = "pytest-rerunfailures" }, @@ -3105,13 +3015,14 @@ test = [ name = "scikit-learn" version = "1.7.2" source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.11'", +] dependencies = [ - { name = "joblib" }, + { name = "joblib", marker = "python_full_version < '3.11'" }, { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "scipy", version = "1.15.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, - { name = "scipy", version = "1.16.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, - { name = "threadpoolctl" }, + { name = "threadpoolctl", marker = "python_full_version < '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/98/c2/a7855e41c9d285dfe86dc50b250978105dce513d6e459ea66a6aeb0e1e0c/scikit_learn-1.7.2.tar.gz", hash = "sha256:20e9e49ecd130598f1ca38a1d85090e1a600147b9c02fa6f15d69cb53d968fda", size = 7193136, upload-time = "2025-09-09T08:21:29.075Z" } wheels = [ @@ -3142,6 +3053,48 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/b5/aa/8444be3cfb10451617ff9d177b3c190288f4563e6c50ff02728be67ad094/scikit_learn-1.7.2-cp313-cp313t-win_amd64.whl", hash = "sha256:57dc4deb1d3762c75d685507fbd0bc17160144b2f2ba4ccea5dc285ab0d0e973", size = 9275749, upload-time = "2025-09-09T08:21:15.96Z" }, ] +[[package]] +name = "scikit-learn" +version = "1.8.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +dependencies = [ + { name = "joblib", marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "scipy", version = "1.16.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "threadpoolctl", marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/0e/d4/40988bf3b8e34feec1d0e6a051446b1f66225f8529b9309becaeef62b6c4/scikit_learn-1.8.0.tar.gz", hash = "sha256:9bccbb3b40e3de10351f8f5068e105d0f4083b1a65fa07b6634fbc401a6287fd", size = 7335585, upload-time = "2025-12-10T07:08:53.618Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c9/92/53ea2181da8ac6bf27170191028aee7251f8f841f8d3edbfdcaf2008fde9/scikit_learn-1.8.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:146b4d36f800c013d267b29168813f7a03a43ecd2895d04861f1240b564421da", size = 8595835, upload-time = "2025-12-10T07:07:39.385Z" }, + { url = "https://files.pythonhosted.org/packages/01/18/d154dc1638803adf987910cdd07097d9c526663a55666a97c124d09fb96a/scikit_learn-1.8.0-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:f984ca4b14914e6b4094c5d52a32ea16b49832c03bd17a110f004db3c223e8e1", size = 8080381, upload-time = "2025-12-10T07:07:41.93Z" }, + { url = "https://files.pythonhosted.org/packages/8a/44/226142fcb7b7101e64fdee5f49dbe6288d4c7af8abf593237b70fca080a4/scikit_learn-1.8.0-cp311-cp311-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:5e30adb87f0cc81c7690a84f7932dd66be5bac57cfe16b91cb9151683a4a2d3b", size = 8799632, upload-time = "2025-12-10T07:07:43.899Z" }, + { url = "https://files.pythonhosted.org/packages/36/4d/4a67f30778a45d542bbea5db2dbfa1e9e100bf9ba64aefe34215ba9f11f6/scikit_learn-1.8.0-cp311-cp311-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:ada8121bcb4dac28d930febc791a69f7cb1673c8495e5eee274190b73a4559c1", size = 9103788, upload-time = "2025-12-10T07:07:45.982Z" }, + { url = "https://files.pythonhosted.org/packages/89/3c/45c352094cfa60050bcbb967b1faf246b22e93cb459f2f907b600f2ceda5/scikit_learn-1.8.0-cp311-cp311-win_amd64.whl", hash = "sha256:c57b1b610bd1f40ba43970e11ce62821c2e6569e4d74023db19c6b26f246cb3b", size = 8081706, upload-time = "2025-12-10T07:07:48.111Z" }, + { url = "https://files.pythonhosted.org/packages/3d/46/5416595bb395757f754feb20c3d776553a386b661658fb21b7c814e89efe/scikit_learn-1.8.0-cp311-cp311-win_arm64.whl", hash = "sha256:2838551e011a64e3053ad7618dda9310175f7515f1742fa2d756f7c874c05961", size = 7688451, upload-time = "2025-12-10T07:07:49.873Z" }, + { url = "https://files.pythonhosted.org/packages/90/74/e6a7cc4b820e95cc38cf36cd74d5aa2b42e8ffc2d21fe5a9a9c45c1c7630/scikit_learn-1.8.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:5fb63362b5a7ddab88e52b6dbb47dac3fd7dafeee740dc6c8d8a446ddedade8e", size = 8548242, upload-time = "2025-12-10T07:07:51.568Z" }, + { url = "https://files.pythonhosted.org/packages/49/d8/9be608c6024d021041c7f0b3928d4749a706f4e2c3832bbede4fb4f58c95/scikit_learn-1.8.0-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:5025ce924beccb28298246e589c691fe1b8c1c96507e6d27d12c5fadd85bfd76", size = 8079075, upload-time = "2025-12-10T07:07:53.697Z" }, + { url = "https://files.pythonhosted.org/packages/dd/47/f187b4636ff80cc63f21cd40b7b2d177134acaa10f6bb73746130ee8c2e5/scikit_learn-1.8.0-cp312-cp312-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4496bb2cf7a43ce1a2d7524a79e40bc5da45cf598dbf9545b7e8316ccba47bb4", size = 8660492, upload-time = "2025-12-10T07:07:55.574Z" }, + { url = "https://files.pythonhosted.org/packages/97/74/b7a304feb2b49df9fafa9382d4d09061a96ee9a9449a7cbea7988dda0828/scikit_learn-1.8.0-cp312-cp312-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0bcfe4d0d14aec44921545fd2af2338c7471de9cb701f1da4c9d85906ab847a", size = 8931904, upload-time = "2025-12-10T07:07:57.666Z" }, + { url = "https://files.pythonhosted.org/packages/9f/c4/0ab22726a04ede56f689476b760f98f8f46607caecff993017ac1b64aa5d/scikit_learn-1.8.0-cp312-cp312-win_amd64.whl", hash = "sha256:35c007dedb2ffe38fe3ee7d201ebac4a2deccd2408e8621d53067733e3c74809", size = 8019359, upload-time = "2025-12-10T07:07:59.838Z" }, + { url = "https://files.pythonhosted.org/packages/24/90/344a67811cfd561d7335c1b96ca21455e7e472d281c3c279c4d3f2300236/scikit_learn-1.8.0-cp312-cp312-win_arm64.whl", hash = "sha256:8c497fff237d7b4e07e9ef1a640887fa4fb765647f86fbe00f969ff6280ce2bb", size = 7641898, upload-time = "2025-12-10T07:08:01.36Z" }, + { url = "https://files.pythonhosted.org/packages/03/aa/e22e0768512ce9255eba34775be2e85c2048da73da1193e841707f8f039c/scikit_learn-1.8.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:0d6ae97234d5d7079dc0040990a6f7aeb97cb7fa7e8945f1999a429b23569e0a", size = 8513770, upload-time = "2025-12-10T07:08:03.251Z" }, + { url = "https://files.pythonhosted.org/packages/58/37/31b83b2594105f61a381fc74ca19e8780ee923be2d496fcd8d2e1147bd99/scikit_learn-1.8.0-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:edec98c5e7c128328124a029bceb09eda2d526997780fef8d65e9a69eead963e", size = 8044458, upload-time = "2025-12-10T07:08:05.336Z" }, + { url = "https://files.pythonhosted.org/packages/2d/5a/3f1caed8765f33eabb723596666da4ebbf43d11e96550fb18bdec42b467b/scikit_learn-1.8.0-cp313-cp313-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:74b66d8689d52ed04c271e1329f0c61635bcaf5b926db9b12d58914cdc01fe57", size = 8610341, upload-time = "2025-12-10T07:08:07.732Z" }, + { url = "https://files.pythonhosted.org/packages/38/cf/06896db3f71c75902a8e9943b444a56e727418f6b4b4a90c98c934f51ed4/scikit_learn-1.8.0-cp313-cp313-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:8fdf95767f989b0cfedb85f7ed8ca215d4be728031f56ff5a519ee1e3276dc2e", size = 8900022, upload-time = "2025-12-10T07:08:09.862Z" }, + { url = "https://files.pythonhosted.org/packages/1c/f9/9b7563caf3ec8873e17a31401858efab6b39a882daf6c1bfa88879c0aa11/scikit_learn-1.8.0-cp313-cp313-win_amd64.whl", hash = "sha256:2de443b9373b3b615aec1bb57f9baa6bb3a9bd093f1269ba95c17d870422b271", size = 7989409, upload-time = "2025-12-10T07:08:12.028Z" }, + { url = "https://files.pythonhosted.org/packages/49/bd/1f4001503650e72c4f6009ac0c4413cb17d2d601cef6f71c0453da2732fc/scikit_learn-1.8.0-cp313-cp313-win_arm64.whl", hash = "sha256:eddde82a035681427cbedded4e6eff5e57fa59216c2e3e90b10b19ab1d0a65c3", size = 7619760, upload-time = "2025-12-10T07:08:13.688Z" }, + { url = "https://files.pythonhosted.org/packages/d2/7d/a630359fc9dcc95496588c8d8e3245cc8fd81980251079bc09c70d41d951/scikit_learn-1.8.0-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:7cc267b6108f0a1499a734167282c00c4ebf61328566b55ef262d48e9849c735", size = 8826045, upload-time = "2025-12-10T07:08:15.215Z" }, + { url = "https://files.pythonhosted.org/packages/cc/56/a0c86f6930cfcd1c7054a2bc417e26960bb88d32444fe7f71d5c2cfae891/scikit_learn-1.8.0-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:fe1c011a640a9f0791146011dfd3c7d9669785f9fed2b2a5f9e207536cf5c2fd", size = 8420324, upload-time = "2025-12-10T07:08:17.561Z" }, + { url = "https://files.pythonhosted.org/packages/46/1e/05962ea1cebc1cf3876667ecb14c283ef755bf409993c5946ade3b77e303/scikit_learn-1.8.0-cp313-cp313t-manylinux_2_27_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:72358cce49465d140cc4e7792015bb1f0296a9742d5622c67e31399b75468b9e", size = 8680651, upload-time = "2025-12-10T07:08:19.952Z" }, + { url = "https://files.pythonhosted.org/packages/fe/56/a85473cd75f200c9759e3a5f0bcab2d116c92a8a02ee08ccd73b870f8bb4/scikit_learn-1.8.0-cp313-cp313t-manylinux_2_27_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:80832434a6cc114f5219211eec13dcbc16c2bac0e31ef64c6d346cde3cf054cb", size = 8925045, upload-time = "2025-12-10T07:08:22.11Z" }, + { url = "https://files.pythonhosted.org/packages/cc/b7/64d8cfa896c64435ae57f4917a548d7ac7a44762ff9802f75a79b77cb633/scikit_learn-1.8.0-cp313-cp313t-win_amd64.whl", hash = "sha256:ee787491dbfe082d9c3013f01f5991658b0f38aa8177e4cd4bf434c58f551702", size = 8507994, upload-time = "2025-12-10T07:08:23.943Z" }, + { url = "https://files.pythonhosted.org/packages/5e/37/e192ea709551799379958b4c4771ec507347027bb7c942662c7fbeba31cb/scikit_learn-1.8.0-cp313-cp313t-win_arm64.whl", hash = "sha256:bf97c10a3f5a7543f9b88cbf488d33d175e9146115a451ae34568597ba33dcde", size = 7869518, upload-time = "2025-12-10T07:08:25.71Z" }, +] + [[package]] name = "scipy" version = "1.15.3" @@ -3203,57 +3156,88 @@ wheels = [ [[package]] name = "scipy" -version = "1.16.2" +version = "1.16.3" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.12'", "python_full_version == '3.11.*'", ] dependencies = [ - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/4c/3b/546a6f0bfe791bbb7f8d591613454d15097e53f906308ec6f7c1ce588e8e/scipy-1.16.2.tar.gz", hash = "sha256:af029b153d243a80afb6eabe40b0a07f8e35c9adc269c019f364ad747f826a6b", size = 30580599, upload-time = "2025-09-11T17:48:08.271Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/0b/ef/37ed4b213d64b48422df92560af7300e10fe30b5d665dd79932baebee0c6/scipy-1.16.2-cp311-cp311-macosx_10_14_x86_64.whl", hash = "sha256:6ab88ea43a57da1af33292ebd04b417e8e2eaf9d5aa05700be8d6e1b6501cd92", size = 36619956, upload-time = "2025-09-11T17:39:20.5Z" }, - { url = "https://files.pythonhosted.org/packages/85/ab/5c2eba89b9416961a982346a4d6a647d78c91ec96ab94ed522b3b6baf444/scipy-1.16.2-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:c95e96c7305c96ede73a7389f46ccd6c659c4da5ef1b2789466baeaed3622b6e", size = 28931117, upload-time = "2025-09-11T17:39:29.06Z" }, - { url = "https://files.pythonhosted.org/packages/80/d1/eed51ab64d227fe60229a2d57fb60ca5898cfa50ba27d4f573e9e5f0b430/scipy-1.16.2-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:87eb178db04ece7c698220d523c170125dbffebb7af0345e66c3554f6f60c173", size = 20921997, upload-time = "2025-09-11T17:39:34.892Z" }, - { url = "https://files.pythonhosted.org/packages/be/7c/33ea3e23bbadde96726edba6bf9111fb1969d14d9d477ffa202c67bec9da/scipy-1.16.2-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:4e409eac067dcee96a57fbcf424c13f428037827ec7ee3cb671ff525ca4fc34d", size = 23523374, upload-time = "2025-09-11T17:39:40.846Z" }, - { url = "https://files.pythonhosted.org/packages/96/0b/7399dc96e1e3f9a05e258c98d716196a34f528eef2ec55aad651ed136d03/scipy-1.16.2-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:e574be127bb760f0dad24ff6e217c80213d153058372362ccb9555a10fc5e8d2", size = 33583702, upload-time = "2025-09-11T17:39:49.011Z" }, - { url = "https://files.pythonhosted.org/packages/1a/bc/a5c75095089b96ea72c1bd37a4497c24b581ec73db4ef58ebee142ad2d14/scipy-1.16.2-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f5db5ba6188d698ba7abab982ad6973265b74bb40a1efe1821b58c87f73892b9", size = 35883427, upload-time = "2025-09-11T17:39:57.406Z" }, - { url = "https://files.pythonhosted.org/packages/ab/66/e25705ca3d2b87b97fe0a278a24b7f477b4023a926847935a1a71488a6a6/scipy-1.16.2-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:ec6e74c4e884104ae006d34110677bfe0098203a3fec2f3faf349f4cb05165e3", size = 36212940, upload-time = "2025-09-11T17:40:06.013Z" }, - { url = "https://files.pythonhosted.org/packages/d6/fd/0bb911585e12f3abdd603d721d83fc1c7492835e1401a0e6d498d7822b4b/scipy-1.16.2-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:912f46667d2d3834bc3d57361f854226475f695eb08c08a904aadb1c936b6a88", size = 38865092, upload-time = "2025-09-11T17:40:15.143Z" }, - { url = "https://files.pythonhosted.org/packages/d6/73/c449a7d56ba6e6f874183759f8483cde21f900a8be117d67ffbb670c2958/scipy-1.16.2-cp311-cp311-win_amd64.whl", hash = "sha256:91e9e8a37befa5a69e9cacbe0bcb79ae5afb4a0b130fd6db6ee6cc0d491695fa", size = 38687626, upload-time = "2025-09-11T17:40:24.041Z" }, - { url = "https://files.pythonhosted.org/packages/68/72/02f37316adf95307f5d9e579023c6899f89ff3a051fa079dbd6faafc48e5/scipy-1.16.2-cp311-cp311-win_arm64.whl", hash = "sha256:f3bf75a6dcecab62afde4d1f973f1692be013110cad5338007927db8da73249c", size = 25503506, upload-time = "2025-09-11T17:40:30.703Z" }, - { url = "https://files.pythonhosted.org/packages/b7/8d/6396e00db1282279a4ddd507c5f5e11f606812b608ee58517ce8abbf883f/scipy-1.16.2-cp312-cp312-macosx_10_14_x86_64.whl", hash = "sha256:89d6c100fa5c48472047632e06f0876b3c4931aac1f4291afc81a3644316bb0d", size = 36646259, upload-time = "2025-09-11T17:40:39.329Z" }, - { url = "https://files.pythonhosted.org/packages/3b/93/ea9edd7e193fceb8eef149804491890bde73fb169c896b61aa3e2d1e4e77/scipy-1.16.2-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:ca748936cd579d3f01928b30a17dc474550b01272d8046e3e1ee593f23620371", size = 28888976, upload-time = "2025-09-11T17:40:46.82Z" }, - { url = "https://files.pythonhosted.org/packages/91/4d/281fddc3d80fd738ba86fd3aed9202331180b01e2c78eaae0642f22f7e83/scipy-1.16.2-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:fac4f8ce2ddb40e2e3d0f7ec36d2a1e7f92559a2471e59aec37bd8d9de01fec0", size = 20879905, upload-time = "2025-09-11T17:40:52.545Z" }, - { url = "https://files.pythonhosted.org/packages/69/40/b33b74c84606fd301b2915f0062e45733c6ff5708d121dd0deaa8871e2d0/scipy-1.16.2-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:033570f1dcefd79547a88e18bccacff025c8c647a330381064f561d43b821232", size = 23553066, upload-time = "2025-09-11T17:40:59.014Z" }, - { url = "https://files.pythonhosted.org/packages/55/a7/22c739e2f21a42cc8f16bc76b47cff4ed54fbe0962832c589591c2abec34/scipy-1.16.2-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:ea3421209bf00c8a5ef2227de496601087d8f638a2363ee09af059bd70976dc1", size = 33336407, upload-time = "2025-09-11T17:41:06.796Z" }, - { url = "https://files.pythonhosted.org/packages/53/11/a0160990b82999b45874dc60c0c183d3a3a969a563fffc476d5a9995c407/scipy-1.16.2-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:f66bd07ba6f84cd4a380b41d1bf3c59ea488b590a2ff96744845163309ee8e2f", size = 35673281, upload-time = "2025-09-11T17:41:15.055Z" }, - { url = "https://files.pythonhosted.org/packages/96/53/7ef48a4cfcf243c3d0f1643f5887c81f29fdf76911c4e49331828e19fc0a/scipy-1.16.2-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:5e9feab931bd2aea4a23388c962df6468af3d808ddf2d40f94a81c5dc38f32ef", size = 36004222, upload-time = "2025-09-11T17:41:23.868Z" }, - { url = "https://files.pythonhosted.org/packages/49/7f/71a69e0afd460049d41c65c630c919c537815277dfea214031005f474d78/scipy-1.16.2-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:03dfc75e52f72cf23ec2ced468645321407faad8f0fe7b1f5b49264adbc29cb1", size = 38664586, upload-time = "2025-09-11T17:41:31.021Z" }, - { url = "https://files.pythonhosted.org/packages/34/95/20e02ca66fb495a95fba0642fd48e0c390d0ece9b9b14c6e931a60a12dea/scipy-1.16.2-cp312-cp312-win_amd64.whl", hash = "sha256:0ce54e07bbb394b417457409a64fd015be623f36e330ac49306433ffe04bc97e", size = 38550641, upload-time = "2025-09-11T17:41:36.61Z" }, - { url = "https://files.pythonhosted.org/packages/92/ad/13646b9beb0a95528ca46d52b7babafbe115017814a611f2065ee4e61d20/scipy-1.16.2-cp312-cp312-win_arm64.whl", hash = "sha256:2a8ffaa4ac0df81a0b94577b18ee079f13fecdb924df3328fc44a7dc5ac46851", size = 25456070, upload-time = "2025-09-11T17:41:41.3Z" }, - { url = "https://files.pythonhosted.org/packages/c1/27/c5b52f1ee81727a9fc457f5ac1e9bf3d6eab311805ea615c83c27ba06400/scipy-1.16.2-cp313-cp313-macosx_10_14_x86_64.whl", hash = "sha256:84f7bf944b43e20b8a894f5fe593976926744f6c185bacfcbdfbb62736b5cc70", size = 36604856, upload-time = "2025-09-11T17:41:47.695Z" }, - { url = "https://files.pythonhosted.org/packages/32/a9/15c20d08e950b540184caa8ced675ba1128accb0e09c653780ba023a4110/scipy-1.16.2-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:5c39026d12edc826a1ef2ad35ad1e6d7f087f934bb868fc43fa3049c8b8508f9", size = 28864626, upload-time = "2025-09-11T17:41:52.642Z" }, - { url = "https://files.pythonhosted.org/packages/4c/fc/ea36098df653cca26062a627c1a94b0de659e97127c8491e18713ca0e3b9/scipy-1.16.2-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:e52729ffd45b68777c5319560014d6fd251294200625d9d70fd8626516fc49f5", size = 20855689, upload-time = "2025-09-11T17:41:57.886Z" }, - { url = "https://files.pythonhosted.org/packages/dc/6f/d0b53be55727f3e6d7c72687ec18ea6d0047cf95f1f77488b99a2bafaee1/scipy-1.16.2-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:024dd4a118cccec09ca3209b7e8e614931a6ffb804b2a601839499cb88bdf925", size = 23512151, upload-time = "2025-09-11T17:42:02.303Z" }, - { url = "https://files.pythonhosted.org/packages/11/85/bf7dab56e5c4b1d3d8eef92ca8ede788418ad38a7dc3ff50262f00808760/scipy-1.16.2-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:7a5dc7ee9c33019973a470556081b0fd3c9f4c44019191039f9769183141a4d9", size = 33329824, upload-time = "2025-09-11T17:42:07.549Z" }, - { url = "https://files.pythonhosted.org/packages/da/6a/1a927b14ddc7714111ea51f4e568203b2bb6ed59bdd036d62127c1a360c8/scipy-1.16.2-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:c2275ff105e508942f99d4e3bc56b6ef5e4b3c0af970386ca56b777608ce95b7", size = 35681881, upload-time = "2025-09-11T17:42:13.255Z" }, - { url = "https://files.pythonhosted.org/packages/c1/5f/331148ea5780b4fcc7007a4a6a6ee0a0c1507a796365cc642d4d226e1c3a/scipy-1.16.2-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:af80196eaa84f033e48444d2e0786ec47d328ba00c71e4299b602235ffef9acb", size = 36006219, upload-time = "2025-09-11T17:42:18.765Z" }, - { url = "https://files.pythonhosted.org/packages/46/3a/e991aa9d2aec723b4a8dcfbfc8365edec5d5e5f9f133888067f1cbb7dfc1/scipy-1.16.2-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:9fb1eb735fe3d6ed1f89918224e3385fbf6f9e23757cacc35f9c78d3b712dd6e", size = 38682147, upload-time = "2025-09-11T17:42:25.177Z" }, - { url = "https://files.pythonhosted.org/packages/a1/57/0f38e396ad19e41b4c5db66130167eef8ee620a49bc7d0512e3bb67e0cab/scipy-1.16.2-cp313-cp313-win_amd64.whl", hash = "sha256:fda714cf45ba43c9d3bae8f2585c777f64e3f89a2e073b668b32ede412d8f52c", size = 38520766, upload-time = "2025-09-11T17:43:25.342Z" }, - { url = "https://files.pythonhosted.org/packages/1b/a5/85d3e867b6822d331e26c862a91375bb7746a0b458db5effa093d34cdb89/scipy-1.16.2-cp313-cp313-win_arm64.whl", hash = "sha256:2f5350da923ccfd0b00e07c3e5cfb316c1c0d6c1d864c07a72d092e9f20db104", size = 25451169, upload-time = "2025-09-11T17:43:30.198Z" }, - { url = "https://files.pythonhosted.org/packages/09/d9/60679189bcebda55992d1a45498de6d080dcaf21ce0c8f24f888117e0c2d/scipy-1.16.2-cp313-cp313t-macosx_10_14_x86_64.whl", hash = "sha256:53d8d2ee29b925344c13bda64ab51785f016b1b9617849dac10897f0701b20c1", size = 37012682, upload-time = "2025-09-11T17:42:30.677Z" }, - { url = "https://files.pythonhosted.org/packages/83/be/a99d13ee4d3b7887a96f8c71361b9659ba4ef34da0338f14891e102a127f/scipy-1.16.2-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:9e05e33657efb4c6a9d23bd8300101536abd99c85cca82da0bffff8d8764d08a", size = 29389926, upload-time = "2025-09-11T17:42:35.845Z" }, - { url = "https://files.pythonhosted.org/packages/bf/0a/130164a4881cec6ca8c00faf3b57926f28ed429cd6001a673f83c7c2a579/scipy-1.16.2-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:7fe65b36036357003b3ef9d37547abeefaa353b237e989c21027b8ed62b12d4f", size = 21381152, upload-time = "2025-09-11T17:42:40.07Z" }, - { url = "https://files.pythonhosted.org/packages/47/a6/503ffb0310ae77fba874e10cddfc4a1280bdcca1d13c3751b8c3c2996cf8/scipy-1.16.2-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:6406d2ac6d40b861cccf57f49592f9779071655e9f75cd4f977fa0bdd09cb2e4", size = 23914410, upload-time = "2025-09-11T17:42:44.313Z" }, - { url = "https://files.pythonhosted.org/packages/fa/c7/1147774bcea50d00c02600aadaa919facbd8537997a62496270133536ed6/scipy-1.16.2-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:ff4dc42bd321991fbf611c23fc35912d690f731c9914bf3af8f417e64aca0f21", size = 33481880, upload-time = "2025-09-11T17:42:49.325Z" }, - { url = "https://files.pythonhosted.org/packages/6a/74/99d5415e4c3e46b2586f30cdbecb95e101c7192628a484a40dd0d163811a/scipy-1.16.2-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:654324826654d4d9133e10675325708fb954bc84dae6e9ad0a52e75c6b1a01d7", size = 35791425, upload-time = "2025-09-11T17:42:54.711Z" }, - { url = "https://files.pythonhosted.org/packages/1b/ee/a6559de7c1cc710e938c0355d9d4fbcd732dac4d0d131959d1f3b63eb29c/scipy-1.16.2-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:63870a84cd15c44e65220eaed2dac0e8f8b26bbb991456a033c1d9abfe8a94f8", size = 36178622, upload-time = "2025-09-11T17:43:00.375Z" }, - { url = "https://files.pythonhosted.org/packages/4e/7b/f127a5795d5ba8ece4e0dce7d4a9fb7cb9e4f4757137757d7a69ab7d4f1a/scipy-1.16.2-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:fa01f0f6a3050fa6a9771a95d5faccc8e2f5a92b4a2e5440a0fa7264a2398472", size = 38783985, upload-time = "2025-09-11T17:43:06.661Z" }, - { url = "https://files.pythonhosted.org/packages/3e/9f/bc81c1d1e033951eb5912cd3750cc005943afa3e65a725d2443a3b3c4347/scipy-1.16.2-cp313-cp313t-win_amd64.whl", hash = "sha256:116296e89fba96f76353a8579820c2512f6e55835d3fad7780fece04367de351", size = 38631367, upload-time = "2025-09-11T17:43:14.44Z" }, - { url = "https://files.pythonhosted.org/packages/d6/5e/2cc7555fd81d01814271412a1d59a289d25f8b63208a0a16c21069d55d3e/scipy-1.16.2-cp313-cp313t-win_arm64.whl", hash = "sha256:98e22834650be81d42982360382b43b17f7ba95e0e6993e2a4f5b9ad9283a94d", size = 25787992, upload-time = "2025-09-11T17:43:19.745Z" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/0a/ca/d8ace4f98322d01abcd52d381134344bf7b431eba7ed8b42bdea5a3c2ac9/scipy-1.16.3.tar.gz", hash = "sha256:01e87659402762f43bd2fee13370553a17ada367d42e7487800bf2916535aecb", size = 30597883, upload-time = "2025-10-28T17:38:54.068Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/9b/5f/6f37d7439de1455ce9c5a556b8d1db0979f03a796c030bafdf08d35b7bf9/scipy-1.16.3-cp311-cp311-macosx_10_14_x86_64.whl", hash = "sha256:40be6cf99e68b6c4321e9f8782e7d5ff8265af28ef2cd56e9c9b2638fa08ad97", size = 36630881, upload-time = "2025-10-28T17:31:47.104Z" }, + { url = "https://files.pythonhosted.org/packages/7c/89/d70e9f628749b7e4db2aa4cd89735502ff3f08f7b9b27d2e799485987cd9/scipy-1.16.3-cp311-cp311-macosx_12_0_arm64.whl", hash = "sha256:8be1ca9170fcb6223cc7c27f4305d680ded114a1567c0bd2bfcbf947d1b17511", size = 28941012, upload-time = "2025-10-28T17:31:53.411Z" }, + { url = "https://files.pythonhosted.org/packages/a8/a8/0e7a9a6872a923505dbdf6bb93451edcac120363131c19013044a1e7cb0c/scipy-1.16.3-cp311-cp311-macosx_14_0_arm64.whl", hash = "sha256:bea0a62734d20d67608660f69dcda23e7f90fb4ca20974ab80b6ed40df87a005", size = 20931935, upload-time = "2025-10-28T17:31:57.361Z" }, + { url = "https://files.pythonhosted.org/packages/bd/c7/020fb72bd79ad798e4dbe53938543ecb96b3a9ac3fe274b7189e23e27353/scipy-1.16.3-cp311-cp311-macosx_14_0_x86_64.whl", hash = "sha256:2a207a6ce9c24f1951241f4693ede2d393f59c07abc159b2cb2be980820e01fb", size = 23534466, upload-time = "2025-10-28T17:32:01.875Z" }, + { url = "https://files.pythonhosted.org/packages/be/a0/668c4609ce6dbf2f948e167836ccaf897f95fb63fa231c87da7558a374cd/scipy-1.16.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:532fb5ad6a87e9e9cd9c959b106b73145a03f04c7d57ea3e6f6bb60b86ab0876", size = 33593618, upload-time = "2025-10-28T17:32:06.902Z" }, + { url = "https://files.pythonhosted.org/packages/ca/6e/8942461cf2636cdae083e3eb72622a7fbbfa5cf559c7d13ab250a5dbdc01/scipy-1.16.3-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:0151a0749efeaaab78711c78422d413c583b8cdd2011a3c1d6c794938ee9fdb2", size = 35899798, upload-time = "2025-10-28T17:32:12.665Z" }, + { url = "https://files.pythonhosted.org/packages/79/e8/d0f33590364cdbd67f28ce79368b373889faa4ee959588beddf6daef9abe/scipy-1.16.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:b7180967113560cca57418a7bc719e30366b47959dd845a93206fbed693c867e", size = 36226154, upload-time = "2025-10-28T17:32:17.961Z" }, + { url = "https://files.pythonhosted.org/packages/39/c1/1903de608c0c924a1749c590064e65810f8046e437aba6be365abc4f7557/scipy-1.16.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:deb3841c925eeddb6afc1e4e4a45e418d19ec7b87c5df177695224078e8ec733", size = 38878540, upload-time = "2025-10-28T17:32:23.907Z" }, + { url = "https://files.pythonhosted.org/packages/f1/d0/22ec7036ba0b0a35bccb7f25ab407382ed34af0b111475eb301c16f8a2e5/scipy-1.16.3-cp311-cp311-win_amd64.whl", hash = "sha256:53c3844d527213631e886621df5695d35e4f6a75f620dca412bcd292f6b87d78", size = 38722107, upload-time = "2025-10-28T17:32:29.921Z" }, + { url = "https://files.pythonhosted.org/packages/7b/60/8a00e5a524bb3bf8898db1650d350f50e6cffb9d7a491c561dc9826c7515/scipy-1.16.3-cp311-cp311-win_arm64.whl", hash = "sha256:9452781bd879b14b6f055b26643703551320aa8d79ae064a71df55c00286a184", size = 25506272, upload-time = "2025-10-28T17:32:34.577Z" }, + { url = "https://files.pythonhosted.org/packages/40/41/5bf55c3f386b1643812f3a5674edf74b26184378ef0f3e7c7a09a7e2ca7f/scipy-1.16.3-cp312-cp312-macosx_10_14_x86_64.whl", hash = "sha256:81fc5827606858cf71446a5e98715ba0e11f0dbc83d71c7409d05486592a45d6", size = 36659043, upload-time = "2025-10-28T17:32:40.285Z" }, + { url = "https://files.pythonhosted.org/packages/1e/0f/65582071948cfc45d43e9870bf7ca5f0e0684e165d7c9ef4e50d783073eb/scipy-1.16.3-cp312-cp312-macosx_12_0_arm64.whl", hash = "sha256:c97176013d404c7346bf57874eaac5187d969293bf40497140b0a2b2b7482e07", size = 28898986, upload-time = "2025-10-28T17:32:45.325Z" }, + { url = "https://files.pythonhosted.org/packages/96/5e/36bf3f0ac298187d1ceadde9051177d6a4fe4d507e8f59067dc9dd39e650/scipy-1.16.3-cp312-cp312-macosx_14_0_arm64.whl", hash = "sha256:2b71d93c8a9936046866acebc915e2af2e292b883ed6e2cbe5c34beb094b82d9", size = 20889814, upload-time = "2025-10-28T17:32:49.277Z" }, + { url = "https://files.pythonhosted.org/packages/80/35/178d9d0c35394d5d5211bbff7ac4f2986c5488b59506fef9e1de13ea28d3/scipy-1.16.3-cp312-cp312-macosx_14_0_x86_64.whl", hash = "sha256:3d4a07a8e785d80289dfe66b7c27d8634a773020742ec7187b85ccc4b0e7b686", size = 23565795, upload-time = "2025-10-28T17:32:53.337Z" }, + { url = "https://files.pythonhosted.org/packages/fa/46/d1146ff536d034d02f83c8afc3c4bab2eddb634624d6529a8512f3afc9da/scipy-1.16.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0553371015692a898e1aa858fed67a3576c34edefa6b7ebdb4e9dde49ce5c203", size = 33349476, upload-time = "2025-10-28T17:32:58.353Z" }, + { url = "https://files.pythonhosted.org/packages/79/2e/415119c9ab3e62249e18c2b082c07aff907a273741b3f8160414b0e9193c/scipy-1.16.3-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:72d1717fd3b5e6ec747327ce9bda32d5463f472c9dce9f54499e81fbd50245a1", size = 35676692, upload-time = "2025-10-28T17:33:03.88Z" }, + { url = "https://files.pythonhosted.org/packages/27/82/df26e44da78bf8d2aeaf7566082260cfa15955a5a6e96e6a29935b64132f/scipy-1.16.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1fb2472e72e24d1530debe6ae078db70fb1605350c88a3d14bc401d6306dbffe", size = 36019345, upload-time = "2025-10-28T17:33:09.773Z" }, + { url = "https://files.pythonhosted.org/packages/82/31/006cbb4b648ba379a95c87262c2855cd0d09453e500937f78b30f02fa1cd/scipy-1.16.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c5192722cffe15f9329a3948c4b1db789fbb1f05c97899187dcf009b283aea70", size = 38678975, upload-time = "2025-10-28T17:33:15.809Z" }, + { url = "https://files.pythonhosted.org/packages/c2/7f/acbd28c97e990b421af7d6d6cd416358c9c293fc958b8529e0bd5d2a2a19/scipy-1.16.3-cp312-cp312-win_amd64.whl", hash = "sha256:56edc65510d1331dae01ef9b658d428e33ed48b4f77b1d51caf479a0253f96dc", size = 38555926, upload-time = "2025-10-28T17:33:21.388Z" }, + { url = "https://files.pythonhosted.org/packages/ce/69/c5c7807fd007dad4f48e0a5f2153038dc96e8725d3345b9ee31b2b7bed46/scipy-1.16.3-cp312-cp312-win_arm64.whl", hash = "sha256:a8a26c78ef223d3e30920ef759e25625a0ecdd0d60e5a8818b7513c3e5384cf2", size = 25463014, upload-time = "2025-10-28T17:33:25.975Z" }, + { url = "https://files.pythonhosted.org/packages/72/f1/57e8327ab1508272029e27eeef34f2302ffc156b69e7e233e906c2a5c379/scipy-1.16.3-cp313-cp313-macosx_10_14_x86_64.whl", hash = "sha256:d2ec56337675e61b312179a1ad124f5f570c00f920cc75e1000025451b88241c", size = 36617856, upload-time = "2025-10-28T17:33:31.375Z" }, + { url = "https://files.pythonhosted.org/packages/44/13/7e63cfba8a7452eb756306aa2fd9b37a29a323b672b964b4fdeded9a3f21/scipy-1.16.3-cp313-cp313-macosx_12_0_arm64.whl", hash = "sha256:16b8bc35a4cc24db80a0ec836a9286d0e31b2503cb2fd7ff7fb0e0374a97081d", size = 28874306, upload-time = "2025-10-28T17:33:36.516Z" }, + { url = "https://files.pythonhosted.org/packages/15/65/3a9400efd0228a176e6ec3454b1fa998fbbb5a8defa1672c3f65706987db/scipy-1.16.3-cp313-cp313-macosx_14_0_arm64.whl", hash = "sha256:5803c5fadd29de0cf27fa08ccbfe7a9e5d741bf63e4ab1085437266f12460ff9", size = 20865371, upload-time = "2025-10-28T17:33:42.094Z" }, + { url = "https://files.pythonhosted.org/packages/33/d7/eda09adf009a9fb81827194d4dd02d2e4bc752cef16737cc4ef065234031/scipy-1.16.3-cp313-cp313-macosx_14_0_x86_64.whl", hash = "sha256:b81c27fc41954319a943d43b20e07c40bdcd3ff7cf013f4fb86286faefe546c4", size = 23524877, upload-time = "2025-10-28T17:33:48.483Z" }, + { url = "https://files.pythonhosted.org/packages/7d/6b/3f911e1ebc364cb81320223a3422aab7d26c9c7973109a9cd0f27c64c6c0/scipy-1.16.