diff --git a/skfp/utils/validators.py b/skfp/utils/validators.py
index af53444c..d01f77d3 100644
--- a/skfp/utils/validators.py
+++ b/skfp/utils/validators.py
@@ -2,24 +2,28 @@
 from collections.abc import Callable, Sequence
 from typing import Any
 
-from rdkit.Chem import Mol, MolFromSmiles, MolToSmiles
+from rdkit.Chem import Mol, MolFromInchi, MolFromSmiles, MolToSmiles
 from rdkit.Chem.PropertyMol import PropertyMol
 
 
 def ensure_mols(X: Sequence[Any]) -> list[Mol]:
     """
     Ensure that all input sequence elements are RDKit ``Mol`` objects. Requires
-    all input elements to be of the same type: string (SMILES strings) or ``Mol``.
-    In the case of SMILES strings, they are converted to RDKit ``Mol`` objects with
+    all input elements to be of the same type: string (SMILES or InChI strings) or ``Mol``.
+    In the case of SMILES or InChI strings, they are converted to RDKit ``Mol`` objects with
     default settings.
     """
     if not all(isinstance(x, (Mol, PropertyMol, str)) for x in X):
         types = {type(x) for x in X}
         raise TypeError(
-            f"Passed values must be RDKit Mol objects or SMILES strings, got types: {types}"
+            f"Passed values must be RDKit Mol objects, SMILES or InChI strings, got types: {types}"
         )
 
-    mols = [MolFromSmiles(x) if isinstance(x, str) else x for x in X]
+    if isinstance(X[0], str):
+        parser = MolFromInchi if X[0].startswith("InChI=") else MolFromSmiles
+        mols = [parser(x) for x in X]
+    else:
+        mols = list(X)
 
     if any(x is None for x in mols):
         idx = mols.index(None)
diff --git a/tests/utils/validators.py b/tests/utils/validators.py
index 983131d4..791238df 100644
--- a/tests/utils/validators.py
+++ b/tests/utils/validators.py
@@ -29,6 +29,27 @@ def test_ensure_mols_wrong_smiles():
     assert "at index 1 as molecule" in str(exc_info)
 
 
+def test_ensure_mols_valid_inchi():
+    inchi_list = ["InChI=1S/H2O/h1H2", "InChI=1S/CH4/h1H4"]
+    mols = ensure_mols(inchi_list)
+    assert all(m is not None for m in mols)
+    assert len(mols) == 2
+    from rdkit.Chem import MolToSmiles
+
+    smiles = [MolToSmiles(m) for m in mols]
+    assert "O" in smiles
+    assert "C" in smiles
+
+
+def test_ensure_mols_invalid_inchi():
+    inchi_list = ["InChI=1S/H2O/h1H2", "InChI=1S/invalid"]
+    with pytest.raises(TypeError) as exc_info:
+        ensure_mols(inchi_list)
+
+    assert "Could not parse" in str(exc_info)
+    assert "at index 1 as molecule" in str(exc_info)
+
+
 def test_ensure_mols_in_fingerprint():
     smiles_list = ["O", "O=N([O-])C1=C(CN=C1NCCSCc2ncccc2)Cc3ccccc3"]
     fp = AtomPairFingerprint()