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:0c3b4dd3d9b08dbce0f3440032c52e9e2ab9f96ade2d3943313dfe51a7056959", size = 33342103, upload-time = "2025-10-28T17:33:56.495Z" }, + { url = "https://files.pythonhosted.org/packages/21/f6/4bfb5695d8941e5c570a04d9fcd0d36bce7511b7d78e6e75c8f9791f82d0/scipy-1.16.3-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:7dc1360c06535ea6116a2220f760ae572db9f661aba2d88074fe30ec2aa1ff88", size = 35697297, upload-time = "2025-10-28T17:34:04.722Z" }, + { url = "https://files.pythonhosted.org/packages/04/e1/6496dadbc80d8d896ff72511ecfe2316b50313bfc3ebf07a3f580f08bd8c/scipy-1.16.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:663b8d66a8748051c3ee9c96465fb417509315b99c71550fda2591d7dd634234", size = 36021756, upload-time = "2025-10-28T17:34:13.482Z" }, + { url = "https://files.pythonhosted.org/packages/fe/bd/a8c7799e0136b987bda3e1b23d155bcb31aec68a4a472554df5f0937eef7/scipy-1.16.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:eab43fae33a0c39006a88096cd7b4f4ef545ea0447d250d5ac18202d40b6611d", size = 38696566, upload-time = "2025-10-28T17:34:22.384Z" }, + { url = "https://files.pythonhosted.org/packages/cd/01/1204382461fcbfeb05b6161b594f4007e78b6eba9b375382f79153172b4d/scipy-1.16.3-cp313-cp313-win_amd64.whl", hash = "sha256:062246acacbe9f8210de8e751b16fc37458213f124bef161a5a02c7a39284304", size = 38529877, upload-time = "2025-10-28T17:35:51.076Z" }, + { url = "https://files.pythonhosted.org/packages/7f/14/9d9fbcaa1260a94f4bb5b64ba9213ceb5d03cd88841fe9fd1ffd47a45b73/scipy-1.16.3-cp313-cp313-win_arm64.whl", hash = "sha256:50a3dbf286dbc7d84f176f9a1574c705f277cb6565069f88f60db9eafdbe3ee2", size = 25455366, upload-time = "2025-10-28T17:35:59.014Z" }, + { url = "https://files.pythonhosted.org/packages/e2/a3/9ec205bd49f42d45d77f1730dbad9ccf146244c1647605cf834b3a8c4f36/scipy-1.16.3-cp313-cp313t-macosx_10_14_x86_64.whl", hash = "sha256:fb4b29f4cf8cc5a8d628bc8d8e26d12d7278cd1f219f22698a378c3d67db5e4b", size = 37027931, upload-time = "2025-10-28T17:34:31.451Z" }, + { url = "https://files.pythonhosted.org/packages/25/06/ca9fd1f3a4589cbd825b1447e5db3a8ebb969c1eaf22c8579bd286f51b6d/scipy-1.16.3-cp313-cp313t-macosx_12_0_arm64.whl", hash = "sha256:8d09d72dc92742988b0e7750bddb8060b0c7079606c0d24a8cc8e9c9c11f9079", size = 29400081, upload-time = "2025-10-28T17:34:39.087Z" }, + { url = "https://files.pythonhosted.org/packages/6a/56/933e68210d92657d93fb0e381683bc0e53a965048d7358ff5fbf9e6a1b17/scipy-1.16.3-cp313-cp313t-macosx_14_0_arm64.whl", hash = "sha256:03192a35e661470197556de24e7cb1330d84b35b94ead65c46ad6f16f6b28f2a", size = 21391244, upload-time = "2025-10-28T17:34:45.234Z" }, + { url = "https://files.pythonhosted.org/packages/a8/7e/779845db03dc1418e215726329674b40576879b91814568757ff0014ad65/scipy-1.16.3-cp313-cp313t-macosx_14_0_x86_64.whl", hash = "sha256:57d01cb6f85e34f0946b33caa66e892aae072b64b034183f3d87c4025802a119", size = 23929753, upload-time = "2025-10-28T17:34:51.793Z" }, + { url = "https://files.pythonhosted.org/packages/4c/4b/f756cf8161d5365dcdef9e5f460ab226c068211030a175d2fc7f3f41ca64/scipy-1.16.3-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.whl", hash = "sha256:96491a6a54e995f00a28a3c3badfff58fd093bf26cd5fb34a2188c8c756a3a2c", size = 33496912, upload-time = "2025-10-28T17:34:59.8Z" }, + { url = "https://files.pythonhosted.org/packages/09/b5/222b1e49a58668f23839ca1542a6322bb095ab8d6590d4f71723869a6c2c/scipy-1.16.3-cp313-cp313t-manylinux2014_x86_64.manylinux_2_17_x86_64.whl", hash = "sha256:cd13e354df9938598af2be05822c323e97132d5e6306b83a3b4ee6724c6e522e", size = 35802371, upload-time = "2025-10-28T17:35:08.173Z" }, + { url = "https://files.pythonhosted.org/packages/c1/8d/5964ef68bb31829bde27611f8c9deeac13764589fe74a75390242b64ca44/scipy-1.16.3-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:63d3cdacb8a824a295191a723ee5e4ea7768ca5ca5f2838532d9f2e2b3ce2135", size = 36190477, upload-time = "2025-10-28T17:35:16.7Z" }, + { url = "https://files.pythonhosted.org/packages/ab/f2/b31d75cb9b5fa4dd39a0a931ee9b33e7f6f36f23be5ef560bf72e0f92f32/scipy-1.16.3-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:e7efa2681ea410b10dde31a52b18b0154d66f2485328830e45fdf183af5aefc6", size = 38796678, upload-time = "2025-10-28T17:35:26.354Z" }, + { url = "https://files.pythonhosted.org/packages/b4/1e/b3723d8ff64ab548c38d87055483714fefe6ee20e0189b62352b5e015bb1/scipy-1.16.3-cp313-cp313t-win_amd64.whl", hash = "sha256:2d1ae2cf0c350e7705168ff2429962a89ad90c2d49d1dd300686d8b2a5af22fc", size = 38640178, upload-time = "2025-10-28T17:35:35.304Z" }, + { url = "https://files.pythonhosted.org/packages/8e/f3/d854ff38789aca9b0cc23008d607ced9de4f7ab14fa1ca4329f86b3758ca/scipy-1.16.3-cp313-cp313t-win_arm64.whl", hash = "sha256:0c623a54f7b79dd88ef56da19bc2873afec9673a48f3b85b18e4d402bdd29a5a", size = 25803246, upload-time = "2025-10-28T17:35:42.155Z" }, +] + +[[package]] +name = "scipy-stubs" +version = "1.15.3.0" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.11'", +] +dependencies = [ + { name = "optype", version = "0.9.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/0b/5f/35c43bd7d412add4adcd68475702571b2489b50c40b6564f808b2355e452/scipy_stubs-1.15.3.0.tar.gz", hash = "sha256:e8f76c9887461cf9424c1e2ad78ea5dac71dd4cbb383dc85f91adfe8f74d1e17", size = 275699, upload-time = "2025-05-08T16:58:35.139Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/6c/42/cd8dc81f8060de1f14960885ad5b2d2651f41de8b93d09f3f919d6567a5a/scipy_stubs-1.15.3.0-py3-none-any.whl", hash = "sha256:a251254cf4fd6e7fb87c55c1feee92d32ddbc1f542ecdf6a0159cdb81c2fb62d", size = 459062, upload-time = "2025-05-08T16:58:33.356Z" }, +] + +[[package]] +name = "scipy-stubs" +version = "1.16.3.3" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +dependencies = [ + { name = "optype", version = "0.15.0", source = { registry = "https://pypi.org/simple" }, extra = ["numpy"], marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/08/91/1700d2a1a9f64f19bb019a547e510b99a6af1fef49641a0bce86bc85fb8e/scipy_stubs-1.16.3.3.tar.gz", hash = "sha256:af47578875d5557567225a16ec1b9b38a48c4c4377d92396413ebd65406c44ee", size = 361468, upload-time = "2025-12-08T13:45:38.37Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/7c/e2/3b8826f281f59301e3284989b19cfc56fdccf799134c1befedd38482a23a/scipy_stubs-1.16.3.3-py3-none-any.whl", hash = "sha256:f6316b36cd0fb272c994ae5b10c4a73c644a7e156ed8d32bcd9c35303d0e1b7e", size = 561750, upload-time = "2025-12-08T13:45:36.568Z" }, ] [[package]] @@ -3294,23 +3278,14 @@ wheels = [ [[package]] name = "smart-open" -version = "7.3.1" +version = "7.5.0" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "wrapt" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/16/be/bf2d60280a9d7fac98ece2150a22538fa4332cda67d04d9618c8406f791e/smart_open-7.3.1.tar.gz", hash = "sha256:b33fee8dffd206f189d5e704106a8723afb4210d2ff47e0e1f7fbe436187a990", size = 51405, upload-time = "2025-09-08T10:03:53.726Z" } +sdist = { url = "https://files.pythonhosted.org/packages/67/9a/0a7acb748b86e2922982366d780ca4b16c33f7246fa5860d26005c97e4f3/smart_open-7.5.0.tar.gz", hash = "sha256:f394b143851d8091011832ac8113ea4aba6b92e6c35f6e677ddaaccb169d7cb9", size = 53920, upload-time = "2025-11-08T21:38:40.698Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/e5/d9/460cf1d58945dd771c228c29d5664f431dfc4060d3d092fed40546b11472/smart_open-7.3.1-py3-none-any.whl", hash = "sha256:e243b2e7f69d6c0c96dd763d6fbbedbb4e0e4fc6d74aa007acc5b018d523858c", size = 61722, upload-time = "2025-09-08T10:03:52.02Z" }, -] - -[[package]] -name = "sniffio" -version = "1.3.1" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/a2/87/a6771e1546d97e7e041b6ae58d80074f81b7d5121207425c964ddf5cfdbd/sniffio-1.3.1.tar.gz", hash = "sha256:f4324edc670a0f49750a81b895f35c3adb843cca46f0530f79fc1babb23789dc", size = 20372, upload-time = "2024-02-25T23:20:04.057Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/e9/44/75a9c9421471a6c4805dbf2356f7c181a29c1879239abab1ea2cc8f38b40/sniffio-1.3.1-py3-none-any.whl", hash = "sha256:2f6da418d1f1e0fddd844478f41680e794e6051915791a034ff65e5f100525a2", size = 10235, upload-time = "2024-02-25T23:20:01.196Z" }, + { url = "https://files.pythonhosted.org/packages/ad/95/bc978be7ea0babf2fb48a414b6afaad414c6a9e8b1eafc5b8a53c030381a/smart_open-7.5.0-py3-none-any.whl", hash = "sha256:87e695c5148bbb988f15cec00971602765874163be85acb1c9fb8abc012e6599", size = 63940, upload-time = "2025-11-08T21:38:39.024Z" }, ] [[package]] @@ -3322,45 +3297,39 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/c8/78/3565d011c61f5a43488987ee32b6f3f656e7f107ac2782dd57bdd7d91d9a/snowballstemmer-3.0.1-py3-none-any.whl", hash = "sha256:6cd7b3897da8d6c9ffb968a6781fa6532dce9c3618a4b127d920dab764a19064", size = 103274, upload-time = "2025-05-09T16:34:50.371Z" }, ] -[[package]] -name = "sortedcontainers" -version = "2.4.0" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e8/c4/ba2f8066cceb6f23394729afe52f3bf7adec04bf9ed2c820b39e19299111/sortedcontainers-2.4.0.tar.gz", hash = "sha256:25caa5a06cc30b6b83d11423433f65d1f9d76c4c6a0c90e3379eaa43b9bfdb88", size = 30594, upload-time = "2021-05-16T22:03:42.897Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/32/46/9cb0e58b2deb7f82b84065f37f3bffeb12413f947f9388e4cac22c4621ce/sortedcontainers-2.4.0-py2.py3-none-any.whl", hash = "sha256:a163dcaede0f1c021485e957a39245190e74249897e2ae4b2aa38595db237ee0", size = 29575, upload-time = "2021-05-16T22:03:41.177Z" }, -] - [[package]] name = "soupsieve" -version = "2.8" +version = "2.8.1" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/6d/e6/21ccce3262dd4889aa3332e5a119a3491a95e8f60939870a3a035aabac0d/soupsieve-2.8.tar.gz", hash = "sha256:e2dd4a40a628cb5f28f6d4b0db8800b8f581b65bb380b97de22ba5ca8d72572f", size = 103472, upload-time = "2025-08-27T15:39:51.78Z" } +sdist = { url = "https://files.pythonhosted.org/packages/89/23/adf3796d740536d63a6fbda113d07e60c734b6ed5d3058d1e47fc0495e47/soupsieve-2.8.1.tar.gz", hash = "sha256:4cf733bc50fa805f5df4b8ef4740fc0e0fa6218cf3006269afd3f9d6d80fd350", size = 117856, upload-time = "2025-12-18T13:50:34.655Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/14/a0/bb38d3b76b8cae341dad93a2dd83ab7462e6dbcdd84d43f54ee60a8dc167/soupsieve-2.8-py3-none-any.whl", hash = "sha256:0cc76456a30e20f5d7f2e14a98a4ae2ee4e5abdc7c5ea0aafe795f344bc7984c", size = 36679, upload-time = "2025-08-27T15:39:50.179Z" }, + { url = "https://files.pythonhosted.org/packages/48/f3/b67d6ea49ca9154453b6d70b34ea22f3996b9fa55da105a79d8732227adc/soupsieve-2.8.1-py3-none-any.whl", hash = "sha256:a11fe2a6f3d76ab3cf2de04eb339c1be5b506a8a47f2ceb6d139803177f85434", size = 36710, upload-time = "2025-12-18T13:50:33.267Z" }, ] [[package]] name = "sphinx" version = "8.1.3" source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version < '3.11'", +] dependencies = [ - { name = "alabaster" }, - { name = "babel" }, - { name = "colorama", marker = "sys_platform == 'win32'" }, - { name = "docutils" }, - { name = "imagesize" }, - { name = "jinja2" }, - { name = "packaging" }, - { name = "pygments" }, - { name = "requests" }, - { name = "snowballstemmer" }, - { name = "sphinxcontrib-applehelp" }, - { name = "sphinxcontrib-devhelp" }, - { name = "sphinxcontrib-htmlhelp" }, - { name = "sphinxcontrib-jsmath" }, - { name = "sphinxcontrib-qthelp" }, - { name = "sphinxcontrib-serializinghtml" }, + { name = "alabaster", marker = "python_full_version < '3.11'" }, + { name = "babel", marker = "python_full_version < '3.11'" }, + { name = "colorama", marker = "python_full_version < '3.11' and sys_platform == 'win32'" }, + { name = "docutils", version = "0.21.2", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "imagesize", marker = "python_full_version < '3.11'" }, + { name = "jinja2", marker = "python_full_version < '3.11'" }, + { name = "packaging", marker = "python_full_version < '3.11'" }, + { name = "pygments", marker = "python_full_version < '3.11'" }, + { name = "requests", marker = "python_full_version < '3.11'" }, + { name = "snowballstemmer", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-applehelp", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-devhelp", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-htmlhelp", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-jsmath", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-qthelp", marker = "python_full_version < '3.11'" }, + { name = "sphinxcontrib-serializinghtml", marker = "python_full_version < '3.11'" }, { name = "tomli", marker = "python_full_version < '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/6f/6d/be0b61178fe2cdcb67e2a92fc9ebb488e3c51c4f74a36a7824c0adf23425/sphinx-8.1.3.tar.gz", hash = "sha256:43c1911eecb0d3e161ad78611bc905d1ad0e523e4ddc202a58a821773dc4c927", size = 8184611, upload-time = "2024-10-13T20:27:13.93Z" } @@ -3368,12 +3337,45 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/26/60/1ddff83a56d33aaf6f10ec8ce84b4c007d9368b21008876fceda7e7381ef/sphinx-8.1.3-py3-none-any.whl", hash = "sha256:09719015511837b76bf6e03e42eb7595ac8c2e41eeb9c29c5b755c6b677992a2", size = 3487125, upload-time = "2024-10-13T20:27:10.448Z" }, ] +[[package]] +name = "sphinx" +version = "9.0.4" +source = { registry = "https://pypi.org/simple" } +resolution-markers = [ + "python_full_version >= '3.12'", + "python_full_version == '3.11.*'", +] +dependencies = [ + { name = "alabaster", marker = "python_full_version >= '3.11'" }, + { name = "babel", marker = "python_full_version >= '3.11'" }, + { name = "colorama", marker = "python_full_version >= '3.11' and sys_platform == 'win32'" }, + { name = "docutils", version = "0.22.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "imagesize", marker = "python_full_version >= '3.11'" }, + { name = "jinja2", marker = "python_full_version >= '3.11'" }, + { name = "packaging", marker = "python_full_version >= '3.11'" }, + { name = "pygments", marker = "python_full_version >= '3.11'" }, + { name = "requests", marker = "python_full_version >= '3.11'" }, + { name = "roman-numerals", marker = "python_full_version >= '3.11'" }, + { name = "snowballstemmer", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-applehelp", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-devhelp", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-htmlhelp", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-jsmath", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-qthelp", marker = "python_full_version >= '3.11'" }, + { name = "sphinxcontrib-serializinghtml", marker = "python_full_version >= '3.11'" }, +] +sdist = { url = "https://files.pythonhosted.org/packages/42/50/a8c6ccc36d5eacdfd7913ddccd15a9cee03ecafc5ee2bc40e1f168d85022/sphinx-9.0.4.tar.gz", hash = "sha256:594ef59d042972abbc581d8baa577404abe4e6c3b04ef61bd7fc2acbd51f3fa3", size = 8710502, upload-time = "2025-12-04T07:45:27.343Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/c6/3f/4bbd76424c393caead2e1eb89777f575dee5c8653e2d4b6afd7a564f5974/sphinx-9.0.4-py3-none-any.whl", hash = "sha256:5bebc595a5e943ea248b99c13814c1c5e10b3ece718976824ffa7959ff95fffb", size = 3917713, upload-time = "2025-12-04T07:45:24.944Z" }, +] + [[package]] name = "sphinx-copybutton" version = "0.5.2" source = { registry = "https://pypi.org/simple" } dependencies = [ - { name = "sphinx" }, + { name = "sphinx", version = "8.1.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, + { name = "sphinx", version = "9.0.4", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, ] sdist = { url = "https://files.pythonhosted.org/packages/fc/2b/a964715e7f5295f77509e59309959f4125122d648f86b4fe7d70ca1d882c/sphinx-copybutton-0.5.2.tar.gz", hash = "sha256:4cf17c82fb9646d1bc9ca92ac280813a3b605d8c421225fd9913154103ee1fbd", size = 23039, upload-time = "2023-04-14T08:10:22.998Z" } wheels = [ @@ -3483,71 +3485,56 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/e6/34/ebdc18bae6aa14fbee1a08b63c015c72b64868ff7dae68808ab500c492e2/tinycss2-1.4.0-py3-none-any.whl", hash = "sha256:3a49cf47b7675da0b15d0c6e1df8df4ebd96e9394bb905a5775adb0d884c5289", size = 26610, upload-time = "2024-10-24T14:58:28.029Z" }, ] -[[package]] -name = "toml" -version = "0.10.2" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/be/ba/1f744cdc819428fc6b5084ec34d9b30660f6f9daaf70eead706e3203ec3c/toml-0.10.2.tar.gz", hash = "sha256:b3bda1d108d5dd99f4a20d24d9c348e91c4db7ab1b749200bded2f839ccbe68f", size = 22253, upload-time = "2020-11-01T01:40:22.204Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/44/6f/7120676b6d73228c96e17f1f794d8ab046fc910d781c8d151120c3f1569e/toml-0.10.2-py2.py3-none-any.whl", hash = "sha256:806143ae5bfb6a3c6e736a764057db0e6a0e05e338b5630894a5f779cabb4f9b", size = 16588, upload-time = "2020-11-01T01:40:20.672Z" }, -] - [[package]] name = "tomli" -version = "2.2.1" +version = "2.3.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/18/87/302344fed471e44a87289cf4967697d07e532f2421fdaf868a303cbae4ff/tomli-2.2.1.tar.gz", hash = "sha256:cd45e1dc79c835ce60f7404ec8119f2eb06d38b1deba146f07ced3bbc44505ff", size = 17175, upload-time = "2024-11-27T22:38:36.873Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/43/ca/75707e6efa2b37c77dadb324ae7d9571cb424e61ea73fad7c56c2d14527f/tomli-2.2.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:678e4fa69e4575eb77d103de3df8a895e1591b48e740211bd1067378c69e8249", size = 131077, upload-time = "2024-11-27T22:37:54.956Z" }, - { url = "https://files.pythonhosted.org/packages/c7/16/51ae563a8615d472fdbffc43a3f3d46588c264ac4f024f63f01283becfbb/tomli-2.2.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:023aa114dd824ade0100497eb2318602af309e5a55595f76b626d6d9f3b7b0a6", size = 123429, upload-time = "2024-11-27T22:37:56.698Z" }, - { url = "https://files.pythonhosted.org/packages/f1/dd/4f6cd1e7b160041db83c694abc78e100473c15d54620083dbd5aae7b990e/tomli-2.2.1-cp311-cp311-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ece47d672db52ac607a3d9599a9d48dcb2f2f735c6c2d1f34130085bb12b112a", size = 226067, upload-time = "2024-11-27T22:37:57.63Z" }, - { url = "https://files.pythonhosted.org/packages/a9/6b/c54ede5dc70d648cc6361eaf429304b02f2871a345bbdd51e993d6cdf550/tomli-2.2.1-cp311-cp311-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:6972ca9c9cc9f0acaa56a8ca1ff51e7af152a9f87fb64623e31d5c83700080ee", size = 236030, upload-time = "2024-11-27T22:37:59.344Z" }, - { url = "https://files.pythonhosted.org/packages/1f/47/999514fa49cfaf7a92c805a86c3c43f4215621855d151b61c602abb38091/tomli-2.2.1-cp311-cp311-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:c954d2250168d28797dd4e3ac5cf812a406cd5a92674ee4c8f123c889786aa8e", size = 240898, upload-time = "2024-11-27T22:38:00.429Z" }, - { url = "https://files.pythonhosted.org/packages/73/41/0a01279a7ae09ee1573b423318e7934674ce06eb33f50936655071d81a24/tomli-2.2.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:8dd28b3e155b80f4d54beb40a441d366adcfe740969820caf156c019fb5c7ec4", size = 229894, upload-time = "2024-11-27T22:38:02.094Z" }, - { url = "https://files.pythonhosted.org/packages/55/18/5d8bc5b0a0362311ce4d18830a5d28943667599a60d20118074ea1b01bb7/tomli-2.2.1-cp311-cp311-musllinux_1_2_i686.whl", hash = "sha256:e59e304978767a54663af13c07b3d1af22ddee3bb2fb0618ca1593e4f593a106", size = 245319, upload-time = "2024-11-27T22:38:03.206Z" }, - { url = "https://files.pythonhosted.org/packages/92/a3/7ade0576d17f3cdf5ff44d61390d4b3febb8a9fc2b480c75c47ea048c646/tomli-2.2.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:33580bccab0338d00994d7f16f4c4ec25b776af3ffaac1ed74e0b3fc95e885a8", size = 238273, upload-time = "2024-11-27T22:38:04.217Z" }, - { url = "https://files.pythonhosted.org/packages/72/6f/fa64ef058ac1446a1e51110c375339b3ec6be245af9d14c87c4a6412dd32/tomli-2.2.1-cp311-cp311-win32.whl", hash = "sha256:465af0e0875402f1d226519c9904f37254b3045fc5084697cefb9bdde1ff99ff", size = 98310, upload-time = "2024-11-27T22:38:05.908Z" }, - { url = "https://files.pythonhosted.org/packages/6a/1c/4a2dcde4a51b81be3530565e92eda625d94dafb46dbeb15069df4caffc34/tomli-2.2.1-cp311-cp311-win_amd64.whl", hash = "sha256:2d0f2fdd22b02c6d81637a3c95f8cd77f995846af7414c5c4b8d0545afa1bc4b", size = 108309, upload-time = "2024-11-27T22:38:06.812Z" }, - { url = "https://files.pythonhosted.org/packages/52/e1/f8af4c2fcde17500422858155aeb0d7e93477a0d59a98e56cbfe75070fd0/tomli-2.2.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:4a8f6e44de52d5e6c657c9fe83b562f5f4256d8ebbfe4ff922c495620a7f6cea", size = 132762, upload-time = "2024-11-27T22:38:07.731Z" }, - { url = "https://files.pythonhosted.org/packages/03/b8/152c68bb84fc00396b83e7bbddd5ec0bd3dd409db4195e2a9b3e398ad2e3/tomli-2.2.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:8d57ca8095a641b8237d5b079147646153d22552f1c637fd3ba7f4b0b29167a8", size = 123453, upload-time = "2024-11-27T22:38:09.384Z" }, - { url = "https://files.pythonhosted.org/packages/c8/d6/fc9267af9166f79ac528ff7e8c55c8181ded34eb4b0e93daa767b8841573/tomli-2.2.1-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:4e340144ad7ae1533cb897d406382b4b6fede8890a03738ff1683af800d54192", size = 233486, upload-time = "2024-11-27T22:38:10.329Z" }, - { url = "https://files.pythonhosted.org/packages/5c/51/51c3f2884d7bab89af25f678447ea7d297b53b5a3b5730a7cb2ef6069f07/tomli-2.2.1-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:db2b95f9de79181805df90bedc5a5ab4c165e6ec3fe99f970d0e302f384ad222", size = 242349, upload-time = "2024-11-27T22:38:11.443Z" }, - { url = "https://files.pythonhosted.org/packages/ab/df/bfa89627d13a5cc22402e441e8a931ef2108403db390ff3345c05253935e/tomli-2.2.1-cp312-cp312-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:40741994320b232529c802f8bc86da4e1aa9f413db394617b9a256ae0f9a7f77", size = 252159, upload-time = "2024-11-27T22:38:13.099Z" }, - { url = "https://files.pythonhosted.org/packages/9e/6e/fa2b916dced65763a5168c6ccb91066f7639bdc88b48adda990db10c8c0b/tomli-2.2.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:400e720fe168c0f8521520190686ef8ef033fb19fc493da09779e592861b78c6", size = 237243, upload-time = "2024-11-27T22:38:14.766Z" }, - { url = "https://files.pythonhosted.org/packages/b4/04/885d3b1f650e1153cbb93a6a9782c58a972b94ea4483ae4ac5cedd5e4a09/tomli-2.2.1-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:02abe224de6ae62c19f090f68da4e27b10af2b93213d36cf44e6e1c5abd19fdd", size = 259645, upload-time = "2024-11-27T22:38:15.843Z" }, - { url = "https://files.pythonhosted.org/packages/9c/de/6b432d66e986e501586da298e28ebeefd3edc2c780f3ad73d22566034239/tomli-2.2.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:b82ebccc8c8a36f2094e969560a1b836758481f3dc360ce9a3277c65f374285e", size = 244584, upload-time = "2024-11-27T22:38:17.645Z" }, - { url = "https://files.pythonhosted.org/packages/1c/9a/47c0449b98e6e7d1be6cbac02f93dd79003234ddc4aaab6ba07a9a7482e2/tomli-2.2.1-cp312-cp312-win32.whl", hash = "sha256:889f80ef92701b9dbb224e49ec87c645ce5df3fa2cc548664eb8a25e03127a98", size = 98875, upload-time = "2024-11-27T22:38:19.159Z" }, - { url = "https://files.pythonhosted.org/packages/ef/60/9b9638f081c6f1261e2688bd487625cd1e660d0a85bd469e91d8db969734/tomli-2.2.1-cp312-cp312-win_amd64.whl", hash = "sha256:7fc04e92e1d624a4a63c76474610238576942d6b8950a2d7f908a340494e67e4", size = 109418, upload-time = "2024-11-27T22:38:20.064Z" }, - { url = "https://files.pythonhosted.org/packages/04/90/2ee5f2e0362cb8a0b6499dc44f4d7d48f8fff06d28ba46e6f1eaa61a1388/tomli-2.2.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:f4039b9cbc3048b2416cc57ab3bda989a6fcf9b36cf8937f01a6e731b64f80d7", size = 132708, upload-time = "2024-11-27T22:38:21.659Z" }, - { url = "https://files.pythonhosted.org/packages/c0/ec/46b4108816de6b385141f082ba99e315501ccd0a2ea23db4a100dd3990ea/tomli-2.2.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:286f0ca2ffeeb5b9bd4fcc8d6c330534323ec51b2f52da063b11c502da16f30c", size = 123582, upload-time = "2024-11-27T22:38:22.693Z" }, - { url = "https://files.pythonhosted.org/packages/a0/bd/b470466d0137b37b68d24556c38a0cc819e8febe392d5b199dcd7f578365/tomli-2.2.1-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a92ef1a44547e894e2a17d24e7557a5e85a9e1d0048b0b5e7541f76c5032cb13", size = 232543, upload-time = "2024-11-27T22:38:24.367Z" }, - { url = "https://files.pythonhosted.org/packages/d9/e5/82e80ff3b751373f7cead2815bcbe2d51c895b3c990686741a8e56ec42ab/tomli-2.2.1-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9316dc65bed1684c9a98ee68759ceaed29d229e985297003e494aa825ebb0281", size = 241691, upload-time = "2024-11-27T22:38:26.081Z" }, - { url = "https://files.pythonhosted.org/packages/05/7e/2a110bc2713557d6a1bfb06af23dd01e7dde52b6ee7dadc589868f9abfac/tomli-2.2.1-cp313-cp313-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e85e99945e688e32d5a35c1ff38ed0b3f41f43fad8df0bdf79f72b2ba7bc5272", size = 251170, upload-time = "2024-11-27T22:38:27.921Z" }, - { url = "https://files.pythonhosted.org/packages/64/7b/22d713946efe00e0adbcdfd6d1aa119ae03fd0b60ebed51ebb3fa9f5a2e5/tomli-2.2.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:ac065718db92ca818f8d6141b5f66369833d4a80a9d74435a268c52bdfa73140", size = 236530, upload-time = "2024-11-27T22:38:29.591Z" }, - { url = "https://files.pythonhosted.org/packages/38/31/3a76f67da4b0cf37b742ca76beaf819dca0ebef26d78fc794a576e08accf/tomli-2.2.1-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:d920f33822747519673ee656a4b6ac33e382eca9d331c87770faa3eef562aeb2", size = 258666, upload-time = "2024-11-27T22:38:30.639Z" }, - { url = "https://files.pythonhosted.org/packages/07/10/5af1293da642aded87e8a988753945d0cf7e00a9452d3911dd3bb354c9e2/tomli-2.2.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:a198f10c4d1b1375d7687bc25294306e551bf1abfa4eace6650070a5c1ae2744", size = 243954, upload-time = "2024-11-27T22:38:31.702Z" }, - { url = "https://files.pythonhosted.org/packages/5b/b9/1ed31d167be802da0fc95020d04cd27b7d7065cc6fbefdd2f9186f60d7bd/tomli-2.2.1-cp313-cp313-win32.whl", hash = "sha256:d3f5614314d758649ab2ab3a62d4f2004c825922f9e370b29416484086b264ec", size = 98724, upload-time = "2024-11-27T22:38:32.837Z" }, - { url = "https://files.pythonhosted.org/packages/c7/32/b0963458706accd9afcfeb867c0f9175a741bf7b19cd424230714d722198/tomli-2.2.1-cp313-cp313-win_amd64.whl", hash = "sha256:a38aa0308e754b0e3c67e344754dff64999ff9b513e691d0e786265c93583c69", size = 109383, upload-time = "2024-11-27T22:38:34.455Z" }, - { url = "https://files.pythonhosted.org/packages/6e/c2/61d3e0f47e2b74ef40a68b9e6ad5984f6241a942f7cd3bbfbdbd03861ea9/tomli-2.2.1-py3-none-any.whl", hash = "sha256:cb55c73c5f4408779d0cf3eef9f762b9c9f147a77de7b258bef0a5628adc85cc", size = 14257, upload-time = "2024-11-27T22:38:35.385Z" }, +sdist = { url = "https://files.pythonhosted.org/packages/52/ed/3f73f72945444548f33eba9a87fc7a6e969915e7b1acc8260b30e1f76a2f/tomli-2.3.0.tar.gz", hash = "sha256:64be704a875d2a59753d80ee8a533c3fe183e3f06807ff7dc2232938ccb01549", size = 17392, upload-time = "2025-10-08T22:01:47.119Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/b3/2e/299f62b401438d5fe1624119c723f5d877acc86a4c2492da405626665f12/tomli-2.3.0-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:88bd15eb972f3664f5ed4b57c1634a97153b4bac4479dcb6a495f41921eb7f45", size = 153236, upload-time = "2025-10-08T22:01:00.137Z" }, + { url = "https://files.pythonhosted.org/packages/86/7f/d8fffe6a7aefdb61bced88fcb5e280cfd71e08939da5894161bd71bea022/tomli-2.3.0-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:883b1c0d6398a6a9d29b508c331fa56adbcdff647f6ace4dfca0f50e90dfd0ba", size = 148084, upload-time = "2025-10-08T22:01:01.63Z" }, + { url = "https://files.pythonhosted.org/packages/47/5c/24935fb6a2ee63e86d80e4d3b58b222dafaf438c416752c8b58537c8b89a/tomli-2.3.0-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:d1381caf13ab9f300e30dd8feadb3de072aeb86f1d34a8569453ff32a7dea4bf", size = 234832, upload-time = "2025-10-08T22:01:02.543Z" }, + { url = "https://files.pythonhosted.org/packages/89/da/75dfd804fc11e6612846758a23f13271b76d577e299592b4371a4ca4cd09/tomli-2.3.0-cp311-cp311-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:a0e285d2649b78c0d9027570d4da3425bdb49830a6156121360b3f8511ea3441", size = 242052, upload-time = "2025-10-08T22:01:03.836Z" }, + { url = "https://files.pythonhosted.org/packages/70/8c/f48ac899f7b3ca7eb13af73bacbc93aec37f9c954df3c08ad96991c8c373/tomli-2.3.0-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:0a154a9ae14bfcf5d8917a59b51ffd5a3ac1fd149b71b47a3a104ca4edcfa845", size = 239555, upload-time = "2025-10-08T22:01:04.834Z" }, + { url = "https://files.pythonhosted.org/packages/ba/28/72f8afd73f1d0e7829bfc093f4cb98ce0a40ffc0cc997009ee1ed94ba705/tomli-2.3.0-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:74bf8464ff93e413514fefd2be591c3b0b23231a77f901db1eb30d6f712fc42c", size = 245128, upload-time = "2025-10-08T22:01:05.84Z" }, + { url = "https://files.pythonhosted.org/packages/b6/eb/a7679c8ac85208706d27436e8d421dfa39d4c914dcf5fa8083a9305f58d9/tomli-2.3.0-cp311-cp311-win32.whl", hash = "sha256:00b5f5d95bbfc7d12f91ad8c593a1659b6387b43f054104cda404be6bda62456", size = 96445, upload-time = "2025-10-08T22:01:06.896Z" }, + { url = "https://files.pythonhosted.org/packages/0a/fe/3d3420c4cb1ad9cb462fb52967080575f15898da97e21cb6f1361d505383/tomli-2.3.0-cp311-cp311-win_amd64.whl", hash = "sha256:4dc4ce8483a5d429ab602f111a93a6ab1ed425eae3122032db7e9acf449451be", size = 107165, upload-time = "2025-10-08T22:01:08.107Z" }, + { url = "https://files.pythonhosted.org/packages/ff/b7/40f36368fcabc518bb11c8f06379a0fd631985046c038aca08c6d6a43c6e/tomli-2.3.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:d7d86942e56ded512a594786a5ba0a5e521d02529b3826e7761a05138341a2ac", size = 154891, upload-time = "2025-10-08T22:01:09.082Z" }, + { url = "https://files.pythonhosted.org/packages/f9/3f/d9dd692199e3b3aab2e4e4dd948abd0f790d9ded8cd10cbaae276a898434/tomli-2.3.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:73ee0b47d4dad1c5e996e3cd33b8a76a50167ae5f96a2607cbe8cc773506ab22", size = 148796, upload-time = "2025-10-08T22:01:10.266Z" }, + { url = "https://files.pythonhosted.org/packages/60/83/59bff4996c2cf9f9387a0f5a3394629c7efa5ef16142076a23a90f1955fa/tomli-2.3.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:792262b94d5d0a466afb5bc63c7daa9d75520110971ee269152083270998316f", size = 242121, upload-time = "2025-10-08T22:01:11.332Z" }, + { url = "https://files.pythonhosted.org/packages/45/e5/7c5119ff39de8693d6baab6c0b6dcb556d192c165596e9fc231ea1052041/tomli-2.3.0-cp312-cp312-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4f195fe57ecceac95a66a75ac24d9d5fbc98ef0962e09b2eddec5d39375aae52", size = 250070, upload-time = "2025-10-08T22:01:12.498Z" }, + { url = "https://files.pythonhosted.org/packages/45/12/ad5126d3a278f27e6701abde51d342aa78d06e27ce2bb596a01f7709a5a2/tomli-2.3.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:e31d432427dcbf4d86958c184b9bfd1e96b5b71f8eb17e6d02531f434fd335b8", size = 245859, upload-time = "2025-10-08T22:01:13.551Z" }, + { url = "https://files.pythonhosted.org/packages/fb/a1/4d6865da6a71c603cfe6ad0e6556c73c76548557a8d658f9e3b142df245f/tomli-2.3.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:7b0882799624980785240ab732537fcfc372601015c00f7fc367c55308c186f6", size = 250296, upload-time = "2025-10-08T22:01:14.614Z" }, + { url = "https://files.pythonhosted.org/packages/a0/b7/a7a7042715d55c9ba6e8b196d65d2cb662578b4d8cd17d882d45322b0d78/tomli-2.3.0-cp312-cp312-win32.whl", hash = "sha256:ff72b71b5d10d22ecb084d345fc26f42b5143c5533db5e2eaba7d2d335358876", size = 97124, upload-time = "2025-10-08T22:01:15.629Z" }, + { url = "https://files.pythonhosted.org/packages/06/1e/f22f100db15a68b520664eb3328fb0ae4e90530887928558112c8d1f4515/tomli-2.3.0-cp312-cp312-win_amd64.whl", hash = "sha256:1cb4ed918939151a03f33d4242ccd0aa5f11b3547d0cf30f7c74a408a5b99878", size = 107698, upload-time = "2025-10-08T22:01:16.51Z" }, + { url = "https://files.pythonhosted.org/packages/89/48/06ee6eabe4fdd9ecd48bf488f4ac783844fd777f547b8d1b61c11939974e/tomli-2.3.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:5192f562738228945d7b13d4930baffda67b69425a7f0da96d360b0a3888136b", size = 154819, upload-time = "2025-10-08T22:01:17.964Z" }, + { url = "https://files.pythonhosted.org/packages/f1/01/88793757d54d8937015c75dcdfb673c65471945f6be98e6a0410fba167ed/tomli-2.3.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:be71c93a63d738597996be9528f4abe628d1adf5e6eb11607bc8fe1a510b5dae", size = 148766, upload-time = "2025-10-08T22:01:18.959Z" }, + { url = "https://files.pythonhosted.org/packages/42/17/5e2c956f0144b812e7e107f94f1cc54af734eb17b5191c0bbfb72de5e93e/tomli-2.3.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c4665508bcbac83a31ff8ab08f424b665200c0e1e645d2bd9ab3d3e557b6185b", size = 240771, upload-time = "2025-10-08T22:01:20.106Z" }, + { url = "https://files.pythonhosted.org/packages/d5/f4/0fbd014909748706c01d16824eadb0307115f9562a15cbb012cd9b3512c5/tomli-2.3.0-cp313-cp313-manylinux2014_x86_64.manylinux_2_17_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:4021923f97266babc6ccab9f5068642a0095faa0a51a246a6a02fccbb3514eaf", size = 248586, upload-time = "2025-10-08T22:01:21.164Z" }, + { url = "https://files.pythonhosted.org/packages/30/77/fed85e114bde5e81ecf9bc5da0cc69f2914b38f4708c80ae67d0c10180c5/tomli-2.3.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:a4ea38c40145a357d513bffad0ed869f13c1773716cf71ccaa83b0fa0cc4e42f", size = 244792, upload-time = "2025-10-08T22:01:22.417Z" }, + { url = "https://files.pythonhosted.org/packages/55/92/afed3d497f7c186dc71e6ee6d4fcb0acfa5f7d0a1a2878f8beae379ae0cc/tomli-2.3.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:ad805ea85eda330dbad64c7ea7a4556259665bdf9d2672f5dccc740eb9d3ca05", size = 248909, upload-time = "2025-10-08T22:01:23.859Z" }, + { url = "https://files.pythonhosted.org/packages/f8/84/ef50c51b5a9472e7265ce1ffc7f24cd4023d289e109f669bdb1553f6a7c2/tomli-2.3.0-cp313-cp313-win32.whl", hash = "sha256:97d5eec30149fd3294270e889b4234023f2c69747e555a27bd708828353ab606", size = 96946, upload-time = "2025-10-08T22:01:24.893Z" }, + { url = "https://files.pythonhosted.org/packages/b2/b7/718cd1da0884f281f95ccfa3a6cc572d30053cba64603f79d431d3c9b61b/tomli-2.3.0-cp313-cp313-win_amd64.whl", hash = "sha256:0c95ca56fbe89e065c6ead5b593ee64b84a26fca063b5d71a1122bf26e533999", size = 107705, upload-time = "2025-10-08T22:01:26.153Z" }, + { url = "https://files.pythonhosted.org/packages/77/b8/0135fadc89e73be292b473cb820b4f5a08197779206b33191e801feeae40/tomli-2.3.0-py3-none-any.whl", hash = "sha256:e95b1af3c5b07d9e643909b5abbec77cd9f1217e6d0bca72b0234736b9fb1f1b", size = 14408, upload-time = "2025-10-08T22:01:46.04Z" }, ] [[package]] name = "tornado" -version = "6.5.2" +version = "6.5.4" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/09/ce/1eb500eae19f4648281bb2186927bb062d2438c2e5093d1360391afd2f90/tornado-6.5.2.tar.gz", hash = "sha256:ab53c8f9a0fa351e2c0741284e06c7a45da86afb544133201c5cc8578eb076a0", size = 510821, upload-time = "2025-08-08T18:27:00.78Z" } +sdist = { url = "https://files.pythonhosted.org/packages/37/1d/0a336abf618272d53f62ebe274f712e213f5a03c0b2339575430b8362ef2/tornado-6.5.4.tar.gz", hash = "sha256:a22fa9047405d03260b483980635f0b041989d8bcc9a313f8fe18b411d84b1d7", size = 513632, upload-time = "2025-12-15T19:21:03.836Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/f6/48/6a7529df2c9cc12efd2e8f5dd219516184d703b34c06786809670df5b3bd/tornado-6.5.2-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:2436822940d37cde62771cff8774f4f00b3c8024fe482e16ca8387b8a2724db6", size = 442563, upload-time = "2025-08-08T18:26:42.945Z" }, - { url = "https://files.pythonhosted.org/packages/f2/b5/9b575a0ed3e50b00c40b08cbce82eb618229091d09f6d14bce80fc01cb0b/tornado-6.5.2-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:583a52c7aa94ee046854ba81d9ebb6c81ec0fd30386d96f7640c96dad45a03ef", size = 440729, upload-time = "2025-08-08T18:26:44.473Z" }, - { url = "https://files.pythonhosted.org/packages/1b/4e/619174f52b120efcf23633c817fd3fed867c30bff785e2cd5a53a70e483c/tornado-6.5.2-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:b0fe179f28d597deab2842b86ed4060deec7388f1fd9c1b4a41adf8af058907e", size = 444295, upload-time = "2025-08-08T18:26:46.021Z" }, - { url = "https://files.pythonhosted.org/packages/95/fa/87b41709552bbd393c85dd18e4e3499dcd8983f66e7972926db8d96aa065/tornado-6.5.2-cp39-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:b186e85d1e3536d69583d2298423744740986018e393d0321df7340e71898882", size = 443644, upload-time = "2025-08-08T18:26:47.625Z" }, - { url = "https://files.pythonhosted.org/packages/f9/41/fb15f06e33d7430ca89420283a8762a4e6b8025b800ea51796ab5e6d9559/tornado-6.5.2-cp39-abi3-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e792706668c87709709c18b353da1f7662317b563ff69f00bab83595940c7108", size = 443878, upload-time = "2025-08-08T18:26:50.599Z" }, - { url = "https://files.pythonhosted.org/packages/11/92/fe6d57da897776ad2e01e279170ea8ae726755b045fe5ac73b75357a5a3f/tornado-6.5.2-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:06ceb1300fd70cb20e43b1ad8aaee0266e69e7ced38fa910ad2e03285009ce7c", size = 444549, upload-time = "2025-08-08T18:26:51.864Z" }, - { url = "https://files.pythonhosted.org/packages/9b/02/c8f4f6c9204526daf3d760f4aa555a7a33ad0e60843eac025ccfd6ff4a93/tornado-6.5.2-cp39-abi3-musllinux_1_2_i686.whl", hash = "sha256:74db443e0f5251be86cbf37929f84d8c20c27a355dd452a5cfa2aada0d001ec4", size = 443973, upload-time = "2025-08-08T18:26:53.625Z" }, - { url = "https://files.pythonhosted.org/packages/ae/2d/f5f5707b655ce2317190183868cd0f6822a1121b4baeae509ceb9590d0bd/tornado-6.5.2-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b5e735ab2889d7ed33b32a459cac490eda71a1ba6857b0118de476ab6c366c04", size = 443954, upload-time = "2025-08-08T18:26:55.072Z" }, - { url = "https://files.pythonhosted.org/packages/e8/59/593bd0f40f7355806bf6573b47b8c22f8e1374c9b6fd03114bd6b7a3dcfd/tornado-6.5.2-cp39-abi3-win32.whl", hash = "sha256:c6f29e94d9b37a95013bb669616352ddb82e3bfe8326fccee50583caebc8a5f0", size = 445023, upload-time = "2025-08-08T18:26:56.677Z" }, - { url = "https://files.pythonhosted.org/packages/c7/2a/f609b420c2f564a748a2d80ebfb2ee02a73ca80223af712fca591386cafb/tornado-6.5.2-cp39-abi3-win_amd64.whl", hash = "sha256:e56a5af51cc30dd2cae649429af65ca2f6571da29504a07995175df14c18f35f", size = 445427, upload-time = "2025-08-08T18:26:57.91Z" }, - { url = "https://files.pythonhosted.org/packages/5e/4f/e1f65e8f8c76d73658b33d33b81eed4322fb5085350e4328d5c956f0c8f9/tornado-6.5.2-cp39-abi3-win_arm64.whl", hash = "sha256:d6c33dc3672e3a1f3618eb63b7ef4683a7688e7b9e6e8f0d9aa5726360a004af", size = 444456, upload-time = "2025-08-08T18:26:59.207Z" }, + { url = "https://files.pythonhosted.org/packages/ab/a9/e94a9d5224107d7ce3cc1fab8d5dc97f5ea351ccc6322ee4fb661da94e35/tornado-6.5.4-cp39-abi3-macosx_10_9_universal2.whl", hash = "sha256:d6241c1a16b1c9e4cc28148b1cda97dd1c6cb4fb7068ac1bedc610768dff0ba9", size = 443909, upload-time = "2025-12-15T19:20:48.382Z" }, + { url = "https://files.pythonhosted.org/packages/db/7e/f7b8d8c4453f305a51f80dbb49014257bb7d28ccb4bbb8dd328ea995ecad/tornado-6.5.4-cp39-abi3-macosx_10_9_x86_64.whl", hash = "sha256:2d50f63dda1d2cac3ae1fa23d254e16b5e38153758470e9956cbc3d813d40843", size = 442163, upload-time = "2025-12-15T19:20:49.791Z" }, + { url = "https://files.pythonhosted.org/packages/ba/b5/206f82d51e1bfa940ba366a8d2f83904b15942c45a78dd978b599870ab44/tornado-6.5.4-cp39-abi3-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:d1cf66105dc6acb5af613c054955b8137e34a03698aa53272dbda4afe252be17", size = 445746, upload-time = "2025-12-15T19:20:51.491Z" }, + { url = "https://files.pythonhosted.org/packages/8e/9d/1a3338e0bd30ada6ad4356c13a0a6c35fbc859063fa7eddb309183364ac1/tornado-6.5.4-cp39-abi3-manylinux_2_5_i686.manylinux1_i686.manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:50ff0a58b0dc97939d29da29cd624da010e7f804746621c78d14b80238669335", size = 445083, upload-time = "2025-12-15T19:20:52.778Z" }, + { url = "https://files.pythonhosted.org/packages/50/d4/e51d52047e7eb9a582da59f32125d17c0482d065afd5d3bc435ff2120dc5/tornado-6.5.4-cp39-abi3-manylinux_2_5_x86_64.manylinux1_x86_64.manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e5fb5e04efa54cf0baabdd10061eb4148e0be137166146fff835745f59ab9f7f", size = 445315, upload-time = "2025-12-15T19:20:53.996Z" }, + { url = "https://files.pythonhosted.org/packages/27/07/2273972f69ca63dbc139694a3fc4684edec3ea3f9efabf77ed32483b875c/tornado-6.5.4-cp39-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:9c86b1643b33a4cd415f8d0fe53045f913bf07b4a3ef646b735a6a86047dda84", size = 446003, upload-time = "2025-12-15T19:20:56.101Z" }, + { url = "https://files.pythonhosted.org/packages/d1/83/41c52e47502bf7260044413b6770d1a48dda2f0246f95ee1384a3cd9c44a/tornado-6.5.4-cp39-abi3-musllinux_1_2_i686.whl", hash = "sha256:6eb82872335a53dd063a4f10917b3efd28270b56a33db69009606a0312660a6f", size = 445412, upload-time = "2025-12-15T19:20:57.398Z" }, + { url = "https://files.pythonhosted.org/packages/10/c7/bc96917f06cbee182d44735d4ecde9c432e25b84f4c2086143013e7b9e52/tornado-6.5.4-cp39-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:6076d5dda368c9328ff41ab5d9dd3608e695e8225d1cd0fd1e006f05da3635a8", size = 445392, upload-time = "2025-12-15T19:20:58.692Z" }, + { url = "https://files.pythonhosted.org/packages/0c/1a/d7592328d037d36f2d2462f4bc1fbb383eec9278bc786c1b111cbbd44cfa/tornado-6.5.4-cp39-abi3-win32.whl", hash = "sha256:1768110f2411d5cd281bac0a090f707223ce77fd110424361092859e089b38d1", size = 446481, upload-time = "2025-12-15T19:21:00.008Z" }, + { url = "https://files.pythonhosted.org/packages/d6/6d/c69be695a0a64fd37a97db12355a035a6d90f79067a3cf936ec2b1dc38cd/tornado-6.5.4-cp39-abi3-win_amd64.whl", hash = "sha256:fa07d31e0cd85c60713f2b995da613588aa03e1303d75705dca6af8babc18ddc", size = 446886, upload-time = "2025-12-15T19:21:01.287Z" }, + { url = "https://files.pythonhosted.org/packages/50/49/8dc3fd90902f70084bd2cd059d576ddb4f8bb44c2c7c0e33a11422acb17e/tornado-6.5.4-cp39-abi3-win_arm64.whl", hash = "sha256:053e6e16701eb6cbe641f308f4c1a9541f91b6261991160391bfc342e8a551a1", size = 445910, upload-time = "2025-12-15T19:21:02.571Z" }, ] [[package]] @@ -3571,15 +3558,6 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/00/c0/8f5d070730d7836adc9c9b6408dec68c6ced86b304a9b26a14df072a6e8c/traitlets-5.14.3-py3-none-any.whl", hash = "sha256:b74e89e397b1ed28cc831db7aea759ba6640cb3de13090ca145426688ff1ac4f", size = 85359, upload-time = "2024-04-19T11:11:46.763Z" }, ] -[[package]] -name = "types-python-dateutil" -version = "2.9.0.20250822" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/0c/0a/775f8551665992204c756be326f3575abba58c4a3a52eef9909ef4536428/types_python_dateutil-2.9.0.20250822.tar.gz", hash = "sha256:84c92c34bd8e68b117bff742bc00b692a1e8531262d4507b33afcc9f7716cd53", size = 16084, upload-time = "2025-08-22T03:02:00.613Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/ab/d9/a29dfa84363e88b053bf85a8b7f212a04f0d7343a4d24933baa45c06e08b/types_python_dateutil-2.9.0.20250822-py3-none-any.whl", hash = "sha256:849d52b737e10a6dc6621d2bd7940ec7c65fcb69e6aa2882acf4e56b2b508ddc", size = 17892, upload-time = "2025-08-22T03:01:59.436Z" }, -] - [[package]] name = "typing-extensions" version = "4.15.0" @@ -3591,11 +3569,11 @@ wheels = [ [[package]] name = "tzdata" -version = "2025.2" +version = "2025.3" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/95/32/1a225d6164441be760d75c2c42e2780dc0873fe382da3e98a2e1e48361e5/tzdata-2025.2.tar.gz", hash = "sha256:b60a638fcc0daffadf82fe0f57e53d06bdec2f36c4df66280ae79bce6bd6f2b9", size = 196380, upload-time = "2025-03-23T13:54:43.652Z" } +sdist = { url = "https://files.pythonhosted.org/packages/5e/a7/c202b344c5ca7daf398f3b8a477eeb205cf3b6f32e7ec3a6bac0629ca975/tzdata-2025.3.tar.gz", hash = "sha256:de39c2ca5dc7b0344f2eba86f49d614019d29f060fc4ebc8a417896a620b56a7", size = 196772, upload-time = "2025-12-13T17:45:35.667Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5c/23/c7abc0ca0a1526a0774eca151daeb8de62ec457e77262b66b359c3c7679e/tzdata-2025.2-py2.py3-none-any.whl", hash = "sha256:1a403fada01ff9221ca8044d701868fa132215d84beb92242d9acd2147f667a8", size = 347839, upload-time = "2025-03-23T13:54:41.845Z" }, + { url = "https://files.pythonhosted.org/packages/c7/b0/003792df09decd6849a5e39c28b513c06e84436a54440380862b5aeff25d/tzdata-2025.3-py2.py3-none-any.whl", hash = "sha256:06a47e5700f3081aab02b2e513160914ff0694bce9947d6b76ebd6bf57cfc5d1", size = 348521, upload-time = "2025-12-13T17:45:33.889Z" }, ] [[package]] @@ -3609,16 +3587,16 @@ wheels = [ [[package]] name = "urllib3" -version = "2.5.0" +version = "2.6.2" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/15/22/9ee70a2574a4f4599c47dd506532914ce044817c7752a79b6a51286319bc/urllib3-2.5.0.tar.gz", hash = "sha256:3fc47733c7e419d4bc3f6b3dc2b4f890bb743906a30d56ba4a5bfa4bbff92760", size = 393185, upload-time = "2025-06-18T14:07:41.644Z" } +sdist = { url = "https://files.pythonhosted.org/packages/1e/24/a2a2ed9addd907787d7aa0355ba36a6cadf1768b934c652ea78acbd59dcd/urllib3-2.6.2.tar.gz", hash = "sha256:016f9c98bb7e98085cb2b4b17b87d2c702975664e4f060c6532e64d1c1a5e797", size = 432930, upload-time = "2025-12-11T15:56:40.252Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/a7/c2/fe1e52489ae3122415c51f387e221dd0773709bad6c6cdaa599e8a2c5185/urllib3-2.5.0-py3-none-any.whl", hash = "sha256:e6b01673c0fa6a13e374b50871808eb3bf7046c4b125b216f6bf1cc604cff0dc", size = 129795, upload-time = "2025-06-18T14:07:40.39Z" }, + { url = "https://files.pythonhosted.org/packages/6d/b9/4095b668ea3678bf6a0af005527f39de12fb026516fb3df17495a733b7f8/urllib3-2.6.2-py3-none-any.whl", hash = "sha256:ec21cddfe7724fc7cb4ba4bea7aa8e2ef36f607a4bab81aa6ce42a13dc3f03dd", size = 131182, upload-time = "2025-12-11T15:56:38.584Z" }, ] [[package]] name = "virtualenv" -version = "20.34.0" +version = "20.35.4" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "distlib" }, @@ -3626,9 +3604,9 @@ dependencies = [ { name = "platformdirs" }, { name = "typing-extensions", marker = "python_full_version < '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/1c/14/37fcdba2808a6c615681cd216fecae00413c9dab44fb2e57805ecf3eaee3/virtualenv-20.34.0.tar.gz", hash = "sha256:44815b2c9dee7ed86e387b842a84f20b93f7f417f95886ca1996a72a4138eb1a", size = 6003808, upload-time = "2025-08-13T14:24:07.464Z" } +sdist = { url = "https://files.pythonhosted.org/packages/20/28/e6f1a6f655d620846bd9df527390ecc26b3805a0c5989048c210e22c5ca9/virtualenv-20.35.4.tar.gz", hash = "sha256:643d3914d73d3eeb0c552cbb12d7e82adf0e504dbf86a3182f8771a153a1971c", size = 6028799, upload-time = "2025-10-29T06:57:40.511Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/76/06/04c8e804f813cf972e3262f3f8584c232de64f0cde9f703b46cf53a45090/virtualenv-20.34.0-py3-none-any.whl", hash = "sha256:341f5afa7eee943e4984a9207c025feedd768baff6753cd660c857ceb3e36026", size = 5983279, upload-time = "2025-08-13T14:24:05.111Z" }, + { url = "https://files.pythonhosted.org/packages/79/0c/c05523fa3181fdf0c9c52a6ba91a23fbf3246cc095f26f6516f9c60e6771/virtualenv-20.35.4-py3-none-any.whl", hash = "sha256:c21c9cede36c9753eeade68ba7d523529f228a403463376cf821eaae2b650f1b", size = 6005095, upload-time = "2025-10-29T06:57:37.598Z" }, ] [[package]] @@ -3642,11 +3620,11 @@ wheels = [ [[package]] name = "webcolors" -version = "24.11.1" +version = "25.10.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/7b/29/061ec845fb58521848f3739e466efd8250b4b7b98c1b6c5bf4d40b419b7e/webcolors-24.11.1.tar.gz", hash = "sha256:ecb3d768f32202af770477b8b65f318fa4f566c22948673a977b00d589dd80f6", size = 45064, upload-time = "2024-11-11T07:43:24.224Z" } +sdist = { url = "https://files.pythonhosted.org/packages/1d/7a/eb316761ec35664ea5174709a68bbd3389de60d4a1ebab8808bfc264ed67/webcolors-25.10.0.tar.gz", hash = "sha256:62abae86504f66d0f6364c2a8520de4a0c47b80c03fc3a5f1815fedbef7c19bf", size = 53491, upload-time = "2025-10-31T07:51:03.977Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/60/e8/c0e05e4684d13459f93d312077a9a2efbe04d59c393bc2b8802248c908d4/webcolors-24.11.1-py3-none-any.whl", hash = "sha256:515291393b4cdf0eb19c155749a096f779f7d909f7cceea072791cb9095b92e9", size = 14934, upload-time = "2024-11-11T07:43:22.529Z" }, + { url = "https://files.pythonhosted.org/packages/e2/cc/e097523dd85c9cf5d354f78310927f1656c422bd7b2613b2db3e3f9a0f2c/webcolors-25.10.0-py3-none-any.whl", hash = "sha256:032c727334856fc0b968f63daa252a1ac93d33db2f5267756623c210e57a4f1d", size = 14905, upload-time = "2025-10-31T07:51:01.778Z" }, ] [[package]] @@ -3660,69 +3638,89 @@ wheels = [ [[package]] name = "websocket-client" -version = "1.8.0" +version = "1.9.0" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/e6/30/fba0d96b4b5fbf5948ed3f4681f7da2f9f64512e1d303f94b4cc174c24a5/websocket_client-1.8.0.tar.gz", hash = "sha256:3239df9f44da632f96012472805d40a23281a991027ce11d2f45a6f24ac4c3da", size = 54648, upload-time = "2024-04-23T22:16:16.976Z" } +sdist = { url = "https://files.pythonhosted.org/packages/2c/41/aa4bf9664e4cda14c3b39865b12251e8e7d239f4cd0e3cc1b6c2ccde25c1/websocket_client-1.9.0.tar.gz", hash = "sha256:9e813624b6eb619999a97dc7958469217c3176312b3a16a4bd1bc7e08a46ec98", size = 70576, upload-time = "2025-10-07T21:16:36.495Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/5a/84/44687a29792a70e111c5c477230a72c4b957d88d16141199bf9acb7537a3/websocket_client-1.8.0-py3-none-any.whl", hash = "sha256:17b44cc997f5c498e809b22cdf2d9c7a9e71c02c8cc2b6c56e7c2d1239bfa526", size = 58826, upload-time = "2024-04-23T22:16:14.422Z" }, + { url = "https://files.pythonhosted.org/packages/34/db/b10e48aa8fff7407e67470363eac595018441cf32d5e1001567a7aeba5d2/websocket_client-1.9.0-py3-none-any.whl", hash = "sha256:af248a825037ef591efbf6ed20cc5faa03d3b47b9e5a2230a529eeee1c1fc3ef", size = 82616, upload-time = "2025-10-07T21:16:34.951Z" }, ] [[package]] name = "widgetsnbextension" -version = "4.0.14" +version = "4.0.15" source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/41/53/2e0253c5efd69c9656b1843892052a31c36d37ad42812b5da45c62191f7e/widgetsnbextension-4.0.14.tar.gz", hash = "sha256:a3629b04e3edb893212df862038c7232f62973373869db5084aed739b437b5af", size = 1097428, upload-time = "2025-04-10T13:01:25.628Z" } +sdist = { url = "https://files.pythonhosted.org/packages/bd/f4/c67440c7fb409a71b7404b7aefcd7569a9c0d6bd071299bf4198ae7a5d95/widgetsnbextension-4.0.15.tar.gz", hash = "sha256:de8610639996f1567952d763a5a41af8af37f2575a41f9852a38f947eb82a3b9", size = 1097402, upload-time = "2025-11-01T21:15:55.178Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/ca/51/5447876806d1088a0f8f71e16542bf350918128d0a69437df26047c8e46f/widgetsnbextension-4.0.14-py3-none-any.whl", hash = "sha256:4875a9eaf72fbf5079dc372a51a9f268fc38d46f767cbf85c43a36da5cb9b575", size = 2196503, upload-time = "2025-04-10T13:01:23.086Z" }, + { url = "https://files.pythonhosted.org/packages/3f/0e/fa3b193432cfc60c93b42f3be03365f5f909d2b3ea410295cf36df739e31/widgetsnbextension-4.0.15-py3-none-any.whl", hash = "sha256:8156704e4346a571d9ce73b84bee86a29906c9abfd7223b7228a28899ccf3366", size = 2196503, upload-time = "2025-11-01T21:15:53.565Z" }, ] [[package]] name = "wrapt" -version = "1.17.3" -source = { registry = "https://pypi.org/simple" } -sdist = { url = "https://files.pythonhosted.org/packages/95/8f/aeb76c5b46e273670962298c23e7ddde79916cb74db802131d49a85e4b7d/wrapt-1.17.3.tar.gz", hash = "sha256:f66eb08feaa410fe4eebd17f2a2c8e2e46d3476e9f8c783daa8e09e0faa666d0", size = 55547, upload-time = "2025-08-12T05:53:21.714Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/3f/23/bb82321b86411eb51e5a5db3fb8f8032fd30bd7c2d74bfe936136b2fa1d6/wrapt-1.17.3-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:88bbae4d40d5a46142e70d58bf664a89b6b4befaea7b2ecc14e03cedb8e06c04", size = 53482, upload-time = "2025-08-12T05:51:44.467Z" }, - { url = "https://files.pythonhosted.org/packages/45/69/f3c47642b79485a30a59c63f6d739ed779fb4cc8323205d047d741d55220/wrapt-1.17.3-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:e6b13af258d6a9ad602d57d889f83b9d5543acd471eee12eb51f5b01f8eb1bc2", size = 38676, upload-time = "2025-08-12T05:51:32.636Z" }, - { url = "https://files.pythonhosted.org/packages/d1/71/e7e7f5670c1eafd9e990438e69d8fb46fa91a50785332e06b560c869454f/wrapt-1.17.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:fd341868a4b6714a5962c1af0bd44f7c404ef78720c7de4892901e540417111c", size = 38957, upload-time = "2025-08-12T05:51:54.655Z" }, - { url = "https://files.pythonhosted.org/packages/de/17/9f8f86755c191d6779d7ddead1a53c7a8aa18bccb7cea8e7e72dfa6a8a09/wrapt-1.17.3-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:f9b2601381be482f70e5d1051a5965c25fb3625455a2bf520b5a077b22afb775", size = 81975, upload-time = "2025-08-12T05:52:30.109Z" }, - { url = "https://files.pythonhosted.org/packages/f2/15/dd576273491f9f43dd09fce517f6c2ce6eb4fe21681726068db0d0467096/wrapt-1.17.3-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:343e44b2a8e60e06a7e0d29c1671a0d9951f59174f3709962b5143f60a2a98bd", size = 83149, upload-time = "2025-08-12T05:52:09.316Z" }, - { url = "https://files.pythonhosted.org/packages/0c/c4/5eb4ce0d4814521fee7aa806264bf7a114e748ad05110441cd5b8a5c744b/wrapt-1.17.3-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:33486899acd2d7d3066156b03465b949da3fd41a5da6e394ec49d271baefcf05", size = 82209, upload-time = "2025-08-12T05:52:10.331Z" }, - { url = "https://files.pythonhosted.org/packages/31/4b/819e9e0eb5c8dc86f60dfc42aa4e2c0d6c3db8732bce93cc752e604bb5f5/wrapt-1.17.3-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:e6f40a8aa5a92f150bdb3e1c44b7e98fb7113955b2e5394122fa5532fec4b418", size = 81551, upload-time = "2025-08-12T05:52:31.137Z" }, - { url = "https://files.pythonhosted.org/packages/f8/83/ed6baf89ba3a56694700139698cf703aac9f0f9eb03dab92f57551bd5385/wrapt-1.17.3-cp310-cp310-win32.whl", hash = "sha256:a36692b8491d30a8c75f1dfee65bef119d6f39ea84ee04d9f9311f83c5ad9390", size = 36464, upload-time = "2025-08-12T05:53:01.204Z" }, - { url = "https://files.pythonhosted.org/packages/2f/90/ee61d36862340ad7e9d15a02529df6b948676b9a5829fd5e16640156627d/wrapt-1.17.3-cp310-cp310-win_amd64.whl", hash = "sha256:afd964fd43b10c12213574db492cb8f73b2f0826c8df07a68288f8f19af2ebe6", size = 38748, upload-time = "2025-08-12T05:53:00.209Z" }, - { url = "https://files.pythonhosted.org/packages/bd/c3/cefe0bd330d389c9983ced15d326f45373f4073c9f4a8c2f99b50bfea329/wrapt-1.17.3-cp310-cp310-win_arm64.whl", hash = "sha256:af338aa93554be859173c39c85243970dc6a289fa907402289eeae7543e1ae18", size = 36810, upload-time = "2025-08-12T05:52:51.906Z" }, - { url = "https://files.pythonhosted.org/packages/52/db/00e2a219213856074a213503fdac0511203dceefff26e1daa15250cc01a0/wrapt-1.17.3-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:273a736c4645e63ac582c60a56b0acb529ef07f78e08dc6bfadf6a46b19c0da7", size = 53482, upload-time = "2025-08-12T05:51:45.79Z" }, - { url = "https://files.pythonhosted.org/packages/5e/30/ca3c4a5eba478408572096fe9ce36e6e915994dd26a4e9e98b4f729c06d9/wrapt-1.17.3-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:5531d911795e3f935a9c23eb1c8c03c211661a5060aab167065896bbf62a5f85", size = 38674, upload-time = "2025-08-12T05:51:34.629Z" }, - { url = "https://files.pythonhosted.org/packages/31/25/3e8cc2c46b5329c5957cec959cb76a10718e1a513309c31399a4dad07eb3/wrapt-1.17.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:0610b46293c59a3adbae3dee552b648b984176f8562ee0dba099a56cfbe4df1f", size = 38959, upload-time = "2025-08-12T05:51:56.074Z" }, - { url = "https://files.pythonhosted.org/packages/5d/8f/a32a99fc03e4b37e31b57cb9cefc65050ea08147a8ce12f288616b05ef54/wrapt-1.17.3-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:b32888aad8b6e68f83a8fdccbf3165f5469702a7544472bdf41f582970ed3311", size = 82376, upload-time = "2025-08-12T05:52:32.134Z" }, - { url = "https://files.pythonhosted.org/packages/31/57/4930cb8d9d70d59c27ee1332a318c20291749b4fba31f113c2f8ac49a72e/wrapt-1.17.3-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:8cccf4f81371f257440c88faed6b74f1053eef90807b77e31ca057b2db74edb1", size = 83604, upload-time = "2025-08-12T05:52:11.663Z" }, - { url = "https://files.pythonhosted.org/packages/a8/f3/1afd48de81d63dd66e01b263a6fbb86e1b5053b419b9b33d13e1f6d0f7d0/wrapt-1.17.3-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:d8a210b158a34164de8bb68b0e7780041a903d7b00c87e906fb69928bf7890d5", size = 82782, upload-time = "2025-08-12T05:52:12.626Z" }, - { url = "https://files.pythonhosted.org/packages/1e/d7/4ad5327612173b144998232f98a85bb24b60c352afb73bc48e3e0d2bdc4e/wrapt-1.17.3-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:79573c24a46ce11aab457b472efd8d125e5a51da2d1d24387666cd85f54c05b2", size = 82076, upload-time = "2025-08-12T05:52:33.168Z" }, - { url = "https://files.pythonhosted.org/packages/bb/59/e0adfc831674a65694f18ea6dc821f9fcb9ec82c2ce7e3d73a88ba2e8718/wrapt-1.17.3-cp311-cp311-win32.whl", hash = "sha256:c31eebe420a9a5d2887b13000b043ff6ca27c452a9a22fa71f35f118e8d4bf89", size = 36457, upload-time = "2025-08-12T05:53:03.936Z" }, - { url = "https://files.pythonhosted.org/packages/83/88/16b7231ba49861b6f75fc309b11012ede4d6b0a9c90969d9e0db8d991aeb/wrapt-1.17.3-cp311-cp311-win_amd64.whl", hash = "sha256:0b1831115c97f0663cb77aa27d381237e73ad4f721391a9bfb2fe8bc25fa6e77", size = 38745, upload-time = "2025-08-12T05:53:02.885Z" }, - { url = "https://files.pythonhosted.org/packages/9a/1e/c4d4f3398ec073012c51d1c8d87f715f56765444e1a4b11e5180577b7e6e/wrapt-1.17.3-cp311-cp311-win_arm64.whl", hash = "sha256:5a7b3c1ee8265eb4c8f1b7d29943f195c00673f5ab60c192eba2d4a7eae5f46a", size = 36806, upload-time = "2025-08-12T05:52:53.368Z" }, - { url = "https://files.pythonhosted.org/packages/9f/41/cad1aba93e752f1f9268c77270da3c469883d56e2798e7df6240dcb2287b/wrapt-1.17.3-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:ab232e7fdb44cdfbf55fc3afa31bcdb0d8980b9b95c38b6405df2acb672af0e0", size = 53998, upload-time = "2025-08-12T05:51:47.138Z" }, - { url = "https://files.pythonhosted.org/packages/60/f8/096a7cc13097a1869fe44efe68dace40d2a16ecb853141394047f0780b96/wrapt-1.17.3-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:9baa544e6acc91130e926e8c802a17f3b16fbea0fd441b5a60f5cf2cc5c3deba", size = 39020, upload-time = "2025-08-12T05:51:35.906Z" }, - { url = "https://files.pythonhosted.org/packages/33/df/bdf864b8997aab4febb96a9ae5c124f700a5abd9b5e13d2a3214ec4be705/wrapt-1.17.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:6b538e31eca1a7ea4605e44f81a48aa24c4632a277431a6ed3f328835901f4fd", size = 39098, upload-time = "2025-08-12T05:51:57.474Z" }, - { url = "https://files.pythonhosted.org/packages/9f/81/5d931d78d0eb732b95dc3ddaeeb71c8bb572fb01356e9133916cd729ecdd/wrapt-1.17.3-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:042ec3bb8f319c147b1301f2393bc19dba6e176b7da446853406d041c36c7828", size = 88036, upload-time = "2025-08-12T05:52:34.784Z" }, - { url = "https://files.pythonhosted.org/packages/ca/38/2e1785df03b3d72d34fc6252d91d9d12dc27a5c89caef3335a1bbb8908ca/wrapt-1.17.3-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3af60380ba0b7b5aeb329bc4e402acd25bd877e98b3727b0135cb5c2efdaefe9", size = 88156, upload-time = "2025-08-12T05:52:13.599Z" }, - { url = "https://files.pythonhosted.org/packages/b3/8b/48cdb60fe0603e34e05cffda0b2a4adab81fd43718e11111a4b0100fd7c1/wrapt-1.17.3-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:0b02e424deef65c9f7326d8c19220a2c9040c51dc165cddb732f16198c168396", size = 87102, upload-time = "2025-08-12T05:52:14.56Z" }, - { url = "https://files.pythonhosted.org/packages/3c/51/d81abca783b58f40a154f1b2c56db1d2d9e0d04fa2d4224e357529f57a57/wrapt-1.17.3-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:74afa28374a3c3a11b3b5e5fca0ae03bef8450d6aa3ab3a1e2c30e3a75d023dc", size = 87732, upload-time = "2025-08-12T05:52:36.165Z" }, - { url = "https://files.pythonhosted.org/packages/9e/b1/43b286ca1392a006d5336412d41663eeef1ad57485f3e52c767376ba7e5a/wrapt-1.17.3-cp312-cp312-win32.whl", hash = "sha256:4da9f45279fff3543c371d5ababc57a0384f70be244de7759c85a7f989cb4ebe", size = 36705, upload-time = "2025-08-12T05:53:07.123Z" }, - { url = "https://files.pythonhosted.org/packages/28/de/49493f962bd3c586ab4b88066e967aa2e0703d6ef2c43aa28cb83bf7b507/wrapt-1.17.3-cp312-cp312-win_amd64.whl", hash = "sha256:e71d5c6ebac14875668a1e90baf2ea0ef5b7ac7918355850c0908ae82bcb297c", size = 38877, upload-time = "2025-08-12T05:53:05.436Z" }, - { url = "https://files.pythonhosted.org/packages/f1/48/0f7102fe9cb1e8a5a77f80d4f0956d62d97034bbe88d33e94699f99d181d/wrapt-1.17.3-cp312-cp312-win_arm64.whl", hash = "sha256:604d076c55e2fdd4c1c03d06dc1a31b95130010517b5019db15365ec4a405fc6", size = 36885, upload-time = "2025-08-12T05:52:54.367Z" }, - { url = "https://files.pythonhosted.org/packages/fc/f6/759ece88472157acb55fc195e5b116e06730f1b651b5b314c66291729193/wrapt-1.17.3-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:a47681378a0439215912ef542c45a783484d4dd82bac412b71e59cf9c0e1cea0", size = 54003, upload-time = "2025-08-12T05:51:48.627Z" }, - { url = "https://files.pythonhosted.org/packages/4f/a9/49940b9dc6d47027dc850c116d79b4155f15c08547d04db0f07121499347/wrapt-1.17.3-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:54a30837587c6ee3cd1a4d1c2ec5d24e77984d44e2f34547e2323ddb4e22eb77", size = 39025, upload-time = "2025-08-12T05:51:37.156Z" }, - { url = "https://files.pythonhosted.org/packages/45/35/6a08de0f2c96dcdd7fe464d7420ddb9a7655a6561150e5fc4da9356aeaab/wrapt-1.17.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:16ecf15d6af39246fe33e507105d67e4b81d8f8d2c6598ff7e3ca1b8a37213f7", size = 39108, upload-time = "2025-08-12T05:51:58.425Z" }, - { url = "https://files.pythonhosted.org/packages/0c/37/6faf15cfa41bf1f3dba80cd3f5ccc6622dfccb660ab26ed79f0178c7497f/wrapt-1.17.3-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:6fd1ad24dc235e4ab88cda009e19bf347aabb975e44fd5c2fb22a3f6e4141277", size = 88072, upload-time = "2025-08-12T05:52:37.53Z" }, - { url = "https://files.pythonhosted.org/packages/78/f2/efe19ada4a38e4e15b6dff39c3e3f3f73f5decf901f66e6f72fe79623a06/wrapt-1.17.3-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:0ed61b7c2d49cee3c027372df5809a59d60cf1b6c2f81ee980a091f3afed6a2d", size = 88214, upload-time = "2025-08-12T05:52:15.886Z" }, - { url = "https://files.pythonhosted.org/packages/40/90/ca86701e9de1622b16e09689fc24b76f69b06bb0150990f6f4e8b0eeb576/wrapt-1.17.3-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:423ed5420ad5f5529db9ce89eac09c8a2f97da18eb1c870237e84c5a5c2d60aa", size = 87105, upload-time = "2025-08-12T05:52:17.914Z" }, - { url = "https://files.pythonhosted.org/packages/fd/e0/d10bd257c9a3e15cbf5523025252cc14d77468e8ed644aafb2d6f54cb95d/wrapt-1.17.3-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:e01375f275f010fcbf7f643b4279896d04e571889b8a5b3f848423d91bf07050", size = 87766, upload-time = "2025-08-12T05:52:39.243Z" }, - { url = "https://files.pythonhosted.org/packages/e8/cf/7d848740203c7b4b27eb55dbfede11aca974a51c3d894f6cc4b865f42f58/wrapt-1.17.3-cp313-cp313-win32.whl", hash = "sha256:53e5e39ff71b3fc484df8a522c933ea2b7cdd0d5d15ae82e5b23fde87d44cbd8", size = 36711, upload-time = "2025-08-12T05:53:10.074Z" }, - { url = "https://files.pythonhosted.org/packages/57/54/35a84d0a4d23ea675994104e667ceff49227ce473ba6a59ba2c84f250b74/wrapt-1.17.3-cp313-cp313-win_amd64.whl", hash = "sha256:1f0b2f40cf341ee8cc1a97d51ff50dddb9fcc73241b9143ec74b30fc4f44f6cb", size = 38885, upload-time = "2025-08-12T05:53:08.695Z" }, - { url = "https://files.pythonhosted.org/packages/01/77/66e54407c59d7b02a3c4e0af3783168fff8e5d61def52cda8728439d86bc/wrapt-1.17.3-cp313-cp313-win_arm64.whl", hash = "sha256:7425ac3c54430f5fc5e7b6f41d41e704db073309acfc09305816bc6a0b26bb16", size = 36896, upload-time = "2025-08-12T05:52:55.34Z" }, - { url = "https://files.pythonhosted.org/packages/1f/f6/a933bd70f98e9cf3e08167fc5cd7aaaca49147e48411c0bd5ae701bb2194/wrapt-1.17.3-py3-none-any.whl", hash = "sha256:7171ae35d2c33d326ac19dd8facb1e82e5fd04ef8c6c0e394d7af55a55051c22", size = 23591, upload-time = "2025-08-12T05:53:20.674Z" }, +version = "2.0.1" +source = { registry = "https://pypi.org/simple" } +sdist = { url = "https://files.pythonhosted.org/packages/49/2a/6de8a50cb435b7f42c46126cf1a54b2aab81784e74c8595c8e025e8f36d3/wrapt-2.0.1.tar.gz", hash = "sha256:9c9c635e78497cacb81e84f8b11b23e0aacac7a136e73b8e5b2109a1d9fc468f", size = 82040, upload-time = "2025-11-07T00:45:33.312Z" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/61/0d/12d8c803ed2ce4e5e7d5b9f5f602721f9dfef82c95959f3ce97fa584bb5c/wrapt-2.0.1-cp310-cp310-macosx_10_9_universal2.whl", hash = "sha256:64b103acdaa53b7caf409e8d45d39a8442fe6dcfec6ba3f3d141e0cc2b5b4dbd", size = 77481, upload-time = "2025-11-07T00:43:11.103Z" }, + { url = "https://files.pythonhosted.org/packages/05/3e/4364ebe221ebf2a44d9fc8695a19324692f7dd2795e64bd59090856ebf12/wrapt-2.0.1-cp310-cp310-macosx_10_9_x86_64.whl", hash = "sha256:91bcc576260a274b169c3098e9a3519fb01f2989f6d3d386ef9cbf8653de1374", size = 60692, upload-time = "2025-11-07T00:43:13.697Z" }, + { url = "https://files.pythonhosted.org/packages/1f/ff/ae2a210022b521f86a8ddcdd6058d137c051003812b0388a5e9a03d3fe10/wrapt-2.0.1-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:ab594f346517010050126fcd822697b25a7031d815bb4fbc238ccbe568216489", size = 61574, upload-time = "2025-11-07T00:43:14.967Z" }, + { url = "https://files.pythonhosted.org/packages/c6/93/5cf92edd99617095592af919cb81d4bff61c5dbbb70d3c92099425a8ec34/wrapt-2.0.1-cp310-cp310-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:36982b26f190f4d737f04a492a68accbfc6fa042c3f42326fdfbb6c5b7a20a31", size = 113688, upload-time = "2025-11-07T00:43:18.275Z" }, + { url = "https://files.pythonhosted.org/packages/a0/0a/e38fc0cee1f146c9fb266d8ef96ca39fb14a9eef165383004019aa53f88a/wrapt-2.0.1-cp310-cp310-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:23097ed8bc4c93b7bf36fa2113c6c733c976316ce0ee2c816f64ca06102034ef", size = 115698, upload-time = "2025-11-07T00:43:19.407Z" }, + { url = "https://files.pythonhosted.org/packages/b0/85/bef44ea018b3925fb0bcbe9112715f665e4d5309bd945191da814c314fd1/wrapt-2.0.1-cp310-cp310-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:8bacfe6e001749a3b64db47bcf0341da757c95959f592823a93931a422395013", size = 112096, upload-time = "2025-11-07T00:43:16.5Z" }, + { url = "https://files.pythonhosted.org/packages/7c/0b/733a2376e413117e497aa1a5b1b78e8f3a28c0e9537d26569f67d724c7c5/wrapt-2.0.1-cp310-cp310-musllinux_1_2_aarch64.whl", hash = "sha256:8ec3303e8a81932171f455f792f8df500fc1a09f20069e5c16bd7049ab4e8e38", size = 114878, upload-time = "2025-11-07T00:43:20.81Z" }, + { url = "https://files.pythonhosted.org/packages/da/03/d81dcb21bbf678fcda656495792b059f9d56677d119ca022169a12542bd0/wrapt-2.0.1-cp310-cp310-musllinux_1_2_riscv64.whl", hash = "sha256:3f373a4ab5dbc528a94334f9fe444395b23c2f5332adab9ff4ea82f5a9e33bc1", size = 111298, upload-time = "2025-11-07T00:43:22.229Z" }, + { url = "https://files.pythonhosted.org/packages/c9/d5/5e623040e8056e1108b787020d56b9be93dbbf083bf2324d42cde80f3a19/wrapt-2.0.1-cp310-cp310-musllinux_1_2_x86_64.whl", hash = "sha256:f49027b0b9503bf6c8cdc297ca55006b80c2f5dd36cecc72c6835ab6e10e8a25", size = 113361, upload-time = "2025-11-07T00:43:24.301Z" }, + { url = "https://files.pythonhosted.org/packages/a1/f3/de535ccecede6960e28c7b722e5744846258111d6c9f071aa7578ea37ad3/wrapt-2.0.1-cp310-cp310-win32.whl", hash = "sha256:8330b42d769965e96e01fa14034b28a2a7600fbf7e8f0cc90ebb36d492c993e4", size = 58035, upload-time = "2025-11-07T00:43:28.96Z" }, + { url = "https://files.pythonhosted.org/packages/21/15/39d3ca5428a70032c2ec8b1f1c9d24c32e497e7ed81aed887a4998905fcc/wrapt-2.0.1-cp310-cp310-win_amd64.whl", hash = "sha256:1218573502a8235bb8a7ecaed12736213b22dcde9feab115fa2989d42b5ded45", size = 60383, upload-time = "2025-11-07T00:43:25.804Z" }, + { url = "https://files.pythonhosted.org/packages/43/c2/dfd23754b7f7a4dce07e08f4309c4e10a40046a83e9ae1800f2e6b18d7c1/wrapt-2.0.1-cp310-cp310-win_arm64.whl", hash = "sha256:eda8e4ecd662d48c28bb86be9e837c13e45c58b8300e43ba3c9b4fa9900302f7", size = 58894, upload-time = "2025-11-07T00:43:27.074Z" }, + { url = "https://files.pythonhosted.org/packages/98/60/553997acf3939079dab022e37b67b1904b5b0cc235503226898ba573b10c/wrapt-2.0.1-cp311-cp311-macosx_10_9_universal2.whl", hash = "sha256:0e17283f533a0d24d6e5429a7d11f250a58d28b4ae5186f8f47853e3e70d2590", size = 77480, upload-time = "2025-11-07T00:43:30.573Z" }, + { url = "https://files.pythonhosted.org/packages/2d/50/e5b3d30895d77c52105c6d5cbf94d5b38e2a3dd4a53d22d246670da98f7c/wrapt-2.0.1-cp311-cp311-macosx_10_9_x86_64.whl", hash = "sha256:85df8d92158cb8f3965aecc27cf821461bb5f40b450b03facc5d9f0d4d6ddec6", size = 60690, upload-time = "2025-11-07T00:43:31.594Z" }, + { url = "https://files.pythonhosted.org/packages/f0/40/660b2898703e5cbbb43db10cdefcc294274458c3ca4c68637c2b99371507/wrapt-2.0.1-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:c1be685ac7700c966b8610ccc63c3187a72e33cab53526a27b2a285a662cd4f7", size = 61578, upload-time = "2025-11-07T00:43:32.918Z" }, + { url = "https://files.pythonhosted.org/packages/5b/36/825b44c8a10556957bc0c1d84c7b29a40e05fcf1873b6c40aa9dbe0bd972/wrapt-2.0.1-cp311-cp311-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:df0b6d3b95932809c5b3fecc18fda0f1e07452d05e2662a0b35548985f256e28", size = 114115, upload-time = "2025-11-07T00:43:35.605Z" }, + { url = "https://files.pythonhosted.org/packages/83/73/0a5d14bb1599677304d3c613a55457d34c344e9b60eda8a737c2ead7619e/wrapt-2.0.1-cp311-cp311-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:4da7384b0e5d4cae05c97cd6f94faaf78cc8b0f791fc63af43436d98c4ab37bb", size = 116157, upload-time = "2025-11-07T00:43:37.058Z" }, + { url = "https://files.pythonhosted.org/packages/01/22/1c158fe763dbf0a119f985d945711d288994fe5514c0646ebe0eb18b016d/wrapt-2.0.1-cp311-cp311-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:ec65a78fbd9d6f083a15d7613b2800d5663dbb6bb96003899c834beaa68b242c", size = 112535, upload-time = "2025-11-07T00:43:34.138Z" }, + { url = "https://files.pythonhosted.org/packages/5c/28/4f16861af67d6de4eae9927799b559c20ebdd4fe432e89ea7fe6fcd9d709/wrapt-2.0.1-cp311-cp311-musllinux_1_2_aarch64.whl", hash = "sha256:7de3cc939be0e1174969f943f3b44e0d79b6f9a82198133a5b7fc6cc92882f16", size = 115404, upload-time = "2025-11-07T00:43:39.214Z" }, + { url = "https://files.pythonhosted.org/packages/a0/8b/7960122e625fad908f189b59c4aae2d50916eb4098b0fb2819c5a177414f/wrapt-2.0.1-cp311-cp311-musllinux_1_2_riscv64.whl", hash = "sha256:fb1a5b72cbd751813adc02ef01ada0b0d05d3dcbc32976ce189a1279d80ad4a2", size = 111802, upload-time = "2025-11-07T00:43:40.476Z" }, + { url = "https://files.pythonhosted.org/packages/3e/73/7881eee5ac31132a713ab19a22c9e5f1f7365c8b1df50abba5d45b781312/wrapt-2.0.1-cp311-cp311-musllinux_1_2_x86_64.whl", hash = "sha256:3fa272ca34332581e00bf7773e993d4f632594eb2d1b0b162a9038df0fd971dd", size = 113837, upload-time = "2025-11-07T00:43:42.921Z" }, + { url = "https://files.pythonhosted.org/packages/45/00/9499a3d14e636d1f7089339f96c4409bbc7544d0889f12264efa25502ae8/wrapt-2.0.1-cp311-cp311-win32.whl", hash = "sha256:fc007fdf480c77301ab1afdbb6ab22a5deee8885f3b1ed7afcb7e5e84a0e27be", size = 58028, upload-time = "2025-11-07T00:43:47.369Z" }, + { url = "https://files.pythonhosted.org/packages/70/5d/8f3d7eea52f22638748f74b102e38fdf88cb57d08ddeb7827c476a20b01b/wrapt-2.0.1-cp311-cp311-win_amd64.whl", hash = "sha256:47434236c396d04875180171ee1f3815ca1eada05e24a1ee99546320d54d1d1b", size = 60385, upload-time = "2025-11-07T00:43:44.34Z" }, + { url = "https://files.pythonhosted.org/packages/14/e2/32195e57a8209003587bbbad44d5922f13e0ced2a493bb46ca882c5b123d/wrapt-2.0.1-cp311-cp311-win_arm64.whl", hash = "sha256:837e31620e06b16030b1d126ed78e9383815cbac914693f54926d816d35d8edf", size = 58893, upload-time = "2025-11-07T00:43:46.161Z" }, + { url = "https://files.pythonhosted.org/packages/cb/73/8cb252858dc8254baa0ce58ce382858e3a1cf616acebc497cb13374c95c6/wrapt-2.0.1-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:1fdbb34da15450f2b1d735a0e969c24bdb8d8924892380126e2a293d9902078c", size = 78129, upload-time = "2025-11-07T00:43:48.852Z" }, + { url = "https://files.pythonhosted.org/packages/19/42/44a0db2108526ee6e17a5ab72478061158f34b08b793df251d9fbb9a7eb4/wrapt-2.0.1-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:3d32794fe940b7000f0519904e247f902f0149edbe6316c710a8562fb6738841", size = 61205, upload-time = "2025-11-07T00:43:50.402Z" }, + { url = "https://files.pythonhosted.org/packages/4d/8a/5b4b1e44b791c22046e90d9b175f9a7581a8cc7a0debbb930f81e6ae8e25/wrapt-2.0.1-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:386fb54d9cd903ee0012c09291336469eb7b244f7183d40dc3e86a16a4bace62", size = 61692, upload-time = "2025-11-07T00:43:51.678Z" }, + { url = "https://files.pythonhosted.org/packages/11/53/3e794346c39f462bcf1f58ac0487ff9bdad02f9b6d5ee2dc84c72e0243b2/wrapt-2.0.1-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:7b219cb2182f230676308cdcacd428fa837987b89e4b7c5c9025088b8a6c9faf", size = 121492, upload-time = "2025-11-07T00:43:55.017Z" }, + { url = "https://files.pythonhosted.org/packages/c6/7e/10b7b0e8841e684c8ca76b462a9091c45d62e8f2de9c4b1390b690eadf16/wrapt-2.0.1-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:641e94e789b5f6b4822bb8d8ebbdfc10f4e4eae7756d648b717d980f657a9eb9", size = 123064, upload-time = "2025-11-07T00:43:56.323Z" }, + { url = "https://files.pythonhosted.org/packages/0e/d1/3c1e4321fc2f5ee7fd866b2d822aa89b84495f28676fd976c47327c5b6aa/wrapt-2.0.1-cp312-cp312-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:fe21b118b9f58859b5ebaa4b130dee18669df4bd111daad082b7beb8799ad16b", size = 117403, upload-time = "2025-11-07T00:43:53.258Z" }, + { url = "https://files.pythonhosted.org/packages/a4/b0/d2f0a413cf201c8c2466de08414a15420a25aa83f53e647b7255cc2fab5d/wrapt-2.0.1-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:17fb85fa4abc26a5184d93b3efd2dcc14deb4b09edcdb3535a536ad34f0b4dba", size = 121500, upload-time = "2025-11-07T00:43:57.468Z" }, + { url = "https://files.pythonhosted.org/packages/bd/45/bddb11d28ca39970a41ed48a26d210505120f925918592283369219f83cc/wrapt-2.0.1-cp312-cp312-musllinux_1_2_riscv64.whl", hash = "sha256:b89ef9223d665ab255ae42cc282d27d69704d94be0deffc8b9d919179a609684", size = 116299, upload-time = "2025-11-07T00:43:58.877Z" }, + { url = "https://files.pythonhosted.org/packages/81/af/34ba6dd570ef7a534e7eec0c25e2615c355602c52aba59413411c025a0cb/wrapt-2.0.1-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:a453257f19c31b31ba593c30d997d6e5be39e3b5ad9148c2af5a7314061c63eb", size = 120622, upload-time = "2025-11-07T00:43:59.962Z" }, + { url = "https://files.pythonhosted.org/packages/e2/3e/693a13b4146646fb03254636f8bafd20c621955d27d65b15de07ab886187/wrapt-2.0.1-cp312-cp312-win32.whl", hash = "sha256:3e271346f01e9c8b1130a6a3b0e11908049fe5be2d365a5f402778049147e7e9", size = 58246, upload-time = "2025-11-07T00:44:03.169Z" }, + { url = "https://files.pythonhosted.org/packages/a7/36/715ec5076f925a6be95f37917b66ebbeaa1372d1862c2ccd7a751574b068/wrapt-2.0.1-cp312-cp312-win_amd64.whl", hash = "sha256:2da620b31a90cdefa9cd0c2b661882329e2e19d1d7b9b920189956b76c564d75", size = 60492, upload-time = "2025-11-07T00:44:01.027Z" }, + { url = "https://files.pythonhosted.org/packages/ef/3e/62451cd7d80f65cc125f2b426b25fbb6c514bf6f7011a0c3904fc8c8df90/wrapt-2.0.1-cp312-cp312-win_arm64.whl", hash = "sha256:aea9c7224c302bc8bfc892b908537f56c430802560e827b75ecbde81b604598b", size = 58987, upload-time = "2025-11-07T00:44:02.095Z" }, + { url = "https://files.pythonhosted.org/packages/ad/fe/41af4c46b5e498c90fc87981ab2972fbd9f0bccda597adb99d3d3441b94b/wrapt-2.0.1-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:47b0f8bafe90f7736151f61482c583c86b0693d80f075a58701dd1549b0010a9", size = 78132, upload-time = "2025-11-07T00:44:04.628Z" }, + { url = "https://files.pythonhosted.org/packages/1c/92/d68895a984a5ebbbfb175512b0c0aad872354a4a2484fbd5552e9f275316/wrapt-2.0.1-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:cbeb0971e13b4bd81d34169ed57a6dda017328d1a22b62fda45e1d21dd06148f", size = 61211, upload-time = "2025-11-07T00:44:05.626Z" }, + { url = "https://files.pythonhosted.org/packages/e8/26/ba83dc5ae7cf5aa2b02364a3d9cf74374b86169906a1f3ade9a2d03cf21c/wrapt-2.0.1-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:eb7cffe572ad0a141a7886a1d2efa5bef0bf7fe021deeea76b3ab334d2c38218", size = 61689, upload-time = "2025-11-07T00:44:06.719Z" }, + { url = "https://files.pythonhosted.org/packages/cf/67/d7a7c276d874e5d26738c22444d466a3a64ed541f6ef35f740dbd865bab4/wrapt-2.0.1-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:c8d60527d1ecfc131426b10d93ab5d53e08a09c5fa0175f6b21b3252080c70a9", size = 121502, upload-time = "2025-11-07T00:44:09.557Z" }, + { url = "https://files.pythonhosted.org/packages/0f/6b/806dbf6dd9579556aab22fc92908a876636e250f063f71548a8660382184/wrapt-2.0.1-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c654eafb01afac55246053d67a4b9a984a3567c3808bb7df2f8de1c1caba2e1c", size = 123110, upload-time = "2025-11-07T00:44:10.64Z" }, + { url = "https://files.pythonhosted.org/packages/e5/08/cdbb965fbe4c02c5233d185d070cabed2ecc1f1e47662854f95d77613f57/wrapt-2.0.1-cp313-cp313-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:98d873ed6c8b4ee2418f7afce666751854d6d03e3c0ec2a399bb039cd2ae89db", size = 117434, upload-time = "2025-11-07T00:44:08.138Z" }, + { url = "https://files.pythonhosted.org/packages/2d/d1/6aae2ce39db4cb5216302fa2e9577ad74424dfbe315bd6669725569e048c/wrapt-2.0.1-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:c9e850f5b7fc67af856ff054c71690d54fa940c3ef74209ad9f935b4f66a0233", size = 121533, upload-time = "2025-11-07T00:44:12.142Z" }, + { url = "https://files.pythonhosted.org/packages/79/35/565abf57559fbe0a9155c29879ff43ce8bd28d2ca61033a3a3dd67b70794/wrapt-2.0.1-cp313-cp313-musllinux_1_2_riscv64.whl", hash = "sha256:e505629359cb5f751e16e30cf3f91a1d3ddb4552480c205947da415d597f7ac2", size = 116324, upload-time = "2025-11-07T00:44:13.28Z" }, + { url = "https://files.pythonhosted.org/packages/e1/e0/53ff5e76587822ee33e560ad55876d858e384158272cd9947abdd4ad42ca/wrapt-2.0.1-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:2879af909312d0baf35f08edeea918ee3af7ab57c37fe47cb6a373c9f2749c7b", size = 120627, upload-time = "2025-11-07T00:44:14.431Z" }, + { url = "https://files.pythonhosted.org/packages/7c/7b/38df30fd629fbd7612c407643c63e80e1c60bcc982e30ceeae163a9800e7/wrapt-2.0.1-cp313-cp313-win32.whl", hash = "sha256:d67956c676be5a24102c7407a71f4126d30de2a569a1c7871c9f3cabc94225d7", size = 58252, upload-time = "2025-11-07T00:44:17.814Z" }, + { url = "https://files.pythonhosted.org/packages/85/64/d3954e836ea67c4d3ad5285e5c8fd9d362fd0a189a2db622df457b0f4f6a/wrapt-2.0.1-cp313-cp313-win_amd64.whl", hash = "sha256:9ca66b38dd642bf90c59b6738af8070747b610115a39af2498535f62b5cdc1c3", size = 60500, upload-time = "2025-11-07T00:44:15.561Z" }, + { url = "https://files.pythonhosted.org/packages/89/4e/3c8b99ac93527cfab7f116089db120fef16aac96e5f6cdb724ddf286086d/wrapt-2.0.1-cp313-cp313-win_arm64.whl", hash = "sha256:5a4939eae35db6b6cec8e7aa0e833dcca0acad8231672c26c2a9ab7a0f8ac9c8", size = 58993, upload-time = "2025-11-07T00:44:16.65Z" }, + { url = "https://files.pythonhosted.org/packages/f9/f4/eff2b7d711cae20d220780b9300faa05558660afb93f2ff5db61fe725b9a/wrapt-2.0.1-cp313-cp313t-macosx_10_13_universal2.whl", hash = "sha256:a52f93d95c8d38fed0669da2ebdb0b0376e895d84596a976c15a9eb45e3eccb3", size = 82028, upload-time = "2025-11-07T00:44:18.944Z" }, + { url = "https://files.pythonhosted.org/packages/0c/67/cb945563f66fd0f61a999339460d950f4735c69f18f0a87ca586319b1778/wrapt-2.0.1-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:4e54bbf554ee29fcceee24fa41c4d091398b911da6e7f5d7bffda963c9aed2e1", size = 62949, upload-time = "2025-11-07T00:44:20.074Z" }, + { url = "https://files.pythonhosted.org/packages/ec/ca/f63e177f0bbe1e5cf5e8d9b74a286537cd709724384ff20860f8f6065904/wrapt-2.0.1-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:908f8c6c71557f4deaa280f55d0728c3bca0960e8c3dd5ceeeafb3c19942719d", size = 63681, upload-time = "2025-11-07T00:44:21.345Z" }, + { url = "https://files.pythonhosted.org/packages/39/a1/1b88fcd21fd835dca48b556daef750952e917a2794fa20c025489e2e1f0f/wrapt-2.0.1-cp313-cp313t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:e2f84e9af2060e3904a32cea9bb6db23ce3f91cfd90c6b426757cf7cc01c45c7", size = 152696, upload-time = "2025-11-07T00:44:24.318Z" }, + { url = "https://files.pythonhosted.org/packages/62/1c/d9185500c1960d9f5f77b9c0b890b7fc62282b53af7ad1b6bd779157f714/wrapt-2.0.1-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e3612dc06b436968dfb9142c62e5dfa9eb5924f91120b3c8ff501ad878f90eb3", size = 158859, upload-time = "2025-11-07T00:44:25.494Z" }, + { url = "https://files.pythonhosted.org/packages/91/60/5d796ed0f481ec003220c7878a1d6894652efe089853a208ea0838c13086/wrapt-2.0.1-cp313-cp313t-manylinux_2_31_riscv64.manylinux_2_39_riscv64.whl", hash = "sha256:6d2d947d266d99a1477cd005b23cbd09465276e302515e122df56bb9511aca1b", size = 146068, upload-time = "2025-11-07T00:44:22.81Z" }, + { url = "https://files.pythonhosted.org/packages/04/f8/75282dd72f102ddbfba137e1e15ecba47b40acff32c08ae97edbf53f469e/wrapt-2.0.1-cp313-cp313t-musllinux_1_2_aarch64.whl", hash = "sha256:7d539241e87b650cbc4c3ac9f32c8d1ac8a54e510f6dca3f6ab60dcfd48c9b10", size = 155724, upload-time = "2025-11-07T00:44:26.634Z" }, + { url = "https://files.pythonhosted.org/packages/5a/27/fe39c51d1b344caebb4a6a9372157bdb8d25b194b3561b52c8ffc40ac7d1/wrapt-2.0.1-cp313-cp313t-musllinux_1_2_riscv64.whl", hash = "sha256:4811e15d88ee62dbf5c77f2c3ff3932b1e3ac92323ba3912f51fc4016ce81ecf", size = 144413, upload-time = "2025-11-07T00:44:27.939Z" }, + { url = "https://files.pythonhosted.org/packages/83/2b/9f6b643fe39d4505c7bf926d7c2595b7cb4b607c8c6b500e56c6b36ac238/wrapt-2.0.1-cp313-cp313t-musllinux_1_2_x86_64.whl", hash = "sha256:c1c91405fcf1d501fa5d55df21e58ea49e6b879ae829f1039faaf7e5e509b41e", size = 150325, upload-time = "2025-11-07T00:44:29.29Z" }, + { url = "https://files.pythonhosted.org/packages/bb/b6/20ffcf2558596a7f58a2e69c89597128781f0b88e124bf5a4cadc05b8139/wrapt-2.0.1-cp313-cp313t-win32.whl", hash = "sha256:e76e3f91f864e89db8b8d2a8311d57df93f01ad6bb1e9b9976d1f2e83e18315c", size = 59943, upload-time = "2025-11-07T00:44:33.211Z" }, + { url = "https://files.pythonhosted.org/packages/87/6a/0e56111cbb3320151eed5d3821ee1373be13e05b376ea0870711f18810c3/wrapt-2.0.1-cp313-cp313t-win_amd64.whl", hash = "sha256:83ce30937f0ba0d28818807b303a412440c4b63e39d3d8fc036a94764b728c92", size = 63240, upload-time = "2025-11-07T00:44:30.935Z" }, + { url = "https://files.pythonhosted.org/packages/1d/54/5ab4c53ea1f7f7e5c3e7c1095db92932cc32fd62359d285486d00c2884c3/wrapt-2.0.1-cp313-cp313t-win_arm64.whl", hash = "sha256:4b55cacc57e1dc2d0991dbe74c6419ffd415fb66474a02335cb10efd1aa3f84f", size = 60416, upload-time = "2025-11-07T00:44:32.002Z" }, + { url = "https://files.pythonhosted.org/packages/15/d1/b51471c11592ff9c012bd3e2f7334a6ff2f42a7aed2caffcf0bdddc9cb89/wrapt-2.0.1-py3-none-any.whl", hash = "sha256:4d2ce1bf1a48c5277d7969259232b57645aae5686dba1eaeade39442277afbca", size = 44046, upload-time = "2025-11-07T00:45:32.116Z" }, ] [[package]] @@ -3744,20 +3742,20 @@ wheels = [ [[package]] name = "xarray" -version = "2025.9.0" +version = "2025.12.0" source = { registry = "https://pypi.org/simple" } resolution-markers = [ "python_full_version >= '3.12'", "python_full_version == '3.11.*'", ] dependencies = [ - { name = "numpy", version = "2.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, + { name = "numpy", version = "2.3.5", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "packaging", marker = "python_full_version >= '3.11'" }, { name = "pandas", marker = "python_full_version >= '3.11'" }, ] -sdist = { url = "https://files.pythonhosted.org/packages/4e/0b/bbb76e05c8e2099baf90e259c29cafe6a525524b1d1da8bfbc39577c043e/xarray-2025.9.0.tar.gz", hash = "sha256:7dd6816fe0062c49c5e9370dd483843bc13e5ed80a47a9ff10baff2b51e070fb", size = 3040318, upload-time = "2025-09-04T04:20:26.296Z" } +sdist = { url = "https://files.pythonhosted.org/packages/d3/af/7b945f331ba8911fdfff2fdfa092763156119f124be1ba4144615c540222/xarray-2025.12.0.tar.gz", hash = "sha256:73f6a6fadccc69c4d45bdd70821a47c72de078a8a0313ff8b1e97cd54ac59fed", size = 3082244, upload-time = "2025-12-05T21:51:22.432Z" } wheels = [ - { url = "https://files.pythonhosted.org/packages/8d/f0/73c24457c941b8b08f7d090853e40f4b2cdde88b5da721f3f28e98df77c9/xarray-2025.9.0-py3-none-any.whl", hash = "sha256:79f0e25fb39571f612526ee998ee5404d8725a1db3951aabffdb287388885df0", size = 1349595, upload-time = "2025-09-04T04:20:24.36Z" }, + { url = "https://files.pythonhosted.org/packages/d5/e4/62a677feefde05b12a70a4fc9bdc8558010182a801fbcab68cb56c2b0986/xarray-2025.12.0-py3-none-any.whl", hash = "sha256:9e77e820474dbbe4c6c2954d0da6342aa484e33adaa96ab916b15a786181e970", size = 1381742, upload-time = "2025-12-05T21:51:20.841Z" }, ] [[package]] From 31ea44cb084e5717cad504a91dd637f400fae711 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sat, 20 Dec 2025 23:33:15 +0100 Subject: [PATCH 02/14] More fixes --- ruff.toml | 1 + skfp/applicability_domain/bounding_box.py | 2 +- skfp/applicability_domain/convex_hull.py | 2 +- .../distance_to_centroid.py | 2 +- .../applicability_domain/hotelling_t2_test.py | 2 +- skfp/applicability_domain/knn.py | 2 +- skfp/applicability_domain/leverage.py | 2 +- skfp/applicability_domain/pca_bounding_box.py | 2 +- .../response_variable_range.py | 2 +- skfp/applicability_domain/topkat.py | 2 +- skfp/bases/base_ad_checker.py | 4 +-- skfp/descriptors/constitutional.py | 2 +- skfp/descriptors/topological.py | 18 ++++++------- skfp/distances/braun_blanquet.py | 12 ++++----- skfp/distances/ct4.py | 24 ++++++++--------- skfp/distances/dice.py | 24 ++++++++--------- skfp/distances/fraggle.py | 2 +- skfp/distances/harris_lahey.py | 12 ++++----- skfp/distances/kulczynski.py | 12 ++++----- skfp/distances/mcconnaughey.py | 12 ++++----- skfp/distances/rand.py | 12 ++++----- skfp/distances/rogot_goldberg.py | 12 ++++----- skfp/distances/russell.py | 12 ++++----- skfp/distances/simpson.py | 12 ++++----- skfp/distances/sokal_sneath.py | 12 ++++----- skfp/distances/tanimoto.py | 24 ++++++++--------- skfp/filters/faf4_druglike.py | 2 +- skfp/filters/faf4_leadlike.py | 4 ++- skfp/filters/gsk.py | 4 ++- skfp/filters/nibr.py | 4 ++- skfp/filters/oprea.py | 4 ++- skfp/filters/rule_of_three.py | 2 +- skfp/filters/rule_of_two.py | 13 ++++++---- skfp/filters/rule_of_veber.py | 13 ++++++---- skfp/filters/rule_of_xu.py | 13 ++++++---- skfp/filters/tice_herbicides.py | 17 +++++++----- skfp/filters/tice_insecticides.py | 17 +++++++----- skfp/filters/valence_discovery.py | 21 +++++++++------ skfp/filters/zinc_druglike.py | 23 +++++++++------- skfp/fingerprints/autocorr.py | 2 +- skfp/fingerprints/bcut2d.py | 6 ++--- skfp/fingerprints/e3fp_fp.py | 4 +-- skfp/fingerprints/electroshape.py | 6 ++--- skfp/fingerprints/estate.py | 2 +- skfp/fingerprints/functional_groups.py | 2 +- skfp/fingerprints/getaway.py | 6 ++--- skfp/fingerprints/ghose_crippen.py | 2 +- .../klekota_roth/klekota_roth_fp.py | 2 +- skfp/fingerprints/laggner.py | 2 +- skfp/fingerprints/maccs.py | 2 +- skfp/fingerprints/mordred_fp.py | 2 +- skfp/fingerprints/morse.py | 2 +- skfp/fingerprints/mqns.py | 2 +- skfp/fingerprints/pubchem/pubchem_fp.py | 2 +- skfp/fingerprints/rdf.py | 6 ++--- skfp/fingerprints/rdkit_2d_desc.py | 2 +- skfp/fingerprints/usr.py | 8 +++--- skfp/fingerprints/usrcat.py | 6 ++--- skfp/fingerprints/vsa.py | 4 +-- skfp/fingerprints/whim.py | 6 ++--- skfp/metrics/multioutput.py | 26 +++++++++---------- skfp/preprocessing/input_output/sdf.py | 4 +-- skfp/utils/parallel.py | 2 +- skfp/utils/validators.py | 9 ++++--- 64 files changed, 249 insertions(+), 230 deletions(-) diff --git a/ruff.toml b/ruff.toml index 98b53157..3db43e3e 100644 --- a/ruff.toml +++ b/ruff.toml @@ -39,6 +39,7 @@ ignore = [ "D413", # no empty line after last docstring section # various other things + "ARG002", # unused arguments due to scikit-learn API "B028", # simple warnings "C408", # call dict(), list(), set() "E731", # Lambda expressions diff --git a/skfp/applicability_domain/bounding_box.py b/skfp/applicability_domain/bounding_box.py index 9b07ef43..291eba6c 100644 --- a/skfp/applicability_domain/bounding_box.py +++ b/skfp/applicability_domain/bounding_box.py @@ -109,7 +109,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/convex_hull.py b/skfp/applicability_domain/convex_hull.py index 46035fc0..9c2458f9 100644 --- a/skfp/applicability_domain/convex_hull.py +++ b/skfp/applicability_domain/convex_hull.py @@ -93,7 +93,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) self.points_ = X diff --git a/skfp/applicability_domain/distance_to_centroid.py b/skfp/applicability_domain/distance_to_centroid.py index a81ab02e..a00849d8 100644 --- a/skfp/applicability_domain/distance_to_centroid.py +++ b/skfp/applicability_domain/distance_to_centroid.py @@ -167,7 +167,7 @@ def _validate_params(self) -> None: def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/hotelling_t2_test.py b/skfp/applicability_domain/hotelling_t2_test.py index 802e296a..0c78ceb2 100644 --- a/skfp/applicability_domain/hotelling_t2_test.py +++ b/skfp/applicability_domain/hotelling_t2_test.py @@ -89,7 +89,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 1c6e18f5..1061c78c 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -151,7 +151,7 @@ def _validate_params(self) -> None: def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) if self.k > X.shape[0]: diff --git a/skfp/applicability_domain/leverage.py b/skfp/applicability_domain/leverage.py index 2383b46b..f59fc1d8 100644 --- a/skfp/applicability_domain/leverage.py +++ b/skfp/applicability_domain/leverage.py @@ -104,7 +104,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/pca_bounding_box.py b/skfp/applicability_domain/pca_bounding_box.py index 7e0cd38c..29dba18e 100644 --- a/skfp/applicability_domain/pca_bounding_box.py +++ b/skfp/applicability_domain/pca_bounding_box.py @@ -105,7 +105,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/response_variable_range.py b/skfp/applicability_domain/response_variable_range.py index 47f5d784..32b9c8c8 100644 --- a/skfp/applicability_domain/response_variable_range.py +++ b/skfp/applicability_domain/response_variable_range.py @@ -93,7 +93,7 @@ def __init__( def fit( # type: ignore[override] # noqa: D102 self, y: np.ndarray, - X: np.ndarray | None = None, # noqa: ARG002 + X: np.ndarray | None = None, ): y = check_array(y, ensure_2d=False, allow_nd=False) if y.ndim != 1: diff --git a/skfp/applicability_domain/topkat.py b/skfp/applicability_domain/topkat.py index 88c409a9..e777f56f 100644 --- a/skfp/applicability_domain/topkat.py +++ b/skfp/applicability_domain/topkat.py @@ -85,7 +85,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, # noqa: ARG002 + y: np.ndarray | None = None, ): X = validate_data(self, X=X) diff --git a/skfp/bases/base_ad_checker.py b/skfp/bases/base_ad_checker.py index a3ce16db..c025dc63 100644 --- a/skfp/bases/base_ad_checker.py +++ b/skfp/bases/base_ad_checker.py @@ -89,7 +89,7 @@ def fit(self, X: np.ndarray, y: np.ndarray | None = None): @abstractmethod def predict(self, X: np.ndarray) -> np.ndarray: """ - Predict labels (1 inside AD, 0 outside AD) of X according to fitted model. + Predict labels (1 inside AD, 0 outside AD) of X according to the fitted model. Parameters ---------- @@ -99,7 +99,7 @@ def predict(self, X: np.ndarray) -> np.ndarray: Returns ------- is_inside_applicability_domain : ndarray of shape (n_samples,) - Returns 1 for molecules inside applicability domain, and 0 for those + Returns 1 for molecules inside the applicability domain, and 0 for those outside (outliers). """ raise NotImplementedError diff --git a/skfp/descriptors/constitutional.py b/skfp/descriptors/constitutional.py index 554a04aa..75bd4716 100644 --- a/skfp/descriptors/constitutional.py +++ b/skfp/descriptors/constitutional.py @@ -47,7 +47,7 @@ def bond_count(mol: Mol, bond_type: str | None = None) -> int: mol : RDKit ``Mol`` object The molecule for which the bond count is to be calculated. - bond_type : str, optional + bond_type : str, default=None If ``None``, returns the total number of bonds. Otherwise, the valid options are RDKit bond types [1]_, e.g. "SINGLE", "DOUBLE", "TRIPLE", "AROMATIC". diff --git a/skfp/descriptors/topological.py b/skfp/descriptors/topological.py index d129d6f6..6dc274b8 100644 --- a/skfp/descriptors/topological.py +++ b/skfp/descriptors/topological.py @@ -21,7 +21,7 @@ def average_wiener_index(mol: Mol, distance_matrix: np.ndarray | None = None) -> mol : RDKit ``Mol`` object The molecule for which the Average Wiener index is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated using RDKit. References @@ -70,7 +70,7 @@ def balaban_j_index(mol: Mol, distance_matrix: np.ndarray | None = None) -> floa mol : RDKit ``Mol`` object The molecule for which the Balaban's J index is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated by RDKit. References @@ -118,7 +118,7 @@ def burden_matrix(mol: Mol, descriptors: np.ndarray | None = None) -> np.ndarray mol : RDKit ``Mol`` object The molecule for which the Balaban's J index is to be calculated. - descriptors : np.ndarray, optional + descriptors : np.ndarray, default=None Vector of atomic descriptors, with the same length as number of atoms in the input molecule. @@ -189,7 +189,7 @@ def diameter(mol: Mol, distance_matrix: np.ndarray | None = None) -> int: mol : RDKit ``Mol`` object The molecule for which the diameter is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated. References @@ -238,7 +238,7 @@ def graph_distance_index(mol: Mol, distance_matrix: np.ndarray | None = None) -> mol : RDKit ``Mol`` object The molecule for which the Graph Distance Index is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated using RDKit. References @@ -323,7 +323,7 @@ def petitjean_index(mol: Mol, distance_matrix: np.ndarray | None = None) -> floa mol : RDKit ``Mol`` object The molecule for which the Petitjean index is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated. References @@ -364,7 +364,7 @@ def polarity_number( mol : RDKit ``Mol`` object The molecule for which the Polarity Number is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated using RDKit. carbon_only : bool, default=False @@ -544,7 +544,7 @@ def radius(mol: Mol, distance_matrix: np.ndarray | None = None) -> int: mol : RDKit ``Mol`` object The molecule for which the radius is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated. References @@ -583,7 +583,7 @@ def wiener_index(mol: Mol, distance_matrix: np.ndarray | None = None) -> int: mol : RDKit ``Mol`` object The molecule for which the Wiener index is to be calculated. - distance_matrix : np.ndarray, optional + distance_matrix : np.ndarray, default=None Precomputed distance matrix. If not provided, it will be calculated using RDKit. References diff --git a/skfp/distances/braun_blanquet.py b/skfp/distances/braun_blanquet.py index 0a98aafa..e59f02a9 100644 --- a/skfp/distances/braun_blanquet.py +++ b/skfp/distances/braun_blanquet.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -91,8 +91,8 @@ def braun_blanquet_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -163,7 +163,7 @@ def braun_blanquet_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -250,7 +250,7 @@ def _bulk_braun_blanquet_binary_similarity_two( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/ct4.py b/skfp/distances/ct4.py index ce38f49d..c508e759 100644 --- a/skfp/distances/ct4.py +++ b/skfp/distances/ct4.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -97,8 +97,8 @@ def ct4_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -174,8 +174,8 @@ def ct4_binary_distance( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -268,8 +268,8 @@ def ct4_count_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -345,7 +345,7 @@ def ct4_count_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -434,7 +434,7 @@ def _bulk_ct4_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarray: @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -472,7 +472,7 @@ def bulk_ct4_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -552,7 +552,7 @@ def _bulk_ct4_count_similarity_two(X: csr_array, Y: csr_array) -> np.ndarray: @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/dice.py b/skfp/distances/dice.py index ac52f961..3b372eec 100644 --- a/skfp/distances/dice.py +++ b/skfp/distances/dice.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -98,8 +98,8 @@ def dice_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -175,8 +175,8 @@ def dice_binary_distance( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -268,8 +268,8 @@ def dice_count_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -345,7 +345,7 @@ def dice_count_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -441,7 +441,7 @@ def _bulk_dice_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarray: @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -500,7 +500,7 @@ def bulk_dice_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -595,7 +595,7 @@ def _bulk_dice_count_similarity_two(X: csr_array, Y: csr_array) -> np.ndarray: @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/fraggle.py b/skfp/distances/fraggle.py index 2a928524..e601c15e 100644 --- a/skfp/distances/fraggle.py +++ b/skfp/distances/fraggle.py @@ -111,7 +111,7 @@ def fraggle_distance( dist(a, b) = 1 - sim(a, b) - See also :py:func:`fraggle_binary_similarity`. + See also :py:func:`fraggle_similarity`. The calculated distance falls within the range :math:`[0, 1]`. Passing all-zero vectors to this function results in a distance of 0. Note that this measure is asymmetric, and order of query and reference molecules diff --git a/skfp/distances/harris_lahey.py b/skfp/distances/harris_lahey.py index 202d2148..d4c884dd 100644 --- a/skfp/distances/harris_lahey.py +++ b/skfp/distances/harris_lahey.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -141,8 +141,8 @@ def harris_lahey_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -218,7 +218,7 @@ def harris_lahey_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -354,7 +354,7 @@ def _bulk_harris_lahey_binary_similarity_two_sparse( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/kulczynski.py b/skfp/distances/kulczynski.py index bdad9bf0..b59bb9e8 100644 --- a/skfp/distances/kulczynski.py +++ b/skfp/distances/kulczynski.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -117,8 +117,8 @@ def kulczynski_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -190,7 +190,7 @@ def kulczynski_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -299,7 +299,7 @@ def _bulk_kulczynski_binary_similarity_two(X: csr_array, Y: csr_array) -> np.nda @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/mcconnaughey.py b/skfp/distances/mcconnaughey.py index 12912f70..ec8aa10d 100644 --- a/skfp/distances/mcconnaughey.py +++ b/skfp/distances/mcconnaughey.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -117,8 +117,8 @@ def mcconnaughey_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -191,7 +191,7 @@ def mcconnaughey_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -313,7 +313,7 @@ def _bulk_mcconnaughey_binary_similarity_two( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/rand.py b/skfp/distances/rand.py index da02c0b1..a34d9343 100644 --- a/skfp/distances/rand.py +++ b/skfp/distances/rand.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -103,8 +103,8 @@ def rand_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -176,7 +176,7 @@ def rand_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -269,7 +269,7 @@ def _bulk_rand_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarray: @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/rogot_goldberg.py b/skfp/distances/rogot_goldberg.py index e04982c1..e5b58771 100644 --- a/skfp/distances/rogot_goldberg.py +++ b/skfp/distances/rogot_goldberg.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -120,8 +120,8 @@ def rogot_goldberg_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -193,7 +193,7 @@ def rogot_goldberg_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -318,7 +318,7 @@ def _bulk_rogot_goldberg_binary_similarity_two( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/russell.py b/skfp/distances/russell.py index 822c83d9..7832fec2 100644 --- a/skfp/distances/russell.py +++ b/skfp/distances/russell.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -97,8 +97,8 @@ def russell_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -170,7 +170,7 @@ def russell_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -231,7 +231,7 @@ def _bulk_russell_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarra @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/simpson.py b/skfp/distances/simpson.py index 2dc30ca0..23c71007 100644 --- a/skfp/distances/simpson.py +++ b/skfp/distances/simpson.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -95,8 +95,8 @@ def simpson_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -171,7 +171,7 @@ def simpson_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -262,7 +262,7 @@ def _bulk_simpson_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarra @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/sokal_sneath.py b/skfp/distances/sokal_sneath.py index 594e5d05..2d13d751 100644 --- a/skfp/distances/sokal_sneath.py +++ b/skfp/distances/sokal_sneath.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -102,8 +102,8 @@ def sokal_sneath_2_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -175,7 +175,7 @@ def sokal_sneath_2_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -281,7 +281,7 @@ def _bulk_sokal_sneath_2_binary_similarity_two( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/distances/tanimoto.py b/skfp/distances/tanimoto.py index ef9aadfc..47e09433 100644 --- a/skfp/distances/tanimoto.py +++ b/skfp/distances/tanimoto.py @@ -5,8 +5,8 @@ @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -85,8 +85,8 @@ def tanimoto_binary_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -151,8 +151,8 @@ def tanimoto_binary_distance( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -234,8 +234,8 @@ def tanimoto_count_similarity( @validate_params( { - "vec_a": ["array-like", csr_array], - "vec_b": ["array-like", csr_array], + "vec_a": ["array-like", "sparse matrix"], + "vec_b": ["array-like", "sparse matrix"], }, prefer_skip_nested_validation=True, ) @@ -299,7 +299,7 @@ def tanimoto_count_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -390,7 +390,7 @@ def _bulk_tanimoto_binary_similarity_two(X: csr_array, Y: csr_array) -> np.ndarr @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -449,7 +449,7 @@ def bulk_tanimoto_binary_distance( @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, @@ -540,7 +540,7 @@ def _bulk_tanimoto_count_similarity_two(X: csr_array, Y: csr_array) -> np.ndarra @validate_params( { - "X": ["array-like", csr_array], + "X": ["array-like", "sparse matrix"], "Y": ["array-like", csr_array, None], }, prefer_skip_nested_validation=True, diff --git a/skfp/filters/faf4_druglike.py b/skfp/filters/faf4_druglike.py index ec2ebb96..7fcead51 100644 --- a/skfp/filters/faf4_druglike.py +++ b/skfp/filters/faf4_druglike.py @@ -91,7 +91,7 @@ class FAF4DruglikeFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. If a dictionary is passed, it is treated as kwargs for ``tqdm()``, and can be used to control the progress bar. diff --git a/skfp/filters/faf4_leadlike.py b/skfp/filters/faf4_leadlike.py index b0eb3dc7..8d2d30e6 100644 --- a/skfp/filters/faf4_leadlike.py +++ b/skfp/filters/faf4_leadlike.py @@ -92,8 +92,10 @@ class FAF4LeadlikeFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- diff --git a/skfp/filters/gsk.py b/skfp/filters/gsk.py index 71094bbc..5aff2252 100644 --- a/skfp/filters/gsk.py +++ b/skfp/filters/gsk.py @@ -52,8 +52,10 @@ class GSKFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- diff --git a/skfp/filters/nibr.py b/skfp/filters/nibr.py index ad78d45c..127f7e30 100644 --- a/skfp/filters/nibr.py +++ b/skfp/filters/nibr.py @@ -61,8 +61,10 @@ class NIBRFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- diff --git a/skfp/filters/oprea.py b/skfp/filters/oprea.py index 52190328..c6a99c75 100644 --- a/skfp/filters/oprea.py +++ b/skfp/filters/oprea.py @@ -59,8 +59,10 @@ class OpreaFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- diff --git a/skfp/filters/rule_of_three.py b/skfp/filters/rule_of_three.py index 17504a6c..72d942a2 100644 --- a/skfp/filters/rule_of_three.py +++ b/skfp/filters/rule_of_three.py @@ -15,7 +15,7 @@ class RuleOfThreeFilter(BaseFilter): """ Rule of three (Ro3). - Rule optimised to search for fragment-based lead-like compounds with desired properties. + Rule optimized to search for fragment-based lead-like compounds with desired properties. It was described in [1]_. Molecule must fulfill conditions: diff --git a/skfp/filters/rule_of_two.py b/skfp/filters/rule_of_two.py index e1358da0..b6f393cf 100644 --- a/skfp/filters/rule_of_two.py +++ b/skfp/filters/rule_of_two.py @@ -27,11 +27,14 @@ class RuleOfTwoFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a Pandas DataFrame with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the diff --git a/skfp/filters/rule_of_veber.py b/skfp/filters/rule_of_veber.py index 4becba25..c6acd1d5 100644 --- a/skfp/filters/rule_of_veber.py +++ b/skfp/filters/rule_of_veber.py @@ -24,11 +24,14 @@ class RuleOfVeberFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a Pandas DataFrame with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the diff --git a/skfp/filters/rule_of_xu.py b/skfp/filters/rule_of_xu.py index 9d7320dc..0b9021d6 100644 --- a/skfp/filters/rule_of_xu.py +++ b/skfp/filters/rule_of_xu.py @@ -25,11 +25,14 @@ class RuleOfXuFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a Pandas DataFrame with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the diff --git a/skfp/filters/tice_herbicides.py b/skfp/filters/tice_herbicides.py index 24e43507..2bd8aae2 100644 --- a/skfp/filters/tice_herbicides.py +++ b/skfp/filters/tice_herbicides.py @@ -29,11 +29,14 @@ class TiceHerbicidesFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a NumPy array with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the @@ -82,8 +85,8 @@ class TiceHerbicidesFilter(BaseFilter): def __init__( self, allow_one_violation: bool = False, - return_indicators: bool = False, return_type: str = "mol", + return_indicators: bool = False, n_jobs: int | None = None, batch_size: int | None = None, verbose: int | dict = 0, @@ -98,8 +101,8 @@ def __init__( super().__init__( condition_names=condition_names, allow_one_violation=allow_one_violation, - return_indicators=return_indicators, return_type=return_type, + return_indicators=return_indicators, n_jobs=n_jobs, batch_size=batch_size, verbose=verbose, diff --git a/skfp/filters/tice_insecticides.py b/skfp/filters/tice_insecticides.py index 433d1bcb..37cdbf6c 100644 --- a/skfp/filters/tice_insecticides.py +++ b/skfp/filters/tice_insecticides.py @@ -29,11 +29,14 @@ class TiceInsecticidesFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a NumPy array with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the @@ -82,8 +85,8 @@ class TiceInsecticidesFilter(BaseFilter): def __init__( self, allow_one_violation: bool = False, - return_indicators: bool = False, return_type: str = "mol", + return_indicators: bool = False, n_jobs: int | None = None, batch_size: int | None = None, verbose: int | dict = 0, @@ -98,8 +101,8 @@ def __init__( super().__init__( condition_names=condition_names, allow_one_violation=allow_one_violation, - return_indicators=return_indicators, return_type=return_type, + return_indicators=return_indicators, n_jobs=n_jobs, batch_size=batch_size, verbose=verbose, diff --git a/skfp/filters/valence_discovery.py b/skfp/filters/valence_discovery.py index 7ad78616..3d782c1e 100644 --- a/skfp/filters/valence_discovery.py +++ b/skfp/filters/valence_discovery.py @@ -58,11 +58,14 @@ class ValenceDiscoveryFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a NumPy array with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the @@ -83,8 +86,10 @@ class ValenceDiscoveryFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- @@ -107,8 +112,8 @@ class ValenceDiscoveryFilter(BaseFilter): def __init__( self, allow_one_violation: bool = False, - return_indicators: bool = False, return_type: str = "mol", + return_indicators: bool = False, n_jobs: int | None = None, batch_size: int | None = None, verbose: int = 0, @@ -134,8 +139,8 @@ def __init__( super().__init__( condition_names=condition_names, allow_one_violation=allow_one_violation, - return_indicators=return_indicators, return_type=return_type, + return_indicators=return_indicators, n_jobs=n_jobs, batch_size=batch_size, verbose=verbose, diff --git a/skfp/filters/zinc_druglike.py b/skfp/filters/zinc_druglike.py index 34cf3746..d3c94f30 100644 --- a/skfp/filters/zinc_druglike.py +++ b/skfp/filters/zinc_druglike.py @@ -52,20 +52,23 @@ class ZINCDruglikeFilter(BaseFilter): filter less restrictive. return_type : {"mol", "indicators", "condition_indicators"}, default="mol" - What values to return as the filtering result. "mol" returns list of - molecules passing the filter. "indicators" returns a binary vector with - indicators which molecules pass the filter. "condition_indicators" returns - a Pandas DataFrame with molecules in rows, filter conditions in columns, and - 0/1 indicators whether a given condition was fulfilled by a given molecule. + What values to return as the filtering result. + + - ``"mol"`` - return a list of molecules remaining in the dataset after filtering + - ``"indicators"`` - return a binary vector with indicators which molecules pass + the filter (1) and which would be removed (0) + - ``"condition_indicators"`` - return a Pandas DataFrame with molecules in rows, + filter conditions in columns, and 0/1 indicators whether a given condition was + fulfilled by a given molecule return_indicators : bool, default=False Whether to return a binary vector with indicators which molecules pass the filter, instead of list of molecules. .. deprecated:: 1.17 - return_indicators is deprecated and will be removed in version 2.0. - Use return_type instead. If return_indicators is set to True, - it will take precedence over return_type. + ``return_indicators`` is deprecated and will be removed in version 2.0. + Use ``return_type`` instead. If ``return_indicators`` is set to ``True``, + it will take precedence over ``return_type``. n_jobs : int, default=None The number of jobs to run in parallel. :meth:`transform_x_y` and @@ -77,8 +80,10 @@ class ZINCDruglikeFilter(BaseFilter): Number of inputs processed in each batch. ``None`` divides input data into equal-sized parts, as many as ``n_jobs``. - verbose : int, default=0 + verbose : int or dict, default=0 Controls the verbosity when filtering molecules. + If a dictionary is passed, it is treated as kwargs for ``tqdm()``, + and can be used to control the progress bar. References ---------- diff --git a/skfp/fingerprints/autocorr.py b/skfp/fingerprints/autocorr.py index b3cd0f30..5b8ea3e1 100644 --- a/skfp/fingerprints/autocorr.py +++ b/skfp/fingerprints/autocorr.py @@ -127,7 +127,7 @@ def __init__( ) self.use_3D = use_3D - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/bcut2d.py b/skfp/fingerprints/bcut2d.py index ec2b8727..08d1a2ce 100644 --- a/skfp/fingerprints/bcut2d.py +++ b/skfp/fingerprints/bcut2d.py @@ -145,7 +145,7 @@ def __init__( self.charge_errors = charge_errors self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They are largest and smallest eigenvalues of Burden matrix for 4 atomic properties. @@ -172,9 +172,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG ] return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute BCUT2D fingerprints. diff --git a/skfp/fingerprints/e3fp_fp.py b/skfp/fingerprints/e3fp_fp.py index a69e1d96..c14395c5 100644 --- a/skfp/fingerprints/e3fp_fp.py +++ b/skfp/fingerprints/e3fp_fp.py @@ -178,9 +178,7 @@ def _validate_params(self) -> None: f"fp_size={self.fp_size}" ) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute E3FP fingerprints. diff --git a/skfp/fingerprints/electroshape.py b/skfp/fingerprints/electroshape.py index 1b53584e..85d75bfd 100644 --- a/skfp/fingerprints/electroshape.py +++ b/skfp/fingerprints/electroshape.py @@ -151,7 +151,7 @@ def __init__( self.charge_errors = charge_errors self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 5 centroid-based points. @@ -185,9 +185,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG ] return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute ElectroShape fingerprints. diff --git a/skfp/fingerprints/estate.py b/skfp/fingerprints/estate.py index c9e06867..760655c0 100644 --- a/skfp/fingerprints/estate.py +++ b/skfp/fingerprints/estate.py @@ -114,7 +114,7 @@ def __init__( ) self.variant = variant - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to SMARTS patterns defining atom types. See the original paper [1]_ for details. diff --git a/skfp/fingerprints/functional_groups.py b/skfp/fingerprints/functional_groups.py index d5414c14..b8358cbb 100644 --- a/skfp/fingerprints/functional_groups.py +++ b/skfp/fingerprints/functional_groups.py @@ -88,7 +88,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They are descriptions of RDKit functional groups (fragments) - see ``_ diff --git a/skfp/fingerprints/getaway.py b/skfp/fingerprints/getaway.py index 03de9c92..b2924d00 100644 --- a/skfp/fingerprints/getaway.py +++ b/skfp/fingerprints/getaway.py @@ -144,7 +144,7 @@ def __init__( ) self.clip_val = clip_val - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to various descriptors derived from weighted Molecular Influence Matrix (MIM). @@ -218,9 +218,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute GETAWAY fingerprints. diff --git a/skfp/fingerprints/ghose_crippen.py b/skfp/fingerprints/ghose_crippen.py index 077af5cc..a8806d50 100644 --- a/skfp/fingerprints/ghose_crippen.py +++ b/skfp/fingerprints/ghose_crippen.py @@ -219,7 +219,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They are raw SMARTS patterns used as feature definitions. diff --git a/skfp/fingerprints/klekota_roth/klekota_roth_fp.py b/skfp/fingerprints/klekota_roth/klekota_roth_fp.py index fd920918..0ca762ab 100644 --- a/skfp/fingerprints/klekota_roth/klekota_roth_fp.py +++ b/skfp/fingerprints/klekota_roth/klekota_roth_fp.py @@ -99,7 +99,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They are raw SMARTS patterns used as feature definitions. diff --git a/skfp/fingerprints/laggner.py b/skfp/fingerprints/laggner.py index 21e386ac..d7134a90 100644 --- a/skfp/fingerprints/laggner.py +++ b/skfp/fingerprints/laggner.py @@ -112,7 +112,7 @@ def _fix_feature_names(self, feature_names: list[str]) -> np.ndarray: return np.asarray(feature_names, dtype=object) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to substructure names defined by Christian Laggner, intended to capture with SMARTS patterns diff --git a/skfp/fingerprints/maccs.py b/skfp/fingerprints/maccs.py index dd7d8176..9566bc58 100644 --- a/skfp/fingerprints/maccs.py +++ b/skfp/fingerprints/maccs.py @@ -115,7 +115,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to substructure names defined by Greg Landrum, based on publicly available MACCS Keys diff --git a/skfp/fingerprints/mordred_fp.py b/skfp/fingerprints/mordred_fp.py index 6e96885c..a628a95d 100644 --- a/skfp/fingerprints/mordred_fp.py +++ b/skfp/fingerprints/mordred_fp.py @@ -109,7 +109,7 @@ def __init__( ) self.use_3D = use_3D - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to descriptor names used by Mordred descriptor calculator, used in this fingerprint. diff --git a/skfp/fingerprints/morse.py b/skfp/fingerprints/morse.py index 47e70db5..53590088 100644 --- a/skfp/fingerprints/morse.py +++ b/skfp/fingerprints/morse.py @@ -140,7 +140,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to 7 weighting variants and 32 scattering values. diff --git a/skfp/fingerprints/mqns.py b/skfp/fingerprints/mqns.py index 01a7f1c7..9b081223 100644 --- a/skfp/fingerprints/mqns.py +++ b/skfp/fingerprints/mqns.py @@ -120,7 +120,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/pubchem/pubchem_fp.py b/skfp/fingerprints/pubchem/pubchem_fp.py index 72726fc6..9560281b 100644 --- a/skfp/fingerprints/pubchem/pubchem_fp.py +++ b/skfp/fingerprints/pubchem/pubchem_fp.py @@ -113,7 +113,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/rdf.py b/skfp/fingerprints/rdf.py index 7a6bc8a3..50eb876a 100644 --- a/skfp/fingerprints/rdf.py +++ b/skfp/fingerprints/rdf.py @@ -134,7 +134,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to 7 weighting variants and 30 radii. @@ -164,9 +164,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG ] return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute RDF fingerprints. diff --git a/skfp/fingerprints/rdkit_2d_desc.py b/skfp/fingerprints/rdkit_2d_desc.py index eda5ac14..07881f84 100644 --- a/skfp/fingerprints/rdkit_2d_desc.py +++ b/skfp/fingerprints/rdkit_2d_desc.py @@ -116,7 +116,7 @@ def __init__( self.normalized = normalized self.clip_val = clip_val - def get_feature_names_out(self, input_features=None): # noqa: ARG002 + def get_feature_names_out(self, input_features=None): """ Get fingerprint output feature names. They correspond to RDKit function names for computing descriptors. diff --git a/skfp/fingerprints/usr.py b/skfp/fingerprints/usr.py index a2cdb103..ae698a6d 100644 --- a/skfp/fingerprints/usr.py +++ b/skfp/fingerprints/usr.py @@ -71,7 +71,7 @@ class USRFingerprint(BaseFingerprintTransformer): :class:`USRCAT` : Related fingerprint, which additionally uses pharmacophoric atom types. - :class:`ElectroShaoe` : Related fingerprint, which additionally uses atomic + :class:`ElectroShape` : Related fingerprint, which additionally uses atomic partial charges. References @@ -125,7 +125,7 @@ def __init__( ) self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 4 centroid-based points. @@ -156,9 +156,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG ] return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute USR fingerprints. If ``errors`` is set to ``"ignore"``, then in case of errors less than n_samples values may be returned. diff --git a/skfp/fingerprints/usrcat.py b/skfp/fingerprints/usrcat.py index b6c23cca..aca0837b 100644 --- a/skfp/fingerprints/usrcat.py +++ b/skfp/fingerprints/usrcat.py @@ -121,7 +121,7 @@ def __init__( ) self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 4 centroid-based points, for each of 5 atom @@ -166,9 +166,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute USRCAT fingerprints. If ``errors`` is set to ``"ignore"``, then in case of errors less than n_samples values may be returned. diff --git a/skfp/fingerprints/vsa.py b/skfp/fingerprints/vsa.py index 0bab67d0..3ccbb992 100644 --- a/skfp/fingerprints/vsa.py +++ b/skfp/fingerprints/vsa.py @@ -151,9 +151,9 @@ def _get_n_features_out(self, variant: str) -> int: try: return n_features_out[variant] except KeyError as err: - raise ValueError(f'Variant "{variant}" not recognized"') from err + raise ValueError(f'Variant "{variant}" not recognized') from err - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to histogram bins for descriptors. diff --git a/skfp/fingerprints/whim.py b/skfp/fingerprints/whim.py index 749e987d..f7bb316d 100644 --- a/skfp/fingerprints/whim.py +++ b/skfp/fingerprints/whim.py @@ -140,7 +140,7 @@ def __init__( ) self.clip_val = clip_val - def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 + def get_feature_names_out(self, input_features=None) -> np.ndarray: """ Get fingerprint output feature names. They correspond to various descriptors derived from weighted covariance matrix. See references @@ -215,9 +215,7 @@ def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG return np.asarray(feature_names, dtype=object) - def transform( - self, X: Sequence[str | Mol], copy: bool = False - ) -> np.ndarray | csr_array: + def transform(self, X: Sequence[Mol], copy: bool = False) -> np.ndarray | csr_array: """ Compute WHIM fingerprints. diff --git a/skfp/metrics/multioutput.py b/skfp/metrics/multioutput.py index a46e2daa..5cafcf99 100644 --- a/skfp/metrics/multioutput.py +++ b/skfp/metrics/multioutput.py @@ -56,7 +56,7 @@ def multioutput_accuracy_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -129,7 +129,7 @@ def multioutput_auroc_score( Target scores, i.e. probability of the class with the greater label for each output of the classifier. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -199,7 +199,7 @@ def multioutput_auprc_score( Target scores, i.e. probability of the class with the greater label for each output of the classifier. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -267,7 +267,7 @@ def multioutput_balanced_accuracy_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -335,7 +335,7 @@ def multioutput_cohen_kappa_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -405,7 +405,7 @@ def multioutput_f1_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -468,7 +468,7 @@ def multioutput_matthews_corr_coef( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -536,7 +536,7 @@ def multioutput_mean_absolute_error( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -604,7 +604,7 @@ def multioutput_mean_squared_error( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -673,7 +673,7 @@ def multioutput_precision_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -742,7 +742,7 @@ def multioutput_recall_score( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -810,7 +810,7 @@ def multioutput_root_mean_squared_error( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. @@ -876,7 +876,7 @@ def multioutput_spearman_correlation( y_pred : array-like of shape (n_samples,) or (n_samples, n_outputs) Estimated target values. - suppress_warnings : boolean, default=False + suppress_warnings : bool, default=False Whether to suppress any warnings that may arise during evaluation on some tasks. diff --git a/skfp/preprocessing/input_output/sdf.py b/skfp/preprocessing/input_output/sdf.py index 097a8a9f..f3ece7ea 100644 --- a/skfp/preprocessing/input_output/sdf.py +++ b/skfp/preprocessing/input_output/sdf.py @@ -61,7 +61,7 @@ def __init__( self.sanitize = sanitize self.remove_hydrogens = remove_hydrogens - def transform(self, X: str, copy: bool = False) -> list[Mol]: # type: ignore[override] # noqa: ARG002 + def transform(self, X: str, copy: bool = False) -> list[Mol]: # type: ignore[override] """ Create RDKit ``Mol`` objects from SDF file. @@ -159,7 +159,7 @@ def __init__( self.kekulize = kekulize self.force_V3000 = force_V3000 - def transform(self, X: Sequence[Mol], copy: bool = False) -> None: # noqa: ARG002 + def transform(self, X: Sequence[Mol], copy: bool = False) -> None: """ Write RDKit ``Mol`` objects to SDF file at location given by ``filepath`` parameter. File is created if necessary, and overwritten diff --git a/skfp/utils/parallel.py b/skfp/utils/parallel.py index a08e33cc..5788d4c7 100644 --- a/skfp/utils/parallel.py +++ b/skfp/utils/parallel.py @@ -12,7 +12,7 @@ class ProgressParallel(Parallel): Parameters ---------- - tqdm_settings: Optional[dict] = None + tqdm_settings: dict or None, default=None Settings to use for the ``tqdm()`` progress bar. """ diff --git a/skfp/utils/validators.py b/skfp/utils/validators.py index 3e494a09..af53444c 100644 --- a/skfp/utils/validators.py +++ b/skfp/utils/validators.py @@ -81,10 +81,11 @@ def require_strings(X: Sequence[Any]) -> None: def require_atoms(min_atoms: int = 1, only_explicit=True) -> Callable: """ - Decorator for functions operating on single molecule. Ensures it is - nonempty (by default) or has at least the specified number of atoms, - raises ValueError otherwise. - """ # noqa: D401 + Ensure molecule is nonempty or has at least min_atoms atoms. + + Used as a decorator for functions operating on a single molecule. + Raises ValueError if conditions are not met. + """ def decorator(func: Callable) -> Callable: @functools.wraps(func) From 7f69c11a48845b140a71a4dea63e1d790c913b55 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sat, 20 Dec 2025 23:37:14 +0100 Subject: [PATCH 03/14] Remove unnecessary whitespaces --- skfp/datasets/moleculeace/moleculeace.py | 30 ------------------------ 1 file changed, 30 deletions(-) diff --git a/skfp/datasets/moleculeace/moleculeace.py b/skfp/datasets/moleculeace/moleculeace.py index 92bcdbf4..7479780e 100644 --- a/skfp/datasets/moleculeace/moleculeace.py +++ b/skfp/datasets/moleculeace/moleculeace.py @@ -25,7 +25,6 @@ def load_chembl204_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Prothrombin target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -111,7 +110,6 @@ def load_chembl214_ki( The task is to predict the inhibitor constant (Ki) of molecules against the 5-hydroxytryptamine receptor 1a target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -197,7 +195,6 @@ def load_chembl218_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Cannabinoid receptor 1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -283,7 +280,6 @@ def load_chembl219_ki( The task is to predict the inhibitor constant (Ki) of molecules against the D(4) dopamine receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -369,7 +365,6 @@ def load_chembl228_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Sodium-dependent serotonin transporter target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -455,7 +450,6 @@ def load_chembl231_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Histamine h1 receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -541,7 +535,6 @@ def load_chembl233_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Mu-type opioid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -627,7 +620,6 @@ def load_chembl234_ki( The task is to predict the inhibitor constant (Ki) of molecules against the D(3) dopamine receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -713,7 +705,6 @@ def load_chembl235_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Peroxisome proliferator-activated receptor gamma target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -799,7 +790,6 @@ def load_chembl236_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Delta-type opioid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -885,7 +875,6 @@ def load_chembl237_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Kappa-type opioid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -971,7 +960,6 @@ def load_chembl237_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Kappa-type opioid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1057,7 +1045,6 @@ def load_chembl238_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Sodium-dependent dopamine transporter target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1143,7 +1130,6 @@ def load_chembl239_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Peroxisome proliferator-activated receptor alpha target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1229,7 +1215,6 @@ def load_chembl244_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Coagulation factor x target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1315,7 +1300,6 @@ def load_chembl262_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Glycogen synthase kinase-3 beta target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1401,7 +1385,6 @@ def load_chembl264_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Histamine h3 receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1487,7 +1470,6 @@ def load_chembl287_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Sigma non-opioid intracellular receptor 1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1573,7 +1555,6 @@ def load_chembl1862_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Tyrosine-protein kinase abl1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1659,7 +1640,6 @@ def load_chembl1871_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Androgen receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1745,7 +1725,6 @@ def load_chembl2034_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Glucocorticoid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1831,7 +1810,6 @@ def load_chembl2047_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Bile acid receptor target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -1917,7 +1895,6 @@ def load_chembl2147_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Serine/threonine-protein kinase pim-1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2003,7 +1980,6 @@ def load_chembl2835_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Tyrosine-protein kinase jak1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2089,7 +2065,6 @@ def load_chembl2971_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Tyrosine-protein kinase jak2 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2175,7 +2150,6 @@ def load_chembl3979_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Peroxisome proliferator-activated receptor delta target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2261,7 +2235,6 @@ def load_chembl4005_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2347,7 +2320,6 @@ def load_chembl4203_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Dual specificity protein kinase clk4 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2433,7 +2405,6 @@ def load_chembl4616_ec50( The task is to predict the half maximal effective concentration (EC50) of molecules against the Growth hormone secretagogue receptor type 1 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression @@ -2519,7 +2490,6 @@ def load_chembl4792_ki( The task is to predict the inhibitor constant (Ki) of molecules against the Orexin receptor type 2 target [1]_ [2]_. - ================== ============== Tasks 1 Task type regression From 659923e2d69d2da1640a7d364f91c83d1b2f2981 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sat, 20 Dec 2025 23:57:20 +0100 Subject: [PATCH 04/14] Fix doctests --- skfp/applicability_domain/knn.py | 7 +- skfp/applicability_domain/prob_std.py | 4 +- .../standard_deviation.py | 6 +- skfp/applicability_domain/topkat.py | 2 +- skfp/datasets/moleculeace/moleculeace.py | 397 +++++++++--------- 5 files changed, 208 insertions(+), 208 deletions(-) diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 1061c78c..2e11eeab 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -104,11 +104,8 @@ class KNNADChecker(BaseADChecker): ... ]) >>> X_test_binary = 1 - X_train_binary >>> knn_ad_checker_binary = KNNADChecker(k=2, metric="tanimoto_binary_distance", agg="mean") - >>> knn_ad_checker_binary - KNNADChecker() - >>> knn_ad_checker_binary.fit(X_train_binary) - KNNADChecker() + KNNADChecker(k=2) >>> knn_ad_checker_binary.predict(X_test_binary) array([False, False, False]) @@ -180,6 +177,8 @@ def fit( # noqa: D102 agg_dists = self._get_agg_dists(k_nearest) self.threshold_ = np.percentile(agg_dists, self.threshold) + return self + def predict(self, X: np.ndarray) -> np.ndarray: # noqa: D102 return self.score_samples(X) <= self.threshold_ diff --git a/skfp/applicability_domain/prob_std.py b/skfp/applicability_domain/prob_std.py index 5e32ae73..4b1b266b 100644 --- a/skfp/applicability_domain/prob_std.py +++ b/skfp/applicability_domain/prob_std.py @@ -73,10 +73,10 @@ class ProbStdADChecker(BaseADChecker): >>> y_train = (X_train[:, 0] + X_train[:, 1] > 1).astype(float) >>> model = RandomForestRegressor(n_estimators=10, random_state=0) >>> model.fit(X_train, y_train) + RandomForestRegressor(n_estimators=10, random_state=0) >>> probstd_ad_checker = ProbStdADChecker(model=model, threshold=0.1) >>> probstd_ad_checker.fit() - >>> probstd_ad_checker - ProbStdADChecker(model=RandomForestRegressor(...), threshold=0.1) + ProbStdADChecker(model=RandomForestRegressor(n_estimators=10, random_state=0)) >>> X_test = np.random.uniform(0, 1, size=(100, 5)) >>> probstd_ad_checker.predict(X_test).shape diff --git a/skfp/applicability_domain/standard_deviation.py b/skfp/applicability_domain/standard_deviation.py index 23ffe393..6cee5d53 100644 --- a/skfp/applicability_domain/standard_deviation.py +++ b/skfp/applicability_domain/standard_deviation.py @@ -69,10 +69,10 @@ class StandardDeviationADChecker(BaseADChecker): >>> y_train = X_train.sum(axis=1) >>> model = RandomForestRegressor(n_estimators=5, random_state=0) >>> model.fit(X_train, y_train) + RandomForestRegressor(n_estimators=5, random_state=0) >>> std_ad_checker = StandardDeviationADChecker(model=model, threshold=0.5) - >>> std_ad_checker.fit() - >>> std_ad_checker - StandardDeviationADChecker() + >>> std_ad_checker.fit() # doctest: +NORMALIZE_WHITESPACE + StandardDeviationADChecker(model=RandomForestRegressor(n_estimators=5, random_state=0), threshold=0.5) >>> X_test = np.random.uniform(0, 1, size=(100, 5)) >>> std_ad_checker.predict(X_test).shape diff --git a/skfp/applicability_domain/topkat.py b/skfp/applicability_domain/topkat.py index e777f56f..30cfe939 100644 --- a/skfp/applicability_domain/topkat.py +++ b/skfp/applicability_domain/topkat.py @@ -62,7 +62,7 @@ class TOPKATADChecker(BaseADChecker): TOPKATADChecker() >>> topkat_ad_checker.predict(X_test) - array([ True, True, True, True, True]) + array([ True, True, True, True, False]) """ _parameter_constraints: dict = { diff --git a/skfp/datasets/moleculeace/moleculeace.py b/skfp/datasets/moleculeace/moleculeace.py index 7479780e..abd31277 100644 --- a/skfp/datasets/moleculeace/moleculeace.py +++ b/skfp/datasets/moleculeace/moleculeace.py @@ -68,7 +68,7 @@ def load_chembl204_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl204_ki + >>> from skfp.datasets.moleculeace import load_chembl204_ki >>> dataset = load_chembl204_ki() >>> dataset # doctest: +SKIP (['CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(=N)N)cc5c4)c3c2)CC1, ..., 'CCC(=O)N1CCC[C@H]1C(=O)NCc1ccc(C(=N)N)cc1'], \ @@ -76,12 +76,12 @@ def load_chembl204_ki( >>> dataset = load_chembl204_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(=N)N)cc5c4)c3c2)CC1 -3.426511 - 1 CC(=N)N1CCC(Oc2ccc3c(c2)nc(C(C)C)n3Cc2ccc3ccc(C(=N)N)cc3c2)CC1 -2.939519 - 2 CCC(C)c1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2ccc(C(=N)N)cc2c1 -3.361728 - 3 COC(=O)C(C)CN(c1ccc2c(c1)nc(C)n2Cc1ccc2ccc(C(=N)N)cc2c1)C1CCN(C(C)=N)CC1 -3.698970 - 4 CCCCc1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2ccc(C(=N)N)cc2c1 -3.301030 + SMILES Ki + 0 CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(... -3.426511 + 1 CC(=N)N1CCC(Oc2ccc3c(c2)nc(C(C)C)n3Cc2ccc3ccc(... -2.939519 + 2 CCC(C)c1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2c... -3.361728 + 3 COC(=O)C(C)CN(c1ccc2c(c1)nc(C)n2Cc1ccc2ccc(C(=... -3.698970 + 4 CCCCc1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2ccc... -3.301030 """ df = fetch_dataset( data_dir, @@ -153,7 +153,7 @@ def load_chembl214_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl214_ki + >>> from skfp.datasets.moleculeace import load_chembl214_ki >>> dataset = load_chembl214_ki() >>> dataset # doctest: +SKIP (['COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc2)cc1N1CCN(C)CC1, ..., 'O=S(=O)(NCCCCCCN1CCN(c2nsc3ccccc23)CC1)c1ccc2ccccc2c1'], \ @@ -161,12 +161,13 @@ def load_chembl214_ki( >>> dataset = load_chembl214_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc2)cc1N1CCN(C)CC1 -1.869232 - 1 Nc1cccc(-c2ccc(CCN3CCN(c4cccc5cccnc45)CC3)cc2)n1 -0.477121 - 2 COc1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1N1CCN(C)CC1 -2.400002 - 3 COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N1CCN(C)CC1 -2.700002 - 4 CN1CCc2cccc3c2[C@H]1Cc1cccc(-c2ccccc2)c1-3 -0.255273 + SMILES Ki + 0 COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc... -1.869232 + 1 Nc1cccc(-c2ccc(CCN3CCN(c4cccc5cccnc45)CC3)cc2)n1 -0.477121 + 2 COc1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1N1CCN(C)CC1 -2.400002 + 3 COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N1CCN(... -2.700002 + 4 CN1CCc2cccc3c2[C@H]1Cc1cccc(-c2ccccc2)c1-3 -0.255273 + """ df = fetch_dataset( data_dir, @@ -238,7 +239,7 @@ def load_chembl218_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl218_ec50 + >>> from skfp.datasets.moleculeace import load_chembl218_ec50 >>> dataset = load_chembl218_ec50() >>> dataset # doctest: +SKIP (['Cn1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1, ..., 'CCCCCc1cccc(OCCCCCCCCCCC(=O)NC2CC2)c1'], \ @@ -246,12 +247,12 @@ def load_chembl218_ec50( >>> dataset = load_chembl218_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 Cn1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 -2.000000 - 1 Cn1c(C(=O)NC2CCCCC2)nc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 -2.698970 - 2 Cn1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 -0.698970 - 3 Cn1c(C(=O)NC2CCCCC2)nc(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 -1.255273 - 4 N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1OCc1ccc(F)c(F)c1 -0.903090 + SMILES EC50 + 0 Cn1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2)c1-c1ccc(... -2.000000 + 1 Cn1c(C(=O)NC2CCCCC2)nc(-c2ccc(Cl)cc2)c1-c1ccc(... -2.698970 + 2 Cn1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)c1-c1cc... -0.698970 + 3 Cn1c(C(=O)NC2CCCCC2)nc(-c2ccc(Cl)cc2Cl)c1-c1cc... -1.255273 + 4 N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1OCc... -0.903090 """ df = fetch_dataset( data_dir, @@ -323,7 +324,7 @@ def load_chembl219_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl219_ki + >>> from skfp.datasets.moleculeace import load_chembl219_ki >>> dataset = load_chembl219_ki() >>> dataset # doctest: +SKIP (['COc1ccccc1N1CCN(Cc2ccn(-c3ccccc3)c2)CC1, ..., 'CNc1cc(OC)c(C(=O)N[C@@H]2CCN(Cc3ccccc3)[C@@H]2C)cc1Cl'], \ @@ -331,12 +332,12 @@ def load_chembl219_ki( >>> dataset = load_chembl219_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 COc1ccccc1N1CCN(Cc2ccn(-c3ccccc3)c2)CC1 -0.113943 - 1 c1ccc(N2CCN(Cc3ccn(-c4ccccc4)c3)CC2)cc1 -0.602060 - 2 CC1Cc2cccc3c2N1C(=O)C(N1CCN(Cc2ccc(Cl)cc2)CC1)CC3 -0.954243 - 3 CC1(C)Cc2cccc3c2N1C(=O)C(N1CCN(Cc2ccc(Cl)cc2)CC1)CC3 -1.278754 - 4 Cc1ccc(CN2CCN(C3CCc4cccc5c4N(CC5)C3=O)CC2)cc1 -0.602060 + SMILES Ki + 0 COc1ccccc1N1CCN(Cc2ccn(-c3ccccc3)c2)CC1 -0.113943 + 1 c1ccc(N2CCN(Cc3ccn(-c4ccccc4)c3)CC2)cc1 -0.602060 + 2 CC1Cc2cccc3c2N1C(=O)C(N1CCN(Cc2ccc(Cl)cc2)CC1)CC3 -0.954243 + 3 CC1(C)Cc2cccc3c2N1C(=O)C(N1CCN(Cc2ccc(Cl)cc2)C... -1.278754 + 4 Cc1ccc(CN2CCN(C3CCc4cccc5c4N(CC5)C3=O)CC2)cc1 -0.602060 """ df = fetch_dataset( data_dir, @@ -408,7 +409,7 @@ def load_chembl228_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl228_ki + >>> from skfp.datasets.moleculeace import load_chembl228_ki >>> dataset = load_chembl228_ki() >>> dataset # doctest: +SKIP (['CN(C)Cc1ccccc1Sc1ccc(C#N)cc1N, ..., 'CCCN(CC[C@]1(O)C[C@H](NC(=O)c2ccc3ccccc3c2)C1)[C@H]1CCc2nc(N)sc2C1'], \ @@ -493,7 +494,7 @@ def load_chembl231_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl231_ki + >>> from skfp.datasets.moleculeace import load_chembl231_ki >>> dataset = load_chembl231_ki() >>> dataset # doctest: +SKIP (['CN1CCN(C2=Nc3ccccc3Nc3sc(CO)cc32)CC1, ..., 'O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)cc(-n2cc(-c3ccc(Cl)s3)nn2)c1'], \ @@ -501,12 +502,12 @@ def load_chembl231_ki( >>> dataset = load_chembl231_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CN1CCN(C2=Nc3ccccc3Nc3sc(CO)cc32)CC1 -0.778151 - 1 Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN(C)CC1 -0.622900 - 2 Cc1cc2c(s1)Nc1ccccc1N=C2N1CCNCC1 -1.342423 - 3 Cc1cc2c(s1)Nc1ccccc1N=C2N1CC[N+](C)([O-])CC1 -1.939519 - 4 CC(=O)c1ccc(OCCCN2CC[C@H](NC(=O)[C@@H](N)CO)C2)cc1 -4.633468 + SMILES Ki + 0 CN1CCN(C2=Nc3ccccc3Nc3sc(CO)cc32)CC1 -0.778151 + 1 Cc1cc2c(s1)Nc1ccccc1N=C2N1CCN(C)CC1 -0.622900 + 2 Cc1cc2c(s1)Nc1ccccc1N=C2N1CCNCC1 -1.342423 + 3 Cc1cc2c(s1)Nc1ccccc1N=C2N1CC[N+](C)([O-])CC1 -1.939519 + 4 CC(=O)c1ccc(OCCCN2CC[C@H](NC(=O)[C@@H](N)CO)C2... -4.633468 """ df = fetch_dataset( data_dir, @@ -578,7 +579,7 @@ def load_chembl233_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl233_ki + >>> from skfp.datasets.moleculeace import load_chembl233_ki >>> dataset = load_chembl233_ki() >>> dataset # doctest: +SKIP (['CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1, ..., 'CCO[C@@]12Cc3cc(-c4ccccc4)cnc3[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5'], \ @@ -586,12 +587,12 @@ def load_chembl233_ki( >>> dataset = load_chembl233_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -4.026125 - 1 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(Cl)c2)cc1 -2.903633 - 2 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2)cc1 -2.937016 - 3 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1ccc(F)cc1)c1ccc(F)cc1 -3.337659 - 4 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1cccc(Cl)c1)c1cccc(Cl)c1 -3.854852 + SMILES Ki + 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -4.026125 + 1 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(... -2.903633 + 2 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2... -2.937016 + 3 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1ccc(F)cc1)c... -3.337659 + 4 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1cccc(Cl)c1)... -3.854852 """ df = fetch_dataset( data_dir, @@ -663,7 +664,7 @@ def load_chembl234_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl234_ki + >>> from skfp.datasets.moleculeace import load_chembl234_ki >>> dataset = load_chembl234_ki() >>> dataset # doctest: +SKIP (['CN1C2CCC1CC(OC(c1ccc(F)cc1)c1ccc(F)cc1)C2, ..., 'CNc1cc(OC)c(C(=O)N[C@@H]2CCN(Cc3ccccc3)[C@@H]2C)cc1Cl'], \ @@ -671,12 +672,12 @@ def load_chembl234_ki( >>> dataset = load_chembl234_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CN1C2CCC1CC(OC(c1ccc(F)cc1)c1ccc(F)cc1)C2 -2.161368 - 1 O=C(NCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cccc2c1-c1ccccc1C2=O -1.556303 - 2 c1ccc(N2CCN(CCCn3c4ccccc4c4ccccc43)CC2)cc1 -3.383815 - 3 Oc1nc2c(N3CCN(Cc4ccccc4)CC3)cccc2[nH]1 -1.752048 - 4 O=C(NCCCN1CCN(c2ccccc2)CC1)c1cccc2c1-c1ccccc1C2=O -2.633468 + SMILES Ki + 0 CN1C2CCC1CC(OC(c1ccc(F)cc1)c1ccc(F)cc1)C2 -2.161368 + 1 O=C(NCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cccc2c1-c1c... -1.556303 + 2 c1ccc(N2CCN(CCCn3c4ccccc4c4ccccc43)CC2)cc1 -3.383815 + 3 Oc1nc2c(N3CCN(Cc4ccccc4)CC3)cccc2[nH]1 -1.752048 + 4 O=C(NCCCN1CCN(c2ccccc2)CC1)c1cccc2c1-c1ccccc1C2=O -2.633468 """ df = fetch_dataset( data_dir, @@ -748,7 +749,7 @@ def load_chembl235_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl235_ec50 + >>> from skfp.datasets.moleculeace import load_chembl235_ec50 >>> dataset = load_chembl235_ec50() >>> dataset # doctest: +SKIP (['CC(/C=C/C(F)=C(/C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCC(F)(F)F)=C\C(=O)O, ..., 'O=C(O)Cc1cc(Br)c(Oc2cc(I)c(O)c(I)c2)c(I)c1'], \ @@ -756,12 +757,12 @@ def load_chembl235_ec50( >>> dataset = load_chembl235_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 CC(/C=C/C(F)=C(/C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCC(F)(F)F)=C\C(=O)O -1.324282 - 1 CCCOc1c(/C(C)=C\C=C\C(C)=C\C(=O)O)cc(C(C)C)cc1C(F)(F)C(F)(F)F -1.343409 - 2 C/C(=C/C=C/C(C)=C/C(=O)O)c1cc(-c2cccs2)cc(C(C)C)c1OCC(F)F -0.993436 - 3 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OCCc3ccccc3)cc2)c1)C(=O)O -3.477121 - 4 CCCCC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -3.397940 + SMILES EC50 + 0 CC(/C=C/C(F)=C(/C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1... -1.324282 + 1 CCCOc1c(/C(C)=C\C=C\C(C)=C\C(=O)O)cc(C(C)C)cc1... -1.343409 + 2 C/C(=C/C=C/C(C)=C/C(=O)O)c1cc(-c2cccs2)cc(C(C)... -0.993436 + 3 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OCCc3ccccc3)cc2)c... -3.477121 + 4 CCCCC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1... -3.397940 """ df = fetch_dataset( data_dir, @@ -833,7 +834,7 @@ def load_chembl236_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl236_ki + >>> from skfp.datasets.moleculeace import load_chembl236_ki >>> dataset = load_chembl236_ki() >>> dataset # doctest: +SKIP (['CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1, ..., 'CCO[C@@]12Cc3cc(-c4ccccc4)cnc3[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5'], \ @@ -841,12 +842,12 @@ def load_chembl236_ki( >>> dataset = load_chembl236_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -4.592399 - 2 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(Cl)c2)cc1 -3.699924 - 4 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2)cc1 -3.465234 - 5 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1ccc(F)cc1)c1ccc(F)cc1 -3.870989 - 6 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1cccc(Cl)c1)c1cccc(Cl)c1 -3.432809 + SMILES Ki + 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -4.592399 + 1 O=C(CCC(=O)NCC(=O)N[C@@H]1CC[C@@]2(O)[C@H]3Cc4... -0.892095 + 2 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(... -3.699924 + 3 O=C(CCC(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H]1CC[C@@... -0.806180 + 4 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2... -3.465234 """ df = fetch_dataset( data_dir, @@ -918,7 +919,7 @@ def load_chembl237_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl237_ec50 + >>> from skfp.datasets.moleculeace import load_chembl237_ec50 >>> dataset = load_chembl237_ec50() >>> dataset # doctest: +SKIP (['C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5, ..., 'Oc1ccc2c3c1O[C@H]1c4ncc(-c5ccccc5)cc4C[C@@]4(OCCCC5CCCCC5)[C@@H](C2)N(CC2CC2)CC[C@]314'], \ @@ -926,12 +927,12 @@ def load_chembl237_ec50( >>> dataset = load_chembl237_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 1 C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5 -0.919078 - 2 CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@]24CC[C@@]3(C[C@H]2C(C)(C)C(C)(C)O4)C1C5 -1.320146 - 3 CO[C@@]12CCC3(C[C@H]1[C@@](C)(O)C(C)(C)C)[C@H]1Cc4ccc(O)c5c4C3(CCN1C)[C@H]2O5 -0.380211 - 4 Nc1nc2cc3c(cc2s1)C[C@@H]1[C@@H]2CCCC[C@]32CCN1CC1CC1 -0.380211 - 5 CN1CCC23c4c5ccc(O)c4OC2c2nc(N)ncc2CC3(O)C1C5 -3.031408 + SMILES EC50 + 0 CC[C@H](C)[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[... 0.130768 + 1 C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CC[C@@]3... -0.919078 + 2 CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@]24CC[C@@]3(... -1.320146 + 3 CO[C@@]12CCC3(C[C@H]1[C@@](C)(O)C(C)(C)C)[C@H]... -0.380211 + 4 Nc1nc2cc3c(cc2s1)C[C@@H]1[C@@H]2CCCC[C@]32CCN1... -0.380211 """ df = fetch_dataset( data_dir, @@ -1003,7 +1004,7 @@ def load_chembl237_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl237_ki + >>> from skfp.datasets.moleculeace import load_chembl237_ki >>> dataset = load_chembl237_ki() >>> dataset # doctest: +SKIP (['CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1, ..., 'CCO[C@@]12Cc3cc(-c4ccccc4)cnc3[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5'], \ @@ -1011,12 +1012,12 @@ def load_chembl237_ki( >>> dataset = load_chembl237_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -3.612678 - 1 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(Cl)c2)cc1 -3.265054 - 2 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2)cc1 -3.127429 - 3 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1ccc(F)cc1)c1ccc(F)cc1 -3.350248 - 4 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1cccc(Cl)c1)c1cccc(Cl)c1 -3.780821 + SMILES Ki + 0 CC(c1ccccc1)N1CC[C@H]1[C@@H](N)c1cccc(Cl)c1 -3.612678 + 1 Cc1ccc(C(c2ccc(C)cc2)N2CC[C@H]2[C@H](N)c2cccc(... -3.265054 + 2 COc1ccc([C@H](N)[C@@H]2CCN2C(c2ccccc2)c2ccccc2... -3.127429 + 3 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1ccc(F)cc1)c... -3.350248 + 4 N[C@H](c1cccc(Cl)c1)[C@@H]1CCN1C(c1cccc(Cl)c1)... -3.780821 """ df = fetch_dataset( data_dir, @@ -1088,7 +1089,7 @@ def load_chembl238_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl238_ki + >>> from skfp.datasets.moleculeace import load_chembl238_ki >>> dataset = load_chembl238_ki() >>> dataset # doctest: +SKIP (['CN1CCC(O)(c2ccc(Cl)c(Cl)c2)C([C@@H](O)c2ccc(Cl)c(Cl)c2)C1, ..., 'C[C@H]1CN(CC[S+](O)C(c2ccc(F)cc2)c2ccc(F)cc2)C[C@@H](C)N1CC(O)Cc1ccccc1'], \ @@ -1096,12 +1097,12 @@ def load_chembl238_ki( >>> dataset = load_chembl238_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CN1CCC(O)(c2ccc(Cl)c(Cl)c2)C([C@@H](O)c2ccc(Cl)c(Cl)c2)C1 -3.617000 - 1 CN1CCC(O)(c2ccc(Cl)c(Cl)c2)C(C(=O)c2ccc(Cl)c(Cl)c2)C1 -1.037426 - 2 Cc1ccc(C2OC(=O)OC3(c4ccc(C)cc4)CCN(C)CC23)cc1 -3.913284 - 3 Cc1ccc([C@H](O)C2CN(C)CCC2(O)c2ccc(C)cc2)cc1 -4.027350 - 4 CN1CCC(O)(c2ccc(F)cc2)C(C(=O)c2ccc(F)cc2)C1 -3.755875 + SMILES Ki + 0 CN1CCC(O)(c2ccc(Cl)c(Cl)c2)C([C@@H](O)c2ccc(Cl... -3.617000 + 1 CN1CCC(O)(c2ccc(Cl)c(Cl)c2)C(C(=O)c2ccc(Cl)c(C... -1.037426 + 2 Cc1ccc(C2OC(=O)OC3(c4ccc(C)cc4)CCN(C)CC23)cc1 -3.913284 + 3 Cc1ccc([C@H](O)C2CN(C)CCC2(O)c2ccc(C)cc2)cc1 -4.027350 + 4 CN1CCC(O)(c2ccc(F)cc2)C(C(=O)c2ccc(F)cc2)C1 -3.755875 """ df = fetch_dataset( data_dir, @@ -1173,7 +1174,7 @@ def load_chembl239_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl239_ec50 + >>> from skfp.datasets.moleculeace import load_chembl239_ec50 >>> dataset = load_chembl239_ec50() >>> dataset # doctest: +SKIP (['CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OCCc3ccccc3)cc2)c1)C(=O)O, ..., 'CC(C)(Oc1ccc(CCOc2ccc(/N=N/c3ccc(Cl)cc3)cc2)cc1)C(=O)O'], \ @@ -1181,12 +1182,12 @@ def load_chembl239_ec50( >>> dataset = load_chembl239_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OCCc3ccccc3)cc2)c1)C(=O)O -3.431364 - 1 CC[C@@H](Cc1ccc(OC)c(C(=O)NCc2ccc(Oc3ccc(F)cc3)cc2)c1)C(=O)O -0.964024 - 2 CCCCC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -3.000000 - 3 CCC(Cc1ccc(OC)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -2.869232 - 4 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OC(F)(F)F)cc2)c1)C(=O)O -1.633468 + SMILES EC50 + 0 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OCCc3ccccc3)cc2)c... -3.431364 + 1 CC[C@@H](Cc1ccc(OC)c(C(=O)NCc2ccc(Oc3ccc(F)cc3... -0.964024 + 2 CCCCC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1... -3.000000 + 3 CCC(Cc1ccc(OC)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1)... -2.869232 + 4 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OC(F)(F)F)cc2)c1)... -1.633468 """ df = fetch_dataset( data_dir, @@ -1258,7 +1259,7 @@ def load_chembl244_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl244_ki + >>> from skfp.datasets.moleculeace import load_chembl244_ki >>> dataset = load_chembl244_ki() >>> dataset # doctest: +SKIP (['CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(=N)N)cc5c4)c3c2)CC1, ..., 'CC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@H](C=O)CCCNC(=N)N'], \ @@ -1266,12 +1267,12 @@ def load_chembl244_ki( >>> dataset = load_chembl244_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(=N)N)cc5c4)c3c2)CC1 -0.113943 - 1 CC(=N)N1CCC(Oc2ccc3c(c2)nc(C(C)C)n3Cc2ccc3ccc(C(=N)N)cc3c2)CC1 -0.301030 - 2 CCC(C)c1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2ccc(C(=N)N)cc2c1 -0.518514 - 3 CC1CCN(C(=O)[C@H](Cc2cccc(C(=N)N)c2)NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC1 -3.301000 - 4 COC(=O)[C@H]1Cc2ccccc2CN1C(=O)[C@H](Cc1cccc(C(=N)N)c1)NS(=O)(=O)c1ccc2ccccc2c1 -4.431000 + SMILES Ki + 0 CC(=N)N1CCC(Oc2ccc3nc(CCC(=O)O)n(Cc4ccc5ccc(C(... -0.113943 + 1 CC(=N)N1CCC(Oc2ccc3c(c2)nc(C(C)C)n3Cc2ccc3ccc(... -0.301030 + 2 CCC(C)c1nc2cc(OC3CCN(C(C)=N)CC3)ccc2n1Cc1ccc2c... -0.518514 + 3 CC1CCN(C(=O)[C@H](Cc2cccc(C(=N)N)c2)NS(=O)(=O)... -3.301000 + 4 COC(=O)[C@H]1Cc2ccccc2CN1C(=O)[C@H](Cc1cccc(C(... -4.431000 """ df = fetch_dataset( data_dir, @@ -1343,7 +1344,7 @@ def load_chembl262_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl262_ki + >>> from skfp.datasets.moleculeace import load_chembl262_ki >>> dataset = load_chembl262_ki() >>> dataset # doctest: +SKIP (['Cc1nc(N)sc1-c1ccnc(Nc2cccc([N+](=O)[O-])c2)n1, ..., 'CC(C)(C#N)c1cccc(-c2ccnc3[nH]ccc23)n1'], \ @@ -1351,12 +1352,12 @@ def load_chembl262_ki( >>> dataset = load_chembl262_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 Cc1nc(N)sc1-c1ccnc(Nc2cccc([N+](=O)[O-])c2)n1 -1.30103 - 1 Cc1ccc2c(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)c(-c3ccc(F)cc3)nn2n1 -1.30103 - 2 Cc1ccc2c(-c3ccnc(Nc4ccc(F)c(F)c4)n3)c(-c3ccc(F)cc3)nn2n1 -1.00000 - 3 Cc1ccc2c(-c3ccnc(Nc4ccc5c(c4)OCCO5)n3)c(-c3ccc(F)cc3)nn2n1 -1.00000 - 4 Cc1ccc2c(-c3ccnc(Nc4ccc(Cl)c(C(F)(F)F)c4)n3)c(-c3ccc(F)cc3)nn2n1 -1.69897 + SMILES Ki + 0 Cc1nc(N)sc1-c1ccnc(Nc2cccc([N+](=O)[O-])c2)n1 -1.30103 + 1 Cc1ccc2c(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)c(-c3c... -1.30103 + 2 Cc1ccc2c(-c3ccnc(Nc4ccc(F)c(F)c4)n3)c(-c3ccc(F... -1.00000 + 3 Cc1ccc2c(-c3ccnc(Nc4ccc5c(c4)OCCO5)n3)c(-c3ccc... -1.00000 + 4 Cc1ccc2c(-c3ccnc(Nc4ccc(Cl)c(C(F)(F)F)c4)n3)c(... -1.69897 """ df = fetch_dataset( data_dir, @@ -1428,7 +1429,7 @@ def load_chembl264_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl264_ki + >>> from skfp.datasets.moleculeace import load_chembl264_ki >>> dataset = load_chembl264_ki() >>> dataset # doctest: +SKIP (['CC(=O)c1ccc(OCCCc2c[nH]cn2)cc1, ..., 'CC(C)(C)c1ccc(OCCCCCCN2CCCCCC2)cc1'], \ @@ -1513,7 +1514,7 @@ def load_chembl287_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl287_ki + >>> from skfp.datasets.moleculeace import load_chembl287_ki >>> dataset = load_chembl287_ki() >>> dataset # doctest: +SKIP (['O=S1(=O)c2ccccc2CCC12CCN(Cc1ccccc1)CC2, ..., 'Cc1[nH]c2cc(C(F)(F)F)ccc2c(=O)c1CN(C)Cc1ccccc1'], \ @@ -1521,12 +1522,12 @@ def load_chembl287_ki( >>> dataset = load_chembl287_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 O=S1(=O)c2ccccc2CCC12CCN(Cc1ccccc1)CC2 -1.301030 - 1 COc1ccc(N2C[C@H](CN3CCC(O)(c4ccsc4)CC3)OC2=O)cc1 -1.531479 - 2 COc1ccc(N2C[C@H](CN3CCC(O)(c4ccc5c(c4)OCO5)CC3)OC2=O)cc1 -1.278754 - 3 CNC(=O)CC1Cc2ccccc2C2(CCN(Cc3ccccc3)CC2)O1 -2.230449 - 4 OCC1OC2(CCN(Cc3ccccc3)CC2)c2ccccc21 -0.752816 + SMILES Ki + 0 O=S1(=O)c2ccccc2CCC12CCN(Cc1ccccc1)CC2 -1.301030 + 1 COc1ccc(N2C[C@H](CN3CCC(O)(c4ccsc4)CC3)OC2=O)cc1 -1.531479 + 2 COc1ccc(N2C[C@H](CN3CCC(O)(c4ccc5c(c4)OCO5)CC3... -1.278754 + 3 CNC(=O)CC1Cc2ccccc2C2(CCN(Cc3ccccc3)CC2)O1 -2.230449 + 4 OCC1OC2(CCN(Cc3ccccc3)CC2)c2ccccc21 -0.752816 """ df = fetch_dataset( data_dir, @@ -1598,7 +1599,7 @@ def load_chembl1862_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl1862_ki + >>> from skfp.datasets.moleculeace import load_chembl1862_ki >>> dataset = load_chembl1862_ki() >>> dataset # doctest: +SKIP (['Nc1[nH]cnc2nnc(-c3ccc(Cl)cc3)c1-2, ..., 'CCCCNc1ncnc2c1cnn2CC(Cl)c1ccccc1'], \ @@ -1606,12 +1607,12 @@ def load_chembl1862_ki( >>> dataset = load_chembl1862_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 Nc1[nH]cnc2nnc(-c3ccc(Cl)cc3)c1-2 -2.69897 - 1 Cc1ccc(N2NC(=O)/C(=C/c3ccc(-c4ccc(C)c(Cl)c4)o3)C2=O)cc1C -3.69897 - 2 O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1cccc(OCc2ccccc2)c1 -3.00000 - 3 O=C1NN(c2ccc(I)cc2)C(=O)/C1=C\c1cc2c(cc1Br)OCO2 -3.39794 - 4 O=C1NN(c2ccc(I)cc2)C(=O)/C1=C\c1ccc(N2CCOCC2)cc1 -4.30103 + SMILES Ki + 0 Nc1[nH]cnc2nnc(-c3ccc(Cl)cc3)c1-2 -2.69897 + 1 Cc1ccc(N2NC(=O)/C(=C/c3ccc(-c4ccc(C)c(Cl)c4)o3... -3.69897 + 2 O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1cccc(OCc2... -3.00000 + 3 O=C1NN(c2ccc(I)cc2)C(=O)/C1=C\c1cc2c(cc1Br)OCO2 -3.39794 + 4 O=C1NN(c2ccc(I)cc2)C(=O)/C1=C\c1ccc(N2CCOCC2)cc1 -4.30103 """ df = fetch_dataset( data_dir, @@ -1683,7 +1684,7 @@ def load_chembl1871_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl1871_ki + >>> from skfp.datasets.moleculeace import load_chembl1871_ki >>> dataset = load_chembl1871_ki() >>> dataset # doctest: +SKIP (['CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(F)cc1-3, ..., 'CN(C[C@](C)(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1)c1ccc(C#N)c(-c2ccccc2)c1'], \ @@ -1691,12 +1692,12 @@ def load_chembl1871_ki( >>> dataset = load_chembl1871_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(F)cc1-3 -2.825426 - 1 CCc1ccccc1/C=C1\Oc2ccc(F)cc2-c2ccc3c(c21)C(C)=CC(C)(C)N3 -3.201124 - 2 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1N(C)C)Oc1ccc(F)cc1-3 -2.913284 - 3 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1)Oc1c(F)cccc1-3 -3.163161 - 4 CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C -0.462398 + SMILES Ki + 0 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(... -2.825426 + 1 CCc1ccccc1/C=C1\Oc2ccc(F)cc2-c2ccc3c(c21)C(C)=... -3.201124 + 2 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1N(C)C)O... -2.913284 + 3 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1)Oc1c(F... -3.163161 + 4 CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C[C@H](C)C4... -0.462398 """ df = fetch_dataset( data_dir, @@ -1768,7 +1769,7 @@ def load_chembl2034_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl2034_ki + >>> from skfp.datasets.moleculeace import load_chembl2034_ki >>> dataset = load_chembl2034_ki() >>> dataset # doctest: +SKIP (['CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(F)cc1-3, ..., 'NS(=O)(=O)C[C@H]1COc2cc(F)ccc2N1C(=O)c1ccc2c(c1)NCCO2'], \ @@ -1776,12 +1777,12 @@ def load_chembl2034_ki( >>> dataset = load_chembl2034_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(F)cc1-3 -1.924279 - 1 CCc1ccccc1/C=C1\Oc2ccc(F)cc2-c2ccc3c(c21)C(C)=CC(C)(C)N3 -2.431364 - 2 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1N(C)C)Oc1ccc(F)cc1-3 -2.692847 - 3 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1)Oc1c(F)cccc1-3 -2.506505 - 4 CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C[C@H](C)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C -1.120574 + SMILES Ki + 0 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccsc1)Oc1ccc(... -1.924279 + 1 CCc1ccccc1/C=C1\Oc2ccc(F)cc2-c2ccc3c(c21)C(C)=... -2.431364 + 2 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1N(C)C)O... -2.692847 + 3 CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1)Oc1c(F... -2.506505 + 4 CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3C[C@H](C)C4... -1.120574 """ df = fetch_dataset( data_dir, @@ -1853,7 +1854,7 @@ def load_chembl2047_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl2047_ec50 + >>> from skfp.datasets.moleculeace import load_chembl2047_ec50 >>> dataset = load_chembl2047_ec50() >>> dataset # doctest: +SKIP (['C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O, ..., 'CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc(CNc2ccc(CC(=O)O)cc2)c(Cl)c1'], \ @@ -1861,12 +1862,12 @@ def load_chembl2047_ec50( >>> dataset = load_chembl2047_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O -3.477121 - 1 C[C@H](CCC(=O)O)C1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@@H](O)CC1[C@@H](C)[C@H]3O -2.875061 - 3 CCC[C@@H]1C2C[C@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C)C([C@H](C)CCC(=O)O)CC[C@H]3[C@@H]2[C@@H]1O -3.045323 - 4 CC(C)c1onc(-c2c(Cl)cccc2Br)c1COc1ccc(/C=C/c2cccc(C(=O)O)c2)c(Cl)c1 -1.079181 - 5 Cc1cc(OCc2c(-c3c(Cl)cccc3Cl)noc2C(C)C)ccc1/C=C/c1cccc(C(=O)O)c1 -1.672098 + SMILES EC50 + 0 C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@... -3.477121 + 1 C[C@H](CCC(=O)O)C1CC[C@H]2[C@H]3[C@H](CC[C@]12... -2.875061 + 2 C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@H... -3.477121 + 3 CCC[C@@H]1C2C[C@H](O)CC[C@]2(C)[C@H]2CC[C@]3(C... -3.045323 + 4 CC(C)c1onc(-c2c(Cl)cccc2Br)c1COc1ccc(/C=C/c2cc... -1.079181 """ df = fetch_dataset( data_dir, @@ -1938,7 +1939,7 @@ def load_chembl2147_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl2147_ki + >>> from skfp.datasets.moleculeace import load_chembl2147_ki >>> dataset = load_chembl2147_ki() >>> dataset # doctest: +SKIP (['FC(F)(F)c1cccc(-c2nnc3ccc(NC4CCCCC4)cn23)c1, ..., 'NC(=O)c1cc(Cl)c2c(Cl)c(C#CC3CNCCO3)n([C@H]3CCCNC3)c2n1'], \ @@ -1946,12 +1947,12 @@ def load_chembl2147_ki( >>> dataset = load_chembl2147_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 FC(F)(F)c1cccc(-c2nnc3ccc(NC4CCCCC4)cn23)c1 -1.041393 - 1 Cc1ccc2[nH]c(=O)c(CC(=O)O)c(-c3ccccc3)c2c1 -3.653213 - 2 O=C(O)c1cccc(Nc2nc(-c3ccc(O)cc3O)cs2)c1 -3.531479 - 3 O=C(O)c1cccc2c(-c3ccccc3)c(-c3ccccc3)[nH]c12 -2.740363 - 4 CCc1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCc2c[nH]c3ccccc23)cc1 -3.322219 + SMILES Ki + 0 FC(F)(F)c1cccc(-c2nnc3ccc(NC4CCCCC4)cn23)c1 -1.041393 + 1 Cc1ccc2[nH]c(=O)c(CC(=O)O)c(-c3ccccc3)c2c1 -3.653213 + 2 O=C(O)c1cccc(Nc2nc(-c3ccc(O)cc3O)cs2)c1 -3.531479 + 3 O=C(O)c1cccc2c(-c3ccccc3)c(-c3ccccc3)[nH]c12 -2.740363 + 4 CCc1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCc2c[nH]c3cccc... -3.322219 """ df = fetch_dataset( data_dir, @@ -2023,7 +2024,7 @@ def load_chembl2835_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl2835_ki + >>> from skfp.datasets.moleculeace import load_chembl2835_ki >>> dataset = load_chembl2835_ki() >>> dataset # doctest: +SKIP (['C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2[nH]ccc12, ..., 'Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1'], \ @@ -2031,12 +2032,12 @@ def load_chembl2835_ki( >>> dataset = load_chembl2835_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2[nH]ccc12 0.154902 - 1 C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1n1cnc2cnc3[nH]ccc3c21 0.301030 - 2 C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1N(C)c1ncnc2[nH]ccc12 -2.785330 - 3 C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1n1cnc2cnc3[nH]ccc3c21 -1.079181 - 4 N#CCC(=O)N1CCC[C@@H](n2cnc3cnc4[nH]ccc4c32)C1 0.397940 + SMILES Ki + 0 C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1N(C)c1ncnc2[nH]c... 0.154902 + 1 C[C@@H]1CCN(C(=O)CC#N)C[C@@H]1n1cnc2cnc3[nH]cc... 0.301030 + 2 C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1N(C)c1ncnc2[nH]c... -2.785330 + 3 C[C@@H]1CCN(Cc2ccccc2)C[C@@H]1n1cnc2cnc3[nH]cc... -1.079181 + 4 N#CCC(=O)N1CCC[C@@H](n2cnc3cnc4[nH]ccc4c32)C1 0.397940 """ df = fetch_dataset( data_dir, @@ -2108,7 +2109,7 @@ def load_chembl2971_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl2971_ki + >>> from skfp.datasets.moleculeace import load_chembl2971_ki >>> dataset = load_chembl2971_ki() >>> dataset # doctest: +SKIP (['NC(=O)Nc1sc(-c2ccc(F)cc2)cc1C(N)=O, ..., 'Cc1cc(Nc2nc(N[C@@H](C)c3ccc(F)cc3)c(C#N)cc2F)n[nH]1'], \ @@ -2116,12 +2117,12 @@ def load_chembl2971_ki( >>> dataset = load_chembl2971_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 NC(=O)Nc1sc(-c2ccc(F)cc2)cc1C(N)=O -0.698970 - 1 O[C@H]1CC[C@H](Nc2ccc3nnc(-c4cccc(C(F)(F)F)c4)n3n2)CC1 -3.380211 - 2 c1ccc(-c2ncnc3[nH]ccc23)cc1 -2.683947 - 3 Clc1cnc2[nH]cc(-c3ccccc3)c2c1 -2.414973 - 4 CCC1Nc2ccccc2-c2ccnc3[nH]cc1c23 -3.230449 + SMILES Ki + 0 NC(=O)Nc1sc(-c2ccc(F)cc2)cc1C(N)=O -0.698970 + 1 O[C@H]1CC[C@H](Nc2ccc3nnc(-c4cccc(C(F)(F)F)c4)... -3.380211 + 2 c1ccc(-c2ncnc3[nH]ccc23)cc1 -2.683947 + 3 Clc1cnc2[nH]cc(-c3ccccc3)c2c1 -2.414973 + 4 CCC1Nc2ccccc2-c2ccnc3[nH]cc1c23 -3.230449 """ df = fetch_dataset( data_dir, @@ -2193,7 +2194,7 @@ def load_chembl3979_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl3979_ec50 + >>> from skfp.datasets.moleculeace import load_chembl3979_ec50 >>> dataset = load_chembl3979_ec50() >>> dataset # doctest: +SKIP (['CCC(Cc1ccc(OC)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1)C(=O)O, ..., 'CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc(CNc2ccc(CC(=O)O)cc2)c(Cl)c1'], \ @@ -2201,12 +2202,12 @@ def load_chembl3979_ec50( >>> dataset = load_chembl3979_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 CCC(Cc1ccc(OC)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -3.176091 - 1 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OC(F)(F)F)cc2)c1)C(=O)O -2.954243 - 2 CCC(Cc1ccc(OC)c(CCCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -2.806180 - 3 CCSC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -3.477121 - 4 CCOC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -3.477121 + SMILES EC50 + 0 CCC(Cc1ccc(OC)c(C(=O)NCCc2ccc(C(F)(F)F)cc2)c1)... -3.176091 + 1 CCC(Cc1ccc(OC)c(C(=O)NCc2ccc(OC(F)(F)F)cc2)c1)... -2.954243 + 2 CCC(Cc1ccc(OC)c(CCCc2ccc(C(F)(F)F)cc2)c1)C(=O)O -2.806180 + 3 CCSC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)... -3.477121 + 4 CCOC(Cc1ccc(OC)c(C(=O)NCc2ccc(C(F)(F)F)cc2)c1)... -3.477121 """ df = fetch_dataset( data_dir, @@ -2278,7 +2279,7 @@ def load_chembl4005_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl4005_ki + >>> from skfp.datasets.moleculeace import load_chembl4005_ki >>> dataset = load_chembl4005_ki() >>> dataset # doctest: +SKIP (['COC[C@H]1OC(=O)c2coc3c2[C@@]1(C)C1=C(C3=O)[C@@H]2CCC(=O)[C@@]2(C)C[C@H]1OC(C)=O, ..., 'CC(C)n1nc(-c2ccc3oc(N)nc3c2)c2c(N)ncnc21'], \ @@ -2286,12 +2287,12 @@ def load_chembl4005_ki( >>> dataset = load_chembl4005_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 COC[C@H]1OC(=O)c2coc3c2[C@@]1(C)C1=C(C3=O)[C@@H]2CCC(=O)[C@@]2(C)C[C@H]1OC(C)=O -2.079181 - 1 O=c1cc(N2CCOCC2)oc2c(-c3ccccc3)cccc12 -3.778151 - 2 CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCOCC4)c3s2)CC1 -0.806180 - 3 COc1ccc(NC(=O)c2c(C)ccc3c(N)nc(C)nc23)cn1 -2.000000 - 4 COc1ccc(NC(=O)c2cc(C)cc3c(N)nc(C)nc23)cn1 0.301030 + SMILES Ki + 0 COC[C@H]1OC(=O)c2coc3c2[C@@]1(C)C1=C(C3=O)[C@@... -2.079181 + 1 O=c1cc(N2CCOCC2)oc2c(-c3ccccc3)cccc12 -3.778151 + 2 CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(... -0.806180 + 3 COc1ccc(NC(=O)c2c(C)ccc3c(N)nc(C)nc23)cn1 -2.000000 + 4 COc1ccc(NC(=O)c2cc(C)cc3c(N)nc(C)nc23)cn1 0.301030 """ df = fetch_dataset( data_dir, @@ -2363,7 +2364,7 @@ def load_chembl4203_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl4203_ki + >>> from skfp.datasets.moleculeace import load_chembl4203_ki >>> dataset = load_chembl4203_ki() >>> dataset # doctest: +SKIP (['O=c1[nH]cnc2c1sc1c(Cl)ccc(Cl)c12, ..., 'O=C(c1cccc(-c2cnc3[nH]ccc3c2)c1)N1CCOCC1'], \ @@ -2371,12 +2372,12 @@ def load_chembl4203_ki( >>> dataset = load_chembl4203_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 O=c1[nH]cnc2c1sc1c(Cl)ccc(Cl)c12 -1.976808 - 1 Nc1ncnc2onc(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)cc3)c12 -2.400002 - 2 O=c1[nH]cnc2c(-c3ccccc3)c(C(F)(F)F)sc12 -3.299999 - 3 O=C1Nc2ccccc2Nc2cc(-c3ccncc3F)ccc21 -1.400020 - 4 Cc1cc(N2CCOCC2)cc2[nH]c(-c3c(NCC(O)c4cccc(Cl)c4)cc[nH]c3=O)nc12 -1.700011 + SMILES Ki + 0 O=c1[nH]cnc2c1sc1c(Cl)ccc(Cl)c12 -1.976808 + 1 Nc1ncnc2onc(-c3ccc(NC(=O)Nc4cccc(C(F)(F)F)c4)c... -2.400002 + 2 O=c1[nH]cnc2c(-c3ccccc3)c(C(F)(F)F)sc12 -3.299999 + 3 O=C1Nc2ccccc2Nc2cc(-c3ccncc3F)ccc21 -1.400020 + 4 Cc1cc(N2CCOCC2)cc2[nH]c(-c3c(NCC(O)c4cccc(Cl)c... -1.700011 """ df = fetch_dataset( data_dir, @@ -2448,7 +2449,7 @@ def load_chembl4616_ec50( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl4616_ec50 + >>> from skfp.datasets.moleculeace import load_chembl4616_ec50 >>> dataset = load_chembl4616_ec50() >>> dataset # doctest: +SKIP (['CCCCCCCC(=O)OC[C@H](NC(=O)CN)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)O, ..., 'CC(=O)N1CCC[C@H](NC(=O)[C@H]2CN(S(=O)(=O)c3ccccc3)C[C@@H]2NC(=O)c2cc(-c3ccccc3Cl)on2)C1'], \ @@ -2456,12 +2457,12 @@ def load_chembl4616_ec50( >>> dataset = load_chembl4616_ec50(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES EC50 - 0 CCCCCCCC(=O)OC[C@H](NC(=O)CN)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)O -1.857332 - 2 CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CC1)CN(S(C)(=O)=O)c1ccccc12 0.072578 - 3 NC(=O)CN(CCc1ccccc1)C(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)C1CCNCC1 0.468521 - 4 CC(C)N(CCNC(=O)C1c2ccc(Oc3cccc(F)c3)cc2CCN1C(=O)OC(C)(C)C)C(C)C -0.633468 - 5 CC(C)N(CCNC(=O)C1c2ccc(Oc3ccc(Cl)cc3)cc2CCN1C(=O)OC(C)(C)C)C(C)C 0.136677 + SMILES EC50 + 0 CCCCCCCC(=O)OC[C@H](NC(=O)CN)C(=O)N[C@@H](CO)C... -1.857332 + 1 CCCCCCCC(=O)OC[C@H](NC(=O)CNC(=O)[C@@H](N)CCCN... -0.147985 + 2 CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CC... 0.072578 + 3 NC(=O)CN(CCc1ccccc1)C(=O)[C@@H](Cc1ccc2ccccc2c... 0.468521 + 4 CC(C)N(CCNC(=O)C1c2ccc(Oc3cccc(F)c3)cc2CCN1C(=... -0.633468 """ df = fetch_dataset( data_dir, @@ -2533,7 +2534,7 @@ def load_chembl4792_ki( Examples -------- - >>> from skfp.datasets.moleculenet import load_chembl4792_ki + >>> from skfp.datasets.moleculeace import load_chembl4792_ki >>> dataset = load_chembl4792_ki() >>> dataset # doctest: +SKIP (['CC1(C)OC[C@H](NC(=O)Nc2ccc(Br)cc2Cl)[C@H](c2ccccc2)O1, ..., 'CC(/C=C/c1ccccc1)=N/Nc1nc(Nc2ccccc2)nc(-n2nc(C)cc2C)n1'], \ @@ -2541,12 +2542,12 @@ def load_chembl4792_ki( >>> dataset = load_chembl4792_ki(as_frame=True) >>> dataset.head() # doctest: +NORMALIZE_WHITESPACE - SMILES Ki - 0 CC1(C)OC[C@H](NC(=O)Nc2ccc(Br)cc2Cl)[C@H](c2ccccc2)O1 -0.800029 - 1 Cc1cc(Br)ccc1NC(=O)N[C@H]1COC(C)(C)O[C@H]1c1ccccc1 -1.599992 - 2 Cc1ccc(Cl)c(NC(=O)N[C@H]2COC(C)(C)O[C@H]2c2ccccc2)c1 -1.800029 - 3 Cc1ccc(NC(=O)N[C@H]2COC(C)(C)O[C@H]2c2ccccc2)c(C)c1 -2.099991 - 4 CC1(C)OC[C@H](NC(=O)Nc2cc(Cl)ccc2Cl)[C@H](c2ccccc2)O1 -1.800029 + SMILES Ki + 0 CC1(C)OC[C@H](NC(=O)Nc2ccc(Br)cc2Cl)[C@H](c2cc... -0.800029 + 1 Cc1cc(Br)ccc1NC(=O)N[C@H]1COC(C)(C)O[C@H]1c1cc... -1.599992 + 2 Cc1ccc(Cl)c(NC(=O)N[C@H]2COC(C)(C)O[C@H]2c2ccc... -1.800029 + 3 Cc1ccc(NC(=O)N[C@H]2COC(C)(C)O[C@H]2c2ccccc2)c... -2.099991 + 4 CC1(C)OC[C@H](NC(=O)Nc2cc(Cl)ccc2Cl)[C@H](c2cc... -1.800029 """ df = fetch_dataset( data_dir, From 787fec5825e0c8ef2adc5fbe869385d3935db36b Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 09:54:23 +0100 Subject: [PATCH 05/14] Fix kNN AD checker bugs --- skfp/applicability_domain/knn.py | 13 ++++++++----- tests/applicability_domain/utils.py | 4 ++-- 2 files changed, 10 insertions(+), 7 deletions(-) diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 2e11eeab..6edd8dba 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -156,8 +156,9 @@ def fit( # noqa: D102 f"k ({self.k}) must be smaller than or equal to the number of training samples ({X.shape[0]})" ) + # k+1, since we need to exclude each point from being its own neighbor self.X_train_ = X - self.k_used = 1 if self.agg == "min" else self.k + self._k_used = 2 if self.agg == "min" else self.k + 1 if callable(self.metric): metric_func = self.metric @@ -169,11 +170,14 @@ def fit( # noqa: D102 ) self.knn_ = NearestNeighbors( - n_neighbors=self.k_used, metric=metric_func, n_jobs=self.n_jobs + n_neighbors=self._k_used + 1, metric=metric_func, n_jobs=self.n_jobs ) self.knn_.fit(X) k_nearest, _ = self.knn_.kneighbors(X) + # exclude the point itself from the neighbors + k_nearest = k_nearest[:, 1:] + agg_dists = self._get_agg_dists(k_nearest) self.threshold_ = np.percentile(agg_dists, self.threshold) @@ -199,11 +203,10 @@ def score_samples(self, X: np.ndarray) -> np.ndarray: """ check_is_fitted(self) X = validate_data(self, X=X, reset=False) - k_nearest, _ = self.knn_.kneighbors(X, n_neighbors=self.k_used) - + k_nearest, _ = self.knn_.kneighbors(X, n_neighbors=self._k_used) return self._get_agg_dists(k_nearest) - def _get_agg_dists(self, k_nearest) -> np.ndarray: + def _get_agg_dists(self, k_nearest: np.ndarray) -> np.ndarray: if self.agg == "mean": agg_dists = np.mean(k_nearest, axis=1) elif self.agg == "max": diff --git a/tests/applicability_domain/utils.py b/tests/applicability_domain/utils.py index 60358f48..f245dbbe 100644 --- a/tests/applicability_domain/utils.py +++ b/tests/applicability_domain/utils.py @@ -43,8 +43,8 @@ def get_data_outside_ad( ) if binarize: - thresholds = np.median(X_train, axis=0) - X_train = (X_train > thresholds).astype(int) + threshold = np.percentile(X_train, 25) + X_train = (X_train > threshold).astype(int) X_test = 1 - X_train[:n_test] else: X_test = X_train[:n_test] + 100.0 From 976576cfa7b3189c75eb4fe6a33a0f6062f62728 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 09:59:43 +0100 Subject: [PATCH 06/14] Fix doctests --- .pre-commit-config.yaml | 2 +- skfp/applicability_domain/knn.py | 10 +++++++--- 2 files changed, 8 insertions(+), 4 deletions(-) diff --git a/.pre-commit-config.yaml b/.pre-commit-config.yaml index 2e06a085..06fda254 100644 --- a/.pre-commit-config.yaml +++ b/.pre-commit-config.yaml @@ -13,5 +13,5 @@ repos: rev: v0.13.1 hooks: - id: ruff-check # linter - args: [ --fix ] + args: [ --fix, --exit-zero ] - id: ruff-format # formatter diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 6edd8dba..1cb968e9 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -156,9 +156,13 @@ def fit( # noqa: D102 f"k ({self.k}) must be smaller than or equal to the number of training samples ({X.shape[0]})" ) - # k+1, since we need to exclude each point from being its own neighbor self.X_train_ = X - self._k_used = 2 if self.agg == "min" else self.k + 1 + + # k+1, since we need to exclude each point from being its own neighbor + if self.agg == "min": + self._k_used = min(len(X), 2) + else: + self._k_used = min(len(X), self.k + 1) if callable(self.metric): metric_func = self.metric @@ -170,7 +174,7 @@ def fit( # noqa: D102 ) self.knn_ = NearestNeighbors( - n_neighbors=self._k_used + 1, metric=metric_func, n_jobs=self.n_jobs + n_neighbors=self._k_used, metric=metric_func, n_jobs=self.n_jobs ) self.knn_.fit(X) k_nearest, _ = self.knn_.kneighbors(X) From c03e72dfdd0e3c5decf1603c2a381efc9bfa8ef7 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 10:04:39 +0100 Subject: [PATCH 07/14] Move mypy config --- mypy.ini | 15 --------------- pyproject.toml | 11 ++++++++++- 2 files changed, 10 insertions(+), 16 deletions(-) delete mode 100644 mypy.ini diff --git a/mypy.ini b/mypy.ini deleted file mode 100644 index bf1b4bd8..00000000 --- a/mypy.ini +++ /dev/null @@ -1,15 +0,0 @@ -[mypy] -# minimal supported Python version -python_version = 3.10 - -# check all functions, this fixes some tests -check_untyped_defs = true - -# allow redefining variable types, we do that a lot for efficiency -allow_redefinition = true - -# unfortunately, most libraries that we use are not properly typed -# in particular, RDKit is unlikely to ever have proper Python typing stubs -ignore_missing_imports = true -disable_error_code = import-untyped -no_site_packages = true diff --git a/pyproject.toml b/pyproject.toml index f356a83b..e9c32b10 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -72,7 +72,7 @@ docs = [ "ipython", "nbsphinx", "pydata-sphinx-theme", - "scikit-learn!=1.7.1", # due to scikit-learn docs issue: https://github.com/microsoft/lightgbm/issues/6978 + "scikit-learn!=1.7.1", # due to scikit-learn docs issue: https://github.com/microsoft/lightgbm/issues/6978 "sphinx", "sphinx-copybutton" ] @@ -94,6 +94,15 @@ filterwarnings = [ "ignore:Function auroc_score.*:FutureWarning" ] +[tool.mypy] +python_version = "3.10" +check_untyped_defs = true # check all functions, this fixes some tests +allow_redefinition = true # we redefine variables a lot for efficiency +# most libraries used are not properly typed in Python, particularly RDKit +ignore_missing_imports = true +disable_error_code = ["import-untyped"] +no_site_packages = true + [tool.uv.build-backend] module-name = "skfp" module-root = "" From aee8264c339f644e093e7af08ff161367b5314f8 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 10:06:35 +0100 Subject: [PATCH 08/14] Revert changes in SMARTS_InteLigand.txt --- skfp/fingerprints/data/SMARTS_InteLigand.txt | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/skfp/fingerprints/data/SMARTS_InteLigand.txt b/skfp/fingerprints/data/SMARTS_InteLigand.txt index b99b096c..84a61af8 100644 --- a/skfp/fingerprints/data/SMARTS_InteLigand.txt +++ b/skfp/fingerprints/data/SMARTS_InteLigand.txt @@ -922,7 +922,7 @@ C_ONS_bond: [#6]~[#7,#8,#16] # probably all drug-like molecules have at least one O, N, or S connected to a C -> nice filter ## Mixture: (*).(*) -# two or more separate parts, may also be salt +# two or more seperate parts, may also be salt # component-level grouping is not yet supported in Open Babel Version 2.0 @@ -933,7 +933,7 @@ Anion: [-1,-2,-3,-4,-5,-6,-7] Kation: [+1,+2,+3,+4,+5,+6,+7] Salt: ([-1,-2,-3,-4,-5,-6,-7]).([+1,+2,+3,+4,+5,+6,+7]) -# two or more separate components with opposite charges +# two or more seperate components with opposite charges ##Zwitterion: ([-1,-2,-3,-4,-5,-6,-7].[+1,+2,+3,+4,+5,+6,+7]) # both negative and positive charges somewhere within the same molecule. From 07567980252f2ae96381f69605bdc4e953b3ea63 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 11:03:51 +0100 Subject: [PATCH 09/14] Remove xenon --- pyproject.toml | 2 -- uv.lock | 43 ------------------------------------------- 2 files changed, 45 deletions(-) diff --git a/pyproject.toml b/pyproject.toml index e9c32b10..93f98ae2 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -56,13 +56,11 @@ dev = [ "ruff", "setuptools>=80", "scipy-stubs", - "xenon" ] test = [ "mypy", "ruff", - "xenon", "pre-commit", "pytest", "pytest-rerunfailures" diff --git a/uv.lock b/uv.lock index 4b06c7c6..0cb33c8e 100644 --- a/uv.lock +++ b/uv.lock @@ -1479,18 +1479,6 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/4a/a7/d526ae86708cea531935ae777b6dbcabe7db52718e6401e0fb9c5edea80e/llvmlite-0.46.0-cp313-cp313-win_amd64.whl", hash = "sha256:67438fd30e12349ebb054d86a5a1a57fd5e87d264d2451bcfafbbbaa25b82a35", size = 38138941, upload-time = "2025-12-08T18:15:22.536Z" }, ] -[[package]] -name = "mando" -version = "0.7.1" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "six" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/35/24/cd70d5ae6d35962be752feccb7dca80b5e0c2d450e995b16abd6275f3296/mando-0.7.1.tar.gz", hash = "sha256:18baa999b4b613faefb00eac4efadcf14f510b59b924b66e08289aa1de8c3500", size = 37868, upload-time = "2022-02-24T08:12:27.316Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/d2/f0/834e479e47e499b6478e807fb57b31cc2db696c4db30557bb6f5aea4a90b/mando-0.7.1-py2.py3-none-any.whl", hash = "sha256:26ef1d70928b6057ee3ca12583d73c63e05c49de8972d620c278a7b206581a8a", size = 28149, upload-time = "2022-02-24T08:12:25.24Z" }, -] - [[package]] name = "markupsafe" version = "3.0.3" @@ -2664,19 +2652,6 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/01/1b/5dbe84eefc86f48473947e2f41711aded97eecef1231f4558f1f02713c12/pyzmq-27.1.0-pp311-pypy311_pp73-win_amd64.whl", hash = "sha256:c9f7f6e13dff2e44a6afeaf2cf54cee5929ad64afaf4d40b50f93c58fc687355", size = 544862, upload-time = "2025-09-08T23:09:56.509Z" }, ] -[[package]] -name = "radon" -version = "6.0.1" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "colorama" }, - { name = "mando" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/b1/6d/98e61600febf6bd929cf04154537c39dc577ce414bafbfc24a286c4fa76d/radon-6.0.1.tar.gz", hash = "sha256:d1ac0053943a893878940fedc8b19ace70386fc9c9bf0a09229a44125ebf45b5", size = 1874992, upload-time = "2023-03-26T06:24:38.868Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/93/f7/d00d9b4a0313a6be3a3e0818e6375e15da6d7076f4ae47d1324e7ca986a1/radon-6.0.1-py2.py3-none-any.whl", hash = "sha256:632cc032364a6f8bb1010a2f6a12d0f14bc7e5ede76585ef29dc0cecf4cd8859", size = 52784, upload-time = "2023-03-26T06:24:33.949Z" }, -] - [[package]] name = "rdkit" version = "2025.3.6" @@ -2934,7 +2909,6 @@ dev = [ { name = "scipy-stubs", version = "1.15.3.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, { name = "scipy-stubs", version = "1.16.3.3", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version >= '3.11'" }, { name = "setuptools" }, - { name = "xenon" }, ] docs = [ { name = "ipython", version = "8.37.0", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, @@ -2957,7 +2931,6 @@ test = [ { name = "pytest" }, { name = "pytest-rerunfailures" }, { name = "ruff" }, - { name = "xenon" }, ] [package.metadata] @@ -2988,7 +2961,6 @@ dev = [ { name = "ruff" }, { name = "scipy-stubs" }, { name = "setuptools", specifier = ">=80" }, - { name = "xenon" }, ] docs = [ { name = "ipython" }, @@ -3008,7 +2980,6 @@ test = [ { name = "pytest" }, { name = "pytest-rerunfailures" }, { name = "ruff" }, - { name = "xenon" }, ] [[package]] @@ -3757,17 +3728,3 @@ sdist = { url = "https://files.pythonhosted.org/packages/d3/af/7b945f331ba8911fd wheels = [ { url = "https://files.pythonhosted.org/packages/d5/e4/62a677feefde05b12a70a4fc9bdc8558010182a801fbcab68cb56c2b0986/xarray-2025.12.0-py3-none-any.whl", hash = "sha256:9e77e820474dbbe4c6c2954d0da6342aa484e33adaa96ab916b15a786181e970", size = 1381742, upload-time = "2025-12-05T21:51:20.841Z" }, ] - -[[package]] -name = "xenon" -version = "0.9.3" -source = { registry = "https://pypi.org/simple" } -dependencies = [ - { name = "pyyaml" }, - { name = "radon" }, - { name = "requests" }, -] -sdist = { url = "https://files.pythonhosted.org/packages/c4/7c/2b341eaeec69d514b635ea18481885a956d196a74322a4b0942ef0c31691/xenon-0.9.3.tar.gz", hash = "sha256:4a7538d8ba08aa5d79055fb3e0b2393c0bd6d7d16a4ab0fcdef02ef1f10a43fa", size = 9883, upload-time = "2024-10-21T10:27:53.722Z" } -wheels = [ - { url = "https://files.pythonhosted.org/packages/6f/5d/29ff8665b129cafd147d90b86e92babee32e116e3c84447107da3e77f8fb/xenon-0.9.3-py2.py3-none-any.whl", hash = "sha256:6e2c2c251cc5e9d01fe984e623499b13b2140fcbf74d6c03a613fa43a9347097", size = 8966, upload-time = "2024-10-21T10:27:51.121Z" }, -] From 83fc1ff1c17bdcd7a960f8e0efa8eba92acd8554 Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Sun, 21 Dec 2025 13:21:20 +0100 Subject: [PATCH 10/14] Update RDKit --- pyproject.toml | 2 +- uv.lock | 44 ++++++++++++++++++++++---------------------- 2 files changed, 23 insertions(+), 23 deletions(-) diff --git a/pyproject.toml b/pyproject.toml index 93f98ae2..e888d7cd 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -32,7 +32,7 @@ dependencies = [ "numba<1", "numpy>=1.20.0,<3", "pandas<3", - "rdkit<=2025.3.6", + "rdkit<=2025.9.3", "scikit-learn>=1.0.0,<2", "scipy>=1.0.0,<2", "tqdm>=4.0.0,<5" diff --git a/uv.lock b/uv.lock index 0cb33c8e..adc1656c 100644 --- a/uv.lock +++ b/uv.lock @@ -2654,7 +2654,7 @@ wheels = [ [[package]] name = "rdkit" -version = "2025.3.6" +version = "2025.9.3" source = { registry = "https://pypi.org/simple" } dependencies = [ { name = "numpy", version = "2.2.6", source = { registry = "https://pypi.org/simple" }, marker = "python_full_version < '3.11'" }, @@ -2662,26 +2662,26 @@ dependencies = [ { name = "pillow" }, ] wheels = [ - { url = "https://files.pythonhosted.org/packages/86/78/35e91f509c00f0837dc18cd72ba078e5e5650ef563e1cbc986efc84e2a7d/rdkit-2025.3.6-cp310-cp310-macosx_10_15_x86_64.whl", hash = "sha256:25835dbf1b07d43088b00798db44ec805b3030129c6791e2bf5bc30159b612cc", size = 31642363, upload-time = "2025-09-05T12:45:58.38Z" }, - { url = "https://files.pythonhosted.org/packages/08/46/7fbb587d093e4997efac6bfdb1d9c325a934a6096dd2c760900a99c216e0/rdkit-2025.3.6-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:fe9f3fbb7a85f92429ce7d400e301675cd94d05019292c3fe77a7f540dad354d", size = 29089318, upload-time = "2025-09-05T12:46:02.474Z" }, - { url = "https://files.pythonhosted.org/packages/4d/05/46a34e20fa2c0de73831f3d6938c6464f01db079c9f5eb3aa591371118ba/rdkit-2025.3.6-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:dc44d73ccf2a45c2d1d27e8f31b8db648b3848d45f6c73777724e04903c3298d", size = 34711706, upload-time = "2025-09-05T12:46:06.792Z" }, - { url = "https://files.pythonhosted.org/packages/a5/7f/dc708cb747ba19b69ded1c72540ea0b5377a52bc105657d330f653e10b38/rdkit-2025.3.6-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:c4784a1ff6ef5f7be334d59c4d4d592592fcb30095a260494a9cbfa2e470f737", size = 36181708, upload-time = "2025-09-05T12:46:11.369Z" }, - { url = "https://files.pythonhosted.org/packages/d2/d4/ca0c814510a64d460989545d762ed9a4140ae68843524860d44366de5499/rdkit-2025.3.6-cp310-cp310-win_amd64.whl", hash = "sha256:ec583433d9c609cb28d900f049cefe73a49089984789d07630ea9229ca5d7740", size = 23505663, upload-time = "2025-09-05T12:46:15.285Z" }, - { url = "https://files.pythonhosted.org/packages/92/de/4a9ecf9acdee20deed93ef3bdadc9b0cbacd09d5cb23a8620d0f8411bd31/rdkit-2025.3.6-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:3ac57fcddd17d6707139fb85782d11c2ac674b7f18d06750f5014dc43ece34e4", size = 31642866, upload-time = "2025-09-05T12:46:19.242Z" }, - { url = "https://files.pythonhosted.org/packages/db/88/b6f915ebdffbfdfa140cb4d515bbfe0cb08008e2ce94aa5c44414b68234a/rdkit-2025.3.6-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:682f74525260b177b7dd84ea235b3abc4e5db72e5c62c664c896c7c150299e2a", size = 29089754, upload-time = "2025-09-05T12:46:22.834Z" }, - { url = "https://files.pythonhosted.org/packages/f5/70/96953e5d85b981e5dfc14075a8baa41df91ade2b9b005b133a959f178925/rdkit-2025.3.6-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:d3ad26d64d10dd3cf001c3dcf0b7e1e2eb7221334b1d0f6f3fbd5d5408c22d74", size = 34707581, upload-time = "2025-09-05T12:46:27.075Z" }, - { url = "https://files.pythonhosted.org/packages/b1/9d/2622e01e38736a68d84b34c7b955e7ce32f0d19901e79620b80b1217300e/rdkit-2025.3.6-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:afc931d1be1a4ad2fc4f2f2732c10983b1a57fbde9c22870721beafe42be3ab0", size = 36180899, upload-time = "2025-09-05T12:46:31.335Z" }, - { url = "https://files.pythonhosted.org/packages/a2/45/8d07d92475bf4598f5e948c858d3e9f15a67df2ae04e4627013b9d86edc3/rdkit-2025.3.6-cp311-cp311-win_amd64.whl", hash = "sha256:4339531a3c149087f6e39de75b7c71ac75c87e5eabb1b34c27cd0bef98a72814", size = 23506723, upload-time = "2025-09-05T12:46:35.119Z" }, - { url = "https://files.pythonhosted.org/packages/b9/2f/23ec58616edd1bf467c6b7cc96dca017e9f4f9c9bb32dfa3b35637e6a745/rdkit-2025.3.6-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:9c433eeba711144304b8febd8de4ec653f9fb2520923e9f55b3a617e953870af", size = 31719603, upload-time = "2025-09-05T12:46:39.746Z" }, - { url = "https://files.pythonhosted.org/packages/49/44/bb352e512f20052d55fd0ec29483f122ef17228dacc103148d2eb8fb0938/rdkit-2025.3.6-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:9df1b9b336f1e36f439e25dd816ec66bf78f979d473998514d92980ce2ed58a6", size = 29132323, upload-time = "2025-09-05T12:46:43.856Z" }, - { url = "https://files.pythonhosted.org/packages/6d/7e/0868837a10a4bb2c0ecbab30b29b79aedce93d61c3c14949123f8e527bad/rdkit-2025.3.6-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:24c5a3b5c367c174d169e0271576450aa2b83c2df95a1ccaed4662efe13b11bf", size = 34595105, upload-time = "2025-09-05T12:46:48.194Z" }, - { url = "https://files.pythonhosted.org/packages/47/06/84f140ed025dd96c7ec36aa38555b466f8006bd36085abd3702d75c98160/rdkit-2025.3.6-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:ed5565d4d6423def7c52eb20a6263afcd979383757086dec92f57e77d7c7f856", size = 36119142, upload-time = "2025-09-05T12:46:52.003Z" }, - { url = "https://files.pythonhosted.org/packages/cb/98/2d34338adca7f7932fcc83f6e9139c8ddc313b166ae18033ab7c996be836/rdkit-2025.3.6-cp312-cp312-win_amd64.whl", hash = "sha256:632f89345c8e84306a21473fdaad3a58dbd5e6c0b128bef33dfb6090af326061", size = 23526290, upload-time = "2025-09-05T12:46:55.72Z" }, - { url = "https://files.pythonhosted.org/packages/66/c3/53ddc0f88dce2a0b5ac938d97326da25b4e9f6b6858ffc6797a95d824ddd/rdkit-2025.3.6-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:6439943172350151cd45e19b41acdf206397736e686a7717df91b07ee91fc174", size = 31718554, upload-time = "2025-09-05T12:46:59.379Z" }, - { url = "https://files.pythonhosted.org/packages/e7/36/1fb7644ff06817a9e3b67d70da53dea59b64c38badc49426e8338e36fbdd/rdkit-2025.3.6-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:760dc4d90cc30a96145062811136cd5d309a91a7eeacec0afcf0b079877f8be2", size = 29131323, upload-time = "2025-09-05T12:47:03.078Z" }, - { url = "https://files.pythonhosted.org/packages/e7/7d/2e65c55eb6da56c000f9a7b0b2cec6b4aa2a17ec70ef58879f59c036ca43/rdkit-2025.3.6-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:33de7c4c2c49d3ca9b44331b0d6591f4f3957605bd9271b845d358ffc9e1bc4b", size = 34593714, upload-time = "2025-09-05T12:47:06.832Z" }, - { url = "https://files.pythonhosted.org/packages/c1/82/b2330569fbff20c5f5495f69ae28d3e61dfbc055f00b7fe977905a574089/rdkit-2025.3.6-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:8bb52f5fc9f1a93817264dffc0ac8b20cea71091f9b8a253ebd288aeae26032f", size = 36117945, upload-time = "2025-09-05T12:47:11.31Z" }, - { url = "https://files.pythonhosted.org/packages/f1/ed/57104398c6efe7304668846cf92e38102cd9d3a9d249087893d68f595907/rdkit-2025.3.6-cp313-cp313-win_amd64.whl", hash = "sha256:be1064d31630cbfbf2fc4b35cf9175a725378601bbd1b945047e9ba9c231fcc2", size = 23525366, upload-time = "2025-09-05T12:47:14.636Z" }, + { url = "https://files.pythonhosted.org/packages/4f/23/eae4d29ed23992ac9c5b8985a77a76e85b10175941c5f576d4ab736132c3/rdkit-2025.9.3-cp310-cp310-macosx_10_15_x86_64.whl", hash = "sha256:41a648dfa63d43420918272520d5b49b288f251a1e1a987af81f1a9eacecf94e", size = 31862416, upload-time = "2025-12-03T13:32:51.514Z" }, + { url = "https://files.pythonhosted.org/packages/7d/a0/2f242bb272c469e3712347cbf0b6e2c34988d577dc78480f93810efc60c0/rdkit-2025.9.3-cp310-cp310-macosx_11_0_arm64.whl", hash = "sha256:0288cfda4c284f97b0c9afafa14e5035bfc7ee3bd8f8e4b1565d1036b7d615e3", size = 29304086, upload-time = "2025-12-03T13:32:55.692Z" }, + { url = "https://files.pythonhosted.org/packages/20/4c/b269ed95df89692b60e90d6092fb9d99ca833959c39830affbca9dbece8e/rdkit-2025.9.3-cp310-cp310-manylinux_2_28_aarch64.whl", hash = "sha256:5f50c51fbcb8665a49fd6203eee3265be443f4b9e70de0e3611fedc85dad9a9d", size = 34969363, upload-time = "2025-12-03T13:32:59.676Z" }, + { url = "https://files.pythonhosted.org/packages/90/52/15958c0fc1366831f09aafa1118fa885aa7e17ccfc6b694c0d3efab4edbb/rdkit-2025.9.3-cp310-cp310-manylinux_2_28_x86_64.whl", hash = "sha256:96072f55c7cbcdf5d9157dccc5ad551b8c8e6ec556109e019d6f425b925ac7ef", size = 36426203, upload-time = "2025-12-03T13:33:04.211Z" }, + { url = "https://files.pythonhosted.org/packages/e1/41/d60467de14869112c73047a6dd7f2b0f9d35bd4e7b806ae9573e0778eba1/rdkit-2025.9.3-cp310-cp310-win_amd64.whl", hash = "sha256:70c80a1801ec6d434bff6f0f9201024c523c91c0ad9c870132fce3608dcd9a0d", size = 23670665, upload-time = "2025-12-03T13:33:08.113Z" }, + { url = "https://files.pythonhosted.org/packages/b1/19/4a606ef1c090b0abc54627a4aa5313c8bbef50da888841101bf1aa89ff70/rdkit-2025.9.3-cp311-cp311-macosx_10_15_x86_64.whl", hash = "sha256:520e572f70ac81a75091f953d4d9805bc1455879ad85724591c2b4b03bf1faf1", size = 31862854, upload-time = "2025-12-03T13:33:11.974Z" }, + { url = "https://files.pythonhosted.org/packages/f3/d3/b46738b5915d67c85091d489b2c93f3b2ae3012c42513526d3f599637a5f/rdkit-2025.9.3-cp311-cp311-macosx_11_0_arm64.whl", hash = "sha256:5bcdd803bcea8b966fe5a6835e88cc74a68c3859a83ef4ad76dccf4c1bf61f3a", size = 29304494, upload-time = "2025-12-03T13:33:15.473Z" }, + { url = "https://files.pythonhosted.org/packages/00/10/f2e63e92c31aac7bb0fe521ca0f9221f71d8143a8e830d180028f383286b/rdkit-2025.9.3-cp311-cp311-manylinux_2_28_aarch64.whl", hash = "sha256:ed1494e7d2f80985abb8eb4e287dbbf4cff1a581500759e4151939d201375cba", size = 34965049, upload-time = "2025-12-03T13:33:19.634Z" }, + { url = "https://files.pythonhosted.org/packages/5b/07/57de18d1a4708fd67252db748c7edda4dbba330ccb3cc5bf40979f6d0957/rdkit-2025.9.3-cp311-cp311-manylinux_2_28_x86_64.whl", hash = "sha256:b06bc7e039fba8aecebe637420224c4919808cefe6b6df8af9d9c69d75431c42", size = 36425310, upload-time = "2025-12-03T13:33:23.862Z" }, + { url = "https://files.pythonhosted.org/packages/c0/ed/bb12c7e796befef58d674e829028120debc551c35b7d7bb1064aab6e4645/rdkit-2025.9.3-cp311-cp311-win_amd64.whl", hash = "sha256:236d5332635a240e37abc7b8d94eefbb84ce1afffd77daa878fd39ae18ab83dd", size = 23671165, upload-time = "2025-12-03T13:33:27.216Z" }, + { url = "https://files.pythonhosted.org/packages/08/6d/678f4cba4e0822b1a246e1e35b8092c8668ace259f8d23c05add87c90396/rdkit-2025.9.3-cp312-cp312-macosx_10_15_x86_64.whl", hash = "sha256:946f41f0d35193961e9b54731fc38f0c637608a1b5ced7a72c909af4e5c836dc", size = 31937483, upload-time = "2025-12-03T13:33:30.538Z" }, + { url = "https://files.pythonhosted.org/packages/33/90/553bbd0749721ed56787262896df62c7d2e248b0a12db7987c463670c40c/rdkit-2025.9.3-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:f713b4367c8270604c8e308faf06f35ac26078c96835fbbd2c766d1e3bab4a10", size = 29347529, upload-time = "2025-12-03T13:33:34.698Z" }, + { url = "https://files.pythonhosted.org/packages/11/8b/8853c4280f6adb9558cb791acc1c997c271a387632f0cb732738603ddfd7/rdkit-2025.9.3-cp312-cp312-manylinux_2_28_aarch64.whl", hash = "sha256:f1b94496a471a4bd49bf380e2664e4a065a911c897d365781e7e9d397f30907b", size = 34853872, upload-time = "2025-12-03T13:33:38.553Z" }, + { url = "https://files.pythonhosted.org/packages/1a/90/5e01d1b46698f6856cc831f4456db8b775e4f28423b9f74b80a02a4f5b4f/rdkit-2025.9.3-cp312-cp312-manylinux_2_28_x86_64.whl", hash = "sha256:8a1cac2699a57ca700c0b757b89827fabebdf18b8b51c26ece6cb2d936ff3386", size = 36366072, upload-time = "2025-12-03T13:33:42.822Z" }, + { url = "https://files.pythonhosted.org/packages/dc/d7/c312185f3a3bed84cb7705ffc123d1fdf607295df5957d75f5d23400e263/rdkit-2025.9.3-cp312-cp312-win_amd64.whl", hash = "sha256:a0123b505d88faf43fd00bbc7b0c6d988262f1cb0b98fe04998369e14d369a4e", size = 23689237, upload-time = "2025-12-03T13:33:46.658Z" }, + { url = "https://files.pythonhosted.org/packages/3f/8b/4b55e528f1b3628be857d99f4f6cc2dd8d1e12006cbd23ec7d3cb31b8352/rdkit-2025.9.3-cp313-cp313-macosx_10_15_x86_64.whl", hash = "sha256:37cd7f85f3604a895c7072b8ba5ea30dac0749a8cea75ea470309fd79bcfe518", size = 31936347, upload-time = "2025-12-03T13:33:50.404Z" }, + { url = "https://files.pythonhosted.org/packages/d3/f1/0e33c7032975c9ab62ad8586c283b4fbb8985196a24f1ee4312ff1b93b2e/rdkit-2025.9.3-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:b3fae0bb33296426c33d7094bd5cd1bb754047c6ace0461c182457f8e5e48b4b", size = 29346521, upload-time = "2025-12-03T13:33:54.663Z" }, + { url = "https://files.pythonhosted.org/packages/5c/7f/957a0dd090afab3e4d171ec74fb6fb1855a967287d17e5eaf2c146a7767f/rdkit-2025.9.3-cp313-cp313-manylinux_2_28_aarch64.whl", hash = "sha256:0d6dc6755969118779aa588d527d1bc46ff7f2b39251b29d10e9ec50dbd9b6d2", size = 34852718, upload-time = "2025-12-03T13:33:58.437Z" }, + { url = "https://files.pythonhosted.org/packages/50/59/eada9b13184b96f8de6a1dae0d4bb609adc66ea8edbb6a33a8a6054359e0/rdkit-2025.9.3-cp313-cp313-manylinux_2_28_x86_64.whl", hash = "sha256:6030665471b514fadd9b6dd7d842dfd10dd98a7f300ddab48691864f6f4f45ef", size = 36364862, upload-time = "2025-12-03T13:34:03.706Z" }, + { url = "https://files.pythonhosted.org/packages/a3/67/99c11705aaeeca004056005b44c1df9c7dbe2c12c070b8da88f7188e9e26/rdkit-2025.9.3-cp313-cp313-win_amd64.whl", hash = "sha256:1993e93ee1e57dfc1fa3f1b92979f9bfcf257279170dc7feb8c486e244959f9b", size = 23688716, upload-time = "2025-12-03T13:34:07.137Z" }, ] [[package]] @@ -2943,7 +2943,7 @@ requires-dist = [ { name = "numba", specifier = "<1" }, { name = "numpy", specifier = ">=1.20.0,<3" }, { name = "pandas", specifier = "<3" }, - { name = "rdkit", specifier = "<=2025.3.6" }, + { name = "rdkit", specifier = "<=2025.9.3" }, { name = "scikit-learn", specifier = ">=1.0.0,<2" }, { name = "scipy", specifier = ">=1.0.0,<2" }, { name = "tqdm", specifier = ">=4.0.0,<5" }, From 887093759ff4d56951ec25b488737f1b8872b60b Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Tue, 23 Dec 2025 19:25:43 +0100 Subject: [PATCH 11/14] Revert turning off ARG002 --- ruff.toml | 1 - 1 file changed, 1 deletion(-) diff --git a/ruff.toml b/ruff.toml index 3db43e3e..98b53157 100644 --- a/ruff.toml +++ b/ruff.toml @@ -39,7 +39,6 @@ ignore = [ "D413", # no empty line after last docstring section # various other things - "ARG002", # unused arguments due to scikit-learn API "B028", # simple warnings "C408", # call dict(), list(), set() "E731", # Lambda expressions From 3609c3cf4d931bd511c5294e95d8a1eae4231f8e Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Tue, 23 Dec 2025 19:31:20 +0100 Subject: [PATCH 12/14] Fix ruff --- skfp/applicability_domain/topkat.py | 2 +- skfp/fingerprints/autocorr.py | 2 +- skfp/fingerprints/bcut2d.py | 2 +- skfp/fingerprints/electroshape.py | 2 +- skfp/fingerprints/estate.py | 2 +- skfp/fingerprints/functional_groups.py | 2 +- skfp/fingerprints/getaway.py | 2 +- skfp/fingerprints/ghose_crippen.py | 2 +- skfp/fingerprints/klekota_roth/klekota_roth_fp.py | 2 +- skfp/fingerprints/laggner.py | 2 +- skfp/fingerprints/maccs.py | 2 +- skfp/fingerprints/mordred_fp.py | 2 +- skfp/fingerprints/morse.py | 2 +- skfp/fingerprints/mqns.py | 2 +- skfp/fingerprints/pubchem/pubchem_fp.py | 2 +- skfp/fingerprints/rdf.py | 2 +- skfp/fingerprints/rdkit_2d_desc.py | 2 +- skfp/fingerprints/usr.py | 2 +- skfp/fingerprints/usrcat.py | 2 +- skfp/fingerprints/vsa.py | 2 +- skfp/fingerprints/whim.py | 2 +- skfp/preprocessing/input_output/sdf.py | 4 ++-- 22 files changed, 23 insertions(+), 23 deletions(-) diff --git a/skfp/applicability_domain/topkat.py b/skfp/applicability_domain/topkat.py index 30cfe939..18dacb3d 100644 --- a/skfp/applicability_domain/topkat.py +++ b/skfp/applicability_domain/topkat.py @@ -85,7 +85,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/fingerprints/autocorr.py b/skfp/fingerprints/autocorr.py index 5b8ea3e1..b3cd0f30 100644 --- a/skfp/fingerprints/autocorr.py +++ b/skfp/fingerprints/autocorr.py @@ -127,7 +127,7 @@ def __init__( ) self.use_3D = use_3D - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/bcut2d.py b/skfp/fingerprints/bcut2d.py index 08d1a2ce..28cd34c7 100644 --- a/skfp/fingerprints/bcut2d.py +++ b/skfp/fingerprints/bcut2d.py @@ -145,7 +145,7 @@ def __init__( self.charge_errors = charge_errors self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They are largest and smallest eigenvalues of Burden matrix for 4 atomic properties. diff --git a/skfp/fingerprints/electroshape.py b/skfp/fingerprints/electroshape.py index 85d75bfd..bf2a1358 100644 --- a/skfp/fingerprints/electroshape.py +++ b/skfp/fingerprints/electroshape.py @@ -151,7 +151,7 @@ def __init__( self.charge_errors = charge_errors self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 5 centroid-based points. diff --git a/skfp/fingerprints/estate.py b/skfp/fingerprints/estate.py index 760655c0..c9e06867 100644 --- a/skfp/fingerprints/estate.py +++ b/skfp/fingerprints/estate.py @@ -114,7 +114,7 @@ def __init__( ) self.variant = variant - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to SMARTS patterns defining atom types. See the original paper [1]_ for details. diff --git a/skfp/fingerprints/functional_groups.py b/skfp/fingerprints/functional_groups.py index b8358cbb..d5414c14 100644 --- a/skfp/fingerprints/functional_groups.py +++ b/skfp/fingerprints/functional_groups.py @@ -88,7 +88,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They are descriptions of RDKit functional groups (fragments) - see ``_ diff --git a/skfp/fingerprints/getaway.py b/skfp/fingerprints/getaway.py index b2924d00..eb30d4b3 100644 --- a/skfp/fingerprints/getaway.py +++ b/skfp/fingerprints/getaway.py @@ -144,7 +144,7 @@ def __init__( ) self.clip_val = clip_val - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to various descriptors derived from weighted Molecular Influence Matrix (MIM). diff --git a/skfp/fingerprints/ghose_crippen.py b/skfp/fingerprints/ghose_crippen.py index a8806d50..077af5cc 100644 --- a/skfp/fingerprints/ghose_crippen.py +++ b/skfp/fingerprints/ghose_crippen.py @@ -219,7 +219,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They are raw SMARTS patterns used as feature definitions. diff --git a/skfp/fingerprints/klekota_roth/klekota_roth_fp.py b/skfp/fingerprints/klekota_roth/klekota_roth_fp.py index 0ca762ab..fd920918 100644 --- a/skfp/fingerprints/klekota_roth/klekota_roth_fp.py +++ b/skfp/fingerprints/klekota_roth/klekota_roth_fp.py @@ -99,7 +99,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They are raw SMARTS patterns used as feature definitions. diff --git a/skfp/fingerprints/laggner.py b/skfp/fingerprints/laggner.py index d7134a90..21e386ac 100644 --- a/skfp/fingerprints/laggner.py +++ b/skfp/fingerprints/laggner.py @@ -112,7 +112,7 @@ def _fix_feature_names(self, feature_names: list[str]) -> np.ndarray: return np.asarray(feature_names, dtype=object) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to substructure names defined by Christian Laggner, intended to capture with SMARTS patterns diff --git a/skfp/fingerprints/maccs.py b/skfp/fingerprints/maccs.py index 9566bc58..dd7d8176 100644 --- a/skfp/fingerprints/maccs.py +++ b/skfp/fingerprints/maccs.py @@ -115,7 +115,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to substructure names defined by Greg Landrum, based on publicly available MACCS Keys diff --git a/skfp/fingerprints/mordred_fp.py b/skfp/fingerprints/mordred_fp.py index a628a95d..6e96885c 100644 --- a/skfp/fingerprints/mordred_fp.py +++ b/skfp/fingerprints/mordred_fp.py @@ -109,7 +109,7 @@ def __init__( ) self.use_3D = use_3D - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to descriptor names used by Mordred descriptor calculator, used in this fingerprint. diff --git a/skfp/fingerprints/morse.py b/skfp/fingerprints/morse.py index 53590088..47e70db5 100644 --- a/skfp/fingerprints/morse.py +++ b/skfp/fingerprints/morse.py @@ -140,7 +140,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to 7 weighting variants and 32 scattering values. diff --git a/skfp/fingerprints/mqns.py b/skfp/fingerprints/mqns.py index 9b081223..01a7f1c7 100644 --- a/skfp/fingerprints/mqns.py +++ b/skfp/fingerprints/mqns.py @@ -120,7 +120,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/pubchem/pubchem_fp.py b/skfp/fingerprints/pubchem/pubchem_fp.py index 9560281b..72726fc6 100644 --- a/skfp/fingerprints/pubchem/pubchem_fp.py +++ b/skfp/fingerprints/pubchem/pubchem_fp.py @@ -113,7 +113,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. diff --git a/skfp/fingerprints/rdf.py b/skfp/fingerprints/rdf.py index 50eb876a..aff8f437 100644 --- a/skfp/fingerprints/rdf.py +++ b/skfp/fingerprints/rdf.py @@ -134,7 +134,7 @@ def __init__( verbose=verbose, ) - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to 7 weighting variants and 30 radii. diff --git a/skfp/fingerprints/rdkit_2d_desc.py b/skfp/fingerprints/rdkit_2d_desc.py index 07881f84..254acb49 100644 --- a/skfp/fingerprints/rdkit_2d_desc.py +++ b/skfp/fingerprints/rdkit_2d_desc.py @@ -116,7 +116,7 @@ def __init__( self.normalized = normalized self.clip_val = clip_val - def get_feature_names_out(self, input_features=None): + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 # noqa: ARG002 """ Get fingerprint output feature names. They correspond to RDKit function names for computing descriptors. diff --git a/skfp/fingerprints/usr.py b/skfp/fingerprints/usr.py index ae698a6d..2084ecec 100644 --- a/skfp/fingerprints/usr.py +++ b/skfp/fingerprints/usr.py @@ -125,7 +125,7 @@ def __init__( ) self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 4 centroid-based points. diff --git a/skfp/fingerprints/usrcat.py b/skfp/fingerprints/usrcat.py index aca0837b..c2c40884 100644 --- a/skfp/fingerprints/usrcat.py +++ b/skfp/fingerprints/usrcat.py @@ -121,7 +121,7 @@ def __init__( ) self.errors = errors - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 """ Get fingerprint output feature names. They correspond to aggregates of atomic distances to 4 centroid-based points, for each of 5 atom diff --git a/skfp/fingerprints/vsa.py b/skfp/fingerprints/vsa.py index 3ccbb992..1df17272 100644 --- a/skfp/fingerprints/vsa.py +++ b/skfp/fingerprints/vsa.py @@ -153,7 +153,7 @@ def _get_n_features_out(self, variant: str) -> int: except KeyError as err: raise ValueError(f'Variant "{variant}" not recognized') from err - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 # noqa: ARG002 """ Get fingerprint output feature names. They correspond to histogram bins for descriptors. diff --git a/skfp/fingerprints/whim.py b/skfp/fingerprints/whim.py index f7bb316d..6ff74297 100644 --- a/skfp/fingerprints/whim.py +++ b/skfp/fingerprints/whim.py @@ -140,7 +140,7 @@ def __init__( ) self.clip_val = clip_val - def get_feature_names_out(self, input_features=None) -> np.ndarray: + def get_feature_names_out(self, input_features=None) -> np.ndarray: # noqa: ARG002 # noqa: ARG002 """ Get fingerprint output feature names. They correspond to various descriptors derived from weighted covariance matrix. See references diff --git a/skfp/preprocessing/input_output/sdf.py b/skfp/preprocessing/input_output/sdf.py index f3ece7ea..39f6e5a0 100644 --- a/skfp/preprocessing/input_output/sdf.py +++ b/skfp/preprocessing/input_output/sdf.py @@ -61,7 +61,7 @@ def __init__( self.sanitize = sanitize self.remove_hydrogens = remove_hydrogens - def transform(self, X: str, copy: bool = False) -> list[Mol]: # type: ignore[override] + def transform(self, X: str, copy: bool = False) -> list[Mol]: # type: ignore[override] # noqa: ARG002 """ Create RDKit ``Mol`` objects from SDF file. @@ -159,7 +159,7 @@ def __init__( self.kekulize = kekulize self.force_V3000 = force_V3000 - def transform(self, X: Sequence[Mol], copy: bool = False) -> None: + def transform(self, X: Sequence[Mol], copy: bool = False) -> None: # noqa: ARG002 """ Write RDKit ``Mol`` objects to SDF file at location given by ``filepath`` parameter. File is created if necessary, and overwritten From 3d296a8ba0021a967f8596c492c6829427a6b33f Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Tue, 23 Dec 2025 19:36:49 +0100 Subject: [PATCH 13/14] Fix ruff --- skfp/applicability_domain/bounding_box.py | 2 +- skfp/applicability_domain/convex_hull.py | 2 +- skfp/applicability_domain/distance_to_centroid.py | 2 +- skfp/applicability_domain/hotelling_t2_test.py | 2 +- skfp/applicability_domain/knn.py | 2 +- skfp/applicability_domain/leverage.py | 2 +- skfp/applicability_domain/pca_bounding_box.py | 2 +- skfp/applicability_domain/response_variable_range.py | 2 +- 8 files changed, 8 insertions(+), 8 deletions(-) diff --git a/skfp/applicability_domain/bounding_box.py b/skfp/applicability_domain/bounding_box.py index 291eba6c..9b07ef43 100644 --- a/skfp/applicability_domain/bounding_box.py +++ b/skfp/applicability_domain/bounding_box.py @@ -109,7 +109,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/convex_hull.py b/skfp/applicability_domain/convex_hull.py index 9c2458f9..46035fc0 100644 --- a/skfp/applicability_domain/convex_hull.py +++ b/skfp/applicability_domain/convex_hull.py @@ -93,7 +93,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) self.points_ = X diff --git a/skfp/applicability_domain/distance_to_centroid.py b/skfp/applicability_domain/distance_to_centroid.py index a00849d8..a81ab02e 100644 --- a/skfp/applicability_domain/distance_to_centroid.py +++ b/skfp/applicability_domain/distance_to_centroid.py @@ -167,7 +167,7 @@ def _validate_params(self) -> None: def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/hotelling_t2_test.py b/skfp/applicability_domain/hotelling_t2_test.py index 0c78ceb2..802e296a 100644 --- a/skfp/applicability_domain/hotelling_t2_test.py +++ b/skfp/applicability_domain/hotelling_t2_test.py @@ -89,7 +89,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/knn.py b/skfp/applicability_domain/knn.py index 1cb968e9..48c4d9ad 100644 --- a/skfp/applicability_domain/knn.py +++ b/skfp/applicability_domain/knn.py @@ -148,7 +148,7 @@ def _validate_params(self) -> None: def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) if self.k > X.shape[0]: diff --git a/skfp/applicability_domain/leverage.py b/skfp/applicability_domain/leverage.py index f59fc1d8..2383b46b 100644 --- a/skfp/applicability_domain/leverage.py +++ b/skfp/applicability_domain/leverage.py @@ -104,7 +104,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/pca_bounding_box.py b/skfp/applicability_domain/pca_bounding_box.py index 29dba18e..7e0cd38c 100644 --- a/skfp/applicability_domain/pca_bounding_box.py +++ b/skfp/applicability_domain/pca_bounding_box.py @@ -105,7 +105,7 @@ def __init__( def fit( # noqa: D102 self, X: np.ndarray, - y: np.ndarray | None = None, + y: np.ndarray | None = None, # noqa: ARG002 ): X = validate_data(self, X=X) diff --git a/skfp/applicability_domain/response_variable_range.py b/skfp/applicability_domain/response_variable_range.py index 32b9c8c8..47f5d784 100644 --- a/skfp/applicability_domain/response_variable_range.py +++ b/skfp/applicability_domain/response_variable_range.py @@ -93,7 +93,7 @@ def __init__( def fit( # type: ignore[override] # noqa: D102 self, y: np.ndarray, - X: np.ndarray | None = None, + X: np.ndarray | None = None, # noqa: ARG002 ): y = check_array(y, ensure_2d=False, allow_nd=False) if y.ndim != 1: From 1268bb989c8a21dd2b77c1c032529be79752d44f Mon Sep 17 00:00:00 2001 From: Jakub Adamczyk Date: Thu, 25 Dec 2025 13:39:20 +0100 Subject: [PATCH 14/14] Add warning about Python 3.13 and update CI --- .github/workflows/tests.yml | 3 +-- README.md | 8 +++++--- 2 files changed, 6 insertions(+), 5 deletions(-) diff --git a/.github/workflows/tests.yml b/.github/workflows/tests.yml index 158a0e15..374952e1 100644 --- a/.github/workflows/tests.yml +++ b/.github/workflows/tests.yml @@ -14,8 +14,7 @@ jobs: strategy: fail-fast: false matrix: - # specific version in 3.13 due to bug https://github.com/python/cpython/issues/138031 - python-version: ["3.10", "3.11", "3.12", "3.13.6"] + python-version: ["3.10", "3.11", "3.12", "3.13"] os: [macos-latest, ubuntu-latest, windows-latest] runs-on: ${{ matrix.os }} steps: diff --git a/README.md b/README.md index fd098e63..54bff714 100644 --- a/README.md +++ b/README.md @@ -53,12 +53,14 @@ Main features: | | `python3.10` | `python3.11` | `python3.12` | `python3.13` | |:-----------:|:------------:|:------------:|:------------:|:------------:| -| **Linux** | ✅ | ✅ | ✅ | ✅ | -| **Windows** | ✅ | ✅ | ✅ | ✅ | -| **macOS** | ✅ | ✅ | ✅ | ✅ | +| **Linux** | ✅ | ✅ | ✅ | ✅ | +| **Windows** | ✅ | ✅ | ✅ | ✅ | +| **macOS** | ✅ | ✅ | ✅ | ✅ | Python 3.9 was supported up to scikit-fingerprints 1.13.0. +Python 3.13 is officially supported, but underlying libraries may not be fully compatible yet. + ## Installation You can install the library using pip: