diff --git a/.dockerignore b/.dockerignore new file mode 100644 index 0000000..49814c8 --- /dev/null +++ b/.dockerignore @@ -0,0 +1,5 @@ +* +!package.json +!pnpm-lock.yaml +!bin/ +!dist/ diff --git a/.env.example b/.env.example index 1d3008f..56cf2ba 100644 --- a/.env.example +++ b/.env.example @@ -5,6 +5,13 @@ # may be useful to set it to `true`. ACTIONS_STEP_DEBUG=true +# E2E tests + +CONFLUENCE_URL=foo-confluence.atlassian.net +CONFLUENCE_PAT=foo-access-token +CONFLUENCE_README_PAGE_ID=foo-readme-page-id +CONFLUENCE_CHANGELOG_PAGE_ID=foo-changelog-page-id + # GitHub Actions inputs should follow `INPUT_` format (case-sensitive). # Hyphens should not be converted to underscores! INPUT_DOCS-DIR="./docs" diff --git a/.github/CONTRIBUTING.md b/.github/CONTRIBUTING.md index b041660..d296db7 100644 --- a/.github/CONTRIBUTING.md +++ b/.github/CONTRIBUTING.md @@ -22,19 +22,13 @@ Thank you for being part of the Telefónica Innovación Digital Open Source Comm 1. :hammer_and_wrench: Install the dependencies ```bash - npm install + pnpm install ``` -1. :building_construction: Package the TypeScript for distribution +2. :white_check_mark: Run the unit tests ```bash - npm run package - ``` - -1. :white_check_mark: Run the unit tests - - ```bash - $ npm run test:unit + $ pnpm test:unit PASS test/unit/specs/main.spec.ts PASS test/unit/specs/index.spec.ts @@ -42,34 +36,34 @@ Thank you for being part of the Telefónica Innovación Digital Open Source Comm ## Test the action locally -The [`@github/local-action`](https://github.com/github/local-action) utility -can be used to test your action locally. It is a simple command-line tool -that "stubs" (or simulates) the GitHub Actions Toolkit. This way, you can run -your TypeScript action locally without having to commit and push your changes -to a repository. +The action is a Docker container that runs a Node.js script. To test the action locally, you can run the Docker compose file in the root of the repository. This will build the Docker image and run the action in a container. -The `local-action` utility can be run in the following ways: +```bash +$ docker compose build +$ docker compose run action +``` -- Visual Studio Code Debugger +> [!CAUTION] +> The Docker image won't work in some systems due to the usage of Chromium, as in MacOS with M1 processors. In this case, you can [run the Node.js code instead](#test-the-nodejs-code-locally). - Make sure to review and, if needed, update - [`.vscode/launch.json`](./.vscode/launch.json) +You can provide a `.env` file to set environment variables used by the GitHub Actions Toolkit. For more information, see the example file, [`.env.example`](./.env.example), and the +[GitHub Actions Documentation](https://docs.github.com/en/actions/learn-github-actions/variables#default-environment-variables). -- Terminal/Command Prompt +> [!IMPORTANT] +> The root workspace directory is mounted as a volume in the container in the `/github/workspace` folder. You can set another workspace subdirectory for testing the synchronization locally by setting the `INPUT_CWD` environment variable to the desired directory (e.g. `INPUT_CWD=test-action`). - ```bash - # npx local action - npx local-action . src/main.ts .env - ``` +### Test the Node.js code locally -You can provide a `.env` file to the `local-action` CLI to set environment -variables used by the GitHub Actions Toolkit. For more information, see the example -file, [`.env.example`](./.env.example), and the -[GitHub Actions Documentation](https://docs.github.com/en/actions/learn-github-actions/variables#default-environment-variables). +Apart from running the unit tests, you can also run the Node.js code locally by following these steps: + +* Modify the `src/action/main.ts` file to change the `BASE_CWD` variable from `/github/workspace` to the desired directory (e.g. `test-action`). +* Build the action code using the `pnpm build` command. +* Add your markdown file and configuration files to the desired directory (e.g. `test-action/markdown-confluence-sync.config.js` and `test-action/docs/foo.md`). +* Run the action code using `node bin/markdown-confluence-sync-action.js`. ## E2E tests -This project includes end-to-end tests, consisting in a workflow that uses the action to sync the documentation of the project itself to a Confluence page, and then checks if the page was updated correctly. +This project includes end-to-end tests, consisting in a workflow that uses the action to sync the documentation of the project itself to a Confluence page, and then checks if the page was updated correctly. Once the documentation has been synced, you can run tests using the following command: ```bash npm run test:e2e diff --git a/.github/actions/setup-node/action.yml b/.github/actions/setup-node/action.yml index 971f3a4..ed70cf8 100644 --- a/.github/actions/setup-node/action.yml +++ b/.github/actions/setup-node/action.yml @@ -12,12 +12,13 @@ inputs: runs: using: composite steps: - - name: Setup Node.js - id: setup-node + - name: Install pnpm + uses: pnpm/action-setup@v4 + - name: Install Node.js uses: actions/setup-node@v4 with: node-version-file: .node-version - cache: npm + cache: pnpm - uses: DamianReeves/write-file-action@v1.3 with: path: .npmrc @@ -25,7 +26,6 @@ runs: @tid-xcut:registry=https://nexus.tid.es/repository/npm-xcut-components/ //nexus.tid.es/repository/npm-xcut-components/:_auth=${{ inputs.npm-token }} write-mode: append - - name: Install Dependencies + - name: Install Node.js dependencies shell: bash - id: npm-ci - run: npm ci + run: pnpm install diff --git a/.github/workflows/build.yml b/.github/workflows/build.yml index 6aea818..6490eeb 100644 --- a/.github/workflows/build.yml +++ b/.github/workflows/build.yml @@ -28,32 +28,25 @@ jobs: with: npm-token: ${{ secrets.NPM_TOKEN_XCUT }} + - name: Build + id: build + run: pnpm build + - name: Lint id: npm-lint - run: npm run lint + run: pnpm lint - name: Check spelling id: npm-check-spelling - run: npm run cspell + run: pnpm cspell - name: Check TypeScript types id: npm-check-types - run: npm run check:types + run: pnpm check:types - name: Test unit id: npm-test - run: npm run test:unit - - - name: Upload coverage - id: upload-coverage - uses: actions/upload-artifact@v4 - with: - name: coverage - path: coverage/ - - - name: Build dist/ Directory - id: build - run: npm run package + run: pnpm test:unit # This will fail the workflow if the `dist/` directory is different than # expected. @@ -80,3 +73,10 @@ jobs: with: name: dist path: dist/ + + - name: Upload coverage + id: upload-coverage + uses: actions/upload-artifact@v4 + with: + name: coverage + path: coverage/ diff --git a/.github/workflows/test-e2e.yml b/.github/workflows/test-e2e.yml index d544772..d2dc867 100644 --- a/.github/workflows/test-e2e.yml +++ b/.github/workflows/test-e2e.yml @@ -28,6 +28,7 @@ jobs: with: mode: id docs-dir: '.' + confluence-notice-message: 'This page is automatically generated from content in the markdown-confluence-sync-action repository Changes made manually will be lost, you should edit this page in Github instead.' files-pattern: '*.md' files-metadata: | [ @@ -45,6 +46,7 @@ jobs: confluence-url: ${{ vars.CONFLUENCE_URL }} confluence-space-key: ${{ vars.CONFLUENCE_SPACE_KEY }} confluence-personal-access-token: ${{ secrets.CONFLUENCE_PAT }} + log-level: debug test-e2e: environment: production diff --git a/.gitignore b/.gitignore index d975af7..356ccb6 100644 --- a/.gitignore +++ b/.gitignore @@ -2,6 +2,9 @@ node_modules .npmrc +# Test action locally +test-action + # Rest pulled from https://github.com/github/gitignore/blob/master/Node.gitignore # Logs logs diff --git a/CHANGELOG.md b/CHANGELOG.md index 8453e09..3eecb7c 100644 --- a/CHANGELOG.md +++ b/CHANGELOG.md @@ -11,6 +11,25 @@ and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0 #### Deprecated #### Removed +## [2.0.0] - 2025-03-18 + +### Changed + +* feat(BREAKING CHANGE): Throw an error in case the `cwd` input is absolute, because the action only has access to the repository files +* chore: Use Docker action instead of Node.js action in order to install Chromium and Puppeteer +* chore: Use Pnpm instead of NPM +* chore: Move `dependencies` to `devDependencies`, because in runtime the action uses only the bundled code, and it installs the mermaid dependencies by itself in the Docker image. This is because the `@tid-xcut` libraries are in a private repository, and the action cannot install them in the Docker image. Some fixes are applied to the bundled code to make it work in the Docker image. + +### Fixed + +* fix: Generate mermaid diagrams in the Confluence page + +### Added + +* docs: Add automation notice to Confluence pages containing the action docs +* test: Add mermaid diagram to readme.md file, and test that it has been synced to Confluence in E2E tests + + ## [1.2.0] - 2025-03-13 ### Changed diff --git a/Dockerfile b/Dockerfile new file mode 100644 index 0000000..738b684 --- /dev/null +++ b/Dockerfile @@ -0,0 +1,32 @@ +FROM --platform=linux/amd64 node:22 +RUN corepack enable && corepack prepare pnpm@9.4.0 --activate + +# We don't need the standalone Chromium +ENV PUPPETEER_SKIP_CHROMIUM_DOWNLOAD=true +ENV PUPPETEER_EXECUTABLE_PATH="/usr/bin/chromium" + +# cspell: disable +# Install Google Chrome Stable and fonts +# Note: this installs the necessary libs to make the browser work with Puppeteer, and the fonts needed for Mermaid +RUN apt-get update && apt-get install curl gnupg -y \ + && curl --location --silent https://dl-ssl.google.com/linux/linux_signing_key.pub | apt-key add - \ + && sh -c 'echo "deb [arch=amd64] http://dl.google.com/linux/chrome/deb/ stable main" >> /etc/apt/sources.list.d/google.list' \ + && apt-get update \ + && apt-get install google-chrome-stable -y --no-install-recommends \ + && apt-get install chromium -y \ + && apt-get install -y \ + fonts-noto-cjk fonts-noto-color-emoji \ + fonts-terminus fonts-dejavu fonts-freefont-ttf \ + fonts-font-awesome fonts-inconsolata \ + fonts-linuxlibertine \ + && fc-cache -f \ + && rm -rf /var/lib/apt/lists/* + +# NOTE: We need to install Mermaid globally, as we are not installing the package.json dependencies due to private packages +RUN npm i -g mermaid@11.5.0 @mermaid-js/mermaid-cli@11.4.0 + +WORKDIR /usr/src/app + +COPY . . + +ENTRYPOINT [ "node", "/usr/src/app/bin/markdown-confluence-sync-action.js"] diff --git a/README.md b/README.md index 9575d1d..3fee9eb 100644 --- a/README.md +++ b/README.md @@ -10,6 +10,7 @@ This action syncs markdown files to Confluence using the [Markdown Confluence Sy - [Tree operation mode](#tree-operation-mode) - [Flat operation mode](#flat-operation-mode) - [Id operation mode](#id-operation-mode) + - [Mermaid diagrams](#mermaid-diagrams) - [Configuration](#configuration) - [Inputs](#inputs) - [Configuration file](#configuration-file) @@ -21,7 +22,7 @@ This action syncs markdown files to Confluence using the [Markdown Confluence Sy * It creates/updates/deletes [Confluence](https://www.atlassian.com/es/software/confluence) pages based on markdown files in a directory. * Upload images to Confluence and update links in markdown files -* Supports Mermaid diagrams +* Supports [Mermaid diagrams](#mermaid-diagrams) * Per-page configuration using [frontmatter metadata](https://jekyllrb.com/docs/front-matter/) * Works great with [Docusaurus](https://docusaurus.io/) * Three modes of operation: @@ -62,7 +63,7 @@ docs/ ```yaml - name: Sync markdown files to Confluence - uses: Telefonica/markdown-confluence-sync-action@v1 + uses: Telefonica/markdown-confluence-sync-action@v2 with: mode: tree docs-dir: './docs' @@ -88,7 +89,7 @@ For example: ```yaml - name: Sync markdown files to Confluence - uses: Telefonica/markdown-confluence-sync-action@v1 + uses: Telefonica/markdown-confluence-sync-action@v2 with: mode: id docs-dir: '.' @@ -131,7 +132,7 @@ confluence_page_id: 123456789 ```yaml - name: Sync markdown files to Confluence - uses: Telefonica/markdown-confluence-sync-action@v1 + uses: Telefonica/markdown-confluence-sync-action@v2 with: mode: flat docs-dir: './docs' @@ -141,6 +142,23 @@ confluence_page_id: 123456789 confluence-personal-access-token: ${{ secrets.CONFLUENCE_PAT }} ``` +### Mermaid diagrams + +Mermaid diagrams are supported in the markdown files. The action will render the diagrams as images and upload them to Confluence. + +```markdown +```mermaid +graph TD; + A-->B; + A-->C; +``` + +```mermaid +graph TD; + A-->B; + A-->C; +``` + ## Configuration The action accepts a configuration file in the root of the repository, and it can be also configured using Github action inputs or even environment variables. @@ -169,7 +187,7 @@ The action accepts a configuration file in the root of the repository, and it ca | `confluence-notice-template` | Template string to use for the notice message | No | | | `confluence-dry-run` | Dry run mode: Do not update Confluence pages. Only log pages to sync | No | `false `| | `log-level` | Log level: `silent`, `silly`, `debug`, `verbose`, `info`, `warn`, `error` | No | `info` | -| `cwd` | Current working directory. Path from where resolve `docs-dir`, `files-pattern`, and search for the configuration file | No | `.` | +| `cwd` | Current working directory. Path from where resolve `docs-dir`, `files-pattern`, and search for the configuration file. It must be relative to the repository folder | No | `.` | > [!NOTE] > Some markdown-confluence-sync options are not available as inputs in the action, as `preprocessor`. If you need to use them, you can set them in the [configuration file](#configuration-file) or using [environment variables](#environment-variables). Refer to the [Markdown Confluence Sync library docs](https://github.com/Telefonica/cross-confluence-tools/tree/main/components/markdown-confluence-sync#configuration-file) for further info about all available options. diff --git a/action.yml b/action.yml index 72b738a..880d53b 100644 --- a/action.yml +++ b/action.yml @@ -65,7 +65,6 @@ inputs: cwd: description: 'Current working directory. Path from where the library resolve docsDir, filesPattern, and searches for configuration files' type: string - runs: - using: node20 - main: dist/index.js + using: docker + image: Dockerfile diff --git a/bin/markdown-confluence-sync-action.js b/bin/markdown-confluence-sync-action.js new file mode 100644 index 0000000..1ddc693 --- /dev/null +++ b/bin/markdown-confluence-sync-action.js @@ -0,0 +1,7 @@ +#!/usr/bin/env node + +// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 + +import { run } from "../dist/index.js"; +run(); diff --git a/dist/index.js b/dist/index.js index a606eed..faf2696 100644 --- a/dist/index.js +++ b/dist/index.js @@ -1,7 +1,7 @@ import './sourcemap-register.cjs';import { createRequire as __WEBPACK_EXTERNAL_createRequire } from "module"; /******/ var __webpack_modules__ = ({ -/***/ 44914: +/***/ 83191: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -31,7 +31,7 @@ var __importStar = (this && this.__importStar) || function (mod) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.issue = exports.issueCommand = void 0; const os = __importStar(__nccwpck_require__(70857)); -const utils_1 = __nccwpck_require__(30302); +const utils_1 = __nccwpck_require__(96283); /** * Commands * @@ -103,7 +103,7 @@ function escapeProperty(s) { /***/ }), -/***/ 37484: +/***/ 59999: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -141,12 +141,12 @@ var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, ge }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.platform = exports.toPlatformPath = exports.toWin32Path = exports.toPosixPath = exports.markdownSummary = exports.summary = exports.getIDToken = exports.getState = exports.saveState = exports.group = exports.endGroup = exports.startGroup = exports.info = exports.notice = exports.warning = exports.error = exports.debug = exports.isDebug = exports.setFailed = exports.setCommandEcho = exports.setOutput = exports.getBooleanInput = exports.getMultilineInput = exports.getInput = exports.addPath = exports.setSecret = exports.exportVariable = exports.ExitCode = void 0; -const command_1 = __nccwpck_require__(44914); -const file_command_1 = __nccwpck_require__(24753); -const utils_1 = __nccwpck_require__(30302); +const command_1 = __nccwpck_require__(83191); +const file_command_1 = __nccwpck_require__(59058); +const utils_1 = __nccwpck_require__(96283); const os = __importStar(__nccwpck_require__(70857)); const path = __importStar(__nccwpck_require__(16928)); -const oidc_utils_1 = __nccwpck_require__(35306); +const oidc_utils_1 = __nccwpck_require__(53549); /** * The code to exit an action */ @@ -431,29 +431,29 @@ exports.getIDToken = getIDToken; /** * Summary exports */ -var summary_1 = __nccwpck_require__(71847); +var summary_1 = __nccwpck_require__(71638); Object.defineProperty(exports, "summary", ({ enumerable: true, get: function () { return summary_1.summary; } })); /** * @deprecated use core.summary */ -var summary_2 = __nccwpck_require__(71847); +var summary_2 = __nccwpck_require__(71638); Object.defineProperty(exports, "markdownSummary", ({ enumerable: true, get: function () { return summary_2.markdownSummary; } })); /** * Path exports */ -var path_utils_1 = __nccwpck_require__(31976); +var path_utils_1 = __nccwpck_require__(40539); Object.defineProperty(exports, "toPosixPath", ({ enumerable: true, get: function () { return path_utils_1.toPosixPath; } })); Object.defineProperty(exports, "toWin32Path", ({ enumerable: true, get: function () { return path_utils_1.toWin32Path; } })); Object.defineProperty(exports, "toPlatformPath", ({ enumerable: true, get: function () { return path_utils_1.toPlatformPath; } })); /** * Platform utilities exports */ -exports.platform = __importStar(__nccwpck_require__(18968)); +exports.platform = __importStar(__nccwpck_require__(22563)); //# sourceMappingURL=core.js.map /***/ }), -/***/ 24753: +/***/ 59058: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -488,7 +488,7 @@ exports.prepareKeyValueMessage = exports.issueFileCommand = void 0; const crypto = __importStar(__nccwpck_require__(76982)); const fs = __importStar(__nccwpck_require__(79896)); const os = __importStar(__nccwpck_require__(70857)); -const utils_1 = __nccwpck_require__(30302); +const utils_1 = __nccwpck_require__(96283); function issueFileCommand(command, message) { const filePath = process.env[`GITHUB_${command}`]; if (!filePath) { @@ -521,7 +521,7 @@ exports.prepareKeyValueMessage = prepareKeyValueMessage; /***/ }), -/***/ 35306: +/***/ 53549: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -536,9 +536,9 @@ var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, ge }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.OidcClient = void 0; -const http_client_1 = __nccwpck_require__(54844); -const auth_1 = __nccwpck_require__(44552); -const core_1 = __nccwpck_require__(37484); +const http_client_1 = __nccwpck_require__(80787); +const auth_1 = __nccwpck_require__(63673); +const core_1 = __nccwpck_require__(59999); class OidcClient { static createHttpClient(allowRetry = true, maxRetry = 10) { const requestOptions = { @@ -604,7 +604,7 @@ exports.OidcClient = OidcClient; /***/ }), -/***/ 31976: +/***/ 40539: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -672,7 +672,7 @@ exports.toPlatformPath = toPlatformPath; /***/ }), -/***/ 18968: +/***/ 22563: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -714,7 +714,7 @@ var __importDefault = (this && this.__importDefault) || function (mod) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getDetails = exports.isLinux = exports.isMacOS = exports.isWindows = exports.arch = exports.platform = void 0; const os_1 = __importDefault(__nccwpck_require__(70857)); -const exec = __importStar(__nccwpck_require__(95236)); +const exec = __importStar(__nccwpck_require__(58872)); const getWindowsInfo = () => __awaiter(void 0, void 0, void 0, function* () { const { stdout: version } = yield exec.getExecOutput('powershell -command "(Get-CimInstance -ClassName Win32_OperatingSystem).Version"', undefined, { silent: true @@ -772,7 +772,7 @@ exports.getDetails = getDetails; /***/ }), -/***/ 71847: +/***/ 71638: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -1061,7 +1061,7 @@ exports.summary = _summary; /***/ }), -/***/ 30302: +/***/ 96283: /***/ ((__unused_webpack_module, exports) => { @@ -1107,7 +1107,7 @@ exports.toCommandProperties = toCommandProperties; /***/ }), -/***/ 95236: +/***/ 58872: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -1142,7 +1142,7 @@ var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, ge Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getExecOutput = exports.exec = void 0; const string_decoder_1 = __nccwpck_require__(13193); -const tr = __importStar(__nccwpck_require__(6665)); +const tr = __importStar(__nccwpck_require__(73725)); /** * Exec a command. * Output will be streamed to the live console. @@ -1216,7 +1216,7 @@ exports.getExecOutput = getExecOutput; /***/ }), -/***/ 6665: +/***/ 73725: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -1254,8 +1254,8 @@ const os = __importStar(__nccwpck_require__(70857)); const events = __importStar(__nccwpck_require__(24434)); const child = __importStar(__nccwpck_require__(35317)); const path = __importStar(__nccwpck_require__(16928)); -const io = __importStar(__nccwpck_require__(94994)); -const ioUtil = __importStar(__nccwpck_require__(75207)); +const io = __importStar(__nccwpck_require__(73357)); +const ioUtil = __importStar(__nccwpck_require__(52746)); const timers_1 = __nccwpck_require__(53557); /* eslint-disable @typescript-eslint/unbound-method */ const IS_WINDOWS = process.platform === 'win32'; @@ -1840,7 +1840,7 @@ class ExecState extends events.EventEmitter { /***/ }), -/***/ 44552: +/***/ 63673: /***/ (function(__unused_webpack_module, exports) { @@ -1927,7 +1927,7 @@ exports.PersonalAccessTokenCredentialHandler = PersonalAccessTokenCredentialHand /***/ }), -/***/ 54844: +/***/ 80787: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -1968,9 +1968,9 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); exports.HttpClient = exports.isHttps = exports.HttpClientResponse = exports.HttpClientError = exports.getProxyUrl = exports.MediaTypes = exports.Headers = exports.HttpCodes = void 0; const http = __importStar(__nccwpck_require__(58611)); const https = __importStar(__nccwpck_require__(65692)); -const pm = __importStar(__nccwpck_require__(54988)); -const tunnel = __importStar(__nccwpck_require__(20770)); -const undici_1 = __nccwpck_require__(46752); +const pm = __importStar(__nccwpck_require__(77407)); +const tunnel = __importStar(__nccwpck_require__(16124)); +const undici_1 = __nccwpck_require__(38242); var HttpCodes; (function (HttpCodes) { HttpCodes[HttpCodes["OK"] = 200] = "OK"; @@ -2434,7 +2434,7 @@ class HttpClient { if (this._keepAlive && useProxy) { agent = this._proxyAgent; } - if (this._keepAlive && !useProxy) { + if (!useProxy) { agent = this._agent; } // if agent is already assigned use that agent. @@ -2466,16 +2466,12 @@ class HttpClient { agent = tunnelAgent(agentOptions); this._proxyAgent = agent; } - // if reusing agent across request and tunneling agent isn't assigned create a new agent - if (this._keepAlive && !agent) { + // if tunneling agent isn't assigned create a new agent + if (!agent) { const options = { keepAlive: this._keepAlive, maxSockets }; agent = usingSsl ? new https.Agent(options) : new http.Agent(options); this._agent = agent; } - // if not using private agent and tunnel agent isn't setup then use global agent - if (!agent) { - agent = usingSsl ? https.globalAgent : http.globalAgent; - } if (usingSsl && this._ignoreSslError) { // we don't want to set NODE_TLS_REJECT_UNAUTHORIZED=0 since that will affect request for entire process // http.RequestOptions doesn't expose a way to modify RequestOptions.agent.options @@ -2497,7 +2493,7 @@ class HttpClient { } const usingSsl = parsedUrl.protocol === 'https:'; proxyAgent = new undici_1.ProxyAgent(Object.assign({ uri: proxyUrl.href, pipelining: !this._keepAlive ? 0 : 1 }, ((proxyUrl.username || proxyUrl.password) && { - token: `${proxyUrl.username}:${proxyUrl.password}` + token: `Basic ${Buffer.from(`${proxyUrl.username}:${proxyUrl.password}`).toString('base64')}` }))); this._proxyAgentDispatcher = proxyAgent; if (usingSsl && this._ignoreSslError) { @@ -2589,7 +2585,7 @@ const lowercaseKeys = (obj) => Object.keys(obj).reduce((c, k) => ((c[k.toLowerCa /***/ }), -/***/ 54988: +/***/ 77407: /***/ ((__unused_webpack_module, exports) => { @@ -2610,11 +2606,11 @@ function getProxyUrl(reqUrl) { })(); if (proxyVar) { try { - return new URL(proxyVar); + return new DecodedURL(proxyVar); } catch (_a) { if (!proxyVar.startsWith('http://') && !proxyVar.startsWith('https://')) - return new URL(`http://${proxyVar}`); + return new DecodedURL(`http://${proxyVar}`); } } else { @@ -2673,11 +2669,24 @@ function isLoopbackAddress(host) { hostLower.startsWith('[::1]') || hostLower.startsWith('[0:0:0:0:0:0:0:1]')); } +class DecodedURL extends URL { + constructor(url, base) { + super(url, base); + this._decodedUsername = decodeURIComponent(super.username); + this._decodedPassword = decodeURIComponent(super.password); + } + get username() { + return this._decodedUsername; + } + get password() { + return this._decodedPassword; + } +} //# sourceMappingURL=proxy.js.map /***/ }), -/***/ 75207: +/***/ 52746: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -2866,7 +2875,7 @@ exports.getCmdPath = getCmdPath; /***/ }), -/***/ 94994: +/***/ 73357: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -2902,7 +2911,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); exports.findInPath = exports.which = exports.mkdirP = exports.rmRF = exports.mv = exports.cp = void 0; const assert_1 = __nccwpck_require__(42613); const path = __importStar(__nccwpck_require__(16928)); -const ioUtil = __importStar(__nccwpck_require__(75207)); +const ioUtil = __importStar(__nccwpck_require__(52746)); /** * Copies a file or folder. * Based off of shelljs - https://github.com/shelljs/shelljs/blob/9237f66c52e5daa40458f94f9565e18e8132f5a6/src/cp.js @@ -3171,10 +3180,783 @@ function copyFile(srcFile, destFile, force) { /***/ }), -/***/ 63451: +/***/ 77295: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +/* + +The MIT License (MIT) + +Original Library + - Copyright (c) Marak Squires + +Additional functionality + - Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. + +*/ + +var colors = {}; +module['exports'] = colors; + +colors.themes = {}; + +var util = __nccwpck_require__(39023); +var ansiStyles = colors.styles = __nccwpck_require__(26561); +var defineProps = Object.defineProperties; +var newLineRegex = new RegExp(/[\r\n]+/g); + +colors.supportsColor = (__nccwpck_require__(57722).supportsColor); + +if (typeof colors.enabled === 'undefined') { + colors.enabled = colors.supportsColor() !== false; +} + +colors.enable = function() { + colors.enabled = true; +}; + +colors.disable = function() { + colors.enabled = false; +}; + +colors.stripColors = colors.strip = function(str) { + return ('' + str).replace(/\x1B\[\d+m/g, ''); +}; + +// eslint-disable-next-line no-unused-vars +var stylize = colors.stylize = function stylize(str, style) { + if (!colors.enabled) { + return str+''; + } + + var styleMap = ansiStyles[style]; + + // Stylize should work for non-ANSI styles, too + if (!styleMap && style in colors) { + // Style maps like trap operate as functions on strings; + // they don't have properties like open or close. + return colors[style](str); + } + + return styleMap.open + str + styleMap.close; +}; + +var matchOperatorsRe = /[|\\{}()[\]^$+*?.]/g; +var escapeStringRegexp = function(str) { + if (typeof str !== 'string') { + throw new TypeError('Expected a string'); + } + return str.replace(matchOperatorsRe, '\\$&'); +}; + +function build(_styles) { + var builder = function builder() { + return applyStyle.apply(builder, arguments); + }; + builder._styles = _styles; + // __proto__ is used because we must return a function, but there is + // no way to create a function with a different prototype. + builder.__proto__ = proto; + return builder; +} + +var styles = (function() { + var ret = {}; + ansiStyles.grey = ansiStyles.gray; + Object.keys(ansiStyles).forEach(function(key) { + ansiStyles[key].closeRe = + new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); + ret[key] = { + get: function() { + return build(this._styles.concat(key)); + }, + }; + }); + return ret; +})(); + +var proto = defineProps(function colors() {}, styles); + +function applyStyle() { + var args = Array.prototype.slice.call(arguments); + + var str = args.map(function(arg) { + // Use weak equality check so we can colorize null/undefined in safe mode + if (arg != null && arg.constructor === String) { + return arg; + } else { + return util.inspect(arg); + } + }).join(' '); + + if (!colors.enabled || !str) { + return str; + } + + var newLinesPresent = str.indexOf('\n') != -1; + + var nestedStyles = this._styles; + + var i = nestedStyles.length; + while (i--) { + var code = ansiStyles[nestedStyles[i]]; + str = code.open + str.replace(code.closeRe, code.open) + code.close; + if (newLinesPresent) { + str = str.replace(newLineRegex, function(match) { + return code.close + match + code.open; + }); + } + } + + return str; +} + +colors.setTheme = function(theme) { + if (typeof theme === 'string') { + console.log('colors.setTheme now only accepts an object, not a string. ' + + 'If you are trying to set a theme from a file, it is now your (the ' + + 'caller\'s) responsibility to require the file. The old syntax ' + + 'looked like colors.setTheme(import.meta.dirname + ' + + '\'/../themes/generic-logging.js\'); The new syntax looks like '+ + 'colors.setTheme(require(import.meta.dirname + ' + + '\'/../themes/generic-logging.js\'));'); + return; + } + for (var style in theme) { + (function(style) { + colors[style] = function(str) { + if (typeof theme[style] === 'object') { + var out = str; + for (var i in theme[style]) { + out = colors[theme[style][i]](out); + } + return out; + } + return colors[theme[style]](str); + }; + })(style); + } +}; + +function init() { + var ret = {}; + Object.keys(styles).forEach(function(name) { + ret[name] = { + get: function() { + return build([name]); + }, + }; + }); + return ret; +} + +var sequencer = function sequencer(map, str) { + var exploded = str.split(''); + exploded = exploded.map(map); + return exploded.join(''); +}; + +// custom formatter methods +colors.trap = __nccwpck_require__(61024); +colors.zalgo = __nccwpck_require__(97314); + +// maps +colors.maps = {}; +colors.maps.america = __nccwpck_require__(50343)(colors); +colors.maps.zebra = __nccwpck_require__(35291)(colors); +colors.maps.rainbow = __nccwpck_require__(61793)(colors); +colors.maps.random = __nccwpck_require__(23920)(colors); + +for (var map in colors.maps) { + (function(map) { + colors[map] = function(str) { + return sequencer(colors.maps[map], str); + }; + })(map); +} + +defineProps(colors, init()); + + +/***/ }), + +/***/ 61024: +/***/ ((module) => { + +module['exports'] = function runTheTrap(text, options) { + var result = ''; + text = text || 'Run the trap, drop the bass'; + text = text.split(''); + var trap = { + a: ['\u0040', '\u0104', '\u023a', '\u0245', '\u0394', '\u039b', '\u0414'], + b: ['\u00df', '\u0181', '\u0243', '\u026e', '\u03b2', '\u0e3f'], + c: ['\u00a9', '\u023b', '\u03fe'], + d: ['\u00d0', '\u018a', '\u0500', '\u0501', '\u0502', '\u0503'], + e: ['\u00cb', '\u0115', '\u018e', '\u0258', '\u03a3', '\u03be', '\u04bc', + '\u0a6c'], + f: ['\u04fa'], + g: ['\u0262'], + h: ['\u0126', '\u0195', '\u04a2', '\u04ba', '\u04c7', '\u050a'], + i: ['\u0f0f'], + j: ['\u0134'], + k: ['\u0138', '\u04a0', '\u04c3', '\u051e'], + l: ['\u0139'], + m: ['\u028d', '\u04cd', '\u04ce', '\u0520', '\u0521', '\u0d69'], + n: ['\u00d1', '\u014b', '\u019d', '\u0376', '\u03a0', '\u048a'], + o: ['\u00d8', '\u00f5', '\u00f8', '\u01fe', '\u0298', '\u047a', '\u05dd', + '\u06dd', '\u0e4f'], + p: ['\u01f7', '\u048e'], + q: ['\u09cd'], + r: ['\u00ae', '\u01a6', '\u0210', '\u024c', '\u0280', '\u042f'], + s: ['\u00a7', '\u03de', '\u03df', '\u03e8'], + t: ['\u0141', '\u0166', '\u0373'], + u: ['\u01b1', '\u054d'], + v: ['\u05d8'], + w: ['\u0428', '\u0460', '\u047c', '\u0d70'], + x: ['\u04b2', '\u04fe', '\u04fc', '\u04fd'], + y: ['\u00a5', '\u04b0', '\u04cb'], + z: ['\u01b5', '\u0240'], + }; + text.forEach(function(c) { + c = c.toLowerCase(); + var chars = trap[c] || [' ']; + var rand = Math.floor(Math.random() * chars.length); + if (typeof trap[c] !== 'undefined') { + result += trap[c][rand]; + } else { + result += c; + } + }); + return result; +}; + + +/***/ }), + +/***/ 97314: +/***/ ((module) => { + +// please no +module['exports'] = function zalgo(text, options) { + text = text || ' he is here '; + var soul = { + 'up': [ + '̍', '̎', '̄', '̅', + '̿', '̑', '̆', '̐', + '͒', '͗', '͑', '̇', + '̈', '̊', '͂', '̓', + '̈', '͊', '͋', '͌', + '̃', '̂', '̌', '͐', + '̀', '́', '̋', '̏', + '̒', '̓', '̔', '̽', + '̉', 'ͣ', 'ͤ', 'ͥ', + 'ͦ', 'ͧ', 'ͨ', 'ͩ', + 'ͪ', 'ͫ', 'ͬ', 'ͭ', + 'ͮ', 'ͯ', '̾', '͛', + '͆', '̚', + ], + 'down': [ + '̖', '̗', '̘', '̙', + '̜', '̝', '̞', '̟', + '̠', '̤', '̥', '̦', + '̩', '̪', '̫', '̬', + '̭', '̮', '̯', '̰', + '̱', '̲', '̳', '̹', + '̺', '̻', '̼', 'ͅ', + '͇', '͈', '͉', '͍', + '͎', '͓', '͔', '͕', + '͖', '͙', '͚', '̣', + ], + 'mid': [ + '̕', '̛', '̀', '́', + '͘', '̡', '̢', '̧', + '̨', '̴', '̵', '̶', + '͜', '͝', '͞', + '͟', '͠', '͢', '̸', + '̷', '͡', ' ҉', + ], + }; + var all = [].concat(soul.up, soul.down, soul.mid); + + function randomNumber(range) { + var r = Math.floor(Math.random() * range); + return r; + } + + function isChar(character) { + var bool = false; + all.filter(function(i) { + bool = (i === character); + }); + return bool; + } + + + function heComes(text, options) { + var result = ''; + var counts; + var l; + options = options || {}; + options['up'] = + typeof options['up'] !== 'undefined' ? options['up'] : true; + options['mid'] = + typeof options['mid'] !== 'undefined' ? options['mid'] : true; + options['down'] = + typeof options['down'] !== 'undefined' ? options['down'] : true; + options['size'] = + typeof options['size'] !== 'undefined' ? options['size'] : 'maxi'; + text = text.split(''); + for (l in text) { + if (isChar(l)) { + continue; + } + result = result + text[l]; + counts = {'up': 0, 'down': 0, 'mid': 0}; + switch (options.size) { + case 'mini': + counts.up = randomNumber(8); + counts.mid = randomNumber(2); + counts.down = randomNumber(8); + break; + case 'maxi': + counts.up = randomNumber(16) + 3; + counts.mid = randomNumber(4) + 1; + counts.down = randomNumber(64) + 3; + break; + default: + counts.up = randomNumber(8) + 1; + counts.mid = randomNumber(6) / 2; + counts.down = randomNumber(8) + 1; + break; + } + + var arr = ['up', 'mid', 'down']; + for (var d in arr) { + var index = arr[d]; + for (var i = 0; i <= counts[index]; i++) { + if (options[index]) { + result = result + soul[index][randomNumber(soul[index].length)]; + } + } + } + } + return result; + } + // don't summon him + return heComes(text, options); +}; + + + +/***/ }), + +/***/ 50343: +/***/ ((module) => { + +module['exports'] = function(colors) { + return function(letter, i, exploded) { + if (letter === ' ') return letter; + switch (i%3) { + case 0: return colors.red(letter); + case 1: return colors.white(letter); + case 2: return colors.blue(letter); + } + }; +}; + + +/***/ }), + +/***/ 61793: +/***/ ((module) => { + +module['exports'] = function(colors) { + // RoY G BiV + var rainbowColors = ['red', 'yellow', 'green', 'blue', 'magenta']; + return function(letter, i, exploded) { + if (letter === ' ') { + return letter; + } else { + return colors[rainbowColors[i++ % rainbowColors.length]](letter); + } + }; +}; + + + +/***/ }), + +/***/ 23920: +/***/ ((module) => { + +module['exports'] = function(colors) { + var available = ['underline', 'inverse', 'grey', 'yellow', 'red', 'green', + 'blue', 'white', 'cyan', 'magenta', 'brightYellow', 'brightRed', + 'brightGreen', 'brightBlue', 'brightWhite', 'brightCyan', 'brightMagenta']; + return function(letter, i, exploded) { + return letter === ' ' ? letter : + colors[ + available[Math.round(Math.random() * (available.length - 2))] + ](letter); + }; +}; + + +/***/ }), + +/***/ 35291: +/***/ ((module) => { + +module['exports'] = function(colors) { + return function(letter, i, exploded) { + return i % 2 === 0 ? letter : colors.inverse(letter); + }; +}; + + +/***/ }), + +/***/ 26561: +/***/ ((module) => { + +/* +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. + +*/ + +var styles = {}; +module['exports'] = styles; + +var codes = { + reset: [0, 0], + + bold: [1, 22], + dim: [2, 22], + italic: [3, 23], + underline: [4, 24], + inverse: [7, 27], + hidden: [8, 28], + strikethrough: [9, 29], + + black: [30, 39], + red: [31, 39], + green: [32, 39], + yellow: [33, 39], + blue: [34, 39], + magenta: [35, 39], + cyan: [36, 39], + white: [37, 39], + gray: [90, 39], + grey: [90, 39], + + brightRed: [91, 39], + brightGreen: [92, 39], + brightYellow: [93, 39], + brightBlue: [94, 39], + brightMagenta: [95, 39], + brightCyan: [96, 39], + brightWhite: [97, 39], + + bgBlack: [40, 49], + bgRed: [41, 49], + bgGreen: [42, 49], + bgYellow: [43, 49], + bgBlue: [44, 49], + bgMagenta: [45, 49], + bgCyan: [46, 49], + bgWhite: [47, 49], + bgGray: [100, 49], + bgGrey: [100, 49], + + bgBrightRed: [101, 49], + bgBrightGreen: [102, 49], + bgBrightYellow: [103, 49], + bgBrightBlue: [104, 49], + bgBrightMagenta: [105, 49], + bgBrightCyan: [106, 49], + bgBrightWhite: [107, 49], + + // legacy styles for colors pre v1.0.0 + blackBG: [40, 49], + redBG: [41, 49], + greenBG: [42, 49], + yellowBG: [43, 49], + blueBG: [44, 49], + magentaBG: [45, 49], + cyanBG: [46, 49], + whiteBG: [47, 49], + +}; + +Object.keys(codes).forEach(function(key) { + var val = codes[key]; + var style = styles[key] = []; + style.open = '\u001b[' + val[0] + 'm'; + style.close = '\u001b[' + val[1] + 'm'; +}); + + +/***/ }), + +/***/ 69432: +/***/ ((module) => { + +/* +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. +*/ + + + +module.exports = function(flag, argv) { + argv = argv || process.argv || []; + + var terminatorPos = argv.indexOf('--'); + var prefix = /^-{1,2}/.test(flag) ? '' : '--'; + var pos = argv.indexOf(prefix + flag); + + return pos !== -1 && (terminatorPos === -1 ? true : pos < terminatorPos); +}; + + +/***/ }), + +/***/ 57722: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +/* +The MIT License (MIT) + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. + +*/ + + + +var os = __nccwpck_require__(70857); +var hasFlag = __nccwpck_require__(69432); + +var env = process.env; + +var forceColor = void 0; +if (hasFlag('no-color') || hasFlag('no-colors') || hasFlag('color=false')) { + forceColor = false; +} else if (hasFlag('color') || hasFlag('colors') || hasFlag('color=true') + || hasFlag('color=always')) { + forceColor = true; +} +if ('FORCE_COLOR' in env) { + forceColor = env.FORCE_COLOR.length === 0 + || parseInt(env.FORCE_COLOR, 10) !== 0; +} + +function translateLevel(level) { + if (level === 0) { + return false; + } + + return { + level: level, + hasBasic: true, + has256: level >= 2, + has16m: level >= 3, + }; +} + +function supportsColor(stream) { + if (forceColor === false) { + return 0; + } + + if (hasFlag('color=16m') || hasFlag('color=full') + || hasFlag('color=truecolor')) { + return 3; + } + + if (hasFlag('color=256')) { + return 2; + } + + if (stream && !stream.isTTY && forceColor !== true) { + return 0; + } + + var min = forceColor ? 1 : 0; + + if (process.platform === 'win32') { + // Node.js 7.5.0 is the first version of Node.js to include a patch to + // libuv that enables 256 color output on Windows. Anything earlier and it + // won't work. However, here we target Node.js 8 at minimum as it is an LTS + // release, and Node.js 7 is not. Windows 10 build 10586 is the first + // Windows release that supports 256 colors. Windows 10 build 14931 is the + // first release that supports 16m/TrueColor. + var osRelease = os.release().split('.'); + if (Number(process.versions.node.split('.')[0]) >= 8 + && Number(osRelease[0]) >= 10 && Number(osRelease[2]) >= 10586) { + return Number(osRelease[2]) >= 14931 ? 3 : 2; + } + + return 1; + } + + if ('CI' in env) { + if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI'].some(function(sign) { + return sign in env; + }) || env.CI_NAME === 'codeship') { + return 1; + } + + return min; + } + + if ('TEAMCITY_VERSION' in env) { + return (/^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0 + ); + } + + if ('TERM_PROGRAM' in env) { + var version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10); + + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + return version >= 3 ? 3 : 2; + case 'Hyper': + return 3; + case 'Apple_Terminal': + return 2; + // No default + } + } + + if (/-256(color)?$/i.test(env.TERM)) { + return 2; + } + + if (/^screen|^xterm|^vt100|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) { + return 1; + } + + if ('COLORTERM' in env) { + return 1; + } + + if (env.TERM === 'dumb') { + return min; + } + + return min; +} + +function getSupportLevel(stream) { + var level = supportsColor(stream); + return translateLevel(level); +} + +module.exports = { + supportsColor: getSupportLevel, + stdout: getSupportLevel(process.stdout), + stderr: getSupportLevel(process.stderr), +}; + + +/***/ }), + +/***/ 9098: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +// +// Remark: Requiring this file will use the "safe" colors API, +// which will not touch String.prototype. +// +// var colors = require('colors/safe'); +// colors.red("foo") +// +// +var colors = __nccwpck_require__(77295); +module['exports'] = colors; + + +/***/ }), + +/***/ 35452: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var enabled = __nccwpck_require__(85909); +var enabled = __nccwpck_require__(41830); /** * Creates a new Adapter. @@ -3196,10 +3978,10 @@ module.exports = function create(fn) { /***/ }), -/***/ 11159: +/***/ 69644: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var adapter = __nccwpck_require__(63451); +var adapter = __nccwpck_require__(35452); /** * Extracts the values from process.env. @@ -3214,7 +3996,7 @@ module.exports = adapter(function processenv() { /***/ }), -/***/ 39094: +/***/ 22371: /***/ ((module) => { /** @@ -3433,7 +4215,7 @@ module.exports = function create(diagnostics) { /***/ }), -/***/ 60602: +/***/ 93249: /***/ ((module) => { /** @@ -3459,11 +4241,11 @@ module.exports = function (meta, messages) { /***/ }), -/***/ 60910: +/***/ 66353: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var colorspace = __nccwpck_require__(48107); -var kuler = __nccwpck_require__(19703); +var colorspace = __nccwpck_require__(38710); +var kuler = __nccwpck_require__(60914); /** * Prefix the messages with a colored namespace. @@ -3486,10 +4268,10 @@ module.exports = function ansiModifier(args, options) { /***/ }), -/***/ 57570: +/***/ 38721: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var create = __nccwpck_require__(39094); +var create = __nccwpck_require__(22371); var tty = (__nccwpck_require__(52018).isatty)(1); /** @@ -3517,9 +4299,9 @@ var diagnostics = create(function dev(namespace, options) { // // Configure the logger for the given environment. // -diagnostics.modify(__nccwpck_require__(60910)); -diagnostics.use(__nccwpck_require__(11159)); -diagnostics.set(__nccwpck_require__(60602)); +diagnostics.modify(__nccwpck_require__(66353)); +diagnostics.use(__nccwpck_require__(69644)); +diagnostics.set(__nccwpck_require__(93249)); // // Expose the diagnostics logger. @@ -3529,25 +4311,25 @@ module.exports = diagnostics; /***/ }), -/***/ 1379: +/***/ 62948: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { // // Select the correct build version depending on the environment. // if (process.env.NODE_ENV === 'production') { - module.exports = __nccwpck_require__(86400); + module.exports = __nccwpck_require__(77569); } else { - module.exports = __nccwpck_require__(57570); + module.exports = __nccwpck_require__(38721); } /***/ }), -/***/ 86400: +/***/ 77569: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var create = __nccwpck_require__(39094); +var create = __nccwpck_require__(22371); /** * Create a new diagnostics logger. @@ -3575,7 +4357,7 @@ module.exports = diagnostics; /***/ }), -/***/ 5483: +/***/ 19240: /***/ ((__unused_webpack_module, exports) => { @@ -4726,7 +5508,7 @@ exports.types = types; /***/ }), -/***/ 72974: +/***/ 95248: /***/ ((__unused_webpack_module, exports) => { @@ -4735,16 +5517,16 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 96552: +/***/ 4242: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.CommandLineArguments = void 0; -const commander_1 = __nccwpck_require__(71825); -const lodash_1 = __nccwpck_require__(52356); -const ConfigNamespaceHelpers_1 = __nccwpck_require__(57587); -const Typing_1 = __nccwpck_require__(20982); +const commander_1 = __nccwpck_require__(18140); +const lodash_1 = __nccwpck_require__(62594); +const ConfigNamespaceHelpers_1 = __nccwpck_require__(21677); +const Typing_1 = __nccwpck_require__(15920); const NAMESPACE_SEPARATOR = "."; const COMMANDER_VALUE_GETTER = ` `; const COMMANDER_ARRAY_VALUE_GETTER = ` `; @@ -4855,7 +5637,7 @@ exports.CommandLineArguments = CommandLineArguments; /***/ }), -/***/ 83547: +/***/ 99117: /***/ ((__unused_webpack_module, exports) => { @@ -4864,7 +5646,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 47947: +/***/ 96345: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -4882,15 +5664,15 @@ var __importDefault = (this && this.__importDefault) || function (mod) { }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.Config = void 0; -const deepmerge_1 = __importDefault(__nccwpck_require__(4873)); -const CommandLineArguments_1 = __nccwpck_require__(96552); -const ConfigNamespace_1 = __nccwpck_require__(14152); -const ConfigNamespaceHelpers_1 = __nccwpck_require__(57587); -const Environment_1 = __nccwpck_require__(14708); -const Files_1 = __nccwpck_require__(87358); -const Options_1 = __nccwpck_require__(14099); -const Typing_1 = __nccwpck_require__(20982); -const Validation_1 = __nccwpck_require__(71058); +const deepmerge_1 = __importDefault(__nccwpck_require__(58245)); +const CommandLineArguments_1 = __nccwpck_require__(4242); +const ConfigNamespace_1 = __nccwpck_require__(86326); +const ConfigNamespaceHelpers_1 = __nccwpck_require__(21677); +const Environment_1 = __nccwpck_require__(97482); +const Files_1 = __nccwpck_require__(47452); +const Options_1 = __nccwpck_require__(75953); +const Typing_1 = __nccwpck_require__(15920); +const Validation_1 = __nccwpck_require__(99032); const ROOT_NAMESPACE = "_rootOptions"; const Config = class Config { constructor({ moduleName, mergeArrays = true } = { moduleName: "", mergeArrays: true }) { @@ -5258,7 +6040,7 @@ exports.Config = Config; /***/ }), -/***/ 40108: +/***/ 24450: /***/ ((__unused_webpack_module, exports) => { @@ -5267,7 +6049,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 14152: +/***/ 86326: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -5277,8 +6059,8 @@ var __importDefault = (this && this.__importDefault) || function (mod) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.ConfigNamespace = void 0; const events_1 = __importDefault(__nccwpck_require__(24434)); -const ConfigNamespaceHelpers_1 = __nccwpck_require__(57587); -const Option_1 = __nccwpck_require__(82780); +const ConfigNamespaceHelpers_1 = __nccwpck_require__(21677); +const Option_1 = __nccwpck_require__(87122); const ConfigNamespace = class ConfigNamespace { constructor(name, { parents = [], brothers, root, isRoot }) { Object.defineProperty(this, "_brothers", { @@ -5421,13 +6203,13 @@ exports.ConfigNamespace = ConfigNamespace; /***/ }), -/***/ 57587: +/***/ 21677: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.getNamespacesValues = exports.getOptionsValues = exports.checkOptionName = exports.checkNamespaceName = exports.findObjectWithName = exports.namespaceAndParentNames = void 0; -const lodash_1 = __nccwpck_require__(52356); +const lodash_1 = __nccwpck_require__(62594); function namespaceAndParentNames(namespace) { const namespaceName = namespace.name; const isRoot = namespace.isRoot; @@ -5494,15 +6276,15 @@ exports.getNamespacesValues = getNamespacesValues; /***/ }), -/***/ 14708: +/***/ 97482: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.Environment = void 0; -const lodash_1 = __nccwpck_require__(52356); -const ConfigNamespaceHelpers_1 = __nccwpck_require__(57587); -const Typing_1 = __nccwpck_require__(20982); +const lodash_1 = __nccwpck_require__(62594); +const ConfigNamespaceHelpers_1 = __nccwpck_require__(21677); +const Typing_1 = __nccwpck_require__(15920); function varSegment(segment) { return (0, lodash_1.snakeCase)(segment).toUpperCase(); } @@ -5565,7 +6347,7 @@ exports.Environment = Environment; /***/ }), -/***/ 42327: +/***/ 31757: /***/ ((__unused_webpack_module, exports) => { @@ -5574,7 +6356,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 83588: +/***/ 57458: /***/ ((__unused_webpack_module, exports) => { @@ -5593,7 +6375,7 @@ exports.addEventListener = addEventListener; /***/ }), -/***/ 39847: +/***/ 44853: /***/ ((__unused_webpack_module, exports) => { @@ -5602,7 +6384,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 87358: +/***/ 47452: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -5617,8 +6399,8 @@ var __awaiter = (this && this.__awaiter) || function (thisArg, _arguments, P, ge }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.Files = void 0; -const cosmiconfig_1 = __nccwpck_require__(62488); -const lodash_1 = __nccwpck_require__(52356); +const cosmiconfig_1 = __nccwpck_require__(69967); +const lodash_1 = __nccwpck_require__(62594); const Files = class Files { constructor(moduleName) { Object.defineProperty(this, "_moduleName", { @@ -5678,7 +6460,7 @@ exports.Files = Files; /***/ }), -/***/ 82937: +/***/ 91999: /***/ ((__unused_webpack_module, exports) => { @@ -5687,7 +6469,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 82780: +/***/ 87122: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -5697,11 +6479,11 @@ var __importDefault = (this && this.__importDefault) || function (mod) { Object.defineProperty(exports, "__esModule", ({ value: true })); exports.Option = void 0; const events_1 = __importDefault(__nccwpck_require__(24434)); -const deepmerge_1 = __importDefault(__nccwpck_require__(4873)); -const lodash_1 = __nccwpck_require__(52356); -const Events_1 = __nccwpck_require__(83588); -const Typing_1 = __nccwpck_require__(20982); -const Validation_1 = __nccwpck_require__(71058); +const deepmerge_1 = __importDefault(__nccwpck_require__(58245)); +const lodash_1 = __nccwpck_require__(62594); +const Events_1 = __nccwpck_require__(57458); +const Typing_1 = __nccwpck_require__(15920); +const Validation_1 = __nccwpck_require__(99032); class Option { constructor(optionProperties) { Object.defineProperty(this, "_eventEmitter", { @@ -5869,7 +6651,7 @@ exports.Option = Option; /***/ }), -/***/ 55295: +/***/ 4693: /***/ ((__unused_webpack_module, exports) => { @@ -5878,7 +6660,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 14099: +/***/ 75953: /***/ ((__unused_webpack_module, exports) => { @@ -5896,7 +6678,7 @@ exports.ALLOW_UNKNOWN_ARGUMENTS_OPTION = "allowUnknownArguments"; /***/ }), -/***/ 13524: +/***/ 91162: /***/ ((__unused_webpack_module, exports) => { @@ -5905,7 +6687,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 20982: +/***/ 15920: /***/ ((__unused_webpack_module, exports) => { @@ -6009,7 +6791,7 @@ exports.avoidArraysMerge = avoidArraysMerge; /***/ }), -/***/ 57905: +/***/ 83163: /***/ ((__unused_webpack_module, exports) => { @@ -6018,7 +6800,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 71058: +/***/ 99032: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -6027,10 +6809,10 @@ var __importDefault = (this && this.__importDefault) || function (mod) { }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.validateValueTypeAndThrow = exports.validateOptionAndThrow = exports.getValidationSchema = exports.validateConfig = exports.validateConfigAndThrow = void 0; -const ajv_1 = __importDefault(__nccwpck_require__(69983)); -const better_ajv_errors_1 = __importDefault(__nccwpck_require__(26001)); -const lodash_1 = __nccwpck_require__(52356); -const Typing_1 = __nccwpck_require__(20982); +const ajv_1 = __importDefault(__nccwpck_require__(53390)); +const better_ajv_errors_1 = __importDefault(__nccwpck_require__(25256)); +const lodash_1 = __nccwpck_require__(62594); +const Typing_1 = __nccwpck_require__(15920); const ajv = new ajv_1.default({ allErrors: true, allowUnionTypes: true }); ajv.addKeyword({ keyword: "isUnknown", @@ -6285,7 +7067,7 @@ exports.validateValueTypeAndThrow = validateValueTypeAndThrow; /***/ }), -/***/ 853: +/***/ 60835: /***/ ((__unused_webpack_module, exports) => { @@ -6294,7 +7076,7 @@ Object.defineProperty(exports, "__esModule", ({ value: true })); /***/ }), -/***/ 94057: +/***/ 65715: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -6314,17 +7096,17 @@ var __exportStar = (this && this.__exportStar) || function(m, exports) { }; Object.defineProperty(exports, "__esModule", ({ value: true })); exports.Config = void 0; -const Config_1 = __nccwpck_require__(47947); -var Config_2 = __nccwpck_require__(47947); +const Config_1 = __nccwpck_require__(96345); +var Config_2 = __nccwpck_require__(96345); Object.defineProperty(exports, "Config", ({ enumerable: true, get: function () { return Config_2.Config; } })); -__exportStar(__nccwpck_require__(1624), exports); -__exportStar(__nccwpck_require__(14099), exports); +__exportStar(__nccwpck_require__(64786), exports); +__exportStar(__nccwpck_require__(75953), exports); exports["default"] = Config_1.Config; /***/ }), -/***/ 1624: +/***/ 64786: /***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { @@ -6343,15238 +7125,14453 @@ var __exportStar = (this && this.__exportStar) || function(m, exports) { for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); }; Object.defineProperty(exports, "__esModule", ({ value: true })); -__exportStar(__nccwpck_require__(72974), exports); -__exportStar(__nccwpck_require__(83547), exports); -__exportStar(__nccwpck_require__(40108), exports); -__exportStar(__nccwpck_require__(42327), exports); -__exportStar(__nccwpck_require__(39847), exports); -__exportStar(__nccwpck_require__(82937), exports); -__exportStar(__nccwpck_require__(55295), exports); -__exportStar(__nccwpck_require__(57905), exports); -__exportStar(__nccwpck_require__(853), exports); -__exportStar(__nccwpck_require__(13524), exports); +__exportStar(__nccwpck_require__(95248), exports); +__exportStar(__nccwpck_require__(99117), exports); +__exportStar(__nccwpck_require__(24450), exports); +__exportStar(__nccwpck_require__(31757), exports); +__exportStar(__nccwpck_require__(44853), exports); +__exportStar(__nccwpck_require__(91999), exports); +__exportStar(__nccwpck_require__(4693), exports); +__exportStar(__nccwpck_require__(83163), exports); +__exportStar(__nccwpck_require__(60835), exports); +__exportStar(__nccwpck_require__(91162), exports); /***/ }), -/***/ 69983: -/***/ ((module, exports, __nccwpck_require__) => { +/***/ 91201: +/***/ ((__unused_webpack_module, exports) => { Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CodeGen = exports.Name = exports.nil = exports.stringify = exports.str = exports._ = exports.KeywordCxt = void 0; -const core_1 = __nccwpck_require__(48629); -const draft7_1 = __nccwpck_require__(3621); -const discriminator_1 = __nccwpck_require__(86102); -const draft7MetaSchema = __nccwpck_require__(38531); -const META_SUPPORT_DATA = ["/properties"]; -const META_SCHEMA_ID = "http://json-schema.org/draft-07/schema"; -class Ajv extends core_1.default { - _addVocabularies() { - super._addVocabularies(); - draft7_1.default.forEach((v) => this.addVocabulary(v)); - if (this.opts.discriminator) - this.addKeyword(discriminator_1.default); - } - _addDefaultMetaSchema() { - super._addDefaultMetaSchema(); - if (!this.opts.meta) - return; - const metaSchema = this.opts.$data - ? this.$dataMetaSchema(draft7MetaSchema, META_SUPPORT_DATA) - : draft7MetaSchema; - this.addMetaSchema(metaSchema, META_SCHEMA_ID, false); - this.refs["http://json-schema.org/schema"] = META_SCHEMA_ID; - } - defaultMeta() { - return (this.opts.defaultMeta = - super.defaultMeta() || (this.getSchema(META_SCHEMA_ID) ? META_SCHEMA_ID : undefined)); - } +exports.observableStore = exports.addEventListener = exports.CHANGE_EVENT = void 0; +exports.CHANGE_EVENT = "change"; +function addEventListener(listener, eventName, eventEmitter) { + const removeCallback = () => { + eventEmitter.removeListener(eventName, listener); + }; + eventEmitter.on(eventName, listener); + return removeCallback; } -module.exports = exports = Ajv; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports["default"] = Ajv; -var validate_1 = __nccwpck_require__(26345); -Object.defineProperty(exports, "KeywordCxt", ({ enumerable: true, get: function () { return validate_1.KeywordCxt; } })); -var codegen_1 = __nccwpck_require__(30972); -Object.defineProperty(exports, "_", ({ enumerable: true, get: function () { return codegen_1._; } })); -Object.defineProperty(exports, "str", ({ enumerable: true, get: function () { return codegen_1.str; } })); -Object.defineProperty(exports, "stringify", ({ enumerable: true, get: function () { return codegen_1.stringify; } })); -Object.defineProperty(exports, "nil", ({ enumerable: true, get: function () { return codegen_1.nil; } })); -Object.defineProperty(exports, "Name", ({ enumerable: true, get: function () { return codegen_1.Name; } })); -Object.defineProperty(exports, "CodeGen", ({ enumerable: true, get: function () { return codegen_1.CodeGen; } })); -//# sourceMappingURL=ajv.js.map +exports.addEventListener = addEventListener; +function observableStore(eventEmitter, storeLimit) { + const array = []; + return new Proxy(array, { + // eslint-disable-next-line @typescript-eslint/no-explicit-any + set: function (target, property, value) { + target[property] = value; + if (property === "length" && value <= storeLimit) { + // when logs reach the limit, it first add, then remove it. So, do not emit until it has been removed to avoid event duplication + eventEmitter.emit(exports.CHANGE_EVENT); + } + return true; + }, + }); +} +exports.observableStore = observableStore; + /***/ }), -/***/ 49847: +/***/ 88106: /***/ ((__unused_webpack_module, exports) => { Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.regexpCode = exports.getEsmExportName = exports.getProperty = exports.safeStringify = exports.stringify = exports.strConcat = exports.addCodeArg = exports.str = exports._ = exports.nil = exports._Code = exports.Name = exports.IDENTIFIER = exports._CodeOrName = void 0; -class _CodeOrName { -} -exports._CodeOrName = _CodeOrName; -exports.IDENTIFIER = /^[a-z$_][a-z$_0-9]*$/i; -class Name extends _CodeOrName { - constructor(s) { - super(); - if (!exports.IDENTIFIER.test(s)) - throw new Error("CodeGen: name must be a valid identifier"); - this.str = s; - } - toString() { - return this.str; - } - emptyStr() { - return false; - } - get names() { - return { [this.str]: 1 }; - } -} -exports.Name = Name; -class _Code extends _CodeOrName { - constructor(code) { - super(); - this._items = typeof code === "string" ? [code] : code; - } - toString() { - return this.str; - } - emptyStr() { - if (this._items.length > 1) - return false; - const item = this._items[0]; - return item === "" || item === '""'; - } - get str() { - var _a; - return ((_a = this._str) !== null && _a !== void 0 ? _a : (this._str = this._items.reduce((s, c) => `${s}${c}`, ""))); - } - get names() { - var _a; - return ((_a = this._names) !== null && _a !== void 0 ? _a : (this._names = this._items.reduce((names, c) => { - if (c instanceof Name) - names[c.str] = (names[c.str] || 0) + 1; - return names; - }, {}))); - } -} -exports._Code = _Code; -exports.nil = new _Code(""); -function _(strs, ...args) { - const code = [strs[0]]; - let i = 0; - while (i < args.length) { - addCodeArg(code, args[i]); - code.push(strs[++i]); + + +/***/ }), + +/***/ 28336: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } - return new _Code(code); -} -exports._ = _; -const plus = new _Code("+"); -function str(strs, ...args) { - const expr = [safeStringify(strs[0])]; - let i = 0; - while (i < args.length) { - expr.push(plus); - addCodeArg(expr, args[i]); - expr.push(plus, safeStringify(strs[++i])); + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.TRANSPORTS = exports.LEVELS = exports.Logger = void 0; +const events_1 = __importDefault(__nccwpck_require__(24434)); +const chalk_1 = __importDefault(__nccwpck_require__(31900)); +const winston = __importStar(__nccwpck_require__(21123)); +const winston_array_transport_1 = __importDefault(__nccwpck_require__(53429)); +const Events_1 = __nccwpck_require__(91201); +const Logger_types_1 = __nccwpck_require__(57083); +const DEFAULT_STORE_LIMIT = 1000; +const TIME_FORMAT = "HH:mm:ss:SS"; +const formatTimestamp = winston.format.timestamp({ + format: TIME_FORMAT, +}); +function colourLabel(label) { + if (!label.length) { + return ""; } - optimize(expr); - return new _Code(expr); -} -exports.str = str; -function addCodeArg(code, arg) { - if (arg instanceof _Code) - code.push(...arg._items); - else if (arg instanceof Name) - code.push(arg); - else - code.push(interpolate(arg)); + return chalk_1.default.grey(label); } -exports.addCodeArg = addCodeArg; -function optimize(expr) { - let i = 1; - while (i < expr.length - 1) { - if (expr[i] === plus) { - const res = mergeExprItems(expr[i - 1], expr[i + 1]); - if (res !== undefined) { - expr.splice(i - 1, 3, res); - continue; - } - expr[i++] = "+"; - } - i++; +function formatLabelOrLevel(labelOrLevel) { + if (!labelOrLevel.length) { + return ""; } + return `[${labelOrLevel}]`; } -function mergeExprItems(a, b) { - if (b === '""') - return a; - if (a === '""') - return b; - if (typeof a == "string") { - if (b instanceof Name || a[a.length - 1] !== '"') - return; - if (typeof b != "string") - return `${a.slice(0, -1)}${b}"`; - if (b[0] === '"') - return a.slice(0, -1) + b.slice(1); - return; - } - if (typeof b == "string" && b[0] === '"' && !(a instanceof Name)) - return `"${a}${b.slice(1)}`; - return; +function logTemplate(log, colors = false) { + const label = colors ? colourLabel(log.label) : log.label; + return `${log.timestamp} ${formatLabelOrLevel(log.level)}${formatLabelOrLevel(label)} ${log.message}`; } -function strConcat(c1, c2) { - return c2.emptyStr() ? c1 : c1.emptyStr() ? c2 : str `${c1}${c2}`; +function colorsTemplate(log) { + return logTemplate(log, true); } -exports.strConcat = strConcat; -// TODO do not allow arrays here -function interpolate(x) { - return typeof x == "number" || typeof x == "boolean" || x === null - ? x - : safeStringify(Array.isArray(x) ? x.join(",") : x); +function template(log) { + return logTemplate(log); } -function stringify(x) { - return new _Code(safeStringify(x)); +const formatLog = winston.format.printf(colorsTemplate); +const formatStore = winston.format.printf(template); +function createArrayTransport(store, defaultLevel, storeLimit) { + return new winston_array_transport_1.default({ + array: store, + limit: storeLimit, + level: defaultLevel, + maxListeners: 0, + format: winston.format.combine(formatTimestamp, formatStore), + }); } -exports.stringify = stringify; -function safeStringify(x) { - return JSON.stringify(x) - .replace(/\u2028/g, "\\u2028") - .replace(/\u2029/g, "\\u2029"); +function createConsoleTransport(defaultLevel) { + return new winston.transports.Console({ + level: defaultLevel, + format: winston.format.combine(winston.format.colorize(), formatTimestamp, formatLog), + }); } -exports.safeStringify = safeStringify; -function getProperty(key) { - return typeof key == "string" && exports.IDENTIFIER.test(key) ? new _Code(`.${key}`) : _ `[${key}]`; +function createTransports(store, defaultLevel, storeLimit, globalStoreTransport) { + return { + [Logger_types_1.TRANSPORT_CONSOLE]: createConsoleTransport(defaultLevel), + [Logger_types_1.TRANSPORT_STORE]: createArrayTransport(store, defaultLevel, storeLimit), + [Logger_types_1.TRANSPORT_GLOBAL_STORE]: globalStoreTransport, + }; } -exports.getProperty = getProperty; -//Does best effort to format the name properly -function getEsmExportName(key) { - if (typeof key == "string" && exports.IDENTIFIER.test(key)) { - return new _Code(`${key}`); +function namespaceLabel(parentLogger, label) { + const parentLabel = parentLogger.label; + if (!parentLabel.length) { + return label; } - throw new Error(`CodeGen: invalid export name: ${key}, use explicit $id name mapping`); -} -exports.getEsmExportName = getEsmExportName; -function regexpCode(rx) { - return new _Code(rx.toString()); + return `${parentLogger.label}:${label}`; } -exports.regexpCode = regexpCode; -//# sourceMappingURL=code.js.map - -/***/ }), - -/***/ 30972: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - - -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.or = exports.and = exports.not = exports.CodeGen = exports.operators = exports.varKinds = exports.ValueScopeName = exports.ValueScope = exports.Scope = exports.Name = exports.regexpCode = exports.stringify = exports.getProperty = exports.nil = exports.strConcat = exports.str = exports._ = void 0; -const code_1 = __nccwpck_require__(49847); -const scope_1 = __nccwpck_require__(92348); -var code_2 = __nccwpck_require__(49847); -Object.defineProperty(exports, "_", ({ enumerable: true, get: function () { return code_2._; } })); -Object.defineProperty(exports, "str", ({ enumerable: true, get: function () { return code_2.str; } })); -Object.defineProperty(exports, "strConcat", ({ enumerable: true, get: function () { return code_2.strConcat; } })); -Object.defineProperty(exports, "nil", ({ enumerable: true, get: function () { return code_2.nil; } })); -Object.defineProperty(exports, "getProperty", ({ enumerable: true, get: function () { return code_2.getProperty; } })); -Object.defineProperty(exports, "stringify", ({ enumerable: true, get: function () { return code_2.stringify; } })); -Object.defineProperty(exports, "regexpCode", ({ enumerable: true, get: function () { return code_2.regexpCode; } })); -Object.defineProperty(exports, "Name", ({ enumerable: true, get: function () { return code_2.Name; } })); -var scope_2 = __nccwpck_require__(92348); -Object.defineProperty(exports, "Scope", ({ enumerable: true, get: function () { return scope_2.Scope; } })); -Object.defineProperty(exports, "ValueScope", ({ enumerable: true, get: function () { return scope_2.ValueScope; } })); -Object.defineProperty(exports, "ValueScopeName", ({ enumerable: true, get: function () { return scope_2.ValueScopeName; } })); -Object.defineProperty(exports, "varKinds", ({ enumerable: true, get: function () { return scope_2.varKinds; } })); -exports.operators = { - GT: new code_1._Code(">"), - GTE: new code_1._Code(">="), - LT: new code_1._Code("<"), - LTE: new code_1._Code("<="), - EQ: new code_1._Code("==="), - NEQ: new code_1._Code("!=="), - NOT: new code_1._Code("!"), - OR: new code_1._Code("||"), - AND: new code_1._Code("&&"), - ADD: new code_1._Code("+"), -}; -class Node { - optimizeNodes() { - return this; +const Logger = class Logger { + constructor(label = "", { level, storeLimit = DEFAULT_STORE_LIMIT, globalStoreLimit = DEFAULT_STORE_LIMIT, } = {}, { parent, root, globalStore, globalStoreTransport } = {}) { + Object.defineProperty(this, "_label", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_transports", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_container", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_logger", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_store", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_storeEmitter", { + enumerable: true, + configurable: true, + writable: true, + value: new events_1.default() + }); + Object.defineProperty(this, "_globalStore", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_globalStoreEmitter", { + enumerable: true, + configurable: true, + writable: true, + value: new events_1.default() + }); + Object.defineProperty(this, "_namespaces", { + enumerable: true, + configurable: true, + writable: true, + value: [] + }); + Object.defineProperty(this, "_parent", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_root", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_level", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + Object.defineProperty(this, "_transportsPinnedLevels", { + enumerable: true, + configurable: true, + writable: true, + value: { + [Logger_types_1.TRANSPORT_CONSOLE]: false, + [Logger_types_1.TRANSPORT_STORE]: false, + } + }); + Object.defineProperty(this, "_pinnedLevel", { + enumerable: true, + configurable: true, + writable: true, + value: false + }); + Object.defineProperty(this, "_globalStoreTransport", { + enumerable: true, + configurable: true, + writable: true, + value: void 0 + }); + this._parent = parent; + this._root = root || this; + const parentLevel = this._parent && this._parent.level; + const defaultLevel = level || parentLevel || Logger_types_1.LEVEL_INFO; + this._level = defaultLevel; + this._label = parent ? namespaceLabel(parent, label) : label; + this._store = (0, Events_1.observableStore)(this._storeEmitter, storeLimit); + this._globalStore = globalStore || (0, Events_1.observableStore)(this._globalStoreEmitter, globalStoreLimit); + this._globalStoreTransport = + globalStoreTransport || + createArrayTransport(this._globalStore, defaultLevel, globalStoreLimit); + this._transports = createTransports(this._store, defaultLevel, storeLimit, this._globalStoreTransport); + this._container = new winston.Container(); + this._container.add(label, { + format: winston.format.combine(winston.format.label({ label: this._label })), + transports: [ + this._transports[Logger_types_1.TRANSPORT_CONSOLE], + this._transports[Logger_types_1.TRANSPORT_STORE], + this._transports[Logger_types_1.TRANSPORT_GLOBAL_STORE], + ], + }); + this._logger = this._container.get(label); } - optimizeNames(_names, _constants) { - return this; + get store() { + return this._store; } -} -class Def extends Node { - constructor(varKind, name, rhs) { - super(); - this.varKind = varKind; - this.name = name; - this.rhs = rhs; + get globalStore() { + return this._globalStore; } - render({ es5, _n }) { - const varKind = es5 ? scope_1.varKinds.var : this.varKind; - const rhs = this.rhs === undefined ? "" : ` = ${this.rhs}`; - return `${varKind} ${this.name}${rhs};` + _n; + get label() { + return this._label; } - optimizeNames(names, constants) { - if (!names[this.name.str]) - return; - if (this.rhs) - this.rhs = optimizeExpr(this.rhs, names, constants); - return this; + get level() { + return this._level; } - get names() { - return this.rhs instanceof code_1._CodeOrName ? this.rhs.names : {}; + get root() { + return this._root; } -} -class Assign extends Node { - constructor(lhs, rhs, sideEffects) { - super(); - this.lhs = lhs; - this.rhs = rhs; - this.sideEffects = sideEffects; + [Logger_types_1.LEVEL_SILLY](message) { + this._logger[Logger_types_1.LEVEL_SILLY](message); } - render({ _n }) { - return `${this.lhs} = ${this.rhs};` + _n; + [Logger_types_1.LEVEL_DEBUG](message) { + this._logger[Logger_types_1.LEVEL_DEBUG](message); } - optimizeNames(names, constants) { - if (this.lhs instanceof code_1.Name && !names[this.lhs.str] && !this.sideEffects) - return; - this.rhs = optimizeExpr(this.rhs, names, constants); - return this; + [Logger_types_1.LEVEL_VERBOSE](message) { + this._logger[Logger_types_1.LEVEL_VERBOSE](message); } - get names() { - const names = this.lhs instanceof code_1.Name ? {} : { ...this.lhs.names }; - return addExprNames(names, this.rhs); + [Logger_types_1.LEVEL_INFO](message) { + this._logger[Logger_types_1.LEVEL_INFO](message); } -} -class AssignOp extends Assign { - constructor(lhs, op, rhs, sideEffects) { - super(lhs, rhs, sideEffects); - this.op = op; + [Logger_types_1.LEVEL_WARN](message) { + this._logger[Logger_types_1.LEVEL_WARN](message); } - render({ _n }) { - return `${this.lhs} ${this.op}= ${this.rhs};` + _n; + [Logger_types_1.LEVEL_ERROR](message) { + this._logger[Logger_types_1.LEVEL_ERROR](message); } -} -class Label extends Node { - constructor(label) { - super(); - this.label = label; - this.names = {}; + setLevel(level, options) { + this._set(level, options); } - render({ _n }) { - return `${this.label}:` + _n; + namespace(label, options) { + return this._getNamespace(label) || this._createNamespace(label, options); } -} -class Break extends Node { - constructor(label) { - super(); - this.label = label; - this.names = {}; + cleanStore() { + this._store.splice(0, this._store.length); } - render({ _n }) { - const label = this.label ? ` ${this.label}` : ""; - return `break${label};` + _n; + onChangeStore(listener) { + return (0, Events_1.addEventListener)(listener, Events_1.CHANGE_EVENT, this._storeEmitter); } -} -class Throw extends Node { - constructor(error) { - super(); - this.error = error; + onChangeGlobalStore(listener) { + return (0, Events_1.addEventListener)(listener, Events_1.CHANGE_EVENT, this._globalStoreEmitter); } - render({ _n }) { - return `throw ${this.error};` + _n; + _setLevelFromParent(level, { transport, forcePropagation = false }) { + if (!this._pinnedLevel || forcePropagation) { + this._set(level, { transport, forcePropagation }); + } } - get names() { - return this.error.names; + _setWinstonTransportLevel(level, transport) { + if (level === Logger_types_1.LEVEL_SILENT) { + this._transports[transport].silent = true; + } + else { + this._transports[transport].silent = false; + this._transports[transport].level = level; + } } -} -class AnyCode extends Node { - constructor(code) { - super(); - this.code = code; + _setTransportLevel(level, transport, { pinned = false, fromBaseLevel = false, forcePropagation = false, }) { + if (forcePropagation || + !fromBaseLevel || + (fromBaseLevel && !this._transportsPinnedLevels[transport])) { + this._transportsPinnedLevels[transport] = pinned; + this._setWinstonTransportLevel(level, transport); + if (transport === Logger_types_1.TRANSPORT_STORE && !this._parent) { + this._setWinstonTransportLevel(level, Logger_types_1.TRANSPORT_GLOBAL_STORE); + } + } } - render({ _n }) { - return `${this.code};` + _n; + _setBaseLevel(level, { pinned = false, forcePropagation }) { + this._level = level; + this._pinnedLevel = pinned; + this._setTransportLevel(level, Logger_types_1.TRANSPORT_CONSOLE, { fromBaseLevel: true, forcePropagation }); + this._setTransportLevel(level, Logger_types_1.TRANSPORT_STORE, { fromBaseLevel: true, forcePropagation }); } - optimizeNodes() { - return `${this.code}` ? this : undefined; + _set(level, { transport, propagate = true, forcePropagation, pinned } = {}) { + if (transport) { + this._setTransportLevel(level, transport, { pinned, forcePropagation }); + } + else { + this._setBaseLevel(level, { pinned, forcePropagation }); + } + if (propagate) { + this._namespaces.forEach((namespace) => { + namespace._setLevelFromParent(level, { transport, forcePropagation }); + }); + } } - optimizeNames(names, constants) { - this.code = optimizeExpr(this.code, names, constants); - return this; + _getNamespace(label) { + return this._namespaces.find((namespace) => { + return namespace.label === label; + }); } - get names() { - return this.code instanceof code_1._CodeOrName ? this.code.names : {}; + _createNamespace(label, options) { + const namespace = new Logger(label, options, { + parent: this, + root: this._root, + globalStoreTransport: this._globalStoreTransport, + globalStore: this._globalStore, + }); + this._namespaces.push(namespace); + return namespace; } -} -class ParentNode extends Node { - constructor(nodes = []) { - super(); - this.nodes = nodes; +}; +exports.Logger = Logger; +exports.LEVELS = { + SILLY: Logger_types_1.LEVEL_SILLY, + DEBUG: Logger_types_1.LEVEL_DEBUG, + VERBOSE: Logger_types_1.LEVEL_VERBOSE, + INFO: Logger_types_1.LEVEL_INFO, + WARN: Logger_types_1.LEVEL_WARN, + ERROR: Logger_types_1.LEVEL_ERROR, + SILENT: Logger_types_1.LEVEL_SILENT, +}; +exports.TRANSPORTS = { + CONSOLE: Logger_types_1.TRANSPORT_CONSOLE, + STORE: Logger_types_1.TRANSPORT_STORE, + GLOBAL_STORE: Logger_types_1.TRANSPORT_GLOBAL_STORE, +}; + + +/***/ }), + +/***/ 57083: +/***/ ((__unused_webpack_module, exports) => { + + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.TRANSPORT_GLOBAL_STORE = exports.TRANSPORT_STORE = exports.TRANSPORT_CONSOLE = exports.LEVEL_SILENT = exports.LEVEL_ERROR = exports.LEVEL_WARN = exports.LEVEL_INFO = exports.LEVEL_VERBOSE = exports.LEVEL_DEBUG = exports.LEVEL_SILLY = void 0; +exports.LEVEL_SILLY = "silly"; +exports.LEVEL_DEBUG = "debug"; +exports.LEVEL_VERBOSE = "verbose"; +exports.LEVEL_INFO = "info"; +exports.LEVEL_WARN = "warn"; +exports.LEVEL_ERROR = "error"; +exports.LEVEL_SILENT = "silent"; +exports.TRANSPORT_CONSOLE = "console"; +exports.TRANSPORT_STORE = "store"; +exports.TRANSPORT_GLOBAL_STORE = "globalStore"; + + +/***/ }), + +/***/ 72842: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } - render(opts) { - return this.nodes.reduce((code, n) => code + n.render(opts), ""); + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __exportStar = (this && this.__exportStar) || function(m, exports) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.Logger = void 0; +const Logger_1 = __nccwpck_require__(28336); +var Logger_2 = __nccwpck_require__(28336); +Object.defineProperty(exports, "Logger", ({ enumerable: true, get: function () { return Logger_2.Logger; } })); +__exportStar(__nccwpck_require__(37351), exports); +exports["default"] = Logger_1.Logger; + + +/***/ }), + +/***/ 37351: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } - optimizeNodes() { - const { nodes } = this; - let i = nodes.length; - while (i--) { - const n = nodes[i].optimizeNodes(); - if (Array.isArray(n)) - nodes.splice(i, 1, ...n); - else if (n) - nodes[i] = n; - else - nodes.splice(i, 1); + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __exportStar = (this && this.__exportStar) || function(m, exports) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +__exportStar(__nccwpck_require__(88106), exports); +__exportStar(__nccwpck_require__(57083), exports); + + +/***/ }), + +/***/ 90350: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ConfluenceSyncPages = void 0; +const promises_1 = __nccwpck_require__(51455); +const logger_1 = __nccwpck_require__(72842); +const fastq_1 = __nccwpck_require__(92247); +const CustomConfluenceClient_1 = __nccwpck_require__(46716); +const ConfluenceSyncPages_types_1 = __nccwpck_require__(92041); +const CompoundError_1 = __nccwpck_require__(59780); +const NotAncestorsExpectedValidationError_1 = __nccwpck_require__(68721); +const PendingPagesToSyncError_1 = __nccwpck_require__(49510); +const RootPageRequiredException_1 = __nccwpck_require__(44690); +const ShouldUseIdModeException_1 = __nccwpck_require__(35188); +const RootPageForbiddenException_1 = __nccwpck_require__(59328); +const PagesWithoutIdException_1 = __nccwpck_require__(25979); +const InvalidSyncModeException_1 = __nccwpck_require__(71617); +const Pages_1 = __nccwpck_require__(52725); +const LOGGER_NAMESPACE = "confluence-sync-pages"; +const DEFAULT_LOG_LEVEL = "silent"; +const ConfluenceSyncPages = class ConfluenceSyncPages { + _logger; + _confluenceClient; + _rootPageId; + _syncMode; + constructor({ logLevel, url, spaceId, personalAccessToken, dryRun, syncMode, rootPageId, }) { + this._logger = new logger_1.Logger(LOGGER_NAMESPACE, { + level: logLevel ?? DEFAULT_LOG_LEVEL, + }); + this._confluenceClient = new CustomConfluenceClient_1.CustomConfluenceClient({ + url, + spaceId, + personalAccessToken, + logger: this._logger.namespace("confluence"), + dryRun, + }); + this._syncMode = syncMode ?? ConfluenceSyncPages_types_1.SyncModes.TREE; + if (![ConfluenceSyncPages_types_1.SyncModes.FLAT, ConfluenceSyncPages_types_1.SyncModes.ID, ConfluenceSyncPages_types_1.SyncModes.TREE].includes(this._syncMode)) { + throw new InvalidSyncModeException_1.InvalidSyncModeException(this._syncMode); } - return nodes.length > 0 ? this : undefined; - } - optimizeNames(names, constants) { - const { nodes } = this; - let i = nodes.length; - while (i--) { - // iterating backwards improves 1-pass optimization - const n = nodes[i]; - if (n.optimizeNames(names, constants)) - continue; - subtractNames(names, n.names); - nodes.splice(i, 1); + if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.TREE && rootPageId === undefined) { + throw new RootPageRequiredException_1.RootPageRequiredException(ConfluenceSyncPages_types_1.SyncModes.TREE); } - return nodes.length > 0 ? this : undefined; - } - get names() { - return this.nodes.reduce((names, n) => addNames(names, n.names), {}); + this._rootPageId = rootPageId; } -} -class BlockNode extends ParentNode { - render(opts) { - return "{" + opts._n + super.render(opts) + "}" + opts._n; + get logger() { + return this._logger; } -} -class Root extends ParentNode { -} -class Else extends BlockNode { -} -Else.kind = "else"; -class If extends BlockNode { - constructor(condition, nodes) { - super(nodes); - this.condition = condition; + async sync(pages) { + const syncMode = this._syncMode; + const confluencePages = new Map(); + const pagesMap = new Map(pages.map((page) => [page.title, page])); + const tasksDone = new Array(); + const errors = new Array(); + const queue = (0, fastq_1.promise)(this._handleTask.bind(this), 1); + function enqueueTask(task) { + queue.push({ + task, + enqueueTask, + getConfluencePageByTitle, + getPageByTitle, + getPagesByAncestor, + storeConfluencePage, + }); + } + function getConfluencePageByTitle(pageTitle) { + return confluencePages.get(pageTitle); + } + function storeConfluencePage(page) { + confluencePages.set(page.title, page); + } + function getPageByTitle(pageTitle) { + return pagesMap.get(pageTitle); + } + function getPagesByAncestor(ancestor, isRoot = false) { + if (syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { + // NOTE: in flat mode all pages without id are considered + // children of root page. Otherwise, they are pages with mirror + // page in Confluence and have no ancestors. + if (isRoot) { + return pages.filter((page) => page.id === undefined); + } + return []; + } + if (isRoot) { + return pages + .filter((page) => page.ancestors === undefined || page.ancestors.length === 0) + .concat(pages.filter((page) => page.ancestors?.at(-1) === ancestor)); + } + return pages.filter((page) => page.ancestors?.at(-1) === ancestor); + } + queue.error((e, job) => { + if (e) { + errors.push(e); + return; + } + const task = job.task; + tasksDone.push(task); + }); + if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { + this._validateFlatMode(pages); + pages + .filter((page) => page.id !== undefined) + .forEach((page) => { + enqueueTask({ type: "update", pageId: page.id, page }); + }); + } + if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.ID) { + this._validateIdMode(pages); + pages.forEach((page) => { + enqueueTask({ type: "update", pageId: page.id, page }); + }); + } + if (this._rootPageId !== undefined) + enqueueTask({ type: "init", pageId: this._rootPageId }); + await queue.drained(); + if (errors.length > 0) { + const e = new CompoundError_1.CompoundError(...errors); + this._logger.error(`Error occurs during sync: ${e}`); + throw e; + } + this._assertPendingPagesToCreate(tasksDone, pages); + this._reportTasks(tasksDone); } - render(opts) { - let code = `if(${this.condition})` + super.render(opts); - if (this.else) - code += "else " + this.else.render(opts); - return code; + _validateIdMode(pages) { + const pagesWithoutId = pages.filter((page) => page.id === undefined); + if (pagesWithoutId.length > 0) { + throw new PagesWithoutIdException_1.PagesWithoutIdException(pagesWithoutId); + } + if (this._rootPageId !== undefined) { + throw new RootPageForbiddenException_1.RootPageForbiddenException(); + } + const pagesWithAncestors = pages.filter((page) => page.ancestors !== undefined && page.ancestors.length > 0); + if (pagesWithAncestors.length > 0) { + throw new NotAncestorsExpectedValidationError_1.NotAncestorsExpectedValidationError(pagesWithAncestors); + } } - optimizeNodes() { - super.optimizeNodes(); - const cond = this.condition; - if (cond === true) - return this.nodes; // else is ignored here - let e = this.else; - if (e) { - const ns = e.optimizeNodes(); - e = this.else = Array.isArray(ns) ? new Else(ns) : ns; + _validateFlatMode(pages) { + const pagesWithoutId = pages.filter((page) => page.id === undefined); + if (pagesWithoutId.length === 0) { + throw new ShouldUseIdModeException_1.ShouldUseIdModeException(`There are no pages without id. You should use ID mode instead of FLAT mode`); } - if (e) { - if (cond === false) - return e instanceof If ? e : e.nodes; - if (this.nodes.length) - return this; - return new If(not(cond), e instanceof If ? [e] : e.nodes); + if (this._rootPageId === undefined) { + throw new RootPageRequiredException_1.RootPageRequiredException(ConfluenceSyncPages_types_1.SyncModes.FLAT); + } + const pagesWithAncestors = pages.filter((page) => page.ancestors !== undefined && page.ancestors.length > 0); + if (pagesWithAncestors.length > 0) { + throw new NotAncestorsExpectedValidationError_1.NotAncestorsExpectedValidationError(pagesWithAncestors); } - if (cond === false || !this.nodes.length) - return undefined; - return this; } - optimizeNames(names, constants) { - var _a; - this.else = (_a = this.else) === null || _a === void 0 ? void 0 : _a.optimizeNames(names, constants); - if (!(super.optimizeNames(names, constants) || this.else)) - return; - this.condition = optimizeExpr(this.condition, names, constants); - return this; + _assertPendingPagesToCreate(tasksDone, _pages) { + const createdOrUpdatedPages = tasksDone + .filter((task) => task.type === "create" || task.type === "update") + .map((task) => task.page.title); + const pendingPagesToCreate = _pages.filter((page) => !createdOrUpdatedPages.includes(page.title)); + if (pendingPagesToCreate.length > 0) { + const e = new PendingPagesToSyncError_1.PendingPagesToSyncError(pendingPagesToCreate); + this._logger.error(e.message); + throw e; + } } - get names() { - const names = super.names; - addExprNames(names, this.condition); - if (this.else) - addNames(names, this.else.names); - return names; + _reportTasks(tasks) { + const createdPages = tasks.filter((task) => task.type === "create"); + this._logger.debug(`Created pages: ${createdPages.length} + ${createdPages.map((task) => `+ ${task.page.title}`).join("\n")}`); + const updatedPages = tasks.filter((task) => task.type === "update"); + this._logger.debug(`Updated pages: ${updatedPages.length} + ${updatedPages.map((task) => `⟳ #${task.pageId} ${task.page.title}`).join("\n")}`); + const deletedPages = tasks.filter((task) => task.type === "delete"); + this._logger.debug(`Deleted pages: ${deletedPages.length} + ${deletedPages.map((task) => `- #${task.pageId}`).join("\n")}`); + this._logger.info("Sync finished"); } -} -If.kind = "if"; -class For extends BlockNode { -} -For.kind = "for"; -class ForLoop extends For { - constructor(iteration) { - super(); - this.iteration = iteration; + _handleTask(job) { + const task = job.task; + switch (task.type) { + case "init": + return this._initSync({ ...job, task }); + case "create": + return this._createPage({ ...job, task }); + case "update": + return this._updatePage({ ...job, task }); + case "delete": + return this._deletePage({ ...job, task }); + case "createAttachments": + return this._createAttachments({ ...job, task }); + case "deleteAttachments": + return this._deleteAttachments({ ...job, task }); + } } - render(opts) { - return `for(${this.iteration})` + super.render(opts); + async _initSync(job) { + this._logger.debug(`Reading page ${job.task.pageId}`); + const confluencePage = await this._confluenceClient.getPage(job.task.pageId); + job.storeConfluencePage(confluencePage); + this._enqueueChildrenPages(job, confluencePage, true); } - optimizeNames(names, constants) { - if (!super.optimizeNames(names, constants)) - return; - this.iteration = optimizeExpr(this.iteration, names, constants); - return this; + async _createPage(job) { + this._logger.debug(`Creating page ${JSON.stringify(job.task.page)}`); + const ancestors = job.task.page.ancestors?.map((ancestorTitle) => { + const ancestor = job.getConfluencePageByTitle(ancestorTitle); + // NOTE: This should never happen. Defensively check anyway. + // istanbul ignore next + if (ancestor === undefined) { + throw new Error(`Could not find ancestor ${ancestorTitle}`); + } + return { id: ancestor.id, title: ancestor.title }; + }); + const confluencePage = await this._confluenceClient.createPage({ + ...job.task.page, + ancestors, + }); + job.storeConfluencePage(confluencePage); + if (job.task.page.attachments !== undefined && + Object.entries(job.task.page.attachments).length > 0) + job.enqueueTask({ + type: "createAttachments", + pageId: confluencePage.id, + pageTitle: confluencePage.title, + attachments: job.task.page.attachments, + }); + const descendants = job.getPagesByAncestor(job.task.page.title); + for (const descendant of descendants) { + job.enqueueTask({ type: "create", page: descendant }); + } } - get names() { - return addNames(super.names, this.iteration.names); + async _updatePage(job) { + this._logger.debug(`Updating page ${job.task.page.title}`); + const confluencePage = await this._confluenceClient.getPage(job.task.pageId); + const updatedConfluencePage = await this._confluenceClient.updatePage({ + id: confluencePage.id, + title: job.task.page.title, + content: job.task.page.content, + ancestors: confluencePage.ancestors, + version: confluencePage.version + 1, + }); + job.storeConfluencePage(updatedConfluencePage); + const attachments = await this._confluenceClient.getAttachments(confluencePage.id); + for (const attachment of attachments) { + this._logger.debug(`Enqueueing delete attachment ${attachment.title} for page ${confluencePage.title}`); + job.enqueueTask({ type: "deleteAttachments", pageId: attachment.id }); + } + if (job.task.page.attachments !== undefined && + Object.entries(job.task.page.attachments).length > 0) { + job.enqueueTask({ + type: "createAttachments", + pageId: confluencePage.id, + pageTitle: confluencePage.title, + attachments: job.task.page.attachments, + }); + } + if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.TREE) { + this._enqueueChildrenPages(job, confluencePage); + } } -} -class ForRange extends For { - constructor(varKind, name, from, to) { - super(); - this.varKind = varKind; - this.name = name; - this.from = from; - this.to = to; - } - render(opts) { - const varKind = opts.es5 ? scope_1.varKinds.var : this.varKind; - const { name, from, to } = this; - return `for(${varKind} ${name}=${from}; ${name}<${to}; ${name}++)` + super.render(opts); - } - get names() { - const names = addExprNames(super.names, this.from); - return addExprNames(names, this.to); - } -} -class ForIter extends For { - constructor(loop, varKind, name, iterable) { - super(); - this.loop = loop; - this.varKind = varKind; - this.name = name; - this.iterable = iterable; - } - render(opts) { - return `for(${this.varKind} ${this.name} ${this.loop} ${this.iterable})` + super.render(opts); - } - optimizeNames(names, constants) { - if (!super.optimizeNames(names, constants)) - return; - this.iterable = optimizeExpr(this.iterable, names, constants); - return this; - } - get names() { - return addNames(super.names, this.iterable.names); - } -} -class Func extends BlockNode { - constructor(name, args, async) { - super(); - this.name = name; - this.args = args; - this.async = async; - } - render(opts) { - const _async = this.async ? "async " : ""; - return `${_async}function ${this.name}(${this.args})` + super.render(opts); - } -} -Func.kind = "func"; -class Return extends ParentNode { - render(opts) { - return "return " + super.render(opts); - } -} -Return.kind = "return"; -class Try extends BlockNode { - render(opts) { - let code = "try" + super.render(opts); - if (this.catch) - code += this.catch.render(opts); - if (this.finally) - code += this.finally.render(opts); - return code; - } - optimizeNodes() { - var _a, _b; - super.optimizeNodes(); - (_a = this.catch) === null || _a === void 0 ? void 0 : _a.optimizeNodes(); - (_b = this.finally) === null || _b === void 0 ? void 0 : _b.optimizeNodes(); - return this; - } - optimizeNames(names, constants) { - var _a, _b; - super.optimizeNames(names, constants); - (_a = this.catch) === null || _a === void 0 ? void 0 : _a.optimizeNames(names, constants); - (_b = this.finally) === null || _b === void 0 ? void 0 : _b.optimizeNames(names, constants); - return this; - } - get names() { - const names = super.names; - if (this.catch) - addNames(names, this.catch.names); - if (this.finally) - addNames(names, this.finally.names); - return names; - } -} -class Catch extends BlockNode { - constructor(error) { - super(); - this.error = error; - } - render(opts) { - return `catch(${this.error})` + super.render(opts); - } -} -Catch.kind = "catch"; -class Finally extends BlockNode { - render(opts) { - return "finally" + super.render(opts); - } -} -Finally.kind = "finally"; -class CodeGen { - constructor(extScope, opts = {}) { - this._values = {}; - this._blockStarts = []; - this._constants = {}; - this.opts = { ...opts, _n: opts.lines ? "\n" : "" }; - this._extScope = extScope; - this._scope = new scope_1.Scope({ parent: extScope }); - this._nodes = [new Root()]; - } - toString() { - return this._root.render(this.opts); - } - // returns unique name in the internal scope - name(prefix) { - return this._scope.name(prefix); - } - // reserves unique name in the external scope - scopeName(prefix) { - return this._extScope.name(prefix); - } - // reserves unique name in the external scope and assigns value to it - scopeValue(prefixOrName, value) { - const name = this._extScope.value(prefixOrName, value); - const vs = this._values[name.prefix] || (this._values[name.prefix] = new Set()); - vs.add(name); - return name; - } - getScopeValue(prefix, keyOrRef) { - return this._extScope.getValue(prefix, keyOrRef); - } - // return code that assigns values in the external scope to the names that are used internally - // (same names that were returned by gen.scopeName or gen.scopeValue) - scopeRefs(scopeName) { - return this._extScope.scopeRefs(scopeName, this._values); - } - scopeCode() { - return this._extScope.scopeCode(this._values); - } - _def(varKind, nameOrPrefix, rhs, constant) { - const name = this._scope.toName(nameOrPrefix); - if (rhs !== undefined && constant) - this._constants[name.str] = rhs; - this._leafNode(new Def(varKind, name, rhs)); - return name; - } - // `const` declaration (`var` in es5 mode) - const(nameOrPrefix, rhs, _constant) { - return this._def(scope_1.varKinds.const, nameOrPrefix, rhs, _constant); - } - // `let` declaration with optional assignment (`var` in es5 mode) - let(nameOrPrefix, rhs, _constant) { - return this._def(scope_1.varKinds.let, nameOrPrefix, rhs, _constant); - } - // `var` declaration with optional assignment - var(nameOrPrefix, rhs, _constant) { - return this._def(scope_1.varKinds.var, nameOrPrefix, rhs, _constant); - } - // assignment code - assign(lhs, rhs, sideEffects) { - return this._leafNode(new Assign(lhs, rhs, sideEffects)); + async _deletePage(job) { + this._logger.debug(`Deleting page ${job.task.pageId}`); + const confluencePage = await this._confluenceClient.getPage(job.task.pageId); + for (const descendant of confluencePage.children ?? []) { + job.enqueueTask({ type: "delete", pageId: descendant.id }); + } + await this._confluenceClient.deleteContent(job.task.pageId); } - // `+=` code - add(lhs, rhs) { - return this._leafNode(new AssignOp(lhs, exports.operators.ADD, rhs)); + async _deleteAttachments(job) { + this._logger.debug(`Deleting attachment ${job.task.pageId}`); + await this._confluenceClient.deleteContent(job.task.pageId); } - // appends passed SafeExpr to code or executes Block - code(c) { - if (typeof c == "function") - c(); - else if (c !== code_1.nil) - this._leafNode(new AnyCode(c)); - return this; + async _createAttachments(job) { + this._logger.debug(`Creating attachments for page ${job.task.pageTitle}, attachments: ${JSON.stringify(job.task.attachments)}`); + const attachments = await Promise.all(Object.entries(job.task.attachments).map(async ([name, path]) => ({ + filename: name, + file: await (0, promises_1.readFile)(path), + }))); + await this._confluenceClient.createAttachments(job.task.pageId, attachments); } - // returns code for object literal for the passed argument list of key-value pairs - object(...keyValues) { - const code = ["{"]; - for (const [key, value] of keyValues) { - if (code.length > 1) - code.push(","); - code.push(key); - if (key !== value || this.opts.es5) { - code.push(":"); - (0, code_1.addCodeArg)(code, value); + _enqueueChildrenPages(job, confluencePage, isRoot = false) { + const descendants = job.getPagesByAncestor(confluencePage.title, isRoot); + const confluenceDescendants = confluencePage.children ?? []; + let descendantsWithPageId = []; + if (isRoot) { + descendants.forEach((descendant) => { + descendant.ancestors = [confluencePage.title]; + }); + if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { + const confluenceDescendantsInputPages = confluenceDescendants + .map(({ title }) => job.getPageByTitle(title)) + .filter(Boolean); + descendantsWithPageId = (0, Pages_1.getPagesTitles)(confluenceDescendantsInputPages.filter((page) => page.id !== undefined)); + if (descendantsWithPageId.length) + this._logger.warn(`Some children of root page contains id: ${descendantsWithPageId.join(", ")}`); } } - code.push("}"); - return new code_1._Code(code); - } - // `if` clause (or statement if `thenBody` and, optionally, `elseBody` are passed) - if(condition, thenBody, elseBody) { - this._blockNode(new If(condition)); - if (thenBody && elseBody) { - this.code(thenBody).else().code(elseBody).endIf(); + const descendantsToCreate = descendants.filter((descendant) => !confluenceDescendants.some((other) => other.title === descendant.title)); + const descendantsToUpdate = confluenceDescendants + .filter((descendant) => descendants.some((other) => other.title === descendant.title)) + .map((descendant) => { + const page = job.getPageByTitle(descendant.title); + return { pageId: descendant.id, page }; + }); + const descendantsToDelete = confluenceDescendants.filter((descendant) => !descendants.some((other) => other.title === descendant.title) && + !descendantsWithPageId.includes(descendant.title)); + for (const descendant of descendantsToDelete) { + job.enqueueTask({ type: "delete", pageId: descendant.id }); } - else if (thenBody) { - this.code(thenBody).endIf(); + for (const descendant of descendantsToCreate) { + job.enqueueTask({ type: "create", page: descendant }); } - else if (elseBody) { - throw new Error('CodeGen: "else" body without "then" body'); + for (const descendant of descendantsToUpdate) { + job.enqueueTask({ + type: "update", + pageId: descendant.pageId, + page: descendant.page, + }); } - return this; - } - // `else if` clause - invalid without `if` or after `else` clauses - elseIf(condition) { - return this._elseNode(new If(condition)); - } - // `else` clause - only valid after `if` or `else if` clauses - else() { - return this._elseNode(new Else()); - } - // end `if` statement (needed if gen.if was used only with condition) - endIf() { - return this._endBlockNode(If, Else); - } - _for(node, forBody) { - this._blockNode(node); - if (forBody) - this.code(forBody).endFor(); - return this; } - // a generic `for` clause (or statement if `forBody` is passed) - for(iteration, forBody) { - return this._for(new ForLoop(iteration), forBody); +}; +exports.ConfluenceSyncPages = ConfluenceSyncPages; + + +/***/ }), + +/***/ 92041: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SyncModes = void 0; +var SyncModes; +(function (SyncModes) { + SyncModes["TREE"] = "tree"; + SyncModes["FLAT"] = "flat"; + SyncModes["ID"] = "id"; +})(SyncModes || (exports.SyncModes = SyncModes = {})); + + +/***/ }), + +/***/ 46716: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.CustomConfluenceClient = void 0; +const confluence_js_1 = __nccwpck_require__(13637); +const AttachmentsNotFoundError_1 = __nccwpck_require__(89273); +const AxiosErrors_1 = __nccwpck_require__(47507); +const CreateAttachmentsError_1 = __nccwpck_require__(24176); +const CreatePageError_1 = __nccwpck_require__(68325); +const DeletePageError_1 = __nccwpck_require__(80436); +const PageNotFoundError_1 = __nccwpck_require__(87644); +const UpdatePageError_1 = __nccwpck_require__(61306); +const CustomConfluenceClient = class CustomConfluenceClient { + _config; + _client; + _logger; + constructor(config) { + this._config = config; + this._client = new confluence_js_1.ConfluenceClient({ + host: config.url, + authentication: { + personalAccessToken: config.personalAccessToken, + }, + apiPrefix: "/rest/", + }); + this._logger = config.logger; } - // `for` statement for a range of values - forRange(nameOrPrefix, from, to, forBody, varKind = this.opts.es5 ? scope_1.varKinds.var : scope_1.varKinds.let) { - const name = this._scope.toName(nameOrPrefix); - return this._for(new ForRange(varKind, name, from, to), () => forBody(name)); + // Exposed mainly for testing purposes + get logger() { + return this._logger; } - // `for-of` statement (in es5 mode replace with a normal for loop) - forOf(nameOrPrefix, iterable, forBody, varKind = scope_1.varKinds.const) { - const name = this._scope.toName(nameOrPrefix); - if (this.opts.es5) { - const arr = iterable instanceof code_1.Name ? iterable : this.var("_arr", iterable); - return this.forRange("_i", 0, (0, code_1._) `${arr}.length`, (i) => { - this.var(name, (0, code_1._) `${arr}[${i}]`); - forBody(name); + async getPage(id) { + try { + this._logger.silly(`Getting page with id ${id}`); + const response = await this._client.content.getContentById({ + id, + expand: ["ancestors", "version.number", "children.page"], }); + this._logger.silly(`Get page response: ${JSON.stringify(response, null, 2)}`); + return { + title: response.title, + id: response.id, + version: response.version?.number, + ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), + children: response.children?.page?.results?.map((child) => this._convertToConfluencePageBasicInfo(child)), + }; } - return this._for(new ForIter("of", varKind, name, iterable), () => forBody(name)); - } - // `for-in` statement. - // With option `ownProperties` replaced with a `for-of` loop for object keys - forIn(nameOrPrefix, obj, forBody, varKind = this.opts.es5 ? scope_1.varKinds.var : scope_1.varKinds.const) { - if (this.opts.ownProperties) { - return this.forOf(nameOrPrefix, (0, code_1._) `Object.keys(${obj})`, forBody); + catch (error) { + throw new PageNotFoundError_1.PageNotFoundError(id, { cause: error }); } - const name = this._scope.toName(nameOrPrefix); - return this._for(new ForIter("in", varKind, name, obj), () => forBody(name)); } - // end `for` loop - endFor() { - return this._endBlockNode(For); - } - // `label` statement - label(label) { - return this._leafNode(new Label(label)); - } - // `break` statement - break(label) { - return this._leafNode(new Break(label)); - } - // `return` statement - return(value) { - const node = new Return(); - this._blockNode(node); - this.code(value); - if (node.nodes.length !== 1) - throw new Error('CodeGen: "return" should have one node'); - return this._endBlockNode(Return); - } - // `try` statement - try(tryBody, catchCode, finallyCode) { - if (!catchCode && !finallyCode) - throw new Error('CodeGen: "try" without "catch" and "finally"'); - const node = new Try(); - this._blockNode(node); - this.code(tryBody); - if (catchCode) { - const error = this.name("e"); - this._currNode = node.catch = new Catch(error); - catchCode(error); + async createPage({ title, content, ancestors, }) { + if (!this._config.dryRun) { + const createContentBody = { + type: "page", + title, + space: { + key: this._config.spaceId, + }, + ancestors: this.handleAncestors(ancestors), + body: { + storage: { + value: content || "", + representation: "storage", + }, + }, + }; + try { + this._logger.silly(`Creating page with title ${title}`); + const response = await this._client.content.createContent(createContentBody); + this._logger.silly(`Create page response: ${JSON.stringify(response, null, 2)}`); + return { + title: response.title, + id: response.id, + version: response.version?.number, + ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), + }; + } + catch (e) { + const error = (0, AxiosErrors_1.toConfluenceClientError)(e); + throw new CreatePageError_1.CreatePageError(title, { cause: error }); + } } - if (finallyCode) { - this._currNode = node.finally = new Finally(); - this.code(finallyCode); + else { + this._logger.info(`Dry run: creating page with title ${title}`); + return { + title, + id: "1234", + version: 1, + ancestors, + }; } - return this._endBlockNode(Catch, Finally); - } - // `throw` statement - throw(error) { - return this._leafNode(new Throw(error)); - } - // start self-balancing block - block(body, nodeCount) { - this._blockStarts.push(this._nodes.length); - if (body) - this.code(body).endBlock(nodeCount); - return this; } - // end the current self-balancing block - endBlock(nodeCount) { - const len = this._blockStarts.pop(); - if (len === undefined) - throw new Error("CodeGen: not in self-balancing block"); - const toClose = this._nodes.length - len; - if (toClose < 0 || (nodeCount !== undefined && toClose !== nodeCount)) { - throw new Error(`CodeGen: wrong number of nodes: ${toClose} vs ${nodeCount} expected`); + async updatePage({ id, title, content, version, ancestors, }) { + if (!this._config.dryRun) { + const updateContentBody = { + id, + type: "page", + title, + ancestors: this.handleAncestors(ancestors), + version: { + number: version, + }, + body: { + storage: { + value: content || "", + representation: "storage", + }, + }, + }; + try { + this._logger.silly(`Updating page with title ${title}`); + const response = await this._client.content.updateContent(updateContentBody); + this._logger.silly(`Update page response: ${JSON.stringify(response, null, 2)}`); + return { + title: response.title, + id: response.id, + version: response.version?.number, + ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), + }; + } + catch (e) { + const error = (0, AxiosErrors_1.toConfluenceClientError)(e); + throw new UpdatePageError_1.UpdatePageError(id, title, { cause: error }); + } } - this._nodes.length = len; - return this; - } - // `function` heading (or definition if funcBody is passed) - func(name, args = code_1.nil, async, funcBody) { - this._blockNode(new Func(name, args, async)); - if (funcBody) - this.code(funcBody).endFunc(); - return this; - } - // end function definition - endFunc() { - return this._endBlockNode(Func); - } - optimize(n = 1) { - while (n-- > 0) { - this._root.optimizeNodes(); - this._root.optimizeNames(this._root.names, this._constants); + else { + this._logger.info(`Dry run: updating page with title ${title}`); + return { + title, + id, + version, + ancestors, + }; } } - _leafNode(node) { - this._currNode.nodes.push(node); - return this; - } - _blockNode(node) { - this._currNode.nodes.push(node); - this._nodes.push(node); - } - _endBlockNode(N1, N2) { - const n = this._currNode; - if (n instanceof N1 || (N2 && n instanceof N2)) { - this._nodes.pop(); - return this; + async deleteContent(id) { + if (!this._config.dryRun) { + try { + this._logger.silly(`Deleting content with id ${id}`); + await this._client.content.deleteContent({ id }); + } + catch (error) { + throw new DeletePageError_1.DeletePageError(id, { cause: error }); + } } - throw new Error(`CodeGen: not in block "${N2 ? `${N1.kind}/${N2.kind}` : N1.kind}"`); - } - _elseNode(node) { - const n = this._currNode; - if (!(n instanceof If)) { - throw new Error('CodeGen: "else" without "if"'); + else { + this._logger.info(`Dry run: deleting content with id ${id}`); } - this._currNode = n.else = node; - return this; } - get _root() { - return this._nodes[0]; + async getAttachments(id) { + try { + this._logger.silly(`Getting attachments of page with id ${id}`); + const response = await this._client.contentAttachments.getAttachments({ + id, + }); + this._logger.silly(`Get attachments response: ${JSON.stringify(response, null, 2)}`); + return (response.results?.map((attachment) => ({ + id: attachment.id, + title: attachment.title, + })) || []); + } + catch (error) { + throw new AttachmentsNotFoundError_1.AttachmentsNotFoundError(id, { cause: error }); + } } - get _currNode() { - const ns = this._nodes; - return ns[ns.length - 1]; + async createAttachments(id, attachments) { + if (!this._config.dryRun) { + try { + const bodyRequest = attachments.map((attachment) => ({ + minorEdit: true, + ...attachment, + })); + this._logger.silly(`Creating attachments of page with id ${id}, attachments: ${attachments + .map((attachment) => attachment.filename) + .join(", ")}`); + const response = await this._client.contentAttachments.createAttachments({ + id, + attachments: bodyRequest, + }); + this._logger.silly(`Create attachments response: ${JSON.stringify(response, null, 2)}`); + } + catch (error) { + throw new CreateAttachmentsError_1.CreateAttachmentsError(id, { cause: error }); + } + } + else { + this._logger + .info(`Dry run: creating attachments of page with id ${id}, attachments: ${attachments + .map((attachment) => attachment.filename) + .join(", ")} + `); + } } - set _currNode(node) { - const ns = this._nodes; - ns[ns.length - 1] = node; + handleAncestors(ancestors) { + if (ancestors && ancestors.length) { + const id = ancestors.at(-1)?.id; + return [{ id }]; + } + else { + return undefined; + } } -} -exports.CodeGen = CodeGen; -function addNames(names, from) { - for (const n in from) - names[n] = (names[n] || 0) + (from[n] || 0); - return names; -} -function addExprNames(names, from) { - return from instanceof code_1._CodeOrName ? addNames(names, from.names) : names; -} -function optimizeExpr(expr, names, constants) { - if (expr instanceof code_1.Name) - return replaceName(expr); - if (!canOptimize(expr)) - return expr; - return new code_1._Code(expr._items.reduce((items, c) => { - if (c instanceof code_1.Name) - c = replaceName(c); - if (c instanceof code_1._Code) - items.push(...c._items); - else - items.push(c); - return items; - }, [])); - function replaceName(n) { - const c = constants[n.str]; - if (c === undefined || names[n.str] !== 1) - return n; - delete names[n.str]; - return c; + _convertToConfluencePageBasicInfo(rawInfo) { + return { + id: rawInfo.id, + title: rawInfo.title, + }; } - function canOptimize(e) { - return (e instanceof code_1._Code && - e._items.some((c) => c instanceof code_1.Name && names[c.str] === 1 && constants[c.str] !== undefined)); +}; +exports.CustomConfluenceClient = CustomConfluenceClient; + + +/***/ }), + +/***/ 19423: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); + + +/***/ }), + +/***/ 89273: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.AttachmentsNotFoundError = void 0; +class AttachmentsNotFoundError extends Error { + constructor(id, options) { + super(`Error getting attachments of page with id ${id}: ${options?.cause}`, options); } } -function subtractNames(names, from) { - for (const n in from) - names[n] = (names[n] || 0) - (from[n] || 0); -} -function not(x) { - return typeof x == "boolean" || typeof x == "number" || x === null ? !x : (0, code_1._) `!${par(x)}`; -} -exports.not = not; -const andCode = mappend(exports.operators.AND); -// boolean AND (&&) expression with the passed arguments -function and(...args) { - return args.reduce(andCode); -} -exports.and = and; -const orCode = mappend(exports.operators.OR); -// boolean OR (||) expression with the passed arguments -function or(...args) { - return args.reduce(orCode); -} -exports.or = or; -function mappend(op) { - return (x, y) => (x === code_1.nil ? y : y === code_1.nil ? x : (0, code_1._) `${par(x)} ${op} ${par(y)}`); -} -function par(x) { - return x instanceof code_1.Name ? x : (0, code_1._) `(${x})`; -} -//# sourceMappingURL=index.js.map +exports.AttachmentsNotFoundError = AttachmentsNotFoundError; + /***/ }), -/***/ 92348: +/***/ 47507: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ValueScope = exports.ValueScopeName = exports.Scope = exports.varKinds = exports.UsedValueState = void 0; -const code_1 = __nccwpck_require__(49847); -class ValueError extends Error { - constructor(name) { - super(`CodeGen: "code" for ${name} not defined`); - this.value = name.value; - } -} -var UsedValueState; -(function (UsedValueState) { - UsedValueState[UsedValueState["Started"] = 0] = "Started"; - UsedValueState[UsedValueState["Completed"] = 1] = "Completed"; -})(UsedValueState = exports.UsedValueState || (exports.UsedValueState = {})); -exports.varKinds = { - const: new code_1.Name("const"), - let: new code_1.Name("let"), - var: new code_1.Name("var"), -}; -class Scope { - constructor({ prefixes, parent } = {}) { - this._names = {}; - this._prefixes = prefixes; - this._parent = parent; - } - toName(nameOrPrefix) { - return nameOrPrefix instanceof code_1.Name ? nameOrPrefix : this.name(nameOrPrefix); - } - name(prefix) { - return new code_1.Name(this._newName(prefix)); - } - _newName(prefix) { - const ng = this._names[prefix] || this._nameGroup(prefix); - return `${prefix}${ng.index++}`; - } - _nameGroup(prefix) { - var _a, _b; - if (((_b = (_a = this._parent) === null || _a === void 0 ? void 0 : _a._prefixes) === null || _b === void 0 ? void 0 : _b.has(prefix)) || (this._prefixes && !this._prefixes.has(prefix))) { - throw new Error(`CodeGen: prefix "${prefix}" is not allowed in this scope`); - } - return (this._names[prefix] = { prefix, index: 0 }); - } -} -exports.Scope = Scope; -class ValueScopeName extends code_1.Name { - constructor(prefix, nameStr) { - super(nameStr); - this.prefix = prefix; - } - setValue(value, { property, itemIndex }) { - this.value = value; - this.scopePath = (0, code_1._) `.${new code_1.Name(property)}[${itemIndex}]`; - } -} -exports.ValueScopeName = ValueScopeName; -const line = (0, code_1._) `\n`; -class ValueScope extends Scope { - constructor(opts) { - super(opts); - this._values = {}; - this._scope = opts.scope; - this.opts = { ...opts, _n: opts.lines ? line : code_1.nil }; - } - get() { - return this._scope; - } - name(prefix) { - return new ValueScopeName(prefix, this._newName(prefix)); - } - value(nameOrPrefix, value) { - var _a; - if (value.ref === undefined) - throw new Error("CodeGen: ref must be passed in value"); - const name = this.toName(nameOrPrefix); - const { prefix } = name; - const valueKey = (_a = value.key) !== null && _a !== void 0 ? _a : value.ref; - let vs = this._values[prefix]; - if (vs) { - const _name = vs.get(valueKey); - if (_name) - return _name; +exports.toConfluenceClientError = toConfluenceClientError; +const axios_1 = __nccwpck_require__(31545); +const BadRequestError_1 = __nccwpck_require__(63605); +const InternalServerError_1 = __nccwpck_require__(17791); +const UnauthorizedError_1 = __nccwpck_require__(17039); +const UnexpectedError_1 = __nccwpck_require__(65104); +const UnknownAxiosError_1 = __nccwpck_require__(72433); +function toConfluenceClientError(error) { + if (error.name === "AxiosError") { + const axiosError = error; + if (axiosError.response?.status === axios_1.HttpStatusCode.BadRequest) { + return new BadRequestError_1.BadRequestError(axiosError); } - else { - vs = this._values[prefix] = new Map(); + if (axiosError.response?.status === axios_1.HttpStatusCode.Unauthorized || + axiosError.response?.status === axios_1.HttpStatusCode.Forbidden) { + return new UnauthorizedError_1.UnauthorizedError(axiosError); } - vs.set(valueKey, name); - const s = this._scope[prefix] || (this._scope[prefix] = []); - const itemIndex = s.length; - s[itemIndex] = value.ref; - name.setValue(value, { property: prefix, itemIndex }); - return name; - } - getValue(prefix, keyOrRef) { - const vs = this._values[prefix]; - if (!vs) - return; - return vs.get(keyOrRef); - } - scopeRefs(scopeName, values = this._values) { - return this._reduceValues(values, (name) => { - if (name.scopePath === undefined) - throw new Error(`CodeGen: name "${name}" has no value`); - return (0, code_1._) `${scopeName}${name.scopePath}`; - }); - } - scopeCode(values = this._values, usedValues, getCode) { - return this._reduceValues(values, (name) => { - if (name.value === undefined) - throw new Error(`CodeGen: name "${name}" has no value`); - return name.value.code; - }, usedValues, getCode); - } - _reduceValues(values, valueCode, usedValues = {}, getCode) { - let code = code_1.nil; - for (const prefix in values) { - const vs = values[prefix]; - if (!vs) - continue; - const nameSet = (usedValues[prefix] = usedValues[prefix] || new Map()); - vs.forEach((name) => { - if (nameSet.has(name)) - return; - nameSet.set(name, UsedValueState.Started); - let c = valueCode(name); - if (c) { - const def = this.opts.es5 ? exports.varKinds.var : exports.varKinds.const; - code = (0, code_1._) `${code}${def} ${name} = ${c};${this.opts._n}`; - } - else if ((c = getCode === null || getCode === void 0 ? void 0 : getCode(name))) { - code = (0, code_1._) `${code}${c}${this.opts._n}`; - } - else { - throw new ValueError(name); - } - nameSet.set(name, UsedValueState.Completed); - }); + if (axiosError.response?.status === axios_1.HttpStatusCode.InternalServerError) { + return new InternalServerError_1.InternalServerError(axiosError); } - return code; + return new UnknownAxiosError_1.UnknownAxiosError(axiosError); } + return new UnexpectedError_1.UnexpectedError(error); } -exports.ValueScope = ValueScope; -//# sourceMappingURL=scope.js.map + /***/ }), -/***/ 75779: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 24176: +/***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.extendErrors = exports.resetErrorsCount = exports.reportExtraError = exports.reportError = exports.keyword$DataError = exports.keywordError = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const names_1 = __nccwpck_require__(66662); -exports.keywordError = { - message: ({ keyword }) => (0, codegen_1.str) `must pass "${keyword}" keyword validation`, -}; -exports.keyword$DataError = { - message: ({ keyword, schemaType }) => schemaType - ? (0, codegen_1.str) `"${keyword}" keyword must be ${schemaType} ($data)` - : (0, codegen_1.str) `"${keyword}" keyword is invalid ($data)`, -}; -function reportError(cxt, error = exports.keywordError, errorPaths, overrideAllErrors) { - const { it } = cxt; - const { gen, compositeRule, allErrors } = it; - const errObj = errorObjectCode(cxt, error, errorPaths); - if (overrideAllErrors !== null && overrideAllErrors !== void 0 ? overrideAllErrors : (compositeRule || allErrors)) { - addError(gen, errObj); - } - else { - returnErrors(it, (0, codegen_1._) `[${errObj}]`); +exports.CreateAttachmentsError = void 0; +class CreateAttachmentsError extends Error { + constructor(id, options) { + super(`Error creating attachments of page with id ${id}: ${options?.cause}`, options); } } -exports.reportError = reportError; -function reportExtraError(cxt, error = exports.keywordError, errorPaths) { - const { it } = cxt; - const { gen, compositeRule, allErrors } = it; - const errObj = errorObjectCode(cxt, error, errorPaths); - addError(gen, errObj); - if (!(compositeRule || allErrors)) { - returnErrors(it, names_1.default.vErrors); +exports.CreateAttachmentsError = CreateAttachmentsError; + + +/***/ }), + +/***/ 68325: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.CreatePageError = void 0; +class CreatePageError extends Error { + constructor(title, options) { + super(`Error creating page with title ${title}: ${options?.cause}`, options); } } -exports.reportExtraError = reportExtraError; -function resetErrorsCount(gen, errsCount) { - gen.assign(names_1.default.errors, errsCount); - gen.if((0, codegen_1._) `${names_1.default.vErrors} !== null`, () => gen.if(errsCount, () => gen.assign((0, codegen_1._) `${names_1.default.vErrors}.length`, errsCount), () => gen.assign(names_1.default.vErrors, null))); -} -exports.resetErrorsCount = resetErrorsCount; -function extendErrors({ gen, keyword, schemaValue, data, errsCount, it, }) { - /* istanbul ignore if */ - if (errsCount === undefined) - throw new Error("ajv implementation error"); - const err = gen.name("err"); - gen.forRange("i", errsCount, names_1.default.errors, (i) => { - gen.const(err, (0, codegen_1._) `${names_1.default.vErrors}[${i}]`); - gen.if((0, codegen_1._) `${err}.instancePath === undefined`, () => gen.assign((0, codegen_1._) `${err}.instancePath`, (0, codegen_1.strConcat)(names_1.default.instancePath, it.errorPath))); - gen.assign((0, codegen_1._) `${err}.schemaPath`, (0, codegen_1.str) `${it.errSchemaPath}/${keyword}`); - if (it.opts.verbose) { - gen.assign((0, codegen_1._) `${err}.schema`, schemaValue); - gen.assign((0, codegen_1._) `${err}.data`, data); - } - }); -} -exports.extendErrors = extendErrors; -function addError(gen, errObj) { - const err = gen.const("err", errObj); - gen.if((0, codegen_1._) `${names_1.default.vErrors} === null`, () => gen.assign(names_1.default.vErrors, (0, codegen_1._) `[${err}]`), (0, codegen_1._) `${names_1.default.vErrors}.push(${err})`); - gen.code((0, codegen_1._) `${names_1.default.errors}++`); -} -function returnErrors(it, errs) { - const { gen, validateName, schemaEnv } = it; - if (schemaEnv.$async) { - gen.throw((0, codegen_1._) `new ${it.ValidationError}(${errs})`); - } - else { - gen.assign((0, codegen_1._) `${validateName}.errors`, errs); - gen.return(false); +exports.CreatePageError = CreatePageError; + + +/***/ }), + +/***/ 80436: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.DeletePageError = void 0; +class DeletePageError extends Error { + constructor(id, options) { + super(`Error deleting content with id ${id}: ${options?.cause}`, options); } } -const E = { - keyword: new codegen_1.Name("keyword"), - schemaPath: new codegen_1.Name("schemaPath"), - params: new codegen_1.Name("params"), - propertyName: new codegen_1.Name("propertyName"), - message: new codegen_1.Name("message"), - schema: new codegen_1.Name("schema"), - parentSchema: new codegen_1.Name("parentSchema"), -}; -function errorObjectCode(cxt, error, errorPaths) { - const { createErrors } = cxt.it; - if (createErrors === false) - return (0, codegen_1._) `{}`; - return errorObject(cxt, error, errorPaths); -} -function errorObject(cxt, error, errorPaths = {}) { - const { gen, it } = cxt; - const keyValues = [ - errorInstancePath(it, errorPaths), - errorSchemaPath(cxt, errorPaths), - ]; - extraErrorProps(cxt, error, keyValues); - return gen.object(...keyValues); -} -function errorInstancePath({ errorPath }, { instancePath }) { - const instPath = instancePath - ? (0, codegen_1.str) `${errorPath}${(0, util_1.getErrorPath)(instancePath, util_1.Type.Str)}` - : errorPath; - return [names_1.default.instancePath, (0, codegen_1.strConcat)(names_1.default.instancePath, instPath)]; -} -function errorSchemaPath({ keyword, it: { errSchemaPath } }, { schemaPath, parentSchema }) { - let schPath = parentSchema ? errSchemaPath : (0, codegen_1.str) `${errSchemaPath}/${keyword}`; - if (schemaPath) { - schPath = (0, codegen_1.str) `${schPath}${(0, util_1.getErrorPath)(schemaPath, util_1.Type.Str)}`; +exports.DeletePageError = DeletePageError; + + +/***/ }), + +/***/ 87644: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PageNotFoundError = void 0; +class PageNotFoundError extends Error { + constructor(id, options) { + super(`Error getting page with id ${id}: ${options?.cause}`, options); } - return [E.schemaPath, schPath]; } -function extraErrorProps(cxt, { params, message }, keyValues) { - const { keyword, data, schemaValue, it } = cxt; - const { opts, propertyName, topSchemaRef, schemaPath } = it; - keyValues.push([E.keyword, keyword], [E.params, typeof params == "function" ? params(cxt) : params || (0, codegen_1._) `{}`]); - if (opts.messages) { - keyValues.push([E.message, typeof message == "function" ? message(cxt) : message]); - } - if (opts.verbose) { - keyValues.push([E.schema, schemaValue], [E.parentSchema, (0, codegen_1._) `${topSchemaRef}${schemaPath}`], [names_1.default.data, data]); +exports.PageNotFoundError = PageNotFoundError; + + +/***/ }), + +/***/ 61306: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.UpdatePageError = void 0; +class UpdatePageError extends Error { + constructor(id, title, options) { + super(`Error updating page with id ${id} and title ${title}: ${options?.cause}`, options); } - if (propertyName) - keyValues.push([E.propertyName, propertyName]); } -//# sourceMappingURL=errors.js.map +exports.UpdatePageError = UpdatePageError; + /***/ }), -/***/ 36222: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 63605: +/***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.resolveSchema = exports.getCompilingSchema = exports.resolveRef = exports.compileSchema = exports.SchemaEnv = void 0; -const codegen_1 = __nccwpck_require__(30972); -const validation_error_1 = __nccwpck_require__(71645); -const names_1 = __nccwpck_require__(66662); -const resolve_1 = __nccwpck_require__(7834); -const util_1 = __nccwpck_require__(87120); -const validate_1 = __nccwpck_require__(26345); -class SchemaEnv { - constructor(env) { - var _a; - this.refs = {}; - this.dynamicAnchors = {}; - let schema; - if (typeof env.schema == "object") - schema = env.schema; - this.schema = env.schema; - this.schemaId = env.schemaId; - this.root = env.root || this; - this.baseId = (_a = env.baseId) !== null && _a !== void 0 ? _a : (0, resolve_1.normalizeId)(schema === null || schema === void 0 ? void 0 : schema[env.schemaId || "$id"]); - this.schemaPath = env.schemaPath; - this.localRefs = env.localRefs; - this.meta = env.meta; - this.$async = schema === null || schema === void 0 ? void 0 : schema.$async; - this.refs = {}; - } -} -exports.SchemaEnv = SchemaEnv; -// let codeSize = 0 -// let nodeCount = 0 -// Compiles schema in SchemaEnv -function compileSchema(sch) { - // TODO refactor - remove compilations - const _sch = getCompilingSchema.call(this, sch); - if (_sch) - return _sch; - const rootId = (0, resolve_1.getFullPath)(this.opts.uriResolver, sch.root.baseId); // TODO if getFullPath removed 1 tests fails - const { es5, lines } = this.opts.code; - const { ownProperties } = this.opts; - const gen = new codegen_1.CodeGen(this.scope, { es5, lines, ownProperties }); - let _ValidationError; - if (sch.$async) { - _ValidationError = gen.scopeValue("Error", { - ref: validation_error_1.default, - code: (0, codegen_1._) `require("ajv/dist/runtime/validation_error").default`, - }); - } - const validateName = gen.scopeName("validate"); - sch.validateName = validateName; - const schemaCxt = { - gen, - allErrors: this.opts.allErrors, - data: names_1.default.data, - parentData: names_1.default.parentData, - parentDataProperty: names_1.default.parentDataProperty, - dataNames: [names_1.default.data], - dataPathArr: [codegen_1.nil], - dataLevel: 0, - dataTypes: [], - definedProperties: new Set(), - topSchemaRef: gen.scopeValue("schema", this.opts.code.source === true - ? { ref: sch.schema, code: (0, codegen_1.stringify)(sch.schema) } - : { ref: sch.schema }), - validateName, - ValidationError: _ValidationError, - schema: sch.schema, - schemaEnv: sch, - rootId, - baseId: sch.baseId || rootId, - schemaPath: codegen_1.nil, - errSchemaPath: sch.schemaPath || (this.opts.jtd ? "" : "#"), - errorPath: (0, codegen_1._) `""`, - opts: this.opts, - self: this, - }; - let sourceCode; - try { - this._compilations.add(sch); - (0, validate_1.validateFunctionCode)(schemaCxt); - gen.optimize(this.opts.code.optimize); - // gen.optimize(1) - const validateCode = gen.toString(); - sourceCode = `${gen.scopeRefs(names_1.default.scope)}return ${validateCode}`; - // console.log((codeSize += sourceCode.length), (nodeCount += gen.nodeCount)) - if (this.opts.code.process) - sourceCode = this.opts.code.process(sourceCode, sch); - // console.log("\n\n\n *** \n", sourceCode) - const makeValidate = new Function(`${names_1.default.self}`, `${names_1.default.scope}`, sourceCode); - const validate = makeValidate(this, this.scope.get()); - this.scope.value(validateName, { ref: validate }); - validate.errors = null; - validate.schema = sch.schema; - validate.schemaEnv = sch; - if (sch.$async) - validate.$async = true; - if (this.opts.code.source === true) { - validate.source = { validateName, validateCode, scopeValues: gen._values }; - } - if (this.opts.unevaluated) { - const { props, items } = schemaCxt; - validate.evaluated = { - props: props instanceof codegen_1.Name ? undefined : props, - items: items instanceof codegen_1.Name ? undefined : items, - dynamicProps: props instanceof codegen_1.Name, - dynamicItems: items instanceof codegen_1.Name, - }; - if (validate.source) - validate.source.evaluated = (0, codegen_1.stringify)(validate.evaluated); - } - sch.validate = validate; - return sch; - } - catch (e) { - delete sch.validate; - delete sch.validateName; - if (sourceCode) - this.logger.error("Error compiling schema, function code:", sourceCode); - // console.log("\n\n\n *** \n", sourceCode, this.opts) - throw e; - } - finally { - this._compilations.delete(sch); - } -} -exports.compileSchema = compileSchema; -function resolveRef(root, baseId, ref) { - var _a; - ref = (0, resolve_1.resolveUrl)(this.opts.uriResolver, baseId, ref); - const schOrFunc = root.refs[ref]; - if (schOrFunc) - return schOrFunc; - let _sch = resolve.call(this, root, ref); - if (_sch === undefined) { - const schema = (_a = root.localRefs) === null || _a === void 0 ? void 0 : _a[ref]; // TODO maybe localRefs should hold SchemaEnv - const { schemaId } = this.opts; - if (schema) - _sch = new SchemaEnv({ schema, schemaId, root, baseId }); - } - if (_sch === undefined) - return; - return (root.refs[ref] = inlineOrCompile.call(this, _sch)); -} -exports.resolveRef = resolveRef; -function inlineOrCompile(sch) { - if ((0, resolve_1.inlineRef)(sch.schema, this.opts.inlineRefs)) - return sch.schema; - return sch.validate ? sch : compileSchema.call(this, sch); -} -// Index of schema compilation in the currently compiled list -function getCompilingSchema(schEnv) { - for (const sch of this._compilations) { - if (sameSchemaEnv(sch, schEnv)) - return sch; - } -} -exports.getCompilingSchema = getCompilingSchema; -function sameSchemaEnv(s1, s2) { - return s1.schema === s2.schema && s1.root === s2.root && s1.baseId === s2.baseId; -} -// resolve and compile the references ($ref) -// TODO returns AnySchemaObject (if the schema can be inlined) or validation function -function resolve(root, // information about the root schema for the current schema -ref // reference to resolve -) { - let sch; - while (typeof (sch = this.refs[ref]) == "string") - ref = sch; - return sch || this.schemas[ref] || resolveSchema.call(this, root, ref); -} -// Resolve schema, its root and baseId -function resolveSchema(root, // root object with properties schema, refs TODO below SchemaEnv is assigned to it -ref // reference to resolve -) { - const p = this.opts.uriResolver.parse(ref); - const refPath = (0, resolve_1._getFullPath)(this.opts.uriResolver, p); - let baseId = (0, resolve_1.getFullPath)(this.opts.uriResolver, root.baseId, undefined); - // TODO `Object.keys(root.schema).length > 0` should not be needed - but removing breaks 2 tests - if (Object.keys(root.schema).length > 0 && refPath === baseId) { - return getJsonPointer.call(this, p, root); - } - const id = (0, resolve_1.normalizeId)(refPath); - const schOrRef = this.refs[id] || this.schemas[id]; - if (typeof schOrRef == "string") { - const sch = resolveSchema.call(this, root, schOrRef); - if (typeof (sch === null || sch === void 0 ? void 0 : sch.schema) !== "object") - return; - return getJsonPointer.call(this, p, sch); - } - if (typeof (schOrRef === null || schOrRef === void 0 ? void 0 : schOrRef.schema) !== "object") - return; - if (!schOrRef.validate) - compileSchema.call(this, schOrRef); - if (id === (0, resolve_1.normalizeId)(ref)) { - const { schema } = schOrRef; - const { schemaId } = this.opts; - const schId = schema[schemaId]; - if (schId) - baseId = (0, resolve_1.resolveUrl)(this.opts.uriResolver, baseId, schId); - return new SchemaEnv({ schema, schemaId, root, baseId }); - } - return getJsonPointer.call(this, p, schOrRef); -} -exports.resolveSchema = resolveSchema; -const PREVENT_SCOPE_CHANGE = new Set([ - "properties", - "patternProperties", - "enum", - "dependencies", - "definitions", -]); -function getJsonPointer(parsedRef, { baseId, schema, root }) { - var _a; - if (((_a = parsedRef.fragment) === null || _a === void 0 ? void 0 : _a[0]) !== "/") - return; - for (const part of parsedRef.fragment.slice(1).split("/")) { - if (typeof schema === "boolean") - return; - const partSchema = schema[(0, util_1.unescapeFragment)(part)]; - if (partSchema === undefined) - return; - schema = partSchema; - // TODO PREVENT_SCOPE_CHANGE could be defined in keyword def? - const schId = typeof schema === "object" && schema[this.opts.schemaId]; - if (!PREVENT_SCOPE_CHANGE.has(part) && schId) { - baseId = (0, resolve_1.resolveUrl)(this.opts.uriResolver, baseId, schId); - } - } - let env; - if (typeof schema != "boolean" && schema.$ref && !(0, util_1.schemaHasRulesButRef)(schema, this.RULES)) { - const $ref = (0, resolve_1.resolveUrl)(this.opts.uriResolver, baseId, schema.$ref); - env = resolveSchema.call(this, root, $ref); +exports.BadRequestError = void 0; +class BadRequestError extends Error { + constructor(error) { + super(`Bad Request + Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); } - // even though resolution failed we need to return SchemaEnv to throw exception - // so that compileAsync loads missing schema. - const { schemaId } = this.opts; - env = env || new SchemaEnv({ schema, schemaId, root, baseId }); - if (env.schema !== env.root.schema) - return env; - return undefined; } -//# sourceMappingURL=index.js.map +exports.BadRequestError = BadRequestError; + /***/ }), -/***/ 66662: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 17791: +/***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const names = { - // validation function arguments - data: new codegen_1.Name("data"), - // args passed from referencing schema - valCxt: new codegen_1.Name("valCxt"), - instancePath: new codegen_1.Name("instancePath"), - parentData: new codegen_1.Name("parentData"), - parentDataProperty: new codegen_1.Name("parentDataProperty"), - rootData: new codegen_1.Name("rootData"), - dynamicAnchors: new codegen_1.Name("dynamicAnchors"), - // function scoped variables - vErrors: new codegen_1.Name("vErrors"), - errors: new codegen_1.Name("errors"), - this: new codegen_1.Name("this"), - // "globals" - self: new codegen_1.Name("self"), - scope: new codegen_1.Name("scope"), - // JTD serialize/parse name for JSON string and position - json: new codegen_1.Name("json"), - jsonPos: new codegen_1.Name("jsonPos"), - jsonLen: new codegen_1.Name("jsonLen"), - jsonPart: new codegen_1.Name("jsonPart"), -}; -exports["default"] = names; -//# sourceMappingURL=names.js.map +exports.InternalServerError = void 0; +class InternalServerError extends Error { + constructor(error) { + super(`Internal Server Error + Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); + } +} +exports.InternalServerError = InternalServerError; + /***/ }), -/***/ 36938: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 17039: +/***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -const resolve_1 = __nccwpck_require__(7834); -class MissingRefError extends Error { - constructor(resolver, baseId, ref, msg) { - super(msg || `can't resolve reference ${ref} from id ${baseId}`); - this.missingRef = (0, resolve_1.resolveUrl)(resolver, baseId, ref); - this.missingSchema = (0, resolve_1.normalizeId)((0, resolve_1.getFullPath)(resolver, this.missingRef)); +exports.UnauthorizedError = void 0; +class UnauthorizedError extends Error { + constructor(error) { + super(`Unauthorized + Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); } } -exports["default"] = MissingRefError; -//# sourceMappingURL=ref_error.js.map +exports.UnauthorizedError = UnauthorizedError; + /***/ }), -/***/ 7834: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 65104: +/***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getSchemaRefs = exports.resolveUrl = exports.normalizeId = exports._getFullPath = exports.getFullPath = exports.inlineRef = void 0; -const util_1 = __nccwpck_require__(87120); -const equal = __nccwpck_require__(23430); -const traverse = __nccwpck_require__(8623); -// TODO refactor to use keyword definitions -const SIMPLE_INLINED = new Set([ - "type", - "format", - "pattern", - "maxLength", - "minLength", - "maxProperties", - "minProperties", - "maxItems", - "minItems", - "maximum", - "minimum", - "uniqueItems", - "multipleOf", - "required", - "enum", - "const", -]); -function inlineRef(schema, limit = true) { - if (typeof schema == "boolean") - return true; - if (limit === true) - return !hasRef(schema); - if (!limit) - return false; - return countKeys(schema) <= limit; -} -exports.inlineRef = inlineRef; -const REF_KEYWORDS = new Set([ - "$ref", - "$recursiveRef", - "$recursiveAnchor", - "$dynamicRef", - "$dynamicAnchor", -]); -function hasRef(schema) { - for (const key in schema) { - if (REF_KEYWORDS.has(key)) - return true; - const sch = schema[key]; - if (Array.isArray(sch) && sch.some(hasRef)) - return true; - if (typeof sch == "object" && hasRef(sch)) - return true; - } - return false; -} -function countKeys(schema) { - let count = 0; - for (const key in schema) { - if (key === "$ref") - return Infinity; - count++; - if (SIMPLE_INLINED.has(key)) - continue; - if (typeof schema[key] == "object") { - (0, util_1.eachItem)(schema[key], (sch) => (count += countKeys(sch))); - } - if (count === Infinity) - return Infinity; - } - return count; -} -function getFullPath(resolver, id = "", normalize) { - if (normalize !== false) - id = normalizeId(id); - const p = resolver.parse(id); - return _getFullPath(resolver, p); -} -exports.getFullPath = getFullPath; -function _getFullPath(resolver, p) { - const serialized = resolver.serialize(p); - return serialized.split("#")[0] + "#"; -} -exports._getFullPath = _getFullPath; -const TRAILING_SLASH_HASH = /#\/?$/; -function normalizeId(id) { - return id ? id.replace(TRAILING_SLASH_HASH, "") : ""; -} -exports.normalizeId = normalizeId; -function resolveUrl(resolver, baseId, id) { - id = normalizeId(id); - return resolver.resolve(baseId, id); -} -exports.resolveUrl = resolveUrl; -const ANCHOR = /^[a-z_][-a-z0-9._]*$/i; -function getSchemaRefs(schema, baseId) { - if (typeof schema == "boolean") - return {}; - const { schemaId, uriResolver } = this.opts; - const schId = normalizeId(schema[schemaId] || baseId); - const baseIds = { "": schId }; - const pathPrefix = getFullPath(uriResolver, schId, false); - const localRefs = {}; - const schemaRefs = new Set(); - traverse(schema, { allKeys: true }, (sch, jsonPtr, _, parentJsonPtr) => { - if (parentJsonPtr === undefined) - return; - const fullPath = pathPrefix + jsonPtr; - let baseId = baseIds[parentJsonPtr]; - if (typeof sch[schemaId] == "string") - baseId = addRef.call(this, sch[schemaId]); - addAnchor.call(this, sch.$anchor); - addAnchor.call(this, sch.$dynamicAnchor); - baseIds[jsonPtr] = baseId; - function addRef(ref) { - // eslint-disable-next-line @typescript-eslint/unbound-method - const _resolve = this.opts.uriResolver.resolve; - ref = normalizeId(baseId ? _resolve(baseId, ref) : ref); - if (schemaRefs.has(ref)) - throw ambiguos(ref); - schemaRefs.add(ref); - let schOrRef = this.refs[ref]; - if (typeof schOrRef == "string") - schOrRef = this.refs[schOrRef]; - if (typeof schOrRef == "object") { - checkAmbiguosRef(sch, schOrRef.schema, ref); - } - else if (ref !== normalizeId(fullPath)) { - if (ref[0] === "#") { - checkAmbiguosRef(sch, localRefs[ref], ref); - localRefs[ref] = sch; - } - else { - this.refs[ref] = fullPath; - } - } - return ref; - } - function addAnchor(anchor) { - if (typeof anchor == "string") { - if (!ANCHOR.test(anchor)) - throw new Error(`invalid anchor "${anchor}"`); - addRef.call(this, `#${anchor}`); - } - } - }); - return localRefs; - function checkAmbiguosRef(sch1, sch2, ref) { - if (sch2 !== undefined && !equal(sch1, sch2)) - throw ambiguos(ref); - } - function ambiguos(ref) { - return new Error(`reference "${ref}" resolves to more than one schema`); +exports.UnexpectedError = void 0; +class UnexpectedError extends Error { + constructor(error) { + super(`Unexpected Error: ${error}`); } } -exports.getSchemaRefs = getSchemaRefs; -//# sourceMappingURL=resolve.js.map +exports.UnexpectedError = UnexpectedError; + /***/ }), -/***/ 72537: +/***/ 72433: /***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getRules = exports.isJSONType = void 0; -const _jsonTypes = ["string", "number", "integer", "boolean", "null", "object", "array"]; -const jsonTypes = new Set(_jsonTypes); -function isJSONType(x) { - return typeof x == "string" && jsonTypes.has(x); -} -exports.isJSONType = isJSONType; -function getRules() { - const groups = { - number: { type: "number", rules: [] }, - string: { type: "string", rules: [] }, - array: { type: "array", rules: [] }, - object: { type: "object", rules: [] }, - }; - return { - types: { ...groups, integer: true, boolean: true, null: true }, - rules: [{ rules: [] }, groups.number, groups.string, groups.array, groups.object], - post: { rules: [] }, - all: {}, - keywords: {}, - }; +exports.UnknownAxiosError = void 0; +class UnknownAxiosError extends Error { + constructor(error) { + super(`Axios Error + Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); + } } -exports.getRules = getRules; -//# sourceMappingURL=rules.js.map +exports.UnknownAxiosError = UnknownAxiosError; + /***/ }), -/***/ 87120: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 22257: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.checkStrictMode = exports.getErrorPath = exports.Type = exports.useFunc = exports.setEvaluated = exports.evaluatedPropsToName = exports.mergeEvaluated = exports.eachItem = exports.unescapeJsonPointer = exports.escapeJsonPointer = exports.escapeFragment = exports.unescapeFragment = exports.schemaRefOrVal = exports.schemaHasRulesButRef = exports.schemaHasRules = exports.checkUnknownRules = exports.alwaysValidSchema = exports.toHash = void 0; -const codegen_1 = __nccwpck_require__(30972); -const code_1 = __nccwpck_require__(49847); -// TODO refactor to use Set -function toHash(arr) { - const hash = {}; - for (const item of arr) - hash[item] = true; - return hash; -} -exports.toHash = toHash; -function alwaysValidSchema(it, schema) { - if (typeof schema == "boolean") - return schema; - if (Object.keys(schema).length === 0) - return true; - checkUnknownRules(it, schema); - return !schemaHasRules(schema, it.self.RULES.all); -} -exports.alwaysValidSchema = alwaysValidSchema; -function checkUnknownRules(it, schema = it.schema) { - const { opts, self } = it; - if (!opts.strictSchema) - return; - if (typeof schema === "boolean") - return; - const rules = self.RULES.keywords; - for (const key in schema) { - if (!rules[key]) - checkStrictMode(it, `unknown keyword: "${key}"`); - } -} -exports.checkUnknownRules = checkUnknownRules; -function schemaHasRules(schema, rules) { - if (typeof schema == "boolean") - return !schema; - for (const key in schema) - if (rules[key]) - return true; - return false; -} -exports.schemaHasRules = schemaHasRules; -function schemaHasRulesButRef(schema, RULES) { - if (typeof schema == "boolean") - return !schema; - for (const key in schema) - if (key !== "$ref" && RULES.all[key]) - return true; - return false; -} -exports.schemaHasRulesButRef = schemaHasRulesButRef; -function schemaRefOrVal({ topSchemaRef, schemaPath }, schema, keyword, $data) { - if (!$data) { - if (typeof schema == "number" || typeof schema == "boolean") - return schema; - if (typeof schema == "string") - return (0, codegen_1._) `${schema}`; - } - return (0, codegen_1._) `${topSchemaRef}${schemaPath}${(0, codegen_1.getProperty)(keyword)}`; -} -exports.schemaRefOrVal = schemaRefOrVal; -function unescapeFragment(str) { - return unescapeJsonPointer(decodeURIComponent(str)); -} -exports.unescapeFragment = unescapeFragment; -function escapeFragment(str) { - return encodeURIComponent(escapeJsonPointer(str)); -} -exports.escapeFragment = escapeFragment; -function escapeJsonPointer(str) { - if (typeof str == "number") - return `${str}`; - return str.replace(/~/g, "~0").replace(/\//g, "~1"); -} -exports.escapeJsonPointer = escapeJsonPointer; -function unescapeJsonPointer(str) { - return str.replace(/~1/g, "/").replace(/~0/g, "~"); -} -exports.unescapeJsonPointer = unescapeJsonPointer; -function eachItem(xs, f) { - if (Array.isArray(xs)) { - for (const x of xs) - f(x); - } - else { - f(xs); +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } -} -exports.eachItem = eachItem; -function makeMergeEvaluated({ mergeNames, mergeToName, mergeValues, resultToName, }) { - return (gen, from, to, toName) => { - const res = to === undefined - ? from - : to instanceof codegen_1.Name - ? (from instanceof codegen_1.Name ? mergeNames(gen, from, to) : mergeToName(gen, from, to), to) - : from instanceof codegen_1.Name - ? (mergeToName(gen, to, from), from) - : mergeValues(from, to); - return toName === codegen_1.Name && !(res instanceof codegen_1.Name) ? resultToName(gen, res) : res; - }; -} -exports.mergeEvaluated = { - props: makeMergeEvaluated({ - mergeNames: (gen, from, to) => gen.if((0, codegen_1._) `${to} !== true && ${from} !== undefined`, () => { - gen.if((0, codegen_1._) `${from} === true`, () => gen.assign(to, true), () => gen.assign(to, (0, codegen_1._) `${to} || {}`).code((0, codegen_1._) `Object.assign(${to}, ${from})`)); - }), - mergeToName: (gen, from, to) => gen.if((0, codegen_1._) `${to} !== true`, () => { - if (from === true) { - gen.assign(to, true); - } - else { - gen.assign(to, (0, codegen_1._) `${to} || {}`); - setEvaluated(gen, to, from); - } - }), - mergeValues: (from, to) => (from === true ? true : { ...from, ...to }), - resultToName: evaluatedPropsToName, - }), - items: makeMergeEvaluated({ - mergeNames: (gen, from, to) => gen.if((0, codegen_1._) `${to} !== true && ${from} !== undefined`, () => gen.assign(to, (0, codegen_1._) `${from} === true ? true : ${to} > ${from} ? ${to} : ${from}`)), - mergeToName: (gen, from, to) => gen.if((0, codegen_1._) `${to} !== true`, () => gen.assign(to, from === true ? true : (0, codegen_1._) `${to} > ${from} ? ${to} : ${from}`)), - mergeValues: (from, to) => (from === true ? true : Math.max(from, to)), - resultToName: (gen, items) => gen.var("items", items), - }), + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __exportStar = (this && this.__exportStar) || function(m, exports) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); }; -function evaluatedPropsToName(gen, ps) { - if (ps === true) - return gen.var("props", true); - const props = gen.var("props", (0, codegen_1._) `{}`); - if (ps !== undefined) - setEvaluated(gen, props, ps); - return props; -} -exports.evaluatedPropsToName = evaluatedPropsToName; -function setEvaluated(gen, props, ps) { - Object.keys(ps).forEach((p) => gen.assign((0, codegen_1._) `${props}${(0, codegen_1.getProperty)(p)}`, true)); -} -exports.setEvaluated = setEvaluated; -const snippets = {}; -function useFunc(gen, f) { - return gen.scopeValue("func", { - ref: f, - code: snippets[f.code] || (snippets[f.code] = new code_1._Code(f.code)), - }); -} -exports.useFunc = useFunc; -var Type; -(function (Type) { - Type[Type["Num"] = 0] = "Num"; - Type[Type["Str"] = 1] = "Str"; -})(Type = exports.Type || (exports.Type = {})); -function getErrorPath(dataProp, dataPropType, jsPropertySyntax) { - // let path - if (dataProp instanceof codegen_1.Name) { - const isNumber = dataPropType === Type.Num; - return jsPropertySyntax - ? isNumber - ? (0, codegen_1._) `"[" + ${dataProp} + "]"` - : (0, codegen_1._) `"['" + ${dataProp} + "']"` - : isNumber - ? (0, codegen_1._) `"/" + ${dataProp}` - : (0, codegen_1._) `"/" + ${dataProp}.replace(/~/g, "~0").replace(/\\//g, "~1")`; // TODO maybe use global escapePointer - } - return jsPropertySyntax ? (0, codegen_1.getProperty)(dataProp).toString() : "/" + escapeJsonPointer(dataProp); -} -exports.getErrorPath = getErrorPath; -function checkStrictMode(it, msg, mode = it.opts.strictSchema) { - if (!mode) - return; - msg = `strict mode: ${msg}`; - if (mode === true) - throw new Error(msg); - it.self.logger.warn(msg); -} -exports.checkStrictMode = checkStrictMode; -//# sourceMappingURL=util.js.map +Object.defineProperty(exports, "__esModule", ({ value: true })); +__exportStar(__nccwpck_require__(19423), exports); + /***/ }), -/***/ 74780: +/***/ 59780: /***/ ((__unused_webpack_module, exports) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.shouldUseRule = exports.shouldUseGroup = exports.schemaHasRulesForType = void 0; -function schemaHasRulesForType({ schema, self }, type) { - const group = self.RULES.types[type]; - return group && group !== true && shouldUseGroup(schema, group); -} -exports.schemaHasRulesForType = schemaHasRulesForType; -function shouldUseGroup(schema, group) { - return group.rules.some((rule) => shouldUseRule(schema, rule)); -} -exports.shouldUseGroup = shouldUseGroup; -function shouldUseRule(schema, rule) { - var _a; - return (schema[rule.keyword] !== undefined || - ((_a = rule.definition.implements) === null || _a === void 0 ? void 0 : _a.some((kwd) => schema[kwd] !== undefined))); +exports.CompoundError = void 0; +class CompoundError extends Error { + errors; + constructor(...errors) { + super(errors.map((error) => error.message).join("\n")); + this.errors = errors; + } } -exports.shouldUseRule = shouldUseRule; -//# sourceMappingURL=applicability.js.map +exports.CompoundError = CompoundError; + /***/ }), -/***/ 2930: +/***/ 71617: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.boolOrEmptySchema = exports.topBoolOrEmptySchema = void 0; -const errors_1 = __nccwpck_require__(75779); -const codegen_1 = __nccwpck_require__(30972); -const names_1 = __nccwpck_require__(66662); -const boolError = { - message: "boolean schema is false", -}; -function topBoolOrEmptySchema(it) { - const { gen, schema, validateName } = it; - if (schema === false) { - falseSchemaError(it, false); - } - else if (typeof schema == "object" && schema.$async === true) { - gen.return(names_1.default.data); - } - else { - gen.assign((0, codegen_1._) `${validateName}.errors`, null); - gen.return(true); - } -} -exports.topBoolOrEmptySchema = topBoolOrEmptySchema; -function boolOrEmptySchema(it, valid) { - const { gen, schema } = it; - if (schema === false) { - gen.var(valid, false); // TODO var - falseSchemaError(it); - } - else { - gen.var(valid, true); // TODO var +exports.InvalidSyncModeException = void 0; +const ConfluenceSyncPages_types_1 = __nccwpck_require__(92041); +class InvalidSyncModeException extends Error { + constructor(syncMode, options) { + super(`Invalid sync mode "${syncMode}". Please use one of "${ConfluenceSyncPages_types_1.SyncModes.FLAT}", "${ConfluenceSyncPages_types_1.SyncModes.TREE}" or "${ConfluenceSyncPages_types_1.SyncModes.ID}"`, options); } } -exports.boolOrEmptySchema = boolOrEmptySchema; -function falseSchemaError(it, overrideAllErrors) { - const { gen, data } = it; - // TODO maybe some other interface should be used for non-keyword validation errors... - const cxt = { - gen, - keyword: "false schema", - data, - schema: false, - schemaCode: false, - schemaValue: false, - params: {}, - it, - }; - (0, errors_1.reportError)(cxt, boolError, undefined, overrideAllErrors); -} -//# sourceMappingURL=boolSchema.js.map +exports.InvalidSyncModeException = InvalidSyncModeException; + /***/ }), -/***/ 4701: +/***/ 68721: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.reportTypeError = exports.checkDataTypes = exports.checkDataType = exports.coerceAndCheckDataType = exports.getJSONTypes = exports.getSchemaTypes = exports.DataType = void 0; -const rules_1 = __nccwpck_require__(72537); -const applicability_1 = __nccwpck_require__(74780); -const errors_1 = __nccwpck_require__(75779); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -var DataType; -(function (DataType) { - DataType[DataType["Correct"] = 0] = "Correct"; - DataType[DataType["Wrong"] = 1] = "Wrong"; -})(DataType = exports.DataType || (exports.DataType = {})); -function getSchemaTypes(schema) { - const types = getJSONTypes(schema.type); - const hasNull = types.includes("null"); - if (hasNull) { - if (schema.nullable === false) - throw new Error("type: null contradicts nullable: false"); - } - else { - if (!types.length && schema.nullable !== undefined) { - throw new Error('"nullable" cannot be used without "type"'); - } - if (schema.nullable === true) - types.push("null"); - } - return types; -} -exports.getSchemaTypes = getSchemaTypes; -function getJSONTypes(ts) { - const types = Array.isArray(ts) ? ts : ts ? [ts] : []; - if (types.every(rules_1.isJSONType)) - return types; - throw new Error("type must be JSONType or JSONType[]: " + types.join(",")); -} -exports.getJSONTypes = getJSONTypes; -function coerceAndCheckDataType(it, types) { - const { gen, data, opts } = it; - const coerceTo = coerceToTypes(types, opts.coerceTypes); - const checkTypes = types.length > 0 && - !(coerceTo.length === 0 && types.length === 1 && (0, applicability_1.schemaHasRulesForType)(it, types[0])); - if (checkTypes) { - const wrongType = checkDataTypes(types, data, opts.strictNumbers, DataType.Wrong); - gen.if(wrongType, () => { - if (coerceTo.length) - coerceData(it, types, coerceTo); - else - reportTypeError(it); - }); - } - return checkTypes; -} -exports.coerceAndCheckDataType = coerceAndCheckDataType; -const COERCIBLE = new Set(["string", "number", "integer", "boolean", "null"]); -function coerceToTypes(types, coerceTypes) { - return coerceTypes - ? types.filter((t) => COERCIBLE.has(t) || (coerceTypes === "array" && t === "array")) - : []; -} -function coerceData(it, types, coerceTo) { - const { gen, data, opts } = it; - const dataType = gen.let("dataType", (0, codegen_1._) `typeof ${data}`); - const coerced = gen.let("coerced", (0, codegen_1._) `undefined`); - if (opts.coerceTypes === "array") { - gen.if((0, codegen_1._) `${dataType} == 'object' && Array.isArray(${data}) && ${data}.length == 1`, () => gen - .assign(data, (0, codegen_1._) `${data}[0]`) - .assign(dataType, (0, codegen_1._) `typeof ${data}`) - .if(checkDataTypes(types, data, opts.strictNumbers), () => gen.assign(coerced, data))); - } - gen.if((0, codegen_1._) `${coerced} !== undefined`); - for (const t of coerceTo) { - if (COERCIBLE.has(t) || (t === "array" && opts.coerceTypes === "array")) { - coerceSpecificType(t); - } - } - gen.else(); - reportTypeError(it); - gen.endIf(); - gen.if((0, codegen_1._) `${coerced} !== undefined`, () => { - gen.assign(data, coerced); - assignParentData(it, coerced); - }); - function coerceSpecificType(t) { - switch (t) { - case "string": - gen - .elseIf((0, codegen_1._) `${dataType} == "number" || ${dataType} == "boolean"`) - .assign(coerced, (0, codegen_1._) `"" + ${data}`) - .elseIf((0, codegen_1._) `${data} === null`) - .assign(coerced, (0, codegen_1._) `""`); - return; - case "number": - gen - .elseIf((0, codegen_1._) `${dataType} == "boolean" || ${data} === null - || (${dataType} == "string" && ${data} && ${data} == +${data})`) - .assign(coerced, (0, codegen_1._) `+${data}`); - return; - case "integer": - gen - .elseIf((0, codegen_1._) `${dataType} === "boolean" || ${data} === null - || (${dataType} === "string" && ${data} && ${data} == +${data} && !(${data} % 1))`) - .assign(coerced, (0, codegen_1._) `+${data}`); - return; - case "boolean": - gen - .elseIf((0, codegen_1._) `${data} === "false" || ${data} === 0 || ${data} === null`) - .assign(coerced, false) - .elseIf((0, codegen_1._) `${data} === "true" || ${data} === 1`) - .assign(coerced, true); - return; - case "null": - gen.elseIf((0, codegen_1._) `${data} === "" || ${data} === 0 || ${data} === false`); - gen.assign(coerced, null); - return; - case "array": - gen - .elseIf((0, codegen_1._) `${dataType} === "string" || ${dataType} === "number" - || ${dataType} === "boolean" || ${data} === null`) - .assign(coerced, (0, codegen_1._) `[${data}]`); - } - } -} -function assignParentData({ gen, parentData, parentDataProperty }, expr) { - // TODO use gen.property - gen.if((0, codegen_1._) `${parentData} !== undefined`, () => gen.assign((0, codegen_1._) `${parentData}[${parentDataProperty}]`, expr)); -} -function checkDataType(dataType, data, strictNums, correct = DataType.Correct) { - const EQ = correct === DataType.Correct ? codegen_1.operators.EQ : codegen_1.operators.NEQ; - let cond; - switch (dataType) { - case "null": - return (0, codegen_1._) `${data} ${EQ} null`; - case "array": - cond = (0, codegen_1._) `Array.isArray(${data})`; - break; - case "object": - cond = (0, codegen_1._) `${data} && typeof ${data} == "object" && !Array.isArray(${data})`; - break; - case "integer": - cond = numCond((0, codegen_1._) `!(${data} % 1) && !isNaN(${data})`); - break; - case "number": - cond = numCond(); - break; - default: - return (0, codegen_1._) `typeof ${data} ${EQ} ${dataType}`; - } - return correct === DataType.Correct ? cond : (0, codegen_1.not)(cond); - function numCond(_cond = codegen_1.nil) { - return (0, codegen_1.and)((0, codegen_1._) `typeof ${data} == "number"`, _cond, strictNums ? (0, codegen_1._) `isFinite(${data})` : codegen_1.nil); +exports.NotAncestorsExpectedValidationError = void 0; +const Pages_1 = __nccwpck_require__(52725); +class NotAncestorsExpectedValidationError extends Error { + constructor(pagesWithAncestors, options) { + super(`Pages with ancestors are not supported in FLAT sync mode: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pagesWithAncestors)}`, options); } } -exports.checkDataType = checkDataType; -function checkDataTypes(dataTypes, data, strictNums, correct) { - if (dataTypes.length === 1) { - return checkDataType(dataTypes[0], data, strictNums, correct); - } - let cond; - const types = (0, util_1.toHash)(dataTypes); - if (types.array && types.object) { - const notObj = (0, codegen_1._) `typeof ${data} != "object"`; - cond = types.null ? notObj : (0, codegen_1._) `!${data} || ${notObj}`; - delete types.null; - delete types.array; - delete types.object; - } - else { - cond = codegen_1.nil; +exports.NotAncestorsExpectedValidationError = NotAncestorsExpectedValidationError; + + +/***/ }), + +/***/ 25979: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + + +// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.PagesWithoutIdException = void 0; +const Pages_1 = __nccwpck_require__(52725); +class PagesWithoutIdException extends Error { + constructor(pagesWithoutId, options) { + super(`You are using ID mode and there are pages without id: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pagesWithoutId)}`, options); } - if (types.number) - delete types.integer; - for (const t in types) - cond = (0, codegen_1.and)(cond, checkDataType(t, data, strictNums, correct)); - return cond; -} -exports.checkDataTypes = checkDataTypes; -const typeError = { - message: ({ schema }) => `must be ${schema}`, - params: ({ schema, schemaValue }) => typeof schema == "string" ? (0, codegen_1._) `{type: ${schema}}` : (0, codegen_1._) `{type: ${schemaValue}}`, -}; -function reportTypeError(it) { - const cxt = getTypeErrorContext(it); - (0, errors_1.reportError)(cxt, typeError); -} -exports.reportTypeError = reportTypeError; -function getTypeErrorContext(it) { - const { gen, data, schema } = it; - const schemaCode = (0, util_1.schemaRefOrVal)(it, schema, "type"); - return { - gen, - keyword: "type", - data, - schema: schema.type, - schemaCode, - schemaValue: schemaCode, - parentSchema: schema, - params: {}, - it, - }; } -//# sourceMappingURL=dataType.js.map +exports.PagesWithoutIdException = PagesWithoutIdException; + /***/ }), -/***/ 46451: +/***/ 49510: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.assignDefaults = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -function assignDefaults(it, ty) { - const { properties, items } = it.schema; - if (ty === "object" && properties) { - for (const key in properties) { - assignDefault(it, key, properties[key].default); - } - } - else if (ty === "array" && Array.isArray(items)) { - items.forEach((sch, i) => assignDefault(it, i, sch.default)); +exports.PendingPagesToSyncError = void 0; +const Pages_1 = __nccwpck_require__(52725); +class PendingPagesToSyncError extends Error { + constructor(pendingPagesToSync, options) { + super(`There still are ${pendingPagesToSync.length} pages to create after sync: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pendingPagesToSync)}, check if they have their ancestors created.`, options); } } -exports.assignDefaults = assignDefaults; -function assignDefault(it, prop, defaultValue) { - const { gen, compositeRule, data, opts } = it; - if (defaultValue === undefined) - return; - const childData = (0, codegen_1._) `${data}${(0, codegen_1.getProperty)(prop)}`; - if (compositeRule) { - (0, util_1.checkStrictMode)(it, `default is ignored for: ${childData}`); - return; - } - let condition = (0, codegen_1._) `${childData} === undefined`; - if (opts.useDefaults === "empty") { - condition = (0, codegen_1._) `${condition} || ${childData} === null || ${childData} === ""`; +exports.PendingPagesToSyncError = PendingPagesToSyncError; + + +/***/ }), + +/***/ 59328: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.RootPageForbiddenException = void 0; +class RootPageForbiddenException extends Error { + constructor(options) { + super("rootPageId option is not allowed in ID mode", options); } - // `${childData} === undefined` + - // (opts.useDefaults === "empty" ? ` || ${childData} === null || ${childData} === ""` : "") - gen.if(condition, (0, codegen_1._) `${childData} = ${(0, codegen_1.stringify)(defaultValue)}`); } -//# sourceMappingURL=defaults.js.map +exports.RootPageForbiddenException = RootPageForbiddenException; + /***/ }), -/***/ 26345: +/***/ 44690: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getData = exports.KeywordCxt = exports.validateFunctionCode = void 0; -const boolSchema_1 = __nccwpck_require__(2930); -const dataType_1 = __nccwpck_require__(4701); -const applicability_1 = __nccwpck_require__(74780); -const dataType_2 = __nccwpck_require__(4701); -const defaults_1 = __nccwpck_require__(46451); -const keyword_1 = __nccwpck_require__(27362); -const subschema_1 = __nccwpck_require__(13400); -const codegen_1 = __nccwpck_require__(30972); -const names_1 = __nccwpck_require__(66662); -const resolve_1 = __nccwpck_require__(7834); -const util_1 = __nccwpck_require__(87120); -const errors_1 = __nccwpck_require__(75779); -// schema compilation - generates validation function, subschemaCode (below) is used for subschemas -function validateFunctionCode(it) { - if (isSchemaObj(it)) { - checkKeywords(it); - if (schemaCxtHasRules(it)) { - topSchemaObjCode(it); - return; +exports.RootPageRequiredException = void 0; +const ConfluenceSyncPages_types_1 = __nccwpck_require__(92041); +class RootPageRequiredException extends Error { + constructor(mode, options) { + /* istanbul ignore else */ + if (mode === ConfluenceSyncPages_types_1.SyncModes.TREE) { + super("rootPageId is required for TREE sync mode", options); } - } - validateFunction(it, () => (0, boolSchema_1.topBoolOrEmptySchema)(it)); -} -exports.validateFunctionCode = validateFunctionCode; -function validateFunction({ gen, validateName, schema, schemaEnv, opts }, body) { - if (opts.code.es5) { - gen.func(validateName, (0, codegen_1._) `${names_1.default.data}, ${names_1.default.valCxt}`, schemaEnv.$async, () => { - gen.code((0, codegen_1._) `"use strict"; ${funcSourceUrl(schema, opts)}`); - destructureValCxtES5(gen, opts); - gen.code(body); - }); - } - else { - gen.func(validateName, (0, codegen_1._) `${names_1.default.data}, ${destructureValCxt(opts)}`, schemaEnv.$async, () => gen.code(funcSourceUrl(schema, opts)).code(body)); - } -} -function destructureValCxt(opts) { - return (0, codegen_1._) `{${names_1.default.instancePath}="", ${names_1.default.parentData}, ${names_1.default.parentDataProperty}, ${names_1.default.rootData}=${names_1.default.data}${opts.dynamicRef ? (0, codegen_1._) `, ${names_1.default.dynamicAnchors}={}` : codegen_1.nil}}={}`; -} -function destructureValCxtES5(gen, opts) { - gen.if(names_1.default.valCxt, () => { - gen.var(names_1.default.instancePath, (0, codegen_1._) `${names_1.default.valCxt}.${names_1.default.instancePath}`); - gen.var(names_1.default.parentData, (0, codegen_1._) `${names_1.default.valCxt}.${names_1.default.parentData}`); - gen.var(names_1.default.parentDataProperty, (0, codegen_1._) `${names_1.default.valCxt}.${names_1.default.parentDataProperty}`); - gen.var(names_1.default.rootData, (0, codegen_1._) `${names_1.default.valCxt}.${names_1.default.rootData}`); - if (opts.dynamicRef) - gen.var(names_1.default.dynamicAnchors, (0, codegen_1._) `${names_1.default.valCxt}.${names_1.default.dynamicAnchors}`); - }, () => { - gen.var(names_1.default.instancePath, (0, codegen_1._) `""`); - gen.var(names_1.default.parentData, (0, codegen_1._) `undefined`); - gen.var(names_1.default.parentDataProperty, (0, codegen_1._) `undefined`); - gen.var(names_1.default.rootData, names_1.default.data); - if (opts.dynamicRef) - gen.var(names_1.default.dynamicAnchors, (0, codegen_1._) `{}`); - }); -} -function topSchemaObjCode(it) { - const { schema, opts, gen } = it; - validateFunction(it, () => { - if (opts.$comment && schema.$comment) - commentKeyword(it); - checkNoDefault(it); - gen.let(names_1.default.vErrors, null); - gen.let(names_1.default.errors, 0); - if (opts.unevaluated) - resetEvaluated(it); - typeAndKeywords(it); - returnResults(it); - }); - return; -} -function resetEvaluated(it) { - // TODO maybe some hook to execute it in the end to check whether props/items are Name, as in assignEvaluated - const { gen, validateName } = it; - it.evaluated = gen.const("evaluated", (0, codegen_1._) `${validateName}.evaluated`); - gen.if((0, codegen_1._) `${it.evaluated}.dynamicProps`, () => gen.assign((0, codegen_1._) `${it.evaluated}.props`, (0, codegen_1._) `undefined`)); - gen.if((0, codegen_1._) `${it.evaluated}.dynamicItems`, () => gen.assign((0, codegen_1._) `${it.evaluated}.items`, (0, codegen_1._) `undefined`)); -} -function funcSourceUrl(schema, opts) { - const schId = typeof schema == "object" && schema[opts.schemaId]; - return schId && (opts.code.source || opts.code.process) ? (0, codegen_1._) `/*# sourceURL=${schId} */` : codegen_1.nil; -} -// schema compilation - this function is used recursively to generate code for sub-schemas -function subschemaCode(it, valid) { - if (isSchemaObj(it)) { - checkKeywords(it); - if (schemaCxtHasRules(it)) { - subSchemaObjCode(it, valid); - return; + else if (mode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { + super("rootPageId is required for FLAT sync mode", options); + } + else { + /* istanbul ignore next */ + super("Unknown sync mode", options); } } - (0, boolSchema_1.boolOrEmptySchema)(it, valid); -} -function schemaCxtHasRules({ schema, self }) { - if (typeof schema == "boolean") - return !schema; - for (const key in schema) - if (self.RULES.all[key]) - return true; - return false; -} -function isSchemaObj(it) { - return typeof it.schema != "boolean"; -} -function subSchemaObjCode(it, valid) { - const { schema, gen, opts } = it; - if (opts.$comment && schema.$comment) - commentKeyword(it); - updateContext(it); - checkAsyncSchema(it); - const errsCount = gen.const("_errs", names_1.default.errors); - typeAndKeywords(it, errsCount); - // TODO var - gen.var(valid, (0, codegen_1._) `${errsCount} === ${names_1.default.errors}`); -} -function checkKeywords(it) { - (0, util_1.checkUnknownRules)(it); - checkRefsAndKeywords(it); -} -function typeAndKeywords(it, errsCount) { - if (it.opts.jtd) - return schemaKeywords(it, [], false, errsCount); - const types = (0, dataType_1.getSchemaTypes)(it.schema); - const checkedTypes = (0, dataType_1.coerceAndCheckDataType)(it, types); - schemaKeywords(it, types, !checkedTypes, errsCount); } -function checkRefsAndKeywords(it) { - const { schema, errSchemaPath, opts, self } = it; - if (schema.$ref && opts.ignoreKeywordsWithRef && (0, util_1.schemaHasRulesButRef)(schema, self.RULES)) { - self.logger.warn(`$ref: keywords ignored in schema at path "${errSchemaPath}"`); +exports.RootPageRequiredException = RootPageRequiredException; + + +/***/ }), + +/***/ 35188: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ShouldUseIdModeException = void 0; +class ShouldUseIdModeException extends Error { + constructor(message, options) { + super(message, options); } } -function checkNoDefault(it) { - const { schema, opts } = it; - if (schema.default !== undefined && opts.useDefaults && opts.strictSchema) { - (0, util_1.checkStrictMode)(it, "default is ignored in the schema root"); +exports.ShouldUseIdModeException = ShouldUseIdModeException; + + +/***/ }), + +/***/ 6229: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __exportStar = (this && this.__exportStar) || function(m, exports) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +__exportStar(__nccwpck_require__(72988), exports); +__exportStar(__nccwpck_require__(90350), exports); + + +/***/ }), + +/***/ 52725: +/***/ ((__unused_webpack_module, exports) => { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getPagesTitles = getPagesTitles; +exports.getPagesTitlesCommaSeparated = getPagesTitlesCommaSeparated; +function getPagesTitles(pages) { + return pages.map((page) => page.title); } -function updateContext(it) { - const schId = it.schema[it.opts.schemaId]; - if (schId) - it.baseId = (0, resolve_1.resolveUrl)(it.opts.uriResolver, it.baseId, schId); -} -function checkAsyncSchema(it) { - if (it.schema.$async && !it.schemaEnv.$async) - throw new Error("async schema in sync schema"); -} -function commentKeyword({ gen, schemaEnv, schema, errSchemaPath, opts }) { - const msg = schema.$comment; - if (opts.$comment === true) { - gen.code((0, codegen_1._) `${names_1.default.self}.logger.log(${msg})`); - } - else if (typeof opts.$comment == "function") { - const schemaPath = (0, codegen_1.str) `${errSchemaPath}/$comment`; - const rootName = gen.scopeValue("root", { ref: schemaEnv.root }); - gen.code((0, codegen_1._) `${names_1.default.self}.opts.$comment(${msg}, ${schemaPath}, ${rootName}.schema)`); - } +function getPagesTitlesCommaSeparated(pages) { + return getPagesTitles(pages).join(", "); } -function returnResults(it) { - const { gen, schemaEnv, validateName, ValidationError, opts } = it; - if (schemaEnv.$async) { - // TODO assign unevaluated - gen.if((0, codegen_1._) `${names_1.default.errors} === 0`, () => gen.return(names_1.default.data), () => gen.throw((0, codegen_1._) `new ${ValidationError}(${names_1.default.vErrors})`)); - } - else { - gen.assign((0, codegen_1._) `${validateName}.errors`, names_1.default.vErrors); - if (opts.unevaluated) - assignEvaluated(it); - gen.return((0, codegen_1._) `${names_1.default.errors} === 0`); + + +/***/ }), + +/***/ 72988: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + + +// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital +// SPDX-License-Identifier: Apache-2.0 +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __exportStar = (this && this.__exportStar) || function(m, exports) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.SyncModes = void 0; +var ConfluenceSyncPages_types_1 = __nccwpck_require__(92041); +Object.defineProperty(exports, "SyncModes", ({ enumerable: true, get: function () { return ConfluenceSyncPages_types_1.SyncModes; } })); +__exportStar(__nccwpck_require__(22257), exports); + + +/***/ }), + +/***/ 10723: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + + + +const XHTMLEntities = __nccwpck_require__(97566); + +const hexNumber = /^[\da-fA-F]+$/; +const decimalNumber = /^\d+$/; + +// The map to `acorn-jsx` tokens from `acorn` namespace objects. +const acornJsxMap = new WeakMap(); + +// Get the original tokens for the given `acorn` namespace object. +function getJsxTokens(acorn) { + acorn = acorn.Parser.acorn || acorn; + let acornJsx = acornJsxMap.get(acorn); + if (!acornJsx) { + const tt = acorn.tokTypes; + const TokContext = acorn.TokContext; + const TokenType = acorn.TokenType; + const tc_oTag = new TokContext('...', true, true); + const tokContexts = { + tc_oTag: tc_oTag, + tc_cTag: tc_cTag, + tc_expr: tc_expr + }; + const tokTypes = { + jsxName: new TokenType('jsxName'), + jsxText: new TokenType('jsxText', {beforeExpr: true}), + jsxTagStart: new TokenType('jsxTagStart', {startsExpr: true}), + jsxTagEnd: new TokenType('jsxTagEnd') + }; + + tokTypes.jsxTagStart.updateContext = function() { + this.context.push(tc_expr); // treat as beginning of JSX expression + this.context.push(tc_oTag); // start opening tag context + this.exprAllowed = false; + }; + tokTypes.jsxTagEnd.updateContext = function(prevType) { + let out = this.context.pop(); + if (out === tc_oTag && prevType === tt.slash || out === tc_cTag) { + this.context.pop(); + this.exprAllowed = this.curContext() === tc_expr; + } else { + this.exprAllowed = true; + } + }; + + acornJsx = { tokContexts: tokContexts, tokTypes: tokTypes }; + acornJsxMap.set(acorn, acornJsx); + } + + return acornJsx; } -function assignEvaluated({ gen, evaluated, props, items }) { - if (props instanceof codegen_1.Name) - gen.assign((0, codegen_1._) `${evaluated}.props`, props); - if (items instanceof codegen_1.Name) - gen.assign((0, codegen_1._) `${evaluated}.items`, items); + +// Transforms JSX element name to string. + +function getQualifiedJSXName(object) { + if (!object) + return object; + + if (object.type === 'JSXIdentifier') + return object.name; + + if (object.type === 'JSXNamespacedName') + return object.namespace.name + ':' + object.name.name; + + if (object.type === 'JSXMemberExpression') + return getQualifiedJSXName(object.object) + '.' + + getQualifiedJSXName(object.property); } -function schemaKeywords(it, types, typeErrors, errsCount) { - const { gen, schema, data, allErrors, opts, self } = it; - const { RULES } = self; - if (schema.$ref && (opts.ignoreKeywordsWithRef || !(0, util_1.schemaHasRulesButRef)(schema, RULES))) { - gen.block(() => keywordCode(it, "$ref", RULES.all.$ref.definition)); // TODO typecast - return; - } - if (!opts.jtd) - checkStrictTypes(it, types); - gen.block(() => { - for (const group of RULES.rules) - groupKeywords(group); - groupKeywords(RULES.post); - }); - function groupKeywords(group) { - if (!(0, applicability_1.shouldUseGroup)(schema, group)) - return; - if (group.type) { - gen.if((0, dataType_2.checkDataType)(group.type, data, opts.strictNumbers)); - iterateKeywords(it, group); - if (types.length === 1 && types[0] === group.type && typeErrors) { - gen.else(); - (0, dataType_2.reportTypeError)(it); - } - gen.endIf(); - } - else { - iterateKeywords(it, group); - } - // TODO make it "ok" call? - if (!allErrors) - gen.if((0, codegen_1._) `${names_1.default.errors} === ${errsCount || 0}`); + +module.exports = function(options) { + options = options || {}; + return function(Parser) { + return plugin({ + allowNamespaces: options.allowNamespaces !== false, + allowNamespacedObjects: !!options.allowNamespacedObjects + }, Parser); + }; +}; + +// This is `tokTypes` of the peer dep. +// This can be different instances from the actual `tokTypes` this plugin uses. +Object.defineProperty(module.exports, "tokTypes", ({ + get: function get_tokTypes() { + return getJsxTokens(__nccwpck_require__(63615)).tokTypes; + }, + configurable: true, + enumerable: true +})); + +function plugin(options, Parser) { + const acorn = Parser.acorn || __nccwpck_require__(63615); + const acornJsx = getJsxTokens(acorn); + const tt = acorn.tokTypes; + const tok = acornJsx.tokTypes; + const tokContexts = acorn.tokContexts; + const tc_oTag = acornJsx.tokContexts.tc_oTag; + const tc_cTag = acornJsx.tokContexts.tc_cTag; + const tc_expr = acornJsx.tokContexts.tc_expr; + const isNewLine = acorn.isNewLine; + const isIdentifierStart = acorn.isIdentifierStart; + const isIdentifierChar = acorn.isIdentifierChar; + + return class extends Parser { + // Expose actual `tokTypes` and `tokContexts` to other plugins. + static get acornJsx() { + return acornJsx; } -} -function iterateKeywords(it, group) { - const { gen, schema, opts: { useDefaults }, } = it; - if (useDefaults) - (0, defaults_1.assignDefaults)(it, group.type); - gen.block(() => { - for (const rule of group.rules) { - if ((0, applicability_1.shouldUseRule)(schema, rule)) { - keywordCode(it, rule.keyword, rule.definition, group.type); + + // Reads inline JSX contents token. + jsx_readToken() { + let out = '', chunkStart = this.pos; + for (;;) { + if (this.pos >= this.input.length) + this.raise(this.start, 'Unterminated JSX contents'); + let ch = this.input.charCodeAt(this.pos); + + switch (ch) { + case 60: // '<' + case 123: // '{' + if (this.pos === this.start) { + if (ch === 60 && this.exprAllowed) { + ++this.pos; + return this.finishToken(tok.jsxTagStart); } + return this.getTokenFromCode(ch); + } + out += this.input.slice(chunkStart, this.pos); + return this.finishToken(tok.jsxText, out); + + case 38: // '&' + out += this.input.slice(chunkStart, this.pos); + out += this.jsx_readEntity(); + chunkStart = this.pos; + break; + + case 62: // '>' + case 125: // '}' + this.raise( + this.pos, + "Unexpected token `" + this.input[this.pos] + "`. Did you mean `" + + (ch === 62 ? ">" : "}") + "` or " + "`{\"" + this.input[this.pos] + "\"}" + "`?" + ); + + default: + if (isNewLine(ch)) { + out += this.input.slice(chunkStart, this.pos); + out += this.jsx_readNewLine(true); + chunkStart = this.pos; + } else { + ++this.pos; + } } - }); -} -function checkStrictTypes(it, types) { - if (it.schemaEnv.meta || !it.opts.strictTypes) - return; - checkContextTypes(it, types); - if (!it.opts.allowUnionTypes) - checkMultipleTypes(it, types); - checkKeywordTypes(it, it.dataTypes); -} -function checkContextTypes(it, types) { - if (!types.length) - return; - if (!it.dataTypes.length) { - it.dataTypes = types; - return; + } } - types.forEach((t) => { - if (!includesType(it.dataTypes, t)) { - strictTypesError(it, `type "${t}" not allowed by context "${it.dataTypes.join(",")}"`); - } - }); - it.dataTypes = it.dataTypes.filter((t) => includesType(types, t)); -} -function checkMultipleTypes(it, ts) { - if (ts.length > 1 && !(ts.length === 2 && ts.includes("null"))) { - strictTypesError(it, "use allowUnionTypes to allow union type keyword"); + + jsx_readNewLine(normalizeCRLF) { + let ch = this.input.charCodeAt(this.pos); + let out; + ++this.pos; + if (ch === 13 && this.input.charCodeAt(this.pos) === 10) { + ++this.pos; + out = normalizeCRLF ? '\n' : '\r\n'; + } else { + out = String.fromCharCode(ch); + } + if (this.options.locations) { + ++this.curLine; + this.lineStart = this.pos; + } + + return out; } -} -function checkKeywordTypes(it, ts) { - const rules = it.self.RULES.all; - for (const keyword in rules) { - const rule = rules[keyword]; - if (typeof rule == "object" && (0, applicability_1.shouldUseRule)(it.schema, rule)) { - const { type } = rule.definition; - if (type.length && !type.some((t) => hasApplicableType(ts, t))) { - strictTypesError(it, `missing type "${type.join(",")}" for keyword "${keyword}"`); - } + + jsx_readString(quote) { + let out = '', chunkStart = ++this.pos; + for (;;) { + if (this.pos >= this.input.length) + this.raise(this.start, 'Unterminated string constant'); + let ch = this.input.charCodeAt(this.pos); + if (ch === quote) break; + if (ch === 38) { // '&' + out += this.input.slice(chunkStart, this.pos); + out += this.jsx_readEntity(); + chunkStart = this.pos; + } else if (isNewLine(ch)) { + out += this.input.slice(chunkStart, this.pos); + out += this.jsx_readNewLine(false); + chunkStart = this.pos; + } else { + ++this.pos; } + } + out += this.input.slice(chunkStart, this.pos++); + return this.finishToken(tt.string, out); } -} -function hasApplicableType(schTs, kwdT) { - return schTs.includes(kwdT) || (kwdT === "number" && schTs.includes("integer")); -} -function includesType(ts, t) { - return ts.includes(t) || (t === "integer" && ts.includes("number")); -} -function strictTypesError(it, msg) { - const schemaPath = it.schemaEnv.baseId + it.errSchemaPath; - msg += ` at "${schemaPath}" (strictTypes)`; - (0, util_1.checkStrictMode)(it, msg, it.opts.strictTypes); -} -class KeywordCxt { - constructor(it, def, keyword) { - (0, keyword_1.validateKeywordUsage)(it, def, keyword); - this.gen = it.gen; - this.allErrors = it.allErrors; - this.keyword = keyword; - this.data = it.data; - this.schema = it.schema[keyword]; - this.$data = def.$data && it.opts.$data && this.schema && this.schema.$data; - this.schemaValue = (0, util_1.schemaRefOrVal)(it, this.schema, keyword, this.$data); - this.schemaType = def.schemaType; - this.parentSchema = it.schema; - this.params = {}; - this.it = it; - this.def = def; - if (this.$data) { - this.schemaCode = it.gen.const("vSchema", getData(this.$data, it)); - } - else { - this.schemaCode = this.schemaValue; - if (!(0, keyword_1.validSchemaType)(this.schema, def.schemaType, def.allowUndefined)) { - throw new Error(`${keyword} value must be ${JSON.stringify(def.schemaType)}`); + + jsx_readEntity() { + let str = '', count = 0, entity; + let ch = this.input[this.pos]; + if (ch !== '&') + this.raise(this.pos, 'Entity must start with an ampersand'); + let startPos = ++this.pos; + while (this.pos < this.input.length && count++ < 10) { + ch = this.input[this.pos++]; + if (ch === ';') { + if (str[0] === '#') { + if (str[1] === 'x') { + str = str.substr(2); + if (hexNumber.test(str)) + entity = String.fromCharCode(parseInt(str, 16)); + } else { + str = str.substr(1); + if (decimalNumber.test(str)) + entity = String.fromCharCode(parseInt(str, 10)); } + } else { + entity = XHTMLEntities[str]; + } + break; } - if ("code" in def ? def.trackErrors : def.errors !== false) { - this.errsCount = it.gen.const("_errs", names_1.default.errors); - } - } - result(condition, successAction, failAction) { - this.failResult((0, codegen_1.not)(condition), successAction, failAction); - } - failResult(condition, successAction, failAction) { - this.gen.if(condition); - if (failAction) - failAction(); - else - this.error(); - if (successAction) { - this.gen.else(); - successAction(); - if (this.allErrors) - this.gen.endIf(); - } - else { - if (this.allErrors) - this.gen.endIf(); - else - this.gen.else(); - } - } - pass(condition, failAction) { - this.failResult((0, codegen_1.not)(condition), undefined, failAction); + str += ch; + } + if (!entity) { + this.pos = startPos; + return '&'; + } + return entity; } - fail(condition) { - if (condition === undefined) { - this.error(); - if (!this.allErrors) - this.gen.if(false); // this branch will be removed by gen.optimize - return; - } - this.gen.if(condition); - this.error(); - if (this.allErrors) - this.gen.endIf(); - else - this.gen.else(); + + // Read a JSX identifier (valid tag or attribute name). + // + // Optimized version since JSX identifiers can't contain + // escape characters and so can be read as single slice. + // Also assumes that first character was already checked + // by isIdentifierStart in readToken. + + jsx_readWord() { + let ch, start = this.pos; + do { + ch = this.input.charCodeAt(++this.pos); + } while (isIdentifierChar(ch) || ch === 45); // '-' + return this.finishToken(tok.jsxName, this.input.slice(start, this.pos)); } - fail$data(condition) { - if (!this.$data) - return this.fail(condition); - const { schemaCode } = this; - this.fail((0, codegen_1._) `${schemaCode} !== undefined && (${(0, codegen_1.or)(this.invalid$data(), condition)})`); + + // Parse next token as JSX identifier + + jsx_parseIdentifier() { + let node = this.startNode(); + if (this.type === tok.jsxName) + node.name = this.value; + else if (this.type.keyword) + node.name = this.type.keyword; + else + this.unexpected(); + this.next(); + return this.finishNode(node, 'JSXIdentifier'); } - error(append, errorParams, errorPaths) { - if (errorParams) { - this.setParams(errorParams); - this._error(append, errorPaths); - this.setParams({}); - return; - } - this._error(append, errorPaths); + + // Parse namespaced identifier. + + jsx_parseNamespacedName() { + let startPos = this.start, startLoc = this.startLoc; + let name = this.jsx_parseIdentifier(); + if (!options.allowNamespaces || !this.eat(tt.colon)) return name; + var node = this.startNodeAt(startPos, startLoc); + node.namespace = name; + node.name = this.jsx_parseIdentifier(); + return this.finishNode(node, 'JSXNamespacedName'); } - _error(append, errorPaths) { - ; - (append ? errors_1.reportExtraError : errors_1.reportError)(this, this.def.error, errorPaths); + + // Parses element name in any form - namespaced, member + // or single identifier. + + jsx_parseElementName() { + if (this.type === tok.jsxTagEnd) return ''; + let startPos = this.start, startLoc = this.startLoc; + let node = this.jsx_parseNamespacedName(); + if (this.type === tt.dot && node.type === 'JSXNamespacedName' && !options.allowNamespacedObjects) { + this.unexpected(); + } + while (this.eat(tt.dot)) { + let newNode = this.startNodeAt(startPos, startLoc); + newNode.object = node; + newNode.property = this.jsx_parseIdentifier(); + node = this.finishNode(newNode, 'JSXMemberExpression'); + } + return node; } - $dataError() { - (0, errors_1.reportError)(this, this.def.$dataError || errors_1.keyword$DataError); + + // Parses any type of JSX attribute value. + + jsx_parseAttributeValue() { + switch (this.type) { + case tt.braceL: + let node = this.jsx_parseExpressionContainer(); + if (node.expression.type === 'JSXEmptyExpression') + this.raise(node.start, 'JSX attributes must only be assigned a non-empty expression'); + return node; + + case tok.jsxTagStart: + case tt.string: + return this.parseExprAtom(); + + default: + this.raise(this.start, 'JSX value should be either an expression or a quoted JSX text'); + } } - reset() { - if (this.errsCount === undefined) - throw new Error('add "trackErrors" to keyword definition'); - (0, errors_1.resetErrorsCount)(this.gen, this.errsCount); + + // JSXEmptyExpression is unique type since it doesn't actually parse anything, + // and so it should start at the end of last read token (left brace) and finish + // at the beginning of the next one (right brace). + + jsx_parseEmptyExpression() { + let node = this.startNodeAt(this.lastTokEnd, this.lastTokEndLoc); + return this.finishNodeAt(node, 'JSXEmptyExpression', this.start, this.startLoc); } - ok(cond) { - if (!this.allErrors) - this.gen.if(cond); + + // Parses JSX expression enclosed into curly brackets. + + jsx_parseExpressionContainer() { + let node = this.startNode(); + this.next(); + node.expression = this.type === tt.braceR + ? this.jsx_parseEmptyExpression() + : this.parseExpression(); + this.expect(tt.braceR); + return this.finishNode(node, 'JSXExpressionContainer'); } - setParams(obj, assign) { - if (assign) - Object.assign(this.params, obj); - else - this.params = obj; + + // Parses following JSX attribute name-value pair. + + jsx_parseAttribute() { + let node = this.startNode(); + if (this.eat(tt.braceL)) { + this.expect(tt.ellipsis); + node.argument = this.parseMaybeAssign(); + this.expect(tt.braceR); + return this.finishNode(node, 'JSXSpreadAttribute'); + } + node.name = this.jsx_parseNamespacedName(); + node.value = this.eat(tt.eq) ? this.jsx_parseAttributeValue() : null; + return this.finishNode(node, 'JSXAttribute'); } - block$data(valid, codeBlock, $dataValid = codegen_1.nil) { - this.gen.block(() => { - this.check$data(valid, $dataValid); - codeBlock(); - }); + + // Parses JSX opening tag starting after '<'. + + jsx_parseOpeningElementAt(startPos, startLoc) { + let node = this.startNodeAt(startPos, startLoc); + node.attributes = []; + let nodeName = this.jsx_parseElementName(); + if (nodeName) node.name = nodeName; + while (this.type !== tt.slash && this.type !== tok.jsxTagEnd) + node.attributes.push(this.jsx_parseAttribute()); + node.selfClosing = this.eat(tt.slash); + this.expect(tok.jsxTagEnd); + return this.finishNode(node, nodeName ? 'JSXOpeningElement' : 'JSXOpeningFragment'); } - check$data(valid = codegen_1.nil, $dataValid = codegen_1.nil) { - if (!this.$data) - return; - const { gen, schemaCode, schemaType, def } = this; - gen.if((0, codegen_1.or)((0, codegen_1._) `${schemaCode} === undefined`, $dataValid)); - if (valid !== codegen_1.nil) - gen.assign(valid, true); - if (schemaType.length || def.validateSchema) { - gen.elseIf(this.invalid$data()); - this.$dataError(); - if (valid !== codegen_1.nil) - gen.assign(valid, false); - } - gen.else(); + + // Parses JSX closing tag starting after ' this.mergeEvaluated(schemaCxt, codegen_1.Name)); - return true; + if (getQualifiedJSXName(closingElement.name) !== getQualifiedJSXName(openingElement.name)) { + this.raise( + closingElement.start, + 'Expected corresponding JSX closing tag for <' + getQualifiedJSXName(openingElement.name) + '>'); } + } + let fragmentOrElement = openingElement.name ? 'Element' : 'Fragment'; + + node['opening' + fragmentOrElement] = openingElement; + node['closing' + fragmentOrElement] = closingElement; + node.children = children; + if (this.type === tt.relational && this.value === "<") { + this.raise(this.start, "Adjacent JSX elements must be wrapped in an enclosing tag"); + } + return this.finishNode(node, 'JSX' + fragmentOrElement); } -} -exports.KeywordCxt = KeywordCxt; -function keywordCode(it, keyword, def, ruleType) { - const cxt = new KeywordCxt(it, def, keyword); - if ("code" in def) { - def.code(cxt, ruleType); - } - else if (cxt.$data && def.validate) { - (0, keyword_1.funcKeywordCode)(cxt, def); - } - else if ("macro" in def) { - (0, keyword_1.macroKeywordCode)(cxt, def); - } - else if (def.compile || def.validate) { - (0, keyword_1.funcKeywordCode)(cxt, def); + + // Parse JSX text + + jsx_parseText() { + let node = this.parseLiteral(this.value); + node.type = "JSXText"; + return node; } -} -const JSON_POINTER = /^\/(?:[^~]|~0|~1)*$/; -const RELATIVE_JSON_POINTER = /^([0-9]+)(#|\/(?:[^~]|~0|~1)*)?$/; -function getData($data, { dataLevel, dataNames, dataPathArr }) { - let jsonPointer; - let data; - if ($data === "") - return names_1.default.rootData; - if ($data[0] === "/") { - if (!JSON_POINTER.test($data)) - throw new Error(`Invalid JSON-pointer: ${$data}`); - jsonPointer = $data; - data = names_1.default.rootData; + + // Parses entire JSX element from current position. + + jsx_parseElement() { + let startPos = this.start, startLoc = this.startLoc; + this.next(); + return this.jsx_parseElementAt(startPos, startLoc); } - else { - const matches = RELATIVE_JSON_POINTER.exec($data); - if (!matches) - throw new Error(`Invalid JSON-pointer: ${$data}`); - const up = +matches[1]; - jsonPointer = matches[2]; - if (jsonPointer === "#") { - if (up >= dataLevel) - throw new Error(errorMsg("property/index", up)); - return dataPathArr[dataLevel - up]; - } - if (up > dataLevel) - throw new Error(errorMsg("data", up)); - data = dataNames[dataLevel - up]; - if (!jsonPointer) - return data; + + parseExprAtom(refShortHandDefaultPos) { + if (this.type === tok.jsxText) + return this.jsx_parseText(); + else if (this.type === tok.jsxTagStart) + return this.jsx_parseElement(); + else + return super.parseExprAtom(refShortHandDefaultPos); } - let expr = data; - const segments = jsonPointer.split("/"); - for (const segment of segments) { - if (segment) { - data = (0, codegen_1._) `${data}${(0, codegen_1.getProperty)((0, util_1.unescapeJsonPointer)(segment))}`; - expr = (0, codegen_1._) `${expr} && ${data}`; + + readToken(code) { + let context = this.curContext(); + + if (context === tc_expr) return this.jsx_readToken(); + + if (context === tc_oTag || context === tc_cTag) { + if (isIdentifierStart(code)) return this.jsx_readWord(); + + if (code == 62) { + ++this.pos; + return this.finishToken(tok.jsxTagEnd); } + + if ((code === 34 || code === 39) && context == tc_oTag) + return this.jsx_readString(code); + } + + if (code === 60 && this.exprAllowed && this.input.charCodeAt(this.pos + 1) !== 33) { + ++this.pos; + return this.finishToken(tok.jsxTagStart); + } + return super.readToken(code); } - return expr; - function errorMsg(pointerType, up) { - return `Cannot access ${pointerType} ${up} levels up, current level is ${dataLevel}`; + + updateContext(prevType) { + if (this.type == tt.braceL) { + var curContext = this.curContext(); + if (curContext == tc_oTag) this.context.push(tokContexts.b_expr); + else if (curContext == tc_expr) this.context.push(tokContexts.b_tmpl); + else super.updateContext(prevType); + this.exprAllowed = true; + } else if (this.type === tt.slash && prevType === tok.jsxTagStart) { + this.context.length -= 2; // do not consider JSX expr -> JSX open tag -> ... anymore + this.context.push(tc_cTag); // reconsider as closing tag context + this.exprAllowed = false; + } else { + return super.updateContext(prevType); + } } + }; } -exports.getData = getData; -//# sourceMappingURL=index.js.map -/***/ }), -/***/ 27362: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ }), +/***/ 97566: +/***/ ((module) => { + +module.exports = { + quot: '\u0022', + amp: '&', + apos: '\u0027', + lt: '<', + gt: '>', + nbsp: '\u00A0', + iexcl: '\u00A1', + cent: '\u00A2', + pound: '\u00A3', + curren: '\u00A4', + yen: '\u00A5', + brvbar: '\u00A6', + sect: '\u00A7', + uml: '\u00A8', + copy: '\u00A9', + ordf: '\u00AA', + laquo: '\u00AB', + not: '\u00AC', + shy: '\u00AD', + reg: '\u00AE', + macr: '\u00AF', + deg: '\u00B0', + plusmn: '\u00B1', + sup2: '\u00B2', + sup3: '\u00B3', + acute: '\u00B4', + micro: '\u00B5', + para: '\u00B6', + middot: '\u00B7', + cedil: '\u00B8', + sup1: '\u00B9', + ordm: '\u00BA', + raquo: '\u00BB', + frac14: '\u00BC', + frac12: '\u00BD', + frac34: '\u00BE', + iquest: '\u00BF', + Agrave: '\u00C0', + Aacute: '\u00C1', + Acirc: '\u00C2', + Atilde: '\u00C3', + Auml: '\u00C4', + Aring: '\u00C5', + AElig: '\u00C6', + Ccedil: '\u00C7', + Egrave: '\u00C8', + Eacute: '\u00C9', + Ecirc: '\u00CA', + Euml: '\u00CB', + Igrave: '\u00CC', + Iacute: '\u00CD', + Icirc: '\u00CE', + Iuml: '\u00CF', + ETH: '\u00D0', + Ntilde: '\u00D1', + Ograve: '\u00D2', + Oacute: '\u00D3', + Ocirc: '\u00D4', + Otilde: '\u00D5', + Ouml: '\u00D6', + times: '\u00D7', + Oslash: '\u00D8', + Ugrave: '\u00D9', + Uacute: '\u00DA', + Ucirc: '\u00DB', + Uuml: '\u00DC', + Yacute: '\u00DD', + THORN: '\u00DE', + szlig: '\u00DF', + agrave: '\u00E0', + aacute: '\u00E1', + acirc: '\u00E2', + atilde: '\u00E3', + auml: '\u00E4', + aring: '\u00E5', + aelig: '\u00E6', + ccedil: '\u00E7', + egrave: '\u00E8', + eacute: '\u00E9', + ecirc: '\u00EA', + euml: '\u00EB', + igrave: '\u00EC', + iacute: '\u00ED', + icirc: '\u00EE', + iuml: '\u00EF', + eth: '\u00F0', + ntilde: '\u00F1', + ograve: '\u00F2', + oacute: '\u00F3', + ocirc: '\u00F4', + otilde: '\u00F5', + ouml: '\u00F6', + divide: '\u00F7', + oslash: '\u00F8', + ugrave: '\u00F9', + uacute: '\u00FA', + ucirc: '\u00FB', + uuml: '\u00FC', + yacute: '\u00FD', + thorn: '\u00FE', + yuml: '\u00FF', + OElig: '\u0152', + oelig: '\u0153', + Scaron: '\u0160', + scaron: '\u0161', + Yuml: '\u0178', + fnof: '\u0192', + circ: '\u02C6', + tilde: '\u02DC', + Alpha: '\u0391', + Beta: '\u0392', + Gamma: '\u0393', + Delta: '\u0394', + Epsilon: '\u0395', + Zeta: '\u0396', + Eta: '\u0397', + Theta: '\u0398', + Iota: '\u0399', + Kappa: '\u039A', + Lambda: '\u039B', + Mu: '\u039C', + Nu: '\u039D', + Xi: '\u039E', + Omicron: '\u039F', + Pi: '\u03A0', + Rho: '\u03A1', + Sigma: '\u03A3', + Tau: '\u03A4', + Upsilon: '\u03A5', + Phi: '\u03A6', + Chi: '\u03A7', + Psi: '\u03A8', + Omega: '\u03A9', + alpha: '\u03B1', + beta: '\u03B2', + gamma: '\u03B3', + delta: '\u03B4', + epsilon: '\u03B5', + zeta: '\u03B6', + eta: '\u03B7', + theta: '\u03B8', + iota: '\u03B9', + kappa: '\u03BA', + lambda: '\u03BB', + mu: '\u03BC', + nu: '\u03BD', + xi: '\u03BE', + omicron: '\u03BF', + pi: '\u03C0', + rho: '\u03C1', + sigmaf: '\u03C2', + sigma: '\u03C3', + tau: '\u03C4', + upsilon: '\u03C5', + phi: '\u03C6', + chi: '\u03C7', + psi: '\u03C8', + omega: '\u03C9', + thetasym: '\u03D1', + upsih: '\u03D2', + piv: '\u03D6', + ensp: '\u2002', + emsp: '\u2003', + thinsp: '\u2009', + zwnj: '\u200C', + zwj: '\u200D', + lrm: '\u200E', + rlm: '\u200F', + ndash: '\u2013', + mdash: '\u2014', + lsquo: '\u2018', + rsquo: '\u2019', + sbquo: '\u201A', + ldquo: '\u201C', + rdquo: '\u201D', + bdquo: '\u201E', + dagger: '\u2020', + Dagger: '\u2021', + bull: '\u2022', + hellip: '\u2026', + permil: '\u2030', + prime: '\u2032', + Prime: '\u2033', + lsaquo: '\u2039', + rsaquo: '\u203A', + oline: '\u203E', + frasl: '\u2044', + euro: '\u20AC', + image: '\u2111', + weierp: '\u2118', + real: '\u211C', + trade: '\u2122', + alefsym: '\u2135', + larr: '\u2190', + uarr: '\u2191', + rarr: '\u2192', + darr: '\u2193', + harr: '\u2194', + crarr: '\u21B5', + lArr: '\u21D0', + uArr: '\u21D1', + rArr: '\u21D2', + dArr: '\u21D3', + hArr: '\u21D4', + forall: '\u2200', + part: '\u2202', + exist: '\u2203', + empty: '\u2205', + nabla: '\u2207', + isin: '\u2208', + notin: '\u2209', + ni: '\u220B', + prod: '\u220F', + sum: '\u2211', + minus: '\u2212', + lowast: '\u2217', + radic: '\u221A', + prop: '\u221D', + infin: '\u221E', + ang: '\u2220', + and: '\u2227', + or: '\u2228', + cap: '\u2229', + cup: '\u222A', + 'int': '\u222B', + there4: '\u2234', + sim: '\u223C', + cong: '\u2245', + asymp: '\u2248', + ne: '\u2260', + equiv: '\u2261', + le: '\u2264', + ge: '\u2265', + sub: '\u2282', + sup: '\u2283', + nsub: '\u2284', + sube: '\u2286', + supe: '\u2287', + oplus: '\u2295', + otimes: '\u2297', + perp: '\u22A5', + sdot: '\u22C5', + lceil: '\u2308', + rceil: '\u2309', + lfloor: '\u230A', + rfloor: '\u230B', + lang: '\u2329', + rang: '\u232A', + loz: '\u25CA', + spades: '\u2660', + clubs: '\u2663', + hearts: '\u2665', + diams: '\u2666' +}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateKeywordUsage = exports.validSchemaType = exports.funcKeywordCode = exports.macroKeywordCode = void 0; -const codegen_1 = __nccwpck_require__(30972); -const names_1 = __nccwpck_require__(66662); -const code_1 = __nccwpck_require__(74532); -const errors_1 = __nccwpck_require__(75779); -function macroKeywordCode(cxt, def) { - const { gen, keyword, schema, parentSchema, it } = cxt; - const macroSchema = def.macro.call(it.self, schema, parentSchema, it); - const schemaRef = useKeyword(gen, keyword, macroSchema); - if (it.opts.validateSchema !== false) - it.self.validateSchema(macroSchema, true); - const valid = gen.name("valid"); - cxt.subschema({ - schema: macroSchema, - schemaPath: codegen_1.nil, - errSchemaPath: `${it.errSchemaPath}/${keyword}`, - topSchemaRef: schemaRef, - compositeRule: true, - }, valid); - cxt.pass(valid, () => cxt.error(true)); -} -exports.macroKeywordCode = macroKeywordCode; -function funcKeywordCode(cxt, def) { - var _a; - const { gen, keyword, schema, parentSchema, $data, it } = cxt; - checkAsyncKeyword(it, def); - const validate = !$data && def.compile ? def.compile.call(it.self, schema, parentSchema, it) : def.validate; - const validateRef = useKeyword(gen, keyword, validate); - const valid = gen.let("valid"); - cxt.block$data(valid, validateKeyword); - cxt.ok((_a = def.valid) !== null && _a !== void 0 ? _a : valid); - function validateKeyword() { - if (def.errors === false) { - assignValid(); - if (def.modifying) - modifyData(cxt); - reportErrs(() => cxt.error()); - } - else { - const ruleErrs = def.async ? validateAsync() : validateSync(); - if (def.modifying) - modifyData(cxt); - reportErrs(() => addErrs(cxt, ruleErrs)); - } - } - function validateAsync() { - const ruleErrs = gen.let("ruleErrs", null); - gen.try(() => assignValid((0, codegen_1._) `await `), (e) => gen.assign(valid, false).if((0, codegen_1._) `${e} instanceof ${it.ValidationError}`, () => gen.assign(ruleErrs, (0, codegen_1._) `${e}.errors`), () => gen.throw(e))); - return ruleErrs; - } - function validateSync() { - const validateErrs = (0, codegen_1._) `${validateRef}.errors`; - gen.assign(validateErrs, null); - assignValid(codegen_1.nil); - return validateErrs; - } - function assignValid(_await = def.async ? (0, codegen_1._) `await ` : codegen_1.nil) { - const passCxt = it.opts.passContext ? names_1.default.this : names_1.default.self; - const passSchema = !(("compile" in def && !$data) || def.schema === false); - gen.assign(valid, (0, codegen_1._) `${_await}${(0, code_1.callValidateCode)(cxt, validateRef, passCxt, passSchema)}`, def.modifying); - } - function reportErrs(errors) { - var _a; - gen.if((0, codegen_1.not)((_a = def.valid) !== null && _a !== void 0 ? _a : valid), errors); - } -} -exports.funcKeywordCode = funcKeywordCode; -function modifyData(cxt) { - const { gen, data, it } = cxt; - gen.if(it.parentData, () => gen.assign(data, (0, codegen_1._) `${it.parentData}[${it.parentDataProperty}]`)); -} -function addErrs(cxt, errs) { - const { gen } = cxt; - gen.if((0, codegen_1._) `Array.isArray(${errs})`, () => { - gen - .assign(names_1.default.vErrors, (0, codegen_1._) `${names_1.default.vErrors} === null ? ${errs} : ${names_1.default.vErrors}.concat(${errs})`) - .assign(names_1.default.errors, (0, codegen_1._) `${names_1.default.vErrors}.length`); - (0, errors_1.extendErrors)(cxt); - }, () => cxt.error()); -} -function checkAsyncKeyword({ schemaEnv }, def) { - if (def.async && !schemaEnv.$async) - throw new Error("async keyword in sync schema"); -} -function useKeyword(gen, keyword, result) { - if (result === undefined) - throw new Error(`keyword "${keyword}" failed to compile`); - return gen.scopeValue("keyword", typeof result == "function" ? { ref: result } : { ref: result, code: (0, codegen_1.stringify)(result) }); -} -function validSchemaType(schema, schemaType, allowUndefined = false) { - // TODO add tests - return (!schemaType.length || - schemaType.some((st) => st === "array" - ? Array.isArray(schema) - : st === "object" - ? schema && typeof schema == "object" && !Array.isArray(schema) - : typeof schema == st || (allowUndefined && typeof schema == "undefined"))); -} -exports.validSchemaType = validSchemaType; -function validateKeywordUsage({ schema, opts, self, errSchemaPath }, def, keyword) { - /* istanbul ignore if */ - if (Array.isArray(def.keyword) ? !def.keyword.includes(keyword) : def.keyword !== keyword) { - throw new Error("ajv implementation error"); - } - const deps = def.dependencies; - if (deps === null || deps === void 0 ? void 0 : deps.some((kwd) => !Object.prototype.hasOwnProperty.call(schema, kwd))) { - throw new Error(`parent schema must have dependencies of ${keyword}: ${deps.join(",")}`); - } - if (def.validateSchema) { - const valid = def.validateSchema(schema[keyword]); - if (!valid) { - const msg = `keyword "${keyword}" value is invalid at path "${errSchemaPath}": ` + - self.errorsText(def.validateSchema.errors); - if (opts.validateSchema === "log") - self.logger.error(msg); - else - throw new Error(msg); - } - } -} -exports.validateKeywordUsage = validateKeywordUsage; -//# sourceMappingURL=keyword.js.map /***/ }), -/***/ 13400: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 63615: +/***/ (function(__unused_webpack_module, exports) { +(function (global, factory) { + true ? factory(exports) : + 0; +})(this, (function (exports) { 'use strict'; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.extendSubschemaMode = exports.extendSubschemaData = exports.getSubschema = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -function getSubschema(it, { keyword, schemaProp, schema, schemaPath, errSchemaPath, topSchemaRef }) { - if (keyword !== undefined && schema !== undefined) { - throw new Error('both "keyword" and "schema" passed, only one allowed'); + // This file was generated. Do not modify manually! + var astralIdentifierCodes = [509, 0, 227, 0, 150, 4, 294, 9, 1368, 2, 2, 1, 6, 3, 41, 2, 5, 0, 166, 1, 574, 3, 9, 9, 7, 9, 32, 4, 318, 1, 80, 3, 71, 10, 50, 3, 123, 2, 54, 14, 32, 10, 3, 1, 11, 3, 46, 10, 8, 0, 46, 9, 7, 2, 37, 13, 2, 9, 6, 1, 45, 0, 13, 2, 49, 13, 9, 3, 2, 11, 83, 11, 7, 0, 3, 0, 158, 11, 6, 9, 7, 3, 56, 1, 2, 6, 3, 1, 3, 2, 10, 0, 11, 1, 3, 6, 4, 4, 68, 8, 2, 0, 3, 0, 2, 3, 2, 4, 2, 0, 15, 1, 83, 17, 10, 9, 5, 0, 82, 19, 13, 9, 214, 6, 3, 8, 28, 1, 83, 16, 16, 9, 82, 12, 9, 9, 7, 19, 58, 14, 5, 9, 243, 14, 166, 9, 71, 5, 2, 1, 3, 3, 2, 0, 2, 1, 13, 9, 120, 6, 3, 6, 4, 0, 29, 9, 41, 6, 2, 3, 9, 0, 10, 10, 47, 15, 343, 9, 54, 7, 2, 7, 17, 9, 57, 21, 2, 13, 123, 5, 4, 0, 2, 1, 2, 6, 2, 0, 9, 9, 49, 4, 2, 1, 2, 4, 9, 9, 330, 3, 10, 1, 2, 0, 49, 6, 4, 4, 14, 10, 5350, 0, 7, 14, 11465, 27, 2343, 9, 87, 9, 39, 4, 60, 6, 26, 9, 535, 9, 470, 0, 2, 54, 8, 3, 82, 0, 12, 1, 19628, 1, 4178, 9, 519, 45, 3, 22, 543, 4, 4, 5, 9, 7, 3, 6, 31, 3, 149, 2, 1418, 49, 513, 54, 5, 49, 9, 0, 15, 0, 23, 4, 2, 14, 1361, 6, 2, 16, 3, 6, 2, 1, 2, 4, 101, 0, 161, 6, 10, 9, 357, 0, 62, 13, 499, 13, 245, 1, 2, 9, 726, 6, 110, 6, 6, 9, 4759, 9, 787719, 239]; + + // This file was generated. Do not modify manually! + var astralIdentifierStartCodes = [0, 11, 2, 25, 2, 18, 2, 1, 2, 14, 3, 13, 35, 122, 70, 52, 268, 28, 4, 48, 48, 31, 14, 29, 6, 37, 11, 29, 3, 35, 5, 7, 2, 4, 43, 157, 19, 35, 5, 35, 5, 39, 9, 51, 13, 10, 2, 14, 2, 6, 2, 1, 2, 10, 2, 14, 2, 6, 2, 1, 4, 51, 13, 310, 10, 21, 11, 7, 25, 5, 2, 41, 2, 8, 70, 5, 3, 0, 2, 43, 2, 1, 4, 0, 3, 22, 11, 22, 10, 30, 66, 18, 2, 1, 11, 21, 11, 25, 71, 55, 7, 1, 65, 0, 16, 3, 2, 2, 2, 28, 43, 28, 4, 28, 36, 7, 2, 27, 28, 53, 11, 21, 11, 18, 14, 17, 111, 72, 56, 50, 14, 50, 14, 35, 39, 27, 10, 22, 251, 41, 7, 1, 17, 2, 60, 28, 11, 0, 9, 21, 43, 17, 47, 20, 28, 22, 13, 52, 58, 1, 3, 0, 14, 44, 33, 24, 27, 35, 30, 0, 3, 0, 9, 34, 4, 0, 13, 47, 15, 3, 22, 0, 2, 0, 36, 17, 2, 24, 20, 1, 64, 6, 2, 0, 2, 3, 2, 14, 2, 9, 8, 46, 39, 7, 3, 1, 3, 21, 2, 6, 2, 1, 2, 4, 4, 0, 19, 0, 13, 4, 31, 9, 2, 0, 3, 0, 2, 37, 2, 0, 26, 0, 2, 0, 45, 52, 19, 3, 21, 2, 31, 47, 21, 1, 2, 0, 185, 46, 42, 3, 37, 47, 21, 0, 60, 42, 14, 0, 72, 26, 38, 6, 186, 43, 117, 63, 32, 7, 3, 0, 3, 7, 2, 1, 2, 23, 16, 0, 2, 0, 95, 7, 3, 38, 17, 0, 2, 0, 29, 0, 11, 39, 8, 0, 22, 0, 12, 45, 20, 0, 19, 72, 200, 32, 32, 8, 2, 36, 18, 0, 50, 29, 113, 6, 2, 1, 2, 37, 22, 0, 26, 5, 2, 1, 2, 31, 15, 0, 328, 18, 16, 0, 2, 12, 2, 33, 125, 0, 80, 921, 103, 110, 18, 195, 2637, 96, 16, 1071, 18, 5, 26, 3994, 6, 582, 6842, 29, 1763, 568, 8, 30, 18, 78, 18, 29, 19, 47, 17, 3, 32, 20, 6, 18, 433, 44, 212, 63, 129, 74, 6, 0, 67, 12, 65, 1, 2, 0, 29, 6135, 9, 1237, 42, 9, 8936, 3, 2, 6, 2, 1, 2, 290, 16, 0, 30, 2, 3, 0, 15, 3, 9, 395, 2309, 106, 6, 12, 4, 8, 8, 9, 5991, 84, 2, 70, 2, 1, 3, 0, 3, 1, 3, 3, 2, 11, 2, 0, 2, 6, 2, 64, 2, 3, 3, 7, 2, 6, 2, 27, 2, 3, 2, 4, 2, 0, 4, 6, 2, 339, 3, 24, 2, 24, 2, 30, 2, 24, 2, 30, 2, 24, 2, 30, 2, 24, 2, 30, 2, 24, 2, 7, 1845, 30, 7, 5, 262, 61, 147, 44, 11, 6, 17, 0, 322, 29, 19, 43, 485, 27, 229, 29, 3, 0, 496, 6, 2, 3, 2, 1, 2, 14, 2, 196, 60, 67, 8, 0, 1205, 3, 2, 26, 2, 1, 2, 0, 3, 0, 2, 9, 2, 3, 2, 0, 2, 0, 7, 0, 5, 0, 2, 0, 2, 0, 2, 2, 2, 1, 2, 0, 3, 0, 2, 0, 2, 0, 2, 0, 2, 0, 2, 1, 2, 0, 3, 3, 2, 6, 2, 3, 2, 3, 2, 0, 2, 9, 2, 16, 6, 2, 2, 4, 2, 16, 4421, 42719, 33, 4153, 7, 221, 3, 5761, 15, 7472, 16, 621, 2467, 541, 1507, 4938, 6, 4191]; + + // This file was generated. Do not modify manually! + var nonASCIIidentifierChars = "\u200c\u200d\xb7\u0300-\u036f\u0387\u0483-\u0487\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u0669\u0670\u06d6-\u06dc\u06df-\u06e4\u06e7\u06e8\u06ea-\u06ed\u06f0-\u06f9\u0711\u0730-\u074a\u07a6-\u07b0\u07c0-\u07c9\u07eb-\u07f3\u07fd\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0859-\u085b\u0897-\u089f\u08ca-\u08e1\u08e3-\u0903\u093a-\u093c\u093e-\u094f\u0951-\u0957\u0962\u0963\u0966-\u096f\u0981-\u0983\u09bc\u09be-\u09c4\u09c7\u09c8\u09cb-\u09cd\u09d7\u09e2\u09e3\u09e6-\u09ef\u09fe\u0a01-\u0a03\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a66-\u0a71\u0a75\u0a81-\u0a83\u0abc\u0abe-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ae2\u0ae3\u0ae6-\u0aef\u0afa-\u0aff\u0b01-\u0b03\u0b3c\u0b3e-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b55-\u0b57\u0b62\u0b63\u0b66-\u0b6f\u0b82\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd7\u0be6-\u0bef\u0c00-\u0c04\u0c3c\u0c3e-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0c66-\u0c6f\u0c81-\u0c83\u0cbc\u0cbe-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0ce6-\u0cef\u0cf3\u0d00-\u0d03\u0d3b\u0d3c\u0d3e-\u0d44\u0d46-\u0d48\u0d4a-\u0d4d\u0d57\u0d62\u0d63\u0d66-\u0d6f\u0d81-\u0d83\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0de6-\u0def\u0df2\u0df3\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0e50-\u0e59\u0eb1\u0eb4-\u0ebc\u0ec8-\u0ece\u0ed0-\u0ed9\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e\u0f3f\u0f71-\u0f84\u0f86\u0f87\u0f8d-\u0f97\u0f99-\u0fbc\u0fc6\u102b-\u103e\u1040-\u1049\u1056-\u1059\u105e-\u1060\u1062-\u1064\u1067-\u106d\u1071-\u1074\u1082-\u108d\u108f-\u109d\u135d-\u135f\u1369-\u1371\u1712-\u1715\u1732-\u1734\u1752\u1753\u1772\u1773\u17b4-\u17d3\u17dd\u17e0-\u17e9\u180b-\u180d\u180f-\u1819\u18a9\u1920-\u192b\u1930-\u193b\u1946-\u194f\u19d0-\u19da\u1a17-\u1a1b\u1a55-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1ab0-\u1abd\u1abf-\u1ace\u1b00-\u1b04\u1b34-\u1b44\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1b82\u1ba1-\u1bad\u1bb0-\u1bb9\u1be6-\u1bf3\u1c24-\u1c37\u1c40-\u1c49\u1c50-\u1c59\u1cd0-\u1cd2\u1cd4-\u1ce8\u1ced\u1cf4\u1cf7-\u1cf9\u1dc0-\u1dff\u200c\u200d\u203f\u2040\u2054\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2cef-\u2cf1\u2d7f\u2de0-\u2dff\u302a-\u302f\u3099\u309a\u30fb\ua620-\ua629\ua66f\ua674-\ua67d\ua69e\ua69f\ua6f0\ua6f1\ua802\ua806\ua80b\ua823-\ua827\ua82c\ua880\ua881\ua8b4-\ua8c5\ua8d0-\ua8d9\ua8e0-\ua8f1\ua8ff-\ua909\ua926-\ua92d\ua947-\ua953\ua980-\ua983\ua9b3-\ua9c0\ua9d0-\ua9d9\ua9e5\ua9f0-\ua9f9\uaa29-\uaa36\uaa43\uaa4c\uaa4d\uaa50-\uaa59\uaa7b-\uaa7d\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uaaeb-\uaaef\uaaf5\uaaf6\uabe3-\uabea\uabec\uabed\uabf0-\uabf9\ufb1e\ufe00-\ufe0f\ufe20-\ufe2f\ufe33\ufe34\ufe4d-\ufe4f\uff10-\uff19\uff3f\uff65"; + + // This file was generated. Do not modify manually! + var nonASCIIidentifierStartChars = "\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u037f\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u052f\u0531-\u0556\u0559\u0560-\u0588\u05d0-\u05ea\u05ef-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u0860-\u086a\u0870-\u0887\u0889-\u088e\u08a0-\u08c9\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u09fc\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0af9\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c39\u0c3d\u0c58-\u0c5a\u0c5d\u0c60\u0c61\u0c80\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cdd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d04-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d54-\u0d56\u0d5f-\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e86-\u0e8a\u0e8c-\u0ea3\u0ea5\u0ea7-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f5\u13f8-\u13fd\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f8\u1700-\u1711\u171f-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1878\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191e\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4c\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1c80-\u1c8a\u1c90-\u1cba\u1cbd-\u1cbf\u1ce9-\u1cec\u1cee-\u1cf3\u1cf5\u1cf6\u1cfa\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2118-\u211d\u2124\u2126\u2128\u212a-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309b-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312f\u3131-\u318e\u31a0-\u31bf\u31f0-\u31ff\u3400-\u4dbf\u4e00-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua69d\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua7cd\ua7d0\ua7d1\ua7d3\ua7d5-\ua7dc\ua7f2-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua8fd\ua8fe\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\ua9e0-\ua9e4\ua9e6-\ua9ef\ua9fa-\ua9fe\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa7e-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uab30-\uab5a\uab5c-\uab69\uab70-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc"; + + // These are a run-length and offset encoded representation of the + // >0xffff code points that are a valid part of identifiers. The + // offset starts at 0x10000, and each pair of numbers represents an + // offset to the next range, and then a size of the range. + + // Reserved word lists for various dialects of the language + + var reservedWords = { + 3: "abstract boolean byte char class double enum export extends final float goto implements import int interface long native package private protected public short static super synchronized throws transient volatile", + 5: "class enum extends super const export import", + 6: "enum", + strict: "implements interface let package private protected public static yield", + strictBind: "eval arguments" + }; + + // And the keywords + + var ecma5AndLessKeywords = "break case catch continue debugger default do else finally for function if return switch throw try var while with null true false instanceof typeof void delete new in this"; + + var keywords$1 = { + 5: ecma5AndLessKeywords, + "5module": ecma5AndLessKeywords + " export import", + 6: ecma5AndLessKeywords + " const class extends export import super" + }; + + var keywordRelationalOperator = /^in(stanceof)?$/; + + // ## Character categories + + var nonASCIIidentifierStart = new RegExp("[" + nonASCIIidentifierStartChars + "]"); + var nonASCIIidentifier = new RegExp("[" + nonASCIIidentifierStartChars + nonASCIIidentifierChars + "]"); + + // This has a complexity linear to the value of the code. The + // assumption is that looking up astral identifier characters is + // rare. + function isInAstralSet(code, set) { + var pos = 0x10000; + for (var i = 0; i < set.length; i += 2) { + pos += set[i]; + if (pos > code) { return false } + pos += set[i + 1]; + if (pos >= code) { return true } } - if (keyword !== undefined) { - const sch = it.schema[keyword]; - return schemaProp === undefined - ? { - schema: sch, - schemaPath: (0, codegen_1._) `${it.schemaPath}${(0, codegen_1.getProperty)(keyword)}`, - errSchemaPath: `${it.errSchemaPath}/${keyword}`, - } - : { - schema: sch[schemaProp], - schemaPath: (0, codegen_1._) `${it.schemaPath}${(0, codegen_1.getProperty)(keyword)}${(0, codegen_1.getProperty)(schemaProp)}`, - errSchemaPath: `${it.errSchemaPath}/${keyword}/${(0, util_1.escapeFragment)(schemaProp)}`, - }; + return false + } + + // Test whether a given character code starts an identifier. + + function isIdentifierStart(code, astral) { + if (code < 65) { return code === 36 } + if (code < 91) { return true } + if (code < 97) { return code === 95 } + if (code < 123) { return true } + if (code <= 0xffff) { return code >= 0xaa && nonASCIIidentifierStart.test(String.fromCharCode(code)) } + if (astral === false) { return false } + return isInAstralSet(code, astralIdentifierStartCodes) + } + + // Test whether a given character is part of an identifier. + + function isIdentifierChar(code, astral) { + if (code < 48) { return code === 36 } + if (code < 58) { return true } + if (code < 65) { return false } + if (code < 91) { return true } + if (code < 97) { return code === 95 } + if (code < 123) { return true } + if (code <= 0xffff) { return code >= 0xaa && nonASCIIidentifier.test(String.fromCharCode(code)) } + if (astral === false) { return false } + return isInAstralSet(code, astralIdentifierStartCodes) || isInAstralSet(code, astralIdentifierCodes) + } + + // ## Token types + + // The assignment of fine-grained, information-carrying type objects + // allows the tokenizer to store the information it has about a + // token in a way that is very cheap for the parser to look up. + + // All token type variables start with an underscore, to make them + // easy to recognize. + + // The `beforeExpr` property is used to disambiguate between regular + // expressions and divisions. It is set on all token types that can + // be followed by an expression (thus, a slash after them would be a + // regular expression). + // + // The `startsExpr` property is used to check if the token ends a + // `yield` expression. It is set on all token types that either can + // directly start an expression (like a quotation mark) or can + // continue an expression (like the body of a string). + // + // `isLoop` marks a keyword as starting a loop, which is important + // to know when parsing a label, in order to allow or disallow + // continue jumps to that label. + + var TokenType = function TokenType(label, conf) { + if ( conf === void 0 ) conf = {}; + + this.label = label; + this.keyword = conf.keyword; + this.beforeExpr = !!conf.beforeExpr; + this.startsExpr = !!conf.startsExpr; + this.isLoop = !!conf.isLoop; + this.isAssign = !!conf.isAssign; + this.prefix = !!conf.prefix; + this.postfix = !!conf.postfix; + this.binop = conf.binop || null; + this.updateContext = null; + }; + + function binop(name, prec) { + return new TokenType(name, {beforeExpr: true, binop: prec}) + } + var beforeExpr = {beforeExpr: true}, startsExpr = {startsExpr: true}; + + // Map keyword names to token types. + + var keywords = {}; + + // Succinct definitions of keyword token types + function kw(name, options) { + if ( options === void 0 ) options = {}; + + options.keyword = name; + return keywords[name] = new TokenType(name, options) + } + + var types$1 = { + num: new TokenType("num", startsExpr), + regexp: new TokenType("regexp", startsExpr), + string: new TokenType("string", startsExpr), + name: new TokenType("name", startsExpr), + privateId: new TokenType("privateId", startsExpr), + eof: new TokenType("eof"), + + // Punctuation token types. + bracketL: new TokenType("[", {beforeExpr: true, startsExpr: true}), + bracketR: new TokenType("]"), + braceL: new TokenType("{", {beforeExpr: true, startsExpr: true}), + braceR: new TokenType("}"), + parenL: new TokenType("(", {beforeExpr: true, startsExpr: true}), + parenR: new TokenType(")"), + comma: new TokenType(",", beforeExpr), + semi: new TokenType(";", beforeExpr), + colon: new TokenType(":", beforeExpr), + dot: new TokenType("."), + question: new TokenType("?", beforeExpr), + questionDot: new TokenType("?."), + arrow: new TokenType("=>", beforeExpr), + template: new TokenType("template"), + invalidTemplate: new TokenType("invalidTemplate"), + ellipsis: new TokenType("...", beforeExpr), + backQuote: new TokenType("`", startsExpr), + dollarBraceL: new TokenType("${", {beforeExpr: true, startsExpr: true}), + + // Operators. These carry several kinds of properties to help the + // parser use them properly (the presence of these properties is + // what categorizes them as operators). + // + // `binop`, when present, specifies that this operator is a binary + // operator, and will refer to its precedence. + // + // `prefix` and `postfix` mark the operator as a prefix or postfix + // unary operator. + // + // `isAssign` marks all of `=`, `+=`, `-=` etcetera, which act as + // binary operators with a very low precedence, that should result + // in AssignmentExpression nodes. + + eq: new TokenType("=", {beforeExpr: true, isAssign: true}), + assign: new TokenType("_=", {beforeExpr: true, isAssign: true}), + incDec: new TokenType("++/--", {prefix: true, postfix: true, startsExpr: true}), + prefix: new TokenType("!/~", {beforeExpr: true, prefix: true, startsExpr: true}), + logicalOR: binop("||", 1), + logicalAND: binop("&&", 2), + bitwiseOR: binop("|", 3), + bitwiseXOR: binop("^", 4), + bitwiseAND: binop("&", 5), + equality: binop("==/!=/===/!==", 6), + relational: binop("/<=/>=", 7), + bitShift: binop("<>/>>>", 8), + plusMin: new TokenType("+/-", {beforeExpr: true, binop: 9, prefix: true, startsExpr: true}), + modulo: binop("%", 10), + star: binop("*", 10), + slash: binop("/", 10), + starstar: new TokenType("**", {beforeExpr: true}), + coalesce: binop("??", 1), + + // Keyword token types. + _break: kw("break"), + _case: kw("case", beforeExpr), + _catch: kw("catch"), + _continue: kw("continue"), + _debugger: kw("debugger"), + _default: kw("default", beforeExpr), + _do: kw("do", {isLoop: true, beforeExpr: true}), + _else: kw("else", beforeExpr), + _finally: kw("finally"), + _for: kw("for", {isLoop: true}), + _function: kw("function", startsExpr), + _if: kw("if"), + _return: kw("return", beforeExpr), + _switch: kw("switch"), + _throw: kw("throw", beforeExpr), + _try: kw("try"), + _var: kw("var"), + _const: kw("const"), + _while: kw("while", {isLoop: true}), + _with: kw("with"), + _new: kw("new", {beforeExpr: true, startsExpr: true}), + _this: kw("this", startsExpr), + _super: kw("super", startsExpr), + _class: kw("class", startsExpr), + _extends: kw("extends", beforeExpr), + _export: kw("export"), + _import: kw("import", startsExpr), + _null: kw("null", startsExpr), + _true: kw("true", startsExpr), + _false: kw("false", startsExpr), + _in: kw("in", {beforeExpr: true, binop: 7}), + _instanceof: kw("instanceof", {beforeExpr: true, binop: 7}), + _typeof: kw("typeof", {beforeExpr: true, prefix: true, startsExpr: true}), + _void: kw("void", {beforeExpr: true, prefix: true, startsExpr: true}), + _delete: kw("delete", {beforeExpr: true, prefix: true, startsExpr: true}) + }; + + // Matches a whole line break (where CRLF is considered a single + // line break). Used to count lines. + + var lineBreak = /\r\n?|\n|\u2028|\u2029/; + var lineBreakG = new RegExp(lineBreak.source, "g"); + + function isNewLine(code) { + return code === 10 || code === 13 || code === 0x2028 || code === 0x2029 + } + + function nextLineBreak(code, from, end) { + if ( end === void 0 ) end = code.length; + + for (var i = from; i < end; i++) { + var next = code.charCodeAt(i); + if (isNewLine(next)) + { return i < end - 1 && next === 13 && code.charCodeAt(i + 1) === 10 ? i + 2 : i + 1 } } - if (schema !== undefined) { - if (schemaPath === undefined || errSchemaPath === undefined || topSchemaRef === undefined) { - throw new Error('"schemaPath", "errSchemaPath" and "topSchemaRef" are required with "schema"'); - } - return { - schema, - schemaPath, - topSchemaRef, - errSchemaPath, - }; + return -1 + } + + var nonASCIIwhitespace = /[\u1680\u2000-\u200a\u202f\u205f\u3000\ufeff]/; + + var skipWhiteSpace = /(?:\s|\/\/.*|\/\*[^]*?\*\/)*/g; + + var ref = Object.prototype; + var hasOwnProperty = ref.hasOwnProperty; + var toString = ref.toString; + + var hasOwn = Object.hasOwn || (function (obj, propName) { return ( + hasOwnProperty.call(obj, propName) + ); }); + + var isArray = Array.isArray || (function (obj) { return ( + toString.call(obj) === "[object Array]" + ); }); + + var regexpCache = Object.create(null); + + function wordsRegexp(words) { + return regexpCache[words] || (regexpCache[words] = new RegExp("^(?:" + words.replace(/ /g, "|") + ")$")) + } + + function codePointToString(code) { + // UTF-16 Decoding + if (code <= 0xFFFF) { return String.fromCharCode(code) } + code -= 0x10000; + return String.fromCharCode((code >> 10) + 0xD800, (code & 1023) + 0xDC00) + } + + var loneSurrogate = /(?:[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])/; + + // These are used when `options.locations` is on, for the + // `startLoc` and `endLoc` properties. + + var Position = function Position(line, col) { + this.line = line; + this.column = col; + }; + + Position.prototype.offset = function offset (n) { + return new Position(this.line, this.column + n) + }; + + var SourceLocation = function SourceLocation(p, start, end) { + this.start = start; + this.end = end; + if (p.sourceFile !== null) { this.source = p.sourceFile; } + }; + + // The `getLineInfo` function is mostly useful when the + // `locations` option is off (for performance reasons) and you + // want to find the line/column position for a given character + // offset. `input` should be the code string that the offset refers + // into. + + function getLineInfo(input, offset) { + for (var line = 1, cur = 0;;) { + var nextBreak = nextLineBreak(input, cur, offset); + if (nextBreak < 0) { return new Position(line, offset - cur) } + ++line; + cur = nextBreak; } - throw new Error('either "keyword" or "schema" must be passed'); -} -exports.getSubschema = getSubschema; -function extendSubschemaData(subschema, it, { dataProp, dataPropType: dpType, data, dataTypes, propertyName }) { - if (data !== undefined && dataProp !== undefined) { - throw new Error('both "data" and "dataProp" passed, only one allowed'); + } + + // A second argument must be given to configure the parser process. + // These options are recognized (only `ecmaVersion` is required): + + var defaultOptions = { + // `ecmaVersion` indicates the ECMAScript version to parse. Must be + // either 3, 5, 6 (or 2015), 7 (2016), 8 (2017), 9 (2018), 10 + // (2019), 11 (2020), 12 (2021), 13 (2022), 14 (2023), or `"latest"` + // (the latest version the library supports). This influences + // support for strict mode, the set of reserved words, and support + // for new syntax features. + ecmaVersion: null, + // `sourceType` indicates the mode the code should be parsed in. + // Can be either `"script"` or `"module"`. This influences global + // strict mode and parsing of `import` and `export` declarations. + sourceType: "script", + // `onInsertedSemicolon` can be a callback that will be called when + // a semicolon is automatically inserted. It will be passed the + // position of the inserted semicolon as an offset, and if + // `locations` is enabled, it is given the location as a `{line, + // column}` object as second argument. + onInsertedSemicolon: null, + // `onTrailingComma` is similar to `onInsertedSemicolon`, but for + // trailing commas. + onTrailingComma: null, + // By default, reserved words are only enforced if ecmaVersion >= 5. + // Set `allowReserved` to a boolean value to explicitly turn this on + // an off. When this option has the value "never", reserved words + // and keywords can also not be used as property names. + allowReserved: null, + // When enabled, a return at the top level is not considered an + // error. + allowReturnOutsideFunction: false, + // When enabled, import/export statements are not constrained to + // appearing at the top of the program, and an import.meta expression + // in a script isn't considered an error. + allowImportExportEverywhere: false, + // By default, await identifiers are allowed to appear at the top-level scope only if ecmaVersion >= 2022. + // When enabled, await identifiers are allowed to appear at the top-level scope, + // but they are still not allowed in non-async functions. + allowAwaitOutsideFunction: null, + // When enabled, super identifiers are not constrained to + // appearing in methods and do not raise an error when they appear elsewhere. + allowSuperOutsideMethod: null, + // When enabled, hashbang directive in the beginning of file is + // allowed and treated as a line comment. Enabled by default when + // `ecmaVersion` >= 2023. + allowHashBang: false, + // By default, the parser will verify that private properties are + // only used in places where they are valid and have been declared. + // Set this to false to turn such checks off. + checkPrivateFields: true, + // When `locations` is on, `loc` properties holding objects with + // `start` and `end` properties in `{line, column}` form (with + // line being 1-based and column 0-based) will be attached to the + // nodes. + locations: false, + // A function can be passed as `onToken` option, which will + // cause Acorn to call that function with object in the same + // format as tokens returned from `tokenizer().getToken()`. Note + // that you are not allowed to call the parser from the + // callback—that will corrupt its internal state. + onToken: null, + // A function can be passed as `onComment` option, which will + // cause Acorn to call that function with `(block, text, start, + // end)` parameters whenever a comment is skipped. `block` is a + // boolean indicating whether this is a block (`/* */`) comment, + // `text` is the content of the comment, and `start` and `end` are + // character offsets that denote the start and end of the comment. + // When the `locations` option is on, two more parameters are + // passed, the full `{line, column}` locations of the start and + // end of the comments. Note that you are not allowed to call the + // parser from the callback—that will corrupt its internal state. + // When this option has an array as value, objects representing the + // comments are pushed to it. + onComment: null, + // Nodes have their start and end characters offsets recorded in + // `start` and `end` properties (directly on the node, rather than + // the `loc` object, which holds line/column data. To also add a + // [semi-standardized][range] `range` property holding a `[start, + // end]` array with the same numbers, set the `ranges` option to + // `true`. + // + // [range]: https://bugzilla.mozilla.org/show_bug.cgi?id=745678 + ranges: false, + // It is possible to parse multiple files into a single AST by + // passing the tree produced by parsing the first file as + // `program` option in subsequent parses. This will add the + // toplevel forms of the parsed file to the `Program` (top) node + // of an existing parse tree. + program: null, + // When `locations` is on, you can pass this to record the source + // file in every node's `loc` object. + sourceFile: null, + // This value, if given, is stored in every node, whether + // `locations` is on or off. + directSourceFile: null, + // When enabled, parenthesized expressions are represented by + // (non-standard) ParenthesizedExpression nodes + preserveParens: false + }; + + // Interpret and default an options object + + var warnedAboutEcmaVersion = false; + + function getOptions(opts) { + var options = {}; + + for (var opt in defaultOptions) + { options[opt] = opts && hasOwn(opts, opt) ? opts[opt] : defaultOptions[opt]; } + + if (options.ecmaVersion === "latest") { + options.ecmaVersion = 1e8; + } else if (options.ecmaVersion == null) { + if (!warnedAboutEcmaVersion && typeof console === "object" && console.warn) { + warnedAboutEcmaVersion = true; + console.warn("Since Acorn 8.0.0, options.ecmaVersion is required.\nDefaulting to 2020, but this will stop working in the future."); + } + options.ecmaVersion = 11; + } else if (options.ecmaVersion >= 2015) { + options.ecmaVersion -= 2009; } - const { gen } = it; - if (dataProp !== undefined) { - const { errorPath, dataPathArr, opts } = it; - const nextData = gen.let("data", (0, codegen_1._) `${it.data}${(0, codegen_1.getProperty)(dataProp)}`, true); - dataContextProps(nextData); - subschema.errorPath = (0, codegen_1.str) `${errorPath}${(0, util_1.getErrorPath)(dataProp, dpType, opts.jsPropertySyntax)}`; - subschema.parentDataProperty = (0, codegen_1._) `${dataProp}`; - subschema.dataPathArr = [...dataPathArr, subschema.parentDataProperty]; + + if (options.allowReserved == null) + { options.allowReserved = options.ecmaVersion < 5; } + + if (!opts || opts.allowHashBang == null) + { options.allowHashBang = options.ecmaVersion >= 14; } + + if (isArray(options.onToken)) { + var tokens = options.onToken; + options.onToken = function (token) { return tokens.push(token); }; } - if (data !== undefined) { - const nextData = data instanceof codegen_1.Name ? data : gen.let("data", data, true); // replaceable if used once? - dataContextProps(nextData); - if (propertyName !== undefined) - subschema.propertyName = propertyName; - // TODO something is possibly wrong here with not changing parentDataProperty and not appending dataPathArr + if (isArray(options.onComment)) + { options.onComment = pushComment(options, options.onComment); } + + return options + } + + function pushComment(options, array) { + return function(block, text, start, end, startLoc, endLoc) { + var comment = { + type: block ? "Block" : "Line", + value: text, + start: start, + end: end + }; + if (options.locations) + { comment.loc = new SourceLocation(this, startLoc, endLoc); } + if (options.ranges) + { comment.range = [start, end]; } + array.push(comment); } - if (dataTypes) - subschema.dataTypes = dataTypes; - function dataContextProps(_nextData) { - subschema.data = _nextData; - subschema.dataLevel = it.dataLevel + 1; - subschema.dataTypes = []; - it.definedProperties = new Set(); - subschema.parentData = it.data; - subschema.dataNames = [...it.dataNames, _nextData]; + } + + // Each scope gets a bitset that may contain these flags + var + SCOPE_TOP = 1, + SCOPE_FUNCTION = 2, + SCOPE_ASYNC = 4, + SCOPE_GENERATOR = 8, + SCOPE_ARROW = 16, + SCOPE_SIMPLE_CATCH = 32, + SCOPE_SUPER = 64, + SCOPE_DIRECT_SUPER = 128, + SCOPE_CLASS_STATIC_BLOCK = 256, + SCOPE_VAR = SCOPE_TOP | SCOPE_FUNCTION | SCOPE_CLASS_STATIC_BLOCK; + + function functionFlags(async, generator) { + return SCOPE_FUNCTION | (async ? SCOPE_ASYNC : 0) | (generator ? SCOPE_GENERATOR : 0) + } + + // Used in checkLVal* and declareName to determine the type of a binding + var + BIND_NONE = 0, // Not a binding + BIND_VAR = 1, // Var-style binding + BIND_LEXICAL = 2, // Let- or const-style binding + BIND_FUNCTION = 3, // Function declaration + BIND_SIMPLE_CATCH = 4, // Simple (identifier pattern) catch binding + BIND_OUTSIDE = 5; // Special case for function names as bound inside the function + + var Parser = function Parser(options, input, startPos) { + this.options = options = getOptions(options); + this.sourceFile = options.sourceFile; + this.keywords = wordsRegexp(keywords$1[options.ecmaVersion >= 6 ? 6 : options.sourceType === "module" ? "5module" : 5]); + var reserved = ""; + if (options.allowReserved !== true) { + reserved = reservedWords[options.ecmaVersion >= 6 ? 6 : options.ecmaVersion === 5 ? 5 : 3]; + if (options.sourceType === "module") { reserved += " await"; } } -} -exports.extendSubschemaData = extendSubschemaData; -function extendSubschemaMode(subschema, { jtdDiscriminator, jtdMetadata, compositeRule, createErrors, allErrors }) { - if (compositeRule !== undefined) - subschema.compositeRule = compositeRule; - if (createErrors !== undefined) - subschema.createErrors = createErrors; - if (allErrors !== undefined) - subschema.allErrors = allErrors; - subschema.jtdDiscriminator = jtdDiscriminator; // not inherited - subschema.jtdMetadata = jtdMetadata; // not inherited -} -exports.extendSubschemaMode = extendSubschemaMode; -//# sourceMappingURL=subschema.js.map + this.reservedWords = wordsRegexp(reserved); + var reservedStrict = (reserved ? reserved + " " : "") + reservedWords.strict; + this.reservedWordsStrict = wordsRegexp(reservedStrict); + this.reservedWordsStrictBind = wordsRegexp(reservedStrict + " " + reservedWords.strictBind); + this.input = String(input); -/***/ }), + // Used to signal to callers of `readWord1` whether the word + // contained any escape sequences. This is needed because words with + // escape sequences must not be interpreted as keywords. + this.containsEsc = false; -/***/ 48629: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Set up token state + // The current position of the tokenizer in the input. + if (startPos) { + this.pos = startPos; + this.lineStart = this.input.lastIndexOf("\n", startPos - 1) + 1; + this.curLine = this.input.slice(0, this.lineStart).split(lineBreak).length; + } else { + this.pos = this.lineStart = 0; + this.curLine = 1; + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CodeGen = exports.Name = exports.nil = exports.stringify = exports.str = exports._ = exports.KeywordCxt = void 0; -var validate_1 = __nccwpck_require__(26345); -Object.defineProperty(exports, "KeywordCxt", ({ enumerable: true, get: function () { return validate_1.KeywordCxt; } })); -var codegen_1 = __nccwpck_require__(30972); -Object.defineProperty(exports, "_", ({ enumerable: true, get: function () { return codegen_1._; } })); -Object.defineProperty(exports, "str", ({ enumerable: true, get: function () { return codegen_1.str; } })); -Object.defineProperty(exports, "stringify", ({ enumerable: true, get: function () { return codegen_1.stringify; } })); -Object.defineProperty(exports, "nil", ({ enumerable: true, get: function () { return codegen_1.nil; } })); -Object.defineProperty(exports, "Name", ({ enumerable: true, get: function () { return codegen_1.Name; } })); -Object.defineProperty(exports, "CodeGen", ({ enumerable: true, get: function () { return codegen_1.CodeGen; } })); -const validation_error_1 = __nccwpck_require__(71645); -const ref_error_1 = __nccwpck_require__(36938); -const rules_1 = __nccwpck_require__(72537); -const compile_1 = __nccwpck_require__(36222); -const codegen_2 = __nccwpck_require__(30972); -const resolve_1 = __nccwpck_require__(7834); -const dataType_1 = __nccwpck_require__(4701); -const util_1 = __nccwpck_require__(87120); -const $dataRefSchema = __nccwpck_require__(91785); -const uri_1 = __nccwpck_require__(72509); -const defaultRegExp = (str, flags) => new RegExp(str, flags); -defaultRegExp.code = "new RegExp"; -const META_IGNORE_OPTIONS = ["removeAdditional", "useDefaults", "coerceTypes"]; -const EXT_SCOPE_NAMES = new Set([ - "validate", - "serialize", - "parse", - "wrapper", - "root", - "schema", - "keyword", - "pattern", - "formats", - "validate$data", - "func", - "obj", - "Error", -]); -const removedOptions = { - errorDataPath: "", - format: "`validateFormats: false` can be used instead.", - nullable: '"nullable" keyword is supported by default.', - jsonPointers: "Deprecated jsPropertySyntax can be used instead.", - extendRefs: "Deprecated ignoreKeywordsWithRef can be used instead.", - missingRefs: "Pass empty schema with $id that should be ignored to ajv.addSchema.", - processCode: "Use option `code: {process: (code, schemaEnv: object) => string}`", - sourceCode: "Use option `code: {source: true}`", - strictDefaults: "It is default now, see option `strict`.", - strictKeywords: "It is default now, see option `strict`.", - uniqueItems: '"uniqueItems" keyword is always validated.', - unknownFormats: "Disable strict mode or pass `true` to `ajv.addFormat` (or `formats` option).", - cache: "Map is used as cache, schema object as key.", - serialize: "Map is used as cache, schema object as key.", - ajvErrors: "It is default now.", -}; -const deprecatedOptions = { - ignoreKeywordsWithRef: "", - jsPropertySyntax: "", - unicode: '"minLength"/"maxLength" account for unicode characters by default.', -}; -const MAX_EXPRESSION = 200; -// eslint-disable-next-line complexity -function requiredOptions(o) { - var _a, _b, _c, _d, _e, _f, _g, _h, _j, _k, _l, _m, _o, _p, _q, _r, _s, _t, _u, _v, _w, _x, _y, _z, _0; - const s = o.strict; - const _optz = (_a = o.code) === null || _a === void 0 ? void 0 : _a.optimize; - const optimize = _optz === true || _optz === undefined ? 1 : _optz || 0; - const regExp = (_c = (_b = o.code) === null || _b === void 0 ? void 0 : _b.regExp) !== null && _c !== void 0 ? _c : defaultRegExp; - const uriResolver = (_d = o.uriResolver) !== null && _d !== void 0 ? _d : uri_1.default; - return { - strictSchema: (_f = (_e = o.strictSchema) !== null && _e !== void 0 ? _e : s) !== null && _f !== void 0 ? _f : true, - strictNumbers: (_h = (_g = o.strictNumbers) !== null && _g !== void 0 ? _g : s) !== null && _h !== void 0 ? _h : true, - strictTypes: (_k = (_j = o.strictTypes) !== null && _j !== void 0 ? _j : s) !== null && _k !== void 0 ? _k : "log", - strictTuples: (_m = (_l = o.strictTuples) !== null && _l !== void 0 ? _l : s) !== null && _m !== void 0 ? _m : "log", - strictRequired: (_p = (_o = o.strictRequired) !== null && _o !== void 0 ? _o : s) !== null && _p !== void 0 ? _p : false, - code: o.code ? { ...o.code, optimize, regExp } : { optimize, regExp }, - loopRequired: (_q = o.loopRequired) !== null && _q !== void 0 ? _q : MAX_EXPRESSION, - loopEnum: (_r = o.loopEnum) !== null && _r !== void 0 ? _r : MAX_EXPRESSION, - meta: (_s = o.meta) !== null && _s !== void 0 ? _s : true, - messages: (_t = o.messages) !== null && _t !== void 0 ? _t : true, - inlineRefs: (_u = o.inlineRefs) !== null && _u !== void 0 ? _u : true, - schemaId: (_v = o.schemaId) !== null && _v !== void 0 ? _v : "$id", - addUsedSchema: (_w = o.addUsedSchema) !== null && _w !== void 0 ? _w : true, - validateSchema: (_x = o.validateSchema) !== null && _x !== void 0 ? _x : true, - validateFormats: (_y = o.validateFormats) !== null && _y !== void 0 ? _y : true, - unicodeRegExp: (_z = o.unicodeRegExp) !== null && _z !== void 0 ? _z : true, - int32range: (_0 = o.int32range) !== null && _0 !== void 0 ? _0 : true, - uriResolver: uriResolver, - }; -} -class Ajv { - constructor(opts = {}) { - this.schemas = {}; - this.refs = {}; - this.formats = {}; - this._compilations = new Set(); - this._loading = {}; - this._cache = new Map(); - opts = this.opts = { ...opts, ...requiredOptions(opts) }; - const { es5, lines } = this.opts.code; - this.scope = new codegen_2.ValueScope({ scope: {}, prefixes: EXT_SCOPE_NAMES, es5, lines }); - this.logger = getLogger(opts.logger); - const formatOpt = opts.validateFormats; - opts.validateFormats = false; - this.RULES = (0, rules_1.getRules)(); - checkOptions.call(this, removedOptions, opts, "NOT SUPPORTED"); - checkOptions.call(this, deprecatedOptions, opts, "DEPRECATED", "warn"); - this._metaOpts = getMetaSchemaOptions.call(this); - if (opts.formats) - addInitialFormats.call(this); - this._addVocabularies(); - this._addDefaultMetaSchema(); - if (opts.keywords) - addInitialKeywords.call(this, opts.keywords); - if (typeof opts.meta == "object") - this.addMetaSchema(opts.meta); - addInitialSchemas.call(this); - opts.validateFormats = formatOpt; - } - _addVocabularies() { - this.addKeyword("$async"); - } - _addDefaultMetaSchema() { - const { $data, meta, schemaId } = this.opts; - let _dataRefSchema = $dataRefSchema; - if (schemaId === "id") { - _dataRefSchema = { ...$dataRefSchema }; - _dataRefSchema.id = _dataRefSchema.$id; - delete _dataRefSchema.$id; - } - if (meta && $data) - this.addMetaSchema(_dataRefSchema, _dataRefSchema[schemaId], false); - } - defaultMeta() { - const { meta, schemaId } = this.opts; - return (this.opts.defaultMeta = typeof meta == "object" ? meta[schemaId] || meta : undefined); - } - validate(schemaKeyRef, // key, ref or schema object - data // to be validated - ) { - let v; - if (typeof schemaKeyRef == "string") { - v = this.getSchema(schemaKeyRef); - if (!v) - throw new Error(`no schema with key or ref "${schemaKeyRef}"`); - } - else { - v = this.compile(schemaKeyRef); - } - const valid = v(data); - if (!("$async" in v)) - this.errors = v.errors; - return valid; - } - compile(schema, _meta) { - const sch = this._addSchema(schema, _meta); - return (sch.validate || this._compileSchemaEnv(sch)); - } - compileAsync(schema, meta) { - if (typeof this.opts.loadSchema != "function") { - throw new Error("options.loadSchema should be a function"); - } - const { loadSchema } = this.opts; - return runCompileAsync.call(this, schema, meta); - async function runCompileAsync(_schema, _meta) { - await loadMetaSchema.call(this, _schema.$schema); - const sch = this._addSchema(_schema, _meta); - return sch.validate || _compileAsync.call(this, sch); - } - async function loadMetaSchema($ref) { - if ($ref && !this.getSchema($ref)) { - await runCompileAsync.call(this, { $ref }, true); - } - } - async function _compileAsync(sch) { - try { - return this._compileSchemaEnv(sch); - } - catch (e) { - if (!(e instanceof ref_error_1.default)) - throw e; - checkLoaded.call(this, e); - await loadMissingSchema.call(this, e.missingSchema); - return _compileAsync.call(this, sch); - } - } - function checkLoaded({ missingSchema: ref, missingRef }) { - if (this.refs[ref]) { - throw new Error(`AnySchema ${ref} is loaded but ${missingRef} cannot be resolved`); - } - } - async function loadMissingSchema(ref) { - const _schema = await _loadSchema.call(this, ref); - if (!this.refs[ref]) - await loadMetaSchema.call(this, _schema.$schema); - if (!this.refs[ref]) - this.addSchema(_schema, ref, meta); - } - async function _loadSchema(ref) { - const p = this._loading[ref]; - if (p) - return p; - try { - return await (this._loading[ref] = loadSchema(ref)); - } - finally { - delete this._loading[ref]; - } - } - } - // Adds schema to the instance - addSchema(schema, // If array is passed, `key` will be ignored - key, // Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`. - _meta, // true if schema is a meta-schema. Used internally, addMetaSchema should be used instead. - _validateSchema = this.opts.validateSchema // false to skip schema validation. Used internally, option validateSchema should be used instead. - ) { - if (Array.isArray(schema)) { - for (const sch of schema) - this.addSchema(sch, undefined, _meta, _validateSchema); - return this; - } - let id; - if (typeof schema === "object") { - const { schemaId } = this.opts; - id = schema[schemaId]; - if (id !== undefined && typeof id != "string") { - throw new Error(`schema ${schemaId} must be string`); - } - } - key = (0, resolve_1.normalizeId)(key || id); - this._checkUnique(key); - this.schemas[key] = this._addSchema(schema, _meta, key, _validateSchema, true); - return this; - } - // Add schema that will be used to validate other schemas - // options in META_IGNORE_OPTIONS are alway set to false - addMetaSchema(schema, key, // schema key - _validateSchema = this.opts.validateSchema // false to skip schema validation, can be used to override validateSchema option for meta-schema - ) { - this.addSchema(schema, key, true, _validateSchema); - return this; - } - // Validate schema against its meta-schema - validateSchema(schema, throwOrLogError) { - if (typeof schema == "boolean") - return true; - let $schema; - $schema = schema.$schema; - if ($schema !== undefined && typeof $schema != "string") { - throw new Error("$schema must be a string"); - } - $schema = $schema || this.opts.defaultMeta || this.defaultMeta(); - if (!$schema) { - this.logger.warn("meta-schema not available"); - this.errors = null; - return true; - } - const valid = this.validate($schema, schema); - if (!valid && throwOrLogError) { - const message = "schema is invalid: " + this.errorsText(); - if (this.opts.validateSchema === "log") - this.logger.error(message); - else - throw new Error(message); - } - return valid; - } - // Get compiled schema by `key` or `ref`. - // (`key` that was passed to `addSchema` or full schema reference - `schema.$id` or resolved id) - getSchema(keyRef) { - let sch; - while (typeof (sch = getSchEnv.call(this, keyRef)) == "string") - keyRef = sch; - if (sch === undefined) { - const { schemaId } = this.opts; - const root = new compile_1.SchemaEnv({ schema: {}, schemaId }); - sch = compile_1.resolveSchema.call(this, root, keyRef); - if (!sch) - return; - this.refs[keyRef] = sch; - } - return (sch.validate || this._compileSchemaEnv(sch)); - } - // Remove cached schema(s). - // If no parameter is passed all schemas but meta-schemas are removed. - // If RegExp is passed all schemas with key/id matching pattern but meta-schemas are removed. - // Even if schema is referenced by other schemas it still can be removed as other schemas have local references. - removeSchema(schemaKeyRef) { - if (schemaKeyRef instanceof RegExp) { - this._removeAllSchemas(this.schemas, schemaKeyRef); - this._removeAllSchemas(this.refs, schemaKeyRef); - return this; - } - switch (typeof schemaKeyRef) { - case "undefined": - this._removeAllSchemas(this.schemas); - this._removeAllSchemas(this.refs); - this._cache.clear(); - return this; - case "string": { - const sch = getSchEnv.call(this, schemaKeyRef); - if (typeof sch == "object") - this._cache.delete(sch.schema); - delete this.schemas[schemaKeyRef]; - delete this.refs[schemaKeyRef]; - return this; - } - case "object": { - const cacheKey = schemaKeyRef; - this._cache.delete(cacheKey); - let id = schemaKeyRef[this.opts.schemaId]; - if (id) { - id = (0, resolve_1.normalizeId)(id); - delete this.schemas[id]; - delete this.refs[id]; - } - return this; - } - default: - throw new Error("ajv.removeSchema: invalid parameter"); - } - } - // add "vocabulary" - a collection of keywords - addVocabulary(definitions) { - for (const def of definitions) - this.addKeyword(def); - return this; - } - addKeyword(kwdOrDef, def // deprecated - ) { - let keyword; - if (typeof kwdOrDef == "string") { - keyword = kwdOrDef; - if (typeof def == "object") { - this.logger.warn("these parameters are deprecated, see docs for addKeyword"); - def.keyword = keyword; - } - } - else if (typeof kwdOrDef == "object" && def === undefined) { - def = kwdOrDef; - keyword = def.keyword; - if (Array.isArray(keyword) && !keyword.length) { - throw new Error("addKeywords: keyword must be string or non-empty array"); - } - } - else { - throw new Error("invalid addKeywords parameters"); - } - checkKeyword.call(this, keyword, def); - if (!def) { - (0, util_1.eachItem)(keyword, (kwd) => addRule.call(this, kwd)); - return this; - } - keywordMetaschema.call(this, def); - const definition = { - ...def, - type: (0, dataType_1.getJSONTypes)(def.type), - schemaType: (0, dataType_1.getJSONTypes)(def.schemaType), - }; - (0, util_1.eachItem)(keyword, definition.type.length === 0 - ? (k) => addRule.call(this, k, definition) - : (k) => definition.type.forEach((t) => addRule.call(this, k, definition, t))); - return this; - } - getKeyword(keyword) { - const rule = this.RULES.all[keyword]; - return typeof rule == "object" ? rule.definition : !!rule; - } - // Remove keyword - removeKeyword(keyword) { - // TODO return type should be Ajv - const { RULES } = this; - delete RULES.keywords[keyword]; - delete RULES.all[keyword]; - for (const group of RULES.rules) { - const i = group.rules.findIndex((rule) => rule.keyword === keyword); - if (i >= 0) - group.rules.splice(i, 1); - } - return this; - } - // Add format - addFormat(name, format) { - if (typeof format == "string") - format = new RegExp(format); - this.formats[name] = format; - return this; - } - errorsText(errors = this.errors, // optional array of validation errors - { separator = ", ", dataVar = "data" } = {} // optional options with properties `separator` and `dataVar` - ) { - if (!errors || errors.length === 0) - return "No errors"; - return errors - .map((e) => `${dataVar}${e.instancePath} ${e.message}`) - .reduce((text, msg) => text + separator + msg); - } - $dataMetaSchema(metaSchema, keywordsJsonPointers) { - const rules = this.RULES.all; - metaSchema = JSON.parse(JSON.stringify(metaSchema)); - for (const jsonPointer of keywordsJsonPointers) { - const segments = jsonPointer.split("/").slice(1); // first segment is an empty string - let keywords = metaSchema; - for (const seg of segments) - keywords = keywords[seg]; - for (const key in rules) { - const rule = rules[key]; - if (typeof rule != "object") - continue; - const { $data } = rule.definition; - const schema = keywords[key]; - if ($data && schema) - keywords[key] = schemaOrData(schema); - } - } - return metaSchema; - } - _removeAllSchemas(schemas, regex) { - for (const keyRef in schemas) { - const sch = schemas[keyRef]; - if (!regex || regex.test(keyRef)) { - if (typeof sch == "string") { - delete schemas[keyRef]; - } - else if (sch && !sch.meta) { - this._cache.delete(sch.schema); - delete schemas[keyRef]; - } - } - } - } - _addSchema(schema, meta, baseId, validateSchema = this.opts.validateSchema, addSchema = this.opts.addUsedSchema) { - let id; - const { schemaId } = this.opts; - if (typeof schema == "object") { - id = schema[schemaId]; - } - else { - if (this.opts.jtd) - throw new Error("schema must be object"); - else if (typeof schema != "boolean") - throw new Error("schema must be object or boolean"); - } - let sch = this._cache.get(schema); - if (sch !== undefined) - return sch; - baseId = (0, resolve_1.normalizeId)(id || baseId); - const localRefs = resolve_1.getSchemaRefs.call(this, schema, baseId); - sch = new compile_1.SchemaEnv({ schema, schemaId, meta, baseId, localRefs }); - this._cache.set(sch.schema, sch); - if (addSchema && !baseId.startsWith("#")) { - // TODO atm it is allowed to overwrite schemas without id (instead of not adding them) - if (baseId) - this._checkUnique(baseId); - this.refs[baseId] = sch; - } - if (validateSchema) - this.validateSchema(schema, true); - return sch; - } - _checkUnique(id) { - if (this.schemas[id] || this.refs[id]) { - throw new Error(`schema with key or id "${id}" already exists`); - } - } - _compileSchemaEnv(sch) { - if (sch.meta) - this._compileMetaSchema(sch); - else - compile_1.compileSchema.call(this, sch); - /* istanbul ignore if */ - if (!sch.validate) - throw new Error("ajv implementation error"); - return sch.validate; - } - _compileMetaSchema(sch) { - const currentOpts = this.opts; - this.opts = this._metaOpts; - try { - compile_1.compileSchema.call(this, sch); - } - finally { - this.opts = currentOpts; - } - } -} -exports["default"] = Ajv; -Ajv.ValidationError = validation_error_1.default; -Ajv.MissingRefError = ref_error_1.default; -function checkOptions(checkOpts, options, msg, log = "error") { - for (const key in checkOpts) { - const opt = key; - if (opt in options) - this.logger[log](`${msg}: option ${key}. ${checkOpts[opt]}`); - } -} -function getSchEnv(keyRef) { - keyRef = (0, resolve_1.normalizeId)(keyRef); // TODO tests fail without this line - return this.schemas[keyRef] || this.refs[keyRef]; -} -function addInitialSchemas() { - const optsSchemas = this.opts.schemas; - if (!optsSchemas) - return; - if (Array.isArray(optsSchemas)) - this.addSchema(optsSchemas); - else - for (const key in optsSchemas) - this.addSchema(optsSchemas[key], key); -} -function addInitialFormats() { - for (const name in this.opts.formats) { - const format = this.opts.formats[name]; - if (format) - this.addFormat(name, format); - } -} -function addInitialKeywords(defs) { - if (Array.isArray(defs)) { - this.addVocabulary(defs); - return; - } - this.logger.warn("keywords option as map is deprecated, pass array"); - for (const keyword in defs) { - const def = defs[keyword]; - if (!def.keyword) - def.keyword = keyword; - this.addKeyword(def); - } -} -function getMetaSchemaOptions() { - const metaOpts = { ...this.opts }; - for (const opt of META_IGNORE_OPTIONS) - delete metaOpts[opt]; - return metaOpts; -} -const noLogs = { log() { }, warn() { }, error() { } }; -function getLogger(logger) { - if (logger === false) - return noLogs; - if (logger === undefined) - return console; - if (logger.log && logger.warn && logger.error) - return logger; - throw new Error("logger must implement log, warn and error methods"); -} -const KEYWORD_NAME = /^[a-z_$][a-z0-9_$:-]*$/i; -function checkKeyword(keyword, def) { - const { RULES } = this; - (0, util_1.eachItem)(keyword, (kwd) => { - if (RULES.keywords[kwd]) - throw new Error(`Keyword ${kwd} is already defined`); - if (!KEYWORD_NAME.test(kwd)) - throw new Error(`Keyword ${kwd} has invalid name`); - }); - if (!def) - return; - if (def.$data && !("code" in def || "validate" in def)) { - throw new Error('$data keyword must have "code" or "validate" function'); - } -} -function addRule(keyword, definition, dataType) { - var _a; - const post = definition === null || definition === void 0 ? void 0 : definition.post; - if (dataType && post) - throw new Error('keyword with "post" flag cannot have "type"'); - const { RULES } = this; - let ruleGroup = post ? RULES.post : RULES.rules.find(({ type: t }) => t === dataType); - if (!ruleGroup) { - ruleGroup = { type: dataType, rules: [] }; - RULES.rules.push(ruleGroup); - } - RULES.keywords[keyword] = true; - if (!definition) - return; - const rule = { - keyword, - definition: { - ...definition, - type: (0, dataType_1.getJSONTypes)(definition.type), - schemaType: (0, dataType_1.getJSONTypes)(definition.schemaType), - }, - }; - if (definition.before) - addBeforeRule.call(this, ruleGroup, rule, definition.before); - else - ruleGroup.rules.push(rule); - RULES.all[keyword] = rule; - (_a = definition.implements) === null || _a === void 0 ? void 0 : _a.forEach((kwd) => this.addKeyword(kwd)); -} -function addBeforeRule(ruleGroup, rule, before) { - const i = ruleGroup.rules.findIndex((_rule) => _rule.keyword === before); - if (i >= 0) { - ruleGroup.rules.splice(i, 0, rule); - } - else { - ruleGroup.rules.push(rule); - this.logger.warn(`rule ${before} is not defined`); - } -} -function keywordMetaschema(def) { - let { metaSchema } = def; - if (metaSchema === undefined) - return; - if (def.$data && this.opts.$data) - metaSchema = schemaOrData(metaSchema); - def.validateSchema = this.compile(metaSchema, true); -} -const $dataRef = { - $ref: "https://raw.githubusercontent.com/ajv-validator/ajv/master/lib/refs/data.json#", -}; -function schemaOrData(schema) { - return { anyOf: [schema, $dataRef] }; -} -//# sourceMappingURL=core.js.map - -/***/ }), + // Properties of the current token: + // Its type + this.type = types$1.eof; + // For tokens that include more information than their type, the value + this.value = null; + // Its start and end offset + this.start = this.end = this.pos; + // And, if locations are used, the {line, column} object + // corresponding to those offsets + this.startLoc = this.endLoc = this.curPosition(); -/***/ 75511: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Position information for the previous token + this.lastTokEndLoc = this.lastTokStartLoc = null; + this.lastTokStart = this.lastTokEnd = this.pos; + // The context stack is used to superficially track syntactic + // context to predict whether a regular expression is allowed in a + // given position. + this.context = this.initialContext(); + this.exprAllowed = true; -Object.defineProperty(exports, "__esModule", ({ value: true })); -// https://github.com/ajv-validator/ajv/issues/889 -const equal = __nccwpck_require__(23430); -equal.code = 'require("ajv/dist/runtime/equal").default'; -exports["default"] = equal; -//# sourceMappingURL=equal.js.map + // Figure out if it's a module code. + this.inModule = options.sourceType === "module"; + this.strict = this.inModule || this.strictDirective(this.pos); -/***/ }), + // Used to signify the start of a potential arrow function + this.potentialArrowAt = -1; + this.potentialArrowInForAwait = false; -/***/ 81462: -/***/ ((__unused_webpack_module, exports) => { + // Positions to delayed-check that yield/await does not exist in default parameters. + this.yieldPos = this.awaitPos = this.awaitIdentPos = 0; + // Labels in scope. + this.labels = []; + // Thus-far undefined exports. + this.undefinedExports = Object.create(null); + // If enabled, skip leading hashbang line. + if (this.pos === 0 && options.allowHashBang && this.input.slice(0, 2) === "#!") + { this.skipLineComment(2); } -Object.defineProperty(exports, "__esModule", ({ value: true })); -// https://mathiasbynens.be/notes/javascript-encoding -// https://github.com/bestiejs/punycode.js - punycode.ucs2.decode -function ucs2length(str) { - const len = str.length; - let length = 0; - let pos = 0; - let value; - while (pos < len) { - length++; - value = str.charCodeAt(pos++); - if (value >= 0xd800 && value <= 0xdbff && pos < len) { - // high surrogate, and there is a next character - value = str.charCodeAt(pos); - if ((value & 0xfc00) === 0xdc00) - pos++; // low surrogate - } - } - return length; -} -exports["default"] = ucs2length; -ucs2length.code = 'require("ajv/dist/runtime/ucs2length").default'; -//# sourceMappingURL=ucs2length.js.map + // Scope tracking for duplicate variable names (see scope.js) + this.scopeStack = []; + this.enterScope(SCOPE_TOP); -/***/ }), + // For RegExp validation + this.regexpState = null; -/***/ 72509: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // The stack of private names. + // Each element has two properties: 'declared' and 'used'. + // When it exited from the outermost class definition, all used private names must be declared. + this.privateNameStack = []; + }; + var prototypeAccessors = { inFunction: { configurable: true },inGenerator: { configurable: true },inAsync: { configurable: true },canAwait: { configurable: true },allowSuper: { configurable: true },allowDirectSuper: { configurable: true },treatFunctionsAsVar: { configurable: true },allowNewDotTarget: { configurable: true },inClassStaticBlock: { configurable: true } }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const uri = __nccwpck_require__(52084); -uri.code = 'require("ajv/dist/runtime/uri").default'; -exports["default"] = uri; -//# sourceMappingURL=uri.js.map + Parser.prototype.parse = function parse () { + var node = this.options.program || this.startNode(); + this.nextToken(); + return this.parseTopLevel(node) + }; -/***/ }), + prototypeAccessors.inFunction.get = function () { return (this.currentVarScope().flags & SCOPE_FUNCTION) > 0 }; -/***/ 71645: -/***/ ((__unused_webpack_module, exports) => { + prototypeAccessors.inGenerator.get = function () { return (this.currentVarScope().flags & SCOPE_GENERATOR) > 0 && !this.currentVarScope().inClassFieldInit }; + prototypeAccessors.inAsync.get = function () { return (this.currentVarScope().flags & SCOPE_ASYNC) > 0 && !this.currentVarScope().inClassFieldInit }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -class ValidationError extends Error { - constructor(errors) { - super("validation failed"); - this.errors = errors; - this.ajv = this.validation = true; + prototypeAccessors.canAwait.get = function () { + for (var i = this.scopeStack.length - 1; i >= 0; i--) { + var scope = this.scopeStack[i]; + if (scope.inClassFieldInit || scope.flags & SCOPE_CLASS_STATIC_BLOCK) { return false } + if (scope.flags & SCOPE_FUNCTION) { return (scope.flags & SCOPE_ASYNC) > 0 } } -} -exports["default"] = ValidationError; -//# sourceMappingURL=validation_error.js.map + return (this.inModule && this.options.ecmaVersion >= 13) || this.options.allowAwaitOutsideFunction + }; -/***/ }), + prototypeAccessors.allowSuper.get = function () { + var ref = this.currentThisScope(); + var flags = ref.flags; + var inClassFieldInit = ref.inClassFieldInit; + return (flags & SCOPE_SUPER) > 0 || inClassFieldInit || this.options.allowSuperOutsideMethod + }; -/***/ 34376: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + prototypeAccessors.allowDirectSuper.get = function () { return (this.currentThisScope().flags & SCOPE_DIRECT_SUPER) > 0 }; + prototypeAccessors.treatFunctionsAsVar.get = function () { return this.treatFunctionsAsVarInScope(this.currentScope()) }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateAdditionalItems = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: ({ params: { len } }) => (0, codegen_1.str) `must NOT have more than ${len} items`, - params: ({ params: { len } }) => (0, codegen_1._) `{limit: ${len}}`, -}; -const def = { - keyword: "additionalItems", - type: "array", - schemaType: ["boolean", "object"], - before: "uniqueItems", - error, - code(cxt) { - const { parentSchema, it } = cxt; - const { items } = parentSchema; - if (!Array.isArray(items)) { - (0, util_1.checkStrictMode)(it, '"additionalItems" is ignored when "items" is not an array of schemas'); - return; - } - validateAdditionalItems(cxt, items); - }, -}; -function validateAdditionalItems(cxt, items) { - const { gen, schema, data, keyword, it } = cxt; - it.items = true; - const len = gen.const("len", (0, codegen_1._) `${data}.length`); - if (schema === false) { - cxt.setParams({ len: items.length }); - cxt.pass((0, codegen_1._) `${len} <= ${items.length}`); - } - else if (typeof schema == "object" && !(0, util_1.alwaysValidSchema)(it, schema)) { - const valid = gen.var("valid", (0, codegen_1._) `${len} <= ${items.length}`); // TODO var - gen.if((0, codegen_1.not)(valid), () => validateItems(valid)); - cxt.ok(valid); - } - function validateItems(valid) { - gen.forRange("i", items.length, len, (i) => { - cxt.subschema({ keyword, dataProp: i, dataPropType: util_1.Type.Num }, valid); - if (!it.allErrors) - gen.if((0, codegen_1.not)(valid), () => gen.break()); - }); - } -} -exports.validateAdditionalItems = validateAdditionalItems; -exports["default"] = def; -//# sourceMappingURL=additionalItems.js.map + prototypeAccessors.allowNewDotTarget.get = function () { + var ref = this.currentThisScope(); + var flags = ref.flags; + var inClassFieldInit = ref.inClassFieldInit; + return (flags & (SCOPE_FUNCTION | SCOPE_CLASS_STATIC_BLOCK)) > 0 || inClassFieldInit + }; -/***/ }), + prototypeAccessors.inClassStaticBlock.get = function () { + return (this.currentVarScope().flags & SCOPE_CLASS_STATIC_BLOCK) > 0 + }; -/***/ 23487: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + Parser.extend = function extend () { + var plugins = [], len = arguments.length; + while ( len-- ) plugins[ len ] = arguments[ len ]; + var cls = this; + for (var i = 0; i < plugins.length; i++) { cls = plugins[i](cls); } + return cls + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const code_1 = __nccwpck_require__(74532); -const codegen_1 = __nccwpck_require__(30972); -const names_1 = __nccwpck_require__(66662); -const util_1 = __nccwpck_require__(87120); -const error = { - message: "must NOT have additional properties", - params: ({ params }) => (0, codegen_1._) `{additionalProperty: ${params.additionalProperty}}`, -}; -const def = { - keyword: "additionalProperties", - type: ["object"], - schemaType: ["boolean", "object"], - allowUndefined: true, - trackErrors: true, - error, - code(cxt) { - const { gen, schema, parentSchema, data, errsCount, it } = cxt; - /* istanbul ignore if */ - if (!errsCount) - throw new Error("ajv implementation error"); - const { allErrors, opts } = it; - it.props = true; - if (opts.removeAdditional !== "all" && (0, util_1.alwaysValidSchema)(it, schema)) - return; - const props = (0, code_1.allSchemaProperties)(parentSchema.properties); - const patProps = (0, code_1.allSchemaProperties)(parentSchema.patternProperties); - checkAdditionalProperties(); - cxt.ok((0, codegen_1._) `${errsCount} === ${names_1.default.errors}`); - function checkAdditionalProperties() { - gen.forIn("key", data, (key) => { - if (!props.length && !patProps.length) - additionalPropertyCode(key); - else - gen.if(isAdditional(key), () => additionalPropertyCode(key)); - }); - } - function isAdditional(key) { - let definedProp; - if (props.length > 8) { - // TODO maybe an option instead of hard-coded 8? - const propsSchema = (0, util_1.schemaRefOrVal)(it, parentSchema.properties, "properties"); - definedProp = (0, code_1.isOwnProperty)(gen, propsSchema, key); - } - else if (props.length) { - definedProp = (0, codegen_1.or)(...props.map((p) => (0, codegen_1._) `${key} === ${p}`)); - } - else { - definedProp = codegen_1.nil; - } - if (patProps.length) { - definedProp = (0, codegen_1.or)(definedProp, ...patProps.map((p) => (0, codegen_1._) `${(0, code_1.usePattern)(cxt, p)}.test(${key})`)); - } - return (0, codegen_1.not)(definedProp); - } - function deleteAdditional(key) { - gen.code((0, codegen_1._) `delete ${data}[${key}]`); - } - function additionalPropertyCode(key) { - if (opts.removeAdditional === "all" || (opts.removeAdditional && schema === false)) { - deleteAdditional(key); - return; - } - if (schema === false) { - cxt.setParams({ additionalProperty: key }); - cxt.error(); - if (!allErrors) - gen.break(); - return; - } - if (typeof schema == "object" && !(0, util_1.alwaysValidSchema)(it, schema)) { - const valid = gen.name("valid"); - if (opts.removeAdditional === "failing") { - applyAdditionalSchema(key, valid, false); - gen.if((0, codegen_1.not)(valid), () => { - cxt.reset(); - deleteAdditional(key); - }); - } - else { - applyAdditionalSchema(key, valid); - if (!allErrors) - gen.if((0, codegen_1.not)(valid), () => gen.break()); - } - } - } - function applyAdditionalSchema(key, valid, errors) { - const subschema = { - keyword: "additionalProperties", - dataProp: key, - dataPropType: util_1.Type.Str, - }; - if (errors === false) { - Object.assign(subschema, { - compositeRule: true, - createErrors: false, - allErrors: false, - }); - } - cxt.subschema(subschema, valid); - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=additionalProperties.js.map + Parser.parse = function parse (input, options) { + return new this(options, input).parse() + }; -/***/ }), + Parser.parseExpressionAt = function parseExpressionAt (input, pos, options) { + var parser = new this(options, input, pos); + parser.nextToken(); + return parser.parseExpression() + }; -/***/ 33125: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + Parser.tokenizer = function tokenizer (input, options) { + return new this(options, input) + }; + Object.defineProperties( Parser.prototype, prototypeAccessors ); -Object.defineProperty(exports, "__esModule", ({ value: true })); -const util_1 = __nccwpck_require__(87120); -const def = { - keyword: "allOf", - schemaType: "array", - code(cxt) { - const { gen, schema, it } = cxt; - /* istanbul ignore if */ - if (!Array.isArray(schema)) - throw new Error("ajv implementation error"); - const valid = gen.name("valid"); - schema.forEach((sch, i) => { - if ((0, util_1.alwaysValidSchema)(it, sch)) - return; - const schCxt = cxt.subschema({ keyword: "allOf", schemaProp: i }, valid); - cxt.ok(valid); - cxt.mergeEvaluated(schCxt); - }); - }, -}; -exports["default"] = def; -//# sourceMappingURL=allOf.js.map + var pp$9 = Parser.prototype; -/***/ }), + // ## Parser utilities -/***/ 48612: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + var literal = /^(?:'((?:\\[^]|[^'\\])*?)'|"((?:\\[^]|[^"\\])*?)")/; + pp$9.strictDirective = function(start) { + if (this.options.ecmaVersion < 5) { return false } + for (;;) { + // Try to find string literal. + skipWhiteSpace.lastIndex = start; + start += skipWhiteSpace.exec(this.input)[0].length; + var match = literal.exec(this.input.slice(start)); + if (!match) { return false } + if ((match[1] || match[2]) === "use strict") { + skipWhiteSpace.lastIndex = start + match[0].length; + var spaceAfter = skipWhiteSpace.exec(this.input), end = spaceAfter.index + spaceAfter[0].length; + var next = this.input.charAt(end); + return next === ";" || next === "}" || + (lineBreak.test(spaceAfter[0]) && + !(/[(`.[+\-/*%<>=,?^&]/.test(next) || next === "!" && this.input.charAt(end + 1) === "=")) + } + start += match[0].length; + // Skip semicolon, if any. + skipWhiteSpace.lastIndex = start; + start += skipWhiteSpace.exec(this.input)[0].length; + if (this.input[start] === ";") + { start++; } + } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const code_1 = __nccwpck_require__(74532); -const def = { - keyword: "anyOf", - schemaType: "array", - trackErrors: true, - code: code_1.validateUnion, - error: { message: "must match a schema in anyOf" }, -}; -exports["default"] = def; -//# sourceMappingURL=anyOf.js.map + // Predicate that tests whether the next token is of the given + // type, and if yes, consumes it as a side effect. -/***/ }), + pp$9.eat = function(type) { + if (this.type === type) { + this.next(); + return true + } else { + return false + } + }; -/***/ 73462: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Tests whether parsed token is a contextual keyword. + pp$9.isContextual = function(name) { + return this.type === types$1.name && this.value === name && !this.containsEsc + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: ({ params: { min, max } }) => max === undefined - ? (0, codegen_1.str) `must contain at least ${min} valid item(s)` - : (0, codegen_1.str) `must contain at least ${min} and no more than ${max} valid item(s)`, - params: ({ params: { min, max } }) => max === undefined ? (0, codegen_1._) `{minContains: ${min}}` : (0, codegen_1._) `{minContains: ${min}, maxContains: ${max}}`, -}; -const def = { - keyword: "contains", - type: "array", - schemaType: ["object", "boolean"], - before: "uniqueItems", - trackErrors: true, - error, - code(cxt) { - const { gen, schema, parentSchema, data, it } = cxt; - let min; - let max; - const { minContains, maxContains } = parentSchema; - if (it.opts.next) { - min = minContains === undefined ? 1 : minContains; - max = maxContains; - } - else { - min = 1; - } - const len = gen.const("len", (0, codegen_1._) `${data}.length`); - cxt.setParams({ min, max }); - if (max === undefined && min === 0) { - (0, util_1.checkStrictMode)(it, `"minContains" == 0 without "maxContains": "contains" keyword ignored`); - return; - } - if (max !== undefined && min > max) { - (0, util_1.checkStrictMode)(it, `"minContains" > "maxContains" is always invalid`); - cxt.fail(); - return; - } - if ((0, util_1.alwaysValidSchema)(it, schema)) { - let cond = (0, codegen_1._) `${len} >= ${min}`; - if (max !== undefined) - cond = (0, codegen_1._) `${cond} && ${len} <= ${max}`; - cxt.pass(cond); - return; - } - it.items = true; - const valid = gen.name("valid"); - if (max === undefined && min === 1) { - validateItems(valid, () => gen.if(valid, () => gen.break())); - } - else if (min === 0) { - gen.let(valid, true); - if (max !== undefined) - gen.if((0, codegen_1._) `${data}.length > 0`, validateItemsWithCount); - } - else { - gen.let(valid, false); - validateItemsWithCount(); - } - cxt.result(valid, () => cxt.reset()); - function validateItemsWithCount() { - const schValid = gen.name("_valid"); - const count = gen.let("count", 0); - validateItems(schValid, () => gen.if(schValid, () => checkLimits(count))); - } - function validateItems(_valid, block) { - gen.forRange("i", 0, len, (i) => { - cxt.subschema({ - keyword: "contains", - dataProp: i, - dataPropType: util_1.Type.Num, - compositeRule: true, - }, _valid); - block(); - }); - } - function checkLimits(count) { - gen.code((0, codegen_1._) `${count}++`); - if (max === undefined) { - gen.if((0, codegen_1._) `${count} >= ${min}`, () => gen.assign(valid, true).break()); - } - else { - gen.if((0, codegen_1._) `${count} > ${max}`, () => gen.assign(valid, false).break()); - if (min === 1) - gen.assign(valid, true); - else - gen.if((0, codegen_1._) `${count} >= ${min}`, () => gen.assign(valid, true)); - } - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=contains.js.map + // Consumes contextual keyword if possible. -/***/ }), + pp$9.eatContextual = function(name) { + if (!this.isContextual(name)) { return false } + this.next(); + return true + }; -/***/ 7762: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Asserts that following token is given contextual keyword. + pp$9.expectContextual = function(name) { + if (!this.eatContextual(name)) { this.unexpected(); } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateSchemaDeps = exports.validatePropertyDeps = exports.error = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const code_1 = __nccwpck_require__(74532); -exports.error = { - message: ({ params: { property, depsCount, deps } }) => { - const property_ies = depsCount === 1 ? "property" : "properties"; - return (0, codegen_1.str) `must have ${property_ies} ${deps} when property ${property} is present`; - }, - params: ({ params: { property, depsCount, deps, missingProperty } }) => (0, codegen_1._) `{property: ${property}, - missingProperty: ${missingProperty}, - depsCount: ${depsCount}, - deps: ${deps}}`, // TODO change to reference -}; -const def = { - keyword: "dependencies", - type: "object", - schemaType: "object", - error: exports.error, - code(cxt) { - const [propDeps, schDeps] = splitDependencies(cxt); - validatePropertyDeps(cxt, propDeps); - validateSchemaDeps(cxt, schDeps); - }, -}; -function splitDependencies({ schema }) { - const propertyDeps = {}; - const schemaDeps = {}; - for (const key in schema) { - if (key === "__proto__") - continue; - const deps = Array.isArray(schema[key]) ? propertyDeps : schemaDeps; - deps[key] = schema[key]; - } - return [propertyDeps, schemaDeps]; -} -function validatePropertyDeps(cxt, propertyDeps = cxt.schema) { - const { gen, data, it } = cxt; - if (Object.keys(propertyDeps).length === 0) - return; - const missing = gen.let("missing"); - for (const prop in propertyDeps) { - const deps = propertyDeps[prop]; - if (deps.length === 0) - continue; - const hasProperty = (0, code_1.propertyInData)(gen, data, prop, it.opts.ownProperties); - cxt.setParams({ - property: prop, - depsCount: deps.length, - deps: deps.join(", "), - }); - if (it.allErrors) { - gen.if(hasProperty, () => { - for (const depProp of deps) { - (0, code_1.checkReportMissingProp)(cxt, depProp); - } - }); - } - else { - gen.if((0, codegen_1._) `${hasProperty} && (${(0, code_1.checkMissingProp)(cxt, deps, missing)})`); - (0, code_1.reportMissingProp)(cxt, missing); - gen.else(); - } + // Test whether a semicolon can be inserted at the current position. + + pp$9.canInsertSemicolon = function() { + return this.type === types$1.eof || + this.type === types$1.braceR || + lineBreak.test(this.input.slice(this.lastTokEnd, this.start)) + }; + + pp$9.insertSemicolon = function() { + if (this.canInsertSemicolon()) { + if (this.options.onInsertedSemicolon) + { this.options.onInsertedSemicolon(this.lastTokEnd, this.lastTokEndLoc); } + return true } -} -exports.validatePropertyDeps = validatePropertyDeps; -function validateSchemaDeps(cxt, schemaDeps = cxt.schema) { - const { gen, data, keyword, it } = cxt; - const valid = gen.name("valid"); - for (const prop in schemaDeps) { - if ((0, util_1.alwaysValidSchema)(it, schemaDeps[prop])) - continue; - gen.if((0, code_1.propertyInData)(gen, data, prop, it.opts.ownProperties), () => { - const schCxt = cxt.subschema({ keyword, schemaProp: prop }, valid); - cxt.mergeValidEvaluated(schCxt, valid); - }, () => gen.var(valid, true) // TODO var - ); - cxt.ok(valid); + }; + + // Consume a semicolon, or, failing that, see if we are allowed to + // pretend that there is a semicolon at this position. + + pp$9.semicolon = function() { + if (!this.eat(types$1.semi) && !this.insertSemicolon()) { this.unexpected(); } + }; + + pp$9.afterTrailingComma = function(tokType, notNext) { + if (this.type === tokType) { + if (this.options.onTrailingComma) + { this.options.onTrailingComma(this.lastTokStart, this.lastTokStartLoc); } + if (!notNext) + { this.next(); } + return true } -} -exports.validateSchemaDeps = validateSchemaDeps; -exports["default"] = def; -//# sourceMappingURL=dependencies.js.map + }; -/***/ }), + // Expect a token of a given type. If found, consume it, otherwise, + // raise an unexpected token error. -/***/ 24872: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$9.expect = function(type) { + this.eat(type) || this.unexpected(); + }; + // Raise an unexpected token error. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: ({ params }) => (0, codegen_1.str) `must match "${params.ifClause}" schema`, - params: ({ params }) => (0, codegen_1._) `{failingKeyword: ${params.ifClause}}`, -}; -const def = { - keyword: "if", - schemaType: ["object", "boolean"], - trackErrors: true, - error, - code(cxt) { - const { gen, parentSchema, it } = cxt; - if (parentSchema.then === undefined && parentSchema.else === undefined) { - (0, util_1.checkStrictMode)(it, '"if" without "then" and "else" is ignored'); - } - const hasThen = hasSchema(it, "then"); - const hasElse = hasSchema(it, "else"); - if (!hasThen && !hasElse) - return; - const valid = gen.let("valid", true); - const schValid = gen.name("_valid"); - validateIf(); - cxt.reset(); - if (hasThen && hasElse) { - const ifClause = gen.let("ifClause"); - cxt.setParams({ ifClause }); - gen.if(schValid, validateClause("then", ifClause), validateClause("else", ifClause)); - } - else if (hasThen) { - gen.if(schValid, validateClause("then")); - } - else { - gen.if((0, codegen_1.not)(schValid), validateClause("else")); - } - cxt.pass(valid, () => cxt.error(true)); - function validateIf() { - const schCxt = cxt.subschema({ - keyword: "if", - compositeRule: true, - createErrors: false, - allErrors: false, - }, schValid); - cxt.mergeEvaluated(schCxt); - } - function validateClause(keyword, ifClause) { - return () => { - const schCxt = cxt.subschema({ keyword }, schValid); - gen.assign(valid, schValid); - cxt.mergeValidEvaluated(schCxt, valid); - if (ifClause) - gen.assign(ifClause, (0, codegen_1._) `${keyword}`); - else - cxt.setParams({ ifClause: keyword }); - }; - } - }, -}; -function hasSchema(it, keyword) { - const schema = it.schema[keyword]; - return schema !== undefined && !(0, util_1.alwaysValidSchema)(it, schema); -} -exports["default"] = def; -//# sourceMappingURL=if.js.map + pp$9.unexpected = function(pos) { + this.raise(pos != null ? pos : this.start, "Unexpected token"); + }; -/***/ }), + var DestructuringErrors = function DestructuringErrors() { + this.shorthandAssign = + this.trailingComma = + this.parenthesizedAssign = + this.parenthesizedBind = + this.doubleProto = + -1; + }; -/***/ 30567: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$9.checkPatternErrors = function(refDestructuringErrors, isAssign) { + if (!refDestructuringErrors) { return } + if (refDestructuringErrors.trailingComma > -1) + { this.raiseRecoverable(refDestructuringErrors.trailingComma, "Comma is not permitted after the rest element"); } + var parens = isAssign ? refDestructuringErrors.parenthesizedAssign : refDestructuringErrors.parenthesizedBind; + if (parens > -1) { this.raiseRecoverable(parens, isAssign ? "Assigning to rvalue" : "Parenthesized pattern"); } + }; + pp$9.checkExpressionErrors = function(refDestructuringErrors, andThrow) { + if (!refDestructuringErrors) { return false } + var shorthandAssign = refDestructuringErrors.shorthandAssign; + var doubleProto = refDestructuringErrors.doubleProto; + if (!andThrow) { return shorthandAssign >= 0 || doubleProto >= 0 } + if (shorthandAssign >= 0) + { this.raise(shorthandAssign, "Shorthand property assignments are valid only in destructuring patterns"); } + if (doubleProto >= 0) + { this.raiseRecoverable(doubleProto, "Redefinition of __proto__ property"); } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const additionalItems_1 = __nccwpck_require__(34376); -const prefixItems_1 = __nccwpck_require__(8515); -const items_1 = __nccwpck_require__(23247); -const items2020_1 = __nccwpck_require__(97791); -const contains_1 = __nccwpck_require__(73462); -const dependencies_1 = __nccwpck_require__(7762); -const propertyNames_1 = __nccwpck_require__(29132); -const additionalProperties_1 = __nccwpck_require__(23487); -const properties_1 = __nccwpck_require__(40746); -const patternProperties_1 = __nccwpck_require__(76360); -const not_1 = __nccwpck_require__(93566); -const anyOf_1 = __nccwpck_require__(48612); -const oneOf_1 = __nccwpck_require__(25818); -const allOf_1 = __nccwpck_require__(33125); -const if_1 = __nccwpck_require__(24872); -const thenElse_1 = __nccwpck_require__(77); -function getApplicator(draft2020 = false) { - const applicator = [ - // any - not_1.default, - anyOf_1.default, - oneOf_1.default, - allOf_1.default, - if_1.default, - thenElse_1.default, - // object - propertyNames_1.default, - additionalProperties_1.default, - dependencies_1.default, - properties_1.default, - patternProperties_1.default, - ]; - // array - if (draft2020) - applicator.push(prefixItems_1.default, items2020_1.default); - else - applicator.push(additionalItems_1.default, items_1.default); - applicator.push(contains_1.default); - return applicator; -} -exports["default"] = getApplicator; -//# sourceMappingURL=index.js.map + pp$9.checkYieldAwaitInDefaultParams = function() { + if (this.yieldPos && (!this.awaitPos || this.yieldPos < this.awaitPos)) + { this.raise(this.yieldPos, "Yield expression cannot be a default value"); } + if (this.awaitPos) + { this.raise(this.awaitPos, "Await expression cannot be a default value"); } + }; -/***/ }), + pp$9.isSimpleAssignTarget = function(expr) { + if (expr.type === "ParenthesizedExpression") + { return this.isSimpleAssignTarget(expr.expression) } + return expr.type === "Identifier" || expr.type === "MemberExpression" + }; -/***/ 23247: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + var pp$8 = Parser.prototype; + // ### Statement parsing -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateTuple = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const code_1 = __nccwpck_require__(74532); -const def = { - keyword: "items", - type: "array", - schemaType: ["object", "array", "boolean"], - before: "uniqueItems", - code(cxt) { - const { schema, it } = cxt; - if (Array.isArray(schema)) - return validateTuple(cxt, "additionalItems", schema); - it.items = true; - if ((0, util_1.alwaysValidSchema)(it, schema)) - return; - cxt.ok((0, code_1.validateArray)(cxt)); - }, -}; -function validateTuple(cxt, extraItems, schArr = cxt.schema) { - const { gen, parentSchema, data, keyword, it } = cxt; - checkStrictTuple(parentSchema); - if (it.opts.unevaluated && schArr.length && it.items !== true) { - it.items = util_1.mergeEvaluated.items(gen, schArr.length, it.items); + // Parse a program. Initializes the parser, reads any number of + // statements, and wraps them in a Program node. Optionally takes a + // `program` argument. If present, the statements will be appended + // to its body instead of creating a new node. + + pp$8.parseTopLevel = function(node) { + var exports = Object.create(null); + if (!node.body) { node.body = []; } + while (this.type !== types$1.eof) { + var stmt = this.parseStatement(null, true, exports); + node.body.push(stmt); } - const valid = gen.name("valid"); - const len = gen.const("len", (0, codegen_1._) `${data}.length`); - schArr.forEach((sch, i) => { - if ((0, util_1.alwaysValidSchema)(it, sch)) - return; - gen.if((0, codegen_1._) `${len} > ${i}`, () => cxt.subschema({ - keyword, - schemaProp: i, - dataProp: i, - }, valid)); - cxt.ok(valid); - }); - function checkStrictTuple(sch) { - const { opts, errSchemaPath } = it; - const l = schArr.length; - const fullTuple = l === sch.minItems && (l === sch.maxItems || sch[extraItems] === false); - if (opts.strictTuples && !fullTuple) { - const msg = `"${keyword}" is ${l}-tuple, but minItems or maxItems/${extraItems} are not specified or different at path "${errSchemaPath}"`; - (0, util_1.checkStrictMode)(it, msg, opts.strictTuples); - } + if (this.inModule) + { for (var i = 0, list = Object.keys(this.undefinedExports); i < list.length; i += 1) + { + var name = list[i]; + + this.raiseRecoverable(this.undefinedExports[name].start, ("Export '" + name + "' is not defined")); + } } + this.adaptDirectivePrologue(node.body); + this.next(); + node.sourceType = this.options.sourceType; + return this.finishNode(node, "Program") + }; + + var loopLabel = {kind: "loop"}, switchLabel = {kind: "switch"}; + + pp$8.isLet = function(context) { + if (this.options.ecmaVersion < 6 || !this.isContextual("let")) { return false } + skipWhiteSpace.lastIndex = this.pos; + var skip = skipWhiteSpace.exec(this.input); + var next = this.pos + skip[0].length, nextCh = this.input.charCodeAt(next); + // For ambiguous cases, determine if a LexicalDeclaration (or only a + // Statement) is allowed here. If context is not empty then only a Statement + // is allowed. However, `let [` is an explicit negative lookahead for + // ExpressionStatement, so special-case it first. + if (nextCh === 91 || nextCh === 92) { return true } // '[', '\' + if (context) { return false } + + if (nextCh === 123 || nextCh > 0xd7ff && nextCh < 0xdc00) { return true } // '{', astral + if (isIdentifierStart(nextCh, true)) { + var pos = next + 1; + while (isIdentifierChar(nextCh = this.input.charCodeAt(pos), true)) { ++pos; } + if (nextCh === 92 || nextCh > 0xd7ff && nextCh < 0xdc00) { return true } + var ident = this.input.slice(next, pos); + if (!keywordRelationalOperator.test(ident)) { return true } } -} -exports.validateTuple = validateTuple; -exports["default"] = def; -//# sourceMappingURL=items.js.map + return false + }; -/***/ }), + // check 'async [no LineTerminator here] function' + // - 'async /*foo*/ function' is OK. + // - 'async /*\n*/ function' is invalid. + pp$8.isAsyncFunction = function() { + if (this.options.ecmaVersion < 8 || !this.isContextual("async")) + { return false } -/***/ 97791: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + skipWhiteSpace.lastIndex = this.pos; + var skip = skipWhiteSpace.exec(this.input); + var next = this.pos + skip[0].length, after; + return !lineBreak.test(this.input.slice(this.pos, next)) && + this.input.slice(next, next + 8) === "function" && + (next + 8 === this.input.length || + !(isIdentifierChar(after = this.input.charCodeAt(next + 8)) || after > 0xd7ff && after < 0xdc00)) + }; + // Parse a single statement. + // + // If expecting a statement and finding a slash operator, parse a + // regular expression literal. This is to handle cases like + // `if (foo) /blah/.exec(foo)`, where looking at the previous token + // does not help. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const code_1 = __nccwpck_require__(74532); -const additionalItems_1 = __nccwpck_require__(34376); -const error = { - message: ({ params: { len } }) => (0, codegen_1.str) `must NOT have more than ${len} items`, - params: ({ params: { len } }) => (0, codegen_1._) `{limit: ${len}}`, -}; -const def = { - keyword: "items", - type: "array", - schemaType: ["object", "boolean"], - before: "uniqueItems", - error, - code(cxt) { - const { schema, parentSchema, it } = cxt; - const { prefixItems } = parentSchema; - it.items = true; - if ((0, util_1.alwaysValidSchema)(it, schema)) - return; - if (prefixItems) - (0, additionalItems_1.validateAdditionalItems)(cxt, prefixItems); - else - cxt.ok((0, code_1.validateArray)(cxt)); - }, -}; -exports["default"] = def; -//# sourceMappingURL=items2020.js.map + pp$8.parseStatement = function(context, topLevel, exports) { + var starttype = this.type, node = this.startNode(), kind; -/***/ }), + if (this.isLet(context)) { + starttype = types$1._var; + kind = "let"; + } -/***/ 93566: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Most types of statements are recognized by the keyword they + // start with. Many are trivial to parse, some require a bit of + // complexity. + switch (starttype) { + case types$1._break: case types$1._continue: return this.parseBreakContinueStatement(node, starttype.keyword) + case types$1._debugger: return this.parseDebuggerStatement(node) + case types$1._do: return this.parseDoStatement(node) + case types$1._for: return this.parseForStatement(node) + case types$1._function: + // Function as sole body of either an if statement or a labeled statement + // works, but not when it is part of a labeled statement that is the sole + // body of an if statement. + if ((context && (this.strict || context !== "if" && context !== "label")) && this.options.ecmaVersion >= 6) { this.unexpected(); } + return this.parseFunctionStatement(node, false, !context) + case types$1._class: + if (context) { this.unexpected(); } + return this.parseClass(node, true) + case types$1._if: return this.parseIfStatement(node) + case types$1._return: return this.parseReturnStatement(node) + case types$1._switch: return this.parseSwitchStatement(node) + case types$1._throw: return this.parseThrowStatement(node) + case types$1._try: return this.parseTryStatement(node) + case types$1._const: case types$1._var: + kind = kind || this.value; + if (context && kind !== "var") { this.unexpected(); } + return this.parseVarStatement(node, kind) + case types$1._while: return this.parseWhileStatement(node) + case types$1._with: return this.parseWithStatement(node) + case types$1.braceL: return this.parseBlock(true, node) + case types$1.semi: return this.parseEmptyStatement(node) + case types$1._export: + case types$1._import: + if (this.options.ecmaVersion > 10 && starttype === types$1._import) { + skipWhiteSpace.lastIndex = this.pos; + var skip = skipWhiteSpace.exec(this.input); + var next = this.pos + skip[0].length, nextCh = this.input.charCodeAt(next); + if (nextCh === 40 || nextCh === 46) // '(' or '.' + { return this.parseExpressionStatement(node, this.parseExpression()) } + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -const util_1 = __nccwpck_require__(87120); -const def = { - keyword: "not", - schemaType: ["object", "boolean"], - trackErrors: true, - code(cxt) { - const { gen, schema, it } = cxt; - if ((0, util_1.alwaysValidSchema)(it, schema)) { - cxt.fail(); - return; - } - const valid = gen.name("valid"); - cxt.subschema({ - keyword: "not", - compositeRule: true, - createErrors: false, - allErrors: false, - }, valid); - cxt.failResult(valid, () => cxt.reset(), () => cxt.error()); - }, - error: { message: "must NOT be valid" }, -}; -exports["default"] = def; -//# sourceMappingURL=not.js.map + if (!this.options.allowImportExportEverywhere) { + if (!topLevel) + { this.raise(this.start, "'import' and 'export' may only appear at the top level"); } + if (!this.inModule) + { this.raise(this.start, "'import' and 'export' may appear only with 'sourceType: module'"); } + } + return starttype === types$1._import ? this.parseImport(node) : this.parseExport(node, exports) -/***/ }), + // If the statement does not start with a statement keyword or a + // brace, it's an ExpressionStatement or LabeledStatement. We + // simply start parsing an expression, and afterwards, if the + // next token is a colon and the expression was a simple + // Identifier node, we switch to interpreting it as a label. + default: + if (this.isAsyncFunction()) { + if (context) { this.unexpected(); } + this.next(); + return this.parseFunctionStatement(node, true, !context) + } -/***/ 25818: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + var maybeName = this.value, expr = this.parseExpression(); + if (starttype === types$1.name && expr.type === "Identifier" && this.eat(types$1.colon)) + { return this.parseLabeledStatement(node, maybeName, expr, context) } + else { return this.parseExpressionStatement(node, expr) } + } + }; + pp$8.parseBreakContinueStatement = function(node, keyword) { + var isBreak = keyword === "break"; + this.next(); + if (this.eat(types$1.semi) || this.insertSemicolon()) { node.label = null; } + else if (this.type !== types$1.name) { this.unexpected(); } + else { + node.label = this.parseIdent(); + this.semicolon(); + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: "must match exactly one schema in oneOf", - params: ({ params }) => (0, codegen_1._) `{passingSchemas: ${params.passing}}`, -}; -const def = { - keyword: "oneOf", - schemaType: "array", - trackErrors: true, - error, - code(cxt) { - const { gen, schema, parentSchema, it } = cxt; - /* istanbul ignore if */ - if (!Array.isArray(schema)) - throw new Error("ajv implementation error"); - if (it.opts.discriminator && parentSchema.discriminator) - return; - const schArr = schema; - const valid = gen.let("valid", false); - const passing = gen.let("passing", null); - const schValid = gen.name("_valid"); - cxt.setParams({ passing }); - // TODO possibly fail straight away (with warning or exception) if there are two empty always valid schemas - gen.block(validateOneOf); - cxt.result(valid, () => cxt.reset(), () => cxt.error(true)); - function validateOneOf() { - schArr.forEach((sch, i) => { - let schCxt; - if ((0, util_1.alwaysValidSchema)(it, sch)) { - gen.var(schValid, true); - } - else { - schCxt = cxt.subschema({ - keyword: "oneOf", - schemaProp: i, - compositeRule: true, - }, schValid); - } - if (i > 0) { - gen - .if((0, codegen_1._) `${schValid} && ${valid}`) - .assign(valid, false) - .assign(passing, (0, codegen_1._) `[${passing}, ${i}]`) - .else(); - } - gen.if(schValid, () => { - gen.assign(valid, true); - gen.assign(passing, i); - if (schCxt) - cxt.mergeEvaluated(schCxt, codegen_1.Name); - }); - }); - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=oneOf.js.map + // Verify that there is an actual destination to break or + // continue to. + var i = 0; + for (; i < this.labels.length; ++i) { + var lab = this.labels[i]; + if (node.label == null || lab.name === node.label.name) { + if (lab.kind != null && (isBreak || lab.kind === "loop")) { break } + if (node.label && isBreak) { break } + } + } + if (i === this.labels.length) { this.raise(node.start, "Unsyntactic " + keyword); } + return this.finishNode(node, isBreak ? "BreakStatement" : "ContinueStatement") + }; -/***/ }), + pp$8.parseDebuggerStatement = function(node) { + this.next(); + this.semicolon(); + return this.finishNode(node, "DebuggerStatement") + }; -/***/ 76360: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseDoStatement = function(node) { + this.next(); + this.labels.push(loopLabel); + node.body = this.parseStatement("do"); + this.labels.pop(); + this.expect(types$1._while); + node.test = this.parseParenExpression(); + if (this.options.ecmaVersion >= 6) + { this.eat(types$1.semi); } + else + { this.semicolon(); } + return this.finishNode(node, "DoWhileStatement") + }; + // Disambiguating between a `for` and a `for`/`in` or `for`/`of` + // loop is non-trivial. Basically, we have to parse the init `var` + // statement or expression, disallowing the `in` operator (see + // the second parameter to `parseExpression`), and then check + // whether the next token is `in` or `of`. When there is no init + // part (semicolon immediately after the opening parenthesis), it + // is a regular `for` loop. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const code_1 = __nccwpck_require__(74532); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const util_2 = __nccwpck_require__(87120); -const def = { - keyword: "patternProperties", - type: "object", - schemaType: "object", - code(cxt) { - const { gen, schema, data, parentSchema, it } = cxt; - const { opts } = it; - const patterns = (0, code_1.allSchemaProperties)(schema); - const alwaysValidPatterns = patterns.filter((p) => (0, util_1.alwaysValidSchema)(it, schema[p])); - if (patterns.length === 0 || - (alwaysValidPatterns.length === patterns.length && - (!it.opts.unevaluated || it.props === true))) { - return; - } - const checkProperties = opts.strictSchema && !opts.allowMatchingProperties && parentSchema.properties; - const valid = gen.name("valid"); - if (it.props !== true && !(it.props instanceof codegen_1.Name)) { - it.props = (0, util_2.evaluatedPropsToName)(gen, it.props); - } - const { props } = it; - validatePatternProperties(); - function validatePatternProperties() { - for (const pat of patterns) { - if (checkProperties) - checkMatchingProperties(pat); - if (it.allErrors) { - validateProperties(pat); - } - else { - gen.var(valid, true); // TODO var - validateProperties(pat); - gen.if(valid); - } - } - } - function checkMatchingProperties(pat) { - for (const prop in checkProperties) { - if (new RegExp(pat).test(prop)) { - (0, util_1.checkStrictMode)(it, `property ${prop} matches pattern ${pat} (use allowMatchingProperties)`); - } - } - } - function validateProperties(pat) { - gen.forIn("key", data, (key) => { - gen.if((0, codegen_1._) `${(0, code_1.usePattern)(cxt, pat)}.test(${key})`, () => { - const alwaysValid = alwaysValidPatterns.includes(pat); - if (!alwaysValid) { - cxt.subschema({ - keyword: "patternProperties", - schemaProp: pat, - dataProp: key, - dataPropType: util_2.Type.Str, - }, valid); - } - if (it.opts.unevaluated && props !== true) { - gen.assign((0, codegen_1._) `${props}[${key}]`, true); - } - else if (!alwaysValid && !it.allErrors) { - // can short-circuit if `unevaluatedProperties` is not supported (opts.next === false) - // or if all properties were evaluated (props === true) - gen.if((0, codegen_1.not)(valid), () => gen.break()); - } - }); - }); + pp$8.parseForStatement = function(node) { + this.next(); + var awaitAt = (this.options.ecmaVersion >= 9 && this.canAwait && this.eatContextual("await")) ? this.lastTokStart : -1; + this.labels.push(loopLabel); + this.enterScope(0); + this.expect(types$1.parenL); + if (this.type === types$1.semi) { + if (awaitAt > -1) { this.unexpected(awaitAt); } + return this.parseFor(node, null) + } + var isLet = this.isLet(); + if (this.type === types$1._var || this.type === types$1._const || isLet) { + var init$1 = this.startNode(), kind = isLet ? "let" : this.value; + this.next(); + this.parseVar(init$1, true, kind); + this.finishNode(init$1, "VariableDeclaration"); + if ((this.type === types$1._in || (this.options.ecmaVersion >= 6 && this.isContextual("of"))) && init$1.declarations.length === 1) { + if (this.options.ecmaVersion >= 9) { + if (this.type === types$1._in) { + if (awaitAt > -1) { this.unexpected(awaitAt); } + } else { node.await = awaitAt > -1; } } - }, -}; -exports["default"] = def; -//# sourceMappingURL=patternProperties.js.map + return this.parseForIn(node, init$1) + } + if (awaitAt > -1) { this.unexpected(awaitAt); } + return this.parseFor(node, init$1) + } + var startsWithLet = this.isContextual("let"), isForOf = false; + var containsEsc = this.containsEsc; + var refDestructuringErrors = new DestructuringErrors; + var initPos = this.start; + var init = awaitAt > -1 + ? this.parseExprSubscripts(refDestructuringErrors, "await") + : this.parseExpression(true, refDestructuringErrors); + if (this.type === types$1._in || (isForOf = this.options.ecmaVersion >= 6 && this.isContextual("of"))) { + if (awaitAt > -1) { // implies `ecmaVersion >= 9` (see declaration of awaitAt) + if (this.type === types$1._in) { this.unexpected(awaitAt); } + node.await = true; + } else if (isForOf && this.options.ecmaVersion >= 8) { + if (init.start === initPos && !containsEsc && init.type === "Identifier" && init.name === "async") { this.unexpected(); } + else if (this.options.ecmaVersion >= 9) { node.await = false; } + } + if (startsWithLet && isForOf) { this.raise(init.start, "The left-hand side of a for-of loop may not start with 'let'."); } + this.toAssignable(init, false, refDestructuringErrors); + this.checkLValPattern(init); + return this.parseForIn(node, init) + } else { + this.checkExpressionErrors(refDestructuringErrors, true); + } + if (awaitAt > -1) { this.unexpected(awaitAt); } + return this.parseFor(node, init) + }; -/***/ }), + pp$8.parseFunctionStatement = function(node, isAsync, declarationPosition) { + this.next(); + return this.parseFunction(node, FUNC_STATEMENT | (declarationPosition ? 0 : FUNC_HANGING_STATEMENT), false, isAsync) + }; -/***/ 8515: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseIfStatement = function(node) { + this.next(); + node.test = this.parseParenExpression(); + // allow function declarations in branches, but only in non-strict mode + node.consequent = this.parseStatement("if"); + node.alternate = this.eat(types$1._else) ? this.parseStatement("if") : null; + return this.finishNode(node, "IfStatement") + }; + pp$8.parseReturnStatement = function(node) { + if (!this.inFunction && !this.options.allowReturnOutsideFunction) + { this.raise(this.start, "'return' outside of function"); } + this.next(); -Object.defineProperty(exports, "__esModule", ({ value: true })); -const items_1 = __nccwpck_require__(23247); -const def = { - keyword: "prefixItems", - type: "array", - schemaType: ["array"], - before: "uniqueItems", - code: (cxt) => (0, items_1.validateTuple)(cxt, "items"), -}; -exports["default"] = def; -//# sourceMappingURL=prefixItems.js.map + // In `return` (and `break`/`continue`), the keywords with + // optional arguments, we eagerly look for a semicolon or the + // possibility to insert one. -/***/ }), + if (this.eat(types$1.semi) || this.insertSemicolon()) { node.argument = null; } + else { node.argument = this.parseExpression(); this.semicolon(); } + return this.finishNode(node, "ReturnStatement") + }; -/***/ 40746: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseSwitchStatement = function(node) { + this.next(); + node.discriminant = this.parseParenExpression(); + node.cases = []; + this.expect(types$1.braceL); + this.labels.push(switchLabel); + this.enterScope(0); + // Statements under must be grouped (by label) in SwitchCase + // nodes. `cur` is used to keep the node that we are currently + // adding statements to. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const validate_1 = __nccwpck_require__(26345); -const code_1 = __nccwpck_require__(74532); -const util_1 = __nccwpck_require__(87120); -const additionalProperties_1 = __nccwpck_require__(23487); -const def = { - keyword: "properties", - type: "object", - schemaType: "object", - code(cxt) { - const { gen, schema, parentSchema, data, it } = cxt; - if (it.opts.removeAdditional === "all" && parentSchema.additionalProperties === undefined) { - additionalProperties_1.default.code(new validate_1.KeywordCxt(it, additionalProperties_1.default, "additionalProperties")); - } - const allProps = (0, code_1.allSchemaProperties)(schema); - for (const prop of allProps) { - it.definedProperties.add(prop); - } - if (it.opts.unevaluated && allProps.length && it.props !== true) { - it.props = util_1.mergeEvaluated.props(gen, (0, util_1.toHash)(allProps), it.props); - } - const properties = allProps.filter((p) => !(0, util_1.alwaysValidSchema)(it, schema[p])); - if (properties.length === 0) - return; - const valid = gen.name("valid"); - for (const prop of properties) { - if (hasDefault(prop)) { - applyPropertySchema(prop); - } - else { - gen.if((0, code_1.propertyInData)(gen, data, prop, it.opts.ownProperties)); - applyPropertySchema(prop); - if (!it.allErrors) - gen.else().var(valid, true); - gen.endIf(); - } - cxt.it.definedProperties.add(prop); - cxt.ok(valid); - } - function hasDefault(prop) { - return it.opts.useDefaults && !it.compositeRule && schema[prop].default !== undefined; - } - function applyPropertySchema(prop) { - cxt.subschema({ - keyword: "properties", - schemaProp: prop, - dataProp: prop, - }, valid); + var cur; + for (var sawDefault = false; this.type !== types$1.braceR;) { + if (this.type === types$1._case || this.type === types$1._default) { + var isCase = this.type === types$1._case; + if (cur) { this.finishNode(cur, "SwitchCase"); } + node.cases.push(cur = this.startNode()); + cur.consequent = []; + this.next(); + if (isCase) { + cur.test = this.parseExpression(); + } else { + if (sawDefault) { this.raiseRecoverable(this.lastTokStart, "Multiple default clauses"); } + sawDefault = true; + cur.test = null; } - }, -}; -exports["default"] = def; -//# sourceMappingURL=properties.js.map + this.expect(types$1.colon); + } else { + if (!cur) { this.unexpected(); } + cur.consequent.push(this.parseStatement(null)); + } + } + this.exitScope(); + if (cur) { this.finishNode(cur, "SwitchCase"); } + this.next(); // Closing brace + this.labels.pop(); + return this.finishNode(node, "SwitchStatement") + }; -/***/ }), + pp$8.parseThrowStatement = function(node) { + this.next(); + if (lineBreak.test(this.input.slice(this.lastTokEnd, this.start))) + { this.raise(this.lastTokEnd, "Illegal newline after throw"); } + node.argument = this.parseExpression(); + this.semicolon(); + return this.finishNode(node, "ThrowStatement") + }; -/***/ 29132: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Reused empty array added for node fields that are always empty. + var empty$1 = []; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: "property name must be valid", - params: ({ params }) => (0, codegen_1._) `{propertyName: ${params.propertyName}}`, -}; -const def = { - keyword: "propertyNames", - type: "object", - schemaType: ["object", "boolean"], - error, - code(cxt) { - const { gen, schema, data, it } = cxt; - if ((0, util_1.alwaysValidSchema)(it, schema)) - return; - const valid = gen.name("valid"); - gen.forIn("key", data, (key) => { - cxt.setParams({ propertyName: key }); - cxt.subschema({ - keyword: "propertyNames", - data: key, - dataTypes: ["string"], - propertyName: key, - compositeRule: true, - }, valid); - gen.if((0, codegen_1.not)(valid), () => { - cxt.error(true); - if (!it.allErrors) - gen.break(); - }); - }); - cxt.ok(valid); - }, -}; -exports["default"] = def; -//# sourceMappingURL=propertyNames.js.map + pp$8.parseCatchClauseParam = function() { + var param = this.parseBindingAtom(); + var simple = param.type === "Identifier"; + this.enterScope(simple ? SCOPE_SIMPLE_CATCH : 0); + this.checkLValPattern(param, simple ? BIND_SIMPLE_CATCH : BIND_LEXICAL); + this.expect(types$1.parenR); -/***/ }), + return param + }; -/***/ 77: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseTryStatement = function(node) { + this.next(); + node.block = this.parseBlock(); + node.handler = null; + if (this.type === types$1._catch) { + var clause = this.startNode(); + this.next(); + if (this.eat(types$1.parenL)) { + clause.param = this.parseCatchClauseParam(); + } else { + if (this.options.ecmaVersion < 10) { this.unexpected(); } + clause.param = null; + this.enterScope(0); + } + clause.body = this.parseBlock(false); + this.exitScope(); + node.handler = this.finishNode(clause, "CatchClause"); + } + node.finalizer = this.eat(types$1._finally) ? this.parseBlock() : null; + if (!node.handler && !node.finalizer) + { this.raise(node.start, "Missing catch or finally clause"); } + return this.finishNode(node, "TryStatement") + }; + pp$8.parseVarStatement = function(node, kind, allowMissingInitializer) { + this.next(); + this.parseVar(node, false, kind, allowMissingInitializer); + this.semicolon(); + return this.finishNode(node, "VariableDeclaration") + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const util_1 = __nccwpck_require__(87120); -const def = { - keyword: ["then", "else"], - schemaType: ["object", "boolean"], - code({ keyword, parentSchema, it }) { - if (parentSchema.if === undefined) - (0, util_1.checkStrictMode)(it, `"${keyword}" without "if" is ignored`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=thenElse.js.map + pp$8.parseWhileStatement = function(node) { + this.next(); + node.test = this.parseParenExpression(); + this.labels.push(loopLabel); + node.body = this.parseStatement("while"); + this.labels.pop(); + return this.finishNode(node, "WhileStatement") + }; -/***/ }), + pp$8.parseWithStatement = function(node) { + if (this.strict) { this.raise(this.start, "'with' in strict mode"); } + this.next(); + node.object = this.parseParenExpression(); + node.body = this.parseStatement("with"); + return this.finishNode(node, "WithStatement") + }; -/***/ 74532: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseEmptyStatement = function(node) { + this.next(); + return this.finishNode(node, "EmptyStatement") + }; + pp$8.parseLabeledStatement = function(node, maybeName, expr, context) { + for (var i$1 = 0, list = this.labels; i$1 < list.length; i$1 += 1) + { + var label = list[i$1]; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.validateUnion = exports.validateArray = exports.usePattern = exports.callValidateCode = exports.schemaProperties = exports.allSchemaProperties = exports.noPropertyInData = exports.propertyInData = exports.isOwnProperty = exports.hasPropFunc = exports.reportMissingProp = exports.checkMissingProp = exports.checkReportMissingProp = void 0; -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const names_1 = __nccwpck_require__(66662); -const util_2 = __nccwpck_require__(87120); -function checkReportMissingProp(cxt, prop) { - const { gen, data, it } = cxt; - gen.if(noPropertyInData(gen, data, prop, it.opts.ownProperties), () => { - cxt.setParams({ missingProperty: (0, codegen_1._) `${prop}` }, true); - cxt.error(); - }); -} -exports.checkReportMissingProp = checkReportMissingProp; -function checkMissingProp({ gen, data, it: { opts } }, properties, missing) { - return (0, codegen_1.or)(...properties.map((prop) => (0, codegen_1.and)(noPropertyInData(gen, data, prop, opts.ownProperties), (0, codegen_1._) `${missing} = ${prop}`))); -} -exports.checkMissingProp = checkMissingProp; -function reportMissingProp(cxt, missing) { - cxt.setParams({ missingProperty: missing }, true); - cxt.error(); -} -exports.reportMissingProp = reportMissingProp; -function hasPropFunc(gen) { - return gen.scopeValue("func", { - // eslint-disable-next-line @typescript-eslint/unbound-method - ref: Object.prototype.hasOwnProperty, - code: (0, codegen_1._) `Object.prototype.hasOwnProperty`, - }); -} -exports.hasPropFunc = hasPropFunc; -function isOwnProperty(gen, data, property) { - return (0, codegen_1._) `${hasPropFunc(gen)}.call(${data}, ${property})`; -} -exports.isOwnProperty = isOwnProperty; -function propertyInData(gen, data, property, ownProperties) { - const cond = (0, codegen_1._) `${data}${(0, codegen_1.getProperty)(property)} !== undefined`; - return ownProperties ? (0, codegen_1._) `${cond} && ${isOwnProperty(gen, data, property)}` : cond; -} -exports.propertyInData = propertyInData; -function noPropertyInData(gen, data, property, ownProperties) { - const cond = (0, codegen_1._) `${data}${(0, codegen_1.getProperty)(property)} === undefined`; - return ownProperties ? (0, codegen_1.or)(cond, (0, codegen_1.not)(isOwnProperty(gen, data, property))) : cond; -} -exports.noPropertyInData = noPropertyInData; -function allSchemaProperties(schemaMap) { - return schemaMap ? Object.keys(schemaMap).filter((p) => p !== "__proto__") : []; -} -exports.allSchemaProperties = allSchemaProperties; -function schemaProperties(it, schemaMap) { - return allSchemaProperties(schemaMap).filter((p) => !(0, util_1.alwaysValidSchema)(it, schemaMap[p])); -} -exports.schemaProperties = schemaProperties; -function callValidateCode({ schemaCode, data, it: { gen, topSchemaRef, schemaPath, errorPath }, it }, func, context, passSchema) { - const dataAndSchema = passSchema ? (0, codegen_1._) `${schemaCode}, ${data}, ${topSchemaRef}${schemaPath}` : data; - const valCxt = [ - [names_1.default.instancePath, (0, codegen_1.strConcat)(names_1.default.instancePath, errorPath)], - [names_1.default.parentData, it.parentData], - [names_1.default.parentDataProperty, it.parentDataProperty], - [names_1.default.rootData, names_1.default.rootData], - ]; - if (it.opts.dynamicRef) - valCxt.push([names_1.default.dynamicAnchors, names_1.default.dynamicAnchors]); - const args = (0, codegen_1._) `${dataAndSchema}, ${gen.object(...valCxt)}`; - return context !== codegen_1.nil ? (0, codegen_1._) `${func}.call(${context}, ${args})` : (0, codegen_1._) `${func}(${args})`; -} -exports.callValidateCode = callValidateCode; -const newRegExp = (0, codegen_1._) `new RegExp`; -function usePattern({ gen, it: { opts } }, pattern) { - const u = opts.unicodeRegExp ? "u" : ""; - const { regExp } = opts.code; - const rx = regExp(pattern, u); - return gen.scopeValue("pattern", { - key: rx.toString(), - ref: rx, - code: (0, codegen_1._) `${regExp.code === "new RegExp" ? newRegExp : (0, util_2.useFunc)(gen, regExp)}(${pattern}, ${u})`, - }); -} -exports.usePattern = usePattern; -function validateArray(cxt) { - const { gen, data, keyword, it } = cxt; - const valid = gen.name("valid"); - if (it.allErrors) { - const validArr = gen.let("valid", true); - validateItems(() => gen.assign(validArr, false)); - return validArr; - } - gen.var(valid, true); - validateItems(() => gen.break()); - return valid; - function validateItems(notValid) { - const len = gen.const("len", (0, codegen_1._) `${data}.length`); - gen.forRange("i", 0, len, (i) => { - cxt.subschema({ - keyword, - dataProp: i, - dataPropType: util_1.Type.Num, - }, valid); - gen.if((0, codegen_1.not)(valid), notValid); - }); + if (label.name === maybeName) + { this.raise(expr.start, "Label '" + maybeName + "' is already declared"); + } } + var kind = this.type.isLoop ? "loop" : this.type === types$1._switch ? "switch" : null; + for (var i = this.labels.length - 1; i >= 0; i--) { + var label$1 = this.labels[i]; + if (label$1.statementStart === node.start) { + // Update information about previous labels on this node + label$1.statementStart = this.start; + label$1.kind = kind; + } else { break } } -} -exports.validateArray = validateArray; -function validateUnion(cxt) { - const { gen, schema, keyword, it } = cxt; - /* istanbul ignore if */ - if (!Array.isArray(schema)) - throw new Error("ajv implementation error"); - const alwaysValid = schema.some((sch) => (0, util_1.alwaysValidSchema)(it, sch)); - if (alwaysValid && !it.opts.unevaluated) - return; - const valid = gen.let("valid", false); - const schValid = gen.name("_valid"); - gen.block(() => schema.forEach((_sch, i) => { - const schCxt = cxt.subschema({ - keyword, - schemaProp: i, - compositeRule: true, - }, schValid); - gen.assign(valid, (0, codegen_1._) `${valid} || ${schValid}`); - const merged = cxt.mergeValidEvaluated(schCxt, schValid); - // can short-circuit if `unevaluatedProperties/Items` not supported (opts.unevaluated !== true) - // or if all properties and items were evaluated (it.props === true && it.items === true) - if (!merged) - gen.if((0, codegen_1.not)(valid)); - })); - cxt.result(valid, () => cxt.reset(), () => cxt.error(true)); -} -exports.validateUnion = validateUnion; -//# sourceMappingURL=code.js.map - -/***/ }), - -/***/ 50032: -/***/ ((__unused_webpack_module, exports) => { - + this.labels.push({name: maybeName, kind: kind, statementStart: this.start}); + node.body = this.parseStatement(context ? context.indexOf("label") === -1 ? context + "label" : context : "label"); + this.labels.pop(); + node.label = expr; + return this.finishNode(node, "LabeledStatement") + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const def = { - keyword: "id", - code() { - throw new Error('NOT SUPPORTED: keyword "id", use "$id" for schema ID'); - }, -}; -exports["default"] = def; -//# sourceMappingURL=id.js.map + pp$8.parseExpressionStatement = function(node, expr) { + node.expression = expr; + this.semicolon(); + return this.finishNode(node, "ExpressionStatement") + }; -/***/ }), + // Parse a semicolon-enclosed block of statements, handling `"use + // strict"` declarations when `allowStrict` is true (used for + // function bodies). -/***/ 48725: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseBlock = function(createNewLexicalScope, node, exitStrict) { + if ( createNewLexicalScope === void 0 ) createNewLexicalScope = true; + if ( node === void 0 ) node = this.startNode(); + node.body = []; + this.expect(types$1.braceL); + if (createNewLexicalScope) { this.enterScope(0); } + while (this.type !== types$1.braceR) { + var stmt = this.parseStatement(null); + node.body.push(stmt); + } + if (exitStrict) { this.strict = false; } + this.next(); + if (createNewLexicalScope) { this.exitScope(); } + return this.finishNode(node, "BlockStatement") + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const id_1 = __nccwpck_require__(50032); -const ref_1 = __nccwpck_require__(94596); -const core = [ - "$schema", - "$id", - "$defs", - "$vocabulary", - { keyword: "$comment" }, - "definitions", - id_1.default, - ref_1.default, -]; -exports["default"] = core; -//# sourceMappingURL=index.js.map + // Parse a regular `for` loop. The disambiguation code in + // `parseStatement` will already have parsed the init statement or + // expression. -/***/ }), + pp$8.parseFor = function(node, init) { + node.init = init; + this.expect(types$1.semi); + node.test = this.type === types$1.semi ? null : this.parseExpression(); + this.expect(types$1.semi); + node.update = this.type === types$1.parenR ? null : this.parseExpression(); + this.expect(types$1.parenR); + node.body = this.parseStatement("for"); + this.exitScope(); + this.labels.pop(); + return this.finishNode(node, "ForStatement") + }; -/***/ 94596: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Parse a `for`/`in` and `for`/`of` loop, which are almost + // same from parser's perspective. + pp$8.parseForIn = function(node, init) { + var isForIn = this.type === types$1._in; + this.next(); -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.callRef = exports.getValidate = void 0; -const ref_error_1 = __nccwpck_require__(36938); -const code_1 = __nccwpck_require__(74532); -const codegen_1 = __nccwpck_require__(30972); -const names_1 = __nccwpck_require__(66662); -const compile_1 = __nccwpck_require__(36222); -const util_1 = __nccwpck_require__(87120); -const def = { - keyword: "$ref", - schemaType: "string", - code(cxt) { - const { gen, schema: $ref, it } = cxt; - const { baseId, schemaEnv: env, validateName, opts, self } = it; - const { root } = env; - if (($ref === "#" || $ref === "#/") && baseId === root.baseId) - return callRootRef(); - const schOrEnv = compile_1.resolveRef.call(self, root, baseId, $ref); - if (schOrEnv === undefined) - throw new ref_error_1.default(it.opts.uriResolver, baseId, $ref); - if (schOrEnv instanceof compile_1.SchemaEnv) - return callValidate(schOrEnv); - return inlineRefSchema(schOrEnv); - function callRootRef() { - if (env === root) - return callRef(cxt, validateName, env, env.$async); - const rootName = gen.scopeValue("root", { ref: root }); - return callRef(cxt, (0, codegen_1._) `${rootName}.validate`, root, root.$async); - } - function callValidate(sch) { - const v = getValidate(cxt, sch); - callRef(cxt, v, sch, sch.$async); - } - function inlineRefSchema(sch) { - const schName = gen.scopeValue("schema", opts.code.source === true ? { ref: sch, code: (0, codegen_1.stringify)(sch) } : { ref: sch }); - const valid = gen.name("valid"); - const schCxt = cxt.subschema({ - schema: sch, - dataTypes: [], - schemaPath: codegen_1.nil, - topSchemaRef: schName, - errSchemaPath: $ref, - }, valid); - cxt.mergeEvaluated(schCxt); - cxt.ok(valid); - } - }, -}; -function getValidate(cxt, sch) { - const { gen } = cxt; - return sch.validate - ? gen.scopeValue("validate", { ref: sch.validate }) - : (0, codegen_1._) `${gen.scopeValue("wrapper", { ref: sch })}.validate`; -} -exports.getValidate = getValidate; -function callRef(cxt, v, sch, $async) { - const { gen, it } = cxt; - const { allErrors, schemaEnv: env, opts } = it; - const passCxt = opts.passContext ? names_1.default.this : codegen_1.nil; - if ($async) - callAsyncRef(); - else - callSyncRef(); - function callAsyncRef() { - if (!env.$async) - throw new Error("async schema referenced by sync schema"); - const valid = gen.let("valid"); - gen.try(() => { - gen.code((0, codegen_1._) `await ${(0, code_1.callValidateCode)(cxt, v, passCxt)}`); - addEvaluatedFrom(v); // TODO will not work with async, it has to be returned with the result - if (!allErrors) - gen.assign(valid, true); - }, (e) => { - gen.if((0, codegen_1._) `!(${e} instanceof ${it.ValidationError})`, () => gen.throw(e)); - addErrorsFrom(e); - if (!allErrors) - gen.assign(valid, false); - }); - cxt.ok(valid); - } - function callSyncRef() { - cxt.result((0, code_1.callValidateCode)(cxt, v, passCxt), () => addEvaluatedFrom(v), () => addErrorsFrom(v)); - } - function addErrorsFrom(source) { - const errs = (0, codegen_1._) `${source}.errors`; - gen.assign(names_1.default.vErrors, (0, codegen_1._) `${names_1.default.vErrors} === null ? ${errs} : ${names_1.default.vErrors}.concat(${errs})`); // TODO tagged - gen.assign(names_1.default.errors, (0, codegen_1._) `${names_1.default.vErrors}.length`); - } - function addEvaluatedFrom(source) { - var _a; - if (!it.opts.unevaluated) - return; - const schEvaluated = (_a = sch === null || sch === void 0 ? void 0 : sch.validate) === null || _a === void 0 ? void 0 : _a.evaluated; - // TODO refactor - if (it.props !== true) { - if (schEvaluated && !schEvaluated.dynamicProps) { - if (schEvaluated.props !== undefined) { - it.props = util_1.mergeEvaluated.props(gen, schEvaluated.props, it.props); - } - } - else { - const props = gen.var("props", (0, codegen_1._) `${source}.evaluated.props`); - it.props = util_1.mergeEvaluated.props(gen, props, it.props, codegen_1.Name); - } - } - if (it.items !== true) { - if (schEvaluated && !schEvaluated.dynamicItems) { - if (schEvaluated.items !== undefined) { - it.items = util_1.mergeEvaluated.items(gen, schEvaluated.items, it.items); - } - } - else { - const items = gen.var("items", (0, codegen_1._) `${source}.evaluated.items`); - it.items = util_1.mergeEvaluated.items(gen, items, it.items, codegen_1.Name); - } - } + if ( + init.type === "VariableDeclaration" && + init.declarations[0].init != null && + ( + !isForIn || + this.options.ecmaVersion < 8 || + this.strict || + init.kind !== "var" || + init.declarations[0].id.type !== "Identifier" + ) + ) { + this.raise( + init.start, + ((isForIn ? "for-in" : "for-of") + " loop variable declaration may not have an initializer") + ); } -} -exports.callRef = callRef; -exports["default"] = def; -//# sourceMappingURL=ref.js.map + node.left = init; + node.right = isForIn ? this.parseExpression() : this.parseMaybeAssign(); + this.expect(types$1.parenR); + node.body = this.parseStatement("for"); + this.exitScope(); + this.labels.pop(); + return this.finishNode(node, isForIn ? "ForInStatement" : "ForOfStatement") + }; -/***/ }), + // Parse a list of variable declarations. -/***/ 86102: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseVar = function(node, isFor, kind, allowMissingInitializer) { + node.declarations = []; + node.kind = kind; + for (;;) { + var decl = this.startNode(); + this.parseVarId(decl, kind); + if (this.eat(types$1.eq)) { + decl.init = this.parseMaybeAssign(isFor); + } else if (!allowMissingInitializer && kind === "const" && !(this.type === types$1._in || (this.options.ecmaVersion >= 6 && this.isContextual("of")))) { + this.unexpected(); + } else if (!allowMissingInitializer && decl.id.type !== "Identifier" && !(isFor && (this.type === types$1._in || this.isContextual("of")))) { + this.raise(this.lastTokEnd, "Complex binding patterns require an initialization value"); + } else { + decl.init = null; + } + node.declarations.push(this.finishNode(decl, "VariableDeclarator")); + if (!this.eat(types$1.comma)) { break } + } + return node + }; + pp$8.parseVarId = function(decl, kind) { + decl.id = this.parseBindingAtom(); + this.checkLValPattern(decl.id, kind === "var" ? BIND_VAR : BIND_LEXICAL, false); + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const types_1 = __nccwpck_require__(73003); -const compile_1 = __nccwpck_require__(36222); -const util_1 = __nccwpck_require__(87120); -const error = { - message: ({ params: { discrError, tagName } }) => discrError === types_1.DiscrError.Tag - ? `tag "${tagName}" must be string` - : `value of tag "${tagName}" must be in oneOf`, - params: ({ params: { discrError, tag, tagName } }) => (0, codegen_1._) `{error: ${discrError}, tag: ${tagName}, tagValue: ${tag}}`, -}; -const def = { - keyword: "discriminator", - type: "object", - schemaType: "object", - error, - code(cxt) { - const { gen, data, schema, parentSchema, it } = cxt; - const { oneOf } = parentSchema; - if (!it.opts.discriminator) { - throw new Error("discriminator: requires discriminator option"); - } - const tagName = schema.propertyName; - if (typeof tagName != "string") - throw new Error("discriminator: requires propertyName"); - if (schema.mapping) - throw new Error("discriminator: mapping is not supported"); - if (!oneOf) - throw new Error("discriminator: requires oneOf keyword"); - const valid = gen.let("valid", false); - const tag = gen.const("tag", (0, codegen_1._) `${data}${(0, codegen_1.getProperty)(tagName)}`); - gen.if((0, codegen_1._) `typeof ${tag} == "string"`, () => validateMapping(), () => cxt.error(false, { discrError: types_1.DiscrError.Tag, tag, tagName })); - cxt.ok(valid); - function validateMapping() { - const mapping = getMapping(); - gen.if(false); - for (const tagValue in mapping) { - gen.elseIf((0, codegen_1._) `${tag} === ${tagValue}`); - gen.assign(valid, applyTagSchema(mapping[tagValue])); - } - gen.else(); - cxt.error(false, { discrError: types_1.DiscrError.Mapping, tag, tagName }); - gen.endIf(); - } - function applyTagSchema(schemaProp) { - const _valid = gen.name("valid"); - const schCxt = cxt.subschema({ keyword: "oneOf", schemaProp }, _valid); - cxt.mergeEvaluated(schCxt, codegen_1.Name); - return _valid; - } - function getMapping() { - var _a; - const oneOfMapping = {}; - const topRequired = hasRequired(parentSchema); - let tagRequired = true; - for (let i = 0; i < oneOf.length; i++) { - let sch = oneOf[i]; - if ((sch === null || sch === void 0 ? void 0 : sch.$ref) && !(0, util_1.schemaHasRulesButRef)(sch, it.self.RULES)) { - sch = compile_1.resolveRef.call(it.self, it.schemaEnv.root, it.baseId, sch === null || sch === void 0 ? void 0 : sch.$ref); - if (sch instanceof compile_1.SchemaEnv) - sch = sch.schema; - } - const propSch = (_a = sch === null || sch === void 0 ? void 0 : sch.properties) === null || _a === void 0 ? void 0 : _a[tagName]; - if (typeof propSch != "object") { - throw new Error(`discriminator: oneOf subschemas (or referenced schemas) must have "properties/${tagName}"`); - } - tagRequired = tagRequired && (topRequired || hasRequired(sch)); - addMappings(propSch, i); - } - if (!tagRequired) - throw new Error(`discriminator: "${tagName}" must be required`); - return oneOfMapping; - function hasRequired({ required }) { - return Array.isArray(required) && required.includes(tagName); - } - function addMappings(sch, i) { - if (sch.const) { - addMapping(sch.const, i); - } - else if (sch.enum) { - for (const tagValue of sch.enum) { - addMapping(tagValue, i); - } - } - else { - throw new Error(`discriminator: "properties/${tagName}" must have "const" or "enum"`); - } - } - function addMapping(tagValue, i) { - if (typeof tagValue != "string" || tagValue in oneOfMapping) { - throw new Error(`discriminator: "${tagName}" values must be unique strings`); - } - oneOfMapping[tagValue] = i; - } - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=index.js.map + var FUNC_STATEMENT = 1, FUNC_HANGING_STATEMENT = 2, FUNC_NULLABLE_ID = 4; -/***/ }), + // Parse a function declaration or literal (depending on the + // `statement & FUNC_STATEMENT`). -/***/ 73003: -/***/ ((__unused_webpack_module, exports) => { + // Remove `allowExpressionBody` for 7.0.0, as it is only called with false + pp$8.parseFunction = function(node, statement, allowExpressionBody, isAsync, forInit) { + this.initFunction(node); + if (this.options.ecmaVersion >= 9 || this.options.ecmaVersion >= 6 && !isAsync) { + if (this.type === types$1.star && (statement & FUNC_HANGING_STATEMENT)) + { this.unexpected(); } + node.generator = this.eat(types$1.star); + } + if (this.options.ecmaVersion >= 8) + { node.async = !!isAsync; } + if (statement & FUNC_STATEMENT) { + node.id = (statement & FUNC_NULLABLE_ID) && this.type !== types$1.name ? null : this.parseIdent(); + if (node.id && !(statement & FUNC_HANGING_STATEMENT)) + // If it is a regular function declaration in sloppy mode, then it is + // subject to Annex B semantics (BIND_FUNCTION). Otherwise, the binding + // mode depends on properties of the current scope (see + // treatFunctionsAsVar). + { this.checkLValSimple(node.id, (this.strict || node.generator || node.async) ? this.treatFunctionsAsVar ? BIND_VAR : BIND_LEXICAL : BIND_FUNCTION); } + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DiscrError = void 0; -var DiscrError; -(function (DiscrError) { - DiscrError["Tag"] = "tag"; - DiscrError["Mapping"] = "mapping"; -})(DiscrError = exports.DiscrError || (exports.DiscrError = {})); -//# sourceMappingURL=types.js.map + var oldYieldPos = this.yieldPos, oldAwaitPos = this.awaitPos, oldAwaitIdentPos = this.awaitIdentPos; + this.yieldPos = 0; + this.awaitPos = 0; + this.awaitIdentPos = 0; + this.enterScope(functionFlags(node.async, node.generator)); -/***/ }), + if (!(statement & FUNC_STATEMENT)) + { node.id = this.type === types$1.name ? this.parseIdent() : null; } -/***/ 3621: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + this.parseFunctionParams(node); + this.parseFunctionBody(node, allowExpressionBody, false, forInit); + this.yieldPos = oldYieldPos; + this.awaitPos = oldAwaitPos; + this.awaitIdentPos = oldAwaitIdentPos; + return this.finishNode(node, (statement & FUNC_STATEMENT) ? "FunctionDeclaration" : "FunctionExpression") + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const core_1 = __nccwpck_require__(48725); -const validation_1 = __nccwpck_require__(34889); -const applicator_1 = __nccwpck_require__(30567); -const format_1 = __nccwpck_require__(30329); -const metadata_1 = __nccwpck_require__(71436); -const draft7Vocabularies = [ - core_1.default, - validation_1.default, - (0, applicator_1.default)(), - format_1.default, - metadata_1.metadataVocabulary, - metadata_1.contentVocabulary, -]; -exports["default"] = draft7Vocabularies; -//# sourceMappingURL=draft7.js.map + pp$8.parseFunctionParams = function(node) { + this.expect(types$1.parenL); + node.params = this.parseBindingList(types$1.parenR, false, this.options.ecmaVersion >= 8); + this.checkYieldAwaitInDefaultParams(); + }; -/***/ }), + // Parse a class declaration or literal (depending on the + // `isStatement` parameter). -/***/ 53122: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseClass = function(node, isStatement) { + this.next(); + // ecma-262 14.6 Class Definitions + // A class definition is always strict mode code. + var oldStrict = this.strict; + this.strict = true; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const error = { - message: ({ schemaCode }) => (0, codegen_1.str) `must match format "${schemaCode}"`, - params: ({ schemaCode }) => (0, codegen_1._) `{format: ${schemaCode}}`, -}; -const def = { - keyword: "format", - type: ["number", "string"], - schemaType: "string", - $data: true, - error, - code(cxt, ruleType) { - const { gen, data, $data, schema, schemaCode, it } = cxt; - const { opts, errSchemaPath, schemaEnv, self } = it; - if (!opts.validateFormats) - return; - if ($data) - validate$DataFormat(); - else - validateFormat(); - function validate$DataFormat() { - const fmts = gen.scopeValue("formats", { - ref: self.formats, - code: opts.code.formats, - }); - const fDef = gen.const("fDef", (0, codegen_1._) `${fmts}[${schemaCode}]`); - const fType = gen.let("fType"); - const format = gen.let("format"); - // TODO simplify - gen.if((0, codegen_1._) `typeof ${fDef} == "object" && !(${fDef} instanceof RegExp)`, () => gen.assign(fType, (0, codegen_1._) `${fDef}.type || "string"`).assign(format, (0, codegen_1._) `${fDef}.validate`), () => gen.assign(fType, (0, codegen_1._) `"string"`).assign(format, fDef)); - cxt.fail$data((0, codegen_1.or)(unknownFmt(), invalidFmt())); - function unknownFmt() { - if (opts.strictSchema === false) - return codegen_1.nil; - return (0, codegen_1._) `${schemaCode} && !${format}`; - } - function invalidFmt() { - const callFormat = schemaEnv.$async - ? (0, codegen_1._) `(${fDef}.async ? await ${format}(${data}) : ${format}(${data}))` - : (0, codegen_1._) `${format}(${data})`; - const validData = (0, codegen_1._) `(typeof ${format} == "function" ? ${callFormat} : ${format}.test(${data}))`; - return (0, codegen_1._) `${format} && ${format} !== true && ${fType} === ${ruleType} && !${validData}`; - } - } - function validateFormat() { - const formatDef = self.formats[schema]; - if (!formatDef) { - unknownFormat(); - return; - } - if (formatDef === true) - return; - const [fmtType, format, fmtRef] = getFormat(formatDef); - if (fmtType === ruleType) - cxt.pass(validCondition()); - function unknownFormat() { - if (opts.strictSchema === false) { - self.logger.warn(unknownMsg()); - return; - } - throw new Error(unknownMsg()); - function unknownMsg() { - return `unknown format "${schema}" ignored in schema at path "${errSchemaPath}"`; - } - } - function getFormat(fmtDef) { - const code = fmtDef instanceof RegExp - ? (0, codegen_1.regexpCode)(fmtDef) - : opts.code.formats - ? (0, codegen_1._) `${opts.code.formats}${(0, codegen_1.getProperty)(schema)}` - : undefined; - const fmt = gen.scopeValue("formats", { key: schema, ref: fmtDef, code }); - if (typeof fmtDef == "object" && !(fmtDef instanceof RegExp)) { - return [fmtDef.type || "string", fmtDef.validate, (0, codegen_1._) `${fmt}.validate`]; - } - return ["string", fmtDef, fmt]; - } - function validCondition() { - if (typeof formatDef == "object" && !(formatDef instanceof RegExp) && formatDef.async) { - if (!schemaEnv.$async) - throw new Error("async format in sync schema"); - return (0, codegen_1._) `await ${fmtRef}(${data})`; - } - return typeof format == "function" ? (0, codegen_1._) `${fmtRef}(${data})` : (0, codegen_1._) `${fmtRef}.test(${data})`; - } + this.parseClassId(node, isStatement); + this.parseClassSuper(node); + var privateNameMap = this.enterClassBody(); + var classBody = this.startNode(); + var hadConstructor = false; + classBody.body = []; + this.expect(types$1.braceL); + while (this.type !== types$1.braceR) { + var element = this.parseClassElement(node.superClass !== null); + if (element) { + classBody.body.push(element); + if (element.type === "MethodDefinition" && element.kind === "constructor") { + if (hadConstructor) { this.raiseRecoverable(element.start, "Duplicate constructor in the same class"); } + hadConstructor = true; + } else if (element.key && element.key.type === "PrivateIdentifier" && isPrivateNameConflicted(privateNameMap, element)) { + this.raiseRecoverable(element.key.start, ("Identifier '#" + (element.key.name) + "' has already been declared")); } - }, -}; -exports["default"] = def; -//# sourceMappingURL=format.js.map + } + } + this.strict = oldStrict; + this.next(); + node.body = this.finishNode(classBody, "ClassBody"); + this.exitClassBody(); + return this.finishNode(node, isStatement ? "ClassDeclaration" : "ClassExpression") + }; -/***/ }), + pp$8.parseClassElement = function(constructorAllowsSuper) { + if (this.eat(types$1.semi)) { return null } -/***/ 30329: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + var ecmaVersion = this.options.ecmaVersion; + var node = this.startNode(); + var keyName = ""; + var isGenerator = false; + var isAsync = false; + var kind = "method"; + var isStatic = false; + if (this.eatContextual("static")) { + // Parse static init block + if (ecmaVersion >= 13 && this.eat(types$1.braceL)) { + this.parseClassStaticBlock(node); + return node + } + if (this.isClassElementNameStart() || this.type === types$1.star) { + isStatic = true; + } else { + keyName = "static"; + } + } + node.static = isStatic; + if (!keyName && ecmaVersion >= 8 && this.eatContextual("async")) { + if ((this.isClassElementNameStart() || this.type === types$1.star) && !this.canInsertSemicolon()) { + isAsync = true; + } else { + keyName = "async"; + } + } + if (!keyName && (ecmaVersion >= 9 || !isAsync) && this.eat(types$1.star)) { + isGenerator = true; + } + if (!keyName && !isAsync && !isGenerator) { + var lastValue = this.value; + if (this.eatContextual("get") || this.eatContextual("set")) { + if (this.isClassElementNameStart()) { + kind = lastValue; + } else { + keyName = lastValue; + } + } + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -const format_1 = __nccwpck_require__(53122); -const format = [format_1.default]; -exports["default"] = format; -//# sourceMappingURL=index.js.map + // Parse element name + if (keyName) { + // 'async', 'get', 'set', or 'static' were not a keyword contextually. + // The last token is any of those. Make it the element name. + node.computed = false; + node.key = this.startNodeAt(this.lastTokStart, this.lastTokStartLoc); + node.key.name = keyName; + this.finishNode(node.key, "Identifier"); + } else { + this.parseClassElementName(node); + } -/***/ }), + // Parse element value + if (ecmaVersion < 13 || this.type === types$1.parenL || kind !== "method" || isGenerator || isAsync) { + var isConstructor = !node.static && checkKeyName(node, "constructor"); + var allowsDirectSuper = isConstructor && constructorAllowsSuper; + // Couldn't move this check into the 'parseClassMethod' method for backward compatibility. + if (isConstructor && kind !== "method") { this.raise(node.key.start, "Constructor can't have get/set modifier"); } + node.kind = isConstructor ? "constructor" : kind; + this.parseClassMethod(node, isGenerator, isAsync, allowsDirectSuper); + } else { + this.parseClassField(node); + } -/***/ 71436: -/***/ ((__unused_webpack_module, exports) => { + return node + }; + pp$8.isClassElementNameStart = function() { + return ( + this.type === types$1.name || + this.type === types$1.privateId || + this.type === types$1.num || + this.type === types$1.string || + this.type === types$1.bracketL || + this.type.keyword + ) + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.contentVocabulary = exports.metadataVocabulary = void 0; -exports.metadataVocabulary = [ - "title", - "description", - "default", - "deprecated", - "readOnly", - "writeOnly", - "examples", -]; -exports.contentVocabulary = [ - "contentMediaType", - "contentEncoding", - "contentSchema", -]; -//# sourceMappingURL=metadata.js.map + pp$8.parseClassElementName = function(element) { + if (this.type === types$1.privateId) { + if (this.value === "constructor") { + this.raise(this.start, "Classes can't have an element named '#constructor'"); + } + element.computed = false; + element.key = this.parsePrivateIdent(); + } else { + this.parsePropertyName(element); + } + }; -/***/ }), + pp$8.parseClassMethod = function(method, isGenerator, isAsync, allowsDirectSuper) { + // Check key and flags + var key = method.key; + if (method.kind === "constructor") { + if (isGenerator) { this.raise(key.start, "Constructor can't be a generator"); } + if (isAsync) { this.raise(key.start, "Constructor can't be an async method"); } + } else if (method.static && checkKeyName(method, "prototype")) { + this.raise(key.start, "Classes may not have a static property named prototype"); + } -/***/ 82666: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Parse value + var value = method.value = this.parseMethod(isGenerator, isAsync, allowsDirectSuper); + // Check value + if (method.kind === "get" && value.params.length !== 0) + { this.raiseRecoverable(value.start, "getter should have no params"); } + if (method.kind === "set" && value.params.length !== 1) + { this.raiseRecoverable(value.start, "setter should have exactly one param"); } + if (method.kind === "set" && value.params[0].type === "RestElement") + { this.raiseRecoverable(value.params[0].start, "Setter cannot use rest params"); } -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const equal_1 = __nccwpck_require__(75511); -const error = { - message: "must be equal to constant", - params: ({ schemaCode }) => (0, codegen_1._) `{allowedValue: ${schemaCode}}`, -}; -const def = { - keyword: "const", - $data: true, - error, - code(cxt) { - const { gen, data, $data, schemaCode, schema } = cxt; - if ($data || (schema && typeof schema == "object")) { - cxt.fail$data((0, codegen_1._) `!${(0, util_1.useFunc)(gen, equal_1.default)}(${data}, ${schemaCode})`); - } - else { - cxt.fail((0, codegen_1._) `${schema} !== ${data}`); - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=const.js.map + return this.finishNode(method, "MethodDefinition") + }; -/***/ }), + pp$8.parseClassField = function(field) { + if (checkKeyName(field, "constructor")) { + this.raise(field.key.start, "Classes can't have a field named 'constructor'"); + } else if (field.static && checkKeyName(field, "prototype")) { + this.raise(field.key.start, "Classes can't have a static field named 'prototype'"); + } -/***/ 49456: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + if (this.eat(types$1.eq)) { + // To raise SyntaxError if 'arguments' exists in the initializer. + var scope = this.currentThisScope(); + var inClassFieldInit = scope.inClassFieldInit; + scope.inClassFieldInit = true; + field.value = this.parseMaybeAssign(); + scope.inClassFieldInit = inClassFieldInit; + } else { + field.value = null; + } + this.semicolon(); + return this.finishNode(field, "PropertyDefinition") + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const equal_1 = __nccwpck_require__(75511); -const error = { - message: "must be equal to one of the allowed values", - params: ({ schemaCode }) => (0, codegen_1._) `{allowedValues: ${schemaCode}}`, -}; -const def = { - keyword: "enum", - schemaType: "array", - $data: true, - error, - code(cxt) { - const { gen, data, $data, schema, schemaCode, it } = cxt; - if (!$data && schema.length === 0) - throw new Error("enum must have non-empty array"); - const useLoop = schema.length >= it.opts.loopEnum; - let eql; - const getEql = () => (eql !== null && eql !== void 0 ? eql : (eql = (0, util_1.useFunc)(gen, equal_1.default))); - let valid; - if (useLoop || $data) { - valid = gen.let("valid"); - cxt.block$data(valid, loopEnum); - } - else { - /* istanbul ignore if */ - if (!Array.isArray(schema)) - throw new Error("ajv implementation error"); - const vSchema = gen.const("vSchema", schemaCode); - valid = (0, codegen_1.or)(...schema.map((_x, i) => equalCode(vSchema, i))); - } - cxt.pass(valid); - function loopEnum() { - gen.assign(valid, false); - gen.forOf("v", schemaCode, (v) => gen.if((0, codegen_1._) `${getEql()}(${data}, ${v})`, () => gen.assign(valid, true).break())); - } - function equalCode(vSchema, i) { - const sch = schema[i]; - return typeof sch === "object" && sch !== null - ? (0, codegen_1._) `${getEql()}(${data}, ${vSchema}[${i}])` - : (0, codegen_1._) `${data} === ${sch}`; - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=enum.js.map + pp$8.parseClassStaticBlock = function(node) { + node.body = []; -/***/ }), + var oldLabels = this.labels; + this.labels = []; + this.enterScope(SCOPE_CLASS_STATIC_BLOCK | SCOPE_SUPER); + while (this.type !== types$1.braceR) { + var stmt = this.parseStatement(null); + node.body.push(stmt); + } + this.next(); + this.exitScope(); + this.labels = oldLabels; -/***/ 34889: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + return this.finishNode(node, "StaticBlock") + }; + pp$8.parseClassId = function(node, isStatement) { + if (this.type === types$1.name) { + node.id = this.parseIdent(); + if (isStatement) + { this.checkLValSimple(node.id, BIND_LEXICAL, false); } + } else { + if (isStatement === true) + { this.unexpected(); } + node.id = null; + } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const limitNumber_1 = __nccwpck_require__(46987); -const multipleOf_1 = __nccwpck_require__(1588); -const limitLength_1 = __nccwpck_require__(22674); -const pattern_1 = __nccwpck_require__(55); -const limitProperties_1 = __nccwpck_require__(33599); -const required_1 = __nccwpck_require__(95656); -const limitItems_1 = __nccwpck_require__(86248); -const uniqueItems_1 = __nccwpck_require__(20300); -const const_1 = __nccwpck_require__(82666); -const enum_1 = __nccwpck_require__(49456); -const validation = [ - // number - limitNumber_1.default, - multipleOf_1.default, - // string - limitLength_1.default, - pattern_1.default, - // object - limitProperties_1.default, - required_1.default, - // array - limitItems_1.default, - uniqueItems_1.default, - // any - { keyword: "type", schemaType: ["string", "array"] }, - { keyword: "nullable", schemaType: "boolean" }, - const_1.default, - enum_1.default, -]; -exports["default"] = validation; -//# sourceMappingURL=index.js.map + pp$8.parseClassSuper = function(node) { + node.superClass = this.eat(types$1._extends) ? this.parseExprSubscripts(null, false) : null; + }; -/***/ }), + pp$8.enterClassBody = function() { + var element = {declared: Object.create(null), used: []}; + this.privateNameStack.push(element); + return element.declared + }; -/***/ 86248: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.exitClassBody = function() { + var ref = this.privateNameStack.pop(); + var declared = ref.declared; + var used = ref.used; + if (!this.options.checkPrivateFields) { return } + var len = this.privateNameStack.length; + var parent = len === 0 ? null : this.privateNameStack[len - 1]; + for (var i = 0; i < used.length; ++i) { + var id = used[i]; + if (!hasOwn(declared, id.name)) { + if (parent) { + parent.used.push(id); + } else { + this.raiseRecoverable(id.start, ("Private field '#" + (id.name) + "' must be declared in an enclosing class")); + } + } + } + }; + function isPrivateNameConflicted(privateNameMap, element) { + var name = element.key.name; + var curr = privateNameMap[name]; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const error = { - message({ keyword, schemaCode }) { - const comp = keyword === "maxItems" ? "more" : "fewer"; - return (0, codegen_1.str) `must NOT have ${comp} than ${schemaCode} items`; - }, - params: ({ schemaCode }) => (0, codegen_1._) `{limit: ${schemaCode}}`, -}; -const def = { - keyword: ["maxItems", "minItems"], - type: "array", - schemaType: "number", - $data: true, - error, - code(cxt) { - const { keyword, data, schemaCode } = cxt; - const op = keyword === "maxItems" ? codegen_1.operators.GT : codegen_1.operators.LT; - cxt.fail$data((0, codegen_1._) `${data}.length ${op} ${schemaCode}`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=limitItems.js.map + var next = "true"; + if (element.type === "MethodDefinition" && (element.kind === "get" || element.kind === "set")) { + next = (element.static ? "s" : "i") + element.kind; + } -/***/ }), + // `class { get #a(){}; static set #a(_){} }` is also conflict. + if ( + curr === "iget" && next === "iset" || + curr === "iset" && next === "iget" || + curr === "sget" && next === "sset" || + curr === "sset" && next === "sget" + ) { + privateNameMap[name] = "true"; + return false + } else if (!curr) { + privateNameMap[name] = next; + return false + } else { + return true + } + } -/***/ 22674: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + function checkKeyName(node, name) { + var computed = node.computed; + var key = node.key; + return !computed && ( + key.type === "Identifier" && key.name === name || + key.type === "Literal" && key.value === name + ) + } + // Parses module export declaration. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const ucs2length_1 = __nccwpck_require__(81462); -const error = { - message({ keyword, schemaCode }) { - const comp = keyword === "maxLength" ? "more" : "fewer"; - return (0, codegen_1.str) `must NOT have ${comp} than ${schemaCode} characters`; - }, - params: ({ schemaCode }) => (0, codegen_1._) `{limit: ${schemaCode}}`, -}; -const def = { - keyword: ["maxLength", "minLength"], - type: "string", - schemaType: "number", - $data: true, - error, - code(cxt) { - const { keyword, data, schemaCode, it } = cxt; - const op = keyword === "maxLength" ? codegen_1.operators.GT : codegen_1.operators.LT; - const len = it.opts.unicode === false ? (0, codegen_1._) `${data}.length` : (0, codegen_1._) `${(0, util_1.useFunc)(cxt.gen, ucs2length_1.default)}(${data})`; - cxt.fail$data((0, codegen_1._) `${len} ${op} ${schemaCode}`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=limitLength.js.map + pp$8.parseExportAllDeclaration = function(node, exports) { + if (this.options.ecmaVersion >= 11) { + if (this.eatContextual("as")) { + node.exported = this.parseModuleExportName(); + this.checkExport(exports, node.exported, this.lastTokStart); + } else { + node.exported = null; + } + } + this.expectContextual("from"); + if (this.type !== types$1.string) { this.unexpected(); } + node.source = this.parseExprAtom(); + if (this.options.ecmaVersion >= 16) + { node.attributes = this.parseWithClause(); } + this.semicolon(); + return this.finishNode(node, "ExportAllDeclaration") + }; -/***/ }), + pp$8.parseExport = function(node, exports) { + this.next(); + // export * from '...' + if (this.eat(types$1.star)) { + return this.parseExportAllDeclaration(node, exports) + } + if (this.eat(types$1._default)) { // export default ... + this.checkExport(exports, "default", this.lastTokStart); + node.declaration = this.parseExportDefaultDeclaration(); + return this.finishNode(node, "ExportDefaultDeclaration") + } + // export var|const|let|function|class ... + if (this.shouldParseExportStatement()) { + node.declaration = this.parseExportDeclaration(node); + if (node.declaration.type === "VariableDeclaration") + { this.checkVariableExport(exports, node.declaration.declarations); } + else + { this.checkExport(exports, node.declaration.id, node.declaration.id.start); } + node.specifiers = []; + node.source = null; + } else { // export { x, y as z } [from '...'] + node.declaration = null; + node.specifiers = this.parseExportSpecifiers(exports); + if (this.eatContextual("from")) { + if (this.type !== types$1.string) { this.unexpected(); } + node.source = this.parseExprAtom(); + if (this.options.ecmaVersion >= 16) + { node.attributes = this.parseWithClause(); } + } else { + for (var i = 0, list = node.specifiers; i < list.length; i += 1) { + // check for keywords used as local names + var spec = list[i]; -/***/ 46987: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + this.checkUnreserved(spec.local); + // check if export is defined + this.checkLocalExport(spec.local); + if (spec.local.type === "Literal") { + this.raise(spec.local.start, "A string literal cannot be used as an exported binding without `from`."); + } + } -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const ops = codegen_1.operators; -const KWDs = { - maximum: { okStr: "<=", ok: ops.LTE, fail: ops.GT }, - minimum: { okStr: ">=", ok: ops.GTE, fail: ops.LT }, - exclusiveMaximum: { okStr: "<", ok: ops.LT, fail: ops.GTE }, - exclusiveMinimum: { okStr: ">", ok: ops.GT, fail: ops.LTE }, -}; -const error = { - message: ({ keyword, schemaCode }) => (0, codegen_1.str) `must be ${KWDs[keyword].okStr} ${schemaCode}`, - params: ({ keyword, schemaCode }) => (0, codegen_1._) `{comparison: ${KWDs[keyword].okStr}, limit: ${schemaCode}}`, -}; -const def = { - keyword: Object.keys(KWDs), - type: "number", - schemaType: "number", - $data: true, - error, - code(cxt) { - const { keyword, data, schemaCode } = cxt; - cxt.fail$data((0, codegen_1._) `${data} ${KWDs[keyword].fail} ${schemaCode} || isNaN(${data})`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=limitNumber.js.map + node.source = null; + } + this.semicolon(); + } + return this.finishNode(node, "ExportNamedDeclaration") + }; -/***/ }), + pp$8.parseExportDeclaration = function(node) { + return this.parseStatement(null) + }; -/***/ 33599: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseExportDefaultDeclaration = function() { + var isAsync; + if (this.type === types$1._function || (isAsync = this.isAsyncFunction())) { + var fNode = this.startNode(); + this.next(); + if (isAsync) { this.next(); } + return this.parseFunction(fNode, FUNC_STATEMENT | FUNC_NULLABLE_ID, false, isAsync) + } else if (this.type === types$1._class) { + var cNode = this.startNode(); + return this.parseClass(cNode, "nullableID") + } else { + var declaration = this.parseMaybeAssign(); + this.semicolon(); + return declaration + } + }; + pp$8.checkExport = function(exports, name, pos) { + if (!exports) { return } + if (typeof name !== "string") + { name = name.type === "Identifier" ? name.name : name.value; } + if (hasOwn(exports, name)) + { this.raiseRecoverable(pos, "Duplicate export '" + name + "'"); } + exports[name] = true; + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const error = { - message({ keyword, schemaCode }) { - const comp = keyword === "maxProperties" ? "more" : "fewer"; - return (0, codegen_1.str) `must NOT have ${comp} than ${schemaCode} properties`; - }, - params: ({ schemaCode }) => (0, codegen_1._) `{limit: ${schemaCode}}`, -}; -const def = { - keyword: ["maxProperties", "minProperties"], - type: "object", - schemaType: "number", - $data: true, - error, - code(cxt) { - const { keyword, data, schemaCode } = cxt; - const op = keyword === "maxProperties" ? codegen_1.operators.GT : codegen_1.operators.LT; - cxt.fail$data((0, codegen_1._) `Object.keys(${data}).length ${op} ${schemaCode}`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=limitProperties.js.map + pp$8.checkPatternExport = function(exports, pat) { + var type = pat.type; + if (type === "Identifier") + { this.checkExport(exports, pat, pat.start); } + else if (type === "ObjectPattern") + { for (var i = 0, list = pat.properties; i < list.length; i += 1) + { + var prop = list[i]; -/***/ }), + this.checkPatternExport(exports, prop); + } } + else if (type === "ArrayPattern") + { for (var i$1 = 0, list$1 = pat.elements; i$1 < list$1.length; i$1 += 1) { + var elt = list$1[i$1]; -/***/ 1588: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + if (elt) { this.checkPatternExport(exports, elt); } + } } + else if (type === "Property") + { this.checkPatternExport(exports, pat.value); } + else if (type === "AssignmentPattern") + { this.checkPatternExport(exports, pat.left); } + else if (type === "RestElement") + { this.checkPatternExport(exports, pat.argument); } + }; + pp$8.checkVariableExport = function(exports, decls) { + if (!exports) { return } + for (var i = 0, list = decls; i < list.length; i += 1) + { + var decl = list[i]; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const codegen_1 = __nccwpck_require__(30972); -const error = { - message: ({ schemaCode }) => (0, codegen_1.str) `must be multiple of ${schemaCode}`, - params: ({ schemaCode }) => (0, codegen_1._) `{multipleOf: ${schemaCode}}`, -}; -const def = { - keyword: "multipleOf", - type: "number", - schemaType: "number", - $data: true, - error, - code(cxt) { - const { gen, data, schemaCode, it } = cxt; - // const bdt = bad$DataType(schemaCode, def.schemaType, $data) - const prec = it.opts.multipleOfPrecision; - const res = gen.let("res"); - const invalid = prec - ? (0, codegen_1._) `Math.abs(Math.round(${res}) - ${res}) > 1e-${prec}` - : (0, codegen_1._) `${res} !== parseInt(${res})`; - cxt.fail$data((0, codegen_1._) `(${schemaCode} === 0 || (${res} = ${data}/${schemaCode}, ${invalid}))`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=multipleOf.js.map + this.checkPatternExport(exports, decl.id); + } + }; -/***/ }), + pp$8.shouldParseExportStatement = function() { + return this.type.keyword === "var" || + this.type.keyword === "const" || + this.type.keyword === "class" || + this.type.keyword === "function" || + this.isLet() || + this.isAsyncFunction() + }; -/***/ 55: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Parses a comma-separated list of module exports. + pp$8.parseExportSpecifier = function(exports) { + var node = this.startNode(); + node.local = this.parseModuleExportName(); -Object.defineProperty(exports, "__esModule", ({ value: true })); -const code_1 = __nccwpck_require__(74532); -const codegen_1 = __nccwpck_require__(30972); -const error = { - message: ({ schemaCode }) => (0, codegen_1.str) `must match pattern "${schemaCode}"`, - params: ({ schemaCode }) => (0, codegen_1._) `{pattern: ${schemaCode}}`, -}; -const def = { - keyword: "pattern", - type: "string", - schemaType: "string", - $data: true, - error, - code(cxt) { - const { data, $data, schema, schemaCode, it } = cxt; - // TODO regexp should be wrapped in try/catchs - const u = it.opts.unicodeRegExp ? "u" : ""; - const regExp = $data ? (0, codegen_1._) `(new RegExp(${schemaCode}, ${u}))` : (0, code_1.usePattern)(cxt, schema); - cxt.fail$data((0, codegen_1._) `!${regExp}.test(${data})`); - }, -}; -exports["default"] = def; -//# sourceMappingURL=pattern.js.map + node.exported = this.eatContextual("as") ? this.parseModuleExportName() : node.local; + this.checkExport( + exports, + node.exported, + node.exported.start + ); -/***/ }), + return this.finishNode(node, "ExportSpecifier") + }; -/***/ 95656: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$8.parseExportSpecifiers = function(exports) { + var nodes = [], first = true; + // export { x, y as z } [from '...'] + this.expect(types$1.braceL); + while (!this.eat(types$1.braceR)) { + if (!first) { + this.expect(types$1.comma); + if (this.afterTrailingComma(types$1.braceR)) { break } + } else { first = false; } + nodes.push(this.parseExportSpecifier(exports)); + } + return nodes + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -const code_1 = __nccwpck_require__(74532); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const error = { - message: ({ params: { missingProperty } }) => (0, codegen_1.str) `must have required property '${missingProperty}'`, - params: ({ params: { missingProperty } }) => (0, codegen_1._) `{missingProperty: ${missingProperty}}`, -}; -const def = { - keyword: "required", - type: "object", - schemaType: "array", - $data: true, - error, - code(cxt) { - const { gen, schema, schemaCode, data, $data, it } = cxt; - const { opts } = it; - if (!$data && schema.length === 0) - return; - const useLoop = schema.length >= opts.loopRequired; - if (it.allErrors) - allErrorsMode(); - else - exitOnErrorMode(); - if (opts.strictRequired) { - const props = cxt.parentSchema.properties; - const { definedProperties } = cxt.it; - for (const requiredKey of schema) { - if ((props === null || props === void 0 ? void 0 : props[requiredKey]) === undefined && !definedProperties.has(requiredKey)) { - const schemaPath = it.schemaEnv.baseId + it.errSchemaPath; - const msg = `required property "${requiredKey}" is not defined at "${schemaPath}" (strictRequired)`; - (0, util_1.checkStrictMode)(it, msg, it.opts.strictRequired); - } - } - } - function allErrorsMode() { - if (useLoop || $data) { - cxt.block$data(codegen_1.nil, loopAllRequired); - } - else { - for (const prop of schema) { - (0, code_1.checkReportMissingProp)(cxt, prop); - } - } - } - function exitOnErrorMode() { - const missing = gen.let("missing"); - if (useLoop || $data) { - const valid = gen.let("valid", true); - cxt.block$data(valid, () => loopUntilMissing(missing, valid)); - cxt.ok(valid); - } - else { - gen.if((0, code_1.checkMissingProp)(cxt, schema, missing)); - (0, code_1.reportMissingProp)(cxt, missing); - gen.else(); - } - } - function loopAllRequired() { - gen.forOf("prop", schemaCode, (prop) => { - cxt.setParams({ missingProperty: prop }); - gen.if((0, code_1.noPropertyInData)(gen, data, prop, opts.ownProperties), () => cxt.error()); - }); - } - function loopUntilMissing(missing, valid) { - cxt.setParams({ missingProperty: missing }); - gen.forOf(missing, schemaCode, () => { - gen.assign(valid, (0, code_1.propertyInData)(gen, data, missing, opts.ownProperties)); - gen.if((0, codegen_1.not)(valid), () => { - cxt.error(); - gen.break(); - }); - }, codegen_1.nil); - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=required.js.map + // Parses import declaration. -/***/ }), + pp$8.parseImport = function(node) { + this.next(); -/***/ 20300: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // import '...' + if (this.type === types$1.string) { + node.specifiers = empty$1; + node.source = this.parseExprAtom(); + } else { + node.specifiers = this.parseImportSpecifiers(); + this.expectContextual("from"); + node.source = this.type === types$1.string ? this.parseExprAtom() : this.unexpected(); + } + if (this.options.ecmaVersion >= 16) + { node.attributes = this.parseWithClause(); } + this.semicolon(); + return this.finishNode(node, "ImportDeclaration") + }; + // Parses a comma-separated list of module imports. -Object.defineProperty(exports, "__esModule", ({ value: true })); -const dataType_1 = __nccwpck_require__(4701); -const codegen_1 = __nccwpck_require__(30972); -const util_1 = __nccwpck_require__(87120); -const equal_1 = __nccwpck_require__(75511); -const error = { - message: ({ params: { i, j } }) => (0, codegen_1.str) `must NOT have duplicate items (items ## ${j} and ${i} are identical)`, - params: ({ params: { i, j } }) => (0, codegen_1._) `{i: ${i}, j: ${j}}`, -}; -const def = { - keyword: "uniqueItems", - type: "array", - schemaType: "boolean", - $data: true, - error, - code(cxt) { - const { gen, data, $data, schema, parentSchema, schemaCode, it } = cxt; - if (!$data && !schema) - return; - const valid = gen.let("valid"); - const itemTypes = parentSchema.items ? (0, dataType_1.getSchemaTypes)(parentSchema.items) : []; - cxt.block$data(valid, validateUniqueItems, (0, codegen_1._) `${schemaCode} === false`); - cxt.ok(valid); - function validateUniqueItems() { - const i = gen.let("i", (0, codegen_1._) `${data}.length`); - const j = gen.let("j"); - cxt.setParams({ i, j }); - gen.assign(valid, true); - gen.if((0, codegen_1._) `${i} > 1`, () => (canOptimize() ? loopN : loopN2)(i, j)); - } - function canOptimize() { - return itemTypes.length > 0 && !itemTypes.some((t) => t === "object" || t === "array"); - } - function loopN(i, j) { - const item = gen.name("item"); - const wrongType = (0, dataType_1.checkDataTypes)(itemTypes, item, it.opts.strictNumbers, dataType_1.DataType.Wrong); - const indices = gen.const("indices", (0, codegen_1._) `{}`); - gen.for((0, codegen_1._) `;${i}--;`, () => { - gen.let(item, (0, codegen_1._) `${data}[${i}]`); - gen.if(wrongType, (0, codegen_1._) `continue`); - if (itemTypes.length > 1) - gen.if((0, codegen_1._) `typeof ${item} == "string"`, (0, codegen_1._) `${item} += "_"`); - gen - .if((0, codegen_1._) `typeof ${indices}[${item}] == "number"`, () => { - gen.assign(j, (0, codegen_1._) `${indices}[${item}]`); - cxt.error(); - gen.assign(valid, false).break(); - }) - .code((0, codegen_1._) `${indices}[${item}] = ${i}`); - }); - } - function loopN2(i, j) { - const eql = (0, util_1.useFunc)(gen, equal_1.default); - const outer = gen.name("outer"); - gen.label(outer).for((0, codegen_1._) `;${i}--;`, () => gen.for((0, codegen_1._) `${j} = ${i}; ${j}--;`, () => gen.if((0, codegen_1._) `${eql}(${data}[${i}], ${data}[${j}])`, () => { - cxt.error(); - gen.assign(valid, false).break(outer); - }))); - } - }, -}; -exports["default"] = def; -//# sourceMappingURL=uniqueItems.js.map + pp$8.parseImportSpecifier = function() { + var node = this.startNode(); + node.imported = this.parseModuleExportName(); -/***/ }), + if (this.eatContextual("as")) { + node.local = this.parseIdent(); + } else { + this.checkUnreserved(node.imported); + node.local = node.imported; + } + this.checkLValSimple(node.local, BIND_LEXICAL); -/***/ 4873: -/***/ ((module) => { + return this.finishNode(node, "ImportSpecifier") + }; + pp$8.parseImportDefaultSpecifier = function() { + // import defaultObj, { x, y as z } from '...' + var node = this.startNode(); + node.local = this.parseIdent(); + this.checkLValSimple(node.local, BIND_LEXICAL); + return this.finishNode(node, "ImportDefaultSpecifier") + }; + pp$8.parseImportNamespaceSpecifier = function() { + var node = this.startNode(); + this.next(); + this.expectContextual("as"); + node.local = this.parseIdent(); + this.checkLValSimple(node.local, BIND_LEXICAL); + return this.finishNode(node, "ImportNamespaceSpecifier") + }; -var isMergeableObject = function isMergeableObject(value) { - return isNonNullObject(value) - && !isSpecial(value) -}; + pp$8.parseImportSpecifiers = function() { + var nodes = [], first = true; + if (this.type === types$1.name) { + nodes.push(this.parseImportDefaultSpecifier()); + if (!this.eat(types$1.comma)) { return nodes } + } + if (this.type === types$1.star) { + nodes.push(this.parseImportNamespaceSpecifier()); + return nodes + } + this.expect(types$1.braceL); + while (!this.eat(types$1.braceR)) { + if (!first) { + this.expect(types$1.comma); + if (this.afterTrailingComma(types$1.braceR)) { break } + } else { first = false; } -function isNonNullObject(value) { - return !!value && typeof value === 'object' -} + nodes.push(this.parseImportSpecifier()); + } + return nodes + }; -function isSpecial(value) { - var stringValue = Object.prototype.toString.call(value); + pp$8.parseWithClause = function() { + var nodes = []; + if (!this.eat(types$1._with)) { + return nodes + } + this.expect(types$1.braceL); + var attributeKeys = {}; + var first = true; + while (!this.eat(types$1.braceR)) { + if (!first) { + this.expect(types$1.comma); + if (this.afterTrailingComma(types$1.braceR)) { break } + } else { first = false; } - return stringValue === '[object RegExp]' - || stringValue === '[object Date]' - || isReactElement(value) -} + var attr = this.parseImportAttribute(); + var keyName = attr.key.type === "Identifier" ? attr.key.name : attr.key.value; + if (hasOwn(attributeKeys, keyName)) + { this.raiseRecoverable(attr.key.start, "Duplicate attribute key '" + keyName + "'"); } + attributeKeys[keyName] = true; + nodes.push(attr); + } + return nodes + }; -// see https://github.com/facebook/react/blob/b5ac963fb791d1298e7f396236383bc955f916c1/src/isomorphic/classic/element/ReactElement.js#L21-L25 -var canUseSymbol = typeof Symbol === 'function' && Symbol.for; -var REACT_ELEMENT_TYPE = canUseSymbol ? Symbol.for('react.element') : 0xeac7; + pp$8.parseImportAttribute = function() { + var node = this.startNode(); + node.key = this.type === types$1.string ? this.parseExprAtom() : this.parseIdent(this.options.allowReserved !== "never"); + this.expect(types$1.colon); + if (this.type !== types$1.string) { + this.unexpected(); + } + node.value = this.parseExprAtom(); + return this.finishNode(node, "ImportAttribute") + }; -function isReactElement(value) { - return value.$$typeof === REACT_ELEMENT_TYPE -} + pp$8.parseModuleExportName = function() { + if (this.options.ecmaVersion >= 13 && this.type === types$1.string) { + var stringLiteral = this.parseLiteral(this.value); + if (loneSurrogate.test(stringLiteral.value)) { + this.raise(stringLiteral.start, "An export name cannot include a lone surrogate."); + } + return stringLiteral + } + return this.parseIdent(true) + }; -function emptyTarget(val) { - return Array.isArray(val) ? [] : {} -} + // Set `ExpressionStatement#directive` property for directive prologues. + pp$8.adaptDirectivePrologue = function(statements) { + for (var i = 0; i < statements.length && this.isDirectiveCandidate(statements[i]); ++i) { + statements[i].directive = statements[i].expression.raw.slice(1, -1); + } + }; + pp$8.isDirectiveCandidate = function(statement) { + return ( + this.options.ecmaVersion >= 5 && + statement.type === "ExpressionStatement" && + statement.expression.type === "Literal" && + typeof statement.expression.value === "string" && + // Reject parenthesized strings. + (this.input[statement.start] === "\"" || this.input[statement.start] === "'") + ) + }; -function cloneUnlessOtherwiseSpecified(value, options) { - return (options.clone !== false && options.isMergeableObject(value)) - ? deepmerge(emptyTarget(value), value, options) - : value -} + var pp$7 = Parser.prototype; -function defaultArrayMerge(target, source, options) { - return target.concat(source).map(function(element) { - return cloneUnlessOtherwiseSpecified(element, options) - }) -} + // Convert existing expression atom to assignable pattern + // if possible. -function getMergeFunction(key, options) { - if (!options.customMerge) { - return deepmerge - } - var customMerge = options.customMerge(key); - return typeof customMerge === 'function' ? customMerge : deepmerge -} + pp$7.toAssignable = function(node, isBinding, refDestructuringErrors) { + if (this.options.ecmaVersion >= 6 && node) { + switch (node.type) { + case "Identifier": + if (this.inAsync && node.name === "await") + { this.raise(node.start, "Cannot use 'await' as identifier inside an async function"); } + break -function getEnumerableOwnPropertySymbols(target) { - return Object.getOwnPropertySymbols - ? Object.getOwnPropertySymbols(target).filter(function(symbol) { - return target.propertyIsEnumerable(symbol) - }) - : [] -} + case "ObjectPattern": + case "ArrayPattern": + case "AssignmentPattern": + case "RestElement": + break -function getKeys(target) { - return Object.keys(target).concat(getEnumerableOwnPropertySymbols(target)) -} + case "ObjectExpression": + node.type = "ObjectPattern"; + if (refDestructuringErrors) { this.checkPatternErrors(refDestructuringErrors, true); } + for (var i = 0, list = node.properties; i < list.length; i += 1) { + var prop = list[i]; -function propertyIsOnObject(object, property) { - try { - return property in object - } catch(_) { - return false - } -} + this.toAssignable(prop, isBinding); + // Early error: + // AssignmentRestProperty[Yield, Await] : + // `...` DestructuringAssignmentTarget[Yield, Await] + // + // It is a Syntax Error if |DestructuringAssignmentTarget| is an |ArrayLiteral| or an |ObjectLiteral|. + if ( + prop.type === "RestElement" && + (prop.argument.type === "ArrayPattern" || prop.argument.type === "ObjectPattern") + ) { + this.raise(prop.argument.start, "Unexpected token"); + } + } + break -// Protects from prototype poisoning and unexpected merging up the prototype chain. -function propertyIsUnsafe(target, key) { - return propertyIsOnObject(target, key) // Properties are safe to merge if they don't exist in the target yet, - && !(Object.hasOwnProperty.call(target, key) // unsafe if they exist up the prototype chain, - && Object.propertyIsEnumerable.call(target, key)) // and also unsafe if they're nonenumerable. -} + case "Property": + // AssignmentProperty has type === "Property" + if (node.kind !== "init") { this.raise(node.key.start, "Object pattern can't contain getter or setter"); } + this.toAssignable(node.value, isBinding); + break -function mergeObject(target, source, options) { - var destination = {}; - if (options.isMergeableObject(target)) { - getKeys(target).forEach(function(key) { - destination[key] = cloneUnlessOtherwiseSpecified(target[key], options); - }); - } - getKeys(source).forEach(function(key) { - if (propertyIsUnsafe(target, key)) { - return - } + case "ArrayExpression": + node.type = "ArrayPattern"; + if (refDestructuringErrors) { this.checkPatternErrors(refDestructuringErrors, true); } + this.toAssignableList(node.elements, isBinding); + break - if (propertyIsOnObject(target, key) && options.isMergeableObject(source[key])) { - destination[key] = getMergeFunction(key, options)(target[key], source[key], options); - } else { - destination[key] = cloneUnlessOtherwiseSpecified(source[key], options); - } - }); - return destination -} + case "SpreadElement": + node.type = "RestElement"; + this.toAssignable(node.argument, isBinding); + if (node.argument.type === "AssignmentPattern") + { this.raise(node.argument.start, "Rest elements cannot have a default value"); } + break -function deepmerge(target, source, options) { - options = options || {}; - options.arrayMerge = options.arrayMerge || defaultArrayMerge; - options.isMergeableObject = options.isMergeableObject || isMergeableObject; - // cloneUnlessOtherwiseSpecified is added to `options` so that custom arrayMerge() - // implementations can use it. The caller may not replace it. - options.cloneUnlessOtherwiseSpecified = cloneUnlessOtherwiseSpecified; + case "AssignmentExpression": + if (node.operator !== "=") { this.raise(node.left.end, "Only '=' operator can be used for specifying default value."); } + node.type = "AssignmentPattern"; + delete node.operator; + this.toAssignable(node.left, isBinding); + break - var sourceIsArray = Array.isArray(source); - var targetIsArray = Array.isArray(target); - var sourceAndTargetTypesMatch = sourceIsArray === targetIsArray; + case "ParenthesizedExpression": + this.toAssignable(node.expression, isBinding, refDestructuringErrors); + break - if (!sourceAndTargetTypesMatch) { - return cloneUnlessOtherwiseSpecified(source, options) - } else if (sourceIsArray) { - return options.arrayMerge(target, source, options) - } else { - return mergeObject(target, source, options) - } -} + case "ChainExpression": + this.raiseRecoverable(node.start, "Optional chaining cannot appear in left-hand side"); + break -deepmerge.all = function deepmergeAll(array, options) { - if (!Array.isArray(array)) { - throw new Error('first argument should be an array') - } + case "MemberExpression": + if (!isBinding) { break } - return array.reduce(function(prev, next) { - return deepmerge(prev, next, options) - }, {}) -}; + default: + this.raise(node.start, "Assigning to rvalue"); + } + } else if (refDestructuringErrors) { this.checkPatternErrors(refDestructuringErrors, true); } + return node + }; -var deepmerge_1 = deepmerge; + // Convert list of expression atoms to binding list. -module.exports = deepmerge_1; + pp$7.toAssignableList = function(exprList, isBinding) { + var end = exprList.length; + for (var i = 0; i < end; i++) { + var elt = exprList[i]; + if (elt) { this.toAssignable(elt, isBinding); } + } + if (end) { + var last = exprList[end - 1]; + if (this.options.ecmaVersion === 6 && isBinding && last && last.type === "RestElement" && last.argument.type !== "Identifier") + { this.unexpected(last.argument.start); } + } + return exprList + }; + // Parses spread element. -/***/ }), + pp$7.parseSpread = function(refDestructuringErrors) { + var node = this.startNode(); + this.next(); + node.argument = this.parseMaybeAssign(false, refDestructuringErrors); + return this.finishNode(node, "SpreadElement") + }; -/***/ 8623: -/***/ ((module) => { + pp$7.parseRestBinding = function() { + var node = this.startNode(); + this.next(); + // RestElement inside of a function parameter must be an identifier + if (this.options.ecmaVersion === 6 && this.type !== types$1.name) + { this.unexpected(); } + node.argument = this.parseBindingAtom(); -var traverse = module.exports = function (schema, opts, cb) { - // Legacy support for v0.3.1 and earlier. - if (typeof opts == 'function') { - cb = opts; - opts = {}; - } + return this.finishNode(node, "RestElement") + }; - cb = opts.cb || cb; - var pre = (typeof cb == 'function') ? cb : cb.pre || function() {}; - var post = cb.post || function() {}; + // Parses lvalue (assignable) atom. - _traverse(opts, pre, post, schema, '', schema); -}; + pp$7.parseBindingAtom = function() { + if (this.options.ecmaVersion >= 6) { + switch (this.type) { + case types$1.bracketL: + var node = this.startNode(); + this.next(); + node.elements = this.parseBindingList(types$1.bracketR, true, true); + return this.finishNode(node, "ArrayPattern") + case types$1.braceL: + return this.parseObj(true) + } + } + return this.parseIdent() + }; -traverse.keywords = { - additionalItems: true, - items: true, - contains: true, - additionalProperties: true, - propertyNames: true, - not: true, - if: true, - then: true, - else: true -}; + pp$7.parseBindingList = function(close, allowEmpty, allowTrailingComma, allowModifiers) { + var elts = [], first = true; + while (!this.eat(close)) { + if (first) { first = false; } + else { this.expect(types$1.comma); } + if (allowEmpty && this.type === types$1.comma) { + elts.push(null); + } else if (allowTrailingComma && this.afterTrailingComma(close)) { + break + } else if (this.type === types$1.ellipsis) { + var rest = this.parseRestBinding(); + this.parseBindingListItem(rest); + elts.push(rest); + if (this.type === types$1.comma) { this.raiseRecoverable(this.start, "Comma is not permitted after the rest element"); } + this.expect(close); + break + } else { + elts.push(this.parseAssignableListItem(allowModifiers)); + } + } + return elts + }; -traverse.arrayKeywords = { - items: true, - allOf: true, - anyOf: true, - oneOf: true -}; + pp$7.parseAssignableListItem = function(allowModifiers) { + var elem = this.parseMaybeDefault(this.start, this.startLoc); + this.parseBindingListItem(elem); + return elem + }; -traverse.propsKeywords = { - $defs: true, - definitions: true, - properties: true, - patternProperties: true, - dependencies: true -}; + pp$7.parseBindingListItem = function(param) { + return param + }; -traverse.skipKeywords = { - default: true, - enum: true, - const: true, - required: true, - maximum: true, - minimum: true, - exclusiveMaximum: true, - exclusiveMinimum: true, - multipleOf: true, - maxLength: true, - minLength: true, - pattern: true, - format: true, - maxItems: true, - minItems: true, - uniqueItems: true, - maxProperties: true, - minProperties: true -}; + // Parses assignment pattern around given atom if possible. + + pp$7.parseMaybeDefault = function(startPos, startLoc, left) { + left = left || this.parseBindingAtom(); + if (this.options.ecmaVersion < 6 || !this.eat(types$1.eq)) { return left } + var node = this.startNodeAt(startPos, startLoc); + node.left = left; + node.right = this.parseMaybeAssign(); + return this.finishNode(node, "AssignmentPattern") + }; + + // The following three functions all verify that a node is an lvalue — + // something that can be bound, or assigned to. In order to do so, they perform + // a variety of checks: + // + // - Check that none of the bound/assigned-to identifiers are reserved words. + // - Record name declarations for bindings in the appropriate scope. + // - Check duplicate argument names, if checkClashes is set. + // + // If a complex binding pattern is encountered (e.g., object and array + // destructuring), the entire pattern is recursively checked. + // + // There are three versions of checkLVal*() appropriate for different + // circumstances: + // + // - checkLValSimple() shall be used if the syntactic construct supports + // nothing other than identifiers and member expressions. Parenthesized + // expressions are also correctly handled. This is generally appropriate for + // constructs for which the spec says + // + // > It is a Syntax Error if AssignmentTargetType of [the production] is not + // > simple. + // + // It is also appropriate for checking if an identifier is valid and not + // defined elsewhere, like import declarations or function/class identifiers. + // + // Examples where this is used include: + // a += …; + // import a from '…'; + // where a is the node to be checked. + // + // - checkLValPattern() shall be used if the syntactic construct supports + // anything checkLValSimple() supports, as well as object and array + // destructuring patterns. This is generally appropriate for constructs for + // which the spec says + // + // > It is a Syntax Error if [the production] is neither an ObjectLiteral nor + // > an ArrayLiteral and AssignmentTargetType of [the production] is not + // > simple. + // + // Examples where this is used include: + // (a = …); + // const a = …; + // try { … } catch (a) { … } + // where a is the node to be checked. + // + // - checkLValInnerPattern() shall be used if the syntactic construct supports + // anything checkLValPattern() supports, as well as default assignment + // patterns, rest elements, and other constructs that may appear within an + // object or array destructuring pattern. + // + // As a special case, function parameters also use checkLValInnerPattern(), + // as they also support defaults and rest constructs. + // + // These functions deliberately support both assignment and binding constructs, + // as the logic for both is exceedingly similar. If the node is the target of + // an assignment, then bindingType should be set to BIND_NONE. Otherwise, it + // should be set to the appropriate BIND_* constant, like BIND_VAR or + // BIND_LEXICAL. + // + // If the function is called with a non-BIND_NONE bindingType, then + // additionally a checkClashes object may be specified to allow checking for + // duplicate argument names. checkClashes is ignored if the provided construct + // is an assignment (i.e., bindingType is BIND_NONE). + pp$7.checkLValSimple = function(expr, bindingType, checkClashes) { + if ( bindingType === void 0 ) bindingType = BIND_NONE; -function _traverse(opts, pre, post, schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex) { - if (schema && typeof schema == 'object' && !Array.isArray(schema)) { - pre(schema, jsonPtr, rootSchema, parentJsonPtr, parentKeyword, parentSchema, keyIndex); - for (var key in schema) { - var sch = schema[key]; - if (Array.isArray(sch)) { - if (key in traverse.arrayKeywords) { - for (var i=0; i { + if (elem) { this.checkLValInnerPattern(elem, bindingType, checkClashes); } + } + break + default: + this.checkLValSimple(expr, bindingType, checkClashes); + } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.observableStore = exports.addEventListener = exports.CHANGE_EVENT = void 0; -exports.CHANGE_EVENT = "change"; -function addEventListener(listener, eventName, eventEmitter) { - const removeCallback = () => { - eventEmitter.removeListener(eventName, listener); - }; - eventEmitter.on(eventName, listener); - return removeCallback; -} -exports.addEventListener = addEventListener; -function observableStore(eventEmitter, storeLimit) { - const array = []; - return new Proxy(array, { - // eslint-disable-next-line @typescript-eslint/no-explicit-any - set: function (target, property, value) { - target[property] = value; - if (property === "length" && value <= storeLimit) { - // when logs reach the limit, it first add, then remove it. So, do not emit until it has been removed to avoid event duplication - eventEmitter.emit(exports.CHANGE_EVENT); - } - return true; - }, - }); -} -exports.observableStore = observableStore; + pp$7.checkLValInnerPattern = function(expr, bindingType, checkClashes) { + if ( bindingType === void 0 ) bindingType = BIND_NONE; + switch (expr.type) { + case "Property": + // AssignmentProperty has type === "Property" + this.checkLValInnerPattern(expr.value, bindingType, checkClashes); + break -/***/ }), + case "AssignmentPattern": + this.checkLValPattern(expr.left, bindingType, checkClashes); + break -/***/ 76077: -/***/ ((__unused_webpack_module, exports) => { + case "RestElement": + this.checkLValPattern(expr.argument, bindingType, checkClashes); + break + default: + this.checkLValPattern(expr, bindingType, checkClashes); + } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); + // The algorithm used to determine whether a regexp can appear at a + // given point in the program is loosely based on sweet.js' approach. + // See https://github.com/mozilla/sweet.js/wiki/design -/***/ }), + var TokContext = function TokContext(token, isExpr, preserveSpace, override, generator) { + this.token = token; + this.isExpr = !!isExpr; + this.preserveSpace = !!preserveSpace; + this.override = override; + this.generator = !!generator; + }; -/***/ 53691: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + var types = { + b_stat: new TokContext("{", false), + b_expr: new TokContext("{", true), + b_tmpl: new TokContext("${", false), + p_stat: new TokContext("(", false), + p_expr: new TokContext("(", true), + q_tmpl: new TokContext("`", true, true, function (p) { return p.tryReadTemplateToken(); }), + f_stat: new TokContext("function", false), + f_expr: new TokContext("function", true), + f_expr_gen: new TokContext("function", true, false, null, true), + f_gen: new TokContext("function", false, false, null, true) + }; + var pp$6 = Parser.prototype; -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; + pp$6.initialContext = function() { + return [types.b_stat] + }; + + pp$6.curContext = function() { + return this.context[this.context.length - 1] + }; + + pp$6.braceIsBlock = function(prevType) { + var parent = this.curContext(); + if (parent === types.f_expr || parent === types.f_stat) + { return true } + if (prevType === types$1.colon && (parent === types.b_stat || parent === types.b_expr)) + { return !parent.isExpr } + + // The check for `tt.name && exprAllowed` detects whether we are + // after a `yield` or `of` construct. See the `updateContext` for + // `tt.name`. + if (prevType === types$1._return || prevType === types$1.name && this.exprAllowed) + { return lineBreak.test(this.input.slice(this.lastTokEnd, this.start)) } + if (prevType === types$1._else || prevType === types$1.semi || prevType === types$1.eof || prevType === types$1.parenR || prevType === types$1.arrow) + { return true } + if (prevType === types$1.braceL) + { return parent === types.b_stat } + if (prevType === types$1._var || prevType === types$1._const || prevType === types$1.name) + { return false } + return !this.exprAllowed + }; + + pp$6.inGeneratorContext = function() { + for (var i = this.context.length - 1; i >= 1; i--) { + var context = this.context[i]; + if (context.token === "function") + { return context.generator } } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { - Object.defineProperty(o, "default", { enumerable: true, value: v }); -}) : function(o, v) { - o["default"] = v; -}); -var __importStar = (this && this.__importStar) || function (mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); - __setModuleDefault(result, mod); - return result; -}; -var __importDefault = (this && this.__importDefault) || function (mod) { - return (mod && mod.__esModule) ? mod : { "default": mod }; -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.TRANSPORTS = exports.LEVELS = exports.Logger = void 0; -const events_1 = __importDefault(__nccwpck_require__(24434)); -const chalk_1 = __importDefault(__nccwpck_require__(9543)); -const winston = __importStar(__nccwpck_require__(34240)); -const winston_array_transport_1 = __importDefault(__nccwpck_require__(67964)); -const Events_1 = __nccwpck_require__(58506); -const Logger_types_1 = __nccwpck_require__(2652); -const DEFAULT_STORE_LIMIT = 1000; -const TIME_FORMAT = "HH:mm:ss:SS"; -const formatTimestamp = winston.format.timestamp({ - format: TIME_FORMAT, -}); -function colourLabel(label) { - if (!label.length) { - return ""; - } - return chalk_1.default.grey(label); -} -function formatLabelOrLevel(labelOrLevel) { - if (!labelOrLevel.length) { - return ""; - } - return `[${labelOrLevel}]`; -} -function logTemplate(log, colors = false) { - const label = colors ? colourLabel(log.label) : log.label; - return `${log.timestamp} ${formatLabelOrLevel(log.level)}${formatLabelOrLevel(label)} ${log.message}`; -} -function colorsTemplate(log) { - return logTemplate(log, true); -} -function template(log) { - return logTemplate(log); -} -const formatLog = winston.format.printf(colorsTemplate); -const formatStore = winston.format.printf(template); -function createArrayTransport(store, defaultLevel, storeLimit) { - return new winston_array_transport_1.default({ - array: store, - limit: storeLimit, - level: defaultLevel, - maxListeners: 0, - format: winston.format.combine(formatTimestamp, formatStore), - }); -} -function createConsoleTransport(defaultLevel) { - return new winston.transports.Console({ - level: defaultLevel, - format: winston.format.combine(winston.format.colorize(), formatTimestamp, formatLog), - }); -} -function createTransports(store, defaultLevel, storeLimit, globalStoreTransport) { - return { - [Logger_types_1.TRANSPORT_CONSOLE]: createConsoleTransport(defaultLevel), - [Logger_types_1.TRANSPORT_STORE]: createArrayTransport(store, defaultLevel, storeLimit), - [Logger_types_1.TRANSPORT_GLOBAL_STORE]: globalStoreTransport, - }; -} -function namespaceLabel(parentLogger, label) { - const parentLabel = parentLogger.label; - if (!parentLabel.length) { - return label; - } - return `${parentLogger.label}:${label}`; -} -const Logger = class Logger { - constructor(label = "", { level, storeLimit = DEFAULT_STORE_LIMIT, globalStoreLimit = DEFAULT_STORE_LIMIT, } = {}, { parent, root, globalStore, globalStoreTransport } = {}) { - Object.defineProperty(this, "_label", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_transports", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_container", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_logger", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_store", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_storeEmitter", { - enumerable: true, - configurable: true, - writable: true, - value: new events_1.default() - }); - Object.defineProperty(this, "_globalStore", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_globalStoreEmitter", { - enumerable: true, - configurable: true, - writable: true, - value: new events_1.default() - }); - Object.defineProperty(this, "_namespaces", { - enumerable: true, - configurable: true, - writable: true, - value: [] - }); - Object.defineProperty(this, "_parent", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_root", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_level", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - Object.defineProperty(this, "_transportsPinnedLevels", { - enumerable: true, - configurable: true, - writable: true, - value: { - [Logger_types_1.TRANSPORT_CONSOLE]: false, - [Logger_types_1.TRANSPORT_STORE]: false, - } - }); - Object.defineProperty(this, "_pinnedLevel", { - enumerable: true, - configurable: true, - writable: true, - value: false - }); - Object.defineProperty(this, "_globalStoreTransport", { - enumerable: true, - configurable: true, - writable: true, - value: void 0 - }); - this._parent = parent; - this._root = root || this; - const parentLevel = this._parent && this._parent.level; - const defaultLevel = level || parentLevel || Logger_types_1.LEVEL_INFO; - this._level = defaultLevel; - this._label = parent ? namespaceLabel(parent, label) : label; - this._store = (0, Events_1.observableStore)(this._storeEmitter, storeLimit); - this._globalStore = globalStore || (0, Events_1.observableStore)(this._globalStoreEmitter, globalStoreLimit); - this._globalStoreTransport = - globalStoreTransport || - createArrayTransport(this._globalStore, defaultLevel, globalStoreLimit); - this._transports = createTransports(this._store, defaultLevel, storeLimit, this._globalStoreTransport); - this._container = new winston.Container(); - this._container.add(label, { - format: winston.format.combine(winston.format.label({ label: this._label })), - transports: [ - this._transports[Logger_types_1.TRANSPORT_CONSOLE], - this._transports[Logger_types_1.TRANSPORT_STORE], - this._transports[Logger_types_1.TRANSPORT_GLOBAL_STORE], - ], - }); - this._logger = this._container.get(label); - } - get store() { - return this._store; - } - get globalStore() { - return this._globalStore; - } - get label() { - return this._label; - } - get level() { - return this._level; - } - get root() { - return this._root; - } - [Logger_types_1.LEVEL_SILLY](message) { - this._logger[Logger_types_1.LEVEL_SILLY](message); - } - [Logger_types_1.LEVEL_DEBUG](message) { - this._logger[Logger_types_1.LEVEL_DEBUG](message); + return false + }; + + pp$6.updateContext = function(prevType) { + var update, type = this.type; + if (type.keyword && prevType === types$1.dot) + { this.exprAllowed = false; } + else if (update = type.updateContext) + { update.call(this, prevType); } + else + { this.exprAllowed = type.beforeExpr; } + }; + + // Used to handle edge cases when token context could not be inferred correctly during tokenization phase + + pp$6.overrideContext = function(tokenCtx) { + if (this.curContext() !== tokenCtx) { + this.context[this.context.length - 1] = tokenCtx; } - [Logger_types_1.LEVEL_VERBOSE](message) { - this._logger[Logger_types_1.LEVEL_VERBOSE](message); + }; + + // Token-specific context update code + + types$1.parenR.updateContext = types$1.braceR.updateContext = function() { + if (this.context.length === 1) { + this.exprAllowed = true; + return } - [Logger_types_1.LEVEL_INFO](message) { - this._logger[Logger_types_1.LEVEL_INFO](message); + var out = this.context.pop(); + if (out === types.b_stat && this.curContext().token === "function") { + out = this.context.pop(); } - [Logger_types_1.LEVEL_WARN](message) { - this._logger[Logger_types_1.LEVEL_WARN](message); + this.exprAllowed = !out.isExpr; + }; + + types$1.braceL.updateContext = function(prevType) { + this.context.push(this.braceIsBlock(prevType) ? types.b_stat : types.b_expr); + this.exprAllowed = true; + }; + + types$1.dollarBraceL.updateContext = function() { + this.context.push(types.b_tmpl); + this.exprAllowed = true; + }; + + types$1.parenL.updateContext = function(prevType) { + var statementParens = prevType === types$1._if || prevType === types$1._for || prevType === types$1._with || prevType === types$1._while; + this.context.push(statementParens ? types.p_stat : types.p_expr); + this.exprAllowed = true; + }; + + types$1.incDec.updateContext = function() { + // tokExprAllowed stays unchanged + }; + + types$1._function.updateContext = types$1._class.updateContext = function(prevType) { + if (prevType.beforeExpr && prevType !== types$1._else && + !(prevType === types$1.semi && this.curContext() !== types.p_stat) && + !(prevType === types$1._return && lineBreak.test(this.input.slice(this.lastTokEnd, this.start))) && + !((prevType === types$1.colon || prevType === types$1.braceL) && this.curContext() === types.b_stat)) + { this.context.push(types.f_expr); } + else + { this.context.push(types.f_stat); } + this.exprAllowed = false; + }; + + types$1.colon.updateContext = function() { + if (this.curContext().token === "function") { this.context.pop(); } + this.exprAllowed = true; + }; + + types$1.backQuote.updateContext = function() { + if (this.curContext() === types.q_tmpl) + { this.context.pop(); } + else + { this.context.push(types.q_tmpl); } + this.exprAllowed = false; + }; + + types$1.star.updateContext = function(prevType) { + if (prevType === types$1._function) { + var index = this.context.length - 1; + if (this.context[index] === types.f_expr) + { this.context[index] = types.f_expr_gen; } + else + { this.context[index] = types.f_gen; } } - [Logger_types_1.LEVEL_ERROR](message) { - this._logger[Logger_types_1.LEVEL_ERROR](message); + this.exprAllowed = true; + }; + + types$1.name.updateContext = function(prevType) { + var allowed = false; + if (this.options.ecmaVersion >= 6 && prevType !== types$1.dot) { + if (this.value === "of" && !this.exprAllowed || + this.value === "yield" && this.inGeneratorContext()) + { allowed = true; } } - setLevel(level, options) { - this._set(level, options); + this.exprAllowed = allowed; + }; + + // A recursive descent parser operates by defining functions for all + // syntactic elements, and recursively calling those, each function + // advancing the input stream and returning an AST node. Precedence + // of constructs (for example, the fact that `!x[1]` means `!(x[1])` + // instead of `(!x)[1]` is handled by the fact that the parser + // function that parses unary prefix operators is called first, and + // in turn calls the function that parses `[]` subscripts — that + // way, it'll receive the node for `x[1]` already parsed, and wraps + // *that* in the unary operator node. + // + // Acorn uses an [operator precedence parser][opp] to handle binary + // operator precedence, because it is much more compact than using + // the technique outlined above, which uses different, nesting + // functions to specify precedence, for all of the ten binary + // precedence levels that JavaScript defines. + // + // [opp]: http://en.wikipedia.org/wiki/Operator-precedence_parser + + + var pp$5 = Parser.prototype; + + // Check if property name clashes with already added. + // Object/class getters and setters are not allowed to clash — + // either with each other or with an init property — and in + // strict mode, init properties are also not allowed to be repeated. + + pp$5.checkPropClash = function(prop, propHash, refDestructuringErrors) { + if (this.options.ecmaVersion >= 9 && prop.type === "SpreadElement") + { return } + if (this.options.ecmaVersion >= 6 && (prop.computed || prop.method || prop.shorthand)) + { return } + var key = prop.key; + var name; + switch (key.type) { + case "Identifier": name = key.name; break + case "Literal": name = String(key.value); break + default: return } - namespace(label, options) { - return this._getNamespace(label) || this._createNamespace(label, options); + var kind = prop.kind; + if (this.options.ecmaVersion >= 6) { + if (name === "__proto__" && kind === "init") { + if (propHash.proto) { + if (refDestructuringErrors) { + if (refDestructuringErrors.doubleProto < 0) { + refDestructuringErrors.doubleProto = key.start; + } + } else { + this.raiseRecoverable(key.start, "Redefinition of __proto__ property"); + } + } + propHash.proto = true; + } + return } - cleanStore() { - this._store.splice(0, this._store.length); + name = "$" + name; + var other = propHash[name]; + if (other) { + var redefinition; + if (kind === "init") { + redefinition = this.strict && other.init || other.get || other.set; + } else { + redefinition = other.init || other[kind]; + } + if (redefinition) + { this.raiseRecoverable(key.start, "Redefinition of property"); } + } else { + other = propHash[name] = { + init: false, + get: false, + set: false + }; } - onChangeStore(listener) { - return (0, Events_1.addEventListener)(listener, Events_1.CHANGE_EVENT, this._storeEmitter); + other[kind] = true; + }; + + // ### Expression parsing + + // These nest, from the most general expression type at the top to + // 'atomic', nondivisible expression types at the bottom. Most of + // the functions will simply let the function(s) below them parse, + // and, *if* the syntactic construct they handle is present, wrap + // the AST node that the inner parser gave them in another node. + + // Parse a full expression. The optional arguments are used to + // forbid the `in` operator (in for loops initalization expressions) + // and provide reference for storing '=' operator inside shorthand + // property assignment in contexts where both object expression + // and object pattern might appear (so it's possible to raise + // delayed syntax error at correct position). + + pp$5.parseExpression = function(forInit, refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc; + var expr = this.parseMaybeAssign(forInit, refDestructuringErrors); + if (this.type === types$1.comma) { + var node = this.startNodeAt(startPos, startLoc); + node.expressions = [expr]; + while (this.eat(types$1.comma)) { node.expressions.push(this.parseMaybeAssign(forInit, refDestructuringErrors)); } + return this.finishNode(node, "SequenceExpression") } - onChangeGlobalStore(listener) { - return (0, Events_1.addEventListener)(listener, Events_1.CHANGE_EVENT, this._globalStoreEmitter); + return expr + }; + + // Parse an assignment expression. This includes applications of + // operators like `+=`. + + pp$5.parseMaybeAssign = function(forInit, refDestructuringErrors, afterLeftParse) { + if (this.isContextual("yield")) { + if (this.inGenerator) { return this.parseYield(forInit) } + // The tokenizer will assume an expression is allowed after + // `yield`, but this isn't that kind of yield + else { this.exprAllowed = false; } } - _setLevelFromParent(level, { transport, forcePropagation = false }) { - if (!this._pinnedLevel || forcePropagation) { - this._set(level, { transport, forcePropagation }); - } + + var ownDestructuringErrors = false, oldParenAssign = -1, oldTrailingComma = -1, oldDoubleProto = -1; + if (refDestructuringErrors) { + oldParenAssign = refDestructuringErrors.parenthesizedAssign; + oldTrailingComma = refDestructuringErrors.trailingComma; + oldDoubleProto = refDestructuringErrors.doubleProto; + refDestructuringErrors.parenthesizedAssign = refDestructuringErrors.trailingComma = -1; + } else { + refDestructuringErrors = new DestructuringErrors; + ownDestructuringErrors = true; } - _setWinstonTransportLevel(level, transport) { - if (level === Logger_types_1.LEVEL_SILENT) { - this._transports[transport].silent = true; - } - else { - this._transports[transport].silent = false; - this._transports[transport].level = level; - } + + var startPos = this.start, startLoc = this.startLoc; + if (this.type === types$1.parenL || this.type === types$1.name) { + this.potentialArrowAt = this.start; + this.potentialArrowInForAwait = forInit === "await"; } - _setTransportLevel(level, transport, { pinned = false, fromBaseLevel = false, forcePropagation = false, }) { - if (forcePropagation || - !fromBaseLevel || - (fromBaseLevel && !this._transportsPinnedLevels[transport])) { - this._transportsPinnedLevels[transport] = pinned; - this._setWinstonTransportLevel(level, transport); - if (transport === Logger_types_1.TRANSPORT_STORE && !this._parent) { - this._setWinstonTransportLevel(level, Logger_types_1.TRANSPORT_GLOBAL_STORE); - } - } + var left = this.parseMaybeConditional(forInit, refDestructuringErrors); + if (afterLeftParse) { left = afterLeftParse.call(this, left, startPos, startLoc); } + if (this.type.isAssign) { + var node = this.startNodeAt(startPos, startLoc); + node.operator = this.value; + if (this.type === types$1.eq) + { left = this.toAssignable(left, false, refDestructuringErrors); } + if (!ownDestructuringErrors) { + refDestructuringErrors.parenthesizedAssign = refDestructuringErrors.trailingComma = refDestructuringErrors.doubleProto = -1; + } + if (refDestructuringErrors.shorthandAssign >= left.start) + { refDestructuringErrors.shorthandAssign = -1; } // reset because shorthand default was used correctly + if (this.type === types$1.eq) + { this.checkLValPattern(left); } + else + { this.checkLValSimple(left); } + node.left = left; + this.next(); + node.right = this.parseMaybeAssign(forInit); + if (oldDoubleProto > -1) { refDestructuringErrors.doubleProto = oldDoubleProto; } + return this.finishNode(node, "AssignmentExpression") + } else { + if (ownDestructuringErrors) { this.checkExpressionErrors(refDestructuringErrors, true); } } - _setBaseLevel(level, { pinned = false, forcePropagation }) { - this._level = level; - this._pinnedLevel = pinned; - this._setTransportLevel(level, Logger_types_1.TRANSPORT_CONSOLE, { fromBaseLevel: true, forcePropagation }); - this._setTransportLevel(level, Logger_types_1.TRANSPORT_STORE, { fromBaseLevel: true, forcePropagation }); + if (oldParenAssign > -1) { refDestructuringErrors.parenthesizedAssign = oldParenAssign; } + if (oldTrailingComma > -1) { refDestructuringErrors.trailingComma = oldTrailingComma; } + return left + }; + + // Parse a ternary conditional (`?:`) operator. + + pp$5.parseMaybeConditional = function(forInit, refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc; + var expr = this.parseExprOps(forInit, refDestructuringErrors); + if (this.checkExpressionErrors(refDestructuringErrors)) { return expr } + if (this.eat(types$1.question)) { + var node = this.startNodeAt(startPos, startLoc); + node.test = expr; + node.consequent = this.parseMaybeAssign(); + this.expect(types$1.colon); + node.alternate = this.parseMaybeAssign(forInit); + return this.finishNode(node, "ConditionalExpression") } - _set(level, { transport, propagate = true, forcePropagation, pinned } = {}) { - if (transport) { - this._setTransportLevel(level, transport, { pinned, forcePropagation }); - } - else { - this._setBaseLevel(level, { pinned, forcePropagation }); + return expr + }; + + // Start the precedence parser. + + pp$5.parseExprOps = function(forInit, refDestructuringErrors) { + var startPos = this.start, startLoc = this.startLoc; + var expr = this.parseMaybeUnary(refDestructuringErrors, false, false, forInit); + if (this.checkExpressionErrors(refDestructuringErrors)) { return expr } + return expr.start === startPos && expr.type === "ArrowFunctionExpression" ? expr : this.parseExprOp(expr, startPos, startLoc, -1, forInit) + }; + + // Parse binary operators with the operator precedence parsing + // algorithm. `left` is the left-hand side of the operator. + // `minPrec` provides context that allows the function to stop and + // defer further parser to one of its callers when it encounters an + // operator that has a lower precedence than the set it is parsing. + + pp$5.parseExprOp = function(left, leftStartPos, leftStartLoc, minPrec, forInit) { + var prec = this.type.binop; + if (prec != null && (!forInit || this.type !== types$1._in)) { + if (prec > minPrec) { + var logical = this.type === types$1.logicalOR || this.type === types$1.logicalAND; + var coalesce = this.type === types$1.coalesce; + if (coalesce) { + // Handle the precedence of `tt.coalesce` as equal to the range of logical expressions. + // In other words, `node.right` shouldn't contain logical expressions in order to check the mixed error. + prec = types$1.logicalAND.binop; } - if (propagate) { - this._namespaces.forEach((namespace) => { - namespace._setLevelFromParent(level, { transport, forcePropagation }); - }); + var op = this.value; + this.next(); + var startPos = this.start, startLoc = this.startLoc; + var right = this.parseExprOp(this.parseMaybeUnary(null, false, false, forInit), startPos, startLoc, prec, forInit); + var node = this.buildBinary(leftStartPos, leftStartLoc, left, right, op, logical || coalesce); + if ((logical && this.type === types$1.coalesce) || (coalesce && (this.type === types$1.logicalOR || this.type === types$1.logicalAND))) { + this.raiseRecoverable(this.start, "Logical expressions and coalesce expressions cannot be mixed. Wrap either by parentheses"); } + return this.parseExprOp(node, leftStartPos, leftStartLoc, minPrec, forInit) + } } - _getNamespace(label) { - return this._namespaces.find((namespace) => { - return namespace.label === label; - }); - } - _createNamespace(label, options) { - const namespace = new Logger(label, options, { - parent: this, - root: this._root, - globalStoreTransport: this._globalStoreTransport, - globalStore: this._globalStore, - }); - this._namespaces.push(namespace); - return namespace; - } -}; -exports.Logger = Logger; -exports.LEVELS = { - SILLY: Logger_types_1.LEVEL_SILLY, - DEBUG: Logger_types_1.LEVEL_DEBUG, - VERBOSE: Logger_types_1.LEVEL_VERBOSE, - INFO: Logger_types_1.LEVEL_INFO, - WARN: Logger_types_1.LEVEL_WARN, - ERROR: Logger_types_1.LEVEL_ERROR, - SILENT: Logger_types_1.LEVEL_SILENT, -}; -exports.TRANSPORTS = { - CONSOLE: Logger_types_1.TRANSPORT_CONSOLE, - STORE: Logger_types_1.TRANSPORT_STORE, - GLOBAL_STORE: Logger_types_1.TRANSPORT_GLOBAL_STORE, -}; + return left + }; + pp$5.buildBinary = function(startPos, startLoc, left, right, op, logical) { + if (right.type === "PrivateIdentifier") { this.raise(right.start, "Private identifier can only be left side of binary expression"); } + var node = this.startNodeAt(startPos, startLoc); + node.left = left; + node.operator = op; + node.right = right; + return this.finishNode(node, logical ? "LogicalExpression" : "BinaryExpression") + }; -/***/ }), + // Parse unary operators, both prefix and postfix. -/***/ 2652: -/***/ ((__unused_webpack_module, exports) => { + pp$5.parseMaybeUnary = function(refDestructuringErrors, sawUnary, incDec, forInit) { + var startPos = this.start, startLoc = this.startLoc, expr; + if (this.isContextual("await") && this.canAwait) { + expr = this.parseAwait(forInit); + sawUnary = true; + } else if (this.type.prefix) { + var node = this.startNode(), update = this.type === types$1.incDec; + node.operator = this.value; + node.prefix = true; + this.next(); + node.argument = this.parseMaybeUnary(null, true, update, forInit); + this.checkExpressionErrors(refDestructuringErrors, true); + if (update) { this.checkLValSimple(node.argument); } + else if (this.strict && node.operator === "delete" && isLocalVariableAccess(node.argument)) + { this.raiseRecoverable(node.start, "Deleting local variable in strict mode"); } + else if (node.operator === "delete" && isPrivateFieldAccess(node.argument)) + { this.raiseRecoverable(node.start, "Private fields can not be deleted"); } + else { sawUnary = true; } + expr = this.finishNode(node, update ? "UpdateExpression" : "UnaryExpression"); + } else if (!sawUnary && this.type === types$1.privateId) { + if ((forInit || this.privateNameStack.length === 0) && this.options.checkPrivateFields) { this.unexpected(); } + expr = this.parsePrivateIdent(); + // only could be private fields in 'in', such as #x in obj + if (this.type !== types$1._in) { this.unexpected(); } + } else { + expr = this.parseExprSubscripts(refDestructuringErrors, forInit); + if (this.checkExpressionErrors(refDestructuringErrors)) { return expr } + while (this.type.postfix && !this.canInsertSemicolon()) { + var node$1 = this.startNodeAt(startPos, startLoc); + node$1.operator = this.value; + node$1.prefix = false; + node$1.argument = expr; + this.checkLValSimple(expr); + this.next(); + expr = this.finishNode(node$1, "UpdateExpression"); + } + } + if (!incDec && this.eat(types$1.starstar)) { + if (sawUnary) + { this.unexpected(this.lastTokStart); } + else + { return this.buildBinary(startPos, startLoc, expr, this.parseMaybeUnary(null, false, false, forInit), "**", false) } + } else { + return expr + } + }; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.TRANSPORT_GLOBAL_STORE = exports.TRANSPORT_STORE = exports.TRANSPORT_CONSOLE = exports.LEVEL_SILENT = exports.LEVEL_ERROR = exports.LEVEL_WARN = exports.LEVEL_INFO = exports.LEVEL_VERBOSE = exports.LEVEL_DEBUG = exports.LEVEL_SILLY = void 0; -exports.LEVEL_SILLY = "silly"; -exports.LEVEL_DEBUG = "debug"; -exports.LEVEL_VERBOSE = "verbose"; -exports.LEVEL_INFO = "info"; -exports.LEVEL_WARN = "warn"; -exports.LEVEL_ERROR = "error"; -exports.LEVEL_SILENT = "silent"; -exports.TRANSPORT_CONSOLE = "console"; -exports.TRANSPORT_STORE = "store"; -exports.TRANSPORT_GLOBAL_STORE = "globalStore"; + function isLocalVariableAccess(node) { + return ( + node.type === "Identifier" || + node.type === "ParenthesizedExpression" && isLocalVariableAccess(node.expression) + ) + } + function isPrivateFieldAccess(node) { + return ( + node.type === "MemberExpression" && node.property.type === "PrivateIdentifier" || + node.type === "ChainExpression" && isPrivateFieldAccess(node.expression) || + node.type === "ParenthesizedExpression" && isPrivateFieldAccess(node.expression) + ) + } -/***/ }), + // Parse call, dot, and `[]`-subscript expressions. -/***/ 40987: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + pp$5.parseExprSubscripts = function(refDestructuringErrors, forInit) { + var startPos = this.start, startLoc = this.startLoc; + var expr = this.parseExprAtom(refDestructuringErrors, forInit); + if (expr.type === "ArrowFunctionExpression" && this.input.slice(this.lastTokStart, this.lastTokEnd) !== ")") + { return expr } + var result = this.parseSubscripts(expr, startPos, startLoc, false, forInit); + if (refDestructuringErrors && result.type === "MemberExpression") { + if (refDestructuringErrors.parenthesizedAssign >= result.start) { refDestructuringErrors.parenthesizedAssign = -1; } + if (refDestructuringErrors.parenthesizedBind >= result.start) { refDestructuringErrors.parenthesizedBind = -1; } + if (refDestructuringErrors.trailingComma >= result.start) { refDestructuringErrors.trailingComma = -1; } + } + return result + }; + + pp$5.parseSubscripts = function(base, startPos, startLoc, noCalls, forInit) { + var maybeAsyncArrow = this.options.ecmaVersion >= 8 && base.type === "Identifier" && base.name === "async" && + this.lastTokEnd === base.end && !this.canInsertSemicolon() && base.end - base.start === 5 && + this.potentialArrowAt === base.start; + var optionalChained = false; + while (true) { + var element = this.parseSubscript(base, startPos, startLoc, noCalls, maybeAsyncArrow, optionalChained, forInit); -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; - } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __exportStar = (this && this.__exportStar) || function(m, exports) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.Logger = void 0; -const Logger_1 = __nccwpck_require__(53691); -var Logger_2 = __nccwpck_require__(53691); -Object.defineProperty(exports, "Logger", ({ enumerable: true, get: function () { return Logger_2.Logger; } })); -__exportStar(__nccwpck_require__(23866), exports); -exports["default"] = Logger_1.Logger; + if (element.optional) { optionalChained = true; } + if (element === base || element.type === "ArrowFunctionExpression") { + if (optionalChained) { + var chainNode = this.startNodeAt(startPos, startLoc); + chainNode.expression = element; + element = this.finishNode(chainNode, "ChainExpression"); + } + return element + } + base = element; + } + }; -/***/ }), + pp$5.shouldParseAsyncArrow = function() { + return !this.canInsertSemicolon() && this.eat(types$1.arrow) + }; -/***/ 23866: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + pp$5.parseSubscriptAsyncArrow = function(startPos, startLoc, exprList, forInit) { + return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), exprList, true, forInit) + }; + pp$5.parseSubscript = function(base, startPos, startLoc, noCalls, maybeAsyncArrow, optionalChained, forInit) { + var optionalSupported = this.options.ecmaVersion >= 11; + var optional = optionalSupported && this.eat(types$1.questionDot); + if (noCalls && optional) { this.raise(this.lastTokStart, "Optional chaining cannot appear in the callee of new expressions"); } -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; + var computed = this.eat(types$1.bracketL); + if (computed || (optional && this.type !== types$1.parenL && this.type !== types$1.backQuote) || this.eat(types$1.dot)) { + var node = this.startNodeAt(startPos, startLoc); + node.object = base; + if (computed) { + node.property = this.parseExpression(); + this.expect(types$1.bracketR); + } else if (this.type === types$1.privateId && base.type !== "Super") { + node.property = this.parsePrivateIdent(); + } else { + node.property = this.parseIdent(this.options.allowReserved !== "never"); + } + node.computed = !!computed; + if (optionalSupported) { + node.optional = optional; + } + base = this.finishNode(node, "MemberExpression"); + } else if (!noCalls && this.eat(types$1.parenL)) { + var refDestructuringErrors = new DestructuringErrors, oldYieldPos = this.yieldPos, oldAwaitPos = this.awaitPos, oldAwaitIdentPos = this.awaitIdentPos; + this.yieldPos = 0; + this.awaitPos = 0; + this.awaitIdentPos = 0; + var exprList = this.parseExprList(types$1.parenR, this.options.ecmaVersion >= 8, false, refDestructuringErrors); + if (maybeAsyncArrow && !optional && this.shouldParseAsyncArrow()) { + this.checkPatternErrors(refDestructuringErrors, false); + this.checkYieldAwaitInDefaultParams(); + if (this.awaitIdentPos > 0) + { this.raise(this.awaitIdentPos, "Cannot use 'await' as identifier inside an async function"); } + this.yieldPos = oldYieldPos; + this.awaitPos = oldAwaitPos; + this.awaitIdentPos = oldAwaitIdentPos; + return this.parseSubscriptAsyncArrow(startPos, startLoc, exprList, forInit) + } + this.checkExpressionErrors(refDestructuringErrors, true); + this.yieldPos = oldYieldPos || this.yieldPos; + this.awaitPos = oldAwaitPos || this.awaitPos; + this.awaitIdentPos = oldAwaitIdentPos || this.awaitIdentPos; + var node$1 = this.startNodeAt(startPos, startLoc); + node$1.callee = base; + node$1.arguments = exprList; + if (optionalSupported) { + node$1.optional = optional; + } + base = this.finishNode(node$1, "CallExpression"); + } else if (this.type === types$1.backQuote) { + if (optional || optionalChained) { + this.raise(this.start, "Optional chaining cannot appear in the tag of tagged template expressions"); + } + var node$2 = this.startNodeAt(startPos, startLoc); + node$2.tag = base; + node$2.quasi = this.parseTemplate({isTagged: true}); + base = this.finishNode(node$2, "TaggedTemplateExpression"); } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __exportStar = (this && this.__exportStar) || function(m, exports) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -__exportStar(__nccwpck_require__(76077), exports); -__exportStar(__nccwpck_require__(2652), exports); + return base + }; + // Parse an atomic expression — either a single token that is an + // expression, an expression started by a keyword like `function` or + // `new`, or an expression wrapped in punctuation like `()`, `[]`, + // or `{}`. -/***/ }), + pp$5.parseExprAtom = function(refDestructuringErrors, forInit, forNew) { + // If a division operator appears in an expression position, the + // tokenizer got confused, and we force it to read a regexp instead. + if (this.type === types$1.slash) { this.readRegexp(); } -/***/ 9543: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + var node, canBeArrow = this.potentialArrowAt === this.start; + switch (this.type) { + case types$1._super: + if (!this.allowSuper) + { this.raise(this.start, "'super' keyword outside a method"); } + node = this.startNode(); + this.next(); + if (this.type === types$1.parenL && !this.allowDirectSuper) + { this.raise(node.start, "super() call outside constructor of a subclass"); } + // The `super` keyword can appear at below: + // SuperProperty: + // super [ Expression ] + // super . IdentifierName + // SuperCall: + // super ( Arguments ) + if (this.type !== types$1.dot && this.type !== types$1.bracketL && this.type !== types$1.parenL) + { this.unexpected(); } + return this.finishNode(node, "Super") + case types$1._this: + node = this.startNode(); + this.next(); + return this.finishNode(node, "ThisExpression") -const ansiStyles = __nccwpck_require__(54412); -const {stdout: stdoutColor, stderr: stderrColor} = __nccwpck_require__(21450); -const { - stringReplaceAll, - stringEncaseCRLFWithFirstIndex -} = __nccwpck_require__(60327); + case types$1.name: + var startPos = this.start, startLoc = this.startLoc, containsEsc = this.containsEsc; + var id = this.parseIdent(false); + if (this.options.ecmaVersion >= 8 && !containsEsc && id.name === "async" && !this.canInsertSemicolon() && this.eat(types$1._function)) { + this.overrideContext(types.f_expr); + return this.parseFunction(this.startNodeAt(startPos, startLoc), 0, false, true, forInit) + } + if (canBeArrow && !this.canInsertSemicolon()) { + if (this.eat(types$1.arrow)) + { return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), [id], false, forInit) } + if (this.options.ecmaVersion >= 8 && id.name === "async" && this.type === types$1.name && !containsEsc && + (!this.potentialArrowInForAwait || this.value !== "of" || this.containsEsc)) { + id = this.parseIdent(false); + if (this.canInsertSemicolon() || !this.eat(types$1.arrow)) + { this.unexpected(); } + return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), [id], true, forInit) + } + } + return id -const {isArray} = Array; + case types$1.regexp: + var value = this.value; + node = this.parseLiteral(value.value); + node.regex = {pattern: value.pattern, flags: value.flags}; + return node -// `supportsColor.level` → `ansiStyles.color[name]` mapping -const levelMapping = [ - 'ansi', - 'ansi', - 'ansi256', - 'ansi16m' -]; + case types$1.num: case types$1.string: + return this.parseLiteral(this.value) -const styles = Object.create(null); + case types$1._null: case types$1._true: case types$1._false: + node = this.startNode(); + node.value = this.type === types$1._null ? null : this.type === types$1._true; + node.raw = this.type.keyword; + this.next(); + return this.finishNode(node, "Literal") -const applyOptions = (object, options = {}) => { - if (options.level && !(Number.isInteger(options.level) && options.level >= 0 && options.level <= 3)) { - throw new Error('The `level` option should be an integer from 0 to 3'); - } + case types$1.parenL: + var start = this.start, expr = this.parseParenAndDistinguishExpression(canBeArrow, forInit); + if (refDestructuringErrors) { + if (refDestructuringErrors.parenthesizedAssign < 0 && !this.isSimpleAssignTarget(expr)) + { refDestructuringErrors.parenthesizedAssign = start; } + if (refDestructuringErrors.parenthesizedBind < 0) + { refDestructuringErrors.parenthesizedBind = start; } + } + return expr - // Detect level if not set manually - const colorLevel = stdoutColor ? stdoutColor.level : 0; - object.level = options.level === undefined ? colorLevel : options.level; -}; + case types$1.bracketL: + node = this.startNode(); + this.next(); + node.elements = this.parseExprList(types$1.bracketR, true, true, refDestructuringErrors); + return this.finishNode(node, "ArrayExpression") -class ChalkClass { - constructor(options) { - // eslint-disable-next-line no-constructor-return - return chalkFactory(options); - } -} + case types$1.braceL: + this.overrideContext(types.b_expr); + return this.parseObj(false, refDestructuringErrors) -const chalkFactory = options => { - const chalk = {}; - applyOptions(chalk, options); + case types$1._function: + node = this.startNode(); + this.next(); + return this.parseFunction(node, 0) - chalk.template = (...arguments_) => chalkTag(chalk.template, ...arguments_); + case types$1._class: + return this.parseClass(this.startNode(), false) - Object.setPrototypeOf(chalk, Chalk.prototype); - Object.setPrototypeOf(chalk.template, chalk); + case types$1._new: + return this.parseNew() - chalk.template.constructor = () => { - throw new Error('`chalk.constructor()` is deprecated. Use `new chalk.Instance()` instead.'); - }; + case types$1.backQuote: + return this.parseTemplate() - chalk.template.Instance = ChalkClass; + case types$1._import: + if (this.options.ecmaVersion >= 11) { + return this.parseExprImport(forNew) + } else { + return this.unexpected() + } - return chalk.template; -}; + default: + return this.parseExprAtomDefault() + } + }; -function Chalk(options) { - return chalkFactory(options); -} + pp$5.parseExprAtomDefault = function() { + this.unexpected(); + }; -for (const [styleName, style] of Object.entries(ansiStyles)) { - styles[styleName] = { - get() { - const builder = createBuilder(this, createStyler(style.open, style.close, this._styler), this._isEmpty); - Object.defineProperty(this, styleName, {value: builder}); - return builder; - } - }; -} + pp$5.parseExprImport = function(forNew) { + var node = this.startNode(); -styles.visible = { - get() { - const builder = createBuilder(this, this._styler, true); - Object.defineProperty(this, 'visible', {value: builder}); - return builder; - } -}; + // Consume `import` as an identifier for `import.meta`. + // Because `this.parseIdent(true)` doesn't check escape sequences, it needs the check of `this.containsEsc`. + if (this.containsEsc) { this.raiseRecoverable(this.start, "Escape sequence in keyword import"); } + this.next(); -const usedModels = ['rgb', 'hex', 'keyword', 'hsl', 'hsv', 'hwb', 'ansi', 'ansi256']; + if (this.type === types$1.parenL && !forNew) { + return this.parseDynamicImport(node) + } else if (this.type === types$1.dot) { + var meta = this.startNodeAt(node.start, node.loc && node.loc.start); + meta.name = "import"; + node.meta = this.finishNode(meta, "Identifier"); + return this.parseImportMeta(node) + } else { + this.unexpected(); + } + }; -for (const model of usedModels) { - styles[model] = { - get() { - const {level} = this; - return function (...arguments_) { - const styler = createStyler(ansiStyles.color[levelMapping[level]][model](...arguments_), ansiStyles.color.close, this._styler); - return createBuilder(this, styler, this._isEmpty); - }; - } - }; -} + pp$5.parseDynamicImport = function(node) { + this.next(); // skip `(` -for (const model of usedModels) { - const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1); - styles[bgModel] = { - get() { - const {level} = this; - return function (...arguments_) { - const styler = createStyler(ansiStyles.bgColor[levelMapping[level]][model](...arguments_), ansiStyles.bgColor.close, this._styler); - return createBuilder(this, styler, this._isEmpty); - }; - } - }; -} + // Parse node.source. + node.source = this.parseMaybeAssign(); -const proto = Object.defineProperties(() => {}, { - ...styles, - level: { - enumerable: true, - get() { - return this._generator.level; - }, - set(level) { - this._generator.level = level; - } - } -}); + if (this.options.ecmaVersion >= 16) { + if (!this.eat(types$1.parenR)) { + this.expect(types$1.comma); + if (!this.afterTrailingComma(types$1.parenR)) { + node.options = this.parseMaybeAssign(); + if (!this.eat(types$1.parenR)) { + this.expect(types$1.comma); + if (!this.afterTrailingComma(types$1.parenR)) { + this.unexpected(); + } + } + } else { + node.options = null; + } + } else { + node.options = null; + } + } else { + // Verify ending. + if (!this.eat(types$1.parenR)) { + var errorPos = this.start; + if (this.eat(types$1.comma) && this.eat(types$1.parenR)) { + this.raiseRecoverable(errorPos, "Trailing comma is not allowed in import()"); + } else { + this.unexpected(errorPos); + } + } + } -const createStyler = (open, close, parent) => { - let openAll; - let closeAll; - if (parent === undefined) { - openAll = open; - closeAll = close; - } else { - openAll = parent.openAll + open; - closeAll = close + parent.closeAll; - } + return this.finishNode(node, "ImportExpression") + }; - return { - open, - close, - openAll, - closeAll, - parent - }; -}; + pp$5.parseImportMeta = function(node) { + this.next(); // skip `.` -const createBuilder = (self, _styler, _isEmpty) => { - const builder = (...arguments_) => { - if (isArray(arguments_[0]) && isArray(arguments_[0].raw)) { - // Called as a template literal, for example: chalk.red`2 + 3 = {bold ${2+3}}` - return applyStyle(builder, chalkTag(builder, ...arguments_)); - } + var containsEsc = this.containsEsc; + node.property = this.parseIdent(true); - // Single argument is hot path, implicit coercion is faster than anything - // eslint-disable-next-line no-implicit-coercion - return applyStyle(builder, (arguments_.length === 1) ? ('' + arguments_[0]) : arguments_.join(' ')); - }; + if (node.property.name !== "meta") + { this.raiseRecoverable(node.property.start, "The only valid meta property for import is 'import.meta'"); } + if (containsEsc) + { this.raiseRecoverable(node.start, "'import.meta' must not contain escaped characters"); } + if (this.options.sourceType !== "module" && !this.options.allowImportExportEverywhere) + { this.raiseRecoverable(node.start, "Cannot use 'import.meta' outside a module"); } - // We alter the prototype because we must return a function, but there is - // no way to create a function with a different prototype - Object.setPrototypeOf(builder, proto); + return this.finishNode(node, "MetaProperty") + }; - builder._generator = self; - builder._styler = _styler; - builder._isEmpty = _isEmpty; + pp$5.parseLiteral = function(value) { + var node = this.startNode(); + node.value = value; + node.raw = this.input.slice(this.start, this.end); + if (node.raw.charCodeAt(node.raw.length - 1) === 110) { node.bigint = node.raw.slice(0, -1).replace(/_/g, ""); } + this.next(); + return this.finishNode(node, "Literal") + }; - return builder; -}; + pp$5.parseParenExpression = function() { + this.expect(types$1.parenL); + var val = this.parseExpression(); + this.expect(types$1.parenR); + return val + }; -const applyStyle = (self, string) => { - if (self.level <= 0 || !string) { - return self._isEmpty ? '' : string; - } + pp$5.shouldParseArrow = function(exprList) { + return !this.canInsertSemicolon() + }; - let styler = self._styler; + pp$5.parseParenAndDistinguishExpression = function(canBeArrow, forInit) { + var startPos = this.start, startLoc = this.startLoc, val, allowTrailingComma = this.options.ecmaVersion >= 8; + if (this.options.ecmaVersion >= 6) { + this.next(); - if (styler === undefined) { - return string; - } + var innerStartPos = this.start, innerStartLoc = this.startLoc; + var exprList = [], first = true, lastIsComma = false; + var refDestructuringErrors = new DestructuringErrors, oldYieldPos = this.yieldPos, oldAwaitPos = this.awaitPos, spreadStart; + this.yieldPos = 0; + this.awaitPos = 0; + // Do not save awaitIdentPos to allow checking awaits nested in parameters + while (this.type !== types$1.parenR) { + first ? first = false : this.expect(types$1.comma); + if (allowTrailingComma && this.afterTrailingComma(types$1.parenR, true)) { + lastIsComma = true; + break + } else if (this.type === types$1.ellipsis) { + spreadStart = this.start; + exprList.push(this.parseParenItem(this.parseRestBinding())); + if (this.type === types$1.comma) { + this.raiseRecoverable( + this.start, + "Comma is not permitted after the rest element" + ); + } + break + } else { + exprList.push(this.parseMaybeAssign(false, refDestructuringErrors, this.parseParenItem)); + } + } + var innerEndPos = this.lastTokEnd, innerEndLoc = this.lastTokEndLoc; + this.expect(types$1.parenR); - const {openAll, closeAll} = styler; - if (string.indexOf('\u001B') !== -1) { - while (styler !== undefined) { - // Replace any instances already present with a re-opening code - // otherwise only the part of the string until said closing code - // will be colored, and the rest will simply be 'plain'. - string = stringReplaceAll(string, styler.close, styler.open); + if (canBeArrow && this.shouldParseArrow(exprList) && this.eat(types$1.arrow)) { + this.checkPatternErrors(refDestructuringErrors, false); + this.checkYieldAwaitInDefaultParams(); + this.yieldPos = oldYieldPos; + this.awaitPos = oldAwaitPos; + return this.parseParenArrowList(startPos, startLoc, exprList, forInit) + } - styler = styler.parent; - } - } + if (!exprList.length || lastIsComma) { this.unexpected(this.lastTokStart); } + if (spreadStart) { this.unexpected(spreadStart); } + this.checkExpressionErrors(refDestructuringErrors, true); + this.yieldPos = oldYieldPos || this.yieldPos; + this.awaitPos = oldAwaitPos || this.awaitPos; - // We can move both next actions out of loop, because remaining actions in loop won't have - // any/visible effect on parts we add here. Close the styling before a linebreak and reopen - // after next line to fix a bleed issue on macOS: https://github.com/chalk/chalk/pull/92 - const lfIndex = string.indexOf('\n'); - if (lfIndex !== -1) { - string = stringEncaseCRLFWithFirstIndex(string, closeAll, openAll, lfIndex); - } + if (exprList.length > 1) { + val = this.startNodeAt(innerStartPos, innerStartLoc); + val.expressions = exprList; + this.finishNodeAt(val, "SequenceExpression", innerEndPos, innerEndLoc); + } else { + val = exprList[0]; + } + } else { + val = this.parseParenExpression(); + } - return openAll + string + closeAll; -}; + if (this.options.preserveParens) { + var par = this.startNodeAt(startPos, startLoc); + par.expression = val; + return this.finishNode(par, "ParenthesizedExpression") + } else { + return val + } + }; -let template; -const chalkTag = (chalk, ...strings) => { - const [firstString] = strings; + pp$5.parseParenItem = function(item) { + return item + }; - if (!isArray(firstString) || !isArray(firstString.raw)) { - // If chalk() was called by itself or with a string, - // return the string itself as a string. - return strings.join(' '); - } + pp$5.parseParenArrowList = function(startPos, startLoc, exprList, forInit) { + return this.parseArrowExpression(this.startNodeAt(startPos, startLoc), exprList, false, forInit) + }; - const arguments_ = strings.slice(1); - const parts = [firstString.raw[0]]; + // New's precedence is slightly tricky. It must allow its argument to + // be a `[]` or dot subscript expression, but not a call — at least, + // not without wrapping it in parentheses. Thus, it uses the noCalls + // argument to parseSubscripts to prevent it from consuming the + // argument list. - for (let i = 1; i < firstString.length; i++) { - parts.push( - String(arguments_[i - 1]).replace(/[{}\\]/g, '\\$&'), - String(firstString.raw[i]) - ); - } + var empty = []; - if (template === undefined) { - template = __nccwpck_require__(6404); - } + pp$5.parseNew = function() { + if (this.containsEsc) { this.raiseRecoverable(this.start, "Escape sequence in keyword new"); } + var node = this.startNode(); + this.next(); + if (this.options.ecmaVersion >= 6 && this.type === types$1.dot) { + var meta = this.startNodeAt(node.start, node.loc && node.loc.start); + meta.name = "new"; + node.meta = this.finishNode(meta, "Identifier"); + this.next(); + var containsEsc = this.containsEsc; + node.property = this.parseIdent(true); + if (node.property.name !== "target") + { this.raiseRecoverable(node.property.start, "The only valid meta property for new is 'new.target'"); } + if (containsEsc) + { this.raiseRecoverable(node.start, "'new.target' must not contain escaped characters"); } + if (!this.allowNewDotTarget) + { this.raiseRecoverable(node.start, "'new.target' can only be used in functions and class static block"); } + return this.finishNode(node, "MetaProperty") + } + var startPos = this.start, startLoc = this.startLoc; + node.callee = this.parseSubscripts(this.parseExprAtom(null, false, true), startPos, startLoc, true, false); + if (this.eat(types$1.parenL)) { node.arguments = this.parseExprList(types$1.parenR, this.options.ecmaVersion >= 8, false); } + else { node.arguments = empty; } + return this.finishNode(node, "NewExpression") + }; - return template(chalk, parts.join('')); -}; + // Parse template expression. -Object.defineProperties(Chalk.prototype, styles); + pp$5.parseTemplateElement = function(ref) { + var isTagged = ref.isTagged; -const chalk = Chalk(); // eslint-disable-line new-cap -chalk.supportsColor = stdoutColor; -chalk.stderr = Chalk({level: stderrColor ? stderrColor.level : 0}); // eslint-disable-line new-cap -chalk.stderr.supportsColor = stderrColor; + var elem = this.startNode(); + if (this.type === types$1.invalidTemplate) { + if (!isTagged) { + this.raiseRecoverable(this.start, "Bad escape sequence in untagged template literal"); + } + elem.value = { + raw: this.value.replace(/\r\n?/g, "\n"), + cooked: null + }; + } else { + elem.value = { + raw: this.input.slice(this.start, this.end).replace(/\r\n?/g, "\n"), + cooked: this.value + }; + } + this.next(); + elem.tail = this.type === types$1.backQuote; + return this.finishNode(elem, "TemplateElement") + }; -module.exports = chalk; + pp$5.parseTemplate = function(ref) { + if ( ref === void 0 ) ref = {}; + var isTagged = ref.isTagged; if ( isTagged === void 0 ) isTagged = false; + var node = this.startNode(); + this.next(); + node.expressions = []; + var curElt = this.parseTemplateElement({isTagged: isTagged}); + node.quasis = [curElt]; + while (!curElt.tail) { + if (this.type === types$1.eof) { this.raise(this.pos, "Unterminated template literal"); } + this.expect(types$1.dollarBraceL); + node.expressions.push(this.parseExpression()); + this.expect(types$1.braceR); + node.quasis.push(curElt = this.parseTemplateElement({isTagged: isTagged})); + } + this.next(); + return this.finishNode(node, "TemplateLiteral") + }; -/***/ }), + pp$5.isAsyncProp = function(prop) { + return !prop.computed && prop.key.type === "Identifier" && prop.key.name === "async" && + (this.type === types$1.name || this.type === types$1.num || this.type === types$1.string || this.type === types$1.bracketL || this.type.keyword || (this.options.ecmaVersion >= 9 && this.type === types$1.star)) && + !lineBreak.test(this.input.slice(this.lastTokEnd, this.start)) + }; -/***/ 6404: -/***/ ((module) => { + // Parse an object literal or binding pattern. + pp$5.parseObj = function(isPattern, refDestructuringErrors) { + var node = this.startNode(), first = true, propHash = {}; + node.properties = []; + this.next(); + while (!this.eat(types$1.braceR)) { + if (!first) { + this.expect(types$1.comma); + if (this.options.ecmaVersion >= 5 && this.afterTrailingComma(types$1.braceR)) { break } + } else { first = false; } -const TEMPLATE_REGEX = /(?:\\(u(?:[a-f\d]{4}|\{[a-f\d]{1,6}\})|x[a-f\d]{2}|.))|(?:\{(~)?(\w+(?:\([^)]*\))?(?:\.\w+(?:\([^)]*\))?)*)(?:[ \t]|(?=\r?\n)))|(\})|((?:.|[\r\n\f])+?)/gi; -const STYLE_REGEX = /(?:^|\.)(\w+)(?:\(([^)]*)\))?/g; -const STRING_REGEX = /^(['"])((?:\\.|(?!\1)[^\\])*)\1$/; -const ESCAPE_REGEX = /\\(u(?:[a-f\d]{4}|{[a-f\d]{1,6}})|x[a-f\d]{2}|.)|([^\\])/gi; + var prop = this.parseProperty(isPattern, refDestructuringErrors); + if (!isPattern) { this.checkPropClash(prop, propHash, refDestructuringErrors); } + node.properties.push(prop); + } + return this.finishNode(node, isPattern ? "ObjectPattern" : "ObjectExpression") + }; -const ESCAPES = new Map([ - ['n', '\n'], - ['r', '\r'], - ['t', '\t'], - ['b', '\b'], - ['f', '\f'], - ['v', '\v'], - ['0', '\0'], - ['\\', '\\'], - ['e', '\u001B'], - ['a', '\u0007'] -]); + pp$5.parseProperty = function(isPattern, refDestructuringErrors) { + var prop = this.startNode(), isGenerator, isAsync, startPos, startLoc; + if (this.options.ecmaVersion >= 9 && this.eat(types$1.ellipsis)) { + if (isPattern) { + prop.argument = this.parseIdent(false); + if (this.type === types$1.comma) { + this.raiseRecoverable(this.start, "Comma is not permitted after the rest element"); + } + return this.finishNode(prop, "RestElement") + } + // Parse argument. + prop.argument = this.parseMaybeAssign(false, refDestructuringErrors); + // To disallow trailing comma via `this.toAssignable()`. + if (this.type === types$1.comma && refDestructuringErrors && refDestructuringErrors.trailingComma < 0) { + refDestructuringErrors.trailingComma = this.start; + } + // Finish + return this.finishNode(prop, "SpreadElement") + } + if (this.options.ecmaVersion >= 6) { + prop.method = false; + prop.shorthand = false; + if (isPattern || refDestructuringErrors) { + startPos = this.start; + startLoc = this.startLoc; + } + if (!isPattern) + { isGenerator = this.eat(types$1.star); } + } + var containsEsc = this.containsEsc; + this.parsePropertyName(prop); + if (!isPattern && !containsEsc && this.options.ecmaVersion >= 8 && !isGenerator && this.isAsyncProp(prop)) { + isAsync = true; + isGenerator = this.options.ecmaVersion >= 9 && this.eat(types$1.star); + this.parsePropertyName(prop); + } else { + isAsync = false; + } + this.parsePropertyValue(prop, isPattern, isGenerator, isAsync, startPos, startLoc, refDestructuringErrors, containsEsc); + return this.finishNode(prop, "Property") + }; -function unescape(c) { - const u = c[0] === 'u'; - const bracket = c[1] === '{'; + pp$5.parseGetterSetter = function(prop) { + prop.kind = prop.key.name; + this.parsePropertyName(prop); + prop.value = this.parseMethod(false); + var paramCount = prop.kind === "get" ? 0 : 1; + if (prop.value.params.length !== paramCount) { + var start = prop.value.start; + if (prop.kind === "get") + { this.raiseRecoverable(start, "getter should have no params"); } + else + { this.raiseRecoverable(start, "setter should have exactly one param"); } + } else { + if (prop.kind === "set" && prop.value.params[0].type === "RestElement") + { this.raiseRecoverable(prop.value.params[0].start, "Setter cannot use rest params"); } + } + }; - if ((u && !bracket && c.length === 5) || (c[0] === 'x' && c.length === 3)) { - return String.fromCharCode(parseInt(c.slice(1), 16)); - } + pp$5.parsePropertyValue = function(prop, isPattern, isGenerator, isAsync, startPos, startLoc, refDestructuringErrors, containsEsc) { + if ((isGenerator || isAsync) && this.type === types$1.colon) + { this.unexpected(); } - if (u && bracket) { - return String.fromCodePoint(parseInt(c.slice(2, -1), 16)); - } + if (this.eat(types$1.colon)) { + prop.value = isPattern ? this.parseMaybeDefault(this.start, this.startLoc) : this.parseMaybeAssign(false, refDestructuringErrors); + prop.kind = "init"; + } else if (this.options.ecmaVersion >= 6 && this.type === types$1.parenL) { + if (isPattern) { this.unexpected(); } + prop.kind = "init"; + prop.method = true; + prop.value = this.parseMethod(isGenerator, isAsync); + } else if (!isPattern && !containsEsc && + this.options.ecmaVersion >= 5 && !prop.computed && prop.key.type === "Identifier" && + (prop.key.name === "get" || prop.key.name === "set") && + (this.type !== types$1.comma && this.type !== types$1.braceR && this.type !== types$1.eq)) { + if (isGenerator || isAsync) { this.unexpected(); } + this.parseGetterSetter(prop); + } else if (this.options.ecmaVersion >= 6 && !prop.computed && prop.key.type === "Identifier") { + if (isGenerator || isAsync) { this.unexpected(); } + this.checkUnreserved(prop.key); + if (prop.key.name === "await" && !this.awaitIdentPos) + { this.awaitIdentPos = startPos; } + prop.kind = "init"; + if (isPattern) { + prop.value = this.parseMaybeDefault(startPos, startLoc, this.copyNode(prop.key)); + } else if (this.type === types$1.eq && refDestructuringErrors) { + if (refDestructuringErrors.shorthandAssign < 0) + { refDestructuringErrors.shorthandAssign = this.start; } + prop.value = this.parseMaybeDefault(startPos, startLoc, this.copyNode(prop.key)); + } else { + prop.value = this.copyNode(prop.key); + } + prop.shorthand = true; + } else { this.unexpected(); } + }; - return ESCAPES.get(c) || c; -} + pp$5.parsePropertyName = function(prop) { + if (this.options.ecmaVersion >= 6) { + if (this.eat(types$1.bracketL)) { + prop.computed = true; + prop.key = this.parseMaybeAssign(); + this.expect(types$1.bracketR); + return prop.key + } else { + prop.computed = false; + } + } + return prop.key = this.type === types$1.num || this.type === types$1.string ? this.parseExprAtom() : this.parseIdent(this.options.allowReserved !== "never") + }; -function parseArguments(name, arguments_) { - const results = []; - const chunks = arguments_.trim().split(/\s*,\s*/g); - let matches; + // Initialize empty function node. - for (const chunk of chunks) { - const number = Number(chunk); - if (!Number.isNaN(number)) { - results.push(number); - } else if ((matches = chunk.match(STRING_REGEX))) { - results.push(matches[2].replace(ESCAPE_REGEX, (m, escape, character) => escape ? unescape(escape) : character)); - } else { - throw new Error(`Invalid Chalk template style argument: ${chunk} (in style '${name}')`); - } - } + pp$5.initFunction = function(node) { + node.id = null; + if (this.options.ecmaVersion >= 6) { node.generator = node.expression = false; } + if (this.options.ecmaVersion >= 8) { node.async = false; } + }; - return results; -} + // Parse object or class method. -function parseStyle(style) { - STYLE_REGEX.lastIndex = 0; + pp$5.parseMethod = function(isGenerator, isAsync, allowDirectSuper) { + var node = this.startNode(), oldYieldPos = this.yieldPos, oldAwaitPos = this.awaitPos, oldAwaitIdentPos = this.awaitIdentPos; - const results = []; - let matches; + this.initFunction(node); + if (this.options.ecmaVersion >= 6) + { node.generator = isGenerator; } + if (this.options.ecmaVersion >= 8) + { node.async = !!isAsync; } - while ((matches = STYLE_REGEX.exec(style)) !== null) { - const name = matches[1]; + this.yieldPos = 0; + this.awaitPos = 0; + this.awaitIdentPos = 0; + this.enterScope(functionFlags(isAsync, node.generator) | SCOPE_SUPER | (allowDirectSuper ? SCOPE_DIRECT_SUPER : 0)); - if (matches[2]) { - const args = parseArguments(name, matches[2]); - results.push([name].concat(args)); - } else { - results.push([name]); - } - } + this.expect(types$1.parenL); + node.params = this.parseBindingList(types$1.parenR, false, this.options.ecmaVersion >= 8); + this.checkYieldAwaitInDefaultParams(); + this.parseFunctionBody(node, false, true, false); - return results; -} + this.yieldPos = oldYieldPos; + this.awaitPos = oldAwaitPos; + this.awaitIdentPos = oldAwaitIdentPos; + return this.finishNode(node, "FunctionExpression") + }; -function buildStyle(chalk, styles) { - const enabled = {}; + // Parse arrow function expression with given parameters. - for (const layer of styles) { - for (const style of layer.styles) { - enabled[style[0]] = layer.inverse ? null : style.slice(1); - } - } + pp$5.parseArrowExpression = function(node, params, isAsync, forInit) { + var oldYieldPos = this.yieldPos, oldAwaitPos = this.awaitPos, oldAwaitIdentPos = this.awaitIdentPos; - let current = chalk; - for (const [styleName, styles] of Object.entries(enabled)) { - if (!Array.isArray(styles)) { - continue; - } + this.enterScope(functionFlags(isAsync, false) | SCOPE_ARROW); + this.initFunction(node); + if (this.options.ecmaVersion >= 8) { node.async = !!isAsync; } - if (!(styleName in current)) { - throw new Error(`Unknown Chalk style: ${styleName}`); - } + this.yieldPos = 0; + this.awaitPos = 0; + this.awaitIdentPos = 0; - current = styles.length > 0 ? current[styleName](...styles) : current[styleName]; - } + node.params = this.toAssignableList(params, true); + this.parseFunctionBody(node, true, false, forInit); - return current; -} + this.yieldPos = oldYieldPos; + this.awaitPos = oldAwaitPos; + this.awaitIdentPos = oldAwaitIdentPos; + return this.finishNode(node, "ArrowFunctionExpression") + }; -module.exports = (chalk, temporary) => { - const styles = []; - const chunks = []; - let chunk = []; + // Parse function body and check parameters. - // eslint-disable-next-line max-params - temporary.replace(TEMPLATE_REGEX, (m, escapeCharacter, inverse, style, close, character) => { - if (escapeCharacter) { - chunk.push(unescape(escapeCharacter)); - } else if (style) { - const string = chunk.join(''); - chunk = []; - chunks.push(styles.length === 0 ? string : buildStyle(chalk, styles)(string)); - styles.push({inverse, styles: parseStyle(style)}); - } else if (close) { - if (styles.length === 0) { - throw new Error('Found extraneous } in Chalk template literal'); - } + pp$5.parseFunctionBody = function(node, isArrowFunction, isMethod, forInit) { + var isExpression = isArrowFunction && this.type !== types$1.braceL; + var oldStrict = this.strict, useStrict = false; - chunks.push(buildStyle(chalk, styles)(chunk.join(''))); - chunk = []; - styles.pop(); - } else { - chunk.push(character); - } - }); + if (isExpression) { + node.body = this.parseMaybeAssign(forInit); + node.expression = true; + this.checkParams(node, false); + } else { + var nonSimple = this.options.ecmaVersion >= 7 && !this.isSimpleParamList(node.params); + if (!oldStrict || nonSimple) { + useStrict = this.strictDirective(this.end); + // If this is a strict mode function, verify that argument names + // are not repeated, and it does not try to bind the words `eval` + // or `arguments`. + if (useStrict && nonSimple) + { this.raiseRecoverable(node.start, "Illegal 'use strict' directive in function with non-simple parameter list"); } + } + // Start a new scope with regard to labels and the `inFunction` + // flag (restore them to their old value afterwards). + var oldLabels = this.labels; + this.labels = []; + if (useStrict) { this.strict = true; } - chunks.push(chunk.join('')); + // Add the params to varDeclaredNames to ensure that an error is thrown + // if a let/const declaration in the function clashes with one of the params. + this.checkParams(node, !oldStrict && !useStrict && !isArrowFunction && !isMethod && this.isSimpleParamList(node.params)); + // Ensure the function name isn't a forbidden identifier in strict mode, e.g. 'eval' + if (this.strict && node.id) { this.checkLValSimple(node.id, BIND_OUTSIDE); } + node.body = this.parseBlock(false, undefined, useStrict && !oldStrict); + node.expression = false; + this.adaptDirectivePrologue(node.body.body); + this.labels = oldLabels; + } + this.exitScope(); + }; - if (styles.length > 0) { - const errMessage = `Chalk template literal is missing ${styles.length} closing bracket${styles.length === 1 ? '' : 's'} (\`}\`)`; - throw new Error(errMessage); - } + pp$5.isSimpleParamList = function(params) { + for (var i = 0, list = params; i < list.length; i += 1) + { + var param = list[i]; - return chunks.join(''); -}; + if (param.type !== "Identifier") { return false + } } + return true + }; + // Checks function params for various disallowed patterns such as using "eval" + // or "arguments" and duplicate parameters. -/***/ }), + pp$5.checkParams = function(node, allowDuplicates) { + var nameHash = Object.create(null); + for (var i = 0, list = node.params; i < list.length; i += 1) + { + var param = list[i]; -/***/ 60327: -/***/ ((module) => { + this.checkLValInnerPattern(param, BIND_VAR, allowDuplicates ? null : nameHash); + } + }; + // Parses a comma-separated list of expressions, and returns them as + // an array. `close` is the token type that ends the list, and + // `allowEmpty` can be turned on to allow subsequent commas with + // nothing in between them to be parsed as `null` (which is needed + // for array literals). + pp$5.parseExprList = function(close, allowTrailingComma, allowEmpty, refDestructuringErrors) { + var elts = [], first = true; + while (!this.eat(close)) { + if (!first) { + this.expect(types$1.comma); + if (allowTrailingComma && this.afterTrailingComma(close)) { break } + } else { first = false; } -const stringReplaceAll = (string, substring, replacer) => { - let index = string.indexOf(substring); - if (index === -1) { - return string; - } + var elt = (void 0); + if (allowEmpty && this.type === types$1.comma) + { elt = null; } + else if (this.type === types$1.ellipsis) { + elt = this.parseSpread(refDestructuringErrors); + if (refDestructuringErrors && this.type === types$1.comma && refDestructuringErrors.trailingComma < 0) + { refDestructuringErrors.trailingComma = this.start; } + } else { + elt = this.parseMaybeAssign(false, refDestructuringErrors); + } + elts.push(elt); + } + return elts + }; - const substringLength = substring.length; - let endIndex = 0; - let returnValue = ''; - do { - returnValue += string.substr(endIndex, index - endIndex) + substring + replacer; - endIndex = index + substringLength; - index = string.indexOf(substring, endIndex); - } while (index !== -1); + pp$5.checkUnreserved = function(ref) { + var start = ref.start; + var end = ref.end; + var name = ref.name; - returnValue += string.substr(endIndex); - return returnValue; -}; + if (this.inGenerator && name === "yield") + { this.raiseRecoverable(start, "Cannot use 'yield' as identifier inside a generator"); } + if (this.inAsync && name === "await") + { this.raiseRecoverable(start, "Cannot use 'await' as identifier inside an async function"); } + if (this.currentThisScope().inClassFieldInit && name === "arguments") + { this.raiseRecoverable(start, "Cannot use 'arguments' in class field initializer"); } + if (this.inClassStaticBlock && (name === "arguments" || name === "await")) + { this.raise(start, ("Cannot use " + name + " in class static initialization block")); } + if (this.keywords.test(name)) + { this.raise(start, ("Unexpected keyword '" + name + "'")); } + if (this.options.ecmaVersion < 6 && + this.input.slice(start, end).indexOf("\\") !== -1) { return } + var re = this.strict ? this.reservedWordsStrict : this.reservedWords; + if (re.test(name)) { + if (!this.inAsync && name === "await") + { this.raiseRecoverable(start, "Cannot use keyword 'await' outside an async function"); } + this.raiseRecoverable(start, ("The keyword '" + name + "' is reserved")); + } + }; -const stringEncaseCRLFWithFirstIndex = (string, prefix, postfix, index) => { - let endIndex = 0; - let returnValue = ''; - do { - const gotCR = string[index - 1] === '\r'; - returnValue += string.substr(endIndex, (gotCR ? index - 1 : index) - endIndex) + prefix + (gotCR ? '\r\n' : '\n') + postfix; - endIndex = index + 1; - index = string.indexOf('\n', endIndex); - } while (index !== -1); + // Parse the next token as an identifier. If `liberal` is true (used + // when parsing properties), it will also convert keywords into + // identifiers. - returnValue += string.substr(endIndex); - return returnValue; -}; + pp$5.parseIdent = function(liberal) { + var node = this.parseIdentNode(); + this.next(!!liberal); + this.finishNode(node, "Identifier"); + if (!liberal) { + this.checkUnreserved(node); + if (node.name === "await" && !this.awaitIdentPos) + { this.awaitIdentPos = node.start; } + } + return node + }; -module.exports = { - stringReplaceAll, - stringEncaseCRLFWithFirstIndex -}; + pp$5.parseIdentNode = function() { + var node = this.startNode(); + if (this.type === types$1.name) { + node.name = this.value; + } else if (this.type.keyword) { + node.name = this.type.keyword; + // To fix https://github.com/acornjs/acorn/issues/575 + // `class` and `function` keywords push new context into this.context. + // But there is no chance to pop the context if the keyword is consumed as an identifier such as a property name. + // If the previous token is a dot, this does not apply because the context-managing code already ignored the keyword + if ((node.name === "class" || node.name === "function") && + (this.lastTokEnd !== this.lastTokStart + 1 || this.input.charCodeAt(this.lastTokStart) !== 46)) { + this.context.pop(); + } + this.type = types$1.name; + } else { + this.unexpected(); + } + return node + }; -/***/ }), + pp$5.parsePrivateIdent = function() { + var node = this.startNode(); + if (this.type === types$1.privateId) { + node.name = this.value; + } else { + this.unexpected(); + } + this.next(); + this.finishNode(node, "PrivateIdentifier"); -/***/ 44477: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // For validating existence + if (this.options.checkPrivateFields) { + if (this.privateNameStack.length === 0) { + this.raise(node.start, ("Private field '#" + (node.name) + "' must be declared in an enclosing class")); + } else { + this.privateNameStack[this.privateNameStack.length - 1].used.push(node); + } + } + return node + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ConfluenceSyncPages = void 0; -const promises_1 = __nccwpck_require__(51455); -const logger_1 = __nccwpck_require__(40987); -const fastq_1 = __nccwpck_require__(48230); -const CustomConfluenceClient_1 = __nccwpck_require__(17303); -const ConfluenceSyncPages_types_1 = __nccwpck_require__(37054); -const CompoundError_1 = __nccwpck_require__(41589); -const NotAncestorsExpectedValidationError_1 = __nccwpck_require__(94732); -const PendingPagesToSyncError_1 = __nccwpck_require__(99947); -const RootPageRequiredException_1 = __nccwpck_require__(52623); -const ShouldUseIdModeException_1 = __nccwpck_require__(51851); -const RootPageForbiddenException_1 = __nccwpck_require__(27023); -const PagesWithoutIdException_1 = __nccwpck_require__(58334); -const InvalidSyncModeException_1 = __nccwpck_require__(12230); -const Pages_1 = __nccwpck_require__(81410); -const LOGGER_NAMESPACE = "confluence-sync-pages"; -const DEFAULT_LOG_LEVEL = "silent"; -const ConfluenceSyncPages = class ConfluenceSyncPages { - _logger; - _confluenceClient; - _rootPageId; - _syncMode; - constructor({ logLevel, url, spaceId, personalAccessToken, dryRun, syncMode, rootPageId, }) { - this._logger = new logger_1.Logger(LOGGER_NAMESPACE, { - level: logLevel ?? DEFAULT_LOG_LEVEL, - }); - this._confluenceClient = new CustomConfluenceClient_1.CustomConfluenceClient({ - url, - spaceId, - personalAccessToken, - logger: this._logger.namespace("confluence"), - dryRun, - }); - this._syncMode = syncMode ?? ConfluenceSyncPages_types_1.SyncModes.TREE; - if (![ConfluenceSyncPages_types_1.SyncModes.FLAT, ConfluenceSyncPages_types_1.SyncModes.ID, ConfluenceSyncPages_types_1.SyncModes.TREE].includes(this._syncMode)) { - throw new InvalidSyncModeException_1.InvalidSyncModeException(this._syncMode); - } - if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.TREE && rootPageId === undefined) { - throw new RootPageRequiredException_1.RootPageRequiredException(ConfluenceSyncPages_types_1.SyncModes.TREE); - } - this._rootPageId = rootPageId; - } - get logger() { - return this._logger; + // Parses yield expression inside generator. + + pp$5.parseYield = function(forInit) { + if (!this.yieldPos) { this.yieldPos = this.start; } + + var node = this.startNode(); + this.next(); + if (this.type === types$1.semi || this.canInsertSemicolon() || (this.type !== types$1.star && !this.type.startsExpr)) { + node.delegate = false; + node.argument = null; + } else { + node.delegate = this.eat(types$1.star); + node.argument = this.parseMaybeAssign(forInit); } - async sync(pages) { - const syncMode = this._syncMode; - const confluencePages = new Map(); - const pagesMap = new Map(pages.map((page) => [page.title, page])); - const tasksDone = new Array(); - const errors = new Array(); - const queue = (0, fastq_1.promise)(this._handleTask.bind(this), 1); - function enqueueTask(task) { - queue.push({ - task, - enqueueTask, - getConfluencePageByTitle, - getPageByTitle, - getPagesByAncestor, - storeConfluencePage, - }); - } - function getConfluencePageByTitle(pageTitle) { - return confluencePages.get(pageTitle); - } - function storeConfluencePage(page) { - confluencePages.set(page.title, page); - } - function getPageByTitle(pageTitle) { - return pagesMap.get(pageTitle); - } - function getPagesByAncestor(ancestor, isRoot = false) { - if (syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { - // NOTE: in flat mode all pages without id are considered - // children of root page. Otherwise, they are pages with mirror - // page in Confluence and have no ancestors. - if (isRoot) { - return pages.filter((page) => page.id === undefined); - } - return []; - } - if (isRoot) { - return pages - .filter((page) => page.ancestors === undefined || page.ancestors.length === 0) - .concat(pages.filter((page) => page.ancestors?.at(-1) === ancestor)); - } - return pages.filter((page) => page.ancestors?.at(-1) === ancestor); - } - queue.error((e, job) => { - if (e) { - errors.push(e); - return; - } - const task = job.task; - tasksDone.push(task); - }); - if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { - this._validateFlatMode(pages); - pages - .filter((page) => page.id !== undefined) - .forEach((page) => { - enqueueTask({ type: "update", pageId: page.id, page }); - }); - } - if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.ID) { - this._validateIdMode(pages); - pages.forEach((page) => { - enqueueTask({ type: "update", pageId: page.id, page }); - }); - } - if (this._rootPageId !== undefined) - enqueueTask({ type: "init", pageId: this._rootPageId }); - await queue.drained(); - if (errors.length > 0) { - const e = new CompoundError_1.CompoundError(...errors); - this._logger.error(`Error occurs during sync: ${e}`); - throw e; - } - this._assertPendingPagesToCreate(tasksDone, pages); - this._reportTasks(tasksDone); + return this.finishNode(node, "YieldExpression") + }; + + pp$5.parseAwait = function(forInit) { + if (!this.awaitPos) { this.awaitPos = this.start; } + + var node = this.startNode(); + this.next(); + node.argument = this.parseMaybeUnary(null, true, false, forInit); + return this.finishNode(node, "AwaitExpression") + }; + + var pp$4 = Parser.prototype; + + // This function is used to raise exceptions on parse errors. It + // takes an offset integer (into the current `input`) to indicate + // the location of the error, attaches the position to the end + // of the error message, and then raises a `SyntaxError` with that + // message. + + pp$4.raise = function(pos, message) { + var loc = getLineInfo(this.input, pos); + message += " (" + loc.line + ":" + loc.column + ")"; + var err = new SyntaxError(message); + err.pos = pos; err.loc = loc; err.raisedAt = this.pos; + throw err + }; + + pp$4.raiseRecoverable = pp$4.raise; + + pp$4.curPosition = function() { + if (this.options.locations) { + return new Position(this.curLine, this.pos - this.lineStart) } - _validateIdMode(pages) { - const pagesWithoutId = pages.filter((page) => page.id === undefined); - if (pagesWithoutId.length > 0) { - throw new PagesWithoutIdException_1.PagesWithoutIdException(pagesWithoutId); - } - if (this._rootPageId !== undefined) { - throw new RootPageForbiddenException_1.RootPageForbiddenException(); - } - const pagesWithAncestors = pages.filter((page) => page.ancestors !== undefined && page.ancestors.length > 0); - if (pagesWithAncestors.length > 0) { - throw new NotAncestorsExpectedValidationError_1.NotAncestorsExpectedValidationError(pagesWithAncestors); + }; + + var pp$3 = Parser.prototype; + + var Scope = function Scope(flags) { + this.flags = flags; + // A list of var-declared names in the current lexical scope + this.var = []; + // A list of lexically-declared names in the current lexical scope + this.lexical = []; + // A list of lexically-declared FunctionDeclaration names in the current lexical scope + this.functions = []; + // A switch to disallow the identifier reference 'arguments' + this.inClassFieldInit = false; + }; + + // The functions in this module keep track of declared variables in the current scope in order to detect duplicate variable names. + + pp$3.enterScope = function(flags) { + this.scopeStack.push(new Scope(flags)); + }; + + pp$3.exitScope = function() { + this.scopeStack.pop(); + }; + + // The spec says: + // > At the top level of a function, or script, function declarations are + // > treated like var declarations rather than like lexical declarations. + pp$3.treatFunctionsAsVarInScope = function(scope) { + return (scope.flags & SCOPE_FUNCTION) || !this.inModule && (scope.flags & SCOPE_TOP) + }; + + pp$3.declareName = function(name, bindingType, pos) { + var redeclared = false; + if (bindingType === BIND_LEXICAL) { + var scope = this.currentScope(); + redeclared = scope.lexical.indexOf(name) > -1 || scope.functions.indexOf(name) > -1 || scope.var.indexOf(name) > -1; + scope.lexical.push(name); + if (this.inModule && (scope.flags & SCOPE_TOP)) + { delete this.undefinedExports[name]; } + } else if (bindingType === BIND_SIMPLE_CATCH) { + var scope$1 = this.currentScope(); + scope$1.lexical.push(name); + } else if (bindingType === BIND_FUNCTION) { + var scope$2 = this.currentScope(); + if (this.treatFunctionsAsVar) + { redeclared = scope$2.lexical.indexOf(name) > -1; } + else + { redeclared = scope$2.lexical.indexOf(name) > -1 || scope$2.var.indexOf(name) > -1; } + scope$2.functions.push(name); + } else { + for (var i = this.scopeStack.length - 1; i >= 0; --i) { + var scope$3 = this.scopeStack[i]; + if (scope$3.lexical.indexOf(name) > -1 && !((scope$3.flags & SCOPE_SIMPLE_CATCH) && scope$3.lexical[0] === name) || + !this.treatFunctionsAsVarInScope(scope$3) && scope$3.functions.indexOf(name) > -1) { + redeclared = true; + break } + scope$3.var.push(name); + if (this.inModule && (scope$3.flags & SCOPE_TOP)) + { delete this.undefinedExports[name]; } + if (scope$3.flags & SCOPE_VAR) { break } + } } - _validateFlatMode(pages) { - const pagesWithoutId = pages.filter((page) => page.id === undefined); - if (pagesWithoutId.length === 0) { - throw new ShouldUseIdModeException_1.ShouldUseIdModeException(`There are no pages without id. You should use ID mode instead of FLAT mode`); - } - if (this._rootPageId === undefined) { - throw new RootPageRequiredException_1.RootPageRequiredException(ConfluenceSyncPages_types_1.SyncModes.FLAT); - } - const pagesWithAncestors = pages.filter((page) => page.ancestors !== undefined && page.ancestors.length > 0); - if (pagesWithAncestors.length > 0) { - throw new NotAncestorsExpectedValidationError_1.NotAncestorsExpectedValidationError(pagesWithAncestors); - } + if (redeclared) { this.raiseRecoverable(pos, ("Identifier '" + name + "' has already been declared")); } + }; + + pp$3.checkLocalExport = function(id) { + // scope.functions must be empty as Module code is always strict. + if (this.scopeStack[0].lexical.indexOf(id.name) === -1 && + this.scopeStack[0].var.indexOf(id.name) === -1) { + this.undefinedExports[id.name] = id; } - _assertPendingPagesToCreate(tasksDone, _pages) { - const createdOrUpdatedPages = tasksDone - .filter((task) => task.type === "create" || task.type === "update") - .map((task) => task.page.title); - const pendingPagesToCreate = _pages.filter((page) => !createdOrUpdatedPages.includes(page.title)); - if (pendingPagesToCreate.length > 0) { - const e = new PendingPagesToSyncError_1.PendingPagesToSyncError(pendingPagesToCreate); - this._logger.error(e.message); - throw e; - } - } - _reportTasks(tasks) { - const createdPages = tasks.filter((task) => task.type === "create"); - this._logger.debug(`Created pages: ${createdPages.length} - ${createdPages.map((task) => `+ ${task.page.title}`).join("\n")}`); - const updatedPages = tasks.filter((task) => task.type === "update"); - this._logger.debug(`Updated pages: ${updatedPages.length} - ${updatedPages.map((task) => `⟳ #${task.pageId} ${task.page.title}`).join("\n")}`); - const deletedPages = tasks.filter((task) => task.type === "delete"); - this._logger.debug(`Deleted pages: ${deletedPages.length} - ${deletedPages.map((task) => `- #${task.pageId}`).join("\n")}`); - this._logger.info("Sync finished"); - } - _handleTask(job) { - const task = job.task; - switch (task.type) { - case "init": - return this._initSync({ ...job, task }); - case "create": - return this._createPage({ ...job, task }); - case "update": - return this._updatePage({ ...job, task }); - case "delete": - return this._deletePage({ ...job, task }); - case "createAttachments": - return this._createAttachments({ ...job, task }); - case "deleteAttachments": - return this._deleteAttachments({ ...job, task }); - } - } - async _initSync(job) { - this._logger.debug(`Reading page ${job.task.pageId}`); - const confluencePage = await this._confluenceClient.getPage(job.task.pageId); - job.storeConfluencePage(confluencePage); - this._enqueueChildrenPages(job, confluencePage, true); - } - async _createPage(job) { - this._logger.debug(`Creating page ${JSON.stringify(job.task.page)}`); - const ancestors = job.task.page.ancestors?.map((ancestorTitle) => { - const ancestor = job.getConfluencePageByTitle(ancestorTitle); - // NOTE: This should never happen. Defensively check anyway. - // istanbul ignore next - if (ancestor === undefined) { - throw new Error(`Could not find ancestor ${ancestorTitle}`); - } - return { id: ancestor.id, title: ancestor.title }; - }); - const confluencePage = await this._confluenceClient.createPage({ - ...job.task.page, - ancestors, - }); - job.storeConfluencePage(confluencePage); - if (job.task.page.attachments !== undefined && - Object.entries(job.task.page.attachments).length > 0) - job.enqueueTask({ - type: "createAttachments", - pageId: confluencePage.id, - pageTitle: confluencePage.title, - attachments: job.task.page.attachments, - }); - const descendants = job.getPagesByAncestor(job.task.page.title); - for (const descendant of descendants) { - job.enqueueTask({ type: "create", page: descendant }); - } - } - async _updatePage(job) { - this._logger.debug(`Updating page ${job.task.page.title}`); - const confluencePage = await this._confluenceClient.getPage(job.task.pageId); - const updatedConfluencePage = await this._confluenceClient.updatePage({ - id: confluencePage.id, - title: job.task.page.title, - content: job.task.page.content, - ancestors: confluencePage.ancestors, - version: confluencePage.version + 1, - }); - job.storeConfluencePage(updatedConfluencePage); - const attachments = await this._confluenceClient.getAttachments(confluencePage.id); - for (const attachment of attachments) { - this._logger.debug(`Enqueueing delete attachment ${attachment.title} for page ${confluencePage.title}`); - job.enqueueTask({ type: "deleteAttachments", pageId: attachment.id }); - } - if (job.task.page.attachments !== undefined && - Object.entries(job.task.page.attachments).length > 0) { - job.enqueueTask({ - type: "createAttachments", - pageId: confluencePage.id, - pageTitle: confluencePage.title, - attachments: job.task.page.attachments, - }); - } - if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.TREE) { - this._enqueueChildrenPages(job, confluencePage); - } - } - async _deletePage(job) { - this._logger.debug(`Deleting page ${job.task.pageId}`); - const confluencePage = await this._confluenceClient.getPage(job.task.pageId); - for (const descendant of confluencePage.children ?? []) { - job.enqueueTask({ type: "delete", pageId: descendant.id }); - } - await this._confluenceClient.deleteContent(job.task.pageId); - } - async _deleteAttachments(job) { - this._logger.debug(`Deleting attachment ${job.task.pageId}`); - await this._confluenceClient.deleteContent(job.task.pageId); - } - async _createAttachments(job) { - this._logger.debug(`Creating attachments for page ${job.task.pageTitle}, attachments: ${JSON.stringify(job.task.attachments)}`); - const attachments = await Promise.all(Object.entries(job.task.attachments).map(async ([name, path]) => ({ - filename: name, - file: await (0, promises_1.readFile)(path), - }))); - await this._confluenceClient.createAttachments(job.task.pageId, attachments); - } - _enqueueChildrenPages(job, confluencePage, isRoot = false) { - const descendants = job.getPagesByAncestor(confluencePage.title, isRoot); - const confluenceDescendants = confluencePage.children ?? []; - let descendantsWithPageId = []; - if (isRoot) { - descendants.forEach((descendant) => { - descendant.ancestors = [confluencePage.title]; - }); - if (this._syncMode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { - const confluenceDescendantsInputPages = confluenceDescendants - .map(({ title }) => job.getPageByTitle(title)) - .filter(Boolean); - descendantsWithPageId = (0, Pages_1.getPagesTitles)(confluenceDescendantsInputPages.filter((page) => page.id !== undefined)); - if (descendantsWithPageId.length) - this._logger.warn(`Some children of root page contains id: ${descendantsWithPageId.join(", ")}`); - } - } - const descendantsToCreate = descendants.filter((descendant) => !confluenceDescendants.some((other) => other.title === descendant.title)); - const descendantsToUpdate = confluenceDescendants - .filter((descendant) => descendants.some((other) => other.title === descendant.title)) - .map((descendant) => { - const page = job.getPageByTitle(descendant.title); - return { pageId: descendant.id, page }; - }); - const descendantsToDelete = confluenceDescendants.filter((descendant) => !descendants.some((other) => other.title === descendant.title) && - !descendantsWithPageId.includes(descendant.title)); - for (const descendant of descendantsToDelete) { - job.enqueueTask({ type: "delete", pageId: descendant.id }); - } - for (const descendant of descendantsToCreate) { - job.enqueueTask({ type: "create", page: descendant }); - } - for (const descendant of descendantsToUpdate) { - job.enqueueTask({ - type: "update", - pageId: descendant.pageId, - page: descendant.page, - }); - } - } -}; -exports.ConfluenceSyncPages = ConfluenceSyncPages; + }; + pp$3.currentScope = function() { + return this.scopeStack[this.scopeStack.length - 1] + }; -/***/ }), + pp$3.currentVarScope = function() { + for (var i = this.scopeStack.length - 1;; i--) { + var scope = this.scopeStack[i]; + if (scope.flags & SCOPE_VAR) { return scope } + } + }; -/***/ 37054: -/***/ ((__unused_webpack_module, exports) => { + // Could be useful for `this`, `new.target`, `super()`, `super.property`, and `super[property]`. + pp$3.currentThisScope = function() { + for (var i = this.scopeStack.length - 1;; i--) { + var scope = this.scopeStack[i]; + if (scope.flags & SCOPE_VAR && !(scope.flags & SCOPE_ARROW)) { return scope } + } + }; + var Node = function Node(parser, pos, loc) { + this.type = ""; + this.start = pos; + this.end = 0; + if (parser.options.locations) + { this.loc = new SourceLocation(parser, loc); } + if (parser.options.directSourceFile) + { this.sourceFile = parser.options.directSourceFile; } + if (parser.options.ranges) + { this.range = [pos, 0]; } + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SyncModes = void 0; -var SyncModes; -(function (SyncModes) { - SyncModes["TREE"] = "tree"; - SyncModes["FLAT"] = "flat"; - SyncModes["ID"] = "id"; -})(SyncModes || (exports.SyncModes = SyncModes = {})); + // Start an AST node, attaching a start offset. + var pp$2 = Parser.prototype; -/***/ }), + pp$2.startNode = function() { + return new Node(this, this.start, this.startLoc) + }; -/***/ 17303: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + pp$2.startNodeAt = function(pos, loc) { + return new Node(this, pos, loc) + }; + // Finish an AST node, adding `type` and `end` properties. -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CustomConfluenceClient = void 0; -const confluence_js_1 = __nccwpck_require__(46920); -const AttachmentsNotFoundError_1 = __nccwpck_require__(20640); -const AxiosErrors_1 = __nccwpck_require__(75840); -const CreateAttachmentsError_1 = __nccwpck_require__(70773); -const CreatePageError_1 = __nccwpck_require__(76742); -const DeletePageError_1 = __nccwpck_require__(79323); -const PageNotFoundError_1 = __nccwpck_require__(58663); -const UpdatePageError_1 = __nccwpck_require__(80069); -const CustomConfluenceClient = class CustomConfluenceClient { - _config; - _client; - _logger; - constructor(config) { - this._config = config; - this._client = new confluence_js_1.ConfluenceClient({ - host: config.url, - authentication: { - personalAccessToken: config.personalAccessToken, - }, - apiPrefix: "/rest/", - }); - this._logger = config.logger; - } - // Exposed mainly for testing purposes - get logger() { - return this._logger; - } - async getPage(id) { - try { - this._logger.silly(`Getting page with id ${id}`); - const response = await this._client.content.getContentById({ - id, - expand: ["ancestors", "version.number", "children.page"], - }); - this._logger.silly(`Get page response: ${JSON.stringify(response, null, 2)}`); - return { - title: response.title, - id: response.id, - version: response.version?.number, - ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), - children: response.children?.page?.results?.map((child) => this._convertToConfluencePageBasicInfo(child)), - }; - } - catch (error) { - throw new PageNotFoundError_1.PageNotFoundError(id, { cause: error }); - } - } - async createPage({ title, content, ancestors, }) { - if (!this._config.dryRun) { - const createContentBody = { - type: "page", - title, - space: { - key: this._config.spaceId, - }, - ancestors: this.handleAncestors(ancestors), - body: { - storage: { - value: content || "", - representation: "storage", - }, - }, - }; - try { - this._logger.silly(`Creating page with title ${title}`); - const response = await this._client.content.createContent(createContentBody); - this._logger.silly(`Create page response: ${JSON.stringify(response, null, 2)}`); - return { - title: response.title, - id: response.id, - version: response.version?.number, - ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), - }; - } - catch (e) { - const error = (0, AxiosErrors_1.toConfluenceClientError)(e); - throw new CreatePageError_1.CreatePageError(title, { cause: error }); - } - } - else { - this._logger.info(`Dry run: creating page with title ${title}`); - return { - title, - id: "1234", - version: 1, - ancestors, - }; - } - } - async updatePage({ id, title, content, version, ancestors, }) { - if (!this._config.dryRun) { - const updateContentBody = { - id, - type: "page", - title, - ancestors: this.handleAncestors(ancestors), - version: { - number: version, - }, - body: { - storage: { - value: content || "", - representation: "storage", - }, - }, - }; - try { - this._logger.silly(`Updating page with title ${title}`); - const response = await this._client.content.updateContent(updateContentBody); - this._logger.silly(`Update page response: ${JSON.stringify(response, null, 2)}`); - return { - title: response.title, - id: response.id, - version: response.version?.number, - ancestors: response.ancestors?.map((ancestor) => this._convertToConfluencePageBasicInfo(ancestor)), - }; - } - catch (e) { - const error = (0, AxiosErrors_1.toConfluenceClientError)(e); - throw new UpdatePageError_1.UpdatePageError(id, title, { cause: error }); - } - } - else { - this._logger.info(`Dry run: updating page with title ${title}`); - return { - title, - id, - version, - ancestors, - }; - } - } - async deleteContent(id) { - if (!this._config.dryRun) { - try { - this._logger.silly(`Deleting content with id ${id}`); - await this._client.content.deleteContent({ id }); - } - catch (error) { - throw new DeletePageError_1.DeletePageError(id, { cause: error }); - } - } - else { - this._logger.info(`Dry run: deleting content with id ${id}`); - } - } - async getAttachments(id) { - try { - this._logger.silly(`Getting attachments of page with id ${id}`); - const response = await this._client.contentAttachments.getAttachments({ - id, - }); - this._logger.silly(`Get attachments response: ${JSON.stringify(response, null, 2)}`); - return (response.results?.map((attachment) => ({ - id: attachment.id, - title: attachment.title, - })) || []); - } - catch (error) { - throw new AttachmentsNotFoundError_1.AttachmentsNotFoundError(id, { cause: error }); - } - } - async createAttachments(id, attachments) { - if (!this._config.dryRun) { - try { - const bodyRequest = attachments.map((attachment) => ({ - minorEdit: true, - ...attachment, - })); - this._logger.silly(`Creating attachments of page with id ${id}, attachments: ${attachments - .map((attachment) => attachment.filename) - .join(", ")}`); - const response = await this._client.contentAttachments.createAttachments({ - id, - attachments: bodyRequest, - }); - this._logger.silly(`Create attachments response: ${JSON.stringify(response, null, 2)}`); - } - catch (error) { - throw new CreateAttachmentsError_1.CreateAttachmentsError(id, { cause: error }); - } - } - else { - this._logger - .info(`Dry run: creating attachments of page with id ${id}, attachments: ${attachments - .map((attachment) => attachment.filename) - .join(", ")} - `); - } - } - handleAncestors(ancestors) { - if (ancestors && ancestors.length) { - const id = ancestors.at(-1)?.id; - return [{ id }]; - } - else { - return undefined; - } - } - _convertToConfluencePageBasicInfo(rawInfo) { - return { - id: rawInfo.id, - title: rawInfo.title, - }; - } -}; -exports.CustomConfluenceClient = CustomConfluenceClient; + function finishNodeAt(node, type, pos, loc) { + node.type = type; + node.end = pos; + if (this.options.locations) + { node.loc.end = loc; } + if (this.options.ranges) + { node.range[1] = pos; } + return node + } + pp$2.finishNode = function(node, type) { + return finishNodeAt.call(this, node, type, this.lastTokEnd, this.lastTokEndLoc) + }; -/***/ }), + // Finish node at given position -/***/ 66464: -/***/ ((__unused_webpack_module, exports) => { + pp$2.finishNodeAt = function(node, type, pos, loc) { + return finishNodeAt.call(this, node, type, pos, loc) + }; + pp$2.copyNode = function(node) { + var newNode = new Node(this, node.start, this.startLoc); + for (var prop in node) { newNode[prop] = node[prop]; } + return newNode + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); + // This file was generated by "bin/generate-unicode-script-values.js". Do not modify manually! + var scriptValuesAddedInUnicode = "Gara Garay Gukh Gurung_Khema Hrkt Katakana_Or_Hiragana Kawi Kirat_Rai Krai Nag_Mundari Nagm Ol_Onal Onao Sunu Sunuwar Todhri Todr Tulu_Tigalari Tutg Unknown Zzzz"; + // This file contains Unicode properties extracted from the ECMAScript specification. + // The lists are extracted like so: + // $$('#table-binary-unicode-properties > figure > table > tbody > tr > td:nth-child(1) code').map(el => el.innerText) -/***/ }), + // #table-binary-unicode-properties + var ecma9BinaryProperties = "ASCII ASCII_Hex_Digit AHex Alphabetic Alpha Any Assigned Bidi_Control Bidi_C Bidi_Mirrored Bidi_M Case_Ignorable CI Cased Changes_When_Casefolded CWCF Changes_When_Casemapped CWCM Changes_When_Lowercased CWL Changes_When_NFKC_Casefolded CWKCF Changes_When_Titlecased CWT Changes_When_Uppercased CWU Dash Default_Ignorable_Code_Point DI Deprecated Dep Diacritic Dia Emoji Emoji_Component Emoji_Modifier Emoji_Modifier_Base Emoji_Presentation Extender Ext Grapheme_Base Gr_Base Grapheme_Extend Gr_Ext Hex_Digit Hex IDS_Binary_Operator IDSB IDS_Trinary_Operator IDST ID_Continue IDC ID_Start IDS Ideographic Ideo Join_Control Join_C Logical_Order_Exception LOE Lowercase Lower Math Noncharacter_Code_Point NChar Pattern_Syntax Pat_Syn Pattern_White_Space Pat_WS Quotation_Mark QMark Radical Regional_Indicator RI Sentence_Terminal STerm Soft_Dotted SD Terminal_Punctuation Term Unified_Ideograph UIdeo Uppercase Upper Variation_Selector VS White_Space space XID_Continue XIDC XID_Start XIDS"; + var ecma10BinaryProperties = ecma9BinaryProperties + " Extended_Pictographic"; + var ecma11BinaryProperties = ecma10BinaryProperties; + var ecma12BinaryProperties = ecma11BinaryProperties + " EBase EComp EMod EPres ExtPict"; + var ecma13BinaryProperties = ecma12BinaryProperties; + var ecma14BinaryProperties = ecma13BinaryProperties; -/***/ 20640: -/***/ ((__unused_webpack_module, exports) => { + var unicodeBinaryProperties = { + 9: ecma9BinaryProperties, + 10: ecma10BinaryProperties, + 11: ecma11BinaryProperties, + 12: ecma12BinaryProperties, + 13: ecma13BinaryProperties, + 14: ecma14BinaryProperties + }; + // #table-binary-unicode-properties-of-strings + var ecma14BinaryPropertiesOfStrings = "Basic_Emoji Emoji_Keycap_Sequence RGI_Emoji_Modifier_Sequence RGI_Emoji_Flag_Sequence RGI_Emoji_Tag_Sequence RGI_Emoji_ZWJ_Sequence RGI_Emoji"; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.AttachmentsNotFoundError = void 0; -class AttachmentsNotFoundError extends Error { - constructor(id, options) { - super(`Error getting attachments of page with id ${id}: ${options?.cause}`, options); - } -} -exports.AttachmentsNotFoundError = AttachmentsNotFoundError; + var unicodeBinaryPropertiesOfStrings = { + 9: "", + 10: "", + 11: "", + 12: "", + 13: "", + 14: ecma14BinaryPropertiesOfStrings + }; + // #table-unicode-general-category-values + var unicodeGeneralCategoryValues = "Cased_Letter LC Close_Punctuation Pe Connector_Punctuation Pc Control Cc cntrl Currency_Symbol Sc Dash_Punctuation Pd Decimal_Number Nd digit Enclosing_Mark Me Final_Punctuation Pf Format Cf Initial_Punctuation Pi Letter L Letter_Number Nl Line_Separator Zl Lowercase_Letter Ll Mark M Combining_Mark Math_Symbol Sm Modifier_Letter Lm Modifier_Symbol Sk Nonspacing_Mark Mn Number N Open_Punctuation Ps Other C Other_Letter Lo Other_Number No Other_Punctuation Po Other_Symbol So Paragraph_Separator Zp Private_Use Co Punctuation P punct Separator Z Space_Separator Zs Spacing_Mark Mc Surrogate Cs Symbol S Titlecase_Letter Lt Unassigned Cn Uppercase_Letter Lu"; -/***/ }), + // #table-unicode-script-values + var ecma9ScriptValues = "Adlam Adlm Ahom Anatolian_Hieroglyphs Hluw Arabic Arab Armenian Armn Avestan Avst Balinese Bali Bamum Bamu Bassa_Vah Bass Batak Batk Bengali Beng Bhaiksuki Bhks Bopomofo Bopo Brahmi Brah Braille Brai Buginese Bugi Buhid Buhd Canadian_Aboriginal Cans Carian Cari Caucasian_Albanian Aghb Chakma Cakm Cham Cham Cherokee Cher Common Zyyy Coptic Copt Qaac Cuneiform Xsux Cypriot Cprt Cyrillic Cyrl Deseret Dsrt Devanagari Deva Duployan Dupl Egyptian_Hieroglyphs Egyp Elbasan Elba Ethiopic Ethi Georgian Geor Glagolitic Glag Gothic Goth Grantha Gran Greek Grek Gujarati Gujr Gurmukhi Guru Han Hani Hangul Hang Hanunoo Hano Hatran Hatr Hebrew Hebr Hiragana Hira Imperial_Aramaic Armi Inherited Zinh Qaai Inscriptional_Pahlavi Phli Inscriptional_Parthian Prti Javanese Java Kaithi Kthi Kannada Knda Katakana Kana Kayah_Li Kali Kharoshthi Khar Khmer Khmr Khojki Khoj Khudawadi Sind Lao Laoo Latin Latn Lepcha Lepc Limbu Limb Linear_A Lina Linear_B Linb Lisu Lisu Lycian Lyci Lydian Lydi Mahajani Mahj Malayalam Mlym Mandaic Mand Manichaean Mani Marchen Marc Masaram_Gondi Gonm Meetei_Mayek Mtei Mende_Kikakui Mend Meroitic_Cursive Merc Meroitic_Hieroglyphs Mero Miao Plrd Modi Mongolian Mong Mro Mroo Multani Mult Myanmar Mymr Nabataean Nbat New_Tai_Lue Talu Newa Newa Nko Nkoo Nushu Nshu Ogham Ogam Ol_Chiki Olck Old_Hungarian Hung Old_Italic Ital Old_North_Arabian Narb Old_Permic Perm Old_Persian Xpeo Old_South_Arabian Sarb Old_Turkic Orkh Oriya Orya Osage Osge Osmanya Osma Pahawh_Hmong Hmng Palmyrene Palm Pau_Cin_Hau Pauc Phags_Pa Phag Phoenician Phnx Psalter_Pahlavi Phlp Rejang Rjng Runic Runr Samaritan Samr Saurashtra Saur Sharada Shrd Shavian Shaw Siddham Sidd SignWriting Sgnw Sinhala Sinh Sora_Sompeng Sora Soyombo Soyo Sundanese Sund Syloti_Nagri Sylo Syriac Syrc Tagalog Tglg Tagbanwa Tagb Tai_Le Tale Tai_Tham Lana Tai_Viet Tavt Takri Takr Tamil Taml Tangut Tang Telugu Telu Thaana Thaa Thai Thai Tibetan Tibt Tifinagh Tfng Tirhuta Tirh Ugaritic Ugar Vai Vaii Warang_Citi Wara Yi Yiii Zanabazar_Square Zanb"; + var ecma10ScriptValues = ecma9ScriptValues + " Dogra Dogr Gunjala_Gondi Gong Hanifi_Rohingya Rohg Makasar Maka Medefaidrin Medf Old_Sogdian Sogo Sogdian Sogd"; + var ecma11ScriptValues = ecma10ScriptValues + " Elymaic Elym Nandinagari Nand Nyiakeng_Puachue_Hmong Hmnp Wancho Wcho"; + var ecma12ScriptValues = ecma11ScriptValues + " Chorasmian Chrs Diak Dives_Akuru Khitan_Small_Script Kits Yezi Yezidi"; + var ecma13ScriptValues = ecma12ScriptValues + " Cypro_Minoan Cpmn Old_Uyghur Ougr Tangsa Tnsa Toto Vithkuqi Vith"; + var ecma14ScriptValues = ecma13ScriptValues + " " + scriptValuesAddedInUnicode; -/***/ 75840: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + var unicodeScriptValues = { + 9: ecma9ScriptValues, + 10: ecma10ScriptValues, + 11: ecma11ScriptValues, + 12: ecma12ScriptValues, + 13: ecma13ScriptValues, + 14: ecma14ScriptValues + }; + var data = {}; + function buildUnicodeData(ecmaVersion) { + var d = data[ecmaVersion] = { + binary: wordsRegexp(unicodeBinaryProperties[ecmaVersion] + " " + unicodeGeneralCategoryValues), + binaryOfStrings: wordsRegexp(unicodeBinaryPropertiesOfStrings[ecmaVersion]), + nonBinary: { + General_Category: wordsRegexp(unicodeGeneralCategoryValues), + Script: wordsRegexp(unicodeScriptValues[ecmaVersion]) + } + }; + d.nonBinary.Script_Extensions = d.nonBinary.Script; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.toConfluenceClientError = toConfluenceClientError; -const axios_1 = __nccwpck_require__(87269); -const BadRequestError_1 = __nccwpck_require__(84778); -const InternalServerError_1 = __nccwpck_require__(37988); -const UnauthorizedError_1 = __nccwpck_require__(55308); -const UnexpectedError_1 = __nccwpck_require__(10115); -const UnknownAxiosError_1 = __nccwpck_require__(53918); -function toConfluenceClientError(error) { - if (error.name === "AxiosError") { - const axiosError = error; - if (axiosError.response?.status === axios_1.HttpStatusCode.BadRequest) { - return new BadRequestError_1.BadRequestError(axiosError); - } - if (axiosError.response?.status === axios_1.HttpStatusCode.Unauthorized || - axiosError.response?.status === axios_1.HttpStatusCode.Forbidden) { - return new UnauthorizedError_1.UnauthorizedError(axiosError); - } - if (axiosError.response?.status === axios_1.HttpStatusCode.InternalServerError) { - return new InternalServerError_1.InternalServerError(axiosError); - } - return new UnknownAxiosError_1.UnknownAxiosError(axiosError); - } - return new UnexpectedError_1.UnexpectedError(error); -} + d.nonBinary.gc = d.nonBinary.General_Category; + d.nonBinary.sc = d.nonBinary.Script; + d.nonBinary.scx = d.nonBinary.Script_Extensions; + } + for (var i = 0, list = [9, 10, 11, 12, 13, 14]; i < list.length; i += 1) { + var ecmaVersion = list[i]; -/***/ }), + buildUnicodeData(ecmaVersion); + } -/***/ 70773: -/***/ ((__unused_webpack_module, exports) => { + var pp$1 = Parser.prototype; + // Track disjunction structure to determine whether a duplicate + // capture group name is allowed because it is in a separate branch. + var BranchID = function BranchID(parent, base) { + // Parent disjunction branch + this.parent = parent; + // Identifies this set of sibling branches + this.base = base || this; + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CreateAttachmentsError = void 0; -class CreateAttachmentsError extends Error { - constructor(id, options) { - super(`Error creating attachments of page with id ${id}: ${options?.cause}`, options); + BranchID.prototype.separatedFrom = function separatedFrom (alt) { + // A branch is separate from another branch if they or any of + // their parents are siblings in a given disjunction + for (var self = this; self; self = self.parent) { + for (var other = alt; other; other = other.parent) { + if (self.base === other.base && self !== other) { return true } + } } -} -exports.CreateAttachmentsError = CreateAttachmentsError; - - -/***/ }), + return false + }; -/***/ 76742: -/***/ ((__unused_webpack_module, exports) => { + BranchID.prototype.sibling = function sibling () { + return new BranchID(this.parent, this.base) + }; + var RegExpValidationState = function RegExpValidationState(parser) { + this.parser = parser; + this.validFlags = "gim" + (parser.options.ecmaVersion >= 6 ? "uy" : "") + (parser.options.ecmaVersion >= 9 ? "s" : "") + (parser.options.ecmaVersion >= 13 ? "d" : "") + (parser.options.ecmaVersion >= 15 ? "v" : ""); + this.unicodeProperties = data[parser.options.ecmaVersion >= 14 ? 14 : parser.options.ecmaVersion]; + this.source = ""; + this.flags = ""; + this.start = 0; + this.switchU = false; + this.switchV = false; + this.switchN = false; + this.pos = 0; + this.lastIntValue = 0; + this.lastStringValue = ""; + this.lastAssertionIsQuantifiable = false; + this.numCapturingParens = 0; + this.maxBackReference = 0; + this.groupNames = Object.create(null); + this.backReferenceNames = []; + this.branchID = null; + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CreatePageError = void 0; -class CreatePageError extends Error { - constructor(title, options) { - super(`Error creating page with title ${title}: ${options?.cause}`, options); + RegExpValidationState.prototype.reset = function reset (start, pattern, flags) { + var unicodeSets = flags.indexOf("v") !== -1; + var unicode = flags.indexOf("u") !== -1; + this.start = start | 0; + this.source = pattern + ""; + this.flags = flags; + if (unicodeSets && this.parser.options.ecmaVersion >= 15) { + this.switchU = true; + this.switchV = true; + this.switchN = true; + } else { + this.switchU = unicode && this.parser.options.ecmaVersion >= 6; + this.switchV = false; + this.switchN = unicode && this.parser.options.ecmaVersion >= 9; } -} -exports.CreatePageError = CreatePageError; - - -/***/ }), + }; -/***/ 79323: -/***/ ((__unused_webpack_module, exports) => { + RegExpValidationState.prototype.raise = function raise (message) { + this.parser.raiseRecoverable(this.start, ("Invalid regular expression: /" + (this.source) + "/: " + message)); + }; + // If u flag is given, this returns the code point at the index (it combines a surrogate pair). + // Otherwise, this returns the code unit of the index (can be a part of a surrogate pair). + RegExpValidationState.prototype.at = function at (i, forceU) { + if ( forceU === void 0 ) forceU = false; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.DeletePageError = void 0; -class DeletePageError extends Error { - constructor(id, options) { - super(`Error deleting content with id ${id}: ${options?.cause}`, options); + var s = this.source; + var l = s.length; + if (i >= l) { + return -1 } -} -exports.DeletePageError = DeletePageError; - - -/***/ }), - -/***/ 58663: -/***/ ((__unused_webpack_module, exports) => { - - -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PageNotFoundError = void 0; -class PageNotFoundError extends Error { - constructor(id, options) { - super(`Error getting page with id ${id}: ${options?.cause}`, options); + var c = s.charCodeAt(i); + if (!(forceU || this.switchU) || c <= 0xD7FF || c >= 0xE000 || i + 1 >= l) { + return c } -} -exports.PageNotFoundError = PageNotFoundError; - - -/***/ }), - -/***/ 80069: -/***/ ((__unused_webpack_module, exports) => { + var next = s.charCodeAt(i + 1); + return next >= 0xDC00 && next <= 0xDFFF ? (c << 10) + next - 0x35FDC00 : c + }; + RegExpValidationState.prototype.nextIndex = function nextIndex (i, forceU) { + if ( forceU === void 0 ) forceU = false; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UpdatePageError = void 0; -class UpdatePageError extends Error { - constructor(id, title, options) { - super(`Error updating page with id ${id} and title ${title}: ${options?.cause}`, options); + var s = this.source; + var l = s.length; + if (i >= l) { + return l } -} -exports.UpdatePageError = UpdatePageError; - - -/***/ }), - -/***/ 84778: -/***/ ((__unused_webpack_module, exports) => { - - -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.BadRequestError = void 0; -class BadRequestError extends Error { - constructor(error) { - super(`Bad Request - Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); + var c = s.charCodeAt(i), next; + if (!(forceU || this.switchU) || c <= 0xD7FF || c >= 0xE000 || i + 1 >= l || + (next = s.charCodeAt(i + 1)) < 0xDC00 || next > 0xDFFF) { + return i + 1 } -} -exports.BadRequestError = BadRequestError; - - -/***/ }), + return i + 2 + }; -/***/ 37988: -/***/ ((__unused_webpack_module, exports) => { + RegExpValidationState.prototype.current = function current (forceU) { + if ( forceU === void 0 ) forceU = false; + return this.at(this.pos, forceU) + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InternalServerError = void 0; -class InternalServerError extends Error { - constructor(error) { - super(`Internal Server Error - Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); - } -} -exports.InternalServerError = InternalServerError; + RegExpValidationState.prototype.lookahead = function lookahead (forceU) { + if ( forceU === void 0 ) forceU = false; + return this.at(this.nextIndex(this.pos, forceU), forceU) + }; -/***/ }), + RegExpValidationState.prototype.advance = function advance (forceU) { + if ( forceU === void 0 ) forceU = false; -/***/ 55308: -/***/ ((__unused_webpack_module, exports) => { + this.pos = this.nextIndex(this.pos, forceU); + }; + RegExpValidationState.prototype.eat = function eat (ch, forceU) { + if ( forceU === void 0 ) forceU = false; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UnauthorizedError = void 0; -class UnauthorizedError extends Error { - constructor(error) { - super(`Unauthorized - Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); + if (this.current(forceU) === ch) { + this.advance(forceU); + return true } -} -exports.UnauthorizedError = UnauthorizedError; - - -/***/ }), + return false + }; -/***/ 10115: -/***/ ((__unused_webpack_module, exports) => { + RegExpValidationState.prototype.eatChars = function eatChars (chs, forceU) { + if ( forceU === void 0 ) forceU = false; + var pos = this.pos; + for (var i = 0, list = chs; i < list.length; i += 1) { + var ch = list[i]; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UnexpectedError = void 0; -class UnexpectedError extends Error { - constructor(error) { - super(`Unexpected Error: ${error}`); + var current = this.at(pos, forceU); + if (current === -1 || current !== ch) { + return false + } + pos = this.nextIndex(pos, forceU); } -} -exports.UnexpectedError = UnexpectedError; - - -/***/ }), + this.pos = pos; + return true + }; -/***/ 53918: -/***/ ((__unused_webpack_module, exports) => { + /** + * Validate the flags part of a given RegExpLiteral. + * + * @param {RegExpValidationState} state The state to validate RegExp. + * @returns {void} + */ + pp$1.validateRegExpFlags = function(state) { + var validFlags = state.validFlags; + var flags = state.flags; + var u = false; + var v = false; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.UnknownAxiosError = void 0; -class UnknownAxiosError extends Error { - constructor(error) { - super(`Axios Error - Response: ${JSON.stringify(error.response?.data, null, 2)}`, { cause: error }); + for (var i = 0; i < flags.length; i++) { + var flag = flags.charAt(i); + if (validFlags.indexOf(flag) === -1) { + this.raise(state.start, "Invalid regular expression flag"); + } + if (flags.indexOf(flag, i + 1) > -1) { + this.raise(state.start, "Duplicate regular expression flag"); + } + if (flag === "u") { u = true; } + if (flag === "v") { v = true; } } -} -exports.UnknownAxiosError = UnknownAxiosError; - - -/***/ }), + if (this.options.ecmaVersion >= 15 && u && v) { + this.raise(state.start, "Invalid regular expression flag"); + } + }; -/***/ 21840: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + function hasProp(obj) { + for (var _ in obj) { return true } + return false + } + /** + * Validate the pattern part of a given RegExpLiteral. + * + * @param {RegExpValidationState} state The state to validate RegExp. + * @returns {void} + */ + pp$1.validateRegExpPattern = function(state) { + this.regexp_pattern(state); -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; + // The goal symbol for the parse is |Pattern[~U, ~N]|. If the result of + // parsing contains a |GroupName|, reparse with the goal symbol + // |Pattern[~U, +N]| and use this result instead. Throw a *SyntaxError* + // exception if _P_ did not conform to the grammar, if any elements of _P_ + // were not matched by the parse, or if any Early Error conditions exist. + if (!state.switchN && this.options.ecmaVersion >= 9 && hasProp(state.groupNames)) { + state.switchN = true; + this.regexp_pattern(state); } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __exportStar = (this && this.__exportStar) || function(m, exports) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -__exportStar(__nccwpck_require__(66464), exports); - - -/***/ }), + }; -/***/ 41589: -/***/ ((__unused_webpack_module, exports) => { + // https://www.ecma-international.org/ecma-262/8.0/#prod-Pattern + pp$1.regexp_pattern = function(state) { + state.pos = 0; + state.lastIntValue = 0; + state.lastStringValue = ""; + state.lastAssertionIsQuantifiable = false; + state.numCapturingParens = 0; + state.maxBackReference = 0; + state.groupNames = Object.create(null); + state.backReferenceNames.length = 0; + state.branchID = null; + this.regexp_disjunction(state); -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.CompoundError = void 0; -class CompoundError extends Error { - errors; - constructor(...errors) { - super(errors.map((error) => error.message).join("\n")); - this.errors = errors; + if (state.pos !== state.source.length) { + // Make the same messages as V8. + if (state.eat(0x29 /* ) */)) { + state.raise("Unmatched ')'"); + } + if (state.eat(0x5D /* ] */) || state.eat(0x7D /* } */)) { + state.raise("Lone quantifier brackets"); + } } -} -exports.CompoundError = CompoundError; + if (state.maxBackReference > state.numCapturingParens) { + state.raise("Invalid escape"); + } + for (var i = 0, list = state.backReferenceNames; i < list.length; i += 1) { + var name = list[i]; + if (!state.groupNames[name]) { + state.raise("Invalid named capture referenced"); + } + } + }; -/***/ }), + // https://www.ecma-international.org/ecma-262/8.0/#prod-Disjunction + pp$1.regexp_disjunction = function(state) { + var trackDisjunction = this.options.ecmaVersion >= 16; + if (trackDisjunction) { state.branchID = new BranchID(state.branchID, null); } + this.regexp_alternative(state); + while (state.eat(0x7C /* | */)) { + if (trackDisjunction) { state.branchID = state.branchID.sibling(); } + this.regexp_alternative(state); + } + if (trackDisjunction) { state.branchID = state.branchID.parent; } -/***/ 12230: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // Make the same message as V8. + if (this.regexp_eatQuantifier(state, true)) { + state.raise("Nothing to repeat"); + } + if (state.eat(0x7B /* { */)) { + state.raise("Lone quantifier brackets"); + } + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-Alternative + pp$1.regexp_alternative = function(state) { + while (state.pos < state.source.length && this.regexp_eatTerm(state)) {} + }; -// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.InvalidSyncModeException = void 0; -const ConfluenceSyncPages_types_1 = __nccwpck_require__(37054); -class InvalidSyncModeException extends Error { - constructor(syncMode, options) { - super(`Invalid sync mode "${syncMode}". Please use one of "${ConfluenceSyncPages_types_1.SyncModes.FLAT}", "${ConfluenceSyncPages_types_1.SyncModes.TREE}" or "${ConfluenceSyncPages_types_1.SyncModes.ID}"`, options); + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-Term + pp$1.regexp_eatTerm = function(state) { + if (this.regexp_eatAssertion(state)) { + // Handle `QuantifiableAssertion Quantifier` alternative. + // `state.lastAssertionIsQuantifiable` is true if the last eaten Assertion + // is a QuantifiableAssertion. + if (state.lastAssertionIsQuantifiable && this.regexp_eatQuantifier(state)) { + // Make the same message as V8. + if (state.switchU) { + state.raise("Invalid quantifier"); + } + } + return true } -} -exports.InvalidSyncModeException = InvalidSyncModeException; - -/***/ }), + if (state.switchU ? this.regexp_eatAtom(state) : this.regexp_eatExtendedAtom(state)) { + this.regexp_eatQuantifier(state); + return true + } -/***/ 94732: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + return false + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-Assertion + pp$1.regexp_eatAssertion = function(state) { + var start = state.pos; + state.lastAssertionIsQuantifiable = false; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.NotAncestorsExpectedValidationError = void 0; -const Pages_1 = __nccwpck_require__(81410); -class NotAncestorsExpectedValidationError extends Error { - constructor(pagesWithAncestors, options) { - super(`Pages with ancestors are not supported in FLAT sync mode: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pagesWithAncestors)}`, options); + // ^, $ + if (state.eat(0x5E /* ^ */) || state.eat(0x24 /* $ */)) { + return true } -} -exports.NotAncestorsExpectedValidationError = NotAncestorsExpectedValidationError; + // \b \B + if (state.eat(0x5C /* \ */)) { + if (state.eat(0x42 /* B */) || state.eat(0x62 /* b */)) { + return true + } + state.pos = start; + } -/***/ }), + // Lookahead / Lookbehind + if (state.eat(0x28 /* ( */) && state.eat(0x3F /* ? */)) { + var lookbehind = false; + if (this.options.ecmaVersion >= 9) { + lookbehind = state.eat(0x3C /* < */); + } + if (state.eat(0x3D /* = */) || state.eat(0x21 /* ! */)) { + this.regexp_disjunction(state); + if (!state.eat(0x29 /* ) */)) { + state.raise("Unterminated group"); + } + state.lastAssertionIsQuantifiable = !lookbehind; + return true + } + } -/***/ 58334: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + state.pos = start; + return false + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-Quantifier + pp$1.regexp_eatQuantifier = function(state, noError) { + if ( noError === void 0 ) noError = false; -// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PagesWithoutIdException = void 0; -const Pages_1 = __nccwpck_require__(81410); -class PagesWithoutIdException extends Error { - constructor(pagesWithoutId, options) { - super(`You are using ID mode and there are pages without id: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pagesWithoutId)}`, options); + if (this.regexp_eatQuantifierPrefix(state, noError)) { + state.eat(0x3F /* ? */); + return true } -} -exports.PagesWithoutIdException = PagesWithoutIdException; - - -/***/ }), + return false + }; -/***/ 99947: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - - -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.PendingPagesToSyncError = void 0; -const Pages_1 = __nccwpck_require__(81410); -class PendingPagesToSyncError extends Error { - constructor(pendingPagesToSync, options) { - super(`There still are ${pendingPagesToSync.length} pages to create after sync: ${(0, Pages_1.getPagesTitlesCommaSeparated)(pendingPagesToSync)}, check if they have their ancestors created.`, options); + // https://www.ecma-international.org/ecma-262/8.0/#prod-QuantifierPrefix + pp$1.regexp_eatQuantifierPrefix = function(state, noError) { + return ( + state.eat(0x2A /* * */) || + state.eat(0x2B /* + */) || + state.eat(0x3F /* ? */) || + this.regexp_eatBracedQuantifier(state, noError) + ) + }; + pp$1.regexp_eatBracedQuantifier = function(state, noError) { + var start = state.pos; + if (state.eat(0x7B /* { */)) { + var min = 0, max = -1; + if (this.regexp_eatDecimalDigits(state)) { + min = state.lastIntValue; + if (state.eat(0x2C /* , */) && this.regexp_eatDecimalDigits(state)) { + max = state.lastIntValue; + } + if (state.eat(0x7D /* } */)) { + // SyntaxError in https://www.ecma-international.org/ecma-262/8.0/#sec-term + if (max !== -1 && max < min && !noError) { + state.raise("numbers out of order in {} quantifier"); + } + return true + } + } + if (state.switchU && !noError) { + state.raise("Incomplete quantifier"); + } + state.pos = start; } -} -exports.PendingPagesToSyncError = PendingPagesToSyncError; - - -/***/ }), + return false + }; -/***/ 27023: -/***/ ((__unused_webpack_module, exports) => { + // https://www.ecma-international.org/ecma-262/8.0/#prod-Atom + pp$1.regexp_eatAtom = function(state) { + return ( + this.regexp_eatPatternCharacters(state) || + state.eat(0x2E /* . */) || + this.regexp_eatReverseSolidusAtomEscape(state) || + this.regexp_eatCharacterClass(state) || + this.regexp_eatUncapturingGroup(state) || + this.regexp_eatCapturingGroup(state) + ) + }; + pp$1.regexp_eatReverseSolidusAtomEscape = function(state) { + var start = state.pos; + if (state.eat(0x5C /* \ */)) { + if (this.regexp_eatAtomEscape(state)) { + return true + } + state.pos = start; + } + return false + }; + pp$1.regexp_eatUncapturingGroup = function(state) { + var start = state.pos; + if (state.eat(0x28 /* ( */)) { + if (state.eat(0x3F /* ? */)) { + if (this.options.ecmaVersion >= 16) { + var addModifiers = this.regexp_eatModifiers(state); + var hasHyphen = state.eat(0x2D /* - */); + if (addModifiers || hasHyphen) { + for (var i = 0; i < addModifiers.length; i++) { + var modifier = addModifiers.charAt(i); + if (addModifiers.indexOf(modifier, i + 1) > -1) { + state.raise("Duplicate regular expression modifiers"); + } + } + if (hasHyphen) { + var removeModifiers = this.regexp_eatModifiers(state); + if (!addModifiers && !removeModifiers && state.current() === 0x3A /* : */) { + state.raise("Invalid regular expression modifiers"); + } + for (var i$1 = 0; i$1 < removeModifiers.length; i$1++) { + var modifier$1 = removeModifiers.charAt(i$1); + if ( + removeModifiers.indexOf(modifier$1, i$1 + 1) > -1 || + addModifiers.indexOf(modifier$1) > -1 + ) { + state.raise("Duplicate regular expression modifiers"); + } + } + } + } + } + if (state.eat(0x3A /* : */)) { + this.regexp_disjunction(state); + if (state.eat(0x29 /* ) */)) { + return true + } + state.raise("Unterminated group"); + } + } + state.pos = start; + } + return false + }; + pp$1.regexp_eatCapturingGroup = function(state) { + if (state.eat(0x28 /* ( */)) { + if (this.options.ecmaVersion >= 9) { + this.regexp_groupSpecifier(state); + } else if (state.current() === 0x3F /* ? */) { + state.raise("Invalid group"); + } + this.regexp_disjunction(state); + if (state.eat(0x29 /* ) */)) { + state.numCapturingParens += 1; + return true + } + state.raise("Unterminated group"); + } + return false + }; + // RegularExpressionModifiers :: + // [empty] + // RegularExpressionModifiers RegularExpressionModifier + pp$1.regexp_eatModifiers = function(state) { + var modifiers = ""; + var ch = 0; + while ((ch = state.current()) !== -1 && isRegularExpressionModifier(ch)) { + modifiers += codePointToString(ch); + state.advance(); + } + return modifiers + }; + // RegularExpressionModifier :: one of + // `i` `m` `s` + function isRegularExpressionModifier(ch) { + return ch === 0x69 /* i */ || ch === 0x6d /* m */ || ch === 0x73 /* s */ + } + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-ExtendedAtom + pp$1.regexp_eatExtendedAtom = function(state) { + return ( + state.eat(0x2E /* . */) || + this.regexp_eatReverseSolidusAtomEscape(state) || + this.regexp_eatCharacterClass(state) || + this.regexp_eatUncapturingGroup(state) || + this.regexp_eatCapturingGroup(state) || + this.regexp_eatInvalidBracedQuantifier(state) || + this.regexp_eatExtendedPatternCharacter(state) + ) + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.RootPageForbiddenException = void 0; -class RootPageForbiddenException extends Error { - constructor(options) { - super("rootPageId option is not allowed in ID mode", options); + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-InvalidBracedQuantifier + pp$1.regexp_eatInvalidBracedQuantifier = function(state) { + if (this.regexp_eatBracedQuantifier(state, true)) { + state.raise("Nothing to repeat"); } -} -exports.RootPageForbiddenException = RootPageForbiddenException; + return false + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-SyntaxCharacter + pp$1.regexp_eatSyntaxCharacter = function(state) { + var ch = state.current(); + if (isSyntaxCharacter(ch)) { + state.lastIntValue = ch; + state.advance(); + return true + } + return false + }; + function isSyntaxCharacter(ch) { + return ( + ch === 0x24 /* $ */ || + ch >= 0x28 /* ( */ && ch <= 0x2B /* + */ || + ch === 0x2E /* . */ || + ch === 0x3F /* ? */ || + ch >= 0x5B /* [ */ && ch <= 0x5E /* ^ */ || + ch >= 0x7B /* { */ && ch <= 0x7D /* } */ + ) + } -/***/ }), + // https://www.ecma-international.org/ecma-262/8.0/#prod-PatternCharacter + // But eat eager. + pp$1.regexp_eatPatternCharacters = function(state) { + var start = state.pos; + var ch = 0; + while ((ch = state.current()) !== -1 && !isSyntaxCharacter(ch)) { + state.advance(); + } + return state.pos !== start + }; -/***/ 52623: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-ExtendedPatternCharacter + pp$1.regexp_eatExtendedPatternCharacter = function(state) { + var ch = state.current(); + if ( + ch !== -1 && + ch !== 0x24 /* $ */ && + !(ch >= 0x28 /* ( */ && ch <= 0x2B /* + */) && + ch !== 0x2E /* . */ && + ch !== 0x3F /* ? */ && + ch !== 0x5B /* [ */ && + ch !== 0x5E /* ^ */ && + ch !== 0x7C /* | */ + ) { + state.advance(); + return true + } + return false + }; + // GroupSpecifier :: + // [empty] + // `?` GroupName + pp$1.regexp_groupSpecifier = function(state) { + if (state.eat(0x3F /* ? */)) { + if (!this.regexp_eatGroupName(state)) { state.raise("Invalid group"); } + var trackDisjunction = this.options.ecmaVersion >= 16; + var known = state.groupNames[state.lastStringValue]; + if (known) { + if (trackDisjunction) { + for (var i = 0, list = known; i < list.length; i += 1) { + var altID = list[i]; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.RootPageRequiredException = void 0; -const ConfluenceSyncPages_types_1 = __nccwpck_require__(37054); -class RootPageRequiredException extends Error { - constructor(mode, options) { - /* istanbul ignore else */ - if (mode === ConfluenceSyncPages_types_1.SyncModes.TREE) { - super("rootPageId is required for TREE sync mode", options); - } - else if (mode === ConfluenceSyncPages_types_1.SyncModes.FLAT) { - super("rootPageId is required for FLAT sync mode", options); - } - else { - /* istanbul ignore next */ - super("Unknown sync mode", options); + if (!altID.separatedFrom(state.branchID)) + { state.raise("Duplicate capture group name"); } + } + } else { + state.raise("Duplicate capture group name"); } + } + if (trackDisjunction) { + (known || (state.groupNames[state.lastStringValue] = [])).push(state.branchID); + } else { + state.groupNames[state.lastStringValue] = true; + } } -} -exports.RootPageRequiredException = RootPageRequiredException; - - -/***/ }), - -/***/ 51851: -/***/ ((__unused_webpack_module, exports) => { + }; + // GroupName :: + // `<` RegExpIdentifierName `>` + // Note: this updates `state.lastStringValue` property with the eaten name. + pp$1.regexp_eatGroupName = function(state) { + state.lastStringValue = ""; + if (state.eat(0x3C /* < */)) { + if (this.regexp_eatRegExpIdentifierName(state) && state.eat(0x3E /* > */)) { + return true + } + state.raise("Invalid capture group name"); + } + return false + }; -// SPDX-FileCopyrightText: 2025 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.ShouldUseIdModeException = void 0; -class ShouldUseIdModeException extends Error { - constructor(message, options) { - super(message, options); + // RegExpIdentifierName :: + // RegExpIdentifierStart + // RegExpIdentifierName RegExpIdentifierPart + // Note: this updates `state.lastStringValue` property with the eaten name. + pp$1.regexp_eatRegExpIdentifierName = function(state) { + state.lastStringValue = ""; + if (this.regexp_eatRegExpIdentifierStart(state)) { + state.lastStringValue += codePointToString(state.lastIntValue); + while (this.regexp_eatRegExpIdentifierPart(state)) { + state.lastStringValue += codePointToString(state.lastIntValue); + } + return true } -} -exports.ShouldUseIdModeException = ShouldUseIdModeException; + return false + }; + // RegExpIdentifierStart :: + // UnicodeIDStart + // `$` + // `_` + // `\` RegExpUnicodeEscapeSequence[+U] + pp$1.regexp_eatRegExpIdentifierStart = function(state) { + var start = state.pos; + var forceU = this.options.ecmaVersion >= 11; + var ch = state.current(forceU); + state.advance(forceU); -/***/ }), + if (ch === 0x5C /* \ */ && this.regexp_eatRegExpUnicodeEscapeSequence(state, forceU)) { + ch = state.lastIntValue; + } + if (isRegExpIdentifierStart(ch)) { + state.lastIntValue = ch; + return true + } -/***/ 10178: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + state.pos = start; + return false + }; + function isRegExpIdentifierStart(ch) { + return isIdentifierStart(ch, true) || ch === 0x24 /* $ */ || ch === 0x5F /* _ */ + } + // RegExpIdentifierPart :: + // UnicodeIDContinue + // `$` + // `_` + // `\` RegExpUnicodeEscapeSequence[+U] + // + // + pp$1.regexp_eatRegExpIdentifierPart = function(state) { + var start = state.pos; + var forceU = this.options.ecmaVersion >= 11; + var ch = state.current(forceU); + state.advance(forceU); -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; + if (ch === 0x5C /* \ */ && this.regexp_eatRegExpUnicodeEscapeSequence(state, forceU)) { + ch = state.lastIntValue; + } + if (isRegExpIdentifierPart(ch)) { + state.lastIntValue = ch; + return true } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __exportStar = (this && this.__exportStar) || function(m, exports) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -__exportStar(__nccwpck_require__(1023), exports); -__exportStar(__nccwpck_require__(44477), exports); + state.pos = start; + return false + }; + function isRegExpIdentifierPart(ch) { + return isIdentifierChar(ch, true) || ch === 0x24 /* $ */ || ch === 0x5F /* _ */ || ch === 0x200C /* */ || ch === 0x200D /* */ + } -/***/ }), + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-AtomEscape + pp$1.regexp_eatAtomEscape = function(state) { + if ( + this.regexp_eatBackReference(state) || + this.regexp_eatCharacterClassEscape(state) || + this.regexp_eatCharacterEscape(state) || + (state.switchN && this.regexp_eatKGroupName(state)) + ) { + return true + } + if (state.switchU) { + // Make the same message as V8. + if (state.current() === 0x63 /* c */) { + state.raise("Invalid unicode escape"); + } + state.raise("Invalid escape"); + } + return false + }; + pp$1.regexp_eatBackReference = function(state) { + var start = state.pos; + if (this.regexp_eatDecimalEscape(state)) { + var n = state.lastIntValue; + if (state.switchU) { + // For SyntaxError in https://www.ecma-international.org/ecma-262/8.0/#sec-atomescape + if (n > state.maxBackReference) { + state.maxBackReference = n; + } + return true + } + if (n <= state.numCapturingParens) { + return true + } + state.pos = start; + } + return false + }; + pp$1.regexp_eatKGroupName = function(state) { + if (state.eat(0x6B /* k */)) { + if (this.regexp_eatGroupName(state)) { + state.backReferenceNames.push(state.lastStringValue); + return true + } + state.raise("Invalid named reference"); + } + return false + }; -/***/ 81410: -/***/ ((__unused_webpack_module, exports) => { + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-CharacterEscape + pp$1.regexp_eatCharacterEscape = function(state) { + return ( + this.regexp_eatControlEscape(state) || + this.regexp_eatCControlLetter(state) || + this.regexp_eatZero(state) || + this.regexp_eatHexEscapeSequence(state) || + this.regexp_eatRegExpUnicodeEscapeSequence(state, false) || + (!state.switchU && this.regexp_eatLegacyOctalEscapeSequence(state)) || + this.regexp_eatIdentityEscape(state) + ) + }; + pp$1.regexp_eatCControlLetter = function(state) { + var start = state.pos; + if (state.eat(0x63 /* c */)) { + if (this.regexp_eatControlLetter(state)) { + return true + } + state.pos = start; + } + return false + }; + pp$1.regexp_eatZero = function(state) { + if (state.current() === 0x30 /* 0 */ && !isDecimalDigit(state.lookahead())) { + state.lastIntValue = 0; + state.advance(); + return true + } + return false + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-ControlEscape + pp$1.regexp_eatControlEscape = function(state) { + var ch = state.current(); + if (ch === 0x74 /* t */) { + state.lastIntValue = 0x09; /* \t */ + state.advance(); + return true + } + if (ch === 0x6E /* n */) { + state.lastIntValue = 0x0A; /* \n */ + state.advance(); + return true + } + if (ch === 0x76 /* v */) { + state.lastIntValue = 0x0B; /* \v */ + state.advance(); + return true + } + if (ch === 0x66 /* f */) { + state.lastIntValue = 0x0C; /* \f */ + state.advance(); + return true + } + if (ch === 0x72 /* r */) { + state.lastIntValue = 0x0D; /* \r */ + state.advance(); + return true + } + return false + }; -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.getPagesTitles = getPagesTitles; -exports.getPagesTitlesCommaSeparated = getPagesTitlesCommaSeparated; -function getPagesTitles(pages) { - return pages.map((page) => page.title); -} -function getPagesTitlesCommaSeparated(pages) { - return getPagesTitles(pages).join(", "); -} + // https://www.ecma-international.org/ecma-262/8.0/#prod-ControlLetter + pp$1.regexp_eatControlLetter = function(state) { + var ch = state.current(); + if (isControlLetter(ch)) { + state.lastIntValue = ch % 0x20; + state.advance(); + return true + } + return false + }; + function isControlLetter(ch) { + return ( + (ch >= 0x41 /* A */ && ch <= 0x5A /* Z */) || + (ch >= 0x61 /* a */ && ch <= 0x7A /* z */) + ) + } + // https://www.ecma-international.org/ecma-262/8.0/#prod-RegExpUnicodeEscapeSequence + pp$1.regexp_eatRegExpUnicodeEscapeSequence = function(state, forceU) { + if ( forceU === void 0 ) forceU = false; -/***/ }), + var start = state.pos; + var switchU = forceU || state.switchU; -/***/ 1023: -/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + if (state.eat(0x75 /* u */)) { + if (this.regexp_eatFixedHexDigits(state, 4)) { + var lead = state.lastIntValue; + if (switchU && lead >= 0xD800 && lead <= 0xDBFF) { + var leadSurrogateEnd = state.pos; + if (state.eat(0x5C /* \ */) && state.eat(0x75 /* u */) && this.regexp_eatFixedHexDigits(state, 4)) { + var trail = state.lastIntValue; + if (trail >= 0xDC00 && trail <= 0xDFFF) { + state.lastIntValue = (lead - 0xD800) * 0x400 + (trail - 0xDC00) + 0x10000; + return true + } + } + state.pos = leadSurrogateEnd; + state.lastIntValue = lead; + } + return true + } + if ( + switchU && + state.eat(0x7B /* { */) && + this.regexp_eatHexDigits(state) && + state.eat(0x7D /* } */) && + isValidUnicode(state.lastIntValue) + ) { + return true + } + if (switchU) { + state.raise("Invalid unicode escape"); + } + state.pos = start; + } + return false + }; + function isValidUnicode(ch) { + return ch >= 0 && ch <= 0x10FFFF + } -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - var desc = Object.getOwnPropertyDescriptor(m, k); - if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { - desc = { enumerable: true, get: function() { return m[k]; } }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-IdentityEscape + pp$1.regexp_eatIdentityEscape = function(state) { + if (state.switchU) { + if (this.regexp_eatSyntaxCharacter(state)) { + return true + } + if (state.eat(0x2F /* / */)) { + state.lastIntValue = 0x2F; /* / */ + return true + } + return false } - Object.defineProperty(o, k2, desc); -}) : (function(o, m, k, k2) { - if (k2 === undefined) k2 = k; - o[k2] = m[k]; -})); -var __exportStar = (this && this.__exportStar) || function(m, exports) { - for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(exports, p)) __createBinding(exports, m, p); -}; -Object.defineProperty(exports, "__esModule", ({ value: true })); -exports.SyncModes = void 0; -var ConfluenceSyncPages_types_1 = __nccwpck_require__(37054); -Object.defineProperty(exports, "SyncModes", ({ enumerable: true, get: function () { return ConfluenceSyncPages_types_1.SyncModes; } })); -__exportStar(__nccwpck_require__(21840), exports); + var ch = state.current(); + if (ch !== 0x63 /* c */ && (!state.switchN || ch !== 0x6B /* k */)) { + state.lastIntValue = ch; + state.advance(); + return true + } -/***/ }), + return false + }; -/***/ 57528: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + // https://www.ecma-international.org/ecma-262/8.0/#prod-DecimalEscape + pp$1.regexp_eatDecimalEscape = function(state) { + state.lastIntValue = 0; + var ch = state.current(); + if (ch >= 0x31 /* 1 */ && ch <= 0x39 /* 9 */) { + do { + state.lastIntValue = 10 * state.lastIntValue + (ch - 0x30 /* 0 */); + state.advance(); + } while ((ch = state.current()) >= 0x30 /* 0 */ && ch <= 0x39 /* 9 */) + return true + } + return false + }; -const isexe = __nccwpck_require__(72940) -const { join, delimiter, sep, posix } = __nccwpck_require__(16928) + // Return values used by character set parsing methods, needed to + // forbid negation of sets that can match strings. + var CharSetNone = 0; // Nothing parsed + var CharSetOk = 1; // Construct parsed, cannot contain strings + var CharSetString = 2; // Construct parsed, can contain strings -const isWindows = process.platform === 'win32' + // https://www.ecma-international.org/ecma-262/8.0/#prod-CharacterClassEscape + pp$1.regexp_eatCharacterClassEscape = function(state) { + var ch = state.current(); -// used to check for slashed in commands passed in. always checks for the posix -// seperator on all platforms, and checks for the current separator when not on -// a posix platform. don't use the isWindows check for this since that is mocked -// in tests but we still need the code to actually work when called. that is also -// why it is ignored from coverage. -/* istanbul ignore next */ -const rSlash = new RegExp(`[${posix.sep}${sep === posix.sep ? '' : sep}]`.replace(/(\\)/g, '\\$1')) -const rRel = new RegExp(`^\\.${rSlash.source}`) + if (isCharacterClassEscape(ch)) { + state.lastIntValue = -1; + state.advance(); + return CharSetOk + } -const getNotFoundError = (cmd) => - Object.assign(new Error(`not found: ${cmd}`), { code: 'ENOENT' }) + var negate = false; + if ( + state.switchU && + this.options.ecmaVersion >= 9 && + ((negate = ch === 0x50 /* P */) || ch === 0x70 /* p */) + ) { + state.lastIntValue = -1; + state.advance(); + var result; + if ( + state.eat(0x7B /* { */) && + (result = this.regexp_eatUnicodePropertyValueExpression(state)) && + state.eat(0x7D /* } */) + ) { + if (negate && result === CharSetString) { state.raise("Invalid property name"); } + return result + } + state.raise("Invalid property name"); + } -const getPathInfo = (cmd, { - path: optPath = process.env.PATH, - pathExt: optPathExt = process.env.PATHEXT, - delimiter: optDelimiter = delimiter, -}) => { - // If it has a slash, then we don't bother searching the pathenv. - // just check the file itself, and that's it. - const pathEnv = cmd.match(rSlash) ? [''] : [ - // windows always checks the cwd first - ...(isWindows ? [process.cwd()] : []), - ...(optPath || /* istanbul ignore next: very unusual */ '').split(optDelimiter), - ] + return CharSetNone + }; - if (isWindows) { - const pathExtExe = optPathExt || - ['.EXE', '.CMD', '.BAT', '.COM'].join(optDelimiter) - const pathExt = pathExtExe.split(optDelimiter).reduce((acc, item) => { - acc.push(item) - acc.push(item.toLowerCase()) - return acc - }, []) - if (cmd.includes('.') && pathExt[0] !== '') { - pathExt.unshift('') - } - return { pathEnv, pathExt, pathExtExe } + function isCharacterClassEscape(ch) { + return ( + ch === 0x64 /* d */ || + ch === 0x44 /* D */ || + ch === 0x73 /* s */ || + ch === 0x53 /* S */ || + ch === 0x77 /* w */ || + ch === 0x57 /* W */ + ) } - return { pathEnv, pathExt: [''] } -} + // UnicodePropertyValueExpression :: + // UnicodePropertyName `=` UnicodePropertyValue + // LoneUnicodePropertyNameOrValue + pp$1.regexp_eatUnicodePropertyValueExpression = function(state) { + var start = state.pos; -const getPathPart = (raw, cmd) => { - const pathPart = /^".*"$/.test(raw) ? raw.slice(1, -1) : raw - const prefix = !pathPart && rRel.test(cmd) ? cmd.slice(0, 2) : '' - return prefix + join(pathPart, cmd) -} + // UnicodePropertyName `=` UnicodePropertyValue + if (this.regexp_eatUnicodePropertyName(state) && state.eat(0x3D /* = */)) { + var name = state.lastStringValue; + if (this.regexp_eatUnicodePropertyValue(state)) { + var value = state.lastStringValue; + this.regexp_validateUnicodePropertyNameAndValue(state, name, value); + return CharSetOk + } + } + state.pos = start; -const which = async (cmd, opt = {}) => { - const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt) - const found = [] + // LoneUnicodePropertyNameOrValue + if (this.regexp_eatLoneUnicodePropertyNameOrValue(state)) { + var nameOrValue = state.lastStringValue; + return this.regexp_validateUnicodePropertyNameOrValue(state, nameOrValue) + } + return CharSetNone + }; - for (const envPart of pathEnv) { - const p = getPathPart(envPart, cmd) + pp$1.regexp_validateUnicodePropertyNameAndValue = function(state, name, value) { + if (!hasOwn(state.unicodeProperties.nonBinary, name)) + { state.raise("Invalid property name"); } + if (!state.unicodeProperties.nonBinary[name].test(value)) + { state.raise("Invalid property value"); } + }; - for (const ext of pathExt) { - const withExt = p + ext - const is = await isexe(withExt, { pathExt: pathExtExe, ignoreErrors: true }) - if (is) { - if (!opt.all) { - return withExt - } - found.push(withExt) - } + pp$1.regexp_validateUnicodePropertyNameOrValue = function(state, nameOrValue) { + if (state.unicodeProperties.binary.test(nameOrValue)) { return CharSetOk } + if (state.switchV && state.unicodeProperties.binaryOfStrings.test(nameOrValue)) { return CharSetString } + state.raise("Invalid property name"); + }; + + // UnicodePropertyName :: + // UnicodePropertyNameCharacters + pp$1.regexp_eatUnicodePropertyName = function(state) { + var ch = 0; + state.lastStringValue = ""; + while (isUnicodePropertyNameCharacter(ch = state.current())) { + state.lastStringValue += codePointToString(ch); + state.advance(); } - } + return state.lastStringValue !== "" + }; - if (opt.all && found.length) { - return found + function isUnicodePropertyNameCharacter(ch) { + return isControlLetter(ch) || ch === 0x5F /* _ */ } - if (opt.nothrow) { - return null + // UnicodePropertyValue :: + // UnicodePropertyValueCharacters + pp$1.regexp_eatUnicodePropertyValue = function(state) { + var ch = 0; + state.lastStringValue = ""; + while (isUnicodePropertyValueCharacter(ch = state.current())) { + state.lastStringValue += codePointToString(ch); + state.advance(); + } + return state.lastStringValue !== "" + }; + function isUnicodePropertyValueCharacter(ch) { + return isUnicodePropertyNameCharacter(ch) || isDecimalDigit(ch) } - throw getNotFoundError(cmd) -} + // LoneUnicodePropertyNameOrValue :: + // UnicodePropertyValueCharacters + pp$1.regexp_eatLoneUnicodePropertyNameOrValue = function(state) { + return this.regexp_eatUnicodePropertyValue(state) + }; -const whichSync = (cmd, opt = {}) => { - const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt) - const found = [] + // https://www.ecma-international.org/ecma-262/8.0/#prod-CharacterClass + pp$1.regexp_eatCharacterClass = function(state) { + if (state.eat(0x5B /* [ */)) { + var negate = state.eat(0x5E /* ^ */); + var result = this.regexp_classContents(state); + if (!state.eat(0x5D /* ] */)) + { state.raise("Unterminated character class"); } + if (negate && result === CharSetString) + { state.raise("Negated character class may contain strings"); } + return true + } + return false + }; - for (const pathEnvPart of pathEnv) { - const p = getPathPart(pathEnvPart, cmd) + // https://tc39.es/ecma262/#prod-ClassContents + // https://www.ecma-international.org/ecma-262/8.0/#prod-ClassRanges + pp$1.regexp_classContents = function(state) { + if (state.current() === 0x5D /* ] */) { return CharSetOk } + if (state.switchV) { return this.regexp_classSetExpression(state) } + this.regexp_nonEmptyClassRanges(state); + return CharSetOk + }; - for (const ext of pathExt) { - const withExt = p + ext - const is = isexe.sync(withExt, { pathExt: pathExtExe, ignoreErrors: true }) - if (is) { - if (!opt.all) { - return withExt + // https://www.ecma-international.org/ecma-262/8.0/#prod-NonemptyClassRanges + // https://www.ecma-international.org/ecma-262/8.0/#prod-NonemptyClassRangesNoDash + pp$1.regexp_nonEmptyClassRanges = function(state) { + while (this.regexp_eatClassAtom(state)) { + var left = state.lastIntValue; + if (state.eat(0x2D /* - */) && this.regexp_eatClassAtom(state)) { + var right = state.lastIntValue; + if (state.switchU && (left === -1 || right === -1)) { + state.raise("Invalid character class"); + } + if (left !== -1 && right !== -1 && left > right) { + state.raise("Range out of order in character class"); } - found.push(withExt) } } - } + }; - if (opt.all && found.length) { - return found - } + // https://www.ecma-international.org/ecma-262/8.0/#prod-ClassAtom + // https://www.ecma-international.org/ecma-262/8.0/#prod-ClassAtomNoDash + pp$1.regexp_eatClassAtom = function(state) { + var start = state.pos; - if (opt.nothrow) { - return null - } + if (state.eat(0x5C /* \ */)) { + if (this.regexp_eatClassEscape(state)) { + return true + } + if (state.switchU) { + // Make the same message as V8. + var ch$1 = state.current(); + if (ch$1 === 0x63 /* c */ || isOctalDigit(ch$1)) { + state.raise("Invalid class escape"); + } + state.raise("Invalid escape"); + } + state.pos = start; + } - throw getNotFoundError(cmd) -} + var ch = state.current(); + if (ch !== 0x5D /* ] */) { + state.lastIntValue = ch; + state.advance(); + return true + } -module.exports = which -which.sync = whichSync + return false + }; + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-ClassEscape + pp$1.regexp_eatClassEscape = function(state) { + var start = state.pos; -/***/ }), + if (state.eat(0x62 /* b */)) { + state.lastIntValue = 0x08; /* */ + return true + } -/***/ 83637: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + if (state.switchU && state.eat(0x2D /* - */)) { + state.lastIntValue = 0x2D; /* - */ + return true + } + if (!state.switchU && state.eat(0x63 /* c */)) { + if (this.regexp_eatClassControlLetter(state)) { + return true + } + state.pos = start; + } + return ( + this.regexp_eatCharacterClassEscape(state) || + this.regexp_eatCharacterEscape(state) + ) + }; -const XHTMLEntities = __nccwpck_require__(35980); + // https://tc39.es/ecma262/#prod-ClassSetExpression + // https://tc39.es/ecma262/#prod-ClassUnion + // https://tc39.es/ecma262/#prod-ClassIntersection + // https://tc39.es/ecma262/#prod-ClassSubtraction + pp$1.regexp_classSetExpression = function(state) { + var result = CharSetOk, subResult; + if (this.regexp_eatClassSetRange(state)) ; else if (subResult = this.regexp_eatClassSetOperand(state)) { + if (subResult === CharSetString) { result = CharSetString; } + // https://tc39.es/ecma262/#prod-ClassIntersection + var start = state.pos; + while (state.eatChars([0x26, 0x26] /* && */)) { + if ( + state.current() !== 0x26 /* & */ && + (subResult = this.regexp_eatClassSetOperand(state)) + ) { + if (subResult !== CharSetString) { result = CharSetOk; } + continue + } + state.raise("Invalid character in character class"); + } + if (start !== state.pos) { return result } + // https://tc39.es/ecma262/#prod-ClassSubtraction + while (state.eatChars([0x2D, 0x2D] /* -- */)) { + if (this.regexp_eatClassSetOperand(state)) { continue } + state.raise("Invalid character in character class"); + } + if (start !== state.pos) { return result } + } else { + state.raise("Invalid character in character class"); + } + // https://tc39.es/ecma262/#prod-ClassUnion + for (;;) { + if (this.regexp_eatClassSetRange(state)) { continue } + subResult = this.regexp_eatClassSetOperand(state); + if (!subResult) { return result } + if (subResult === CharSetString) { result = CharSetString; } + } + }; -const hexNumber = /^[\da-fA-F]+$/; -const decimalNumber = /^\d+$/; + // https://tc39.es/ecma262/#prod-ClassSetRange + pp$1.regexp_eatClassSetRange = function(state) { + var start = state.pos; + if (this.regexp_eatClassSetCharacter(state)) { + var left = state.lastIntValue; + if (state.eat(0x2D /* - */) && this.regexp_eatClassSetCharacter(state)) { + var right = state.lastIntValue; + if (left !== -1 && right !== -1 && left > right) { + state.raise("Range out of order in character class"); + } + return true + } + state.pos = start; + } + return false + }; -// The map to `acorn-jsx` tokens from `acorn` namespace objects. -const acornJsxMap = new WeakMap(); + // https://tc39.es/ecma262/#prod-ClassSetOperand + pp$1.regexp_eatClassSetOperand = function(state) { + if (this.regexp_eatClassSetCharacter(state)) { return CharSetOk } + return this.regexp_eatClassStringDisjunction(state) || this.regexp_eatNestedClass(state) + }; -// Get the original tokens for the given `acorn` namespace object. -function getJsxTokens(acorn) { - acorn = acorn.Parser.acorn || acorn; - let acornJsx = acornJsxMap.get(acorn); - if (!acornJsx) { - const tt = acorn.tokTypes; - const TokContext = acorn.TokContext; - const TokenType = acorn.TokenType; - const tc_oTag = new TokContext('...', true, true); - const tokContexts = { - tc_oTag: tc_oTag, - tc_cTag: tc_cTag, - tc_expr: tc_expr - }; - const tokTypes = { - jsxName: new TokenType('jsxName'), - jsxText: new TokenType('jsxText', {beforeExpr: true}), - jsxTagStart: new TokenType('jsxTagStart', {startsExpr: true}), - jsxTagEnd: new TokenType('jsxTagEnd') - }; + // https://tc39.es/ecma262/#prod-NestedClass + pp$1.regexp_eatNestedClass = function(state) { + var start = state.pos; + if (state.eat(0x5B /* [ */)) { + var negate = state.eat(0x5E /* ^ */); + var result = this.regexp_classContents(state); + if (state.eat(0x5D /* ] */)) { + if (negate && result === CharSetString) { + state.raise("Negated character class may contain strings"); + } + return result + } + state.pos = start; + } + if (state.eat(0x5C /* \ */)) { + var result$1 = this.regexp_eatCharacterClassEscape(state); + if (result$1) { + return result$1 + } + state.pos = start; + } + return null + }; - tokTypes.jsxTagStart.updateContext = function() { - this.context.push(tc_expr); // treat as beginning of JSX expression - this.context.push(tc_oTag); // start opening tag context - this.exprAllowed = false; - }; - tokTypes.jsxTagEnd.updateContext = function(prevType) { - let out = this.context.pop(); - if (out === tc_oTag && prevType === tt.slash || out === tc_cTag) { - this.context.pop(); - this.exprAllowed = this.curContext() === tc_expr; + // https://tc39.es/ecma262/#prod-ClassStringDisjunction + pp$1.regexp_eatClassStringDisjunction = function(state) { + var start = state.pos; + if (state.eatChars([0x5C, 0x71] /* \q */)) { + if (state.eat(0x7B /* { */)) { + var result = this.regexp_classStringDisjunctionContents(state); + if (state.eat(0x7D /* } */)) { + return result + } } else { - this.exprAllowed = true; + // Make the same message as V8. + state.raise("Invalid escape"); } - }; + state.pos = start; + } + return null + }; - acornJsx = { tokContexts: tokContexts, tokTypes: tokTypes }; - acornJsxMap.set(acorn, acornJsx); - } + // https://tc39.es/ecma262/#prod-ClassStringDisjunctionContents + pp$1.regexp_classStringDisjunctionContents = function(state) { + var result = this.regexp_classString(state); + while (state.eat(0x7C /* | */)) { + if (this.regexp_classString(state) === CharSetString) { result = CharSetString; } + } + return result + }; - return acornJsx; -} + // https://tc39.es/ecma262/#prod-ClassString + // https://tc39.es/ecma262/#prod-NonEmptyClassString + pp$1.regexp_classString = function(state) { + var count = 0; + while (this.regexp_eatClassSetCharacter(state)) { count++; } + return count === 1 ? CharSetOk : CharSetString + }; -// Transforms JSX element name to string. + // https://tc39.es/ecma262/#prod-ClassSetCharacter + pp$1.regexp_eatClassSetCharacter = function(state) { + var start = state.pos; + if (state.eat(0x5C /* \ */)) { + if ( + this.regexp_eatCharacterEscape(state) || + this.regexp_eatClassSetReservedPunctuator(state) + ) { + return true + } + if (state.eat(0x62 /* b */)) { + state.lastIntValue = 0x08; /* */ + return true + } + state.pos = start; + return false + } + var ch = state.current(); + if (ch < 0 || ch === state.lookahead() && isClassSetReservedDoublePunctuatorCharacter(ch)) { return false } + if (isClassSetSyntaxCharacter(ch)) { return false } + state.advance(); + state.lastIntValue = ch; + return true + }; -function getQualifiedJSXName(object) { - if (!object) - return object; + // https://tc39.es/ecma262/#prod-ClassSetReservedDoublePunctuator + function isClassSetReservedDoublePunctuatorCharacter(ch) { + return ( + ch === 0x21 /* ! */ || + ch >= 0x23 /* # */ && ch <= 0x26 /* & */ || + ch >= 0x2A /* * */ && ch <= 0x2C /* , */ || + ch === 0x2E /* . */ || + ch >= 0x3A /* : */ && ch <= 0x40 /* @ */ || + ch === 0x5E /* ^ */ || + ch === 0x60 /* ` */ || + ch === 0x7E /* ~ */ + ) + } - if (object.type === 'JSXIdentifier') - return object.name; + // https://tc39.es/ecma262/#prod-ClassSetSyntaxCharacter + function isClassSetSyntaxCharacter(ch) { + return ( + ch === 0x28 /* ( */ || + ch === 0x29 /* ) */ || + ch === 0x2D /* - */ || + ch === 0x2F /* / */ || + ch >= 0x5B /* [ */ && ch <= 0x5D /* ] */ || + ch >= 0x7B /* { */ && ch <= 0x7D /* } */ + ) + } - if (object.type === 'JSXNamespacedName') - return object.namespace.name + ':' + object.name.name; + // https://tc39.es/ecma262/#prod-ClassSetReservedPunctuator + pp$1.regexp_eatClassSetReservedPunctuator = function(state) { + var ch = state.current(); + if (isClassSetReservedPunctuator(ch)) { + state.lastIntValue = ch; + state.advance(); + return true + } + return false + }; - if (object.type === 'JSXMemberExpression') - return getQualifiedJSXName(object.object) + '.' + - getQualifiedJSXName(object.property); -} + // https://tc39.es/ecma262/#prod-ClassSetReservedPunctuator + function isClassSetReservedPunctuator(ch) { + return ( + ch === 0x21 /* ! */ || + ch === 0x23 /* # */ || + ch === 0x25 /* % */ || + ch === 0x26 /* & */ || + ch === 0x2C /* , */ || + ch === 0x2D /* - */ || + ch >= 0x3A /* : */ && ch <= 0x3E /* > */ || + ch === 0x40 /* @ */ || + ch === 0x60 /* ` */ || + ch === 0x7E /* ~ */ + ) + } -module.exports = function(options) { - options = options || {}; - return function(Parser) { - return plugin({ - allowNamespaces: options.allowNamespaces !== false, - allowNamespacedObjects: !!options.allowNamespacedObjects - }, Parser); + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-ClassControlLetter + pp$1.regexp_eatClassControlLetter = function(state) { + var ch = state.current(); + if (isDecimalDigit(ch) || ch === 0x5F /* _ */) { + state.lastIntValue = ch % 0x20; + state.advance(); + return true + } + return false }; -}; -// This is `tokTypes` of the peer dep. -// This can be different instances from the actual `tokTypes` this plugin uses. -Object.defineProperty(module.exports, "tokTypes", ({ - get: function get_tokTypes() { - return getJsxTokens(__nccwpck_require__(90859)).tokTypes; - }, - configurable: true, - enumerable: true -})); + // https://www.ecma-international.org/ecma-262/8.0/#prod-HexEscapeSequence + pp$1.regexp_eatHexEscapeSequence = function(state) { + var start = state.pos; + if (state.eat(0x78 /* x */)) { + if (this.regexp_eatFixedHexDigits(state, 2)) { + return true + } + if (state.switchU) { + state.raise("Invalid escape"); + } + state.pos = start; + } + return false + }; -function plugin(options, Parser) { - const acorn = Parser.acorn || __nccwpck_require__(90859); - const acornJsx = getJsxTokens(acorn); - const tt = acorn.tokTypes; - const tok = acornJsx.tokTypes; - const tokContexts = acorn.tokContexts; - const tc_oTag = acornJsx.tokContexts.tc_oTag; - const tc_cTag = acornJsx.tokContexts.tc_cTag; - const tc_expr = acornJsx.tokContexts.tc_expr; - const isNewLine = acorn.isNewLine; - const isIdentifierStart = acorn.isIdentifierStart; - const isIdentifierChar = acorn.isIdentifierChar; + // https://www.ecma-international.org/ecma-262/8.0/#prod-DecimalDigits + pp$1.regexp_eatDecimalDigits = function(state) { + var start = state.pos; + var ch = 0; + state.lastIntValue = 0; + while (isDecimalDigit(ch = state.current())) { + state.lastIntValue = 10 * state.lastIntValue + (ch - 0x30 /* 0 */); + state.advance(); + } + return state.pos !== start + }; + function isDecimalDigit(ch) { + return ch >= 0x30 /* 0 */ && ch <= 0x39 /* 9 */ + } - return class extends Parser { - // Expose actual `tokTypes` and `tokContexts` to other plugins. - static get acornJsx() { - return acornJsx; + // https://www.ecma-international.org/ecma-262/8.0/#prod-HexDigits + pp$1.regexp_eatHexDigits = function(state) { + var start = state.pos; + var ch = 0; + state.lastIntValue = 0; + while (isHexDigit(ch = state.current())) { + state.lastIntValue = 16 * state.lastIntValue + hexToInt(ch); + state.advance(); + } + return state.pos !== start + }; + function isHexDigit(ch) { + return ( + (ch >= 0x30 /* 0 */ && ch <= 0x39 /* 9 */) || + (ch >= 0x41 /* A */ && ch <= 0x46 /* F */) || + (ch >= 0x61 /* a */ && ch <= 0x66 /* f */) + ) + } + function hexToInt(ch) { + if (ch >= 0x41 /* A */ && ch <= 0x46 /* F */) { + return 10 + (ch - 0x41 /* A */) + } + if (ch >= 0x61 /* a */ && ch <= 0x66 /* f */) { + return 10 + (ch - 0x61 /* a */) } + return ch - 0x30 /* 0 */ + } - // Reads inline JSX contents token. - jsx_readToken() { - let out = '', chunkStart = this.pos; - for (;;) { - if (this.pos >= this.input.length) - this.raise(this.start, 'Unterminated JSX contents'); - let ch = this.input.charCodeAt(this.pos); + // https://www.ecma-international.org/ecma-262/8.0/#prod-annexB-LegacyOctalEscapeSequence + // Allows only 0-377(octal) i.e. 0-255(decimal). + pp$1.regexp_eatLegacyOctalEscapeSequence = function(state) { + if (this.regexp_eatOctalDigit(state)) { + var n1 = state.lastIntValue; + if (this.regexp_eatOctalDigit(state)) { + var n2 = state.lastIntValue; + if (n1 <= 3 && this.regexp_eatOctalDigit(state)) { + state.lastIntValue = n1 * 64 + n2 * 8 + state.lastIntValue; + } else { + state.lastIntValue = n1 * 8 + n2; + } + } else { + state.lastIntValue = n1; + } + return true + } + return false + }; - switch (ch) { - case 60: // '<' - case 123: // '{' - if (this.pos === this.start) { - if (ch === 60 && this.exprAllowed) { - ++this.pos; - return this.finishToken(tok.jsxTagStart); - } - return this.getTokenFromCode(ch); - } - out += this.input.slice(chunkStart, this.pos); - return this.finishToken(tok.jsxText, out); + // https://www.ecma-international.org/ecma-262/8.0/#prod-OctalDigit + pp$1.regexp_eatOctalDigit = function(state) { + var ch = state.current(); + if (isOctalDigit(ch)) { + state.lastIntValue = ch - 0x30; /* 0 */ + state.advance(); + return true + } + state.lastIntValue = 0; + return false + }; + function isOctalDigit(ch) { + return ch >= 0x30 /* 0 */ && ch <= 0x37 /* 7 */ + } - case 38: // '&' - out += this.input.slice(chunkStart, this.pos); - out += this.jsx_readEntity(); - chunkStart = this.pos; - break; + // https://www.ecma-international.org/ecma-262/8.0/#prod-Hex4Digits + // https://www.ecma-international.org/ecma-262/8.0/#prod-HexDigit + // And HexDigit HexDigit in https://www.ecma-international.org/ecma-262/8.0/#prod-HexEscapeSequence + pp$1.regexp_eatFixedHexDigits = function(state, length) { + var start = state.pos; + state.lastIntValue = 0; + for (var i = 0; i < length; ++i) { + var ch = state.current(); + if (!isHexDigit(ch)) { + state.pos = start; + return false + } + state.lastIntValue = 16 * state.lastIntValue + hexToInt(ch); + state.advance(); + } + return true + }; - case 62: // '>' - case 125: // '}' - this.raise( - this.pos, - "Unexpected token `" + this.input[this.pos] + "`. Did you mean `" + - (ch === 62 ? ">" : "}") + "` or " + "`{\"" + this.input[this.pos] + "\"}" + "`?" - ); + // Object type used to represent tokens. Note that normally, tokens + // simply exist as properties on the parser object. This is only + // used for the onToken callback and the external tokenizer. - default: - if (isNewLine(ch)) { - out += this.input.slice(chunkStart, this.pos); - out += this.jsx_readNewLine(true); - chunkStart = this.pos; - } else { - ++this.pos; + var Token = function Token(p) { + this.type = p.type; + this.value = p.value; + this.start = p.start; + this.end = p.end; + if (p.options.locations) + { this.loc = new SourceLocation(p, p.startLoc, p.endLoc); } + if (p.options.ranges) + { this.range = [p.start, p.end]; } + }; + + // ## Tokenizer + + var pp = Parser.prototype; + + // Move to the next token + + pp.next = function(ignoreEscapeSequenceInKeyword) { + if (!ignoreEscapeSequenceInKeyword && this.type.keyword && this.containsEsc) + { this.raiseRecoverable(this.start, "Escape sequence in keyword " + this.type.keyword); } + if (this.options.onToken) + { this.options.onToken(new Token(this)); } + + this.lastTokEnd = this.end; + this.lastTokStart = this.start; + this.lastTokEndLoc = this.endLoc; + this.lastTokStartLoc = this.startLoc; + this.nextToken(); + }; + + pp.getToken = function() { + this.next(); + return new Token(this) + }; + + // If we're in an ES6 environment, make parsers iterable + if (typeof Symbol !== "undefined") + { pp[Symbol.iterator] = function() { + var this$1$1 = this; + + return { + next: function () { + var token = this$1$1.getToken(); + return { + done: token.type === types$1.eof, + value: token } } } - } + }; } - jsx_readNewLine(normalizeCRLF) { - let ch = this.input.charCodeAt(this.pos); - let out; - ++this.pos; - if (ch === 13 && this.input.charCodeAt(this.pos) === 10) { - ++this.pos; - out = normalizeCRLF ? '\n' : '\r\n'; - } else { - out = String.fromCharCode(ch); - } - if (this.options.locations) { + // Toggle strict mode. Re-reads the next number or string to please + // pedantic tests (`"use strict"; 010;` should fail). + + // Read a single token, updating the parser object's token-related + // properties. + + pp.nextToken = function() { + var curContext = this.curContext(); + if (!curContext || !curContext.preserveSpace) { this.skipSpace(); } + + this.start = this.pos; + if (this.options.locations) { this.startLoc = this.curPosition(); } + if (this.pos >= this.input.length) { return this.finishToken(types$1.eof) } + + if (curContext.override) { return curContext.override(this) } + else { this.readToken(this.fullCharCodeAtPos()); } + }; + + pp.readToken = function(code) { + // Identifier or keyword. '\uXXXX' sequences are allowed in + // identifiers, so '\' also dispatches to that. + if (isIdentifierStart(code, this.options.ecmaVersion >= 6) || code === 92 /* '\' */) + { return this.readWord() } + + return this.getTokenFromCode(code) + }; + + pp.fullCharCodeAtPos = function() { + var code = this.input.charCodeAt(this.pos); + if (code <= 0xd7ff || code >= 0xdc00) { return code } + var next = this.input.charCodeAt(this.pos + 1); + return next <= 0xdbff || next >= 0xe000 ? code : (code << 10) + next - 0x35fdc00 + }; + + pp.skipBlockComment = function() { + var startLoc = this.options.onComment && this.curPosition(); + var start = this.pos, end = this.input.indexOf("*/", this.pos += 2); + if (end === -1) { this.raise(this.pos - 2, "Unterminated comment"); } + this.pos = end + 2; + if (this.options.locations) { + for (var nextBreak = (void 0), pos = start; (nextBreak = nextLineBreak(this.input, pos, this.pos)) > -1;) { ++this.curLine; - this.lineStart = this.pos; + pos = this.lineStart = nextBreak; } + } + if (this.options.onComment) + { this.options.onComment(true, this.input.slice(start + 2, end), start, this.pos, + startLoc, this.curPosition()); } + }; - return out; + pp.skipLineComment = function(startSkip) { + var start = this.pos; + var startLoc = this.options.onComment && this.curPosition(); + var ch = this.input.charCodeAt(this.pos += startSkip); + while (this.pos < this.input.length && !isNewLine(ch)) { + ch = this.input.charCodeAt(++this.pos); } + if (this.options.onComment) + { this.options.onComment(false, this.input.slice(start + startSkip, this.pos), start, this.pos, + startLoc, this.curPosition()); } + }; - jsx_readString(quote) { - let out = '', chunkStart = ++this.pos; - for (;;) { - if (this.pos >= this.input.length) - this.raise(this.start, 'Unterminated string constant'); - let ch = this.input.charCodeAt(this.pos); - if (ch === quote) break; - if (ch === 38) { // '&' - out += this.input.slice(chunkStart, this.pos); - out += this.jsx_readEntity(); - chunkStart = this.pos; - } else if (isNewLine(ch)) { - out += this.input.slice(chunkStart, this.pos); - out += this.jsx_readNewLine(false); - chunkStart = this.pos; - } else { + // Called at the start of the parse and after every token. Skips + // whitespace and comments, and. + + pp.skipSpace = function() { + loop: while (this.pos < this.input.length) { + var ch = this.input.charCodeAt(this.pos); + switch (ch) { + case 32: case 160: // ' ' + ++this.pos; + break + case 13: + if (this.input.charCodeAt(this.pos + 1) === 10) { ++this.pos; } - } - out += this.input.slice(chunkStart, this.pos++); - return this.finishToken(tt.string, out); - } - - jsx_readEntity() { - let str = '', count = 0, entity; - let ch = this.input[this.pos]; - if (ch !== '&') - this.raise(this.pos, 'Entity must start with an ampersand'); - let startPos = ++this.pos; - while (this.pos < this.input.length && count++ < 10) { - ch = this.input[this.pos++]; - if (ch === ';') { - if (str[0] === '#') { - if (str[1] === 'x') { - str = str.substr(2); - if (hexNumber.test(str)) - entity = String.fromCharCode(parseInt(str, 16)); - } else { - str = str.substr(1); - if (decimalNumber.test(str)) - entity = String.fromCharCode(parseInt(str, 10)); - } - } else { - entity = XHTMLEntities[str]; - } - break; + case 10: case 8232: case 8233: + ++this.pos; + if (this.options.locations) { + ++this.curLine; + this.lineStart = this.pos; + } + break + case 47: // '/' + switch (this.input.charCodeAt(this.pos + 1)) { + case 42: // '*' + this.skipBlockComment(); + break + case 47: + this.skipLineComment(2); + break + default: + break loop + } + break + default: + if (ch > 8 && ch < 14 || ch >= 5760 && nonASCIIwhitespace.test(String.fromCharCode(ch))) { + ++this.pos; + } else { + break loop } - str += ch; - } - if (!entity) { - this.pos = startPos; - return '&'; } - return entity; } + }; - // Read a JSX identifier (valid tag or attribute name). - // - // Optimized version since JSX identifiers can't contain - // escape characters and so can be read as single slice. - // Also assumes that first character was already checked - // by isIdentifierStart in readToken. + // Called at the end of every token. Sets `end`, `val`, and + // maintains `context` and `exprAllowed`, and skips the space after + // the token, so that the next one's `start` will point at the + // right position. - jsx_readWord() { - let ch, start = this.pos; - do { - ch = this.input.charCodeAt(++this.pos); - } while (isIdentifierChar(ch) || ch === 45); // '-' - return this.finishToken(tok.jsxName, this.input.slice(start, this.pos)); - } + pp.finishToken = function(type, val) { + this.end = this.pos; + if (this.options.locations) { this.endLoc = this.curPosition(); } + var prevType = this.type; + this.type = type; + this.value = val; - // Parse next token as JSX identifier + this.updateContext(prevType); + }; - jsx_parseIdentifier() { - let node = this.startNode(); - if (this.type === tok.jsxName) - node.name = this.value; - else if (this.type.keyword) - node.name = this.type.keyword; - else - this.unexpected(); - this.next(); - return this.finishNode(node, 'JSXIdentifier'); + // ### Token reading + + // This is the function that is called to fetch the next token. It + // is somewhat obscure, because it works in character codes rather + // than characters, and because operator parsing has been inlined + // into it. + // + // All in the name of speed. + // + pp.readToken_dot = function() { + var next = this.input.charCodeAt(this.pos + 1); + if (next >= 48 && next <= 57) { return this.readNumber(true) } + var next2 = this.input.charCodeAt(this.pos + 2); + if (this.options.ecmaVersion >= 6 && next === 46 && next2 === 46) { // 46 = dot '.' + this.pos += 3; + return this.finishToken(types$1.ellipsis) + } else { + ++this.pos; + return this.finishToken(types$1.dot) } + }; - // Parse namespaced identifier. + pp.readToken_slash = function() { // '/' + var next = this.input.charCodeAt(this.pos + 1); + if (this.exprAllowed) { ++this.pos; return this.readRegexp() } + if (next === 61) { return this.finishOp(types$1.assign, 2) } + return this.finishOp(types$1.slash, 1) + }; - jsx_parseNamespacedName() { - let startPos = this.start, startLoc = this.startLoc; - let name = this.jsx_parseIdentifier(); - if (!options.allowNamespaces || !this.eat(tt.colon)) return name; - var node = this.startNodeAt(startPos, startLoc); - node.namespace = name; - node.name = this.jsx_parseIdentifier(); - return this.finishNode(node, 'JSXNamespacedName'); + pp.readToken_mult_modulo_exp = function(code) { // '%*' + var next = this.input.charCodeAt(this.pos + 1); + var size = 1; + var tokentype = code === 42 ? types$1.star : types$1.modulo; + + // exponentiation operator ** and **= + if (this.options.ecmaVersion >= 7 && code === 42 && next === 42) { + ++size; + tokentype = types$1.starstar; + next = this.input.charCodeAt(this.pos + 2); } - // Parses element name in any form - namespaced, member - // or single identifier. + if (next === 61) { return this.finishOp(types$1.assign, size + 1) } + return this.finishOp(tokentype, size) + }; - jsx_parseElementName() { - if (this.type === tok.jsxTagEnd) return ''; - let startPos = this.start, startLoc = this.startLoc; - let node = this.jsx_parseNamespacedName(); - if (this.type === tt.dot && node.type === 'JSXNamespacedName' && !options.allowNamespacedObjects) { - this.unexpected(); - } - while (this.eat(tt.dot)) { - let newNode = this.startNodeAt(startPos, startLoc); - newNode.object = node; - newNode.property = this.jsx_parseIdentifier(); - node = this.finishNode(newNode, 'JSXMemberExpression'); + pp.readToken_pipe_amp = function(code) { // '|&' + var next = this.input.charCodeAt(this.pos + 1); + if (next === code) { + if (this.options.ecmaVersion >= 12) { + var next2 = this.input.charCodeAt(this.pos + 2); + if (next2 === 61) { return this.finishOp(types$1.assign, 3) } } - return node; + return this.finishOp(code === 124 ? types$1.logicalOR : types$1.logicalAND, 2) } + if (next === 61) { return this.finishOp(types$1.assign, 2) } + return this.finishOp(code === 124 ? types$1.bitwiseOR : types$1.bitwiseAND, 1) + }; - // Parses any type of JSX attribute value. - - jsx_parseAttributeValue() { - switch (this.type) { - case tt.braceL: - let node = this.jsx_parseExpressionContainer(); - if (node.expression.type === 'JSXEmptyExpression') - this.raise(node.start, 'JSX attributes must only be assigned a non-empty expression'); - return node; - - case tok.jsxTagStart: - case tt.string: - return this.parseExprAtom(); + pp.readToken_caret = function() { // '^' + var next = this.input.charCodeAt(this.pos + 1); + if (next === 61) { return this.finishOp(types$1.assign, 2) } + return this.finishOp(types$1.bitwiseXOR, 1) + }; - default: - this.raise(this.start, 'JSX value should be either an expression or a quoted JSX text'); + pp.readToken_plus_min = function(code) { // '+-' + var next = this.input.charCodeAt(this.pos + 1); + if (next === code) { + if (next === 45 && !this.inModule && this.input.charCodeAt(this.pos + 2) === 62 && + (this.lastTokEnd === 0 || lineBreak.test(this.input.slice(this.lastTokEnd, this.pos)))) { + // A `-->` line comment + this.skipLineComment(3); + this.skipSpace(); + return this.nextToken() } + return this.finishOp(types$1.incDec, 2) } + if (next === 61) { return this.finishOp(types$1.assign, 2) } + return this.finishOp(types$1.plusMin, 1) + }; - // JSXEmptyExpression is unique type since it doesn't actually parse anything, - // and so it should start at the end of last read token (left brace) and finish - // at the beginning of the next one (right brace). + pp.readToken_lt_gt = function(code) { // '<>' + var next = this.input.charCodeAt(this.pos + 1); + var size = 1; + if (next === code) { + size = code === 62 && this.input.charCodeAt(this.pos + 2) === 62 ? 3 : 2; + if (this.input.charCodeAt(this.pos + size) === 61) { return this.finishOp(types$1.assign, size + 1) } + return this.finishOp(types$1.bitShift, size) + } + if (next === 33 && code === 60 && !this.inModule && this.input.charCodeAt(this.pos + 2) === 45 && + this.input.charCodeAt(this.pos + 3) === 45) { + // `` line comment - this.skipLineComment(3); - this.skipSpace(); - return this.nextToken() - } - return this.finishOp(types$1.incDec, 2) - } - if (next === 61) { return this.finishOp(types$1.assign, 2) } - return this.finishOp(types$1.plusMin, 1) - }; - pp.readToken_lt_gt = function(code) { // '<>' - var next = this.input.charCodeAt(this.pos + 1); - var size = 1; - if (next === code) { - size = code === 62 && this.input.charCodeAt(this.pos + 2) === 62 ? 3 : 2; - if (this.input.charCodeAt(this.pos + size) === 61) { return this.finishOp(types$1.assign, size + 1) } - return this.finishOp(types$1.bitShift, size) - } - if (next === 33 && code === 60 && !this.inModule && this.input.charCodeAt(this.pos + 2) === 45 && - this.input.charCodeAt(this.pos + 3) === 45) { - // `\n\n' - } - } - - return '\n\n' -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/node_modules/mdast-util-to-markdown/lib/util/indent-lines.js -/** - * @typedef {import('../types.js').IndentLines} IndentLines - */ - -const indent_lines_eol = /\r?\n|\r/g - -/** - * @type {IndentLines} - */ -function indent_lines_indentLines(value, map) { - /** @type {Array} */ - const result = [] - let start = 0 - let line = 0 - /** @type {RegExpExecArray | null} */ - let match - - while ((match = indent_lines_eol.exec(value))) { - one(value.slice(start, match.index)) - result.push(match[0]) - start = match.index + match[0].length - line++ - } - - one(value.slice(start)) - - return result.join('') - - /** - * @param {string} value - */ - function one(value) { - result.push(map(value, line, !value)) - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/node_modules/mdast-util-to-markdown/lib/util/pattern-compile.js -/** - * @typedef {import('../types.js').Unsafe} Unsafe - */ - -/** - * @param {Unsafe} pattern - * @returns {RegExp} - */ -function pattern_compile_patternCompile(pattern) { - if (!pattern._compiled) { - const before = - (pattern.atBreak ? '[\\r\\n][\\t ]*' : '') + - (pattern.before ? '(?:' + pattern.before + ')' : '') - - pattern._compiled = new RegExp( - (before ? '(' + before + ')' : '') + - (/[|\\{}()[\]^$+*?.-]/.test(pattern.character) ? '\\' : '') + - pattern.character + - (pattern.after ? '(?:' + pattern.after + ')' : ''), - 'g' - ) - } - - return pattern._compiled -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/node_modules/mdast-util-to-markdown/lib/util/pattern-in-scope.js -/** - * @typedef {import('../types.js').Unsafe} Unsafe - * @typedef {import('../types.js').ConstructName} ConstructName - */ - -/** - * @param {Array} stack - * @param {Unsafe} pattern - * @returns {boolean} - */ -function pattern_in_scope_patternInScope(stack, pattern) { - return ( - pattern_in_scope_listInScope(stack, pattern.inConstruct, true) && - !pattern_in_scope_listInScope(stack, pattern.notInConstruct, false) - ) -} - -/** - * @param {Array} stack - * @param {Unsafe['inConstruct']} list - * @param {boolean} none - * @returns {boolean} - */ -function pattern_in_scope_listInScope(stack, list, none) { - if (typeof list === 'string') { - list = [list] - } - - if (!list || list.length === 0) { - return none - } - - let index = -1 - - while (++index < list.length) { - if (stack.includes(list[index])) { - return true - } - } - - return false -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/node_modules/mdast-util-to-markdown/lib/util/safe.js -/** - * @typedef {import('../types.js').State} State - * @typedef {import('../types.js').SafeConfig} SafeConfig - */ - - - - -/** - * Make a string safe for embedding in markdown constructs. - * - * In markdown, almost all punctuation characters can, in certain cases, - * result in something. - * Whether they do is highly subjective to where they happen and in what - * they happen. - * - * To solve this, `mdast-util-to-markdown` tracks: - * - * * Characters before and after something; - * * What “constructs” we are in. - * - * This information is then used by this function to escape or encode - * special characters. - * - * @param {State} state - * Info passed around about the current state. - * @param {string | null | undefined} input - * Raw value to make safe. - * @param {SafeConfig} config - * Configuration. - * @returns {string} - * Serialized markdown safe for embedding. - */ -function safe_safe(state, input, config) { - const value = (config.before || '') + (input || '') + (config.after || '') - /** @type {Array} */ - const positions = [] - /** @type {Array} */ - const result = [] - /** @type {Record} */ - const infos = {} - let index = -1 - - while (++index < state.unsafe.length) { - const pattern = state.unsafe[index] - - if (!pattern_in_scope_patternInScope(state.stack, pattern)) { - continue - } - - const expression = pattern_compile_patternCompile(pattern) - /** @type {RegExpExecArray | null} */ - let match - - while ((match = expression.exec(value))) { - const before = 'before' in pattern || Boolean(pattern.atBreak) - const after = 'after' in pattern - const position = match.index + (before ? match[1].length : 0) - - if (positions.includes(position)) { - if (infos[position].before && !before) { - infos[position].before = false - } - - if (infos[position].after && !after) { - infos[position].after = false - } - } else { - positions.push(position) - infos[position] = {before, after} - } - } - } - - positions.sort(safe_numerical) - - let start = config.before ? config.before.length : 0 - const end = value.length - (config.after ? config.after.length : 0) - index = -1 - - while (++index < positions.length) { - const position = positions[index] - - // Character before or after matched: - if (position < start || position >= end) { - continue - } - - // If this character is supposed to be escaped because it has a condition on - // the next character, and the next character is definitly being escaped, - // then skip this escape. - if ( - (position + 1 < end && - positions[index + 1] === position + 1 && - infos[position].after && - !infos[position + 1].before && - !infos[position + 1].after) || - (positions[index - 1] === position - 1 && - infos[position].before && - !infos[position - 1].before && - !infos[position - 1].after) - ) { - continue - } - - if (start !== position) { - // If we have to use a character reference, an ampersand would be more - // correct, but as backslashes only care about punctuation, either will - // do the trick - result.push(safe_escapeBackslashes(value.slice(start, position), '\\')) - } - - start = position - - if ( - /[!-/:-@[-`{-~]/.test(value.charAt(position)) && - (!config.encode || !config.encode.includes(value.charAt(position))) - ) { - // Character escape. - result.push('\\') - } else { - // Character reference. - result.push( - '&#x' + value.charCodeAt(position).toString(16).toUpperCase() + ';' - ) - start++ - } - } - - result.push(safe_escapeBackslashes(value.slice(start, end), config.after)) - - return result.join('') -} - -/** - * @param {number} a - * @param {number} b - * @returns {number} - */ -function safe_numerical(a, b) { - return a - b -} - -/** - * @param {string} value - * @param {string} after - * @returns {string} - */ -function safe_escapeBackslashes(value, after) { - const expression = /\\(?=[!-/:-@[-`{-~])/g - /** @type {Array} */ - const positions = [] - /** @type {Array} */ - const results = [] - const whole = value + after - let index = -1 - let start = 0 - /** @type {RegExpExecArray | null} */ - let match - - while ((match = expression.exec(whole))) { - positions.push(match.index) - } - - while (++index < positions.length) { - if (start !== positions[index]) { - results.push(value.slice(start, positions[index])) - } - - results.push('\\') - start = positions[index] - } - - results.push(value.slice(start)) - - return results.join('') -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/node_modules/mdast-util-to-markdown/lib/util/track.js -/** - * @typedef {import('../types.js').CreateTracker} CreateTracker - * @typedef {import('../types.js').TrackCurrent} TrackCurrent - * @typedef {import('../types.js').TrackMove} TrackMove - * @typedef {import('../types.js').TrackShift} TrackShift - */ - -/** - * Track positional info in the output. - * - * @type {CreateTracker} - */ -function track_track(config) { - // Defaults are used to prevent crashes when older utilities somehow activate - // this code. - /* c8 ignore next 5 */ - const options = config || {} - const now = options.now || {} - let lineShift = options.lineShift || 0 - let line = now.line || 1 - let column = now.column || 1 - - return {move, current, shift} - - /** - * Get the current tracked info. - * - * @type {TrackCurrent} - */ - function current() { - return {now: {line, column}, lineShift} - } - - /** - * Define an increased line shift (the typical indent for lines). - * - * @type {TrackShift} - */ - function shift(value) { - lineShift += value - } - - /** - * Move past some generated markdown. - * - * @type {TrackMove} - */ - function move(input) { - // eslint-disable-next-line unicorn/prefer-default-parameters - const value = input || '' - const chunks = value.split(/\r?\n|\r/g) - const tail = chunks[chunks.length - 1] - line += chunks.length - 1 - column = - chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift - return value - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-footnote/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-gfm-footnote@1.0.2/node_modules/mdast-util-gfm-footnote/lib/index.js /** * @typedef {import('mdast').FootnoteReference} FootnoteReference * @typedef {import('mdast').FootnoteDefinition} FootnoteDefinition @@ -196680,7 +186391,7 @@ function exitFootnoteDefinitionLabelString(token) { this.stack[this.stack.length - 1] ) node.label = label - node.identifier = node_modules_micromark_util_normalize_identifier_normalizeIdentifier( + node.identifier = normalizeIdentifier( this.sliceSerialize(token) ).toLowerCase() } @@ -196719,7 +186430,7 @@ function exitFootnoteCallString(token) { this.stack[this.stack.length - 1] ) node.label = label - node.identifier = node_modules_micromark_util_normalize_identifier_normalizeIdentifier( + node.identifier = normalizeIdentifier( this.sliceSerialize(token) ).toLowerCase() } @@ -196737,12 +186448,12 @@ function exitFootnoteCall(token) { * @param {FootnoteReference} node */ function footnoteReference(node, _, context, safeOptions) { - const tracker = track_track(safeOptions) + const tracker = track(safeOptions) let value = tracker.move('[^') const exit = context.enter('footnoteReference') const subexit = context.enter('reference') value += tracker.move( - safe_safe(context, association_association(node), { + safe(context, association(node), { ...tracker.current(), before: value, after: ']' @@ -196764,12 +186475,12 @@ function footnoteReferencePeek() { * @param {FootnoteDefinition} node */ function footnoteDefinition(node, _, context, safeOptions) { - const tracker = track_track(safeOptions) + const tracker = track(safeOptions) let value = tracker.move('[^') const exit = context.enter('footnoteDefinition') const subexit = context.enter('label') value += tracker.move( - safe_safe(context, association_association(node), { + safe(context, association(node), { ...tracker.current(), before: value, after: ']' @@ -196781,7 +186492,7 @@ function footnoteDefinition(node, _, context, safeOptions) { ) tracker.shift(4) value += tracker.move( - indent_lines_indentLines(container_flow_containerFlow(node, context, tracker.current()), lib_map) + indentLines(containerFlow(node, context, tracker.current()), lib_map) ) exit() @@ -196797,166 +186508,7 @@ function lib_map(line, index, blank) { return (blank ? '' : ' ') + line } -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-strikethrough/node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js -/** - * @typedef {import('../types.js').Handle} Handle - * @typedef {import('../types.js').Info} Info - * @typedef {import('../types.js').Parent} Parent - * @typedef {import('../types.js').PhrasingContent} PhrasingContent - * @typedef {import('../types.js').State} State - */ - -/** - * Serialize the children of a parent that contains phrasing children. - * - * These children will be joined flush together. - * - * @param {Parent & {children: Array}} parent - * Parent of flow nodes. - * @param {State} state - * Info passed around about the current state. - * @param {Info} info - * Info on where we are in the document we are generating. - * @returns {string} - * Serialized children, joined together. - */ -function container_phrasing_containerPhrasing(parent, state, info) { - const indexStack = state.indexStack - const children = parent.children || [] - /** @type {Array} */ - const results = [] - let index = -1 - let before = info.before - - indexStack.push(-1) - let tracker = state.createTracker(info) - - while (++index < children.length) { - const child = children[index] - /** @type {string} */ - let after - - indexStack[indexStack.length - 1] = index - - if (index + 1 < children.length) { - /** @type {Handle} */ - // @ts-expect-error: hush, it’s actually a `zwitch`. - let handle = state.handle.handlers[children[index + 1].type] - /** @type {Handle} */ - // @ts-expect-error: hush, it’s actually a `zwitch`. - if (handle && handle.peek) handle = handle.peek - after = handle - ? handle(children[index + 1], parent, state, { - before: '', - after: '', - ...tracker.current() - }).charAt(0) - : '' - } else { - after = info.after - } - - // In some cases, html (text) can be found in phrasing right after an eol. - // When we’d serialize that, in most cases that would be seen as html - // (flow). - // As we can’t escape or so to prevent it from happening, we take a somewhat - // reasonable approach: replace that eol with a space. - // See: - if ( - results.length > 0 && - (before === '\r' || before === '\n') && - child.type === 'html' - ) { - results[results.length - 1] = results[results.length - 1].replace( - /(\r?\n|\r)$/, - ' ' - ) - before = ' ' - - // To do: does this work to reset tracker? - tracker = state.createTracker(info) - tracker.move(results.join('')) - } - - results.push( - tracker.move( - state.handle(child, parent, state, { - ...tracker.current(), - before, - after - }) - ) - ) - - before = results[results.length - 1].slice(-1) - } - - indexStack.pop() - - return results.join('') -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-strikethrough/node_modules/mdast-util-to-markdown/lib/util/track.js -/** - * @typedef {import('../types.js').CreateTracker} CreateTracker - * @typedef {import('../types.js').TrackCurrent} TrackCurrent - * @typedef {import('../types.js').TrackMove} TrackMove - * @typedef {import('../types.js').TrackShift} TrackShift - */ - -/** - * Track positional info in the output. - * - * @type {CreateTracker} - */ -function util_track_track(config) { - // Defaults are used to prevent crashes when older utilities somehow activate - // this code. - /* c8 ignore next 5 */ - const options = config || {} - const now = options.now || {} - let lineShift = options.lineShift || 0 - let line = now.line || 1 - let column = now.column || 1 - - return {move, current, shift} - - /** - * Get the current tracked info. - * - * @type {TrackCurrent} - */ - function current() { - return {now: {line, column}, lineShift} - } - - /** - * Define an increased line shift (the typical indent for lines). - * - * @type {TrackShift} - */ - function shift(value) { - lineShift += value - } - - /** - * Move past some generated markdown. - * - * @type {TrackMove} - */ - function move(input) { - // eslint-disable-next-line unicorn/prefer-default-parameters - const value = input || '' - const chunks = value.split(/\r?\n|\r/g) - const tail = chunks[chunks.length - 1] - line += chunks.length - 1 - column = - chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift - return value - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-strikethrough/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-gfm-strikethrough@1.0.3/node_modules/mdast-util-gfm-strikethrough/lib/index.js /** * @typedef {import('mdast').Delete} Delete * @@ -197044,10 +186596,10 @@ function exitStrikethrough(token) { * @param {Delete} node */ function handleDelete(node, _, context, safeOptions) { - const tracker = util_track_track(safeOptions) + const tracker = track(safeOptions) const exit = context.enter('strikethrough') let value = tracker.move('~~') - value += container_phrasing_containerPhrasing(node, context, { + value += containerPhrasing(node, context, { ...tracker.current(), before: value, after: '~' @@ -197062,214 +186614,7 @@ function peekDelete() { return '~' } -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-table/node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js -/** - * @typedef {import('../types.js').Handle} Handle - * @typedef {import('../types.js').Info} Info - * @typedef {import('../types.js').Parent} Parent - * @typedef {import('../types.js').PhrasingContent} PhrasingContent - * @typedef {import('../types.js').State} State - */ - -/** - * Serialize the children of a parent that contains phrasing children. - * - * These children will be joined flush together. - * - * @param {Parent & {children: Array}} parent - * Parent of flow nodes. - * @param {State} state - * Info passed around about the current state. - * @param {Info} info - * Info on where we are in the document we are generating. - * @returns {string} - * Serialized children, joined together. - */ -function util_container_phrasing_containerPhrasing(parent, state, info) { - const indexStack = state.indexStack - const children = parent.children || [] - /** @type {Array} */ - const results = [] - let index = -1 - let before = info.before - - indexStack.push(-1) - let tracker = state.createTracker(info) - - while (++index < children.length) { - const child = children[index] - /** @type {string} */ - let after - - indexStack[indexStack.length - 1] = index - - if (index + 1 < children.length) { - /** @type {Handle} */ - // @ts-expect-error: hush, it’s actually a `zwitch`. - let handle = state.handle.handlers[children[index + 1].type] - /** @type {Handle} */ - // @ts-expect-error: hush, it’s actually a `zwitch`. - if (handle && handle.peek) handle = handle.peek - after = handle - ? handle(children[index + 1], parent, state, { - before: '', - after: '', - ...tracker.current() - }).charAt(0) - : '' - } else { - after = info.after - } - - // In some cases, html (text) can be found in phrasing right after an eol. - // When we’d serialize that, in most cases that would be seen as html - // (flow). - // As we can’t escape or so to prevent it from happening, we take a somewhat - // reasonable approach: replace that eol with a space. - // See: - if ( - results.length > 0 && - (before === '\r' || before === '\n') && - child.type === 'html' - ) { - results[results.length - 1] = results[results.length - 1].replace( - /(\r?\n|\r)$/, - ' ' - ) - before = ' ' - - // To do: does this work to reset tracker? - tracker = state.createTracker(info) - tracker.move(results.join('')) - } - - results.push( - tracker.move( - state.handle(child, parent, state, { - ...tracker.current(), - before, - after - }) - ) - ) - - before = results[results.length - 1].slice(-1) - } - - indexStack.pop() - - return results.join('') -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-table/node_modules/mdast-util-to-markdown/lib/util/pattern-compile.js -/** - * @typedef {import('../types.js').Unsafe} Unsafe - */ - -/** - * @param {Unsafe} pattern - * @returns {RegExp} - */ -function util_pattern_compile_patternCompile(pattern) { - if (!pattern._compiled) { - const before = - (pattern.atBreak ? '[\\r\\n][\\t ]*' : '') + - (pattern.before ? '(?:' + pattern.before + ')' : '') - - pattern._compiled = new RegExp( - (before ? '(' + before + ')' : '') + - (/[|\\{}()[\]^$+*?.-]/.test(pattern.character) ? '\\' : '') + - pattern.character + - (pattern.after ? '(?:' + pattern.after + ')' : ''), - 'g' - ) - } - - return pattern._compiled -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-table/node_modules/mdast-util-to-markdown/lib/handle/inline-code.js -/** - * @typedef {import('mdast').InlineCode} InlineCode - * @typedef {import('../types.js').Parent} Parent - * @typedef {import('../types.js').State} State - */ - - - -inline_code_inlineCode.peek = inline_code_inlineCodePeek - -/** - * @param {InlineCode} node - * @param {Parent | undefined} _ - * @param {State} state - * @returns {string} - */ -function inline_code_inlineCode(node, _, state) { - let value = node.value || '' - let sequence = '`' - let index = -1 - - // If there is a single grave accent on its own in the code, use a fence of - // two. - // If there are two in a row, use one. - while (new RegExp('(^|[^`])' + sequence + '([^`]|$)').test(value)) { - sequence += '`' - } - - // If this is not just spaces or eols (tabs don’t count), and either the - // first or last character are a space, eol, or tick, then pad with spaces. - if ( - /[^ \r\n]/.test(value) && - ((/^[ \r\n]/.test(value) && /[ \r\n]$/.test(value)) || /^`|`$/.test(value)) - ) { - value = ' ' + value + ' ' - } - - // We have a potential problem: certain characters after eols could result in - // blocks being seen. - // For example, if someone injected the string `'\n# b'`, then that would - // result in an ATX heading. - // We can’t escape characters in `inlineCode`, but because eols are - // transformed to spaces when going from markdown to HTML anyway, we can swap - // them out. - while (++index < state.unsafe.length) { - const pattern = state.unsafe[index] - const expression = util_pattern_compile_patternCompile(pattern) - /** @type {RegExpExecArray | null} */ - let match - - // Only look for `atBreak`s. - // Btw: note that `atBreak` patterns will always start the regex at LF or - // CR. - if (!pattern.atBreak) continue - - while ((match = expression.exec(value))) { - let position = match.index - - // Support CRLF (patterns only look for one of the characters). - if ( - value.charCodeAt(position) === 10 /* `\n` */ && - value.charCodeAt(position - 1) === 13 /* `\r` */ - ) { - position-- - } - - value = value.slice(0, position) + ' ' + value.slice(match.index + 1) - } - } - - return sequence + value + sequence -} - -/** - * @returns {string} - */ -function inline_code_inlineCodePeek() { - return '`' -} - -;// CONCATENATED MODULE: ./node_modules/markdown-table/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/markdown-table@3.0.4/node_modules/markdown-table/index.js // To do: next major: remove. /** * @typedef {Options} MarkdownTableOptions @@ -197664,7 +187009,7 @@ function toAlignment(value) { : 0 } -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-table/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-gfm-table@1.0.7/node_modules/mdast-util-gfm-table/lib/index.js /** * @typedef {import('mdast').Table} Table * @typedef {import('mdast').TableRow} TableRow @@ -197880,7 +187225,7 @@ function gfmTableToMarkdown(options) { function handleTableCell(node, _, context, safeOptions) { const exit = context.enter('tableCell') const subexit = context.enter('phrasing') - const value = util_container_phrasing_containerPhrasing(node, context, { + const value = containerPhrasing(node, context, { ...safeOptions, before: around, after: around @@ -197965,7 +187310,7 @@ function gfmTableToMarkdown(options) { * @param {InlineCode} node */ function inlineCodeWithTable(node, parent, context) { - let value = inline_code_inlineCode(node, parent, context) + let value = inlineCode(node, parent, context) if (context.stack.includes('tableCell')) { value = value.replace(/\|/g, '\\$&') @@ -197975,188 +187320,7 @@ function gfmTableToMarkdown(options) { } } -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-task-list-item/node_modules/mdast-util-to-markdown/lib/util/check-bullet.js -/** - * @typedef {import('../types.js').State} State - * @typedef {import('../types.js').Options} Options - */ - -/** - * @param {State} state - * @returns {Exclude} - */ -function check_bullet_checkBullet(state) { - const marker = state.options.bullet || '*' - - if (marker !== '*' && marker !== '+' && marker !== '-') { - throw new Error( - 'Cannot serialize items with `' + - marker + - '` for `options.bullet`, expected `*`, `+`, or `-`' - ) - } - - return marker -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-task-list-item/node_modules/mdast-util-to-markdown/lib/util/check-list-item-indent.js -/** - * @typedef {import('../types.js').State} State - * @typedef {import('../types.js').Options} Options - */ - -/** - * @param {State} state - * @returns {Exclude} - */ -function check_list_item_indent_checkListItemIndent(state) { - const style = state.options.listItemIndent || 'tab' - - // To do: remove in a major. - // @ts-expect-error: deprecated. - if (style === 1 || style === '1') { - return 'one' - } - - if (style !== 'tab' && style !== 'one' && style !== 'mixed') { - throw new Error( - 'Cannot serialize items with `' + - style + - '` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`' - ) - } - - return style -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-task-list-item/node_modules/mdast-util-to-markdown/lib/handle/list-item.js -/** - * @typedef {import('mdast').ListItem} ListItem - * @typedef {import('../types.js').Map} Map - * @typedef {import('../types.js').Parent} Parent - * @typedef {import('../types.js').State} State - * @typedef {import('../types.js').Info} Info - */ - - - - -/** - * @param {ListItem} node - * @param {Parent | undefined} parent - * @param {State} state - * @param {Info} info - * @returns {string} - */ -function list_item_listItem(node, parent, state, info) { - const listItemIndent = check_list_item_indent_checkListItemIndent(state) - let bullet = state.bulletCurrent || check_bullet_checkBullet(state) - - // Add the marker value for ordered lists. - if (parent && parent.type === 'list' && parent.ordered) { - bullet = - (typeof parent.start === 'number' && parent.start > -1 - ? parent.start - : 1) + - (state.options.incrementListMarker === false - ? 0 - : parent.children.indexOf(node)) + - bullet - } - - let size = bullet.length + 1 - - if ( - listItemIndent === 'tab' || - (listItemIndent === 'mixed' && - ((parent && parent.type === 'list' && parent.spread) || node.spread)) - ) { - size = Math.ceil(size / 4) * 4 - } - - const tracker = state.createTracker(info) - tracker.move(bullet + ' '.repeat(size - bullet.length)) - tracker.shift(size) - const exit = state.enter('listItem') - const value = state.indentLines( - state.containerFlow(node, tracker.current()), - map - ) - exit() - - return value - - /** @type {Map} */ - function map(line, index, blank) { - if (index) { - return (blank ? '' : ' '.repeat(size)) + line - } - - return (blank ? bullet : bullet + ' '.repeat(size - bullet.length)) + line - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-task-list-item/node_modules/mdast-util-to-markdown/lib/util/track.js -/** - * @typedef {import('../types.js').CreateTracker} CreateTracker - * @typedef {import('../types.js').TrackCurrent} TrackCurrent - * @typedef {import('../types.js').TrackMove} TrackMove - * @typedef {import('../types.js').TrackShift} TrackShift - */ - -/** - * Track positional info in the output. - * - * @type {CreateTracker} - */ -function lib_util_track_track(config) { - // Defaults are used to prevent crashes when older utilities somehow activate - // this code. - /* c8 ignore next 5 */ - const options = config || {} - const now = options.now || {} - let lineShift = options.lineShift || 0 - let line = now.line || 1 - let column = now.column || 1 - - return {move, current, shift} - - /** - * Get the current tracked info. - * - * @type {TrackCurrent} - */ - function current() { - return {now: {line, column}, lineShift} - } - - /** - * Define an increased line shift (the typical indent for lines). - * - * @type {TrackShift} - */ - function shift(value) { - lineShift += value - } - - /** - * Move past some generated markdown. - * - * @type {TrackMove} - */ - function move(input) { - // eslint-disable-next-line unicorn/prefer-default-parameters - const value = input || '' - const chunks = value.split(/\r?\n|\r/g) - const tail = chunks[chunks.length - 1] - line += chunks.length - 1 - column = - chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift - return value - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm-task-list-item/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-gfm-task-list-item@1.0.2/node_modules/mdast-util-gfm-task-list-item/lib/index.js /** * @typedef {import('mdast').Content} Content * @typedef {import('mdast').ListItem} ListItem @@ -198275,13 +187439,13 @@ function listItemWithTaskListItem(node, parent, context, safeOptions) { const checkable = typeof node.checked === 'boolean' && head && head.type === 'paragraph' const checkbox = '[' + (node.checked ? 'x' : ' ') + '] ' - const tracker = lib_util_track_track(safeOptions) + const tracker = track(safeOptions) if (checkable) { tracker.move(checkbox) } - let value = list_item_listItem(node, parent, context, { + let value = listItem(node, parent, context, { ...safeOptions, ...tracker.current() }) @@ -198301,7 +187465,7 @@ function listItemWithTaskListItem(node, parent, context, safeOptions) { } } -;// CONCATENATED MODULE: ./node_modules/mdast-util-gfm/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-gfm@2.0.2/node_modules/mdast-util-gfm/lib/index.js /** * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension @@ -198358,7 +187522,7 @@ function gfmToMarkdown(options) { } } -;// CONCATENATED MODULE: ./node_modules/remark-gfm/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/remark-gfm@3.0.1/node_modules/remark-gfm/index.js /** * @typedef {import('mdast').Root} Root * @typedef {import('micromark-extension-gfm').Options & import('mdast-util-gfm').Options} Options @@ -198394,269 +187558,7 @@ function remarkGfm(options = {}) { } } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/node_modules/micromark-util-character/lib/unicode-punctuation-regex.js -// This module is generated by `script/`. -// -// CommonMark handles attention (emphasis, strong) markers based on what comes -// before or after them. -// One such difference is if those characters are Unicode punctuation. -// This script is generated from the Unicode data. - -/** - * Regular expression that matches a unicode punctuation character. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_lib_unicode_punctuation_regex_unicodePunctuationRegex = - /[!-\/:-@\[-`\{-~\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061D-\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C77\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1B7D\u1B7E\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4F\u2E52-\u2E5D\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]/ - -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/node_modules/micromark-util-character/index.js -/** - * @typedef {import('micromark-util-types').Code} Code - */ - - - -/** - * Check whether the character code represents an ASCII alpha (`a` through `z`, - * case insensitive). - * - * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha. - * - * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`) - * to U+005A (`Z`). - * - * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`) - * to U+007A (`z`). - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiAlpha = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/[A-Za-z]/) - -/** - * Check whether the character code represents an ASCII alphanumeric (`a` - * through `z`, case insensitive, or `0` through `9`). - * - * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha - * (see `asciiAlpha`). - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiAlphanumeric = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/[\dA-Za-z]/) - -/** - * Check whether the character code represents an ASCII atext. - * - * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in - * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`), - * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F - * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E - * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE - * (`{`) to U+007E TILDE (`~`). - * - * See: - * **\[RFC5322]**: - * [Internet Message Format](https://tools.ietf.org/html/rfc5322). - * P. Resnick. - * IETF. - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiAtext = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/[#-'*+\--9=?A-Z^-~]/) - -/** - * Check whether a character code is an ASCII control character. - * - * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL) - * to U+001F (US), or U+007F (DEL). - * - * @param {Code} code - * Code. - * @returns {boolean} - * Whether it matches. - */ -function mdast_util_to_hast_node_modules_micromark_util_character_asciiControl(code) { - return ( - // Special whitespace codes (which have negative values), C0 and Control - // character DEL - code !== null && (code < 32 || code === 127) - ) -} - -/** - * Check whether the character code represents an ASCII digit (`0` through `9`). - * - * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to - * U+0039 (`9`). - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiDigit = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/\d/) - -/** - * Check whether the character code represents an ASCII hex digit (`a` through - * `f`, case insensitive, or `0` through `9`). - * - * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex - * digit, or an ASCII lower hex digit. - * - * An **ASCII upper hex digit** is a character in the inclusive range U+0041 - * (`A`) to U+0046 (`F`). - * - * An **ASCII lower hex digit** is a character in the inclusive range U+0061 - * (`a`) to U+0066 (`f`). - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiHexDigit = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/[\dA-Fa-f]/) - -/** - * Check whether the character code represents ASCII punctuation. - * - * An **ASCII punctuation** is a character in the inclusive ranges U+0021 - * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT - * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT - * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`). - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_asciiPunctuation = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/[!-/:-@[-`{-~]/) - -/** - * Check whether a character code is a markdown line ending. - * - * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN - * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR). - * - * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE - * RETURN (CR) are replaced by these virtual characters depending on whether - * they occurred together. - * - * @param {Code} code - * Code. - * @returns {boolean} - * Whether it matches. - */ -function mdast_util_to_hast_node_modules_micromark_util_character_markdownLineEnding(code) { - return code !== null && code < -2 -} - -/** - * Check whether a character code is a markdown line ending (see - * `markdownLineEnding`) or markdown space (see `markdownSpace`). - * - * @param {Code} code - * Code. - * @returns {boolean} - * Whether it matches. - */ -function mdast_util_to_hast_node_modules_micromark_util_character_markdownLineEndingOrSpace(code) { - return code !== null && (code < 0 || code === 32) -} - -/** - * Check whether a character code is a markdown space. - * - * A **markdown space** is the concrete character U+0020 SPACE (SP) and the - * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT). - * - * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is - * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL - * SPACE (VS) characters, depending on the column at which the tab occurred. - * - * @param {Code} code - * Code. - * @returns {boolean} - * Whether it matches. - */ -function mdast_util_to_hast_node_modules_micromark_util_character_markdownSpace(code) { - return code === -2 || code === -1 || code === 32 -} - -// Size note: removing ASCII from the regex and using `asciiPunctuation` here -// In fact adds to the bundle size. -/** - * Check whether the character code represents Unicode punctuation. - * - * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation, - * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf` - * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po` - * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII - * punctuation (see `asciiPunctuation`). - * - * See: - * **\[UNICODE]**: - * [The Unicode Standard](https://www.unicode.org/versions/). - * Unicode Consortium. - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_unicodePunctuation = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(mdast_util_to_hast_node_modules_micromark_util_character_lib_unicode_punctuation_regex_unicodePunctuationRegex) - -/** - * Check whether the character code represents Unicode whitespace. - * - * Note that this does handle micromark specific markdown whitespace characters. - * See `markdownLineEndingOrSpace` to check that. - * - * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator, - * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF), - * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\[UNICODE]**). - * - * See: - * **\[UNICODE]**: - * [The Unicode Standard](https://www.unicode.org/versions/). - * Unicode Consortium. - * - * @param code - * Code. - * @returns - * Whether it matches. - */ -const mdast_util_to_hast_node_modules_micromark_util_character_unicodeWhitespace = mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(/\s/) - -/** - * Create a code check from a regex. - * - * @param {RegExp} regex - * @returns {(code: Code) => boolean} - */ -function mdast_util_to_hast_node_modules_micromark_util_character_regexCheck(regex) { - return check - - /** - * Check whether a code matches the bound regex. - * - * @param {Code} code - * Character code. - * @returns {boolean} - * Whether the character code matches the bound regex. - */ - function check(code) { - return code !== null && regex.test(String.fromCharCode(code)) - } -} - -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/node_modules/micromark-util-sanitize-uri/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/micromark-util-sanitize-uri@1.2.0/node_modules/micromark-util-sanitize-uri/index.js /** @@ -198730,8 +187632,8 @@ function normalizeUri(value) { // A correct percent encoded value. if ( code === 37 && - mdast_util_to_hast_node_modules_micromark_util_character_asciiAlphanumeric(value.charCodeAt(index + 1)) && - mdast_util_to_hast_node_modules_micromark_util_character_asciiAlphanumeric(value.charCodeAt(index + 2)) + asciiAlphanumeric(value.charCodeAt(index + 1)) && + asciiAlphanumeric(value.charCodeAt(index + 2)) ) { skip = 2 } @@ -198772,7 +187674,7 @@ function normalizeUri(value) { return result.join('') + value.slice(start) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/footer.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/footer.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').ElementContent} ElementContent @@ -198902,7 +187804,7 @@ function footer(state) { } } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/node_modules/unist-util-position/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/unist-util-position@4.0.4/node_modules/unist-util-position/lib/index.js /** * @typedef {import('unist').Position} Position * @typedef {import('unist').Node} Node @@ -198952,7 +187854,7 @@ const pointEnd = unist_util_position_lib_point('end') * @returns {Position} * Position. */ -function unist_util_position_lib_position(node) { +function lib_position(node) { return {start: pointStart(node), end: pointEnd(node)} } @@ -198988,7 +187890,7 @@ function unist_util_position_lib_point(type) { } } -;// CONCATENATED MODULE: ./node_modules/unist-util-generated/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/unist-util-generated@2.0.1/node_modules/unist-util-generated/lib/index.js /** * @typedef PointLike * @property {number | null | undefined} [line] @@ -199024,7 +187926,7 @@ function generated(node) { ) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-definitions/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-definitions@5.1.2/node_modules/mdast-util-definitions/lib/index.js /** * @typedef {import('mdast').Root} Root * @typedef {import('mdast').Content} Content @@ -199090,7 +187992,7 @@ function clean(value) { return String(value || '').toUpperCase() } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/blockquote.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/blockquote.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Blockquote} Blockquote @@ -199119,7 +188021,7 @@ function blockquote_blockquote(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/break.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/break.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Text} Text @@ -199144,7 +188046,7 @@ function break_hardBreak(state, node) { return [state.applyData(node, result), {type: 'text', value: '\n'}] } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/code.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/code.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Properties} Properties @@ -199197,7 +188099,7 @@ function code_code(state, node) { return result } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/delete.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/delete.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Delete} Delete @@ -199227,7 +188129,7 @@ function strikethrough(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/emphasis.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/emphasis.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Emphasis} Emphasis @@ -199256,7 +188158,7 @@ function emphasis_emphasis(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/footnote-reference.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/footnote-reference.js /** * @typedef {import('mdast').FootnoteReference} FootnoteReference * @typedef {import('hast').Element} Element @@ -199322,7 +188224,7 @@ function footnote_reference_footnoteReference(state, node) { return state.applyData(node, sup) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/footnote.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/footnote.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Footnote} Footnote @@ -199369,7 +188271,7 @@ function footnote(state, node) { }) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/heading.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/heading.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Heading} Heading @@ -199398,7 +188300,7 @@ function heading_heading(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/html.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/html.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').HTML} Html @@ -199429,7 +188331,7 @@ function handlers_html_html(state, node) { return null } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/revert.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/revert.js /** * @typedef {import('hast').ElementContent} ElementContent * @@ -199491,7 +188393,7 @@ function revert(state, node) { return contents } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/image-reference.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/image-reference.js /** * @typedef {import('hast').ElementContent} ElementContent * @typedef {import('hast').Element} Element @@ -199533,7 +188435,7 @@ function image_reference_imageReference(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/image.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/image.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Properties} Properties @@ -199571,7 +188473,7 @@ function handlers_image_image(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/inline-code.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/inline-code.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Text} Text @@ -199589,7 +188491,7 @@ function handlers_image_image(state, node) { * @returns {Element} * hast node. */ -function handlers_inline_code_inlineCode(state, node) { +function inline_code_inlineCode(state, node) { /** @type {Text} */ const text = {type: 'text', value: node.value.replace(/\r?\n|\r/g, ' ')} state.patch(node, text) @@ -199605,7 +188507,7 @@ function handlers_inline_code_inlineCode(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/link-reference.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/link-reference.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').ElementContent} ElementContent @@ -199652,7 +188554,7 @@ function link_reference_linkReference(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/link.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/link.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Properties} Properties @@ -199691,7 +188593,7 @@ function handlers_link_link(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/list-item.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/list-item.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').ElementContent} ElementContent @@ -199720,7 +188622,7 @@ function handlers_link_link(state, node) { * @returns {Element} * hast node. */ -function handlers_list_item_listItem(state, node, parent) { +function list_item_listItem(state, node, parent) { const results = state.all(node) const loose = parent ? listLoose(parent) : listItemLoose(node) /** @type {Properties} */ @@ -199822,7 +188724,7 @@ function listItemLoose(node) { : spread } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/list.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/list.js /** * @typedef {import('hast').Element} Element * @typedef {import('hast').Properties} Properties @@ -199877,7 +188779,7 @@ function handlers_list_list(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/paragraph.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/paragraph.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Paragraph} Paragraph @@ -199906,7 +188808,7 @@ function paragraph_paragraph(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/root.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/root.js /** * @typedef {import('hast').Root} HastRoot * @typedef {import('hast').Element} HastElement @@ -199931,7 +188833,7 @@ function handlers_root_root(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/strong.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/strong.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Strong} Strong @@ -199960,7 +188862,7 @@ function strong_strong(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/table.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/table.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').Table} Table @@ -200023,7 +188925,7 @@ function table(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/table-row.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/table-row.js /** * @typedef {import('hast').Properties} Properties * @typedef {import('hast').Element} Element @@ -200097,7 +188999,7 @@ function tableRow(state, node, parent) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/table-cell.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/table-cell.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').TableCell} TableCell @@ -200128,7 +189030,7 @@ function tableCell(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/trim-lines/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/trim-lines@3.0.1/node_modules/trim-lines/index.js const tab = 9 /* `\t` */ const space = 32 /* ` ` */ @@ -200199,7 +189101,7 @@ function trimLine(value, start, end) { return endIndex > startIndex ? value.slice(startIndex, endIndex) : '' } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/text.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/text.js /** * @typedef {import('hast').Element} HastElement * @typedef {import('hast').Text} HastText @@ -200226,7 +189128,7 @@ function handlers_text_text(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/thematic-break.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/thematic-break.js /** * @typedef {import('hast').Element} Element * @typedef {import('mdast').ThematicBreak} ThematicBreak @@ -200255,7 +189157,7 @@ function handlers_thematic_break_thematicBreak(state, node) { return state.applyData(node, result) } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/handlers/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/handlers/index.js @@ -200296,10 +189198,10 @@ const handlers = { html: handlers_html_html, imageReference: image_reference_imageReference, image: handlers_image_image, - inlineCode: handlers_inline_code_inlineCode, + inlineCode: inline_code_inlineCode, linkReference: link_reference_linkReference, link: handlers_link_link, - listItem: handlers_list_item_listItem, + listItem: list_item_listItem, list: handlers_list_list, paragraph: paragraph_paragraph, root: handlers_root_root, @@ -200321,7 +189223,7 @@ function ignore() { return null } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/state.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/state.js /** * @typedef {import('hast').Content} HastContent * @typedef {import('hast').Element} HastElement @@ -200679,7 +189581,7 @@ function createState(tree, options) { * Nothing. */ function patch(from, to) { - if (from.position) to.position = unist_util_position_lib_position(from) + if (from.position) to.position = lib_position(from) } /** @@ -200900,7 +189802,7 @@ function state_wrap(nodes, loose) { return result } -;// CONCATENATED MODULE: ./node_modules/mdast-util-to-hast/lib/index.js +;// CONCATENATED MODULE: ./node_modules/.pnpm/mdast-util-to-hast@12.3.0/node_modules/mdast-util-to-hast/lib/index.js /** * @typedef {import('hast').Content} HastContent * @typedef {import('hast').Root} HastRoot @@ -200986,1696 +189888,149 @@ function state_wrap(nodes, loose) { * node * * otherwise, create a `
` element (which could be changed with * `data.hName`), with its children mapped from mdast to hast as well - * - * This behavior can be changed by passing an `unknownHandler`. - * - * @param {MdastNodes} tree - * mdast tree. - * @param {Options | null | undefined} [options] - * Configuration. - * @returns {HastNodes | null | undefined} - * hast tree. - */ -// To do: next major: always return a single `root`. -function toHast(tree, options) { - const state = createState(tree, options) - const node = state.one(tree, null) - const foot = footer(state) - - if (foot) { - // @ts-expect-error If there’s a footer, there were definitions, meaning block - // content. - // So assume `node` is a parent node. - node.children.push({type: 'text', value: '\n'}, foot) - } - - // To do: next major: always return root? - return Array.isArray(node) ? {type: 'root', children: node} : node -} - -;// CONCATENATED MODULE: ./node_modules/remark-rehype/lib/index.js -/** - * @typedef {import('hast').Root} HastRoot - * @typedef {import('mdast').Root} MdastRoot - * @typedef {import('mdast-util-to-hast').Options} Options - * @typedef {import('unified').Processor} Processor - * - * @typedef {import('mdast-util-to-hast')} DoNotTouchAsThisImportIncludesRawInTree - */ - - - -// Note: the `` overload doesn’t seem to work :'( - -/** - * Plugin that turns markdown into HTML to support rehype. - * - * * If a destination processor is given, that processor runs with a new HTML - * (hast) tree (bridge-mode). - * As the given processor runs with a hast tree, and rehype plugins support - * hast, that means rehype plugins can be used with the given processor. - * The hast tree is discarded in the end. - * It’s highly unlikely that you want to do this. - * * The common case is to not pass a destination processor, in which case the - * current processor continues running with a new HTML (hast) tree - * (mutate-mode). - * As the current processor continues with a hast tree, and rehype plugins - * support hast, that means rehype plugins can be used after - * `remark-rehype`. - * It’s likely that this is what you want to do. - * - * @param destination - * Optional unified processor. - * @param options - * Options passed to `mdast-util-to-hast`. - */ -const remarkRehype = - /** @type {(import('unified').Plugin<[Processor, Options?]|[null|undefined, Options?]|[Options]|[], MdastRoot>)} */ - ( - function (destination, options) { - return destination && 'run' in destination - ? bridge(destination, options) - : mutate(destination || options) - } - ) - -/* harmony default export */ const remark_rehype_lib = (remarkRehype); - -/** - * Bridge-mode. - * Runs the destination with the new hast tree. - * - * @type {import('unified').Plugin<[Processor, Options?], MdastRoot>} - */ -function bridge(destination, options) { - return (node, file, next) => { - destination.run(toHast(node, options), file, (error) => { - next(error) - }) - } -} - -/** - * Mutate-mode. - * Further plugins run on the hast tree. - * - * @type {import('unified').Plugin<[Options?]|void[], MdastRoot, HastRoot>} - */ -function mutate(options) { - // @ts-expect-error: assume a corresponding node is returned by `toHast`. - return (node) => toHast(node, options) -} - -// EXTERNAL MODULE: external "fs" -var external_fs_ = __nccwpck_require__(79896); -;// CONCATENATED MODULE: ./node_modules/to-vfile/lib/index.js -/** - * @typedef {import('vfile').VFileValue} Value - * @typedef {import('vfile').VFileOptions} Options - * @typedef {import('vfile').BufferEncoding} BufferEncoding - * Encodings supported by the buffer class. - * - * This is a copy of the types from Node and `VFile`. - * - * @typedef ReadOptions - * Configuration for `fs.readFile`. - * @property {BufferEncoding | null | undefined} [encoding] - * Encoding to read file as, will turn `file.value` into a string if passed. - * @property {string | undefined} [flag] - * File system flags to use. - * - * @typedef WriteOptions - * Configuration for `fs.writeFile`. - * @property {BufferEncoding | null | undefined} [encoding] - * Encoding to write file as. - * @property {number | string | undefined} [mode] - * File mode (permission and sticky bits) if the file was newly created. - * @property {string | undefined} [flag] - * File system flags to use. - * - * @typedef {URL | Value} Path - * URL to file or path to file. - * - * > 👉 **Note**: `Value` is used here because it’s a smarter `Buffer` - * @typedef {Path | Options | VFile} Compatible - * URL to file, path to file, options for file, or actual file. - */ - -/** - * @callback Callback - * Callback called after reading or writing a file. - * @param {NodeJS.ErrnoException | null} error - * Error when reading or writing was not successful. - * @param {VFile | null | undefined} file - * File when reading or writing was successful. - */ - - - - - - - -// To do: next major: use `node:` prefix. -// To do: next major: use `URL` from global. -// To do: next major: Only pass `undefined`. - -/** - * Create a virtual file from a description. - * - * This is like `VFile`, but it accepts a file path instead of file cotnents. - * - * If `options` is a string, URL, or buffer, it’s used as the path. - * Otherwise, if it’s a file, that’s returned instead. - * Otherwise, the options are passed through to `new VFile()`. - * - * @param {Compatible | null | undefined} [description] - * Path to file, file options, or file itself. - * @returns {VFile} - * Given file or new file. - */ -function toVFile(description) { - if (typeof description === 'string' || description instanceof external_url_.URL) { - description = {path: description} - } else if (is_buffer(description)) { - description = {path: String(description)} - } - - return lib_looksLikeAVFile(description) - ? description - : // To do: remove when `VFile` allows explicit `null`. - new VFile(description || undefined) -} - -/** - * Create a virtual file and read it in, synchronously. - * - * @param {Compatible} description - * Path to file, file options, or file itself. - * @param {BufferEncoding | ReadOptions | null | undefined} [options] - * Encoding to use or Node.JS read options. - * @returns {VFile} - * Given file or new file. - */ -function readSync(description, options) { - const file = toVFile(description) - file.value = external_fs_.readFileSync(external_path_.resolve(file.cwd, file.path), options) - return file -} - -/** - * Create a virtual file and write it, synchronously. - * - * @param {Compatible} description - * Path to file, file options, or file itself. - * @param {BufferEncoding | WriteOptions | null | undefined} [options] - * Encoding to use or Node.JS write options. - * @returns {VFile} - * Given file or new file. - */ -function writeSync(description, options) { - const file = toVFile(description) - external_fs_.writeFileSync(external_path_.resolve(file.cwd, file.path), file.value || '', options) - return file -} - -/** - * Create a virtual file and read it in, async. - * - * @param description - * Path to file, file options, or file itself. - * @param options - * Encoding to use or Node.JS read options. - * @param callback - * Callback called when done. - * @returns - * Nothing when a callback is given, otherwise promise that resolves to given - * file or new file. - */ -const read = - /** - * @type {{ - * (description: Compatible, options: BufferEncoding | ReadOptions | null | undefined, callback: Callback): void - * (description: Compatible, callback: Callback): void - * (description: Compatible, options?: BufferEncoding | ReadOptions | null | undefined): Promise - * }} - */ - ( - /** - * @param {Compatible} description - * @param {BufferEncoding | ReadOptions | null | undefined} [options] - * @param {Callback | null | undefined} [callback] - */ - function (description, options, callback) { - const file = toVFile(description) - - if (!callback && typeof options === 'function') { - callback = options - options = null - } - - if (!callback) { - return new Promise(executor) - } - - executor(resolve, callback) - - /** - * @param {VFile} result - */ - function resolve(result) { - // @ts-expect-error: `callback` always defined. - callback(null, result) - } - - /** - * @param {(error: VFile) => void} resolve - * @param {(error: NodeJS.ErrnoException, file?: VFile | undefined) => void} reject - */ - function executor(resolve, reject) { - /** @type {string} */ - let fp - - try { - fp = external_path_.resolve(file.cwd, file.path) - } catch (error) { - const exception = /** @type {NodeJS.ErrnoException} */ (error) - return reject(exception) - } - - external_fs_.readFile(fp, options, done) - - /** - * @param {NodeJS.ErrnoException | null} error - * @param {Value} result - */ - function done(error, result) { - if (error) { - reject(error) - } else { - file.value = result - resolve(file) - } - } - } - } - ) - -/** - * Create a virtual file and write it, async. - * - * @param description - * Path to file, file options, or file itself. - * @param options - * Encoding to use or Node.JS write options. - * @param callback - * Callback called when done. - * @returns - * Nothing when a callback is given, otherwise promise that resolves to given - * file or new file. - */ -const write = - /** - * @type {{ - * (description: Compatible, options: BufferEncoding | WriteOptions | null | undefined, callback: Callback): void - * (description: Compatible, callback: Callback): void - * (description: Compatible, options?: BufferEncoding | WriteOptions | null | undefined): Promise - * }} - */ - ( - /** - * @param {Compatible} description - * @param {BufferEncoding | WriteOptions | null | undefined} [options] - * @param {Callback | null | undefined} [callback] - */ - function (description, options, callback) { - const file = toVFile(description) - - // Weird, right? Otherwise `fs` doesn’t accept it. - if (!callback && typeof options === 'function') { - callback = options - options = undefined - } - - if (!callback) { - return new Promise(executor) - } - - executor(resolve, callback) - - /** - * @param {VFile} result - */ - function resolve(result) { - // @ts-expect-error: `callback` always defined. - callback(null, result) - } - - /** - * @param {(error: VFile) => void} resolve - * @param {(error: NodeJS.ErrnoException, file: VFile | null) => void} reject - */ - function executor(resolve, reject) { - /** @type {string} */ - let fp - - try { - fp = external_path_.resolve(file.cwd, file.path) - } catch (error) { - const exception = /** @type {NodeJS.ErrnoException} */ (error) - return reject(exception, null) - } - - external_fs_.writeFile(fp, file.value || '', options || null, done) - - /** - * @param {NodeJS.ErrnoException | null} error - */ - function done(error) { - if (error) { - reject(error, null) - } else { - resolve(file) - } - } - } - } - ) - -/** - * Check if something looks like a vfile. - * - * @param {Compatible | null | undefined} value - * Value. - * @returns {value is VFile} - * Whether `value` looks like a `VFile`. - */ -function lib_looksLikeAVFile(value) { - return Boolean( - value && - typeof value === 'object' && - 'message' in value && - 'messages' in value - ) -} - -// To do: next major: remove? -toVFile.readSync = readSync -toVFile.writeSync = writeSync -toVFile.read = read -toVFile.write = write - -;// CONCATENATED MODULE: ./node_modules/@tid-xcut/markdown-confluence-sync/dist/lib/confluence/transformer/errors/InvalidTemplateError.js -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -class InvalidTemplateError extends Error { -} - -;// CONCATENATED MODULE: ./node_modules/@tid-xcut/markdown-confluence-sync/dist/lib/confluence/transformer/support/rehype/rehype-add-attachments-images.js -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 - - -function isImage(node) { - return (node.tagName.toLowerCase() === "img" && - node.properties != null && - "src" in node.properties); -} -/** - * Plugin to add attachments images in frontmatter - */ -const rehypeAddAttachmentsImages = function rehypeAddAttachmentsImages() { - return function (tree, file) { - const images = {}; - visit(tree, "element", function (node) { - if (isImage(node)) { - const base = file.dirname - ? external_node_path_namespaceObject.resolve(file.cwd, file.dirname) - : file.cwd; - const url = external_node_path_namespaceObject.resolve(base, node.properties?.src); - const baseName = external_node_path_namespaceObject.basename(url); - images[baseName] = url; - node.properties = { ...node.properties, src: baseName }; - } - }); - file.data.images = images; - }; -}; -/* harmony default export */ const rehype_add_attachments_images = (rehypeAddAttachmentsImages); - -;// CONCATENATED MODULE: ./node_modules/@tid-xcut/markdown-confluence-sync/dist/lib/confluence/transformer/support/rehype/rehype-add-notice.js -// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital -// SPDX-License-Identifier: Apache-2.0 -function composeNotice(message) { - return { - type: "element", - tagName: "p", - children: [ - { - type: "element", - tagName: "strong", - children: [{ type: "raw", value: message }], - }, - ], - }; -} -/** - * UnifiedPlugin to add a notice to the AST. - */ -const rehypeAddNotice = function rehypeAddNotice(options) { - return function (tree) { - tree.children.unshift(composeNotice(options.noticeMessage)); - }; -}; -/* harmony default export */ const rehype_add_notice = (rehypeAddNotice); - -// EXTERNAL MODULE: ./node_modules/parse5/lib/parser/index.js -var lib_parser = __nccwpck_require__(87892); -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/schema.js -/** - * @typedef {import('./info.js').Info} Info - * @typedef {Record} Properties - * @typedef {Record} Normal - */ - -class schema_Schema { - /** - * @constructor - * @param {Properties} property - * @param {Normal} normal - * @param {string} [space] - */ - constructor(property, normal, space) { - this.property = property - this.normal = normal - if (space) { - this.space = space - } - } -} - -/** @type {Properties} */ -schema_Schema.prototype.property = {} -/** @type {Normal} */ -schema_Schema.prototype.normal = {} -/** @type {string|null} */ -schema_Schema.prototype.space = null - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/merge.js -/** - * @typedef {import('./schema.js').Properties} Properties - * @typedef {import('./schema.js').Normal} Normal - */ - - - -/** - * @param {Schema[]} definitions - * @param {string} [space] - * @returns {Schema} - */ -function merge_merge(definitions, space) { - /** @type {Properties} */ - const property = {} - /** @type {Normal} */ - const normal = {} - let index = -1 - - while (++index < definitions.length) { - Object.assign(property, definitions[index].property) - Object.assign(normal, definitions[index].normal) - } - - return new schema_Schema(property, normal, space) -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/normalize.js -/** - * @param {string} value - * @returns {string} - */ -function normalize_normalize(value) { - return value.toLowerCase() -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/info.js -class info_Info { - /** - * @constructor - * @param {string} property - * @param {string} attribute - */ - constructor(property, attribute) { - /** @type {string} */ - this.property = property - /** @type {string} */ - this.attribute = attribute - } -} - -/** @type {string|null} */ -info_Info.prototype.space = null -info_Info.prototype.boolean = false -info_Info.prototype.booleanish = false -info_Info.prototype.overloadedBoolean = false -info_Info.prototype.number = false -info_Info.prototype.commaSeparated = false -info_Info.prototype.spaceSeparated = false -info_Info.prototype.commaOrSpaceSeparated = false -info_Info.prototype.mustUseProperty = false -info_Info.prototype.defined = false - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/types.js -let types_powers = 0 - -const util_types_boolean = types_increment() -const types_booleanish = types_increment() -const types_overloadedBoolean = types_increment() -const types_number = types_increment() -const types_spaceSeparated = types_increment() -const types_commaSeparated = types_increment() -const types_commaOrSpaceSeparated = types_increment() - -function types_increment() { - return 2 ** ++types_powers -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/defined-info.js - - - -/** @type {Array} */ -// @ts-expect-error: hush. -const defined_info_checks = Object.keys(util_types_namespaceObject) - -class defined_info_DefinedInfo extends info_Info { - /** - * @constructor - * @param {string} property - * @param {string} attribute - * @param {number|null} [mask] - * @param {string} [space] - */ - constructor(property, attribute, mask, space) { - let index = -1 - - super(property, attribute) - - defined_info_mark(this, 'space', space) - - if (typeof mask === 'number') { - while (++index < defined_info_checks.length) { - const check = defined_info_checks[index] - defined_info_mark(this, defined_info_checks[index], (mask & util_types_namespaceObject[check]) === util_types_namespaceObject[check]) - } - } - } -} - -defined_info_DefinedInfo.prototype.defined = true - -/** - * @param {DefinedInfo} values - * @param {string} key - * @param {unknown} value - */ -function defined_info_mark(values, key, value) { - if (value) { - // @ts-expect-error: assume `value` matches the expected value of `key`. - values[key] = value - } -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/create.js -/** - * @typedef {import('./schema.js').Properties} Properties - * @typedef {import('./schema.js').Normal} Normal - * - * @typedef {Record} Attributes - * - * @typedef {Object} Definition - * @property {Record} properties - * @property {(attributes: Attributes, property: string) => string} transform - * @property {string} [space] - * @property {Attributes} [attributes] - * @property {Array} [mustUseProperty] - */ - - - - - -const create_own = {}.hasOwnProperty - -/** - * @param {Definition} definition - * @returns {Schema} - */ -function create_create(definition) { - /** @type {Properties} */ - const property = {} - /** @type {Normal} */ - const normal = {} - /** @type {string} */ - let prop - - for (prop in definition.properties) { - if (create_own.call(definition.properties, prop)) { - const value = definition.properties[prop] - const info = new defined_info_DefinedInfo( - prop, - definition.transform(definition.attributes || {}, prop), - value, - definition.space - ) - - if ( - definition.mustUseProperty && - definition.mustUseProperty.includes(prop) - ) { - info.mustUseProperty = true - } - - property[prop] = info - - normal[normalize_normalize(prop)] = prop - normal[normalize_normalize(info.attribute)] = prop - } - } - - return new schema_Schema(property, normal, definition.space) -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/xlink.js - - -const xlink_xlink = create_create({ - space: 'xlink', - transform(_, prop) { - return 'xlink:' + prop.slice(5).toLowerCase() - }, - properties: { - xLinkActuate: null, - xLinkArcRole: null, - xLinkHref: null, - xLinkRole: null, - xLinkShow: null, - xLinkTitle: null, - xLinkType: null - } -}) - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/xml.js - - -const xml_xml = create_create({ - space: 'xml', - transform(_, prop) { - return 'xml:' + prop.slice(3).toLowerCase() - }, - properties: {xmlLang: null, xmlBase: null, xmlSpace: null} -}) - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/case-sensitive-transform.js -/** - * @param {Record} attributes - * @param {string} attribute - * @returns {string} - */ -function case_sensitive_transform_caseSensitiveTransform(attributes, attribute) { - return attribute in attributes ? attributes[attribute] : attribute -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/util/case-insensitive-transform.js - - -/** - * @param {Record} attributes - * @param {string} property - * @returns {string} - */ -function case_insensitive_transform_caseInsensitiveTransform(attributes, property) { - return case_sensitive_transform_caseSensitiveTransform(attributes, property.toLowerCase()) -} - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/xmlns.js - - - -const xmlns_xmlns = create_create({ - space: 'xmlns', - attributes: {xmlnsxlink: 'xmlns:xlink'}, - transform: case_insensitive_transform_caseInsensitiveTransform, - properties: {xmlns: null, xmlnsXLink: null} -}) - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/aria.js - - - -const aria_aria = create_create({ - transform(_, prop) { - return prop === 'role' ? prop : 'aria-' + prop.slice(4).toLowerCase() - }, - properties: { - ariaActiveDescendant: null, - ariaAtomic: types_booleanish, - ariaAutoComplete: null, - ariaBusy: types_booleanish, - ariaChecked: types_booleanish, - ariaColCount: types_number, - ariaColIndex: types_number, - ariaColSpan: types_number, - ariaControls: types_spaceSeparated, - ariaCurrent: null, - ariaDescribedBy: types_spaceSeparated, - ariaDetails: null, - ariaDisabled: types_booleanish, - ariaDropEffect: types_spaceSeparated, - ariaErrorMessage: null, - ariaExpanded: types_booleanish, - ariaFlowTo: types_spaceSeparated, - ariaGrabbed: types_booleanish, - ariaHasPopup: null, - ariaHidden: types_booleanish, - ariaInvalid: null, - ariaKeyShortcuts: null, - ariaLabel: null, - ariaLabelledBy: types_spaceSeparated, - ariaLevel: types_number, - ariaLive: null, - ariaModal: types_booleanish, - ariaMultiLine: types_booleanish, - ariaMultiSelectable: types_booleanish, - ariaOrientation: null, - ariaOwns: types_spaceSeparated, - ariaPlaceholder: null, - ariaPosInSet: types_number, - ariaPressed: types_booleanish, - ariaReadOnly: types_booleanish, - ariaRelevant: null, - ariaRequired: types_booleanish, - ariaRoleDescription: types_spaceSeparated, - ariaRowCount: types_number, - ariaRowIndex: types_number, - ariaRowSpan: types_number, - ariaSelected: types_booleanish, - ariaSetSize: types_number, - ariaSort: null, - ariaValueMax: types_number, - ariaValueMin: types_number, - ariaValueNow: types_number, - ariaValueText: null, - role: null - } -}) - -;// CONCATENATED MODULE: ./node_modules/rehype-parse/node_modules/property-information/lib/html.js - - - - -const lib_html_html = create_create({ - space: 'html', - attributes: { - acceptcharset: 'accept-charset', - classname: 'class', - htmlfor: 'for', - httpequiv: 'http-equiv' - }, - transform: case_insensitive_transform_caseInsensitiveTransform, - mustUseProperty: ['checked', 'multiple', 'muted', 'selected'], - properties: { - // Standard Properties. - abbr: null, - accept: types_commaSeparated, - acceptCharset: types_spaceSeparated, - accessKey: types_spaceSeparated, - action: null, - allow: null, - allowFullScreen: util_types_boolean, - allowPaymentRequest: util_types_boolean, - allowUserMedia: util_types_boolean, - alt: null, - as: null, - async: util_types_boolean, - autoCapitalize: null, - autoComplete: types_spaceSeparated, - autoFocus: util_types_boolean, - autoPlay: util_types_boolean, - blocking: types_spaceSeparated, - capture: null, - charSet: null, - checked: util_types_boolean, - cite: null, - className: types_spaceSeparated, - cols: types_number, - colSpan: null, - content: null, - contentEditable: types_booleanish, - controls: util_types_boolean, - controlsList: types_spaceSeparated, - coords: types_number | types_commaSeparated, - crossOrigin: null, - data: null, - dateTime: null, - decoding: null, - default: util_types_boolean, - defer: util_types_boolean, - dir: null, - dirName: null, - disabled: util_types_boolean, - download: types_overloadedBoolean, - draggable: types_booleanish, - encType: null, - enterKeyHint: null, - fetchPriority: null, - form: null, - formAction: null, - formEncType: null, - formMethod: null, - formNoValidate: util_types_boolean, - formTarget: null, - headers: types_spaceSeparated, - height: types_number, - hidden: util_types_boolean, - high: types_number, - href: null, - hrefLang: null, - htmlFor: types_spaceSeparated, - httpEquiv: types_spaceSeparated, - id: null, - imageSizes: null, - imageSrcSet: null, - inert: util_types_boolean, - inputMode: null, - integrity: null, - is: null, - isMap: util_types_boolean, - itemId: null, - itemProp: types_spaceSeparated, - itemRef: types_spaceSeparated, - itemScope: util_types_boolean, - itemType: types_spaceSeparated, - kind: null, - label: null, - lang: null, - language: null, - list: null, - loading: null, - loop: util_types_boolean, - low: types_number, - manifest: null, - max: null, - maxLength: types_number, - media: null, - method: null, - min: null, - minLength: types_number, - multiple: util_types_boolean, - muted: util_types_boolean, - name: null, - nonce: null, - noModule: util_types_boolean, - noValidate: util_types_boolean, - onAbort: null, - onAfterPrint: null, - onAuxClick: null, - onBeforeMatch: null, - onBeforePrint: null, - onBeforeToggle: null, - onBeforeUnload: null, - onBlur: null, - onCancel: null, - onCanPlay: null, - onCanPlayThrough: null, - onChange: null, - onClick: null, - onClose: null, - onContextLost: null, - onContextMenu: null, - onContextRestored: null, - onCopy: null, - onCueChange: null, - onCut: null, - onDblClick: null, - onDrag: null, - onDragEnd: null, - onDragEnter: null, - onDragExit: null, - onDragLeave: null, - onDragOver: null, - onDragStart: null, - onDrop: null, - onDurationChange: null, - onEmptied: null, - onEnded: null, - onError: null, - onFocus: null, - onFormData: null, - onHashChange: null, - onInput: null, - onInvalid: null, - onKeyDown: null, - onKeyPress: null, - onKeyUp: null, - onLanguageChange: null, - onLoad: null, - onLoadedData: null, - onLoadedMetadata: null, - onLoadEnd: null, - onLoadStart: null, - onMessage: null, - onMessageError: null, - onMouseDown: null, - onMouseEnter: null, - onMouseLeave: null, - onMouseMove: null, - onMouseOut: null, - onMouseOver: null, - onMouseUp: null, - onOffline: null, - onOnline: null, - onPageHide: null, - onPageShow: null, - onPaste: null, - onPause: null, - onPlay: null, - onPlaying: null, - onPopState: null, - onProgress: null, - onRateChange: null, - onRejectionHandled: null, - onReset: null, - onResize: null, - onScroll: null, - onScrollEnd: null, - onSecurityPolicyViolation: null, - onSeeked: null, - onSeeking: null, - onSelect: null, - onSlotChange: null, - onStalled: null, - onStorage: null, - onSubmit: null, - onSuspend: null, - onTimeUpdate: null, - onToggle: null, - onUnhandledRejection: null, - onUnload: null, - onVolumeChange: null, - onWaiting: null, - onWheel: null, - open: util_types_boolean, - optimum: types_number, - pattern: null, - ping: types_spaceSeparated, - placeholder: null, - playsInline: util_types_boolean, - popover: null, - popoverTarget: null, - popoverTargetAction: null, - poster: null, - preload: null, - readOnly: util_types_boolean, - referrerPolicy: null, - rel: types_spaceSeparated, - required: util_types_boolean, - reversed: util_types_boolean, - rows: types_number, - rowSpan: types_number, - sandbox: types_spaceSeparated, - scope: null, - scoped: util_types_boolean, - seamless: util_types_boolean, - selected: util_types_boolean, - shadowRootClonable: util_types_boolean, - shadowRootDelegatesFocus: util_types_boolean, - shadowRootMode: null, - shape: null, - size: types_number, - sizes: null, - slot: null, - span: types_number, - spellCheck: types_booleanish, - src: null, - srcDoc: null, - srcLang: null, - srcSet: null, - start: types_number, - step: null, - style: null, - tabIndex: types_number, - target: null, - title: null, - translate: null, - type: null, - typeMustMatch: util_types_boolean, - useMap: null, - value: types_booleanish, - width: types_number, - wrap: null, - writingSuggestions: null, - - // Legacy. - // See: https://html.spec.whatwg.org/#other-elements,-attributes-and-apis - align: null, // Several. Use CSS `text-align` instead, - aLink: null, // ``. Use CSS `a:active {color}` instead - archive: types_spaceSeparated, // ``. List of URIs to archives - axis: null, // `` and ``. Use `scope` on `` - background: null, // ``. Use CSS `background-image` instead - bgColor: null, // `` and table elements. Use CSS `background-color` instead - border: types_number, // ``. Use CSS `border-width` instead, - borderColor: null, // `
`. Use CSS `border-color` instead, - bottomMargin: types_number, // `` - cellPadding: null, // `
` - cellSpacing: null, // `
` - char: null, // Several table elements. When `align=char`, sets the character to align on - charOff: null, // Several table elements. When `char`, offsets the alignment - classId: null, // `` - clear: null, // `
`. Use CSS `clear` instead - code: null, // `` - codeBase: null, // `` - codeType: null, // `` - color: null, // `` and `
`. Use CSS instead - compact: util_types_boolean, // Lists. Use CSS to reduce space between items instead - declare: util_types_boolean, // `` - event: null, // `\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationRawTagOpen(code) {\n if (code === 47) {\n effects.consume(code)\n buffer = ''\n return continuationRawEndTag\n }\n return continuation(code)\n }\n\n /**\n * In raw continuation, after ` | \n * ^^^^^^\n * ```\n *\n * @type {State}\n */\n function continuationRawEndTag(code) {\n if (code === 62) {\n const name = buffer.toLowerCase()\n if (htmlRawNames.includes(name)) {\n effects.consume(code)\n return continuationClose\n }\n return continuation(code)\n }\n if (asciiAlpha(code) && buffer.length < 8) {\n effects.consume(code)\n // @ts-expect-error: not null.\n buffer += String.fromCharCode(code)\n return continuationRawEndTag\n }\n return continuation(code)\n }\n\n /**\n * In cdata continuation, after `]`, expecting `]>`.\n *\n * ```markdown\n * > | &<]]>\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationCdataInside(code) {\n if (code === 93) {\n effects.consume(code)\n return continuationDeclarationInside\n }\n return continuation(code)\n }\n\n /**\n * In declaration or instruction continuation, at `>`.\n *\n * ```markdown\n * > | \n * ^\n * > | \n * ^\n * > | \n * ^\n * > | \n * ^\n * > | &<]]>\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationDeclarationInside(code) {\n if (code === 62) {\n effects.consume(code)\n return continuationClose\n }\n\n // More dashes.\n if (code === 45 && marker === 2) {\n effects.consume(code)\n return continuationDeclarationInside\n }\n return continuation(code)\n }\n\n /**\n * In closed continuation: everything we get until the eol/eof is part of it.\n *\n * ```markdown\n * > | \n * ^\n * ```\n *\n * @type {State}\n */\n function continuationClose(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('htmlFlowData')\n return continuationAfter(code)\n }\n effects.consume(code)\n return continuationClose\n }\n\n /**\n * Done.\n *\n * ```markdown\n * > | \n * ^\n * ```\n *\n * @type {State}\n */\n function continuationAfter(code) {\n effects.exit('htmlFlow')\n // // Feel free to interrupt.\n // tokenizer.interrupt = false\n // // No longer concrete.\n // tokenizer.concrete = false\n return ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuationStart(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * At eol, before continuation.\n *\n * ```markdown\n * > | * ```js\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n if (markdownLineEnding(code)) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return after\n }\n return nok(code)\n }\n\n /**\n * A continuation.\n *\n * ```markdown\n * | * ```js\n * > | b\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n return self.parser.lazy[self.now().line] ? nok(code) : ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeBlankLineBefore(effects, ok, nok) {\n return start\n\n /**\n * Before eol, expecting blank line.\n *\n * ```markdown\n * > |
\n * ^\n * |\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return effects.attempt(blankLine, ok, nok)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEnding, markdownSpace} from 'micromark-util-character'\n/** @type {Construct} */\nconst nonLazyContinuation = {\n tokenize: tokenizeNonLazyContinuation,\n partial: true\n}\n\n/** @type {Construct} */\nexport const codeFenced = {\n name: 'codeFenced',\n tokenize: tokenizeCodeFenced,\n concrete: true\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCodeFenced(effects, ok, nok) {\n const self = this\n /** @type {Construct} */\n const closeStart = {\n tokenize: tokenizeCloseStart,\n partial: true\n }\n let initialPrefix = 0\n let sizeOpen = 0\n /** @type {NonNullable} */\n let marker\n return start\n\n /**\n * Start of code.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // To do: parse whitespace like `markdown-rs`.\n return beforeSequenceOpen(code)\n }\n\n /**\n * In opening fence, after prefix, at sequence.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function beforeSequenceOpen(code) {\n const tail = self.events[self.events.length - 1]\n initialPrefix =\n tail && tail[1].type === 'linePrefix'\n ? tail[2].sliceSerialize(tail[1], true).length\n : 0\n marker = code\n effects.enter('codeFenced')\n effects.enter('codeFencedFence')\n effects.enter('codeFencedFenceSequence')\n return sequenceOpen(code)\n }\n\n /**\n * In opening fence sequence.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function sequenceOpen(code) {\n if (code === marker) {\n sizeOpen++\n effects.consume(code)\n return sequenceOpen\n }\n if (sizeOpen < 3) {\n return nok(code)\n }\n effects.exit('codeFencedFenceSequence')\n return markdownSpace(code)\n ? factorySpace(effects, infoBefore, 'whitespace')(code)\n : infoBefore(code)\n }\n\n /**\n * In opening fence, after the sequence (and optional whitespace), before info.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function infoBefore(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFencedFence')\n return self.interrupt\n ? ok(code)\n : effects.check(nonLazyContinuation, atNonLazyBreak, after)(code)\n }\n effects.enter('codeFencedFenceInfo')\n effects.enter('chunkString', {\n contentType: 'string'\n })\n return info(code)\n }\n\n /**\n * In info.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function info(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceInfo')\n return infoBefore(code)\n }\n if (markdownSpace(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceInfo')\n return factorySpace(effects, metaBefore, 'whitespace')(code)\n }\n if (code === 96 && code === marker) {\n return nok(code)\n }\n effects.consume(code)\n return info\n }\n\n /**\n * In opening fence, after info and whitespace, before meta.\n *\n * ```markdown\n * > | ~~~js eval\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function metaBefore(code) {\n if (code === null || markdownLineEnding(code)) {\n return infoBefore(code)\n }\n effects.enter('codeFencedFenceMeta')\n effects.enter('chunkString', {\n contentType: 'string'\n })\n return meta(code)\n }\n\n /**\n * In meta.\n *\n * ```markdown\n * > | ~~~js eval\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function meta(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceMeta')\n return infoBefore(code)\n }\n if (code === 96 && code === marker) {\n return nok(code)\n }\n effects.consume(code)\n return meta\n }\n\n /**\n * At eol/eof in code, before a non-lazy closing fence or content.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function atNonLazyBreak(code) {\n return effects.attempt(closeStart, after, contentBefore)(code)\n }\n\n /**\n * Before code content, not a closing fence, at eol.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentBefore(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return contentStart\n }\n\n /**\n * Before code content, not a closing fence.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentStart(code) {\n return initialPrefix > 0 && markdownSpace(code)\n ? factorySpace(\n effects,\n beforeContentChunk,\n 'linePrefix',\n initialPrefix + 1\n )(code)\n : beforeContentChunk(code)\n }\n\n /**\n * Before code content, after optional prefix.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function beforeContentChunk(code) {\n if (code === null || markdownLineEnding(code)) {\n return effects.check(nonLazyContinuation, atNonLazyBreak, after)(code)\n }\n effects.enter('codeFlowValue')\n return contentChunk(code)\n }\n\n /**\n * In code content.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^^^^^^^^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentChunk(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFlowValue')\n return beforeContentChunk(code)\n }\n effects.consume(code)\n return contentChunk\n }\n\n /**\n * After code.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n effects.exit('codeFenced')\n return ok(code)\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeCloseStart(effects, ok, nok) {\n let size = 0\n return startBefore\n\n /**\n *\n *\n * @type {State}\n */\n function startBefore(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return start\n }\n\n /**\n * Before closing fence, at optional whitespace.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // Always populated by defaults.\n\n // To do: `enter` here or in next state?\n effects.enter('codeFencedFence')\n return markdownSpace(code)\n ? factorySpace(\n effects,\n beforeSequenceClose,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n : beforeSequenceClose(code)\n }\n\n /**\n * In closing fence, after optional whitespace, at sequence.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function beforeSequenceClose(code) {\n if (code === marker) {\n effects.enter('codeFencedFenceSequence')\n return sequenceClose(code)\n }\n return nok(code)\n }\n\n /**\n * In closing fence sequence.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceClose(code) {\n if (code === marker) {\n size++\n effects.consume(code)\n return sequenceClose\n }\n if (size >= sizeOpen) {\n effects.exit('codeFencedFenceSequence')\n return markdownSpace(code)\n ? factorySpace(effects, sequenceCloseAfter, 'whitespace')(code)\n : sequenceCloseAfter(code)\n }\n return nok(code)\n }\n\n /**\n * After closing fence sequence, after optional whitespace.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceCloseAfter(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFencedFence')\n return ok(code)\n }\n return nok(code)\n }\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuation(effects, ok, nok) {\n const self = this\n return start\n\n /**\n *\n *\n * @type {State}\n */\n function start(code) {\n if (code === null) {\n return nok(code)\n }\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return lineStart\n }\n\n /**\n *\n *\n * @type {State}\n */\n function lineStart(code) {\n return self.parser.lazy[self.now().line] ? nok(code) : ok(code)\n }\n}\n","/**\n * Map of named character references.\n *\n * @type {Record}\n */\nexport const characterEntities = {\n AElig: 'Æ',\n AMP: '&',\n Aacute: 'Á',\n Abreve: 'Ă',\n Acirc: 'Â',\n Acy: 'А',\n Afr: '𝔄',\n Agrave: 'À',\n Alpha: 'Α',\n Amacr: 'Ā',\n And: '⩓',\n Aogon: 'Ą',\n Aopf: '𝔸',\n ApplyFunction: '⁡',\n Aring: 'Å',\n Ascr: '𝒜',\n Assign: '≔',\n Atilde: 'Ã',\n Auml: 'Ä',\n Backslash: '∖',\n Barv: '⫧',\n Barwed: '⌆',\n Bcy: 'Б',\n Because: '∵',\n Bernoullis: 'ℬ',\n Beta: 'Β',\n Bfr: '𝔅',\n Bopf: '𝔹',\n Breve: '˘',\n Bscr: 'ℬ',\n Bumpeq: '≎',\n CHcy: 'Ч',\n COPY: '©',\n Cacute: 'Ć',\n Cap: '⋒',\n CapitalDifferentialD: 'ⅅ',\n Cayleys: 'ℭ',\n Ccaron: 'Č',\n Ccedil: 'Ç',\n Ccirc: 'Ĉ',\n Cconint: '∰',\n Cdot: 'Ċ',\n Cedilla: '¸',\n CenterDot: '·',\n Cfr: 'ℭ',\n Chi: 'Χ',\n CircleDot: '⊙',\n CircleMinus: '⊖',\n CirclePlus: '⊕',\n CircleTimes: '⊗',\n ClockwiseContourIntegral: '∲',\n CloseCurlyDoubleQuote: '”',\n CloseCurlyQuote: '’',\n Colon: '∷',\n Colone: '⩴',\n Congruent: '≡',\n Conint: '∯',\n ContourIntegral: '∮',\n Copf: 'ℂ',\n Coproduct: '∐',\n CounterClockwiseContourIntegral: '∳',\n Cross: '⨯',\n Cscr: '𝒞',\n Cup: '⋓',\n CupCap: '≍',\n DD: 'ⅅ',\n DDotrahd: '⤑',\n DJcy: 'Ђ',\n DScy: 'Ѕ',\n DZcy: 'Џ',\n Dagger: '‡',\n Darr: '↡',\n Dashv: '⫤',\n Dcaron: 'Ď',\n Dcy: 'Д',\n Del: '∇',\n Delta: 'Δ',\n Dfr: '𝔇',\n DiacriticalAcute: '´',\n DiacriticalDot: '˙',\n DiacriticalDoubleAcute: '˝',\n DiacriticalGrave: '`',\n DiacriticalTilde: '˜',\n Diamond: '⋄',\n DifferentialD: 'ⅆ',\n Dopf: '𝔻',\n Dot: '¨',\n DotDot: '⃜',\n DotEqual: '≐',\n DoubleContourIntegral: '∯',\n DoubleDot: '¨',\n DoubleDownArrow: '⇓',\n DoubleLeftArrow: '⇐',\n DoubleLeftRightArrow: '⇔',\n DoubleLeftTee: '⫤',\n DoubleLongLeftArrow: '⟸',\n DoubleLongLeftRightArrow: '⟺',\n DoubleLongRightArrow: '⟹',\n DoubleRightArrow: '⇒',\n DoubleRightTee: '⊨',\n DoubleUpArrow: '⇑',\n DoubleUpDownArrow: '⇕',\n DoubleVerticalBar: '∥',\n DownArrow: '↓',\n DownArrowBar: '⤓',\n DownArrowUpArrow: '⇵',\n DownBreve: '̑',\n DownLeftRightVector: '⥐',\n DownLeftTeeVector: '⥞',\n DownLeftVector: '↽',\n DownLeftVectorBar: '⥖',\n DownRightTeeVector: '⥟',\n DownRightVector: '⇁',\n DownRightVectorBar: '⥗',\n DownTee: '⊤',\n DownTeeArrow: '↧',\n Downarrow: '⇓',\n Dscr: '𝒟',\n Dstrok: 'Đ',\n ENG: 'Ŋ',\n ETH: 'Ð',\n Eacute: 'É',\n Ecaron: 'Ě',\n Ecirc: 'Ê',\n Ecy: 'Э',\n Edot: 'Ė',\n Efr: '𝔈',\n Egrave: 'È',\n Element: '∈',\n Emacr: 'Ē',\n EmptySmallSquare: '◻',\n EmptyVerySmallSquare: '▫',\n Eogon: 'Ę',\n Eopf: '𝔼',\n Epsilon: 'Ε',\n Equal: '⩵',\n EqualTilde: '≂',\n Equilibrium: '⇌',\n Escr: 'ℰ',\n Esim: '⩳',\n Eta: 'Η',\n Euml: 'Ë',\n Exists: '∃',\n ExponentialE: 'ⅇ',\n Fcy: 'Ф',\n Ffr: '𝔉',\n FilledSmallSquare: '◼',\n FilledVerySmallSquare: '▪',\n Fopf: '𝔽',\n ForAll: '∀',\n Fouriertrf: 'ℱ',\n Fscr: 'ℱ',\n GJcy: 'Ѓ',\n GT: '>',\n Gamma: 'Γ',\n Gammad: 'Ϝ',\n Gbreve: 'Ğ',\n Gcedil: 'Ģ',\n Gcirc: 'Ĝ',\n Gcy: 'Г',\n Gdot: 'Ġ',\n Gfr: '𝔊',\n Gg: '⋙',\n Gopf: '𝔾',\n GreaterEqual: '≥',\n GreaterEqualLess: '⋛',\n GreaterFullEqual: '≧',\n GreaterGreater: '⪢',\n GreaterLess: '≷',\n GreaterSlantEqual: '⩾',\n GreaterTilde: '≳',\n Gscr: '𝒢',\n Gt: '≫',\n HARDcy: 'Ъ',\n Hacek: 'ˇ',\n Hat: '^',\n Hcirc: 'Ĥ',\n Hfr: 'ℌ',\n HilbertSpace: 'ℋ',\n Hopf: 'ℍ',\n HorizontalLine: '─',\n Hscr: 'ℋ',\n Hstrok: 'Ħ',\n HumpDownHump: '≎',\n HumpEqual: '≏',\n IEcy: 'Е',\n IJlig: 'IJ',\n IOcy: 'Ё',\n Iacute: 'Í',\n Icirc: 'Î',\n Icy: 'И',\n Idot: 'İ',\n Ifr: 'ℑ',\n Igrave: 'Ì',\n Im: 'ℑ',\n Imacr: 'Ī',\n ImaginaryI: 'ⅈ',\n Implies: '⇒',\n Int: '∬',\n Integral: '∫',\n Intersection: '⋂',\n InvisibleComma: '⁣',\n InvisibleTimes: '⁢',\n Iogon: 'Į',\n Iopf: '𝕀',\n Iota: 'Ι',\n Iscr: 'ℐ',\n Itilde: 'Ĩ',\n Iukcy: 'І',\n Iuml: 'Ï',\n Jcirc: 'Ĵ',\n Jcy: 'Й',\n Jfr: '𝔍',\n Jopf: '𝕁',\n Jscr: '𝒥',\n Jsercy: 'Ј',\n Jukcy: 'Є',\n KHcy: 'Х',\n KJcy: 'Ќ',\n Kappa: 'Κ',\n Kcedil: 'Ķ',\n Kcy: 'К',\n Kfr: '𝔎',\n Kopf: '𝕂',\n Kscr: '𝒦',\n LJcy: 'Љ',\n LT: '<',\n Lacute: 'Ĺ',\n Lambda: 'Λ',\n Lang: '⟪',\n Laplacetrf: 'ℒ',\n Larr: '↞',\n Lcaron: 'Ľ',\n Lcedil: 'Ļ',\n Lcy: 'Л',\n LeftAngleBracket: '⟨',\n LeftArrow: '←',\n LeftArrowBar: '⇤',\n LeftArrowRightArrow: '⇆',\n LeftCeiling: '⌈',\n LeftDoubleBracket: '⟦',\n LeftDownTeeVector: '⥡',\n LeftDownVector: '⇃',\n LeftDownVectorBar: '⥙',\n LeftFloor: '⌊',\n LeftRightArrow: '↔',\n LeftRightVector: '⥎',\n LeftTee: '⊣',\n LeftTeeArrow: '↤',\n LeftTeeVector: '⥚',\n LeftTriangle: '⊲',\n LeftTriangleBar: '⧏',\n LeftTriangleEqual: '⊴',\n LeftUpDownVector: '⥑',\n LeftUpTeeVector: '⥠',\n LeftUpVector: '↿',\n LeftUpVectorBar: '⥘',\n LeftVector: '↼',\n LeftVectorBar: '⥒',\n Leftarrow: '⇐',\n Leftrightarrow: '⇔',\n LessEqualGreater: '⋚',\n LessFullEqual: '≦',\n LessGreater: '≶',\n LessLess: '⪡',\n LessSlantEqual: '⩽',\n LessTilde: '≲',\n Lfr: '𝔏',\n Ll: '⋘',\n Lleftarrow: '⇚',\n Lmidot: 'Ŀ',\n LongLeftArrow: '⟵',\n LongLeftRightArrow: '⟷',\n LongRightArrow: '⟶',\n Longleftarrow: '⟸',\n Longleftrightarrow: '⟺',\n Longrightarrow: '⟹',\n Lopf: '𝕃',\n LowerLeftArrow: '↙',\n LowerRightArrow: '↘',\n Lscr: 'ℒ',\n Lsh: '↰',\n Lstrok: 'Ł',\n Lt: '≪',\n Map: '⤅',\n Mcy: 'М',\n MediumSpace: ' ',\n Mellintrf: 'ℳ',\n Mfr: '𝔐',\n MinusPlus: '∓',\n Mopf: '𝕄',\n Mscr: 'ℳ',\n Mu: 'Μ',\n NJcy: 'Њ',\n Nacute: 'Ń',\n Ncaron: 'Ň',\n Ncedil: 'Ņ',\n Ncy: 'Н',\n NegativeMediumSpace: '​',\n NegativeThickSpace: '​',\n NegativeThinSpace: '​',\n NegativeVeryThinSpace: '​',\n NestedGreaterGreater: '≫',\n NestedLessLess: '≪',\n NewLine: '\\n',\n Nfr: '𝔑',\n NoBreak: '⁠',\n NonBreakingSpace: ' ',\n Nopf: 'ℕ',\n Not: '⫬',\n NotCongruent: '≢',\n NotCupCap: '≭',\n NotDoubleVerticalBar: '∦',\n NotElement: '∉',\n NotEqual: '≠',\n NotEqualTilde: '≂̸',\n NotExists: '∄',\n NotGreater: '≯',\n NotGreaterEqual: '≱',\n NotGreaterFullEqual: '≧̸',\n NotGreaterGreater: '≫̸',\n NotGreaterLess: '≹',\n NotGreaterSlantEqual: '⩾̸',\n NotGreaterTilde: '≵',\n NotHumpDownHump: '≎̸',\n NotHumpEqual: '≏̸',\n NotLeftTriangle: '⋪',\n NotLeftTriangleBar: '⧏̸',\n NotLeftTriangleEqual: '⋬',\n NotLess: '≮',\n NotLessEqual: '≰',\n NotLessGreater: '≸',\n NotLessLess: '≪̸',\n NotLessSlantEqual: '⩽̸',\n NotLessTilde: '≴',\n NotNestedGreaterGreater: '⪢̸',\n NotNestedLessLess: '⪡̸',\n NotPrecedes: '⊀',\n NotPrecedesEqual: '⪯̸',\n NotPrecedesSlantEqual: '⋠',\n NotReverseElement: '∌',\n NotRightTriangle: '⋫',\n NotRightTriangleBar: '⧐̸',\n NotRightTriangleEqual: '⋭',\n NotSquareSubset: '⊏̸',\n NotSquareSubsetEqual: '⋢',\n NotSquareSuperset: '⊐̸',\n NotSquareSupersetEqual: '⋣',\n NotSubset: '⊂⃒',\n NotSubsetEqual: '⊈',\n NotSucceeds: '⊁',\n NotSucceedsEqual: '⪰̸',\n NotSucceedsSlantEqual: '⋡',\n NotSucceedsTilde: '≿̸',\n NotSuperset: '⊃⃒',\n NotSupersetEqual: '⊉',\n NotTilde: '≁',\n NotTildeEqual: '≄',\n NotTildeFullEqual: '≇',\n NotTildeTilde: '≉',\n NotVerticalBar: '∤',\n Nscr: '𝒩',\n Ntilde: 'Ñ',\n Nu: 'Ν',\n OElig: 'Œ',\n Oacute: 'Ó',\n Ocirc: 'Ô',\n Ocy: 'О',\n Odblac: 'Ő',\n Ofr: '𝔒',\n Ograve: 'Ò',\n Omacr: 'Ō',\n Omega: 'Ω',\n Omicron: 'Ο',\n Oopf: '𝕆',\n OpenCurlyDoubleQuote: '“',\n OpenCurlyQuote: '‘',\n Or: '⩔',\n Oscr: '𝒪',\n Oslash: 'Ø',\n Otilde: 'Õ',\n Otimes: '⨷',\n Ouml: 'Ö',\n OverBar: '‾',\n OverBrace: '⏞',\n OverBracket: '⎴',\n OverParenthesis: '⏜',\n PartialD: '∂',\n Pcy: 'П',\n Pfr: '𝔓',\n Phi: 'Φ',\n Pi: 'Π',\n PlusMinus: '±',\n Poincareplane: 'ℌ',\n Popf: 'ℙ',\n Pr: '⪻',\n Precedes: '≺',\n PrecedesEqual: '⪯',\n PrecedesSlantEqual: '≼',\n PrecedesTilde: '≾',\n Prime: '″',\n Product: '∏',\n Proportion: '∷',\n Proportional: '∝',\n Pscr: '𝒫',\n Psi: 'Ψ',\n QUOT: '\"',\n Qfr: '𝔔',\n Qopf: 'ℚ',\n Qscr: '𝒬',\n RBarr: '⤐',\n REG: '®',\n Racute: 'Ŕ',\n Rang: '⟫',\n Rarr: '↠',\n Rarrtl: '⤖',\n Rcaron: 'Ř',\n Rcedil: 'Ŗ',\n Rcy: 'Р',\n Re: 'ℜ',\n ReverseElement: '∋',\n ReverseEquilibrium: '⇋',\n ReverseUpEquilibrium: '⥯',\n Rfr: 'ℜ',\n Rho: 'Ρ',\n RightAngleBracket: '⟩',\n RightArrow: '→',\n RightArrowBar: '⇥',\n RightArrowLeftArrow: '⇄',\n RightCeiling: '⌉',\n RightDoubleBracket: '⟧',\n RightDownTeeVector: '⥝',\n RightDownVector: '⇂',\n RightDownVectorBar: '⥕',\n RightFloor: '⌋',\n RightTee: '⊢',\n RightTeeArrow: '↦',\n RightTeeVector: '⥛',\n RightTriangle: '⊳',\n RightTriangleBar: '⧐',\n RightTriangleEqual: '⊵',\n RightUpDownVector: '⥏',\n RightUpTeeVector: '⥜',\n RightUpVector: '↾',\n RightUpVectorBar: '⥔',\n RightVector: '⇀',\n RightVectorBar: '⥓',\n Rightarrow: '⇒',\n Ropf: 'ℝ',\n RoundImplies: '⥰',\n Rrightarrow: '⇛',\n Rscr: 'ℛ',\n Rsh: '↱',\n RuleDelayed: '⧴',\n SHCHcy: 'Щ',\n SHcy: 'Ш',\n SOFTcy: 'Ь',\n Sacute: 'Ś',\n Sc: '⪼',\n Scaron: 'Š',\n Scedil: 'Ş',\n Scirc: 'Ŝ',\n Scy: 'С',\n Sfr: '𝔖',\n ShortDownArrow: '↓',\n ShortLeftArrow: '←',\n ShortRightArrow: '→',\n ShortUpArrow: '↑',\n Sigma: 'Σ',\n SmallCircle: '∘',\n Sopf: '𝕊',\n Sqrt: '√',\n Square: '□',\n SquareIntersection: '⊓',\n SquareSubset: '⊏',\n SquareSubsetEqual: '⊑',\n SquareSuperset: '⊐',\n SquareSupersetEqual: '⊒',\n SquareUnion: '⊔',\n Sscr: '𝒮',\n Star: '⋆',\n Sub: '⋐',\n Subset: '⋐',\n SubsetEqual: '⊆',\n Succeeds: '≻',\n SucceedsEqual: '⪰',\n SucceedsSlantEqual: '≽',\n SucceedsTilde: '≿',\n SuchThat: '∋',\n Sum: '∑',\n Sup: '⋑',\n Superset: '⊃',\n SupersetEqual: '⊇',\n Supset: '⋑',\n THORN: 'Þ',\n TRADE: '™',\n TSHcy: 'Ћ',\n TScy: 'Ц',\n Tab: '\\t',\n Tau: 'Τ',\n Tcaron: 'Ť',\n Tcedil: 'Ţ',\n Tcy: 'Т',\n Tfr: '𝔗',\n Therefore: '∴',\n Theta: 'Θ',\n ThickSpace: '  ',\n ThinSpace: ' ',\n Tilde: '∼',\n TildeEqual: '≃',\n TildeFullEqual: '≅',\n TildeTilde: '≈',\n Topf: '𝕋',\n TripleDot: '⃛',\n Tscr: '𝒯',\n Tstrok: 'Ŧ',\n Uacute: 'Ú',\n Uarr: '↟',\n Uarrocir: '⥉',\n Ubrcy: 'Ў',\n Ubreve: 'Ŭ',\n Ucirc: 'Û',\n Ucy: 'У',\n Udblac: 'Ű',\n Ufr: '𝔘',\n Ugrave: 'Ù',\n Umacr: 'Ū',\n UnderBar: '_',\n UnderBrace: '⏟',\n UnderBracket: '⎵',\n UnderParenthesis: '⏝',\n Union: '⋃',\n UnionPlus: '⊎',\n Uogon: 'Ų',\n Uopf: '𝕌',\n UpArrow: '↑',\n UpArrowBar: '⤒',\n UpArrowDownArrow: '⇅',\n UpDownArrow: '↕',\n UpEquilibrium: '⥮',\n UpTee: '⊥',\n UpTeeArrow: '↥',\n Uparrow: '⇑',\n Updownarrow: '⇕',\n UpperLeftArrow: '↖',\n UpperRightArrow: '↗',\n Upsi: 'ϒ',\n Upsilon: 'Υ',\n Uring: 'Ů',\n Uscr: '𝒰',\n Utilde: 'Ũ',\n Uuml: 'Ü',\n VDash: '⊫',\n Vbar: '⫫',\n Vcy: 'В',\n Vdash: '⊩',\n Vdashl: '⫦',\n Vee: '⋁',\n Verbar: '‖',\n Vert: '‖',\n VerticalBar: '∣',\n VerticalLine: '|',\n VerticalSeparator: '❘',\n VerticalTilde: '≀',\n VeryThinSpace: ' ',\n Vfr: '𝔙',\n Vopf: '𝕍',\n Vscr: '𝒱',\n Vvdash: '⊪',\n Wcirc: 'Ŵ',\n Wedge: '⋀',\n Wfr: '𝔚',\n Wopf: '𝕎',\n Wscr: '𝒲',\n Xfr: '𝔛',\n Xi: 'Ξ',\n Xopf: '𝕏',\n Xscr: '𝒳',\n YAcy: 'Я',\n YIcy: 'Ї',\n YUcy: 'Ю',\n Yacute: 'Ý',\n Ycirc: 'Ŷ',\n Ycy: 'Ы',\n Yfr: '𝔜',\n Yopf: '𝕐',\n Yscr: '𝒴',\n Yuml: 'Ÿ',\n ZHcy: 'Ж',\n Zacute: 'Ź',\n Zcaron: 'Ž',\n Zcy: 'З',\n Zdot: 'Ż',\n ZeroWidthSpace: '​',\n Zeta: 'Ζ',\n Zfr: 'ℨ',\n Zopf: 'ℤ',\n Zscr: '𝒵',\n aacute: 'á',\n abreve: 'ă',\n ac: '∾',\n acE: '∾̳',\n acd: '∿',\n acirc: 'â',\n acute: '´',\n acy: 'а',\n aelig: 'æ',\n af: '⁡',\n afr: '𝔞',\n agrave: 'à',\n alefsym: 'ℵ',\n aleph: 'ℵ',\n alpha: 'α',\n amacr: 'ā',\n amalg: '⨿',\n amp: '&',\n and: '∧',\n andand: '⩕',\n andd: '⩜',\n andslope: '⩘',\n andv: '⩚',\n ang: '∠',\n ange: '⦤',\n angle: '∠',\n angmsd: '∡',\n angmsdaa: '⦨',\n angmsdab: '⦩',\n angmsdac: '⦪',\n angmsdad: '⦫',\n angmsdae: '⦬',\n angmsdaf: '⦭',\n angmsdag: '⦮',\n angmsdah: '⦯',\n angrt: '∟',\n angrtvb: '⊾',\n angrtvbd: '⦝',\n angsph: '∢',\n angst: 'Å',\n angzarr: '⍼',\n aogon: 'ą',\n aopf: '𝕒',\n ap: '≈',\n apE: '⩰',\n apacir: '⩯',\n ape: '≊',\n apid: '≋',\n apos: \"'\",\n approx: '≈',\n approxeq: '≊',\n aring: 'å',\n ascr: '𝒶',\n ast: '*',\n asymp: '≈',\n asympeq: '≍',\n atilde: 'ã',\n auml: 'ä',\n awconint: '∳',\n awint: '⨑',\n bNot: '⫭',\n backcong: '≌',\n backepsilon: '϶',\n backprime: '‵',\n backsim: '∽',\n backsimeq: '⋍',\n barvee: '⊽',\n barwed: '⌅',\n barwedge: '⌅',\n bbrk: '⎵',\n bbrktbrk: '⎶',\n bcong: '≌',\n bcy: 'б',\n bdquo: '„',\n becaus: '∵',\n because: '∵',\n bemptyv: '⦰',\n bepsi: '϶',\n bernou: 'ℬ',\n beta: 'β',\n beth: 'ℶ',\n between: '≬',\n bfr: '𝔟',\n bigcap: '⋂',\n bigcirc: '◯',\n bigcup: '⋃',\n bigodot: '⨀',\n bigoplus: '⨁',\n bigotimes: '⨂',\n bigsqcup: '⨆',\n bigstar: '★',\n bigtriangledown: '▽',\n bigtriangleup: '△',\n biguplus: '⨄',\n bigvee: '⋁',\n bigwedge: '⋀',\n bkarow: '⤍',\n blacklozenge: '⧫',\n blacksquare: '▪',\n blacktriangle: '▴',\n blacktriangledown: '▾',\n blacktriangleleft: '◂',\n blacktriangleright: '▸',\n blank: '␣',\n blk12: '▒',\n blk14: '░',\n blk34: '▓',\n block: '█',\n bne: '=⃥',\n bnequiv: '≡⃥',\n bnot: '⌐',\n bopf: '𝕓',\n bot: '⊥',\n bottom: '⊥',\n bowtie: '⋈',\n boxDL: '╗',\n boxDR: '╔',\n boxDl: '╖',\n boxDr: '╓',\n boxH: '═',\n boxHD: '╦',\n boxHU: '╩',\n boxHd: '╤',\n boxHu: '╧',\n boxUL: '╝',\n boxUR: '╚',\n boxUl: '╜',\n boxUr: '╙',\n boxV: '║',\n boxVH: '╬',\n boxVL: '╣',\n boxVR: '╠',\n boxVh: '╫',\n boxVl: '╢',\n boxVr: '╟',\n boxbox: '⧉',\n boxdL: '╕',\n boxdR: '╒',\n boxdl: '┐',\n boxdr: '┌',\n boxh: '─',\n boxhD: '╥',\n boxhU: '╨',\n boxhd: '┬',\n boxhu: '┴',\n boxminus: '⊟',\n boxplus: '⊞',\n boxtimes: '⊠',\n boxuL: '╛',\n boxuR: '╘',\n boxul: '┘',\n boxur: '└',\n boxv: '│',\n boxvH: '╪',\n boxvL: '╡',\n boxvR: '╞',\n boxvh: '┼',\n boxvl: '┤',\n boxvr: '├',\n bprime: '‵',\n breve: '˘',\n brvbar: '¦',\n bscr: '𝒷',\n bsemi: '⁏',\n bsim: '∽',\n bsime: '⋍',\n bsol: '\\\\',\n bsolb: '⧅',\n bsolhsub: '⟈',\n bull: '•',\n bullet: '•',\n bump: '≎',\n bumpE: '⪮',\n bumpe: '≏',\n bumpeq: '≏',\n cacute: 'ć',\n cap: '∩',\n capand: '⩄',\n capbrcup: '⩉',\n capcap: '⩋',\n capcup: '⩇',\n capdot: '⩀',\n caps: '∩︀',\n caret: '⁁',\n caron: 'ˇ',\n ccaps: '⩍',\n ccaron: 'č',\n ccedil: 'ç',\n ccirc: 'ĉ',\n ccups: '⩌',\n ccupssm: '⩐',\n cdot: 'ċ',\n cedil: '¸',\n cemptyv: '⦲',\n cent: '¢',\n centerdot: '·',\n cfr: '𝔠',\n chcy: 'ч',\n check: '✓',\n checkmark: '✓',\n chi: 'χ',\n cir: '○',\n cirE: '⧃',\n circ: 'ˆ',\n circeq: '≗',\n circlearrowleft: '↺',\n circlearrowright: '↻',\n circledR: '®',\n circledS: 'Ⓢ',\n circledast: '⊛',\n circledcirc: '⊚',\n circleddash: '⊝',\n cire: '≗',\n cirfnint: '⨐',\n cirmid: '⫯',\n cirscir: '⧂',\n clubs: '♣',\n clubsuit: '♣',\n colon: ':',\n colone: '≔',\n coloneq: '≔',\n comma: ',',\n commat: '@',\n comp: '∁',\n compfn: '∘',\n complement: '∁',\n complexes: 'ℂ',\n cong: '≅',\n congdot: '⩭',\n conint: '∮',\n copf: '𝕔',\n coprod: '∐',\n copy: '©',\n copysr: '℗',\n crarr: '↵',\n cross: '✗',\n cscr: '𝒸',\n csub: '⫏',\n csube: '⫑',\n csup: '⫐',\n csupe: '⫒',\n ctdot: '⋯',\n cudarrl: '⤸',\n cudarrr: '⤵',\n cuepr: '⋞',\n cuesc: '⋟',\n cularr: '↶',\n cularrp: '⤽',\n cup: '∪',\n cupbrcap: '⩈',\n cupcap: '⩆',\n cupcup: '⩊',\n cupdot: '⊍',\n cupor: '⩅',\n cups: '∪︀',\n curarr: '↷',\n curarrm: '⤼',\n curlyeqprec: '⋞',\n curlyeqsucc: '⋟',\n curlyvee: '⋎',\n curlywedge: '⋏',\n curren: '¤',\n curvearrowleft: '↶',\n curvearrowright: '↷',\n cuvee: '⋎',\n cuwed: '⋏',\n cwconint: '∲',\n cwint: '∱',\n cylcty: '⌭',\n dArr: '⇓',\n dHar: '⥥',\n dagger: '†',\n daleth: 'ℸ',\n darr: '↓',\n dash: '‐',\n dashv: '⊣',\n dbkarow: '⤏',\n dblac: '˝',\n dcaron: 'ď',\n dcy: 'д',\n dd: 'ⅆ',\n ddagger: '‡',\n ddarr: '⇊',\n ddotseq: '⩷',\n deg: '°',\n delta: 'δ',\n demptyv: '⦱',\n dfisht: '⥿',\n dfr: '𝔡',\n dharl: '⇃',\n dharr: '⇂',\n diam: '⋄',\n diamond: '⋄',\n diamondsuit: '♦',\n diams: '♦',\n die: '¨',\n digamma: 'ϝ',\n disin: '⋲',\n div: '÷',\n divide: '÷',\n divideontimes: '⋇',\n divonx: '⋇',\n djcy: 'ђ',\n dlcorn: '⌞',\n dlcrop: '⌍',\n dollar: '$',\n dopf: '𝕕',\n dot: '˙',\n doteq: '≐',\n doteqdot: '≑',\n dotminus: '∸',\n dotplus: '∔',\n dotsquare: '⊡',\n doublebarwedge: '⌆',\n downarrow: '↓',\n downdownarrows: '⇊',\n downharpoonleft: '⇃',\n downharpoonright: '⇂',\n drbkarow: '⤐',\n drcorn: '⌟',\n drcrop: '⌌',\n dscr: '𝒹',\n dscy: 'ѕ',\n dsol: '⧶',\n dstrok: 'đ',\n dtdot: '⋱',\n dtri: '▿',\n dtrif: '▾',\n duarr: '⇵',\n duhar: '⥯',\n dwangle: '⦦',\n dzcy: 'џ',\n dzigrarr: '⟿',\n eDDot: '⩷',\n eDot: '≑',\n eacute: 'é',\n easter: '⩮',\n ecaron: 'ě',\n ecir: '≖',\n ecirc: 'ê',\n ecolon: '≕',\n ecy: 'э',\n edot: 'ė',\n ee: 'ⅇ',\n efDot: '≒',\n efr: '𝔢',\n eg: '⪚',\n egrave: 'è',\n egs: '⪖',\n egsdot: '⪘',\n el: '⪙',\n elinters: '⏧',\n ell: 'ℓ',\n els: '⪕',\n elsdot: '⪗',\n emacr: 'ē',\n empty: '∅',\n emptyset: '∅',\n emptyv: '∅',\n emsp13: ' ',\n emsp14: ' ',\n emsp: ' ',\n eng: 'ŋ',\n ensp: ' ',\n eogon: 'ę',\n eopf: '𝕖',\n epar: '⋕',\n eparsl: '⧣',\n eplus: '⩱',\n epsi: 'ε',\n epsilon: 'ε',\n epsiv: 'ϵ',\n eqcirc: '≖',\n eqcolon: '≕',\n eqsim: '≂',\n eqslantgtr: '⪖',\n eqslantless: '⪕',\n equals: '=',\n equest: '≟',\n equiv: '≡',\n equivDD: '⩸',\n eqvparsl: '⧥',\n erDot: '≓',\n erarr: '⥱',\n escr: 'ℯ',\n esdot: '≐',\n esim: '≂',\n eta: 'η',\n eth: 'ð',\n euml: 'ë',\n euro: '€',\n excl: '!',\n exist: '∃',\n expectation: 'ℰ',\n exponentiale: 'ⅇ',\n fallingdotseq: '≒',\n fcy: 'ф',\n female: '♀',\n ffilig: 'ffi',\n fflig: 'ff',\n ffllig: 'ffl',\n ffr: '𝔣',\n filig: 'fi',\n fjlig: 'fj',\n flat: '♭',\n fllig: 'fl',\n fltns: '▱',\n fnof: 'ƒ',\n fopf: '𝕗',\n forall: '∀',\n fork: '⋔',\n forkv: '⫙',\n fpartint: '⨍',\n frac12: '½',\n frac13: '⅓',\n frac14: '¼',\n frac15: '⅕',\n frac16: '⅙',\n frac18: '⅛',\n frac23: '⅔',\n frac25: '⅖',\n frac34: '¾',\n frac35: '⅗',\n frac38: '⅜',\n frac45: '⅘',\n frac56: '⅚',\n frac58: '⅝',\n frac78: '⅞',\n frasl: '⁄',\n frown: '⌢',\n fscr: '𝒻',\n gE: '≧',\n gEl: '⪌',\n gacute: 'ǵ',\n gamma: 'γ',\n gammad: 'ϝ',\n gap: '⪆',\n gbreve: 'ğ',\n gcirc: 'ĝ',\n gcy: 'г',\n gdot: 'ġ',\n ge: '≥',\n gel: '⋛',\n geq: '≥',\n geqq: '≧',\n geqslant: '⩾',\n ges: '⩾',\n gescc: '⪩',\n gesdot: '⪀',\n gesdoto: '⪂',\n gesdotol: '⪄',\n gesl: '⋛︀',\n gesles: '⪔',\n gfr: '𝔤',\n gg: '≫',\n ggg: '⋙',\n gimel: 'ℷ',\n gjcy: 'ѓ',\n gl: '≷',\n glE: '⪒',\n gla: '⪥',\n glj: '⪤',\n gnE: '≩',\n gnap: '⪊',\n gnapprox: '⪊',\n gne: '⪈',\n gneq: '⪈',\n gneqq: '≩',\n gnsim: '⋧',\n gopf: '𝕘',\n grave: '`',\n gscr: 'ℊ',\n gsim: '≳',\n gsime: '⪎',\n gsiml: '⪐',\n gt: '>',\n gtcc: '⪧',\n gtcir: '⩺',\n gtdot: '⋗',\n gtlPar: '⦕',\n gtquest: '⩼',\n gtrapprox: '⪆',\n gtrarr: '⥸',\n gtrdot: '⋗',\n gtreqless: '⋛',\n gtreqqless: '⪌',\n gtrless: '≷',\n gtrsim: '≳',\n gvertneqq: '≩︀',\n gvnE: '≩︀',\n hArr: '⇔',\n hairsp: ' ',\n half: '½',\n hamilt: 'ℋ',\n hardcy: 'ъ',\n harr: '↔',\n harrcir: '⥈',\n harrw: '↭',\n hbar: 'ℏ',\n hcirc: 'ĥ',\n hearts: '♥',\n heartsuit: '♥',\n hellip: '…',\n hercon: '⊹',\n hfr: '𝔥',\n hksearow: '⤥',\n hkswarow: '⤦',\n hoarr: '⇿',\n homtht: '∻',\n hookleftarrow: '↩',\n hookrightarrow: '↪',\n hopf: '𝕙',\n horbar: '―',\n hscr: '𝒽',\n hslash: 'ℏ',\n hstrok: 'ħ',\n hybull: '⁃',\n hyphen: '‐',\n iacute: 'í',\n ic: '⁣',\n icirc: 'î',\n icy: 'и',\n iecy: 'е',\n iexcl: '¡',\n iff: '⇔',\n ifr: '𝔦',\n igrave: 'ì',\n ii: 'ⅈ',\n iiiint: '⨌',\n iiint: '∭',\n iinfin: '⧜',\n iiota: '℩',\n ijlig: 'ij',\n imacr: 'ī',\n image: 'ℑ',\n imagline: 'ℐ',\n imagpart: 'ℑ',\n imath: 'ı',\n imof: '⊷',\n imped: 'Ƶ',\n in: '∈',\n incare: '℅',\n infin: '∞',\n infintie: '⧝',\n inodot: 'ı',\n int: '∫',\n intcal: '⊺',\n integers: 'ℤ',\n intercal: '⊺',\n intlarhk: '⨗',\n intprod: '⨼',\n iocy: 'ё',\n iogon: 'į',\n iopf: '𝕚',\n iota: 'ι',\n iprod: '⨼',\n iquest: '¿',\n iscr: '𝒾',\n isin: '∈',\n isinE: '⋹',\n isindot: '⋵',\n isins: '⋴',\n isinsv: '⋳',\n isinv: '∈',\n it: '⁢',\n itilde: 'ĩ',\n iukcy: 'і',\n iuml: 'ï',\n jcirc: 'ĵ',\n jcy: 'й',\n jfr: '𝔧',\n jmath: 'ȷ',\n jopf: '𝕛',\n jscr: '𝒿',\n jsercy: 'ј',\n jukcy: 'є',\n kappa: 'κ',\n kappav: 'ϰ',\n kcedil: 'ķ',\n kcy: 'к',\n kfr: '𝔨',\n kgreen: 'ĸ',\n khcy: 'х',\n kjcy: 'ќ',\n kopf: '𝕜',\n kscr: '𝓀',\n lAarr: '⇚',\n lArr: '⇐',\n lAtail: '⤛',\n lBarr: '⤎',\n lE: '≦',\n lEg: '⪋',\n lHar: '⥢',\n lacute: 'ĺ',\n laemptyv: '⦴',\n lagran: 'ℒ',\n lambda: 'λ',\n lang: '⟨',\n langd: '⦑',\n langle: '⟨',\n lap: '⪅',\n laquo: '«',\n larr: '←',\n larrb: '⇤',\n larrbfs: '⤟',\n larrfs: '⤝',\n larrhk: '↩',\n larrlp: '↫',\n larrpl: '⤹',\n larrsim: '⥳',\n larrtl: '↢',\n lat: '⪫',\n latail: '⤙',\n late: '⪭',\n lates: '⪭︀',\n lbarr: '⤌',\n lbbrk: '❲',\n lbrace: '{',\n lbrack: '[',\n lbrke: '⦋',\n lbrksld: '⦏',\n lbrkslu: '⦍',\n lcaron: 'ľ',\n lcedil: 'ļ',\n lceil: '⌈',\n lcub: '{',\n lcy: 'л',\n ldca: '⤶',\n ldquo: '“',\n ldquor: '„',\n ldrdhar: '⥧',\n ldrushar: '⥋',\n ldsh: '↲',\n le: '≤',\n leftarrow: '←',\n leftarrowtail: '↢',\n leftharpoondown: '↽',\n leftharpoonup: '↼',\n leftleftarrows: '⇇',\n leftrightarrow: '↔',\n leftrightarrows: '⇆',\n leftrightharpoons: '⇋',\n leftrightsquigarrow: '↭',\n leftthreetimes: '⋋',\n leg: '⋚',\n leq: '≤',\n leqq: '≦',\n leqslant: '⩽',\n les: '⩽',\n lescc: '⪨',\n lesdot: '⩿',\n lesdoto: '⪁',\n lesdotor: '⪃',\n lesg: '⋚︀',\n lesges: '⪓',\n lessapprox: '⪅',\n lessdot: '⋖',\n lesseqgtr: '⋚',\n lesseqqgtr: '⪋',\n lessgtr: '≶',\n lesssim: '≲',\n lfisht: '⥼',\n lfloor: '⌊',\n lfr: '𝔩',\n lg: '≶',\n lgE: '⪑',\n lhard: '↽',\n lharu: '↼',\n lharul: '⥪',\n lhblk: '▄',\n ljcy: 'љ',\n ll: '≪',\n llarr: '⇇',\n llcorner: '⌞',\n llhard: '⥫',\n lltri: '◺',\n lmidot: 'ŀ',\n lmoust: '⎰',\n lmoustache: '⎰',\n lnE: '≨',\n lnap: '⪉',\n lnapprox: '⪉',\n lne: '⪇',\n lneq: '⪇',\n lneqq: '≨',\n lnsim: '⋦',\n loang: '⟬',\n loarr: '⇽',\n lobrk: '⟦',\n longleftarrow: '⟵',\n longleftrightarrow: '⟷',\n longmapsto: '⟼',\n longrightarrow: '⟶',\n looparrowleft: '↫',\n looparrowright: '↬',\n lopar: '⦅',\n lopf: '𝕝',\n loplus: '⨭',\n lotimes: '⨴',\n lowast: '∗',\n lowbar: '_',\n loz: '◊',\n lozenge: '◊',\n lozf: '⧫',\n lpar: '(',\n lparlt: '⦓',\n lrarr: '⇆',\n lrcorner: '⌟',\n lrhar: '⇋',\n lrhard: '⥭',\n lrm: '‎',\n lrtri: '⊿',\n lsaquo: '‹',\n lscr: '𝓁',\n lsh: '↰',\n lsim: '≲',\n lsime: '⪍',\n lsimg: '⪏',\n lsqb: '[',\n lsquo: '‘',\n lsquor: '‚',\n lstrok: 'ł',\n lt: '<',\n ltcc: '⪦',\n ltcir: '⩹',\n ltdot: '⋖',\n lthree: '⋋',\n ltimes: '⋉',\n ltlarr: '⥶',\n ltquest: '⩻',\n ltrPar: '⦖',\n ltri: '◃',\n ltrie: '⊴',\n ltrif: '◂',\n lurdshar: '⥊',\n luruhar: '⥦',\n lvertneqq: '≨︀',\n lvnE: '≨︀',\n mDDot: '∺',\n macr: '¯',\n male: '♂',\n malt: '✠',\n maltese: '✠',\n map: '↦',\n mapsto: '↦',\n mapstodown: '↧',\n mapstoleft: '↤',\n mapstoup: '↥',\n marker: '▮',\n mcomma: '⨩',\n mcy: 'м',\n mdash: '—',\n measuredangle: '∡',\n mfr: '𝔪',\n mho: '℧',\n micro: 'µ',\n mid: '∣',\n midast: '*',\n midcir: '⫰',\n middot: '·',\n minus: '−',\n minusb: '⊟',\n minusd: '∸',\n minusdu: '⨪',\n mlcp: '⫛',\n mldr: '…',\n mnplus: '∓',\n models: '⊧',\n mopf: '𝕞',\n mp: '∓',\n mscr: '𝓂',\n mstpos: '∾',\n mu: 'μ',\n multimap: '⊸',\n mumap: '⊸',\n nGg: '⋙̸',\n nGt: '≫⃒',\n nGtv: '≫̸',\n nLeftarrow: '⇍',\n nLeftrightarrow: '⇎',\n nLl: '⋘̸',\n nLt: '≪⃒',\n nLtv: '≪̸',\n nRightarrow: '⇏',\n nVDash: '⊯',\n nVdash: '⊮',\n nabla: '∇',\n nacute: 'ń',\n nang: '∠⃒',\n nap: '≉',\n napE: '⩰̸',\n napid: '≋̸',\n napos: 'ʼn',\n napprox: '≉',\n natur: '♮',\n natural: '♮',\n naturals: 'ℕ',\n nbsp: ' ',\n nbump: '≎̸',\n nbumpe: '≏̸',\n ncap: '⩃',\n ncaron: 'ň',\n ncedil: 'ņ',\n ncong: '≇',\n ncongdot: '⩭̸',\n ncup: '⩂',\n ncy: 'н',\n ndash: '–',\n ne: '≠',\n neArr: '⇗',\n nearhk: '⤤',\n nearr: '↗',\n nearrow: '↗',\n nedot: '≐̸',\n nequiv: '≢',\n nesear: '⤨',\n nesim: '≂̸',\n nexist: '∄',\n nexists: '∄',\n nfr: '𝔫',\n ngE: '≧̸',\n nge: '≱',\n ngeq: '≱',\n ngeqq: '≧̸',\n ngeqslant: '⩾̸',\n nges: '⩾̸',\n ngsim: '≵',\n ngt: '≯',\n ngtr: '≯',\n nhArr: '⇎',\n nharr: '↮',\n nhpar: '⫲',\n ni: '∋',\n nis: '⋼',\n nisd: '⋺',\n niv: '∋',\n njcy: 'њ',\n nlArr: '⇍',\n nlE: '≦̸',\n nlarr: '↚',\n nldr: '‥',\n nle: '≰',\n nleftarrow: '↚',\n nleftrightarrow: '↮',\n nleq: '≰',\n nleqq: '≦̸',\n nleqslant: '⩽̸',\n nles: '⩽̸',\n nless: '≮',\n nlsim: '≴',\n nlt: '≮',\n nltri: '⋪',\n nltrie: '⋬',\n nmid: '∤',\n nopf: '𝕟',\n not: '¬',\n notin: '∉',\n notinE: '⋹̸',\n notindot: '⋵̸',\n notinva: '∉',\n notinvb: '⋷',\n notinvc: '⋶',\n notni: '∌',\n notniva: '∌',\n notnivb: '⋾',\n notnivc: '⋽',\n npar: '∦',\n nparallel: '∦',\n nparsl: '⫽⃥',\n npart: '∂̸',\n npolint: '⨔',\n npr: '⊀',\n nprcue: '⋠',\n npre: '⪯̸',\n nprec: '⊀',\n npreceq: '⪯̸',\n nrArr: '⇏',\n nrarr: '↛',\n nrarrc: '⤳̸',\n nrarrw: '↝̸',\n nrightarrow: '↛',\n nrtri: '⋫',\n nrtrie: '⋭',\n nsc: '⊁',\n nsccue: '⋡',\n nsce: '⪰̸',\n nscr: '𝓃',\n nshortmid: '∤',\n nshortparallel: '∦',\n nsim: '≁',\n nsime: '≄',\n nsimeq: '≄',\n nsmid: '∤',\n nspar: '∦',\n nsqsube: '⋢',\n nsqsupe: '⋣',\n nsub: '⊄',\n nsubE: '⫅̸',\n nsube: '⊈',\n nsubset: '⊂⃒',\n nsubseteq: '⊈',\n nsubseteqq: '⫅̸',\n nsucc: '⊁',\n nsucceq: '⪰̸',\n nsup: '⊅',\n nsupE: '⫆̸',\n nsupe: '⊉',\n nsupset: '⊃⃒',\n nsupseteq: '⊉',\n nsupseteqq: '⫆̸',\n ntgl: '≹',\n ntilde: 'ñ',\n ntlg: '≸',\n ntriangleleft: '⋪',\n ntrianglelefteq: '⋬',\n ntriangleright: '⋫',\n ntrianglerighteq: '⋭',\n nu: 'ν',\n num: '#',\n numero: '№',\n numsp: ' ',\n nvDash: '⊭',\n nvHarr: '⤄',\n nvap: '≍⃒',\n nvdash: '⊬',\n nvge: '≥⃒',\n nvgt: '>⃒',\n nvinfin: '⧞',\n nvlArr: '⤂',\n nvle: '≤⃒',\n nvlt: '<⃒',\n nvltrie: '⊴⃒',\n nvrArr: '⤃',\n nvrtrie: '⊵⃒',\n nvsim: '∼⃒',\n nwArr: '⇖',\n nwarhk: '⤣',\n nwarr: '↖',\n nwarrow: '↖',\n nwnear: '⤧',\n oS: 'Ⓢ',\n oacute: 'ó',\n oast: '⊛',\n ocir: '⊚',\n ocirc: 'ô',\n ocy: 'о',\n odash: '⊝',\n odblac: 'ő',\n odiv: '⨸',\n odot: '⊙',\n odsold: '⦼',\n oelig: 'œ',\n ofcir: '⦿',\n ofr: '𝔬',\n ogon: '˛',\n ograve: 'ò',\n ogt: '⧁',\n ohbar: '⦵',\n ohm: 'Ω',\n oint: '∮',\n olarr: '↺',\n olcir: '⦾',\n olcross: '⦻',\n oline: '‾',\n olt: '⧀',\n omacr: 'ō',\n omega: 'ω',\n omicron: 'ο',\n omid: '⦶',\n ominus: '⊖',\n oopf: '𝕠',\n opar: '⦷',\n operp: '⦹',\n oplus: '⊕',\n or: '∨',\n orarr: '↻',\n ord: '⩝',\n order: 'ℴ',\n orderof: 'ℴ',\n ordf: 'ª',\n ordm: 'º',\n origof: '⊶',\n oror: '⩖',\n orslope: '⩗',\n orv: '⩛',\n oscr: 'ℴ',\n oslash: 'ø',\n osol: '⊘',\n otilde: 'õ',\n otimes: '⊗',\n otimesas: '⨶',\n ouml: 'ö',\n ovbar: '⌽',\n par: '∥',\n para: '¶',\n parallel: '∥',\n parsim: '⫳',\n parsl: '⫽',\n part: '∂',\n pcy: 'п',\n percnt: '%',\n period: '.',\n permil: '‰',\n perp: '⊥',\n pertenk: '‱',\n pfr: '𝔭',\n phi: 'φ',\n phiv: 'ϕ',\n phmmat: 'ℳ',\n phone: '☎',\n pi: 'π',\n pitchfork: '⋔',\n piv: 'ϖ',\n planck: 'ℏ',\n planckh: 'ℎ',\n plankv: 'ℏ',\n plus: '+',\n plusacir: '⨣',\n plusb: '⊞',\n pluscir: '⨢',\n plusdo: '∔',\n plusdu: '⨥',\n pluse: '⩲',\n plusmn: '±',\n plussim: '⨦',\n plustwo: '⨧',\n pm: '±',\n pointint: '⨕',\n popf: '𝕡',\n pound: '£',\n pr: '≺',\n prE: '⪳',\n prap: '⪷',\n prcue: '≼',\n pre: '⪯',\n prec: '≺',\n precapprox: '⪷',\n preccurlyeq: '≼',\n preceq: '⪯',\n precnapprox: '⪹',\n precneqq: '⪵',\n precnsim: '⋨',\n precsim: '≾',\n prime: '′',\n primes: 'ℙ',\n prnE: '⪵',\n prnap: '⪹',\n prnsim: '⋨',\n prod: '∏',\n profalar: '⌮',\n profline: '⌒',\n profsurf: '⌓',\n prop: '∝',\n propto: '∝',\n prsim: '≾',\n prurel: '⊰',\n pscr: '𝓅',\n psi: 'ψ',\n puncsp: ' ',\n qfr: '𝔮',\n qint: '⨌',\n qopf: '𝕢',\n qprime: '⁗',\n qscr: '𝓆',\n quaternions: 'ℍ',\n quatint: '⨖',\n quest: '?',\n questeq: '≟',\n quot: '\"',\n rAarr: '⇛',\n rArr: '⇒',\n rAtail: '⤜',\n rBarr: '⤏',\n rHar: '⥤',\n race: '∽̱',\n racute: 'ŕ',\n radic: '√',\n raemptyv: '⦳',\n rang: '⟩',\n rangd: '⦒',\n range: '⦥',\n rangle: '⟩',\n raquo: '»',\n rarr: '→',\n rarrap: '⥵',\n rarrb: '⇥',\n rarrbfs: '⤠',\n rarrc: '⤳',\n rarrfs: '⤞',\n rarrhk: '↪',\n rarrlp: '↬',\n rarrpl: '⥅',\n rarrsim: '⥴',\n rarrtl: '↣',\n rarrw: '↝',\n ratail: '⤚',\n ratio: '∶',\n rationals: 'ℚ',\n rbarr: '⤍',\n rbbrk: '❳',\n rbrace: '}',\n rbrack: ']',\n rbrke: '⦌',\n rbrksld: '⦎',\n rbrkslu: '⦐',\n rcaron: 'ř',\n rcedil: 'ŗ',\n rceil: '⌉',\n rcub: '}',\n rcy: 'р',\n rdca: '⤷',\n rdldhar: '⥩',\n rdquo: '”',\n rdquor: '”',\n rdsh: '↳',\n real: 'ℜ',\n realine: 'ℛ',\n realpart: 'ℜ',\n reals: 'ℝ',\n rect: '▭',\n reg: '®',\n rfisht: '⥽',\n rfloor: '⌋',\n rfr: '𝔯',\n rhard: '⇁',\n rharu: '⇀',\n rharul: '⥬',\n rho: 'ρ',\n rhov: 'ϱ',\n rightarrow: '→',\n rightarrowtail: '↣',\n rightharpoondown: '⇁',\n rightharpoonup: '⇀',\n rightleftarrows: '⇄',\n rightleftharpoons: '⇌',\n rightrightarrows: '⇉',\n rightsquigarrow: '↝',\n rightthreetimes: '⋌',\n ring: '˚',\n risingdotseq: '≓',\n rlarr: '⇄',\n rlhar: '⇌',\n rlm: '‏',\n rmoust: '⎱',\n rmoustache: '⎱',\n rnmid: '⫮',\n roang: '⟭',\n roarr: '⇾',\n robrk: '⟧',\n ropar: '⦆',\n ropf: '𝕣',\n roplus: '⨮',\n rotimes: '⨵',\n rpar: ')',\n rpargt: '⦔',\n rppolint: '⨒',\n rrarr: '⇉',\n rsaquo: '›',\n rscr: '𝓇',\n rsh: '↱',\n rsqb: ']',\n rsquo: '’',\n rsquor: '’',\n rthree: '⋌',\n rtimes: '⋊',\n rtri: '▹',\n rtrie: '⊵',\n rtrif: '▸',\n rtriltri: '⧎',\n ruluhar: '⥨',\n rx: '℞',\n sacute: 'ś',\n sbquo: '‚',\n sc: '≻',\n scE: '⪴',\n scap: '⪸',\n scaron: 'š',\n sccue: '≽',\n sce: '⪰',\n scedil: 'ş',\n scirc: 'ŝ',\n scnE: '⪶',\n scnap: '⪺',\n scnsim: '⋩',\n scpolint: '⨓',\n scsim: '≿',\n scy: 'с',\n sdot: '⋅',\n sdotb: '⊡',\n sdote: '⩦',\n seArr: '⇘',\n searhk: '⤥',\n searr: '↘',\n searrow: '↘',\n sect: '§',\n semi: ';',\n seswar: '⤩',\n setminus: '∖',\n setmn: '∖',\n sext: '✶',\n sfr: '𝔰',\n sfrown: '⌢',\n sharp: '♯',\n shchcy: 'щ',\n shcy: 'ш',\n shortmid: '∣',\n shortparallel: '∥',\n shy: '­',\n sigma: 'σ',\n sigmaf: 'ς',\n sigmav: 'ς',\n sim: '∼',\n simdot: '⩪',\n sime: '≃',\n simeq: '≃',\n simg: '⪞',\n simgE: '⪠',\n siml: '⪝',\n simlE: '⪟',\n simne: '≆',\n simplus: '⨤',\n simrarr: '⥲',\n slarr: '←',\n smallsetminus: '∖',\n smashp: '⨳',\n smeparsl: '⧤',\n smid: '∣',\n smile: '⌣',\n smt: '⪪',\n smte: '⪬',\n smtes: '⪬︀',\n softcy: 'ь',\n sol: '/',\n solb: '⧄',\n solbar: '⌿',\n sopf: '𝕤',\n spades: '♠',\n spadesuit: '♠',\n spar: '∥',\n sqcap: '⊓',\n sqcaps: '⊓︀',\n sqcup: '⊔',\n sqcups: '⊔︀',\n sqsub: '⊏',\n sqsube: '⊑',\n sqsubset: '⊏',\n sqsubseteq: '⊑',\n sqsup: '⊐',\n sqsupe: '⊒',\n sqsupset: '⊐',\n sqsupseteq: '⊒',\n squ: '□',\n square: '□',\n squarf: '▪',\n squf: '▪',\n srarr: '→',\n sscr: '𝓈',\n ssetmn: '∖',\n ssmile: '⌣',\n sstarf: '⋆',\n star: '☆',\n starf: '★',\n straightepsilon: 'ϵ',\n straightphi: 'ϕ',\n strns: '¯',\n sub: '⊂',\n subE: '⫅',\n subdot: '⪽',\n sube: '⊆',\n subedot: '⫃',\n submult: '⫁',\n subnE: '⫋',\n subne: '⊊',\n subplus: '⪿',\n subrarr: '⥹',\n subset: '⊂',\n subseteq: '⊆',\n subseteqq: '⫅',\n subsetneq: '⊊',\n subsetneqq: '⫋',\n subsim: '⫇',\n subsub: '⫕',\n subsup: '⫓',\n succ: '≻',\n succapprox: '⪸',\n succcurlyeq: '≽',\n succeq: '⪰',\n succnapprox: '⪺',\n succneqq: '⪶',\n succnsim: '⋩',\n succsim: '≿',\n sum: '∑',\n sung: '♪',\n sup1: '¹',\n sup2: '²',\n sup3: '³',\n sup: '⊃',\n supE: '⫆',\n supdot: '⪾',\n supdsub: '⫘',\n supe: '⊇',\n supedot: '⫄',\n suphsol: '⟉',\n suphsub: '⫗',\n suplarr: '⥻',\n supmult: '⫂',\n supnE: '⫌',\n supne: '⊋',\n supplus: '⫀',\n supset: '⊃',\n supseteq: '⊇',\n supseteqq: '⫆',\n supsetneq: '⊋',\n supsetneqq: '⫌',\n supsim: '⫈',\n supsub: '⫔',\n supsup: '⫖',\n swArr: '⇙',\n swarhk: '⤦',\n swarr: '↙',\n swarrow: '↙',\n swnwar: '⤪',\n szlig: 'ß',\n target: '⌖',\n tau: 'τ',\n tbrk: '⎴',\n tcaron: 'ť',\n tcedil: 'ţ',\n tcy: 'т',\n tdot: '⃛',\n telrec: '⌕',\n tfr: '𝔱',\n there4: '∴',\n therefore: '∴',\n theta: 'θ',\n thetasym: 'ϑ',\n thetav: 'ϑ',\n thickapprox: '≈',\n thicksim: '∼',\n thinsp: ' ',\n thkap: '≈',\n thksim: '∼',\n thorn: 'þ',\n tilde: '˜',\n times: '×',\n timesb: '⊠',\n timesbar: '⨱',\n timesd: '⨰',\n tint: '∭',\n toea: '⤨',\n top: '⊤',\n topbot: '⌶',\n topcir: '⫱',\n topf: '𝕥',\n topfork: '⫚',\n tosa: '⤩',\n tprime: '‴',\n trade: '™',\n triangle: '▵',\n triangledown: '▿',\n triangleleft: '◃',\n trianglelefteq: '⊴',\n triangleq: '≜',\n triangleright: '▹',\n trianglerighteq: '⊵',\n tridot: '◬',\n trie: '≜',\n triminus: '⨺',\n triplus: '⨹',\n trisb: '⧍',\n tritime: '⨻',\n trpezium: '⏢',\n tscr: '𝓉',\n tscy: 'ц',\n tshcy: 'ћ',\n tstrok: 'ŧ',\n twixt: '≬',\n twoheadleftarrow: '↞',\n twoheadrightarrow: '↠',\n uArr: '⇑',\n uHar: '⥣',\n uacute: 'ú',\n uarr: '↑',\n ubrcy: 'ў',\n ubreve: 'ŭ',\n ucirc: 'û',\n ucy: 'у',\n udarr: '⇅',\n udblac: 'ű',\n udhar: '⥮',\n ufisht: '⥾',\n ufr: '𝔲',\n ugrave: 'ù',\n uharl: '↿',\n uharr: '↾',\n uhblk: '▀',\n ulcorn: '⌜',\n ulcorner: '⌜',\n ulcrop: '⌏',\n ultri: '◸',\n umacr: 'ū',\n uml: '¨',\n uogon: 'ų',\n uopf: '𝕦',\n uparrow: '↑',\n updownarrow: '↕',\n upharpoonleft: '↿',\n upharpoonright: '↾',\n uplus: '⊎',\n upsi: 'υ',\n upsih: 'ϒ',\n upsilon: 'υ',\n upuparrows: '⇈',\n urcorn: '⌝',\n urcorner: '⌝',\n urcrop: '⌎',\n uring: 'ů',\n urtri: '◹',\n uscr: '𝓊',\n utdot: '⋰',\n utilde: 'ũ',\n utri: '▵',\n utrif: '▴',\n uuarr: '⇈',\n uuml: 'ü',\n uwangle: '⦧',\n vArr: '⇕',\n vBar: '⫨',\n vBarv: '⫩',\n vDash: '⊨',\n vangrt: '⦜',\n varepsilon: 'ϵ',\n varkappa: 'ϰ',\n varnothing: '∅',\n varphi: 'ϕ',\n varpi: 'ϖ',\n varpropto: '∝',\n varr: '↕',\n varrho: 'ϱ',\n varsigma: 'ς',\n varsubsetneq: '⊊︀',\n varsubsetneqq: '⫋︀',\n varsupsetneq: '⊋︀',\n varsupsetneqq: '⫌︀',\n vartheta: 'ϑ',\n vartriangleleft: '⊲',\n vartriangleright: '⊳',\n vcy: 'в',\n vdash: '⊢',\n vee: '∨',\n veebar: '⊻',\n veeeq: '≚',\n vellip: '⋮',\n verbar: '|',\n vert: '|',\n vfr: '𝔳',\n vltri: '⊲',\n vnsub: '⊂⃒',\n vnsup: '⊃⃒',\n vopf: '𝕧',\n vprop: '∝',\n vrtri: '⊳',\n vscr: '𝓋',\n vsubnE: '⫋︀',\n vsubne: '⊊︀',\n vsupnE: '⫌︀',\n vsupne: '⊋︀',\n vzigzag: '⦚',\n wcirc: 'ŵ',\n wedbar: '⩟',\n wedge: '∧',\n wedgeq: '≙',\n weierp: '℘',\n wfr: '𝔴',\n wopf: '𝕨',\n wp: '℘',\n wr: '≀',\n wreath: '≀',\n wscr: '𝓌',\n xcap: '⋂',\n xcirc: '◯',\n xcup: '⋃',\n xdtri: '▽',\n xfr: '𝔵',\n xhArr: '⟺',\n xharr: '⟷',\n xi: 'ξ',\n xlArr: '⟸',\n xlarr: '⟵',\n xmap: '⟼',\n xnis: '⋻',\n xodot: '⨀',\n xopf: '𝕩',\n xoplus: '⨁',\n xotime: '⨂',\n xrArr: '⟹',\n xrarr: '⟶',\n xscr: '𝓍',\n xsqcup: '⨆',\n xuplus: '⨄',\n xutri: '△',\n xvee: '⋁',\n xwedge: '⋀',\n yacute: 'ý',\n yacy: 'я',\n ycirc: 'ŷ',\n ycy: 'ы',\n yen: '¥',\n yfr: '𝔶',\n yicy: 'ї',\n yopf: '𝕪',\n yscr: '𝓎',\n yucy: 'ю',\n yuml: 'ÿ',\n zacute: 'ź',\n zcaron: 'ž',\n zcy: 'з',\n zdot: 'ż',\n zeetrf: 'ℨ',\n zeta: 'ζ',\n zfr: '𝔷',\n zhcy: 'ж',\n zigrarr: '⇝',\n zopf: '𝕫',\n zscr: '𝓏',\n zwj: '‍',\n zwnj: '‌'\n}\n","import {characterEntities} from 'character-entities'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Decode a single character reference (without the `&` or `;`).\n * You probably only need this when you’re building parsers yourself that follow\n * different rules compared to HTML.\n * This is optimized to be tiny in browsers.\n *\n * @param {string} value\n * `notin` (named), `#123` (deci), `#x123` (hexa).\n * @returns {string|false}\n * Decoded reference.\n */\nexport function decodeNamedCharacterReference(value) {\n return own.call(characterEntities, value) ? characterEntities[value] : false\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {\n asciiAlphanumeric,\n asciiDigit,\n asciiHexDigit\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const characterReference = {\n name: 'characterReference',\n tokenize: tokenizeCharacterReference\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterReference(effects, ok, nok) {\n const self = this\n let size = 0\n /** @type {number} */\n let max\n /** @type {(code: Code) => boolean} */\n let test\n return start\n\n /**\n * Start of character reference.\n *\n * ```markdown\n * > | a&b\n * ^\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('characterReference')\n effects.enter('characterReferenceMarker')\n effects.consume(code)\n effects.exit('characterReferenceMarker')\n return open\n }\n\n /**\n * After `&`, at `#` for numeric references or alphanumeric for named\n * references.\n *\n * ```markdown\n * > | a&b\n * ^\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 35) {\n effects.enter('characterReferenceMarkerNumeric')\n effects.consume(code)\n effects.exit('characterReferenceMarkerNumeric')\n return numeric\n }\n effects.enter('characterReferenceValue')\n max = 31\n test = asciiAlphanumeric\n return value(code)\n }\n\n /**\n * After `#`, at `x` for hexadecimals or digit for decimals.\n *\n * ```markdown\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function numeric(code) {\n if (code === 88 || code === 120) {\n effects.enter('characterReferenceMarkerHexadecimal')\n effects.consume(code)\n effects.exit('characterReferenceMarkerHexadecimal')\n effects.enter('characterReferenceValue')\n max = 6\n test = asciiHexDigit\n return value\n }\n effects.enter('characterReferenceValue')\n max = 7\n test = asciiDigit\n return value(code)\n }\n\n /**\n * After markers (`&#x`, `&#`, or `&`), in value, before `;`.\n *\n * The character reference kind defines what and how many characters are\n * allowed.\n *\n * ```markdown\n * > | a&b\n * ^^^\n * > | a{b\n * ^^^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function value(code) {\n if (code === 59 && size) {\n const token = effects.exit('characterReferenceValue')\n if (\n test === asciiAlphanumeric &&\n !decodeNamedCharacterReference(self.sliceSerialize(token))\n ) {\n return nok(code)\n }\n\n // To do: `markdown-rs` uses a different name:\n // `CharacterReferenceMarkerSemi`.\n effects.enter('characterReferenceMarker')\n effects.consume(code)\n effects.exit('characterReferenceMarker')\n effects.exit('characterReference')\n return ok\n }\n if (test(code) && size++ < max) {\n effects.consume(code)\n return value\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {asciiPunctuation} from 'micromark-util-character'\n/** @type {Construct} */\nexport const characterEscape = {\n name: 'characterEscape',\n tokenize: tokenizeCharacterEscape\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterEscape(effects, ok, nok) {\n return start\n\n /**\n * Start of character escape.\n *\n * ```markdown\n * > | a\\*b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('characterEscape')\n effects.enter('escapeMarker')\n effects.consume(code)\n effects.exit('escapeMarker')\n return inside\n }\n\n /**\n * After `\\`, at punctuation.\n *\n * ```markdown\n * > | a\\*b\n * ^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n // ASCII punctuation.\n if (asciiPunctuation(code)) {\n effects.enter('characterEscapeValue')\n effects.consume(code)\n effects.exit('characterEscapeValue')\n effects.exit('characterEscape')\n return ok\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const lineEnding = {\n name: 'lineEnding',\n tokenize: tokenizeLineEnding\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLineEnding(effects, ok) {\n return start\n\n /** @type {State} */\n function start(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return factorySpace(effects, ok, 'linePrefix')\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factoryDestination} from 'micromark-factory-destination'\nimport {factoryLabel} from 'micromark-factory-label'\nimport {factoryTitle} from 'micromark-factory-title'\nimport {factoryWhitespace} from 'micromark-factory-whitespace'\nimport {markdownLineEndingOrSpace} from 'micromark-util-character'\nimport {push, splice} from 'micromark-util-chunked'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/** @type {Construct} */\nexport const labelEnd = {\n name: 'labelEnd',\n tokenize: tokenizeLabelEnd,\n resolveTo: resolveToLabelEnd,\n resolveAll: resolveAllLabelEnd\n}\n\n/** @type {Construct} */\nconst resourceConstruct = {\n tokenize: tokenizeResource\n}\n/** @type {Construct} */\nconst referenceFullConstruct = {\n tokenize: tokenizeReferenceFull\n}\n/** @type {Construct} */\nconst referenceCollapsedConstruct = {\n tokenize: tokenizeReferenceCollapsed\n}\n\n/** @type {Resolver} */\nfunction resolveAllLabelEnd(events) {\n let index = -1\n while (++index < events.length) {\n const token = events[index][1]\n if (\n token.type === 'labelImage' ||\n token.type === 'labelLink' ||\n token.type === 'labelEnd'\n ) {\n // Remove the marker.\n events.splice(index + 1, token.type === 'labelImage' ? 4 : 2)\n token.type = 'data'\n index++\n }\n }\n return events\n}\n\n/** @type {Resolver} */\nfunction resolveToLabelEnd(events, context) {\n let index = events.length\n let offset = 0\n /** @type {Token} */\n let token\n /** @type {number | undefined} */\n let open\n /** @type {number | undefined} */\n let close\n /** @type {Array} */\n let media\n\n // Find an opening.\n while (index--) {\n token = events[index][1]\n if (open) {\n // If we see another link, or inactive link label, we’ve been here before.\n if (\n token.type === 'link' ||\n (token.type === 'labelLink' && token._inactive)\n ) {\n break\n }\n\n // Mark other link openings as inactive, as we can’t have links in\n // links.\n if (events[index][0] === 'enter' && token.type === 'labelLink') {\n token._inactive = true\n }\n } else if (close) {\n if (\n events[index][0] === 'enter' &&\n (token.type === 'labelImage' || token.type === 'labelLink') &&\n !token._balanced\n ) {\n open = index\n if (token.type !== 'labelLink') {\n offset = 2\n break\n }\n }\n } else if (token.type === 'labelEnd') {\n close = index\n }\n }\n const group = {\n type: events[open][1].type === 'labelLink' ? 'link' : 'image',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[events.length - 1][1].end)\n }\n const label = {\n type: 'label',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[close][1].end)\n }\n const text = {\n type: 'labelText',\n start: Object.assign({}, events[open + offset + 2][1].end),\n end: Object.assign({}, events[close - 2][1].start)\n }\n media = [\n ['enter', group, context],\n ['enter', label, context]\n ]\n\n // Opening marker.\n media = push(media, events.slice(open + 1, open + offset + 3))\n\n // Text open.\n media = push(media, [['enter', text, context]])\n\n // Always populated by defaults.\n\n // Between.\n media = push(\n media,\n resolveAll(\n context.parser.constructs.insideSpan.null,\n events.slice(open + offset + 4, close - 3),\n context\n )\n )\n\n // Text close, marker close, label close.\n media = push(media, [\n ['exit', text, context],\n events[close - 2],\n events[close - 1],\n ['exit', label, context]\n ])\n\n // Reference, resource, or so.\n media = push(media, events.slice(close + 1))\n\n // Media close.\n media = push(media, [['exit', group, context]])\n splice(events, open, events.length, media)\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelEnd(effects, ok, nok) {\n const self = this\n let index = self.events.length\n /** @type {Token} */\n let labelStart\n /** @type {boolean} */\n let defined\n\n // Find an opening.\n while (index--) {\n if (\n (self.events[index][1].type === 'labelImage' ||\n self.events[index][1].type === 'labelLink') &&\n !self.events[index][1]._balanced\n ) {\n labelStart = self.events[index][1]\n break\n }\n }\n return start\n\n /**\n * Start of label end.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // If there is not an okay opening.\n if (!labelStart) {\n return nok(code)\n }\n\n // If the corresponding label (link) start is marked as inactive,\n // it means we’d be wrapping a link, like this:\n //\n // ```markdown\n // > | a [b [c](d) e](f) g.\n // ^\n // ```\n //\n // We can’t have that, so it’s just balanced brackets.\n if (labelStart._inactive) {\n return labelEndNok(code)\n }\n defined = self.parser.defined.includes(\n normalizeIdentifier(\n self.sliceSerialize({\n start: labelStart.end,\n end: self.now()\n })\n )\n )\n effects.enter('labelEnd')\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelEnd')\n return after\n }\n\n /**\n * After `]`.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // Note: `markdown-rs` also parses GFM footnotes here, which for us is in\n // an extension.\n\n // Resource (`[asd](fgh)`)?\n if (code === 40) {\n return effects.attempt(\n resourceConstruct,\n labelEndOk,\n defined ? labelEndOk : labelEndNok\n )(code)\n }\n\n // Full (`[asd][fgh]`) or collapsed (`[asd][]`) reference?\n if (code === 91) {\n return effects.attempt(\n referenceFullConstruct,\n labelEndOk,\n defined ? referenceNotFull : labelEndNok\n )(code)\n }\n\n // Shortcut (`[asd]`) reference?\n return defined ? labelEndOk(code) : labelEndNok(code)\n }\n\n /**\n * After `]`, at `[`, but not at a full reference.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceNotFull(code) {\n return effects.attempt(\n referenceCollapsedConstruct,\n labelEndOk,\n labelEndNok\n )(code)\n }\n\n /**\n * Done, we found something.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEndOk(code) {\n // Note: `markdown-rs` does a bunch of stuff here.\n return ok(code)\n }\n\n /**\n * Done, it’s nothing.\n *\n * There was an okay opening, but we didn’t match anything.\n *\n * ```markdown\n * > | [a](b c\n * ^\n * > | [a][b c\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEndNok(code) {\n labelStart._balanced = true\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeResource(effects, ok, nok) {\n return resourceStart\n\n /**\n * At a resource.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceStart(code) {\n effects.enter('resource')\n effects.enter('resourceMarker')\n effects.consume(code)\n effects.exit('resourceMarker')\n return resourceBefore\n }\n\n /**\n * In resource, after `(`, at optional whitespace.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceBefore(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceOpen)(code)\n : resourceOpen(code)\n }\n\n /**\n * In resource, after optional whitespace, at `)` or a destination.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceOpen(code) {\n if (code === 41) {\n return resourceEnd(code)\n }\n return factoryDestination(\n effects,\n resourceDestinationAfter,\n resourceDestinationMissing,\n 'resourceDestination',\n 'resourceDestinationLiteral',\n 'resourceDestinationLiteralMarker',\n 'resourceDestinationRaw',\n 'resourceDestinationString',\n 32\n )(code)\n }\n\n /**\n * In resource, after destination, at optional whitespace.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceDestinationAfter(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceBetween)(code)\n : resourceEnd(code)\n }\n\n /**\n * At invalid destination.\n *\n * ```markdown\n * > | [a](<<) b\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceDestinationMissing(code) {\n return nok(code)\n }\n\n /**\n * In resource, after destination and whitespace, at `(` or title.\n *\n * ```markdown\n * > | [a](b ) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceBetween(code) {\n if (code === 34 || code === 39 || code === 40) {\n return factoryTitle(\n effects,\n resourceTitleAfter,\n nok,\n 'resourceTitle',\n 'resourceTitleMarker',\n 'resourceTitleString'\n )(code)\n }\n return resourceEnd(code)\n }\n\n /**\n * In resource, after title, at optional whitespace.\n *\n * ```markdown\n * > | [a](b \"c\") d\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceTitleAfter(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceEnd)(code)\n : resourceEnd(code)\n }\n\n /**\n * In resource, at `)`.\n *\n * ```markdown\n * > | [a](b) d\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceEnd(code) {\n if (code === 41) {\n effects.enter('resourceMarker')\n effects.consume(code)\n effects.exit('resourceMarker')\n effects.exit('resource')\n return ok\n }\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceFull(effects, ok, nok) {\n const self = this\n return referenceFull\n\n /**\n * In a reference (full), at the `[`.\n *\n * ```markdown\n * > | [a][b] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFull(code) {\n return factoryLabel.call(\n self,\n effects,\n referenceFullAfter,\n referenceFullMissing,\n 'reference',\n 'referenceMarker',\n 'referenceString'\n )(code)\n }\n\n /**\n * In a reference (full), after `]`.\n *\n * ```markdown\n * > | [a][b] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFullAfter(code) {\n return self.parser.defined.includes(\n normalizeIdentifier(\n self.sliceSerialize(self.events[self.events.length - 1][1]).slice(1, -1)\n )\n )\n ? ok(code)\n : nok(code)\n }\n\n /**\n * In reference (full) that was missing.\n *\n * ```markdown\n * > | [a][b d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFullMissing(code) {\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceCollapsed(effects, ok, nok) {\n return referenceCollapsedStart\n\n /**\n * In reference (collapsed), at `[`.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceCollapsedStart(code) {\n // We only attempt a collapsed label if there’s a `[`.\n\n effects.enter('reference')\n effects.enter('referenceMarker')\n effects.consume(code)\n effects.exit('referenceMarker')\n return referenceCollapsedOpen\n }\n\n /**\n * In reference (collapsed), at `]`.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceCollapsedOpen(code) {\n if (code === 93) {\n effects.enter('referenceMarker')\n effects.consume(code)\n effects.exit('referenceMarker')\n effects.exit('reference')\n return ok\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {labelEnd} from './label-end.js'\n\n/** @type {Construct} */\nexport const labelStartImage = {\n name: 'labelStartImage',\n tokenize: tokenizeLabelStartImage,\n resolveAll: labelEnd.resolveAll\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartImage(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of label (image) start.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('labelImage')\n effects.enter('labelImageMarker')\n effects.consume(code)\n effects.exit('labelImageMarker')\n return open\n }\n\n /**\n * After `!`, at `[`.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 91) {\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelImage')\n return after\n }\n return nok(code)\n }\n\n /**\n * After `![`.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * This is needed in because, when GFM footnotes are enabled, images never\n * form when started with a `^`.\n * Instead, links form:\n *\n * ```markdown\n * ![^a](b)\n *\n * ![^a][b]\n *\n * [b]: c\n * ```\n *\n * ```html\n *

!^a

\n *

!^a

\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // To do: use a new field to do this, this is still needed for\n // `micromark-extension-gfm-footnote`, but the `label-start-link`\n // behavior isn’t.\n // Hidden footnotes hook.\n /* c8 ignore next 3 */\n return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs\n ? nok(code)\n : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {\n markdownLineEndingOrSpace,\n unicodePunctuation,\n unicodeWhitespace\n} from 'micromark-util-character'\n/**\n * Classify whether a code represents whitespace, punctuation, or something\n * else.\n *\n * Used for attention (emphasis, strong), whose sequences can open or close\n * based on the class of surrounding characters.\n *\n * > 👉 **Note**: eof (`null`) is seen as whitespace.\n *\n * @param {Code} code\n * Code.\n * @returns {typeof constants.characterGroupWhitespace | typeof constants.characterGroupPunctuation | undefined}\n * Group.\n */\nexport function classifyCharacter(code) {\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return 1\n }\n if (unicodePunctuation(code)) {\n return 2\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Point} Point\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {push, splice} from 'micromark-util-chunked'\nimport {classifyCharacter} from 'micromark-util-classify-character'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/** @type {Construct} */\nexport const attention = {\n name: 'attention',\n tokenize: tokenizeAttention,\n resolveAll: resolveAllAttention\n}\n\n/**\n * Take all events and resolve attention to emphasis or strong.\n *\n * @type {Resolver}\n */\nfunction resolveAllAttention(events, context) {\n let index = -1\n /** @type {number} */\n let open\n /** @type {Token} */\n let group\n /** @type {Token} */\n let text\n /** @type {Token} */\n let openingSequence\n /** @type {Token} */\n let closingSequence\n /** @type {number} */\n let use\n /** @type {Array} */\n let nextEvents\n /** @type {number} */\n let offset\n\n // Walk through all events.\n //\n // Note: performance of this is fine on an mb of normal markdown, but it’s\n // a bottleneck for malicious stuff.\n while (++index < events.length) {\n // Find a token that can close.\n if (\n events[index][0] === 'enter' &&\n events[index][1].type === 'attentionSequence' &&\n events[index][1]._close\n ) {\n open = index\n\n // Now walk back to find an opener.\n while (open--) {\n // Find a token that can open the closer.\n if (\n events[open][0] === 'exit' &&\n events[open][1].type === 'attentionSequence' &&\n events[open][1]._open &&\n // If the markers are the same:\n context.sliceSerialize(events[open][1]).charCodeAt(0) ===\n context.sliceSerialize(events[index][1]).charCodeAt(0)\n ) {\n // If the opening can close or the closing can open,\n // and the close size *is not* a multiple of three,\n // but the sum of the opening and closing size *is* multiple of three,\n // then don’t match.\n if (\n (events[open][1]._close || events[index][1]._open) &&\n (events[index][1].end.offset - events[index][1].start.offset) % 3 &&\n !(\n (events[open][1].end.offset -\n events[open][1].start.offset +\n events[index][1].end.offset -\n events[index][1].start.offset) %\n 3\n )\n ) {\n continue\n }\n\n // Number of markers to use from the sequence.\n use =\n events[open][1].end.offset - events[open][1].start.offset > 1 &&\n events[index][1].end.offset - events[index][1].start.offset > 1\n ? 2\n : 1\n const start = Object.assign({}, events[open][1].end)\n const end = Object.assign({}, events[index][1].start)\n movePoint(start, -use)\n movePoint(end, use)\n openingSequence = {\n type: use > 1 ? 'strongSequence' : 'emphasisSequence',\n start,\n end: Object.assign({}, events[open][1].end)\n }\n closingSequence = {\n type: use > 1 ? 'strongSequence' : 'emphasisSequence',\n start: Object.assign({}, events[index][1].start),\n end\n }\n text = {\n type: use > 1 ? 'strongText' : 'emphasisText',\n start: Object.assign({}, events[open][1].end),\n end: Object.assign({}, events[index][1].start)\n }\n group = {\n type: use > 1 ? 'strong' : 'emphasis',\n start: Object.assign({}, openingSequence.start),\n end: Object.assign({}, closingSequence.end)\n }\n events[open][1].end = Object.assign({}, openingSequence.start)\n events[index][1].start = Object.assign({}, closingSequence.end)\n nextEvents = []\n\n // If there are more markers in the opening, add them before.\n if (events[open][1].end.offset - events[open][1].start.offset) {\n nextEvents = push(nextEvents, [\n ['enter', events[open][1], context],\n ['exit', events[open][1], context]\n ])\n }\n\n // Opening.\n nextEvents = push(nextEvents, [\n ['enter', group, context],\n ['enter', openingSequence, context],\n ['exit', openingSequence, context],\n ['enter', text, context]\n ])\n\n // Always populated by defaults.\n\n // Between.\n nextEvents = push(\n nextEvents,\n resolveAll(\n context.parser.constructs.insideSpan.null,\n events.slice(open + 1, index),\n context\n )\n )\n\n // Closing.\n nextEvents = push(nextEvents, [\n ['exit', text, context],\n ['enter', closingSequence, context],\n ['exit', closingSequence, context],\n ['exit', group, context]\n ])\n\n // If there are more markers in the closing, add them after.\n if (events[index][1].end.offset - events[index][1].start.offset) {\n offset = 2\n nextEvents = push(nextEvents, [\n ['enter', events[index][1], context],\n ['exit', events[index][1], context]\n ])\n } else {\n offset = 0\n }\n splice(events, open - 1, index - open + 3, nextEvents)\n index = open + nextEvents.length - offset - 2\n break\n }\n }\n }\n }\n\n // Remove remaining sequences.\n index = -1\n while (++index < events.length) {\n if (events[index][1].type === 'attentionSequence') {\n events[index][1].type = 'data'\n }\n }\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeAttention(effects, ok) {\n const attentionMarkers = this.parser.constructs.attentionMarkers.null\n const previous = this.previous\n const before = classifyCharacter(previous)\n\n /** @type {NonNullable} */\n let marker\n return start\n\n /**\n * Before a sequence.\n *\n * ```markdown\n * > | **\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n marker = code\n effects.enter('attentionSequence')\n return inside(code)\n }\n\n /**\n * In a sequence.\n *\n * ```markdown\n * > | **\n * ^^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n if (code === marker) {\n effects.consume(code)\n return inside\n }\n const token = effects.exit('attentionSequence')\n\n // To do: next major: move this to resolver, just like `markdown-rs`.\n const after = classifyCharacter(code)\n\n // Always populated by defaults.\n\n const open =\n !after || (after === 2 && before) || attentionMarkers.includes(code)\n const close =\n !before || (before === 2 && after) || attentionMarkers.includes(previous)\n token._open = Boolean(marker === 42 ? open : open && (before || !close))\n token._close = Boolean(marker === 42 ? close : close && (after || !open))\n return ok(code)\n }\n}\n\n/**\n * Move a point a bit.\n *\n * Note: `move` only works inside lines! It’s not possible to move past other\n * chunks (replacement characters, tabs, or line endings).\n *\n * @param {Point} point\n * @param {number} offset\n * @returns {void}\n */\nfunction movePoint(point, offset) {\n point.column += offset\n point.offset += offset\n point._bufferIndex += offset\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n asciiAtext,\n asciiControl\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const autolink = {\n name: 'autolink',\n tokenize: tokenizeAutolink\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeAutolink(effects, ok, nok) {\n let size = 0\n return start\n\n /**\n * Start of an autolink.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('autolink')\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.enter('autolinkProtocol')\n return open\n }\n\n /**\n * After `<`, at protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (asciiAlpha(code)) {\n effects.consume(code)\n return schemeOrEmailAtext\n }\n return emailAtext(code)\n }\n\n /**\n * At second byte of protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function schemeOrEmailAtext(code) {\n // ASCII alphanumeric and `+`, `-`, and `.`.\n if (code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) {\n // Count the previous alphabetical from `open` too.\n size = 1\n return schemeInsideOrEmailAtext(code)\n }\n return emailAtext(code)\n }\n\n /**\n * In ambiguous protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function schemeInsideOrEmailAtext(code) {\n if (code === 58) {\n effects.consume(code)\n size = 0\n return urlInside\n }\n\n // ASCII alphanumeric and `+`, `-`, and `.`.\n if (\n (code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) &&\n size++ < 32\n ) {\n effects.consume(code)\n return schemeInsideOrEmailAtext\n }\n size = 0\n return emailAtext(code)\n }\n\n /**\n * After protocol, in URL.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function urlInside(code) {\n if (code === 62) {\n effects.exit('autolinkProtocol')\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.exit('autolink')\n return ok\n }\n\n // ASCII control, space, or `<`.\n if (code === null || code === 32 || code === 60 || asciiControl(code)) {\n return nok(code)\n }\n effects.consume(code)\n return urlInside\n }\n\n /**\n * In email atext.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailAtext(code) {\n if (code === 64) {\n effects.consume(code)\n return emailAtSignOrDot\n }\n if (asciiAtext(code)) {\n effects.consume(code)\n return emailAtext\n }\n return nok(code)\n }\n\n /**\n * In label, after at-sign or dot.\n *\n * ```markdown\n * > | ab\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function emailAtSignOrDot(code) {\n return asciiAlphanumeric(code) ? emailLabel(code) : nok(code)\n }\n\n /**\n * In label, where `.` and `>` are allowed.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailLabel(code) {\n if (code === 46) {\n effects.consume(code)\n size = 0\n return emailAtSignOrDot\n }\n if (code === 62) {\n // Exit, then change the token type.\n effects.exit('autolinkProtocol').type = 'autolinkEmail'\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.exit('autolink')\n return ok\n }\n return emailValue(code)\n }\n\n /**\n * In label, where `.` and `>` are *not* allowed.\n *\n * Though, this is also used in `emailLabel` to parse other values.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailValue(code) {\n // ASCII alphanumeric or `-`.\n if ((code === 45 || asciiAlphanumeric(code)) && size++ < 63) {\n const next = code === 45 ? emailValue : emailLabel\n effects.consume(code)\n return next\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n markdownLineEnding,\n markdownLineEndingOrSpace,\n markdownSpace\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const htmlText = {\n name: 'htmlText',\n tokenize: tokenizeHtmlText\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeHtmlText(effects, ok, nok) {\n const self = this\n /** @type {NonNullable | undefined} */\n let marker\n /** @type {number} */\n let index\n /** @type {State} */\n let returnState\n return start\n\n /**\n * Start of HTML (text).\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('htmlText')\n effects.enter('htmlTextData')\n effects.consume(code)\n return open\n }\n\n /**\n * After `<`, at tag name or other stuff.\n *\n * ```markdown\n * > | a c\n * ^\n * > | a c\n * ^\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 33) {\n effects.consume(code)\n return declarationOpen\n }\n if (code === 47) {\n effects.consume(code)\n return tagCloseStart\n }\n if (code === 63) {\n effects.consume(code)\n return instruction\n }\n\n // ASCII alphabetical.\n if (asciiAlpha(code)) {\n effects.consume(code)\n return tagOpen\n }\n return nok(code)\n }\n\n /**\n * After ` | a c\n * ^\n * > | a c\n * ^\n * > | a &<]]> c\n * ^\n * ```\n *\n * @type {State}\n */\n function declarationOpen(code) {\n if (code === 45) {\n effects.consume(code)\n return commentOpenInside\n }\n if (code === 91) {\n effects.consume(code)\n index = 0\n return cdataOpenInside\n }\n if (asciiAlpha(code)) {\n effects.consume(code)\n return declaration\n }\n return nok(code)\n }\n\n /**\n * In a comment, after ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentOpenInside(code) {\n if (code === 45) {\n effects.consume(code)\n return commentEnd\n }\n return nok(code)\n }\n\n /**\n * In comment.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function comment(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 45) {\n effects.consume(code)\n return commentClose\n }\n if (markdownLineEnding(code)) {\n returnState = comment\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return comment\n }\n\n /**\n * In comment, after `-`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentClose(code) {\n if (code === 45) {\n effects.consume(code)\n return commentEnd\n }\n return comment(code)\n }\n\n /**\n * In comment, after `--`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentEnd(code) {\n return code === 62\n ? end(code)\n : code === 45\n ? commentClose(code)\n : comment(code)\n }\n\n /**\n * After ` | a &<]]> b\n * ^^^^^^\n * ```\n *\n * @type {State}\n */\n function cdataOpenInside(code) {\n const value = 'CDATA['\n if (code === value.charCodeAt(index++)) {\n effects.consume(code)\n return index === value.length ? cdata : cdataOpenInside\n }\n return nok(code)\n }\n\n /**\n * In CDATA.\n *\n * ```markdown\n * > | a &<]]> b\n * ^^^\n * ```\n *\n * @type {State}\n */\n function cdata(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 93) {\n effects.consume(code)\n return cdataClose\n }\n if (markdownLineEnding(code)) {\n returnState = cdata\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return cdata\n }\n\n /**\n * In CDATA, after `]`, at another `]`.\n *\n * ```markdown\n * > | a &<]]> b\n * ^\n * ```\n *\n * @type {State}\n */\n function cdataClose(code) {\n if (code === 93) {\n effects.consume(code)\n return cdataEnd\n }\n return cdata(code)\n }\n\n /**\n * In CDATA, after `]]`, at `>`.\n *\n * ```markdown\n * > | a &<]]> b\n * ^\n * ```\n *\n * @type {State}\n */\n function cdataEnd(code) {\n if (code === 62) {\n return end(code)\n }\n if (code === 93) {\n effects.consume(code)\n return cdataEnd\n }\n return cdata(code)\n }\n\n /**\n * In declaration.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function declaration(code) {\n if (code === null || code === 62) {\n return end(code)\n }\n if (markdownLineEnding(code)) {\n returnState = declaration\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return declaration\n }\n\n /**\n * In instruction.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function instruction(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 63) {\n effects.consume(code)\n return instructionClose\n }\n if (markdownLineEnding(code)) {\n returnState = instruction\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return instruction\n }\n\n /**\n * In instruction, after `?`, at `>`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function instructionClose(code) {\n return code === 62 ? end(code) : instruction(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagCloseStart(code) {\n // ASCII alphabetical.\n if (asciiAlpha(code)) {\n effects.consume(code)\n return tagClose\n }\n return nok(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagClose(code) {\n // ASCII alphanumerical and `-`.\n if (code === 45 || asciiAlphanumeric(code)) {\n effects.consume(code)\n return tagClose\n }\n return tagCloseBetween(code)\n }\n\n /**\n * In closing tag, after tag name.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagCloseBetween(code) {\n if (markdownLineEnding(code)) {\n returnState = tagCloseBetween\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagCloseBetween\n }\n return end(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpen(code) {\n // ASCII alphanumerical and `-`.\n if (code === 45 || asciiAlphanumeric(code)) {\n effects.consume(code)\n return tagOpen\n }\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n return nok(code)\n }\n\n /**\n * In opening tag, after tag name.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenBetween(code) {\n if (code === 47) {\n effects.consume(code)\n return end\n }\n\n // ASCII alphabetical and `:` and `_`.\n if (code === 58 || code === 95 || asciiAlpha(code)) {\n effects.consume(code)\n return tagOpenAttributeName\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenBetween\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenBetween\n }\n return end(code)\n }\n\n /**\n * In attribute name.\n *\n * ```markdown\n * > | a d\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeName(code) {\n // ASCII alphabetical and `-`, `.`, `:`, and `_`.\n if (\n code === 45 ||\n code === 46 ||\n code === 58 ||\n code === 95 ||\n asciiAlphanumeric(code)\n ) {\n effects.consume(code)\n return tagOpenAttributeName\n }\n return tagOpenAttributeNameAfter(code)\n }\n\n /**\n * After attribute name, before initializer, the end of the tag, or\n * whitespace.\n *\n * ```markdown\n * > | a d\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeNameAfter(code) {\n if (code === 61) {\n effects.consume(code)\n return tagOpenAttributeValueBefore\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeNameAfter\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenAttributeNameAfter\n }\n return tagOpenBetween(code)\n }\n\n /**\n * Before unquoted, double quoted, or single quoted attribute value, allowing\n * whitespace.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueBefore(code) {\n if (\n code === null ||\n code === 60 ||\n code === 61 ||\n code === 62 ||\n code === 96\n ) {\n return nok(code)\n }\n if (code === 34 || code === 39) {\n effects.consume(code)\n marker = code\n return tagOpenAttributeValueQuoted\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeValueBefore\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenAttributeValueBefore\n }\n effects.consume(code)\n return tagOpenAttributeValueUnquoted\n }\n\n /**\n * In double or single quoted attribute value.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueQuoted(code) {\n if (code === marker) {\n effects.consume(code)\n marker = undefined\n return tagOpenAttributeValueQuotedAfter\n }\n if (code === null) {\n return nok(code)\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeValueQuoted\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return tagOpenAttributeValueQuoted\n }\n\n /**\n * In unquoted attribute value.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueUnquoted(code) {\n if (\n code === null ||\n code === 34 ||\n code === 39 ||\n code === 60 ||\n code === 61 ||\n code === 96\n ) {\n return nok(code)\n }\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n effects.consume(code)\n return tagOpenAttributeValueUnquoted\n }\n\n /**\n * After double or single quoted attribute value, before whitespace or the end\n * of the tag.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueQuotedAfter(code) {\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n return nok(code)\n }\n\n /**\n * In certain circumstances of a tag where only an `>` is allowed.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function end(code) {\n if (code === 62) {\n effects.consume(code)\n effects.exit('htmlTextData')\n effects.exit('htmlText')\n return ok\n }\n return nok(code)\n }\n\n /**\n * At eol.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * > | a \n * ```\n *\n * @type {State}\n */\n function lineEndingBefore(code) {\n effects.exit('htmlTextData')\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return lineEndingAfter\n }\n\n /**\n * After eol, at optional whitespace.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * | a \n * ^\n * ```\n *\n * @type {State}\n */\n function lineEndingAfter(code) {\n // Always populated by defaults.\n\n return markdownSpace(code)\n ? factorySpace(\n effects,\n lineEndingAfterPrefix,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n : lineEndingAfterPrefix(code)\n }\n\n /**\n * After eol, after optional whitespace.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * | a \n * ^\n * ```\n *\n * @type {State}\n */\n function lineEndingAfterPrefix(code) {\n effects.enter('htmlTextData')\n return returnState(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {labelEnd} from './label-end.js'\n\n/** @type {Construct} */\nexport const labelStartLink = {\n name: 'labelStartLink',\n tokenize: tokenizeLabelStartLink,\n resolveAll: labelEnd.resolveAll\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartLink(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of label (link) start.\n *\n * ```markdown\n * > | a [b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('labelLink')\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelLink')\n return after\n }\n\n /** @type {State} */\n function after(code) {\n // To do: this isn’t needed in `micromark-extension-gfm-footnote`,\n // remove.\n // Hidden footnotes hook.\n /* c8 ignore next 3 */\n return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs\n ? nok(code)\n : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const hardBreakEscape = {\n name: 'hardBreakEscape',\n tokenize: tokenizeHardBreakEscape\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeHardBreakEscape(effects, ok, nok) {\n return start\n\n /**\n * Start of a hard break (escape).\n *\n * ```markdown\n * > | a\\\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('hardBreakEscape')\n effects.consume(code)\n return after\n }\n\n /**\n * After `\\`, at eol.\n *\n * ```markdown\n * > | a\\\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function after(code) {\n if (markdownLineEnding(code)) {\n effects.exit('hardBreakEscape')\n return ok(code)\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Previous} Previous\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const codeText = {\n name: 'codeText',\n tokenize: tokenizeCodeText,\n resolve: resolveCodeText,\n previous\n}\n\n// To do: next major: don’t resolve, like `markdown-rs`.\n/** @type {Resolver} */\nfunction resolveCodeText(events) {\n let tailExitIndex = events.length - 4\n let headEnterIndex = 3\n /** @type {number} */\n let index\n /** @type {number | undefined} */\n let enter\n\n // If we start and end with an EOL or a space.\n if (\n (events[headEnterIndex][1].type === 'lineEnding' ||\n events[headEnterIndex][1].type === 'space') &&\n (events[tailExitIndex][1].type === 'lineEnding' ||\n events[tailExitIndex][1].type === 'space')\n ) {\n index = headEnterIndex\n\n // And we have data.\n while (++index < tailExitIndex) {\n if (events[index][1].type === 'codeTextData') {\n // Then we have padding.\n events[headEnterIndex][1].type = 'codeTextPadding'\n events[tailExitIndex][1].type = 'codeTextPadding'\n headEnterIndex += 2\n tailExitIndex -= 2\n break\n }\n }\n }\n\n // Merge adjacent spaces and data.\n index = headEnterIndex - 1\n tailExitIndex++\n while (++index <= tailExitIndex) {\n if (enter === undefined) {\n if (index !== tailExitIndex && events[index][1].type !== 'lineEnding') {\n enter = index\n }\n } else if (\n index === tailExitIndex ||\n events[index][1].type === 'lineEnding'\n ) {\n events[enter][1].type = 'codeTextData'\n if (index !== enter + 2) {\n events[enter][1].end = events[index - 1][1].end\n events.splice(enter + 2, index - enter - 2)\n tailExitIndex -= index - enter - 2\n index = enter + 2\n }\n enter = undefined\n }\n }\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Previous}\n */\nfunction previous(code) {\n // If there is a previous code, there will always be a tail.\n return (\n code !== 96 ||\n this.events[this.events.length - 1][1].type === 'characterEscape'\n )\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCodeText(effects, ok, nok) {\n const self = this\n let sizeOpen = 0\n /** @type {number} */\n let size\n /** @type {Token} */\n let token\n return start\n\n /**\n * Start of code (text).\n *\n * ```markdown\n * > | `a`\n * ^\n * > | \\`a`\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('codeText')\n effects.enter('codeTextSequence')\n return sequenceOpen(code)\n }\n\n /**\n * In opening sequence.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceOpen(code) {\n if (code === 96) {\n effects.consume(code)\n sizeOpen++\n return sequenceOpen\n }\n effects.exit('codeTextSequence')\n return between(code)\n }\n\n /**\n * Between something and something else.\n *\n * ```markdown\n * > | `a`\n * ^^\n * ```\n *\n * @type {State}\n */\n function between(code) {\n // EOF.\n if (code === null) {\n return nok(code)\n }\n\n // To do: next major: don’t do spaces in resolve, but when compiling,\n // like `markdown-rs`.\n // Tabs don’t work, and virtual spaces don’t make sense.\n if (code === 32) {\n effects.enter('space')\n effects.consume(code)\n effects.exit('space')\n return between\n }\n\n // Closing fence? Could also be data.\n if (code === 96) {\n token = effects.enter('codeTextSequence')\n size = 0\n return sequenceClose(code)\n }\n if (markdownLineEnding(code)) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return between\n }\n\n // Data.\n effects.enter('codeTextData')\n return data(code)\n }\n\n /**\n * In data.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function data(code) {\n if (\n code === null ||\n code === 32 ||\n code === 96 ||\n markdownLineEnding(code)\n ) {\n effects.exit('codeTextData')\n return between(code)\n }\n effects.consume(code)\n return data\n }\n\n /**\n * In closing sequence.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceClose(code) {\n // More.\n if (code === 96) {\n effects.consume(code)\n size++\n return sequenceClose\n }\n\n // Done!\n if (size === sizeOpen) {\n effects.exit('codeTextSequence')\n effects.exit('codeText')\n return ok(code)\n }\n\n // More or less accents: mark as data.\n token.type = 'codeTextData'\n return data(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Extension} Extension\n */\n\nimport {\n attention,\n autolink,\n blockQuote,\n characterEscape,\n characterReference,\n codeFenced,\n codeIndented,\n codeText,\n definition,\n hardBreakEscape,\n headingAtx,\n htmlFlow,\n htmlText,\n labelEnd,\n labelStartImage,\n labelStartLink,\n lineEnding,\n list,\n setextUnderline,\n thematicBreak\n} from 'micromark-core-commonmark'\nimport {resolver as resolveText} from './initialize/text.js'\n\n/** @satisfies {Extension['document']} */\nexport const document = {\n [42]: list,\n [43]: list,\n [45]: list,\n [48]: list,\n [49]: list,\n [50]: list,\n [51]: list,\n [52]: list,\n [53]: list,\n [54]: list,\n [55]: list,\n [56]: list,\n [57]: list,\n [62]: blockQuote\n}\n\n/** @satisfies {Extension['contentInitial']} */\nexport const contentInitial = {\n [91]: definition\n}\n\n/** @satisfies {Extension['flowInitial']} */\nexport const flowInitial = {\n [-2]: codeIndented,\n [-1]: codeIndented,\n [32]: codeIndented\n}\n\n/** @satisfies {Extension['flow']} */\nexport const flow = {\n [35]: headingAtx,\n [42]: thematicBreak,\n [45]: [setextUnderline, thematicBreak],\n [60]: htmlFlow,\n [61]: setextUnderline,\n [95]: thematicBreak,\n [96]: codeFenced,\n [126]: codeFenced\n}\n\n/** @satisfies {Extension['string']} */\nexport const string = {\n [38]: characterReference,\n [92]: characterEscape\n}\n\n/** @satisfies {Extension['text']} */\nexport const text = {\n [-5]: lineEnding,\n [-4]: lineEnding,\n [-3]: lineEnding,\n [33]: labelStartImage,\n [38]: characterReference,\n [42]: attention,\n [60]: [autolink, htmlText],\n [91]: labelStartLink,\n [92]: [hardBreakEscape, characterEscape],\n [93]: labelEnd,\n [95]: attention,\n [96]: codeText\n}\n\n/** @satisfies {Extension['insideSpan']} */\nexport const insideSpan = {\n null: [attention, resolveText]\n}\n\n/** @satisfies {Extension['attentionMarkers']} */\nexport const attentionMarkers = {\n null: [42, 95]\n}\n\n/** @satisfies {Extension['disable']} */\nexport const disable = {\n null: []\n}\n","/**\n * @typedef {import('micromark-util-types').Create} Create\n * @typedef {import('micromark-util-types').FullNormalizedExtension} FullNormalizedExtension\n * @typedef {import('micromark-util-types').InitialConstruct} InitialConstruct\n * @typedef {import('micromark-util-types').ParseContext} ParseContext\n * @typedef {import('micromark-util-types').ParseOptions} ParseOptions\n */\n\nimport {combineExtensions} from 'micromark-util-combine-extensions'\nimport {content} from './initialize/content.js'\nimport {document} from './initialize/document.js'\nimport {flow} from './initialize/flow.js'\nimport {text, string} from './initialize/text.js'\nimport {createTokenizer} from './create-tokenizer.js'\nimport * as defaultConstructs from './constructs.js'\n\n/**\n * @param {ParseOptions | null | undefined} [options]\n * @returns {ParseContext}\n */\nexport function parse(options) {\n const settings = options || {}\n const constructs =\n /** @type {FullNormalizedExtension} */\n combineExtensions([defaultConstructs, ...(settings.extensions || [])])\n\n /** @type {ParseContext} */\n const parser = {\n defined: [],\n lazy: {},\n constructs,\n content: create(content),\n document: create(document),\n flow: create(flow),\n string: create(string),\n text: create(text)\n }\n return parser\n\n /**\n * @param {InitialConstruct} initial\n */\n function create(initial) {\n return creator\n /** @type {Create} */\n function creator(from) {\n return createTokenizer(parser, initial, from)\n }\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Chunk} Chunk\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Encoding} Encoding\n * @typedef {import('micromark-util-types').Value} Value\n */\n\n/**\n * @callback Preprocessor\n * @param {Value} value\n * @param {Encoding | null | undefined} [encoding]\n * @param {boolean | null | undefined} [end=false]\n * @returns {Array}\n */\n\nconst search = /[\\0\\t\\n\\r]/g\n\n/**\n * @returns {Preprocessor}\n */\nexport function preprocess() {\n let column = 1\n let buffer = ''\n /** @type {boolean | undefined} */\n let start = true\n /** @type {boolean | undefined} */\n let atCarriageReturn\n return preprocessor\n\n /** @type {Preprocessor} */\n function preprocessor(value, encoding, end) {\n /** @type {Array} */\n const chunks = []\n /** @type {RegExpMatchArray | null} */\n let match\n /** @type {number} */\n let next\n /** @type {number} */\n let startPosition\n /** @type {number} */\n let endPosition\n /** @type {Code} */\n let code\n\n // @ts-expect-error `Buffer` does allow an encoding.\n value = buffer + value.toString(encoding)\n startPosition = 0\n buffer = ''\n if (start) {\n // To do: `markdown-rs` actually parses BOMs (byte order mark).\n if (value.charCodeAt(0) === 65279) {\n startPosition++\n }\n start = undefined\n }\n while (startPosition < value.length) {\n search.lastIndex = startPosition\n match = search.exec(value)\n endPosition =\n match && match.index !== undefined ? match.index : value.length\n code = value.charCodeAt(endPosition)\n if (!match) {\n buffer = value.slice(startPosition)\n break\n }\n if (code === 10 && startPosition === endPosition && atCarriageReturn) {\n chunks.push(-3)\n atCarriageReturn = undefined\n } else {\n if (atCarriageReturn) {\n chunks.push(-5)\n atCarriageReturn = undefined\n }\n if (startPosition < endPosition) {\n chunks.push(value.slice(startPosition, endPosition))\n column += endPosition - startPosition\n }\n switch (code) {\n case 0: {\n chunks.push(65533)\n column++\n break\n }\n case 9: {\n next = Math.ceil(column / 4) * 4\n chunks.push(-2)\n while (column++ < next) chunks.push(-1)\n break\n }\n case 10: {\n chunks.push(-4)\n column = 1\n break\n }\n default: {\n atCarriageReturn = true\n column = 1\n }\n }\n }\n startPosition = endPosition + 1\n }\n if (end) {\n if (atCarriageReturn) chunks.push(-5)\n if (buffer) chunks.push(buffer)\n chunks.push(null)\n }\n return chunks\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\nimport {subtokenize} from 'micromark-util-subtokenize'\n\n/**\n * @param {Array} events\n * @returns {Array}\n */\nexport function postprocess(events) {\n while (!subtokenize(events)) {\n // Empty\n }\n return events\n}\n","/**\n * Turn the number (in string form as either hexa- or plain decimal) coming from\n * a numeric character reference into a character.\n *\n * Sort of like `String.fromCharCode(Number.parseInt(value, base))`, but makes\n * non-characters and control characters safe.\n *\n * @param {string} value\n * Value to decode.\n * @param {number} base\n * Numeric base.\n * @returns {string}\n * Character.\n */\nexport function decodeNumericCharacterReference(value, base) {\n const code = Number.parseInt(value, base)\n if (\n // C0 except for HT, LF, FF, CR, space.\n code < 9 ||\n code === 11 ||\n (code > 13 && code < 32) ||\n // Control character (DEL) of C0, and C1 controls.\n (code > 126 && code < 160) ||\n // Lone high surrogates and low surrogates.\n (code > 55295 && code < 57344) ||\n // Noncharacters.\n (code > 64975 && code < 65008) /* eslint-disable no-bitwise */ ||\n (code & 65535) === 65535 ||\n (code & 65535) === 65534 /* eslint-enable no-bitwise */ ||\n // Out of range\n code > 1114111\n ) {\n return '\\uFFFD'\n }\n return String.fromCharCode(code)\n}\n","import {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nconst characterEscapeOrReference =\n /\\\\([!-/:-@[-`{-~])|&(#(?:\\d{1,7}|x[\\da-f]{1,6})|[\\da-z]{1,31});/gi\n\n/**\n * Decode markdown strings (which occur in places such as fenced code info\n * strings, destinations, labels, and titles).\n *\n * The “string” content type allows character escapes and -references.\n * This decodes those.\n *\n * @param {string} value\n * Value to decode.\n * @returns {string}\n * Decoded value.\n */\nexport function decodeString(value) {\n return value.replace(characterEscapeOrReference, decode)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @param {string} $2\n * @returns {string}\n */\nfunction decode($0, $1, $2) {\n if ($1) {\n // Escape.\n return $1\n }\n\n // Reference.\n const head = $2.charCodeAt(0)\n if (head === 35) {\n const head = $2.charCodeAt(1)\n const hex = head === 120 || head === 88\n return decodeNumericCharacterReference($2.slice(hex ? 2 : 1), hex ? 16 : 10)\n }\n return decodeNamedCharacterReference($2) || $0\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Point} Point\n * @typedef {import('unist').Position} Position\n */\n\n/**\n * @typedef NodeLike\n * @property {string} type\n * @property {PositionLike | null | undefined} [position]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n *\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n */\n\n/**\n * Serialize the positional info of a point, position (start and end points),\n * or node.\n *\n * @param {Node | NodeLike | Position | PositionLike | Point | PointLike | null | undefined} [value]\n * Node, position, or point.\n * @returns {string}\n * Pretty printed positional info of a node (`string`).\n *\n * In the format of a range `ls:cs-le:ce` (when given `node` or `position`)\n * or a point `l:c` (when given `point`), where `l` stands for line, `c` for\n * column, `s` for `start`, and `e` for end.\n * An empty string (`''`) is returned if the given value is neither `node`,\n * `position`, nor `point`.\n */\nexport function stringifyPosition(value) {\n // Nothing.\n if (!value || typeof value !== 'object') {\n return ''\n }\n\n // Node.\n if ('position' in value || 'type' in value) {\n return position(value.position)\n }\n\n // Position.\n if ('start' in value || 'end' in value) {\n return position(value)\n }\n\n // Point.\n if ('line' in value || 'column' in value) {\n return point(value)\n }\n\n // ?\n return ''\n}\n\n/**\n * @param {Point | PointLike | null | undefined} point\n * @returns {string}\n */\nfunction point(point) {\n return index(point && point.line) + ':' + index(point && point.column)\n}\n\n/**\n * @param {Position | PositionLike | null | undefined} pos\n * @returns {string}\n */\nfunction position(pos) {\n return point(pos && pos.start) + '-' + point(pos && pos.end)\n}\n\n/**\n * @param {number | null | undefined} value\n * @returns {number}\n */\nfunction index(value) {\n return value && typeof value === 'number' ? value : 1\n}\n","/**\n * @typedef {import('micromark-util-types').Encoding} Encoding\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').ParseOptions} ParseOptions\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Value} Value\n *\n * @typedef {import('unist').Parent} UnistParent\n * @typedef {import('unist').Point} Point\n *\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('mdast').StaticPhrasingContent} StaticPhrasingContent\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Break} Break\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('mdast').Code} Code\n * @typedef {import('mdast').Definition} Definition\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('mdast').HTML} HTML\n * @typedef {import('mdast').Image} Image\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('mdast').Link} Link\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('mdast').List} List\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('mdast').Text} Text\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('mdast').ReferenceType} ReferenceType\n * @typedef {import('../index.js').CompileData} CompileData\n */\n\n/**\n * @typedef {Root | Content} Node\n * @typedef {Extract} Parent\n *\n * @typedef {Omit & {type: 'fragment', children: Array}} Fragment\n */\n\n/**\n * @callback Transform\n * Extra transform, to change the AST afterwards.\n * @param {Root} tree\n * Tree to transform.\n * @returns {Root | undefined | null | void}\n * New tree or nothing (in which case the current tree is used).\n *\n * @callback Handle\n * Handle a token.\n * @param {CompileContext} this\n * Context.\n * @param {Token} token\n * Current token.\n * @returns {void}\n * Nothing.\n *\n * @typedef {Record} Handles\n * Token types mapping to handles\n *\n * @callback OnEnterError\n * Handle the case where the `right` token is open, but it is closed (by the\n * `left` token) or because we reached the end of the document.\n * @param {Omit} this\n * Context.\n * @param {Token | undefined} left\n * Left token.\n * @param {Token} right\n * Right token.\n * @returns {void}\n * Nothing.\n *\n * @callback OnExitError\n * Handle the case where the `right` token is open but it is closed by\n * exiting the `left` token.\n * @param {Omit} this\n * Context.\n * @param {Token} left\n * Left token.\n * @param {Token} right\n * Right token.\n * @returns {void}\n * Nothing.\n *\n * @typedef {[Token, OnEnterError | undefined]} TokenTuple\n * Open token on the stack, with an optional error handler for when\n * that token isn’t closed properly.\n */\n\n/**\n * @typedef Config\n * Configuration.\n *\n * We have our defaults, but extensions will add more.\n * @property {Array} canContainEols\n * Token types where line endings are used.\n * @property {Handles} enter\n * Opening handles.\n * @property {Handles} exit\n * Closing handles.\n * @property {Array} transforms\n * Tree transforms.\n *\n * @typedef {Partial} Extension\n * Change how markdown tokens from micromark are turned into mdast.\n *\n * @typedef CompileContext\n * mdast compiler context.\n * @property {Array} stack\n * Stack of nodes.\n * @property {Array} tokenStack\n * Stack of tokens.\n * @property {(key: Key) => CompileData[Key]} getData\n * Get data from the key/value store.\n * @property {(key: Key, value?: CompileData[Key]) => void} setData\n * Set data into the key/value store.\n * @property {(this: CompileContext) => void} buffer\n * Capture some of the output data.\n * @property {(this: CompileContext) => string} resume\n * Stop capturing and access the output data.\n * @property {(this: CompileContext, node: Kind, token: Token, onError?: OnEnterError) => Kind} enter\n * Enter a token.\n * @property {(this: CompileContext, token: Token, onError?: OnExitError) => Node} exit\n * Exit a token.\n * @property {TokenizeContext['sliceSerialize']} sliceSerialize\n * Get the string value of a token.\n * @property {Config} config\n * Configuration.\n *\n * @typedef FromMarkdownOptions\n * Configuration for how to build mdast.\n * @property {Array> | null | undefined} [mdastExtensions]\n * Extensions for this utility to change how tokens are turned into a tree.\n *\n * @typedef {ParseOptions & FromMarkdownOptions} Options\n * Configuration.\n */\n\n// To do: micromark: create a registry of tokens?\n// To do: next major: don’t return given `Node` from `enter`.\n// To do: next major: remove setter/getter.\n\nimport {toString} from 'mdast-util-to-string'\nimport {parse} from 'micromark/lib/parse.js'\nimport {preprocess} from 'micromark/lib/preprocess.js'\nimport {postprocess} from 'micromark/lib/postprocess.js'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nimport {decodeString} from 'micromark-util-decode-string'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {stringifyPosition} from 'unist-util-stringify-position'\nconst own = {}.hasOwnProperty\n\n/**\n * @param value\n * Markdown to parse.\n * @param encoding\n * Character encoding for when `value` is `Buffer`.\n * @param options\n * Configuration.\n * @returns\n * mdast tree.\n */\nexport const fromMarkdown =\n /**\n * @type {(\n * ((value: Value, encoding: Encoding, options?: Options | null | undefined) => Root) &\n * ((value: Value, options?: Options | null | undefined) => Root)\n * )}\n */\n\n /**\n * @param {Value} value\n * @param {Encoding | Options | null | undefined} [encoding]\n * @param {Options | null | undefined} [options]\n * @returns {Root}\n */\n function (value, encoding, options) {\n if (typeof encoding !== 'string') {\n options = encoding\n encoding = undefined\n }\n return compiler(options)(\n postprocess(\n parse(options).document().write(preprocess()(value, encoding, true))\n )\n )\n }\n\n/**\n * Note this compiler only understand complete buffering, not streaming.\n *\n * @param {Options | null | undefined} [options]\n */\nfunction compiler(options) {\n /** @type {Config} */\n const config = {\n transforms: [],\n canContainEols: ['emphasis', 'fragment', 'heading', 'paragraph', 'strong'],\n enter: {\n autolink: opener(link),\n autolinkProtocol: onenterdata,\n autolinkEmail: onenterdata,\n atxHeading: opener(heading),\n blockQuote: opener(blockQuote),\n characterEscape: onenterdata,\n characterReference: onenterdata,\n codeFenced: opener(codeFlow),\n codeFencedFenceInfo: buffer,\n codeFencedFenceMeta: buffer,\n codeIndented: opener(codeFlow, buffer),\n codeText: opener(codeText, buffer),\n codeTextData: onenterdata,\n data: onenterdata,\n codeFlowValue: onenterdata,\n definition: opener(definition),\n definitionDestinationString: buffer,\n definitionLabelString: buffer,\n definitionTitleString: buffer,\n emphasis: opener(emphasis),\n hardBreakEscape: opener(hardBreak),\n hardBreakTrailing: opener(hardBreak),\n htmlFlow: opener(html, buffer),\n htmlFlowData: onenterdata,\n htmlText: opener(html, buffer),\n htmlTextData: onenterdata,\n image: opener(image),\n label: buffer,\n link: opener(link),\n listItem: opener(listItem),\n listItemValue: onenterlistitemvalue,\n listOrdered: opener(list, onenterlistordered),\n listUnordered: opener(list),\n paragraph: opener(paragraph),\n reference: onenterreference,\n referenceString: buffer,\n resourceDestinationString: buffer,\n resourceTitleString: buffer,\n setextHeading: opener(heading),\n strong: opener(strong),\n thematicBreak: opener(thematicBreak)\n },\n exit: {\n atxHeading: closer(),\n atxHeadingSequence: onexitatxheadingsequence,\n autolink: closer(),\n autolinkEmail: onexitautolinkemail,\n autolinkProtocol: onexitautolinkprotocol,\n blockQuote: closer(),\n characterEscapeValue: onexitdata,\n characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,\n characterReferenceMarkerNumeric: onexitcharacterreferencemarker,\n characterReferenceValue: onexitcharacterreferencevalue,\n codeFenced: closer(onexitcodefenced),\n codeFencedFence: onexitcodefencedfence,\n codeFencedFenceInfo: onexitcodefencedfenceinfo,\n codeFencedFenceMeta: onexitcodefencedfencemeta,\n codeFlowValue: onexitdata,\n codeIndented: closer(onexitcodeindented),\n codeText: closer(onexitcodetext),\n codeTextData: onexitdata,\n data: onexitdata,\n definition: closer(),\n definitionDestinationString: onexitdefinitiondestinationstring,\n definitionLabelString: onexitdefinitionlabelstring,\n definitionTitleString: onexitdefinitiontitlestring,\n emphasis: closer(),\n hardBreakEscape: closer(onexithardbreak),\n hardBreakTrailing: closer(onexithardbreak),\n htmlFlow: closer(onexithtmlflow),\n htmlFlowData: onexitdata,\n htmlText: closer(onexithtmltext),\n htmlTextData: onexitdata,\n image: closer(onexitimage),\n label: onexitlabel,\n labelText: onexitlabeltext,\n lineEnding: onexitlineending,\n link: closer(onexitlink),\n listItem: closer(),\n listOrdered: closer(),\n listUnordered: closer(),\n paragraph: closer(),\n referenceString: onexitreferencestring,\n resourceDestinationString: onexitresourcedestinationstring,\n resourceTitleString: onexitresourcetitlestring,\n resource: onexitresource,\n setextHeading: closer(onexitsetextheading),\n setextHeadingLineSequence: onexitsetextheadinglinesequence,\n setextHeadingText: onexitsetextheadingtext,\n strong: closer(),\n thematicBreak: closer()\n }\n }\n configure(config, (options || {}).mdastExtensions || [])\n\n /** @type {CompileData} */\n const data = {}\n return compile\n\n /**\n * Turn micromark events into an mdast tree.\n *\n * @param {Array} events\n * Events.\n * @returns {Root}\n * mdast tree.\n */\n function compile(events) {\n /** @type {Root} */\n let tree = {\n type: 'root',\n children: []\n }\n /** @type {Omit} */\n const context = {\n stack: [tree],\n tokenStack: [],\n config,\n enter,\n exit,\n buffer,\n resume,\n setData,\n getData\n }\n /** @type {Array} */\n const listStack = []\n let index = -1\n while (++index < events.length) {\n // We preprocess lists to add `listItem` tokens, and to infer whether\n // items the list itself are spread out.\n if (\n events[index][1].type === 'listOrdered' ||\n events[index][1].type === 'listUnordered'\n ) {\n if (events[index][0] === 'enter') {\n listStack.push(index)\n } else {\n const tail = listStack.pop()\n index = prepareList(events, tail, index)\n }\n }\n }\n index = -1\n while (++index < events.length) {\n const handler = config[events[index][0]]\n if (own.call(handler, events[index][1].type)) {\n handler[events[index][1].type].call(\n Object.assign(\n {\n sliceSerialize: events[index][2].sliceSerialize\n },\n context\n ),\n events[index][1]\n )\n }\n }\n\n // Handle tokens still being open.\n if (context.tokenStack.length > 0) {\n const tail = context.tokenStack[context.tokenStack.length - 1]\n const handler = tail[1] || defaultOnError\n handler.call(context, undefined, tail[0])\n }\n\n // Figure out `root` position.\n tree.position = {\n start: point(\n events.length > 0\n ? events[0][1].start\n : {\n line: 1,\n column: 1,\n offset: 0\n }\n ),\n end: point(\n events.length > 0\n ? events[events.length - 2][1].end\n : {\n line: 1,\n column: 1,\n offset: 0\n }\n )\n }\n\n // Call transforms.\n index = -1\n while (++index < config.transforms.length) {\n tree = config.transforms[index](tree) || tree\n }\n return tree\n }\n\n /**\n * @param {Array} events\n * @param {number} start\n * @param {number} length\n * @returns {number}\n */\n function prepareList(events, start, length) {\n let index = start - 1\n let containerBalance = -1\n let listSpread = false\n /** @type {Token | undefined} */\n let listItem\n /** @type {number | undefined} */\n let lineIndex\n /** @type {number | undefined} */\n let firstBlankLineIndex\n /** @type {boolean | undefined} */\n let atMarker\n while (++index <= length) {\n const event = events[index]\n if (\n event[1].type === 'listUnordered' ||\n event[1].type === 'listOrdered' ||\n event[1].type === 'blockQuote'\n ) {\n if (event[0] === 'enter') {\n containerBalance++\n } else {\n containerBalance--\n }\n atMarker = undefined\n } else if (event[1].type === 'lineEndingBlank') {\n if (event[0] === 'enter') {\n if (\n listItem &&\n !atMarker &&\n !containerBalance &&\n !firstBlankLineIndex\n ) {\n firstBlankLineIndex = index\n }\n atMarker = undefined\n }\n } else if (\n event[1].type === 'linePrefix' ||\n event[1].type === 'listItemValue' ||\n event[1].type === 'listItemMarker' ||\n event[1].type === 'listItemPrefix' ||\n event[1].type === 'listItemPrefixWhitespace'\n ) {\n // Empty.\n } else {\n atMarker = undefined\n }\n if (\n (!containerBalance &&\n event[0] === 'enter' &&\n event[1].type === 'listItemPrefix') ||\n (containerBalance === -1 &&\n event[0] === 'exit' &&\n (event[1].type === 'listUnordered' ||\n event[1].type === 'listOrdered'))\n ) {\n if (listItem) {\n let tailIndex = index\n lineIndex = undefined\n while (tailIndex--) {\n const tailEvent = events[tailIndex]\n if (\n tailEvent[1].type === 'lineEnding' ||\n tailEvent[1].type === 'lineEndingBlank'\n ) {\n if (tailEvent[0] === 'exit') continue\n if (lineIndex) {\n events[lineIndex][1].type = 'lineEndingBlank'\n listSpread = true\n }\n tailEvent[1].type = 'lineEnding'\n lineIndex = tailIndex\n } else if (\n tailEvent[1].type === 'linePrefix' ||\n tailEvent[1].type === 'blockQuotePrefix' ||\n tailEvent[1].type === 'blockQuotePrefixWhitespace' ||\n tailEvent[1].type === 'blockQuoteMarker' ||\n tailEvent[1].type === 'listItemIndent'\n ) {\n // Empty\n } else {\n break\n }\n }\n if (\n firstBlankLineIndex &&\n (!lineIndex || firstBlankLineIndex < lineIndex)\n ) {\n listItem._spread = true\n }\n\n // Fix position.\n listItem.end = Object.assign(\n {},\n lineIndex ? events[lineIndex][1].start : event[1].end\n )\n events.splice(lineIndex || index, 0, ['exit', listItem, event[2]])\n index++\n length++\n }\n\n // Create a new list item.\n if (event[1].type === 'listItemPrefix') {\n listItem = {\n type: 'listItem',\n _spread: false,\n start: Object.assign({}, event[1].start),\n // @ts-expect-error: we’ll add `end` in a second.\n end: undefined\n }\n // @ts-expect-error: `listItem` is most definitely defined, TS...\n events.splice(index, 0, ['enter', listItem, event[2]])\n index++\n length++\n firstBlankLineIndex = undefined\n atMarker = true\n }\n }\n }\n events[start][1]._spread = listSpread\n return length\n }\n\n /**\n * Set data.\n *\n * @template {keyof CompileData} Key\n * Field type.\n * @param {Key} key\n * Key of field.\n * @param {CompileData[Key]} [value]\n * New value.\n * @returns {void}\n * Nothing.\n */\n function setData(key, value) {\n data[key] = value\n }\n\n /**\n * Get data.\n *\n * @template {keyof CompileData} Key\n * Field type.\n * @param {Key} key\n * Key of field.\n * @returns {CompileData[Key]}\n * Value.\n */\n function getData(key) {\n return data[key]\n }\n\n /**\n * Create an opener handle.\n *\n * @param {(token: Token) => Node} create\n * Create a node.\n * @param {Handle} [and]\n * Optional function to also run.\n * @returns {Handle}\n * Handle.\n */\n function opener(create, and) {\n return open\n\n /**\n * @this {CompileContext}\n * @param {Token} token\n * @returns {void}\n */\n function open(token) {\n enter.call(this, create(token), token)\n if (and) and.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * @returns {void}\n */\n function buffer() {\n this.stack.push({\n type: 'fragment',\n children: []\n })\n }\n\n /**\n * @template {Node} Kind\n * Node type.\n * @this {CompileContext}\n * Context.\n * @param {Kind} node\n * Node to enter.\n * @param {Token} token\n * Corresponding token.\n * @param {OnEnterError | undefined} [errorHandler]\n * Handle the case where this token is open, but it is closed by something else.\n * @returns {Kind}\n * The given node.\n */\n function enter(node, token, errorHandler) {\n const parent = this.stack[this.stack.length - 1]\n // @ts-expect-error: Assume `Node` can exist as a child of `parent`.\n parent.children.push(node)\n this.stack.push(node)\n this.tokenStack.push([token, errorHandler])\n // @ts-expect-error: `end` will be patched later.\n node.position = {\n start: point(token.start)\n }\n return node\n }\n\n /**\n * Create a closer handle.\n *\n * @param {Handle} [and]\n * Optional function to also run.\n * @returns {Handle}\n * Handle.\n */\n function closer(and) {\n return close\n\n /**\n * @this {CompileContext}\n * @param {Token} token\n * @returns {void}\n */\n function close(token) {\n if (and) and.call(this, token)\n exit.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * Context.\n * @param {Token} token\n * Corresponding token.\n * @param {OnExitError | undefined} [onExitError]\n * Handle the case where another token is open.\n * @returns {Node}\n * The closed node.\n */\n function exit(token, onExitError) {\n const node = this.stack.pop()\n const open = this.tokenStack.pop()\n if (!open) {\n throw new Error(\n 'Cannot close `' +\n token.type +\n '` (' +\n stringifyPosition({\n start: token.start,\n end: token.end\n }) +\n '): it’s not open'\n )\n } else if (open[0].type !== token.type) {\n if (onExitError) {\n onExitError.call(this, token, open[0])\n } else {\n const handler = open[1] || defaultOnError\n handler.call(this, token, open[0])\n }\n }\n node.position.end = point(token.end)\n return node\n }\n\n /**\n * @this {CompileContext}\n * @returns {string}\n */\n function resume() {\n return toString(this.stack.pop())\n }\n\n //\n // Handlers.\n //\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onenterlistordered() {\n setData('expectingFirstListItemValue', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onenterlistitemvalue(token) {\n if (getData('expectingFirstListItemValue')) {\n const ancestor = this.stack[this.stack.length - 2]\n ancestor.start = Number.parseInt(this.sliceSerialize(token), 10)\n setData('expectingFirstListItemValue')\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfenceinfo() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.lang = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfencemeta() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.meta = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfence() {\n // Exit if this is the closing fence.\n if (getData('flowCodeInside')) return\n this.buffer()\n setData('flowCodeInside', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefenced() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data.replace(/^(\\r?\\n|\\r)|(\\r?\\n|\\r)$/g, '')\n setData('flowCodeInside')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodeindented() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data.replace(/(\\r?\\n|\\r)$/g, '')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitionlabelstring(token) {\n const label = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitiontitlestring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.title = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitiondestinationstring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.url = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitatxheadingsequence(token) {\n const node = this.stack[this.stack.length - 1]\n if (!node.depth) {\n const depth = this.sliceSerialize(token).length\n node.depth = depth\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheadingtext() {\n setData('setextHeadingSlurpLineEnding', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheadinglinesequence(token) {\n const node = this.stack[this.stack.length - 1]\n node.depth = this.sliceSerialize(token).charCodeAt(0) === 61 ? 1 : 2\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheading() {\n setData('setextHeadingSlurpLineEnding')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onenterdata(token) {\n const node = this.stack[this.stack.length - 1]\n let tail = node.children[node.children.length - 1]\n if (!tail || tail.type !== 'text') {\n // Add a new text node.\n tail = text()\n // @ts-expect-error: we’ll add `end` later.\n tail.position = {\n start: point(token.start)\n }\n // @ts-expect-error: Assume `parent` accepts `text`.\n node.children.push(tail)\n }\n this.stack.push(tail)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitdata(token) {\n const tail = this.stack.pop()\n tail.value += this.sliceSerialize(token)\n tail.position.end = point(token.end)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlineending(token) {\n const context = this.stack[this.stack.length - 1]\n // If we’re at a hard break, include the line ending in there.\n if (getData('atHardBreak')) {\n const tail = context.children[context.children.length - 1]\n tail.position.end = point(token.end)\n setData('atHardBreak')\n return\n }\n if (\n !getData('setextHeadingSlurpLineEnding') &&\n config.canContainEols.includes(context.type)\n ) {\n onenterdata.call(this, token)\n onexitdata.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithardbreak() {\n setData('atHardBreak', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithtmlflow() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithtmltext() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitcodetext() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlink() {\n const node = this.stack[this.stack.length - 1]\n // Note: there are also `identifier` and `label` fields on this link node!\n // These are used / cleaned here.\n // To do: clean.\n if (getData('inReference')) {\n /** @type {ReferenceType} */\n const referenceType = getData('referenceType') || 'shortcut'\n node.type += 'Reference'\n // @ts-expect-error: mutate.\n node.referenceType = referenceType\n // @ts-expect-error: mutate.\n delete node.url\n delete node.title\n } else {\n // @ts-expect-error: mutate.\n delete node.identifier\n // @ts-expect-error: mutate.\n delete node.label\n }\n setData('referenceType')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitimage() {\n const node = this.stack[this.stack.length - 1]\n // Note: there are also `identifier` and `label` fields on this link node!\n // These are used / cleaned here.\n // To do: clean.\n if (getData('inReference')) {\n /** @type {ReferenceType} */\n const referenceType = getData('referenceType') || 'shortcut'\n node.type += 'Reference'\n // @ts-expect-error: mutate.\n node.referenceType = referenceType\n // @ts-expect-error: mutate.\n delete node.url\n delete node.title\n } else {\n // @ts-expect-error: mutate.\n delete node.identifier\n // @ts-expect-error: mutate.\n delete node.label\n }\n setData('referenceType')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlabeltext(token) {\n const string = this.sliceSerialize(token)\n const ancestor = this.stack[this.stack.length - 2]\n // @ts-expect-error: stash this on the node, as it might become a reference\n // later.\n ancestor.label = decodeString(string)\n // @ts-expect-error: same as above.\n ancestor.identifier = normalizeIdentifier(string).toLowerCase()\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlabel() {\n const fragment = this.stack[this.stack.length - 1]\n const value = this.resume()\n const node = this.stack[this.stack.length - 1]\n // Assume a reference.\n setData('inReference', true)\n if (node.type === 'link') {\n /** @type {Array} */\n // @ts-expect-error: Assume static phrasing content.\n const children = fragment.children\n node.children = children\n } else {\n node.alt = value\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresourcedestinationstring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.url = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresourcetitlestring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.title = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresource() {\n setData('inReference')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onenterreference() {\n setData('referenceType', 'collapsed')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitreferencestring(token) {\n const label = this.resume()\n const node = this.stack[this.stack.length - 1]\n // @ts-expect-error: stash this on the node, as it might become a reference\n // later.\n node.label = label\n // @ts-expect-error: same as above.\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n setData('referenceType', 'full')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitcharacterreferencemarker(token) {\n setData('characterReferenceType', token.type)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcharacterreferencevalue(token) {\n const data = this.sliceSerialize(token)\n const type = getData('characterReferenceType')\n /** @type {string} */\n let value\n if (type) {\n value = decodeNumericCharacterReference(\n data,\n type === 'characterReferenceMarkerNumeric' ? 10 : 16\n )\n setData('characterReferenceType')\n } else {\n const result = decodeNamedCharacterReference(data)\n value = result\n }\n const tail = this.stack.pop()\n tail.value += value\n tail.position.end = point(token.end)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitautolinkprotocol(token) {\n onexitdata.call(this, token)\n const node = this.stack[this.stack.length - 1]\n node.url = this.sliceSerialize(token)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitautolinkemail(token) {\n onexitdata.call(this, token)\n const node = this.stack[this.stack.length - 1]\n node.url = 'mailto:' + this.sliceSerialize(token)\n }\n\n //\n // Creaters.\n //\n\n /** @returns {Blockquote} */\n function blockQuote() {\n return {\n type: 'blockquote',\n children: []\n }\n }\n\n /** @returns {Code} */\n function codeFlow() {\n return {\n type: 'code',\n lang: null,\n meta: null,\n value: ''\n }\n }\n\n /** @returns {InlineCode} */\n function codeText() {\n return {\n type: 'inlineCode',\n value: ''\n }\n }\n\n /** @returns {Definition} */\n function definition() {\n return {\n type: 'definition',\n identifier: '',\n label: null,\n title: null,\n url: ''\n }\n }\n\n /** @returns {Emphasis} */\n function emphasis() {\n return {\n type: 'emphasis',\n children: []\n }\n }\n\n /** @returns {Heading} */\n function heading() {\n // @ts-expect-error `depth` will be set later.\n return {\n type: 'heading',\n depth: undefined,\n children: []\n }\n }\n\n /** @returns {Break} */\n function hardBreak() {\n return {\n type: 'break'\n }\n }\n\n /** @returns {HTML} */\n function html() {\n return {\n type: 'html',\n value: ''\n }\n }\n\n /** @returns {Image} */\n function image() {\n return {\n type: 'image',\n title: null,\n url: '',\n alt: null\n }\n }\n\n /** @returns {Link} */\n function link() {\n return {\n type: 'link',\n title: null,\n url: '',\n children: []\n }\n }\n\n /**\n * @param {Token} token\n * @returns {List}\n */\n function list(token) {\n return {\n type: 'list',\n ordered: token.type === 'listOrdered',\n start: null,\n spread: token._spread,\n children: []\n }\n }\n\n /**\n * @param {Token} token\n * @returns {ListItem}\n */\n function listItem(token) {\n return {\n type: 'listItem',\n spread: token._spread,\n checked: null,\n children: []\n }\n }\n\n /** @returns {Paragraph} */\n function paragraph() {\n return {\n type: 'paragraph',\n children: []\n }\n }\n\n /** @returns {Strong} */\n function strong() {\n return {\n type: 'strong',\n children: []\n }\n }\n\n /** @returns {Text} */\n function text() {\n return {\n type: 'text',\n value: ''\n }\n }\n\n /** @returns {ThematicBreak} */\n function thematicBreak() {\n return {\n type: 'thematicBreak'\n }\n }\n}\n\n/**\n * Copy a point-like value.\n *\n * @param {Point} d\n * Point-like value.\n * @returns {Point}\n * unist point.\n */\nfunction point(d) {\n return {\n line: d.line,\n column: d.column,\n offset: d.offset\n }\n}\n\n/**\n * @param {Config} combined\n * @param {Array>} extensions\n * @returns {void}\n */\nfunction configure(combined, extensions) {\n let index = -1\n while (++index < extensions.length) {\n const value = extensions[index]\n if (Array.isArray(value)) {\n configure(combined, value)\n } else {\n extension(combined, value)\n }\n }\n}\n\n/**\n * @param {Config} combined\n * @param {Extension} extension\n * @returns {void}\n */\nfunction extension(combined, extension) {\n /** @type {keyof Extension} */\n let key\n for (key in extension) {\n if (own.call(extension, key)) {\n if (key === 'canContainEols') {\n const right = extension[key]\n if (right) {\n combined[key].push(...right)\n }\n } else if (key === 'transforms') {\n const right = extension[key]\n if (right) {\n combined[key].push(...right)\n }\n } else if (key === 'enter' || key === 'exit') {\n const right = extension[key]\n if (right) {\n Object.assign(combined[key], right)\n }\n }\n }\n }\n}\n\n/** @type {OnEnterError} */\nfunction defaultOnError(left, right) {\n if (left) {\n throw new Error(\n 'Cannot close `' +\n left.type +\n '` (' +\n stringifyPosition({\n start: left.start,\n end: left.end\n }) +\n '): a different token (`' +\n right.type +\n '`, ' +\n stringifyPosition({\n start: right.start,\n end: right.end\n }) +\n ') is open'\n )\n } else {\n throw new Error(\n 'Cannot close document, a token (`' +\n right.type +\n '`, ' +\n stringifyPosition({\n start: right.start,\n end: right.end\n }) +\n ') is still open'\n )\n }\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-from-markdown').Options} Options\n */\n\nimport {fromMarkdown} from 'mdast-util-from-markdown'\n\n/**\n * @this {import('unified').Processor}\n * @type {import('unified').Plugin<[Options?] | void[], string, Root>}\n */\nexport default function remarkParse(options) {\n /** @type {import('unified').ParserFunction} */\n const parser = (doc) => {\n // Assume options.\n const settings = /** @type {Options} */ (this.data('settings'))\n\n return fromMarkdown(\n doc,\n Object.assign({}, settings, options, {\n // Note: these options are not in the readme.\n // The goal is for them to be set by plugins on `data` instead of being\n // passed by users.\n extensions: this.data('micromarkExtensions') || [],\n mdastExtensions: this.data('fromMarkdownExtensions') || []\n })\n )\n }\n\n Object.assign(this, {Parser: parser})\n}\n","/**\n * @typedef {import('./types.js').Options} Options\n * @typedef {import('./types.js').State} State\n */\n\n/**\n * @param {State} base\n * @param {Options} extension\n * @returns {State}\n */\nexport function configure(base, extension) {\n let index = -1\n /** @type {keyof Options} */\n let key\n\n // First do subextensions.\n if (extension.extensions) {\n while (++index < extension.extensions.length) {\n configure(base, extension.extensions[index])\n }\n }\n\n for (key in extension) {\n if (key === 'extensions') {\n // Empty.\n } else if (key === 'unsafe' || key === 'join') {\n /* c8 ignore next 2 */\n // @ts-expect-error: hush.\n base[key] = [...(base[key] || []), ...(extension[key] || [])]\n } else if (key === 'handlers') {\n base[key] = Object.assign(base[key], extension[key] || {})\n } else {\n // @ts-expect-error: hush.\n base.options[key] = extension[key]\n }\n }\n\n return base\n}\n","/**\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Map} Map\n */\n\n/**\n * @param {Blockquote} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function blockquote(node, _, state, info) {\n const exit = state.enter('blockquote')\n const tracker = state.createTracker(info)\n tracker.move('> ')\n tracker.shift(2)\n const value = state.indentLines(\n state.containerFlow(node, tracker.current()),\n map\n )\n exit()\n return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n return '>' + (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n * @typedef {import('../types.js').ConstructName} ConstructName\n */\n\n/**\n * @param {Array} stack\n * @param {Unsafe} pattern\n * @returns {boolean}\n */\nexport function patternInScope(stack, pattern) {\n return (\n listInScope(stack, pattern.inConstruct, true) &&\n !listInScope(stack, pattern.notInConstruct, false)\n )\n}\n\n/**\n * @param {Array} stack\n * @param {Unsafe['inConstruct']} list\n * @param {boolean} none\n * @returns {boolean}\n */\nfunction listInScope(stack, list, none) {\n if (typeof list === 'string') {\n list = [list]\n }\n\n if (!list || list.length === 0) {\n return none\n }\n\n let index = -1\n\n while (++index < list.length) {\n if (stack.includes(list[index])) {\n return true\n }\n }\n\n return false\n}\n","/**\n * @typedef {import('mdast').Break} Break\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {patternInScope} from '../util/pattern-in-scope.js'\n\n/**\n * @param {Break} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function hardBreak(_, _1, state, info) {\n let index = -1\n\n while (++index < state.unsafe.length) {\n // If we can’t put eols in this construct (setext headings, tables), use a\n // space instead.\n if (\n state.unsafe[index].character === '\\n' &&\n patternInScope(state.stack, state.unsafe[index])\n ) {\n return /[ \\t]/.test(info.before) ? '' : ' '\n }\n }\n\n return '\\\\\\n'\n}\n","/**\n * Get the count of the longest repeating streak of `substring` in `value`.\n *\n * @param {string} value\n * Content to search in.\n * @param {string} substring\n * Substring to look for, typically one character.\n * @returns {number}\n * Count of most frequent adjacent `substring`s in `value`.\n */\nexport function longestStreak(value, substring) {\n const source = String(value)\n let index = source.indexOf(substring)\n let expected = index\n let count = 0\n let max = 0\n\n if (typeof substring !== 'string') {\n throw new TypeError('Expected substring')\n }\n\n while (index !== -1) {\n if (index === expected) {\n if (++count > max) {\n max = count\n }\n } else {\n count = 1\n }\n\n expected = index + substring.length\n index = source.indexOf(substring, expected)\n }\n\n return max\n}\n","/**\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * @param {Code} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatCodeAsIndented(node, state) {\n return Boolean(\n !state.options.fences &&\n node.value &&\n // If there’s no info…\n !node.lang &&\n // And there’s a non-whitespace character…\n /[^ \\r\\n]/.test(node.value) &&\n // And the value doesn’t start or end in a blank…\n !/^[\\t ]*(?:[\\r\\n]|$)|(?:^|[\\r\\n])[\\t ]*$/.test(node.value)\n )\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkFence(state) {\n const marker = state.options.fence || '`'\n\n if (marker !== '`' && marker !== '~') {\n throw new Error(\n 'Cannot serialize code with `' +\n marker +\n '` for `options.fence`, expected `` ` `` or `~`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Map} Map\n */\n\nimport {longestStreak} from 'longest-streak'\nimport {formatCodeAsIndented} from '../util/format-code-as-indented.js'\nimport {checkFence} from '../util/check-fence.js'\n\n/**\n * @param {Code} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function code(node, _, state, info) {\n const marker = checkFence(state)\n const raw = node.value || ''\n const suffix = marker === '`' ? 'GraveAccent' : 'Tilde'\n\n if (formatCodeAsIndented(node, state)) {\n const exit = state.enter('codeIndented')\n const value = state.indentLines(raw, map)\n exit()\n return value\n }\n\n const tracker = state.createTracker(info)\n const sequence = marker.repeat(Math.max(longestStreak(raw, marker) + 1, 3))\n const exit = state.enter('codeFenced')\n let value = tracker.move(sequence)\n\n if (node.lang) {\n const subexit = state.enter(`codeFencedLang${suffix}`)\n value += tracker.move(\n state.safe(node.lang, {\n before: value,\n after: ' ',\n encode: ['`'],\n ...tracker.current()\n })\n )\n subexit()\n }\n\n if (node.lang && node.meta) {\n const subexit = state.enter(`codeFencedMeta${suffix}`)\n value += tracker.move(' ')\n value += tracker.move(\n state.safe(node.meta, {\n before: value,\n after: '\\n',\n encode: ['`'],\n ...tracker.current()\n })\n )\n subexit()\n }\n\n value += tracker.move('\\n')\n\n if (raw) {\n value += tracker.move(raw + '\\n')\n }\n\n value += tracker.move(sequence)\n exit()\n return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n return (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkQuote(state) {\n const marker = state.options.quote || '\"'\n\n if (marker !== '\"' && marker !== \"'\") {\n throw new Error(\n 'Cannot serialize title with `' +\n marker +\n '` for `options.quote`, expected `\"`, or `\\'`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Definition} Definition\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\n/**\n * @param {Definition} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function definition(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const exit = state.enter('definition')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('[')\n value += tracker.move(\n state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n )\n value += tracker.move(']: ')\n\n subexit()\n\n if (\n // If there’s no url, or…\n !node.url ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : '\\n',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n exit()\n\n return value\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkEmphasis(state) {\n const marker = state.options.emphasis || '*'\n\n if (marker !== '*' && marker !== '_') {\n throw new Error(\n 'Cannot serialize emphasis with `' +\n marker +\n '` for `options.emphasis`, expected `*`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkEmphasis} from '../util/check-emphasis.js'\n\nemphasis.peek = emphasisPeek\n\n// To do: there are cases where emphasis cannot “form” depending on the\n// previous or next character of sequences.\n// There’s no way around that though, except for injecting zero-width stuff.\n// Do we need to safeguard against that?\n/**\n * @param {Emphasis} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function emphasis(node, _, state, info) {\n const marker = checkEmphasis(state)\n const exit = state.enter('emphasis')\n const tracker = state.createTracker(info)\n let value = tracker.move(marker)\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: marker,\n ...tracker.current()\n })\n )\n value += tracker.move(marker)\n exit()\n return value\n}\n\n/**\n * @param {Emphasis} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction emphasisPeek(_, _1, state) {\n return state.options.emphasis || '*'\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n */\n\n/**\n * @typedef {Record} Props\n * @typedef {null | undefined | string | Props | TestFunctionAnything | Array} Test\n * Check for an arbitrary node, unaware of TypeScript inferral.\n *\n * @callback TestFunctionAnything\n * Check if a node passes a test, unaware of TypeScript inferral.\n * @param {unknown} this\n * The given context.\n * @param {Node} node\n * A node.\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {boolean | void}\n * Whether this node passes the test.\n */\n\n/**\n * @template {Node} Kind\n * Node type.\n * @typedef {Kind['type'] | Partial | TestFunctionPredicate | Array | TestFunctionPredicate>} PredicateTest\n * Check for a node that can be inferred by TypeScript.\n */\n\n/**\n * Check if a node passes a certain test.\n *\n * @template {Node} Kind\n * Node type.\n * @callback TestFunctionPredicate\n * Complex test function for a node that can be inferred by TypeScript.\n * @param {Node} node\n * A node.\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {node is Kind}\n * Whether this node passes the test.\n */\n\n/**\n * @callback AssertAnything\n * Check that an arbitrary value is a node, unaware of TypeScript inferral.\n * @param {unknown} [node]\n * Anything (typically a node).\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {boolean}\n * Whether this is a node and passes a test.\n */\n\n/**\n * Check if a node is a node and passes a certain node test.\n *\n * @template {Node} Kind\n * Node type.\n * @callback AssertPredicate\n * Check that an arbitrary value is a specific node, aware of TypeScript.\n * @param {unknown} [node]\n * Anything (typically a node).\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {node is Kind}\n * Whether this is a node and passes a test.\n */\n\n/**\n * Check if `node` is a `Node` and whether it passes the given test.\n *\n * @param node\n * Thing to check, typically `Node`.\n * @param test\n * A check for a specific node.\n * @param index\n * The node’s position in its parent.\n * @param parent\n * The node’s parent.\n * @returns\n * Whether `node` is a node and passes a test.\n */\nexport const is =\n /**\n * @type {(\n * (() => false) &\n * ((node: unknown, test: PredicateTest, index: number, parent: Parent, context?: unknown) => node is Kind) &\n * ((node: unknown, test: PredicateTest, index?: null | undefined, parent?: null | undefined, context?: unknown) => node is Kind) &\n * ((node: unknown, test: Test, index: number, parent: Parent, context?: unknown) => boolean) &\n * ((node: unknown, test?: Test, index?: null | undefined, parent?: null | undefined, context?: unknown) => boolean)\n * )}\n */\n (\n /**\n * @param {unknown} [node]\n * @param {Test} [test]\n * @param {number | null | undefined} [index]\n * @param {Parent | null | undefined} [parent]\n * @param {unknown} [context]\n * @returns {boolean}\n */\n // eslint-disable-next-line max-params\n function is(node, test, index, parent, context) {\n const check = convert(test)\n\n if (\n index !== undefined &&\n index !== null &&\n (typeof index !== 'number' ||\n index < 0 ||\n index === Number.POSITIVE_INFINITY)\n ) {\n throw new Error('Expected positive finite index')\n }\n\n if (\n parent !== undefined &&\n parent !== null &&\n (!is(parent) || !parent.children)\n ) {\n throw new Error('Expected parent node')\n }\n\n if (\n (parent === undefined || parent === null) !==\n (index === undefined || index === null)\n ) {\n throw new Error('Expected both parent and index')\n }\n\n // @ts-expect-error Looks like a node.\n return node && node.type && typeof node.type === 'string'\n ? Boolean(check.call(context, node, index, parent))\n : false\n }\n )\n\n/**\n * Generate an assertion from a test.\n *\n * Useful if you’re going to test many nodes, for example when creating a\n * utility where something else passes a compatible test.\n *\n * The created function is a bit faster because it expects valid input only:\n * a `node`, `index`, and `parent`.\n *\n * @param test\n * * when nullish, checks if `node` is a `Node`.\n * * when `string`, works like passing `(node) => node.type === test`.\n * * when `function` checks if function passed the node is true.\n * * when `object`, checks that all keys in test are in node, and that they have (strictly) equal values.\n * * when `array`, checks if any one of the subtests pass.\n * @returns\n * An assertion.\n */\nexport const convert =\n /**\n * @type {(\n * ((test: PredicateTest) => AssertPredicate) &\n * ((test?: Test) => AssertAnything)\n * )}\n */\n (\n /**\n * @param {Test} [test]\n * @returns {AssertAnything}\n */\n function (test) {\n if (test === undefined || test === null) {\n return ok\n }\n\n if (typeof test === 'string') {\n return typeFactory(test)\n }\n\n if (typeof test === 'object') {\n return Array.isArray(test) ? anyFactory(test) : propsFactory(test)\n }\n\n if (typeof test === 'function') {\n return castFactory(test)\n }\n\n throw new Error('Expected function, string, or object as test')\n }\n )\n\n/**\n * @param {Array} tests\n * @returns {AssertAnything}\n */\nfunction anyFactory(tests) {\n /** @type {Array} */\n const checks = []\n let index = -1\n\n while (++index < tests.length) {\n checks[index] = convert(tests[index])\n }\n\n return castFactory(any)\n\n /**\n * @this {unknown}\n * @param {Array} parameters\n * @returns {boolean}\n */\n function any(...parameters) {\n let index = -1\n\n while (++index < checks.length) {\n if (checks[index].call(this, ...parameters)) return true\n }\n\n return false\n }\n}\n\n/**\n * Turn an object into a test for a node with a certain fields.\n *\n * @param {Props} check\n * @returns {AssertAnything}\n */\nfunction propsFactory(check) {\n return castFactory(all)\n\n /**\n * @param {Node} node\n * @returns {boolean}\n */\n function all(node) {\n /** @type {string} */\n let key\n\n for (key in check) {\n // @ts-expect-error: hush, it sure works as an index.\n if (node[key] !== check[key]) return false\n }\n\n return true\n }\n}\n\n/**\n * Turn a string into a test for a node with a certain type.\n *\n * @param {string} check\n * @returns {AssertAnything}\n */\nfunction typeFactory(check) {\n return castFactory(type)\n\n /**\n * @param {Node} node\n */\n function type(node) {\n return node && node.type === check\n }\n}\n\n/**\n * Turn a custom test into a test for a node that passes that test.\n *\n * @param {TestFunctionAnything} check\n * @returns {AssertAnything}\n */\nfunction castFactory(check) {\n return assertion\n\n /**\n * @this {unknown}\n * @param {unknown} node\n * @param {Array} parameters\n * @returns {boolean}\n */\n function assertion(node, ...parameters) {\n return Boolean(\n node &&\n typeof node === 'object' &&\n 'type' in node &&\n // @ts-expect-error: fine.\n Boolean(check.call(this, node, ...parameters))\n )\n }\n}\n\nfunction ok() {\n return true\n}\n","/**\n * @param {string} d\n * @returns {string}\n */\nexport function color(d) {\n return '\\u001B[33m' + d + '\\u001B[39m'\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n * @typedef {import('unist-util-is').Test} Test\n */\n\n/**\n * @typedef {boolean | 'skip'} Action\n * Union of the action types.\n *\n * @typedef {number} Index\n * Move to the sibling at `index` next (after node itself is completely\n * traversed).\n *\n * Useful if mutating the tree, such as removing the node the visitor is\n * currently on, or any of its previous siblings.\n * Results less than 0 or greater than or equal to `children.length` stop\n * traversing the parent.\n *\n * @typedef {[(Action | null | undefined | void)?, (Index | null | undefined)?]} ActionTuple\n * List with one or two values, the first an action, the second an index.\n *\n * @typedef {Action | ActionTuple | Index | null | undefined | void} VisitorResult\n * Any value that can be returned from a visitor.\n */\n\n/**\n * @template {Node} [Visited=Node]\n * Visited node type.\n * @template {Parent} [Ancestor=Parent]\n * Ancestor type.\n * @callback Visitor\n * Handle a node (matching `test`, if given).\n *\n * Visitors are free to transform `node`.\n * They can also transform the parent of node (the last of `ancestors`).\n *\n * Replacing `node` itself, if `SKIP` is not returned, still causes its\n * descendants to be walked (which is a bug).\n *\n * When adding or removing previous siblings of `node` (or next siblings, in\n * case of reverse), the `Visitor` should return a new `Index` to specify the\n * sibling to traverse after `node` is traversed.\n * Adding or removing next siblings of `node` (or previous siblings, in case\n * of reverse) is handled as expected without needing to return a new `Index`.\n *\n * Removing the children property of an ancestor still results in them being\n * traversed.\n * @param {Visited} node\n * Found node.\n * @param {Array} ancestors\n * Ancestors of `node`.\n * @returns {VisitorResult}\n * What to do next.\n *\n * An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n * An `Action` is treated as a tuple of `[Action]`.\n *\n * Passing a tuple back only makes sense if the `Action` is `SKIP`.\n * When the `Action` is `EXIT`, that action can be returned.\n * When the `Action` is `CONTINUE`, `Index` can be returned.\n */\n\n/**\n * @template {Node} [Tree=Node]\n * Tree type.\n * @template {Test} [Check=string]\n * Test type.\n * @typedef {Visitor, Check>, Extract, Parent>>} BuildVisitor\n * Build a typed `Visitor` function from a tree and a test.\n *\n * It will infer which values are passed as `node` and which as `parents`.\n */\n\nimport {convert} from 'unist-util-is'\nimport {color} from './color.js'\n\n/**\n * Continue traversing as normal.\n */\nexport const CONTINUE = true\n\n/**\n * Stop traversing immediately.\n */\nexport const EXIT = false\n\n/**\n * Do not traverse this node’s children.\n */\nexport const SKIP = 'skip'\n\n/**\n * Visit nodes, with ancestral information.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @param tree\n * Tree to traverse.\n * @param test\n * `unist-util-is`-compatible test\n * @param visitor\n * Handle each node.\n * @param reverse\n * Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns\n * Nothing.\n */\nexport const visitParents =\n /**\n * @type {(\n * ((tree: Tree, test: Check, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void) &\n * ((tree: Tree, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void)\n * )}\n */\n (\n /**\n * @param {Node} tree\n * @param {Test} test\n * @param {Visitor} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {void}\n */\n function (tree, test, visitor, reverse) {\n if (typeof test === 'function' && typeof visitor !== 'function') {\n reverse = visitor\n // @ts-expect-error no visitor given, so `visitor` is test.\n visitor = test\n test = null\n }\n\n const is = convert(test)\n const step = reverse ? -1 : 1\n\n factory(tree, undefined, [])()\n\n /**\n * @param {Node} node\n * @param {number | undefined} index\n * @param {Array} parents\n */\n function factory(node, index, parents) {\n /** @type {Record} */\n // @ts-expect-error: hush\n const value = node && typeof node === 'object' ? node : {}\n\n if (typeof value.type === 'string') {\n const name =\n // `hast`\n typeof value.tagName === 'string'\n ? value.tagName\n : // `xast`\n typeof value.name === 'string'\n ? value.name\n : undefined\n\n Object.defineProperty(visit, 'name', {\n value:\n 'node (' + color(node.type + (name ? '<' + name + '>' : '')) + ')'\n })\n }\n\n return visit\n\n function visit() {\n /** @type {ActionTuple} */\n let result = []\n /** @type {ActionTuple} */\n let subresult\n /** @type {number} */\n let offset\n /** @type {Array} */\n let grandparents\n\n if (!test || is(node, index, parents[parents.length - 1] || null)) {\n result = toResult(visitor(node, parents))\n\n if (result[0] === EXIT) {\n return result\n }\n }\n\n // @ts-expect-error looks like a parent.\n if (node.children && result[0] !== SKIP) {\n // @ts-expect-error looks like a parent.\n offset = (reverse ? node.children.length : -1) + step\n // @ts-expect-error looks like a parent.\n grandparents = parents.concat(node)\n\n // @ts-expect-error looks like a parent.\n while (offset > -1 && offset < node.children.length) {\n // @ts-expect-error looks like a parent.\n subresult = factory(node.children[offset], offset, grandparents)()\n\n if (subresult[0] === EXIT) {\n return subresult\n }\n\n offset =\n typeof subresult[1] === 'number' ? subresult[1] : offset + step\n }\n }\n\n return result\n }\n }\n }\n )\n\n/**\n * Turn a return value into a clean result.\n *\n * @param {VisitorResult} value\n * Valid return values from visitors.\n * @returns {ActionTuple}\n * Clean result.\n */\nfunction toResult(value) {\n if (Array.isArray(value)) {\n return value\n }\n\n if (typeof value === 'number') {\n return [CONTINUE, value]\n }\n\n return [value]\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n * @typedef {import('unist-util-is').Test} Test\n * @typedef {import('unist-util-visit-parents').VisitorResult} VisitorResult\n */\n\n/**\n * Check if `Child` can be a child of `Ancestor`.\n *\n * Returns the ancestor when `Child` can be a child of `Ancestor`, or returns\n * `never`.\n *\n * @template {Node} Ancestor\n * Node type.\n * @template {Node} Child\n * Node type.\n * @typedef {(\n * Ancestor extends Parent\n * ? Child extends Ancestor['children'][number]\n * ? Ancestor\n * : never\n * : never\n * )} ParentsOf\n */\n\n/**\n * @template {Node} [Visited=Node]\n * Visited node type.\n * @template {Parent} [Ancestor=Parent]\n * Ancestor type.\n * @callback Visitor\n * Handle a node (matching `test`, if given).\n *\n * Visitors are free to transform `node`.\n * They can also transform `parent`.\n *\n * Replacing `node` itself, if `SKIP` is not returned, still causes its\n * descendants to be walked (which is a bug).\n *\n * When adding or removing previous siblings of `node` (or next siblings, in\n * case of reverse), the `Visitor` should return a new `Index` to specify the\n * sibling to traverse after `node` is traversed.\n * Adding or removing next siblings of `node` (or previous siblings, in case\n * of reverse) is handled as expected without needing to return a new `Index`.\n *\n * Removing the children property of `parent` still results in them being\n * traversed.\n * @param {Visited} node\n * Found node.\n * @param {Visited extends Node ? number | null : never} index\n * Index of `node` in `parent`.\n * @param {Ancestor extends Node ? Ancestor | null : never} parent\n * Parent of `node`.\n * @returns {VisitorResult}\n * What to do next.\n *\n * An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n * An `Action` is treated as a tuple of `[Action]`.\n *\n * Passing a tuple back only makes sense if the `Action` is `SKIP`.\n * When the `Action` is `EXIT`, that action can be returned.\n * When the `Action` is `CONTINUE`, `Index` can be returned.\n */\n\n/**\n * Build a typed `Visitor` function from a node and all possible parents.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} Visited\n * Node type.\n * @template {Parent} Ancestor\n * Parent type.\n * @typedef {Visitor>} BuildVisitorFromMatch\n */\n\n/**\n * Build a typed `Visitor` function from a list of descendants and a test.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} Descendant\n * Node type.\n * @template {Test} Check\n * Test type.\n * @typedef {(\n * BuildVisitorFromMatch<\n * import('unist-util-visit-parents/complex-types.js').Matches,\n * Extract\n * >\n * )} BuildVisitorFromDescendants\n */\n\n/**\n * Build a typed `Visitor` function from a tree and a test.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} [Tree=Node]\n * Node type.\n * @template {Test} [Check=string]\n * Test type.\n * @typedef {(\n * BuildVisitorFromDescendants<\n * import('unist-util-visit-parents/complex-types.js').InclusiveDescendant,\n * Check\n * >\n * )} BuildVisitor\n */\n\nimport {visitParents} from 'unist-util-visit-parents'\n\n/**\n * Visit nodes.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @param tree\n * Tree to traverse.\n * @param test\n * `unist-util-is`-compatible test\n * @param visitor\n * Handle each node.\n * @param reverse\n * Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns\n * Nothing.\n */\nexport const visit =\n /**\n * @type {(\n * ((tree: Tree, test: Check, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void) &\n * ((tree: Tree, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void)\n * )}\n */\n (\n /**\n * @param {Node} tree\n * @param {Test} test\n * @param {Visitor} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {void}\n */\n function (tree, test, visitor, reverse) {\n if (typeof test === 'function' && typeof visitor !== 'function') {\n reverse = visitor\n visitor = test\n test = null\n }\n\n visitParents(tree, test, overload, reverse)\n\n /**\n * @param {Node} node\n * @param {Array} parents\n */\n function overload(node, parents) {\n const parent = parents[parents.length - 1]\n return visitor(\n node,\n parent ? parent.children.indexOf(node) : null,\n parent\n )\n }\n }\n )\n\nexport {CONTINUE, EXIT, SKIP} from 'unist-util-visit-parents'\n","/**\n * @typedef {import('mdast').Root|import('mdast').Content} Node\n *\n * @typedef Options\n * Configuration (optional).\n * @property {boolean | null | undefined} [includeImageAlt=true]\n * Whether to use `alt` for `image`s.\n * @property {boolean | null | undefined} [includeHtml=true]\n * Whether to use `value` of HTML.\n */\n\n/** @type {Options} */\nconst emptyOptions = {}\n\n/**\n * Get the text content of a node or list of nodes.\n *\n * Prefers the node’s plain-text fields, otherwise serializes its children,\n * and if the given value is an array, serialize the nodes in it.\n *\n * @param {unknown} value\n * Thing to serialize, typically `Node`.\n * @param {Options | null | undefined} [options]\n * Configuration (optional).\n * @returns {string}\n * Serialized `value`.\n */\nexport function toString(value, options) {\n const settings = options || emptyOptions\n const includeImageAlt =\n typeof settings.includeImageAlt === 'boolean'\n ? settings.includeImageAlt\n : true\n const includeHtml =\n typeof settings.includeHtml === 'boolean' ? settings.includeHtml : true\n\n return one(value, includeImageAlt, includeHtml)\n}\n\n/**\n * One node or several nodes.\n *\n * @param {unknown} value\n * Thing to serialize.\n * @param {boolean} includeImageAlt\n * Include image `alt`s.\n * @param {boolean} includeHtml\n * Include HTML.\n * @returns {string}\n * Serialized node.\n */\nfunction one(value, includeImageAlt, includeHtml) {\n if (node(value)) {\n if ('value' in value) {\n return value.type === 'html' && !includeHtml ? '' : value.value\n }\n\n if (includeImageAlt && 'alt' in value && value.alt) {\n return value.alt\n }\n\n if ('children' in value) {\n return all(value.children, includeImageAlt, includeHtml)\n }\n }\n\n if (Array.isArray(value)) {\n return all(value, includeImageAlt, includeHtml)\n }\n\n return ''\n}\n\n/**\n * Serialize a list of nodes.\n *\n * @param {Array} values\n * Thing to serialize.\n * @param {boolean} includeImageAlt\n * Include image `alt`s.\n * @param {boolean} includeHtml\n * Include HTML.\n * @returns {string}\n * Serialized nodes.\n */\nfunction all(values, includeImageAlt, includeHtml) {\n /** @type {Array} */\n const result = []\n let index = -1\n\n while (++index < values.length) {\n result[index] = one(values[index], includeImageAlt, includeHtml)\n }\n\n return result.join('')\n}\n\n/**\n * Check if `value` looks like a node.\n *\n * @param {unknown} value\n * Thing.\n * @returns {value is Node}\n * Whether `value` is a node.\n */\nfunction node(value) {\n return Boolean(value && typeof value === 'object')\n}\n","/**\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../types.js').State} State\n */\n\nimport {visit, EXIT} from 'unist-util-visit'\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Heading} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatHeadingAsSetext(node, state) {\n let literalWithBreak = false\n\n // Look for literals with a line break.\n // Note that this also\n visit(node, (node) => {\n if (\n ('value' in node && /\\r?\\n|\\r/.test(node.value)) ||\n node.type === 'break'\n ) {\n literalWithBreak = true\n return EXIT\n }\n })\n\n return Boolean(\n (!node.depth || node.depth < 3) &&\n toString(node) &&\n (state.options.setext || literalWithBreak)\n )\n}\n","/**\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {formatHeadingAsSetext} from '../util/format-heading-as-setext.js'\n\n/**\n * @param {Heading} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function heading(node, _, state, info) {\n const rank = Math.max(Math.min(6, node.depth || 1), 1)\n const tracker = state.createTracker(info)\n\n if (formatHeadingAsSetext(node, state)) {\n const exit = state.enter('headingSetext')\n const subexit = state.enter('phrasing')\n const value = state.containerPhrasing(node, {\n ...tracker.current(),\n before: '\\n',\n after: '\\n'\n })\n subexit()\n exit()\n\n return (\n value +\n '\\n' +\n (rank === 1 ? '=' : '-').repeat(\n // The whole size…\n value.length -\n // Minus the position of the character after the last EOL (or\n // 0 if there is none)…\n (Math.max(value.lastIndexOf('\\r'), value.lastIndexOf('\\n')) + 1)\n )\n )\n }\n\n const sequence = '#'.repeat(rank)\n const exit = state.enter('headingAtx')\n const subexit = state.enter('phrasing')\n\n // Note: for proper tracking, we should reset the output positions when there\n // is no content returned, because then the space is not output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n tracker.move(sequence + ' ')\n\n let value = state.containerPhrasing(node, {\n before: '# ',\n after: '\\n',\n ...tracker.current()\n })\n\n if (/^[\\t ]/.test(value)) {\n // To do: what effect has the character reference on tracking?\n value =\n '&#x' +\n value.charCodeAt(0).toString(16).toUpperCase() +\n ';' +\n value.slice(1)\n }\n\n value = value ? sequence + ' ' + value : sequence\n\n if (state.options.closeAtx) {\n value += ' ' + sequence\n }\n\n subexit()\n exit()\n\n return value\n}\n","/**\n * @typedef {import('mdast').HTML} HTML\n */\n\nhtml.peek = htmlPeek\n\n/**\n * @param {HTML} node\n * @returns {string}\n */\nexport function html(node) {\n return node.value || ''\n}\n\n/**\n * @returns {string}\n */\nfunction htmlPeek() {\n return '<'\n}\n","/**\n * @typedef {import('mdast').Image} Image\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\nimage.peek = imagePeek\n\n/**\n * @param {Image} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function image(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const exit = state.enter('image')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('![')\n value += tracker.move(\n state.safe(node.alt, {before: value, after: ']', ...tracker.current()})\n )\n value += tracker.move('](')\n\n subexit()\n\n if (\n // If there’s no url but there is a title…\n (!node.url && node.title) ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : ')',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n value += tracker.move(')')\n exit()\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction imagePeek() {\n return '!'\n}\n","/**\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimageReference.peek = imageReferencePeek\n\n/**\n * @param {ImageReference} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function imageReference(node, _, state, info) {\n const type = node.referenceType\n const exit = state.enter('imageReference')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('![')\n const alt = state.safe(node.alt, {\n before: value,\n after: ']',\n ...tracker.current()\n })\n value += tracker.move(alt + '][')\n\n subexit()\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n subexit = state.enter('reference')\n // Note: for proper tracking, we should reset the output positions when we end\n // up making a `shortcut` reference, because then there is no brace output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n const reference = state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n subexit()\n state.stack = stack\n exit()\n\n if (type === 'full' || !alt || alt !== reference) {\n value += tracker.move(reference + ']')\n } else if (type === 'shortcut') {\n // Remove the unwanted `[`.\n value = value.slice(0, -1)\n } else {\n value += tracker.move(']')\n }\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction imageReferencePeek() {\n return '!'\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n */\n\n/**\n * @param {Unsafe} pattern\n * @returns {RegExp}\n */\nexport function patternCompile(pattern) {\n if (!pattern._compiled) {\n const before =\n (pattern.atBreak ? '[\\\\r\\\\n][\\\\t ]*' : '') +\n (pattern.before ? '(?:' + pattern.before + ')' : '')\n\n pattern._compiled = new RegExp(\n (before ? '(' + before + ')' : '') +\n (/[|\\\\{}()[\\]^$+*?.-]/.test(pattern.character) ? '\\\\' : '') +\n pattern.character +\n (pattern.after ? '(?:' + pattern.after + ')' : ''),\n 'g'\n )\n }\n\n return pattern._compiled\n}\n","/**\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n */\n\nimport {patternCompile} from '../util/pattern-compile.js'\n\ninlineCode.peek = inlineCodePeek\n\n/**\n * @param {InlineCode} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @returns {string}\n */\nexport function inlineCode(node, _, state) {\n let value = node.value || ''\n let sequence = '`'\n let index = -1\n\n // If there is a single grave accent on its own in the code, use a fence of\n // two.\n // If there are two in a row, use one.\n while (new RegExp('(^|[^`])' + sequence + '([^`]|$)').test(value)) {\n sequence += '`'\n }\n\n // If this is not just spaces or eols (tabs don’t count), and either the\n // first or last character are a space, eol, or tick, then pad with spaces.\n if (\n /[^ \\r\\n]/.test(value) &&\n ((/^[ \\r\\n]/.test(value) && /[ \\r\\n]$/.test(value)) || /^`|`$/.test(value))\n ) {\n value = ' ' + value + ' '\n }\n\n // We have a potential problem: certain characters after eols could result in\n // blocks being seen.\n // For example, if someone injected the string `'\\n# b'`, then that would\n // result in an ATX heading.\n // We can’t escape characters in `inlineCode`, but because eols are\n // transformed to spaces when going from markdown to HTML anyway, we can swap\n // them out.\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n // Only look for `atBreak`s.\n // Btw: note that `atBreak` patterns will always start the regex at LF or\n // CR.\n if (!pattern.atBreak) continue\n\n while ((match = expression.exec(value))) {\n let position = match.index\n\n // Support CRLF (patterns only look for one of the characters).\n if (\n value.charCodeAt(position) === 10 /* `\\n` */ &&\n value.charCodeAt(position - 1) === 13 /* `\\r` */\n ) {\n position--\n }\n\n value = value.slice(0, position) + ' ' + value.slice(match.index + 1)\n }\n }\n\n return sequence + value + sequence\n}\n\n/**\n * @returns {string}\n */\nfunction inlineCodePeek() {\n return '`'\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../types.js').State} State\n */\n\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Link} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatLinkAsAutolink(node, state) {\n const raw = toString(node)\n\n return Boolean(\n !state.options.resourceLink &&\n // If there’s a url…\n node.url &&\n // And there’s a no title…\n !node.title &&\n // And the content of `node` is a single text node…\n node.children &&\n node.children.length === 1 &&\n node.children[0].type === 'text' &&\n // And if the url is the same as the content…\n (raw === node.url || 'mailto:' + raw === node.url) &&\n // And that starts w/ a protocol…\n /^[a-z][a-z+.-]+:/i.test(node.url) &&\n // And that doesn’t contain ASCII control codes (character escapes and\n // references don’t work), space, or angle brackets…\n !/[\\0- <>\\u007F]/.test(node.url)\n )\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Exit} Exit\n */\n\nimport {checkQuote} from '../util/check-quote.js'\nimport {formatLinkAsAutolink} from '../util/format-link-as-autolink.js'\n\nlink.peek = linkPeek\n\n/**\n * @param {Link} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function link(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const tracker = state.createTracker(info)\n /** @type {Exit} */\n let exit\n /** @type {Exit} */\n let subexit\n\n if (formatLinkAsAutolink(node, state)) {\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n exit = state.enter('autolink')\n let value = tracker.move('<')\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: '>',\n ...tracker.current()\n })\n )\n value += tracker.move('>')\n exit()\n state.stack = stack\n return value\n }\n\n exit = state.enter('link')\n subexit = state.enter('label')\n let value = tracker.move('[')\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: '](',\n ...tracker.current()\n })\n )\n value += tracker.move('](')\n subexit()\n\n if (\n // If there’s no url but there is a title…\n (!node.url && node.title) ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : ')',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n value += tracker.move(')')\n\n exit()\n return value\n}\n\n/**\n * @param {Link} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @returns {string}\n */\nfunction linkPeek(node, _, state) {\n return formatLinkAsAutolink(node, state) ? '<' : '['\n}\n","/**\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nlinkReference.peek = linkReferencePeek\n\n/**\n * @param {LinkReference} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function linkReference(node, _, state, info) {\n const type = node.referenceType\n const exit = state.enter('linkReference')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('[')\n const text = state.containerPhrasing(node, {\n before: value,\n after: ']',\n ...tracker.current()\n })\n value += tracker.move(text + '][')\n\n subexit()\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n subexit = state.enter('reference')\n // Note: for proper tracking, we should reset the output positions when we end\n // up making a `shortcut` reference, because then there is no brace output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n const reference = state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n subexit()\n state.stack = stack\n exit()\n\n if (type === 'full' || !text || text !== reference) {\n value += tracker.move(reference + ']')\n } else if (type === 'shortcut') {\n // Remove the unwanted `[`.\n value = value.slice(0, -1)\n } else {\n value += tracker.move(']')\n }\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction linkReferencePeek() {\n return '['\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBullet(state) {\n const marker = state.options.bullet || '*'\n\n if (marker !== '*' && marker !== '+' && marker !== '-') {\n throw new Error(\n 'Cannot serialize items with `' +\n marker +\n '` for `options.bullet`, expected `*`, `+`, or `-`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\nimport {checkBullet} from './check-bullet.js'\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOther(state) {\n const bullet = checkBullet(state)\n const bulletOther = state.options.bulletOther\n\n if (!bulletOther) {\n return bullet === '*' ? '-' : '*'\n }\n\n if (bulletOther !== '*' && bulletOther !== '+' && bulletOther !== '-') {\n throw new Error(\n 'Cannot serialize items with `' +\n bulletOther +\n '` for `options.bulletOther`, expected `*`, `+`, or `-`'\n )\n }\n\n if (bulletOther === bullet) {\n throw new Error(\n 'Expected `bullet` (`' +\n bullet +\n '`) and `bulletOther` (`' +\n bulletOther +\n '`) to be different'\n )\n }\n\n return bulletOther\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOrdered(state) {\n const marker = state.options.bulletOrdered || '.'\n\n if (marker !== '.' && marker !== ')') {\n throw new Error(\n 'Cannot serialize items with `' +\n marker +\n '` for `options.bulletOrdered`, expected `.` or `)`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\nimport {checkBulletOrdered} from './check-bullet-ordered.js'\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOrderedOther(state) {\n const bulletOrdered = checkBulletOrdered(state)\n const bulletOrderedOther = state.options.bulletOrderedOther\n\n if (!bulletOrderedOther) {\n return bulletOrdered === '.' ? ')' : '.'\n }\n\n if (bulletOrderedOther !== '.' && bulletOrderedOther !== ')') {\n throw new Error(\n 'Cannot serialize items with `' +\n bulletOrderedOther +\n '` for `options.bulletOrderedOther`, expected `*`, `+`, or `-`'\n )\n }\n\n if (bulletOrderedOther === bulletOrdered) {\n throw new Error(\n 'Expected `bulletOrdered` (`' +\n bulletOrdered +\n '`) and `bulletOrderedOther` (`' +\n bulletOrderedOther +\n '`) to be different'\n )\n }\n\n return bulletOrderedOther\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkRule(state) {\n const marker = state.options.rule || '*'\n\n if (marker !== '*' && marker !== '-' && marker !== '_') {\n throw new Error(\n 'Cannot serialize rules with `' +\n marker +\n '` for `options.rule`, expected `*`, `-`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').List} List\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkBulletOther} from '../util/check-bullet-other.js'\nimport {checkBulletOrdered} from '../util/check-bullet-ordered.js'\nimport {checkBulletOrderedOther} from '../util/check-bullet-ordered-other.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {List} node\n * @param {Parent | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function list(node, parent, state, info) {\n const exit = state.enter('list')\n const bulletCurrent = state.bulletCurrent\n /** @type {string} */\n let bullet = node.ordered ? checkBulletOrdered(state) : checkBullet(state)\n /** @type {string} */\n const bulletOther = node.ordered\n ? checkBulletOrderedOther(state)\n : checkBulletOther(state)\n const bulletLastUsed = state.bulletLastUsed\n let useDifferentMarker = false\n\n if (\n parent &&\n // Explicit `other` set.\n (node.ordered\n ? state.options.bulletOrderedOther\n : state.options.bulletOther) &&\n bulletLastUsed &&\n bullet === bulletLastUsed\n ) {\n useDifferentMarker = true\n }\n\n if (!node.ordered) {\n const firstListItem = node.children ? node.children[0] : undefined\n\n // If there’s an empty first list item directly in two list items,\n // we have to use a different bullet:\n //\n // ```markdown\n // * - *\n // ```\n //\n // …because otherwise it would become one big thematic break.\n if (\n // Bullet could be used as a thematic break marker:\n (bullet === '*' || bullet === '-') &&\n // Empty first list item:\n firstListItem &&\n (!firstListItem.children || !firstListItem.children[0]) &&\n // Directly in two other list items:\n state.stack[state.stack.length - 1] === 'list' &&\n state.stack[state.stack.length - 2] === 'listItem' &&\n state.stack[state.stack.length - 3] === 'list' &&\n state.stack[state.stack.length - 4] === 'listItem' &&\n // That are each the first child.\n state.indexStack[state.indexStack.length - 1] === 0 &&\n state.indexStack[state.indexStack.length - 2] === 0 &&\n state.indexStack[state.indexStack.length - 3] === 0\n ) {\n useDifferentMarker = true\n }\n\n // If there’s a thematic break at the start of the first list item,\n // we have to use a different bullet:\n //\n // ```markdown\n // * ---\n // ```\n //\n // …because otherwise it would become one big thematic break.\n if (checkRule(state) === bullet && firstListItem) {\n let index = -1\n\n while (++index < node.children.length) {\n const item = node.children[index]\n\n if (\n item &&\n item.type === 'listItem' &&\n item.children &&\n item.children[0] &&\n item.children[0].type === 'thematicBreak'\n ) {\n useDifferentMarker = true\n break\n }\n }\n }\n }\n\n if (useDifferentMarker) {\n bullet = bulletOther\n }\n\n state.bulletCurrent = bullet\n const value = state.containerFlow(node, info)\n state.bulletLastUsed = bullet\n state.bulletCurrent = bulletCurrent\n exit()\n return value\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkListItemIndent(state) {\n const style = state.options.listItemIndent || 'tab'\n\n // To do: remove in a major.\n // @ts-expect-error: deprecated.\n if (style === 1 || style === '1') {\n return 'one'\n }\n\n if (style !== 'tab' && style !== 'one' && style !== 'mixed') {\n throw new Error(\n 'Cannot serialize items with `' +\n style +\n '` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`'\n )\n }\n\n return style\n}\n","/**\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('../types.js').Map} Map\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkListItemIndent} from '../util/check-list-item-indent.js'\n\n/**\n * @param {ListItem} node\n * @param {Parent | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function listItem(node, parent, state, info) {\n const listItemIndent = checkListItemIndent(state)\n let bullet = state.bulletCurrent || checkBullet(state)\n\n // Add the marker value for ordered lists.\n if (parent && parent.type === 'list' && parent.ordered) {\n bullet =\n (typeof parent.start === 'number' && parent.start > -1\n ? parent.start\n : 1) +\n (state.options.incrementListMarker === false\n ? 0\n : parent.children.indexOf(node)) +\n bullet\n }\n\n let size = bullet.length + 1\n\n if (\n listItemIndent === 'tab' ||\n (listItemIndent === 'mixed' &&\n ((parent && parent.type === 'list' && parent.spread) || node.spread))\n ) {\n size = Math.ceil(size / 4) * 4\n }\n\n const tracker = state.createTracker(info)\n tracker.move(bullet + ' '.repeat(size - bullet.length))\n tracker.shift(size)\n const exit = state.enter('listItem')\n const value = state.indentLines(\n state.containerFlow(node, tracker.current()),\n map\n )\n exit()\n\n return value\n\n /** @type {Map} */\n function map(line, index, blank) {\n if (index) {\n return (blank ? '' : ' '.repeat(size)) + line\n }\n\n return (blank ? bullet : bullet + ' '.repeat(size - bullet.length)) + line\n }\n}\n","/**\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\n/**\n * @param {Paragraph} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function paragraph(node, _, state, info) {\n const exit = state.enter('paragraph')\n const subexit = state.enter('phrasing')\n const value = state.containerPhrasing(node, info)\n subexit()\n exit()\n return value\n}\n","/**\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('unist-util-is').AssertPredicate} AssertPredicatePhrasing\n */\n\nimport {convert} from 'unist-util-is'\n\n/**\n * Check if the given value is *phrasing content*.\n *\n * @param\n * Thing to check, typically `Node`.\n * @returns\n * Whether `value` is phrasing content.\n */\nexport const phrasing = /** @type {AssertPredicatePhrasing} */ (\n convert([\n 'break',\n 'delete',\n 'emphasis',\n 'footnote',\n 'footnoteReference',\n 'image',\n 'imageReference',\n 'inlineCode',\n 'link',\n 'linkReference',\n 'strong',\n 'text'\n ])\n)\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {phrasing} from 'mdast-util-phrasing'\n\n/**\n * @param {Root} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function root(node, _, state, info) {\n // Note: `html` nodes are ambiguous.\n const hasPhrasing = node.children.some((d) => phrasing(d))\n const fn = hasPhrasing ? state.containerPhrasing : state.containerFlow\n // @ts-expect-error: `root`s are supposed to have one type of content\n return fn.call(state, node, info)\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkStrong(state) {\n const marker = state.options.strong || '*'\n\n if (marker !== '*' && marker !== '_') {\n throw new Error(\n 'Cannot serialize strong with `' +\n marker +\n '` for `options.strong`, expected `*`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkStrong} from '../util/check-strong.js'\n\nstrong.peek = strongPeek\n\n// To do: there are cases where emphasis cannot “form” depending on the\n// previous or next character of sequences.\n// There’s no way around that though, except for injecting zero-width stuff.\n// Do we need to safeguard against that?\n/**\n * @param {Strong} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function strong(node, _, state, info) {\n const marker = checkStrong(state)\n const exit = state.enter('strong')\n const tracker = state.createTracker(info)\n let value = tracker.move(marker + marker)\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: marker,\n ...tracker.current()\n })\n )\n value += tracker.move(marker + marker)\n exit()\n return value\n}\n\n/**\n * @param {Strong} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction strongPeek(_, _1, state) {\n return state.options.strong || '*'\n}\n","/**\n * @typedef {import('mdast').Text} Text\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\n/**\n * @param {Text} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function text(node, _, state, info) {\n return state.safe(node.value, info)\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkRuleRepetition(state) {\n const repetition = state.options.ruleRepetition || 3\n\n if (repetition < 3) {\n throw new Error(\n 'Cannot serialize rules with repetition `' +\n repetition +\n '` for `options.ruleRepetition`, expected `3` or more'\n )\n }\n\n return repetition\n}\n","/**\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n */\n\nimport {checkRuleRepetition} from '../util/check-rule-repetition.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {ThematicBreak} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nexport function thematicBreak(_, _1, state) {\n const value = (\n checkRule(state) + (state.options.ruleSpaces ? ' ' : '')\n ).repeat(checkRuleRepetition(state))\n\n return state.options.ruleSpaces ? value.slice(0, -1) : value\n}\n","import {blockquote} from './blockquote.js'\nimport {hardBreak} from './break.js'\nimport {code} from './code.js'\nimport {definition} from './definition.js'\nimport {emphasis} from './emphasis.js'\nimport {heading} from './heading.js'\nimport {html} from './html.js'\nimport {image} from './image.js'\nimport {imageReference} from './image-reference.js'\nimport {inlineCode} from './inline-code.js'\nimport {link} from './link.js'\nimport {linkReference} from './link-reference.js'\nimport {list} from './list.js'\nimport {listItem} from './list-item.js'\nimport {paragraph} from './paragraph.js'\nimport {root} from './root.js'\nimport {strong} from './strong.js'\nimport {text} from './text.js'\nimport {thematicBreak} from './thematic-break.js'\n\n/**\n * Default (CommonMark) handlers.\n */\nexport const handle = {\n blockquote,\n break: hardBreak,\n code,\n definition,\n emphasis,\n hardBreak,\n heading,\n html,\n image,\n imageReference,\n inlineCode,\n link,\n linkReference,\n list,\n listItem,\n paragraph,\n root,\n strong,\n text,\n thematicBreak\n}\n","/**\n * @typedef {import('./types.js').Join} Join\n */\n\nimport {formatCodeAsIndented} from './util/format-code-as-indented.js'\nimport {formatHeadingAsSetext} from './util/format-heading-as-setext.js'\n\n/** @type {Array} */\nexport const join = [joinDefaults]\n\n/** @type {Join} */\nfunction joinDefaults(left, right, parent, state) {\n // Indented code after list or another indented code.\n if (\n right.type === 'code' &&\n formatCodeAsIndented(right, state) &&\n (left.type === 'list' ||\n (left.type === right.type && formatCodeAsIndented(left, state)))\n ) {\n return false\n }\n\n // Two lists with the same marker.\n if (\n left.type === 'list' &&\n left.type === right.type &&\n Boolean(left.ordered) === Boolean(right.ordered) &&\n !(left.ordered\n ? state.options.bulletOrderedOther\n : state.options.bulletOther)\n ) {\n return false\n }\n\n // Join children of a list or an item.\n // In which case, `parent` has a `spread` field.\n if ('spread' in parent && typeof parent.spread === 'boolean') {\n if (\n left.type === 'paragraph' &&\n // Two paragraphs.\n (left.type === right.type ||\n right.type === 'definition' ||\n // Paragraph followed by a setext heading.\n (right.type === 'heading' && formatHeadingAsSetext(right, state)))\n ) {\n return\n }\n\n return parent.spread ? 1 : 0\n }\n}\n","/**\n * @typedef {import('./types.js').Unsafe} Unsafe\n * @typedef {import('./types.js').ConstructName} ConstructName\n */\n\n/**\n * List of constructs that occur in phrasing (paragraphs, headings), but cannot\n * contain things like attention (emphasis, strong), images, or links.\n * So they sort of cancel each other out.\n * Note: could use a better name.\n *\n * @type {Array}\n */\nconst fullPhrasingSpans = [\n 'autolink',\n 'destinationLiteral',\n 'destinationRaw',\n 'reference',\n 'titleQuote',\n 'titleApostrophe'\n]\n\n/** @type {Array} */\nexport const unsafe = [\n {character: '\\t', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {character: '\\t', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {\n character: '\\t',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n },\n {\n character: '\\r',\n inConstruct: [\n 'codeFencedLangGraveAccent',\n 'codeFencedLangTilde',\n 'codeFencedMetaGraveAccent',\n 'codeFencedMetaTilde',\n 'destinationLiteral',\n 'headingAtx'\n ]\n },\n {\n character: '\\n',\n inConstruct: [\n 'codeFencedLangGraveAccent',\n 'codeFencedLangTilde',\n 'codeFencedMetaGraveAccent',\n 'codeFencedMetaTilde',\n 'destinationLiteral',\n 'headingAtx'\n ]\n },\n {character: ' ', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {character: ' ', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {\n character: ' ',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n },\n // An exclamation mark can start an image, if it is followed by a link or\n // a link reference.\n {\n character: '!',\n after: '\\\\[',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n // A quote can break out of a title.\n {character: '\"', inConstruct: 'titleQuote'},\n // A number sign could start an ATX heading if it starts a line.\n {atBreak: true, character: '#'},\n {character: '#', inConstruct: 'headingAtx', after: '(?:[\\r\\n]|$)'},\n // Dollar sign and percentage are not used in markdown.\n // An ampersand could start a character reference.\n {character: '&', after: '[#A-Za-z]', inConstruct: 'phrasing'},\n // An apostrophe can break out of a title.\n {character: \"'\", inConstruct: 'titleApostrophe'},\n // A left paren could break out of a destination raw.\n {character: '(', inConstruct: 'destinationRaw'},\n // A left paren followed by `]` could make something into a link or image.\n {\n before: '\\\\]',\n character: '(',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n // A right paren could start a list item or break out of a destination\n // raw.\n {atBreak: true, before: '\\\\d+', character: ')'},\n {character: ')', inConstruct: 'destinationRaw'},\n // An asterisk can start thematic breaks, list items, emphasis, strong.\n {atBreak: true, character: '*', after: '(?:[ \\t\\r\\n*])'},\n {character: '*', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // A plus sign could start a list item.\n {atBreak: true, character: '+', after: '(?:[ \\t\\r\\n])'},\n // A dash can start thematic breaks, list items, and setext heading\n // underlines.\n {atBreak: true, character: '-', after: '(?:[ \\t\\r\\n-])'},\n // A dot could start a list item.\n {atBreak: true, before: '\\\\d+', character: '.', after: '(?:[ \\t\\r\\n]|$)'},\n // Slash, colon, and semicolon are not used in markdown for constructs.\n // A less than can start html (flow or text) or an autolink.\n // HTML could start with an exclamation mark (declaration, cdata, comment),\n // slash (closing tag), question mark (instruction), or a letter (tag).\n // An autolink also starts with a letter.\n // Finally, it could break out of a destination literal.\n {atBreak: true, character: '<', after: '[!/?A-Za-z]'},\n {\n character: '<',\n after: '[!/?A-Za-z]',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n {character: '<', inConstruct: 'destinationLiteral'},\n // An equals to can start setext heading underlines.\n {atBreak: true, character: '='},\n // A greater than can start block quotes and it can break out of a\n // destination literal.\n {atBreak: true, character: '>'},\n {character: '>', inConstruct: 'destinationLiteral'},\n // Question mark and at sign are not used in markdown for constructs.\n // A left bracket can start definitions, references, labels,\n {atBreak: true, character: '['},\n {character: '[', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n {character: '[', inConstruct: ['label', 'reference']},\n // A backslash can start an escape (when followed by punctuation) or a\n // hard break (when followed by an eol).\n // Note: typical escapes are handled in `safe`!\n {character: '\\\\', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n // A right bracket can exit labels.\n {character: ']', inConstruct: ['label', 'reference']},\n // Caret is not used in markdown for constructs.\n // An underscore can start emphasis, strong, or a thematic break.\n {atBreak: true, character: '_'},\n {character: '_', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // A grave accent can start code (fenced or text), or it can break out of\n // a grave accent code fence.\n {atBreak: true, character: '`'},\n {\n character: '`',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedMetaGraveAccent']\n },\n {character: '`', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // Left brace, vertical bar, right brace are not used in markdown for\n // constructs.\n // A tilde can start code (fenced).\n {atBreak: true, character: '~'}\n]\n","/**\n * Turn the number (in string form as either hexa- or plain decimal) coming from\n * a numeric character reference into a character.\n *\n * Sort of like `String.fromCharCode(Number.parseInt(value, base))`, but makes\n * non-characters and control characters safe.\n *\n * @param {string} value\n * Value to decode.\n * @param {number} base\n * Numeric base.\n * @returns {string}\n * Character.\n */\nexport function decodeNumericCharacterReference(value, base) {\n const code = Number.parseInt(value, base)\n if (\n // C0 except for HT, LF, FF, CR, space.\n code < 9 ||\n code === 11 ||\n (code > 13 && code < 32) ||\n // Control character (DEL) of C0, and C1 controls.\n (code > 126 && code < 160) ||\n // Lone high surrogates and low surrogates.\n (code > 55295 && code < 57344) ||\n // Noncharacters.\n (code > 64975 && code < 65008) /* eslint-disable no-bitwise */ ||\n (code & 65535) === 65535 ||\n (code & 65535) === 65534 /* eslint-enable no-bitwise */ ||\n // Out of range\n code > 1114111\n ) {\n return '\\uFFFD'\n }\n return String.fromCharCode(code)\n}\n","import {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nconst characterEscapeOrReference =\n /\\\\([!-/:-@[-`{-~])|&(#(?:\\d{1,7}|x[\\da-f]{1,6})|[\\da-z]{1,31});/gi\n\n/**\n * Decode markdown strings (which occur in places such as fenced code info\n * strings, destinations, labels, and titles).\n *\n * The “string” content type allows character escapes and -references.\n * This decodes those.\n *\n * @param {string} value\n * Value to decode.\n * @returns {string}\n * Decoded value.\n */\nexport function decodeString(value) {\n return value.replace(characterEscapeOrReference, decode)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @param {string} $2\n * @returns {string}\n */\nfunction decode($0, $1, $2) {\n if ($1) {\n // Escape.\n return $1\n }\n\n // Reference.\n const head = $2.charCodeAt(0)\n if (head === 35) {\n const head = $2.charCodeAt(1)\n const hex = head === 120 || head === 88\n return decodeNumericCharacterReference($2.slice(hex ? 2 : 1), hex ? 16 : 10)\n }\n return decodeNamedCharacterReference($2) || $0\n}\n","/**\n * @typedef {import('../types.js').AssociationId} AssociationId\n */\n\nimport {decodeString} from 'micromark-util-decode-string'\n\n/**\n * Get an identifier from an association to match it to others.\n *\n * Associations are nodes that match to something else through an ID:\n * .\n *\n * The `label` of an association is the string value: character escapes and\n * references work, and casing is intact.\n * The `identifier` is used to match one association to another:\n * controversially, character escapes and references don’t work in this\n * matching: `©` does not match `©`, and `\\+` does not match `+`.\n *\n * But casing is ignored (and whitespace) is trimmed and collapsed: ` A\\nb`\n * matches `a b`.\n * So, we do prefer the label when figuring out how we’re going to serialize:\n * it has whitespace, casing, and we can ignore most useless character\n * escapes and all character references.\n *\n * @type {AssociationId}\n */\nexport function association(node) {\n if (node.label || !node.identifier) {\n return node.label || ''\n }\n\n return decodeString(node.identifier)\n}\n","/**\n * @typedef {import('../types.js').Handle} Handle\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').PhrasingContent} PhrasingContent\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nexport function containerPhrasing(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n /** @type {Array} */\n const results = []\n let index = -1\n let before = info.before\n\n indexStack.push(-1)\n let tracker = state.createTracker(info)\n\n while (++index < children.length) {\n const child = children[index]\n /** @type {string} */\n let after\n\n indexStack[indexStack.length - 1] = index\n\n if (index + 1 < children.length) {\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n let handle = state.handle.handlers[children[index + 1].type]\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n if (handle && handle.peek) handle = handle.peek\n after = handle\n ? handle(children[index + 1], parent, state, {\n before: '',\n after: '',\n ...tracker.current()\n }).charAt(0)\n : ''\n } else {\n after = info.after\n }\n\n // In some cases, html (text) can be found in phrasing right after an eol.\n // When we’d serialize that, in most cases that would be seen as html\n // (flow).\n // As we can’t escape or so to prevent it from happening, we take a somewhat\n // reasonable approach: replace that eol with a space.\n // See: \n if (\n results.length > 0 &&\n (before === '\\r' || before === '\\n') &&\n child.type === 'html'\n ) {\n results[results.length - 1] = results[results.length - 1].replace(\n /(\\r?\\n|\\r)$/,\n ' '\n )\n before = ' '\n\n // To do: does this work to reset tracker?\n tracker = state.createTracker(info)\n tracker.move(results.join(''))\n }\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n ...tracker.current(),\n before,\n after\n })\n )\n )\n\n before = results[results.length - 1].slice(-1)\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').FlowContent} FlowContent\n * @typedef {import('../types.js').Node} Node\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').TrackFields} TrackFields\n */\n\n/**\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {TrackFields} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined by (blank) lines.\n */\nexport function containerFlow(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n const tracker = state.createTracker(info)\n /** @type {Array} */\n const results = []\n let index = -1\n\n indexStack.push(-1)\n\n while (++index < children.length) {\n const child = children[index]\n\n indexStack[indexStack.length - 1] = index\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n before: '\\n',\n after: '\\n',\n ...tracker.current()\n })\n )\n )\n\n if (child.type !== 'list') {\n state.bulletLastUsed = undefined\n }\n\n if (index < children.length - 1) {\n results.push(\n tracker.move(between(child, children[index + 1], parent, state))\n )\n }\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n\n/**\n * @param {Node} left\n * @param {Node} right\n * @param {Parent} parent\n * @param {State} state\n * @returns {string}\n */\nfunction between(left, right, parent, state) {\n let index = state.join.length\n\n while (index--) {\n const result = state.join[index](left, right, parent, state)\n\n if (result === true || result === 1) {\n break\n }\n\n if (typeof result === 'number') {\n return '\\n'.repeat(1 + result)\n }\n\n if (result === false) {\n return '\\n\\n\\n\\n'\n }\n }\n\n return '\\n\\n'\n}\n","/**\n * @typedef {import('../types.js').IndentLines} IndentLines\n */\n\nconst eol = /\\r?\\n|\\r/g\n\n/**\n * @type {IndentLines}\n */\nexport function indentLines(value, map) {\n /** @type {Array} */\n const result = []\n let start = 0\n let line = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = eol.exec(value))) {\n one(value.slice(start, match.index))\n result.push(match[0])\n start = match.index + match[0].length\n line++\n }\n\n one(value.slice(start))\n\n return result.join('')\n\n /**\n * @param {string} value\n */\n function one(value) {\n result.push(map(value, line, !value))\n }\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').SafeConfig} SafeConfig\n */\n\nimport {patternCompile} from './pattern-compile.js'\nimport {patternInScope} from './pattern-in-scope.js'\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What “constructs” we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @param {State} state\n * Info passed around about the current state.\n * @param {string | null | undefined} input\n * Raw value to make safe.\n * @param {SafeConfig} config\n * Configuration.\n * @returns {string}\n * Serialized markdown safe for embedding.\n */\nexport function safe(state, input, config) {\n const value = (config.before || '') + (input || '') + (config.after || '')\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const result = []\n /** @type {Record} */\n const infos = {}\n let index = -1\n\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n\n if (!patternInScope(state.stack, pattern)) {\n continue\n }\n\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(value))) {\n const before = 'before' in pattern || Boolean(pattern.atBreak)\n const after = 'after' in pattern\n const position = match.index + (before ? match[1].length : 0)\n\n if (positions.includes(position)) {\n if (infos[position].before && !before) {\n infos[position].before = false\n }\n\n if (infos[position].after && !after) {\n infos[position].after = false\n }\n } else {\n positions.push(position)\n infos[position] = {before, after}\n }\n }\n }\n\n positions.sort(numerical)\n\n let start = config.before ? config.before.length : 0\n const end = value.length - (config.after ? config.after.length : 0)\n index = -1\n\n while (++index < positions.length) {\n const position = positions[index]\n\n // Character before or after matched:\n if (position < start || position >= end) {\n continue\n }\n\n // If this character is supposed to be escaped because it has a condition on\n // the next character, and the next character is definitly being escaped,\n // then skip this escape.\n if (\n (position + 1 < end &&\n positions[index + 1] === position + 1 &&\n infos[position].after &&\n !infos[position + 1].before &&\n !infos[position + 1].after) ||\n (positions[index - 1] === position - 1 &&\n infos[position].before &&\n !infos[position - 1].before &&\n !infos[position - 1].after)\n ) {\n continue\n }\n\n if (start !== position) {\n // If we have to use a character reference, an ampersand would be more\n // correct, but as backslashes only care about punctuation, either will\n // do the trick\n result.push(escapeBackslashes(value.slice(start, position), '\\\\'))\n }\n\n start = position\n\n if (\n /[!-/:-@[-`{-~]/.test(value.charAt(position)) &&\n (!config.encode || !config.encode.includes(value.charAt(position)))\n ) {\n // Character escape.\n result.push('\\\\')\n } else {\n // Character reference.\n result.push(\n '&#x' + value.charCodeAt(position).toString(16).toUpperCase() + ';'\n )\n start++\n }\n }\n\n result.push(escapeBackslashes(value.slice(start, end), config.after))\n\n return result.join('')\n}\n\n/**\n * @param {number} a\n * @param {number} b\n * @returns {number}\n */\nfunction numerical(a, b) {\n return a - b\n}\n\n/**\n * @param {string} value\n * @param {string} after\n * @returns {string}\n */\nfunction escapeBackslashes(value, after) {\n const expression = /\\\\(?=[!-/:-@[-`{-~])/g\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const results = []\n const whole = value + after\n let index = -1\n let start = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(whole))) {\n positions.push(match.index)\n }\n\n while (++index < positions.length) {\n if (start !== positions[index]) {\n results.push(value.slice(start, positions[index]))\n }\n\n results.push('\\\\')\n start = positions[index]\n }\n\n results.push(value.slice(start))\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').CreateTracker} CreateTracker\n * @typedef {import('../types.js').TrackCurrent} TrackCurrent\n * @typedef {import('../types.js').TrackMove} TrackMove\n * @typedef {import('../types.js').TrackShift} TrackShift\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n // Defaults are used to prevent crashes when older utilities somehow activate\n // this code.\n /* c8 ignore next 5 */\n const options = config || {}\n const now = options.now || {}\n let lineShift = options.lineShift || 0\n let line = now.line || 1\n let column = now.column || 1\n\n return {move, current, shift}\n\n /**\n * Get the current tracked info.\n *\n * @type {TrackCurrent}\n */\n function current() {\n return {now: {line, column}, lineShift}\n }\n\n /**\n * Define an increased line shift (the typical indent for lines).\n *\n * @type {TrackShift}\n */\n function shift(value) {\n lineShift += value\n }\n\n /**\n * Move past some generated markdown.\n *\n * @type {TrackMove}\n */\n function move(input) {\n // eslint-disable-next-line unicorn/prefer-default-parameters\n const value = input || ''\n const chunks = value.split(/\\r?\\n|\\r/g)\n const tail = chunks[chunks.length - 1]\n line += chunks.length - 1\n column =\n chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n return value\n }\n}\n","/**\n * @typedef {import('./types.js').Enter} Enter\n * @typedef {import('./types.js').Info} Info\n * @typedef {import('./types.js').Join} Join\n * @typedef {import('./types.js').FlowContent} FlowContent\n * @typedef {import('./types.js').Node} Node\n * @typedef {import('./types.js').Options} Options\n * @typedef {import('./types.js').Parent} Parent\n * @typedef {import('./types.js').PhrasingContent} PhrasingContent\n * @typedef {import('./types.js').SafeConfig} SafeConfig\n * @typedef {import('./types.js').State} State\n * @typedef {import('./types.js').TrackFields} TrackFields\n */\n\nimport {zwitch} from 'zwitch'\nimport {configure} from './configure.js'\nimport {handle as handlers} from './handle/index.js'\nimport {join} from './join.js'\nimport {unsafe} from './unsafe.js'\nimport {association} from './util/association.js'\nimport {containerPhrasing} from './util/container-phrasing.js'\nimport {containerFlow} from './util/container-flow.js'\nimport {indentLines} from './util/indent-lines.js'\nimport {safe} from './util/safe.js'\nimport {track} from './util/track.js'\n\n/**\n * Turn an mdast syntax tree into markdown.\n *\n * @param {Node} tree\n * Tree to serialize.\n * @param {Options} [options]\n * Configuration (optional).\n * @returns {string}\n * Serialized markdown representing `tree`.\n */\nexport function toMarkdown(tree, options = {}) {\n /** @type {State} */\n const state = {\n enter,\n indentLines,\n associationId: association,\n containerPhrasing: containerPhrasingBound,\n containerFlow: containerFlowBound,\n createTracker: track,\n safe: safeBound,\n stack: [],\n unsafe: [],\n join: [],\n // @ts-expect-error: we’ll fill it next.\n handlers: {},\n options: {},\n indexStack: [],\n // @ts-expect-error: we’ll add `handle` later.\n handle: undefined\n }\n\n configure(state, {unsafe, join, handlers})\n configure(state, options)\n\n if (state.options.tightDefinitions) {\n configure(state, {join: [joinDefinition]})\n }\n\n state.handle = zwitch('type', {\n invalid,\n unknown,\n handlers: state.handlers\n })\n\n let result = state.handle(tree, undefined, state, {\n before: '\\n',\n after: '\\n',\n now: {line: 1, column: 1},\n lineShift: 0\n })\n\n if (\n result &&\n result.charCodeAt(result.length - 1) !== 10 &&\n result.charCodeAt(result.length - 1) !== 13\n ) {\n result += '\\n'\n }\n\n return result\n\n /** @type {Enter} */\n function enter(name) {\n state.stack.push(name)\n return exit\n\n function exit() {\n state.stack.pop()\n }\n }\n}\n\n/**\n * @param {unknown} value\n * @returns {never}\n */\nfunction invalid(value) {\n throw new Error('Cannot handle value `' + value + '`, expected node')\n}\n\n/**\n * @param {unknown} node\n * @returns {never}\n */\nfunction unknown(node) {\n // @ts-expect-error: fine.\n throw new Error('Cannot handle unknown node `' + node.type + '`')\n}\n\n/** @type {Join} */\nfunction joinDefinition(left, right) {\n // No blank line between adjacent definitions.\n if (left.type === 'definition' && left.type === right.type) {\n return 0\n }\n}\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nfunction containerPhrasingBound(parent, info) {\n return containerPhrasing(parent, this, info)\n}\n\n/**\n * Serialize the children of a parent that contains flow children.\n *\n * These children will typically be joined by blank lines.\n * What they are joined by exactly is defined by `Join` functions.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {TrackFields} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined by (blank) lines.\n */\nfunction containerFlowBound(parent, info) {\n return containerFlow(parent, this, info)\n}\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What “constructs” we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {string | null | undefined} value\n * Raw value to make safe.\n * @param {SafeConfig} config\n * Configuration.\n * @returns {string}\n * Serialized markdown safe for embedding.\n */\nfunction safeBound(value, config) {\n return safe(this, value, config)\n}\n","/**\n * @typedef {import('mdast').Root|import('mdast').Content} Node\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownOptions\n * @typedef {Omit} Options\n */\n\nimport {toMarkdown} from 'mdast-util-to-markdown'\n\n/**\n * @this {import('unified').Processor}\n * @type {import('unified').Plugin<[Options?]|void[], Node, string>}\n */\nexport default function remarkStringify(options) {\n /** @type {import('unified').CompilerFunction} */\n const compiler = (tree) => {\n // Assume options.\n const settings = /** @type {Options} */ (this.data('settings'))\n\n return toMarkdown(\n tree,\n Object.assign({}, settings, options, {\n // Note: this option is not in the readme.\n // The goal is for it to be set by plugins on `data` instead of being\n // passed by users.\n extensions:\n /** @type {ToMarkdownOptions['extensions']} */ (\n this.data('toMarkdownExtensions')\n ) || []\n })\n )\n }\n\n Object.assign(this, {Compiler: compiler})\n}\n","import {unified} from 'unified'\nimport remarkParse from 'remark-parse'\nimport remarkStringify from 'remark-stringify'\n\nexport const remark = unified().use(remarkParse).use(remarkStringify).freeze()\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","// @ts-expect-error\nimport formatter from 'format'\n\nexport const fault = Object.assign(create(Error), {\n eval: create(EvalError),\n range: create(RangeError),\n reference: create(ReferenceError),\n syntax: create(SyntaxError),\n type: create(TypeError),\n uri: create(URIError)\n})\n\n/**\n * Create a new `EConstructor`, with the formatted `format` as a first argument.\n *\n * @template {Error} Fault\n * @template {new (reason: string) => Fault} Class\n * @param {Class} Constructor\n */\nexport function create(Constructor) {\n /** @type {string} */\n // @ts-expect-error\n FormattedError.displayName = Constructor.displayName || Constructor.name\n\n return FormattedError\n\n /**\n * Create an error with a printf-like formatted message.\n *\n * @param {string|null} [format]\n * Template string.\n * @param {...unknown} values\n * Values to render in `format`.\n * @returns {Fault}\n */\n function FormattedError(format, ...values) {\n /** @type {string} */\n const reason = format ? formatter(format, ...values) : format\n return new Constructor(reason)\n }\n}\n","/**\n * @typedef {'toml' | 'yaml'} Preset\n * Known name of a frontmatter style.\n *\n * @typedef Info\n * Sequence.\n *\n * Depending on how this structure is used, it reflects a marker or a fence.\n * @property {string} open\n * Opening.\n * @property {string} close\n * Closing.\n *\n * @typedef MatterProps\n * Fields describing a kind of matter.\n * @property {string} type\n * Node type to tokenize as.\n * @property {boolean | null | undefined} [anywhere=false]\n * Whether matter can be found anywhere in the document, normally, only matter\n * at the start of the document is recognized.\n *\n * > 👉 **Note**: using this is a terrible idea.\n * > It’s called frontmatter, not matter-in-the-middle or so.\n * > This makes your markdown less portable.\n *\n * @typedef MarkerProps\n * Marker configuration.\n * @property {Info | string} marker\n * Character repeated 3 times, used as complete fences.\n *\n * For example the character `'-'` will result in `'---'` being used as the\n * fence\n * Pass `open` and `close` to specify different characters for opening and\n * closing fences.\n * @property {never} [fence]\n * If `marker` is set, `fence` must not be set.\n *\n * @typedef FenceProps\n * Fence configuration.\n * @property {Info | string} fence\n * Complete fences.\n *\n * This can be used when fences contain different characters or lengths\n * other than 3.\n * Pass `open` and `close` to interface to specify different characters for opening and\n * closing fences.\n * @property {never} [marker]\n * If `fence` is set, `marker` must not be set.\n *\n * @typedef {(MatterProps & FenceProps) | (MatterProps & MarkerProps)} Matter\n * Fields describing a kind of matter.\n *\n * > 👉 **Note**: using `anywhere` is a terrible idea.\n * > It’s called frontmatter, not matter-in-the-middle or so.\n * > This makes your markdown less portable.\n *\n * > 👉 **Note**: `marker` and `fence` are mutually exclusive.\n * > If `marker` is set, `fence` must not be set, and vice versa.\n *\n * @typedef {Matter | Preset | Array} Options\n * Configuration.\n */\n\nimport {fault} from 'fault'\nconst own = {}.hasOwnProperty\nconst markers = {\n yaml: '-',\n toml: '+'\n}\n\n/**\n * Simplify one or more options.\n *\n * @param {Options | null | undefined} [options='yaml']\n * Configuration.\n * @returns {Array}\n * List of matters.\n */\nexport function matters(options) {\n /** @type {Array} */\n const result = []\n let index = -1\n\n /** @type {Array} */\n const presetsOrMatters = Array.isArray(options)\n ? options\n : options\n ? [options]\n : ['yaml']\n while (++index < presetsOrMatters.length) {\n result[index] = matter(presetsOrMatters[index])\n }\n return result\n}\n\n/**\n * Simplify an option.\n *\n * @param {Matter | Preset} option\n * Configuration.\n * @returns {Matter}\n * Matters.\n */\nfunction matter(option) {\n let result = option\n if (typeof result === 'string') {\n if (!own.call(markers, result)) {\n throw fault('Missing matter definition for `%s`', result)\n }\n result = {\n type: result,\n marker: markers[result]\n }\n } else if (typeof result !== 'object') {\n throw fault('Expected matter to be an object, not `%j`', result)\n }\n if (!own.call(result, 'type')) {\n throw fault('Missing `type` in matter `%j`', result)\n }\n if (!own.call(result, 'fence') && !own.call(result, 'marker')) {\n throw fault('Missing `marker` or `fence` in matter `%j`', result)\n }\n return result\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').ConstructRecord} ConstructRecord\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenType} TokenType\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n *\n * @typedef {import('../matters.js').Info} Info\n * @typedef {import('../matters.js').Matter} Matter\n * @typedef {import('../matters.js').Options} Options\n */\n\nimport {markdownLineEnding, markdownSpace} from 'micromark-util-character'\nimport {matters} from '../matters.js'\n\n/**\n * Create an extension for `micromark` to enable frontmatter syntax.\n *\n * @param {Options | null | undefined} [options='yaml']\n * Configuration.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable frontmatter syntax.\n */\nexport function frontmatter(options) {\n const listOfMatters = matters(options)\n /** @type {ConstructRecord} */\n const flow = {}\n let index = -1\n while (++index < listOfMatters.length) {\n const matter = listOfMatters[index]\n const code = fence(matter, 'open').charCodeAt(0)\n const construct = createConstruct(matter)\n const existing = flow[code]\n if (Array.isArray(existing)) {\n existing.push(construct)\n } else {\n // Never a single object, always an array.\n flow[code] = [construct]\n }\n }\n return {\n flow\n }\n}\n\n/**\n * @param {Matter} matter\n * @returns {Construct}\n */\nfunction createConstruct(matter) {\n const anywhere = matter.anywhere\n const frontmatterType = /** @type {TokenType} */ matter.type\n const fenceType = /** @type {TokenType} */ frontmatterType + 'Fence'\n const sequenceType = /** @type {TokenType} */ fenceType + 'Sequence'\n const valueType = /** @type {TokenType} */ frontmatterType + 'Value'\n const closingFenceConstruct = {\n tokenize: tokenizeClosingFence,\n partial: true\n }\n\n /**\n * Fence to look for.\n *\n * @type {string}\n */\n let buffer\n let bufferIndex = 0\n return {\n tokenize: tokenizeFrontmatter,\n concrete: true\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeFrontmatter(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of frontmatter.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function start(code) {\n const position = self.now()\n if (\n // Indent not allowed.\n position.column === 1 &&\n // Normally, only allowed in first line.\n (position.line === 1 || anywhere)\n ) {\n buffer = fence(matter, 'open')\n bufferIndex = 0\n if (code === buffer.charCodeAt(bufferIndex)) {\n effects.enter(frontmatterType)\n effects.enter(fenceType)\n effects.enter(sequenceType)\n return openSequence(code)\n }\n }\n return nok(code)\n }\n\n /**\n * In open sequence.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openSequence(code) {\n if (bufferIndex === buffer.length) {\n effects.exit(sequenceType)\n if (markdownSpace(code)) {\n effects.enter('whitespace')\n return openSequenceWhitespace(code)\n }\n return openAfter(code)\n }\n if (code === buffer.charCodeAt(bufferIndex++)) {\n effects.consume(code)\n return openSequence\n }\n return nok(code)\n }\n\n /**\n * In whitespace after open sequence.\n *\n * ```markdown\n * > | ---␠\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openSequenceWhitespace(code) {\n if (markdownSpace(code)) {\n effects.consume(code)\n return openSequenceWhitespace\n }\n effects.exit('whitespace')\n return openAfter(code)\n }\n\n /**\n * After open sequence.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openAfter(code) {\n if (markdownLineEnding(code)) {\n effects.exit(fenceType)\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n // Get ready for closing fence.\n buffer = fence(matter, 'close')\n bufferIndex = 0\n return effects.attempt(closingFenceConstruct, after, contentStart)\n }\n\n // EOF is not okay.\n return nok(code)\n }\n\n /**\n * Start of content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentStart(code) {\n if (code === null || markdownLineEnding(code)) {\n return contentEnd(code)\n }\n effects.enter(valueType)\n return contentInside(code)\n }\n\n /**\n * In content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentInside(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit(valueType)\n return contentEnd(code)\n }\n effects.consume(code)\n return contentInside\n }\n\n /**\n * End of content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentEnd(code) {\n // Require a closing fence.\n if (code === null) {\n return nok(code)\n }\n\n // Can only be an eol.\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return effects.attempt(closingFenceConstruct, after, contentStart)\n }\n\n /**\n * After frontmatter.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // `code` must be eol/eof.\n effects.exit(frontmatterType)\n return ok(code)\n }\n }\n\n /** @type {Tokenizer} */\n function tokenizeClosingFence(effects, ok, nok) {\n let bufferIndex = 0\n return closeStart\n\n /**\n * Start of close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeStart(code) {\n if (code === buffer.charCodeAt(bufferIndex)) {\n effects.enter(fenceType)\n effects.enter(sequenceType)\n return closeSequence(code)\n }\n return nok(code)\n }\n\n /**\n * In close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeSequence(code) {\n if (bufferIndex === buffer.length) {\n effects.exit(sequenceType)\n if (markdownSpace(code)) {\n effects.enter('whitespace')\n return closeSequenceWhitespace(code)\n }\n return closeAfter(code)\n }\n if (code === buffer.charCodeAt(bufferIndex++)) {\n effects.consume(code)\n return closeSequence\n }\n return nok(code)\n }\n\n /**\n * In whitespace after close sequence.\n *\n * ```markdown\n * > | ---\n * | title: \"Venus\"\n * | ---␠\n * ^\n * ```\n *\n * @type {State}\n */\n function closeSequenceWhitespace(code) {\n if (markdownSpace(code)) {\n effects.consume(code)\n return closeSequenceWhitespace\n }\n effects.exit('whitespace')\n return closeAfter(code)\n }\n\n /**\n * After close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeAfter(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit(fenceType)\n return ok(code)\n }\n return nok(code)\n }\n }\n}\n\n/**\n * @param {Matter} matter\n * @param {'open' | 'close'} prop\n * @returns {string}\n */\nfunction fence(matter, prop) {\n return matter.marker\n ? pick(matter.marker, prop).repeat(3)\n : // @ts-expect-error: They’re mutually exclusive.\n pick(matter.fence, prop)\n}\n\n/**\n * @param {Info | string} schema\n * @param {'open' | 'close'} prop\n * @returns {string}\n */\nfunction pick(schema, prop) {\n return typeof schema === 'string' ? schema : schema[prop]\n}\n","/**\n * @typedef {import('mdast').Literal} Literal\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n *\n * @typedef {import('micromark-extension-frontmatter').Options} Options\n * @typedef {import('micromark-extension-frontmatter/matters.js').Matter} Matter\n * @typedef {import('micromark-extension-frontmatter/matters.js').Info} Info\n */\n\nimport {matters} from 'micromark-extension-frontmatter/matters.js'\n\n/**\n * Create an extension for `mdast-util-from-markdown`.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {FromMarkdownExtension}\n * Extension for `mdast-util-from-markdown`.\n */\nexport function frontmatterFromMarkdown(options) {\n // @ts-expect-error: `micromark-extension-frontmatter` should fix types to\n // accept `null` as options.\n const settings = matters(options)\n /** @type {FromMarkdownExtension['enter']} */\n const enter = {}\n /** @type {FromMarkdownExtension['exit']} */\n const exit = {}\n let index = -1\n\n while (++index < settings.length) {\n const matter = settings[index]\n enter[matter.type] = opener(matter)\n exit[matter.type] = close\n exit[matter.type + 'Value'] = value\n }\n\n return {enter, exit}\n}\n\n/**\n * @param {Matter} matter\n * @returns {FromMarkdownHandle} enter\n */\nfunction opener(matter) {\n return open\n\n /**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\n function open(token) {\n // @ts-expect-error: custom.\n this.enter({type: matter.type, value: ''}, token)\n this.buffer()\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction close(token) {\n const data = this.resume()\n const node = /** @type {Literal} */ (this.exit(token))\n // Remove the initial and final eol.\n node.value = data.replace(/^(\\r?\\n|\\r)|(\\r?\\n|\\r)$/g, '')\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction value(token) {\n this.config.enter.data.call(this, token)\n this.config.exit.data.call(this, token)\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown`.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown`.\n */\nexport function frontmatterToMarkdown(options) {\n // To do: use an extension object with `satisfies` later.\n /** @type {ToMarkdownExtension['unsafe']} */\n const unsafe = []\n /** @type {ToMarkdownExtension['handlers']} */\n const handlers = {}\n // @ts-expect-error: `micromark-extension-frontmatter` should fix types to\n // accept `null` as options.\n const settings = matters(options)\n let index = -1\n\n while (++index < settings.length) {\n const matter = settings[index]\n\n // @ts-expect-error: this can add custom frontmatter nodes.\n // Typing those is the responsibility of the end user.\n handlers[matter.type] = handler(matter)\n\n // To do: idea: perhaps make this smarter, with an `after` of the second char?\n unsafe.push({atBreak: true, character: fence(matter, 'open').charAt(0)})\n }\n\n return {unsafe, handlers}\n}\n\n/**\n * Create a handle that can serialize a frontmatter node as markdown.\n *\n * @param {Matter} matter\n * Structure.\n * @returns {(node: Literal) => string} enter\n * Handler.\n */\nfunction handler(matter) {\n const open = fence(matter, 'open')\n const close = fence(matter, 'close')\n\n return handle\n\n /**\n * Serialize a frontmatter node as markdown.\n *\n * @param {Literal} node\n * Node to serialize.\n * @returns {string}\n * Serialized node.\n */\n function handle(node) {\n return open + (node.value ? '\\n' + node.value : '') + '\\n' + close\n }\n}\n\n/**\n * Get an `open` or `close` fence.\n *\n * @param {Matter} matter\n * Structure.\n * @param {'open' | 'close'} prop\n * Field to get.\n * @returns {string}\n * Fence.\n */\nfunction fence(matter, prop) {\n return matter.marker\n ? pick(matter.marker, prop).repeat(3)\n : // @ts-expect-error: They’re mutually exclusive.\n pick(matter.fence, prop)\n}\n\n/**\n * Take `open` or `close` fields when schema is an info object, or use the\n * given value when it is a string.\n *\n * @param {Info | string} schema\n * Info object or value.\n * @param {'open' | 'close'} prop\n * Field to get.\n * @returns {string}\n * Thing to use for the opening or closing.\n */\nfunction pick(schema, prop) {\n return typeof schema === 'string' ? schema : schema[prop]\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('micromark-extension-frontmatter').Options} Options\n */\n\nimport {frontmatter} from 'micromark-extension-frontmatter'\nimport {\n frontmatterFromMarkdown,\n frontmatterToMarkdown\n} from 'mdast-util-frontmatter'\n\n/**\n * Plugin to add support for frontmatter.\n *\n * @type {import('unified').Plugin<[Options?]|void[], Root>}\n */\nexport default function remarkFrontmatter(options = 'yaml') {\n const data = this.data()\n\n add('micromarkExtensions', frontmatter(options))\n add('fromMarkdownExtensions', frontmatterFromMarkdown(options))\n add('toMarkdownExtensions', frontmatterToMarkdown(options))\n\n /**\n * @param {string} field\n * @param {unknown} value\n */\n function add(field, value) {\n const list = /** @type {unknown[]} */ (\n // Other extensions\n /* c8 ignore next 2 */\n data[field] ? data[field] : (data[field] = [])\n )\n\n list.push(value)\n }\n}\n","/**\n * Like `Array#splice`, but smarter for giant arrays.\n *\n * `Array#splice` takes all items to be inserted as individual argument which\n * causes a stack overflow in V8 when trying to insert 100k items for instance.\n *\n * Otherwise, this does not return the removed items, and takes `items` as an\n * array instead of rest parameters.\n *\n * @template {unknown} T\n * Item type.\n * @param {Array} list\n * List to operate on.\n * @param {number} start\n * Index to remove/insert at (can be negative).\n * @param {number} remove\n * Number of items to remove.\n * @param {Array} items\n * Items to inject into `list`.\n * @returns {void}\n * Nothing.\n */\nexport function splice(list, start, remove, items) {\n const end = list.length\n let chunkStart = 0\n /** @type {Array} */\n let parameters\n\n // Make start between zero and `end` (included).\n if (start < 0) {\n start = -start > end ? 0 : end + start\n } else {\n start = start > end ? end : start\n }\n remove = remove > 0 ? remove : 0\n\n // No need to chunk the items if there’s only a couple (10k) items.\n if (items.length < 10000) {\n parameters = Array.from(items)\n parameters.unshift(start, remove)\n // @ts-expect-error Hush, it’s fine.\n list.splice(...parameters)\n } else {\n // Delete `remove` items starting from `start`\n if (remove) list.splice(start, remove)\n\n // Insert the items in chunks to not cause stack overflows.\n while (chunkStart < items.length) {\n parameters = items.slice(chunkStart, chunkStart + 10000)\n parameters.unshift(start, 0)\n // @ts-expect-error Hush, it’s fine.\n list.splice(...parameters)\n chunkStart += 10000\n start += 10000\n }\n }\n}\n\n/**\n * Append `items` (an array) at the end of `list` (another array).\n * When `list` was empty, returns `items` instead.\n *\n * This prevents a potentially expensive operation when `list` is empty,\n * and adds items in batches to prevent V8 from hanging.\n *\n * @template {unknown} T\n * Item type.\n * @param {Array} list\n * List to operate on.\n * @param {Array} items\n * Items to add to `list`.\n * @returns {Array}\n * Either `list` or `items`.\n */\nexport function push(list, items) {\n if (list.length > 0) {\n splice(list, list.length, 0, items)\n return list\n }\n return items\n}\n","/**\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Handles} Handles\n * @typedef {import('micromark-util-types').HtmlExtension} HtmlExtension\n * @typedef {import('micromark-util-types').NormalizedExtension} NormalizedExtension\n */\n\nimport {splice} from 'micromark-util-chunked'\n\nconst hasOwnProperty = {}.hasOwnProperty\n\n/**\n * Combine multiple syntax extensions into one.\n *\n * @param {Array} extensions\n * List of syntax extensions.\n * @returns {NormalizedExtension}\n * A single combined extension.\n */\nexport function combineExtensions(extensions) {\n /** @type {NormalizedExtension} */\n const all = {}\n let index = -1\n\n while (++index < extensions.length) {\n syntaxExtension(all, extensions[index])\n }\n\n return all\n}\n\n/**\n * Merge `extension` into `all`.\n *\n * @param {NormalizedExtension} all\n * Extension to merge into.\n * @param {Extension} extension\n * Extension to merge.\n * @returns {void}\n */\nfunction syntaxExtension(all, extension) {\n /** @type {keyof Extension} */\n let hook\n\n for (hook in extension) {\n const maybe = hasOwnProperty.call(all, hook) ? all[hook] : undefined\n /** @type {Record} */\n const left = maybe || (all[hook] = {})\n /** @type {Record | undefined} */\n const right = extension[hook]\n /** @type {string} */\n let code\n\n if (right) {\n for (code in right) {\n if (!hasOwnProperty.call(left, code)) left[code] = []\n const value = right[code]\n constructs(\n // @ts-expect-error Looks like a list.\n left[code],\n Array.isArray(value) ? value : value ? [value] : []\n )\n }\n }\n }\n}\n\n/**\n * Merge `list` into `existing` (both lists of constructs).\n * Mutates `existing`.\n *\n * @param {Array} existing\n * @param {Array} list\n * @returns {void}\n */\nfunction constructs(existing, list) {\n let index = -1\n /** @type {Array} */\n const before = []\n\n while (++index < list.length) {\n // @ts-expect-error Looks like an object.\n ;(list[index].add === 'after' ? existing : before).push(list[index])\n }\n\n splice(existing, 0, 0, before)\n}\n\n/**\n * Combine multiple HTML extensions into one.\n *\n * @param {Array} htmlExtensions\n * List of HTML extensions.\n * @returns {HtmlExtension}\n * A single combined HTML extension.\n */\nexport function combineHtmlExtensions(htmlExtensions) {\n /** @type {HtmlExtension} */\n const handlers = {}\n let index = -1\n\n while (++index < htmlExtensions.length) {\n htmlExtension(handlers, htmlExtensions[index])\n }\n\n return handlers\n}\n\n/**\n * Merge `extension` into `all`.\n *\n * @param {HtmlExtension} all\n * Extension to merge into.\n * @param {HtmlExtension} extension\n * Extension to merge.\n * @returns {void}\n */\nfunction htmlExtension(all, extension) {\n /** @type {keyof HtmlExtension} */\n let hook\n\n for (hook in extension) {\n const maybe = hasOwnProperty.call(all, hook) ? all[hook] : undefined\n const left = maybe || (all[hook] = {})\n const right = extension[hook]\n /** @type {keyof Handles} */\n let type\n\n if (right) {\n for (type in right) {\n // @ts-expect-error assume document vs regular handler are managed correctly.\n left[type] = right[type]\n }\n }\n }\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').ConstructRecord} ConstructRecord\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Previous} Previous\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n asciiControl,\n markdownLineEndingOrSpace,\n unicodePunctuation,\n unicodeWhitespace\n} from 'micromark-util-character'\nconst wwwPrefix = {\n tokenize: tokenizeWwwPrefix,\n partial: true\n}\nconst domain = {\n tokenize: tokenizeDomain,\n partial: true\n}\nconst path = {\n tokenize: tokenizePath,\n partial: true\n}\nconst trail = {\n tokenize: tokenizeTrail,\n partial: true\n}\nconst emailDomainDotTrail = {\n tokenize: tokenizeEmailDomainDotTrail,\n partial: true\n}\nconst wwwAutolink = {\n tokenize: tokenizeWwwAutolink,\n previous: previousWww\n}\nconst protocolAutolink = {\n tokenize: tokenizeProtocolAutolink,\n previous: previousProtocol\n}\nconst emailAutolink = {\n tokenize: tokenizeEmailAutolink,\n previous: previousEmail\n}\n\n/** @type {ConstructRecord} */\nconst text = {}\n\n// To do: next major: expose functions that yields extension.\n\n/**\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * autolink literal syntax.\n *\n * @type {Extension}\n */\nexport const gfmAutolinkLiteral = {\n text\n}\n\n/** @type {Code} */\nlet code = 48\n\n// Add alphanumerics.\nwhile (code < 123) {\n text[code] = emailAutolink\n code++\n if (code === 58) code = 65\n else if (code === 91) code = 97\n}\ntext[43] = emailAutolink\ntext[45] = emailAutolink\ntext[46] = emailAutolink\ntext[95] = emailAutolink\ntext[72] = [emailAutolink, protocolAutolink]\ntext[104] = [emailAutolink, protocolAutolink]\ntext[87] = [emailAutolink, wwwAutolink]\ntext[119] = [emailAutolink, wwwAutolink]\n\n// To do: perform email autolink literals on events, afterwards.\n// That’s where `markdown-rs` and `cmark-gfm` perform it.\n// It should look for `@`, then for atext backwards, and then for a label\n// forwards.\n// To do: `mailto:`, `xmpp:` protocol as prefix.\n\n/**\n * Email autolink literal.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^^^^^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeEmailAutolink(effects, ok, nok) {\n const self = this\n /** @type {boolean | undefined} */\n let dot\n /** @type {boolean} */\n let data\n return start\n\n /**\n * Start of email autolink literal.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n if (\n !gfmAtext(code) ||\n !previousEmail.call(self, self.previous) ||\n previousUnbalanced(self.events)\n ) {\n return nok(code)\n }\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkEmail')\n return atext(code)\n }\n\n /**\n * In email atext.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function atext(code) {\n if (gfmAtext(code)) {\n effects.consume(code)\n return atext\n }\n if (code === 64) {\n effects.consume(code)\n return emailDomain\n }\n return nok(code)\n }\n\n /**\n * In email domain.\n *\n * The reference code is a bit overly complex as it handles the `@`, of which\n * there may be just one.\n * Source: \n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomain(code) {\n // Dot followed by alphanumerical (not `-` or `_`).\n if (code === 46) {\n return effects.check(\n emailDomainDotTrail,\n emailDomainAfter,\n emailDomainDot\n )(code)\n }\n\n // Alphanumerical, `-`, and `_`.\n if (code === 45 || code === 95 || asciiAlphanumeric(code)) {\n data = true\n effects.consume(code)\n return emailDomain\n }\n\n // To do: `/` if xmpp.\n\n // Note: normally we’d truncate trailing punctuation from the link.\n // However, email autolink literals cannot contain any of those markers,\n // except for `.`, but that can only occur if it isn’t trailing.\n // So we can ignore truncating!\n return emailDomainAfter(code)\n }\n\n /**\n * In email domain, on dot that is not a trail.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomainDot(code) {\n effects.consume(code)\n dot = true\n return emailDomain\n }\n\n /**\n * After email domain.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomainAfter(code) {\n // Domain must not be empty, must include a dot, and must end in alphabetical.\n // Source: .\n if (data && dot && asciiAlpha(self.previous)) {\n effects.exit('literalAutolinkEmail')\n effects.exit('literalAutolink')\n return ok(code)\n }\n return nok(code)\n }\n}\n\n/**\n * `www` autolink literal.\n *\n * ```markdown\n * > | a www.example.org b\n * ^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeWwwAutolink(effects, ok, nok) {\n const self = this\n return wwwStart\n\n /**\n * Start of www autolink literal.\n *\n * ```markdown\n * > | www.example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwStart(code) {\n if (\n (code !== 87 && code !== 119) ||\n !previousWww.call(self, self.previous) ||\n previousUnbalanced(self.events)\n ) {\n return nok(code)\n }\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkWww')\n // Note: we *check*, so we can discard the `www.` we parsed.\n // If it worked, we consider it as a part of the domain.\n return effects.check(\n wwwPrefix,\n effects.attempt(domain, effects.attempt(path, wwwAfter), nok),\n nok\n )(code)\n }\n\n /**\n * After a www autolink literal.\n *\n * ```markdown\n * > | www.example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwAfter(code) {\n effects.exit('literalAutolinkWww')\n effects.exit('literalAutolink')\n return ok(code)\n }\n}\n\n/**\n * Protocol autolink literal.\n *\n * ```markdown\n * > | a https://example.org b\n * ^^^^^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeProtocolAutolink(effects, ok, nok) {\n const self = this\n let buffer = ''\n let seen = false\n return protocolStart\n\n /**\n * Start of protocol autolink literal.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function protocolStart(code) {\n if (\n (code === 72 || code === 104) &&\n previousProtocol.call(self, self.previous) &&\n !previousUnbalanced(self.events)\n ) {\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkHttp')\n buffer += String.fromCodePoint(code)\n effects.consume(code)\n return protocolPrefixInside\n }\n return nok(code)\n }\n\n /**\n * In protocol.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^^^^^\n * ```\n *\n * @type {State}\n */\n function protocolPrefixInside(code) {\n // `5` is size of `https`\n if (asciiAlpha(code) && buffer.length < 5) {\n // @ts-expect-error: definitely number.\n buffer += String.fromCodePoint(code)\n effects.consume(code)\n return protocolPrefixInside\n }\n if (code === 58) {\n const protocol = buffer.toLowerCase()\n if (protocol === 'http' || protocol === 'https') {\n effects.consume(code)\n return protocolSlashesInside\n }\n }\n return nok(code)\n }\n\n /**\n * In slashes.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^^\n * ```\n *\n * @type {State}\n */\n function protocolSlashesInside(code) {\n if (code === 47) {\n effects.consume(code)\n if (seen) {\n return afterProtocol\n }\n seen = true\n return protocolSlashesInside\n }\n return nok(code)\n }\n\n /**\n * After protocol, before domain.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function afterProtocol(code) {\n // To do: this is different from `markdown-rs`:\n // https://github.com/wooorm/markdown-rs/blob/b3a921c761309ae00a51fe348d8a43adbc54b518/src/construct/gfm_autolink_literal.rs#L172-L182\n return code === null ||\n asciiControl(code) ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code) ||\n unicodePunctuation(code)\n ? nok(code)\n : effects.attempt(domain, effects.attempt(path, protocolAfter), nok)(code)\n }\n\n /**\n * After a protocol autolink literal.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function protocolAfter(code) {\n effects.exit('literalAutolinkHttp')\n effects.exit('literalAutolink')\n return ok(code)\n }\n}\n\n/**\n * `www` prefix.\n *\n * ```markdown\n * > | a www.example.org b\n * ^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeWwwPrefix(effects, ok, nok) {\n let size = 0\n return wwwPrefixInside\n\n /**\n * In www prefix.\n *\n * ```markdown\n * > | www.example.com\n * ^^^^\n * ```\n *\n * @type {State}\n */\n function wwwPrefixInside(code) {\n if ((code === 87 || code === 119) && size < 3) {\n size++\n effects.consume(code)\n return wwwPrefixInside\n }\n if (code === 46 && size === 3) {\n effects.consume(code)\n return wwwPrefixAfter\n }\n return nok(code)\n }\n\n /**\n * After www prefix.\n *\n * ```markdown\n * > | www.example.com\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwPrefixAfter(code) {\n // If there is *anything*, we can link.\n return code === null ? nok(code) : ok(code)\n }\n}\n\n/**\n * Domain.\n *\n * ```markdown\n * > | a https://example.org b\n * ^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDomain(effects, ok, nok) {\n /** @type {boolean | undefined} */\n let underscoreInLastSegment\n /** @type {boolean | undefined} */\n let underscoreInLastLastSegment\n /** @type {boolean | undefined} */\n let seen\n return domainInside\n\n /**\n * In domain.\n *\n * ```markdown\n * > | https://example.com/a\n * ^^^^^^^^^^^\n * ```\n *\n * @type {State}\n */\n function domainInside(code) {\n // Check whether this marker, which is a trailing punctuation\n // marker, optionally followed by more trailing markers, and then\n // followed by an end.\n if (code === 46 || code === 95) {\n return effects.check(trail, domainAfter, domainAtPunctuation)(code)\n }\n\n // GH documents that only alphanumerics (other than `-`, `.`, and `_`) can\n // occur, which sounds like ASCII only, but they also support `www.點看.com`,\n // so that’s Unicode.\n // Instead of some new production for Unicode alphanumerics, markdown\n // already has that for Unicode punctuation and whitespace, so use those.\n // Source: .\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code) ||\n (code !== 45 && unicodePunctuation(code))\n ) {\n return domainAfter(code)\n }\n seen = true\n effects.consume(code)\n return domainInside\n }\n\n /**\n * In domain, at potential trailing punctuation, that was not trailing.\n *\n * ```markdown\n * > | https://example.com\n * ^\n * ```\n *\n * @type {State}\n */\n function domainAtPunctuation(code) {\n // There is an underscore in the last segment of the domain\n if (code === 95) {\n underscoreInLastSegment = true\n }\n // Otherwise, it’s a `.`: save the last segment underscore in the\n // penultimate segment slot.\n else {\n underscoreInLastLastSegment = underscoreInLastSegment\n underscoreInLastSegment = undefined\n }\n effects.consume(code)\n return domainInside\n }\n\n /**\n * After domain.\n *\n * ```markdown\n * > | https://example.com/a\n * ^\n * ```\n *\n * @type {State} */\n function domainAfter(code) {\n // Note: that’s GH says a dot is needed, but it’s not true:\n // \n if (underscoreInLastLastSegment || underscoreInLastSegment || !seen) {\n return nok(code)\n }\n return ok(code)\n }\n}\n\n/**\n * Path.\n *\n * ```markdown\n * > | a https://example.org/stuff b\n * ^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizePath(effects, ok) {\n let sizeOpen = 0\n let sizeClose = 0\n return pathInside\n\n /**\n * In path.\n *\n * ```markdown\n * > | https://example.com/a\n * ^^\n * ```\n *\n * @type {State}\n */\n function pathInside(code) {\n if (code === 40) {\n sizeOpen++\n effects.consume(code)\n return pathInside\n }\n\n // To do: `markdown-rs` also needs this.\n // If this is a paren, and there are less closings than openings,\n // we don’t check for a trail.\n if (code === 41 && sizeClose < sizeOpen) {\n return pathAtPunctuation(code)\n }\n\n // Check whether this trailing punctuation marker is optionally\n // followed by more trailing markers, and then followed\n // by an end.\n if (\n code === 33 ||\n code === 34 ||\n code === 38 ||\n code === 39 ||\n code === 41 ||\n code === 42 ||\n code === 44 ||\n code === 46 ||\n code === 58 ||\n code === 59 ||\n code === 60 ||\n code === 63 ||\n code === 93 ||\n code === 95 ||\n code === 126\n ) {\n return effects.check(trail, ok, pathAtPunctuation)(code)\n }\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n effects.consume(code)\n return pathInside\n }\n\n /**\n * In path, at potential trailing punctuation, that was not trailing.\n *\n * ```markdown\n * > | https://example.com/a\"b\n * ^\n * ```\n *\n * @type {State}\n */\n function pathAtPunctuation(code) {\n // Count closing parens.\n if (code === 41) {\n sizeClose++\n }\n effects.consume(code)\n return pathInside\n }\n}\n\n/**\n * Trail.\n *\n * This calls `ok` if this *is* the trail, followed by an end, which means\n * the entire trail is not part of the link.\n * It calls `nok` if this *is* part of the link.\n *\n * ```markdown\n * > | https://example.com\").\n * ^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTrail(effects, ok, nok) {\n return trail\n\n /**\n * In trail of domain or path.\n *\n * ```markdown\n * > | https://example.com\").\n * ^\n * ```\n *\n * @type {State}\n */\n function trail(code) {\n // Regular trailing punctuation.\n if (\n code === 33 ||\n code === 34 ||\n code === 39 ||\n code === 41 ||\n code === 42 ||\n code === 44 ||\n code === 46 ||\n code === 58 ||\n code === 59 ||\n code === 63 ||\n code === 95 ||\n code === 126\n ) {\n effects.consume(code)\n return trail\n }\n\n // `&` followed by one or more alphabeticals and then a `;`, is\n // as a whole considered as trailing punctuation.\n // In all other cases, it is considered as continuation of the URL.\n if (code === 38) {\n effects.consume(code)\n return trailCharRefStart\n }\n\n // Needed because we allow literals after `[`, as we fix:\n // .\n // Check that it is not followed by `(` or `[`.\n if (code === 93) {\n effects.consume(code)\n return trailBracketAfter\n }\n if (\n // `<` is an end.\n code === 60 ||\n // So is whitespace.\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n return nok(code)\n }\n\n /**\n * In trail, after `]`.\n *\n * > 👉 **Note**: this deviates from `cmark-gfm` to fix a bug.\n * > See end of for more.\n *\n * ```markdown\n * > | https://example.com](\n * ^\n * ```\n *\n * @type {State}\n */\n function trailBracketAfter(code) {\n // Whitespace or something that could start a resource or reference is the end.\n // Switch back to trail otherwise.\n if (\n code === null ||\n code === 40 ||\n code === 91 ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n return trail(code)\n }\n\n /**\n * In character-reference like trail, after `&`.\n *\n * ```markdown\n * > | https://example.com&).\n * ^\n * ```\n *\n * @type {State}\n */\n function trailCharRefStart(code) {\n // When non-alpha, it’s not a trail.\n return asciiAlpha(code) ? trailCharRefInside(code) : nok(code)\n }\n\n /**\n * In character-reference like trail.\n *\n * ```markdown\n * > | https://example.com&).\n * ^\n * ```\n *\n * @type {State}\n */\n function trailCharRefInside(code) {\n // Switch back to trail if this is well-formed.\n if (code === 59) {\n effects.consume(code)\n return trail\n }\n if (asciiAlpha(code)) {\n effects.consume(code)\n return trailCharRefInside\n }\n\n // It’s not a trail.\n return nok(code)\n }\n}\n\n/**\n * Dot in email domain trail.\n *\n * This calls `ok` if this *is* the trail, followed by an end, which means\n * the trail is not part of the link.\n * It calls `nok` if this *is* part of the link.\n *\n * ```markdown\n * > | contact@example.org.\n * ^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeEmailDomainDotTrail(effects, ok, nok) {\n return start\n\n /**\n * Dot.\n *\n * ```markdown\n * > | contact@example.org.\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // Must be dot.\n effects.consume(code)\n return after\n }\n\n /**\n * After dot.\n *\n * ```markdown\n * > | contact@example.org.\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // Not a trail if alphanumeric.\n return asciiAlphanumeric(code) ? nok(code) : ok(code)\n }\n}\n\n/**\n * See:\n * .\n *\n * @type {Previous}\n */\nfunction previousWww(code) {\n return (\n code === null ||\n code === 40 ||\n code === 42 ||\n code === 95 ||\n code === 91 ||\n code === 93 ||\n code === 126 ||\n markdownLineEndingOrSpace(code)\n )\n}\n\n/**\n * See:\n * .\n *\n * @type {Previous}\n */\nfunction previousProtocol(code) {\n return !asciiAlpha(code)\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Previous}\n */\nfunction previousEmail(code) {\n // Do not allow a slash “inside” atext.\n // The reference code is a bit weird, but that’s what it results in.\n // Source: .\n // Other than slash, every preceding character is allowed.\n return !(code === 47 || gfmAtext(code))\n}\n\n/**\n * @param {Code} code\n * @returns {boolean}\n */\nfunction gfmAtext(code) {\n return (\n code === 43 ||\n code === 45 ||\n code === 46 ||\n code === 95 ||\n asciiAlphanumeric(code)\n )\n}\n\n/**\n * @param {Array} events\n * @returns {boolean}\n */\nfunction previousUnbalanced(events) {\n let index = events.length\n let result = false\n while (index--) {\n const token = events[index][1]\n if (\n (token.type === 'labelLink' || token.type === 'labelImage') &&\n !token._balanced\n ) {\n result = true\n break\n }\n\n // If we’ve seen this token, and it was marked as not having any unbalanced\n // bracket before it, we can exit.\n if (token._gfmAutolinkLiteralWalkedInto) {\n result = false\n break\n }\n }\n if (events.length > 0 && !result) {\n // Mark the last token as “walked into” w/o finding\n // anything.\n events[events.length - 1][1]._gfmAutolinkLiteralWalkedInto = true\n }\n return result\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Effects} Effects\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenType} TokenType\n */\n\nimport {markdownSpace} from 'micromark-util-character'\n\n// To do: implement `spaceOrTab`, `spaceOrTabMinMax`, `spaceOrTabWithOptions`.\n\n/**\n * Parse spaces and tabs.\n *\n * There is no `nok` parameter:\n *\n * * spaces in markdown are often optional, in which case this factory can be\n * used and `ok` will be switched to whether spaces were found or not\n * * one line ending or space can be detected with `markdownSpace(code)` right\n * before using `factorySpace`\n *\n * ###### Examples\n *\n * Where `␉` represents a tab (plus how much it expands) and `␠` represents a\n * single space.\n *\n * ```markdown\n * ␉\n * ␠␠␠␠\n * ␉␠\n * ```\n *\n * @param {Effects} effects\n * Context.\n * @param {State} ok\n * State switched to when successful.\n * @param {TokenType} type\n * Type (`' \\t'`).\n * @param {number | undefined} [max=Infinity]\n * Max (exclusive).\n * @returns\n * Start state.\n */\nexport function factorySpace(effects, ok, type, max) {\n const limit = max ? max - 1 : Number.POSITIVE_INFINITY\n let size = 0\n return start\n\n /** @type {State} */\n function start(code) {\n if (markdownSpace(code)) {\n effects.enter(type)\n return prefix(code)\n }\n return ok(code)\n }\n\n /** @type {State} */\n function prefix(code) {\n if (markdownSpace(code) && size++ < limit) {\n effects.consume(code)\n return prefix\n }\n effects.exit(type)\n return ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEnding, markdownSpace} from 'micromark-util-character'\n/** @type {Construct} */\nexport const blankLine = {\n tokenize: tokenizeBlankLine,\n partial: true\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeBlankLine(effects, ok, nok) {\n return start\n\n /**\n * Start of blank line.\n *\n * > 👉 **Note**: `␠` represents a space character.\n *\n * ```markdown\n * > | ␠␠␊\n * ^\n * > | ␊\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n return markdownSpace(code)\n ? factorySpace(effects, after, 'linePrefix')(code)\n : after(code)\n }\n\n /**\n * At eof/eol, after optional whitespace.\n *\n * > 👉 **Note**: `␠` represents a space character.\n *\n * ```markdown\n * > | ␠␠␊\n * ^\n * > | ␊\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n return code === null || markdownLineEnding(code) ? ok(code) : nok(code)\n }\n}\n","/**\n * Normalize an identifier (as found in references, definitions).\n *\n * Collapses markdown whitespace, trim, and then lower- and uppercase.\n *\n * Some characters are considered “uppercase”, such as U+03F4 (`ϴ`), but if their\n * lowercase counterpart (U+03B8 (`θ`)) is uppercased will result in a different\n * uppercase character (U+0398 (`Θ`)).\n * So, to get a canonical form, we perform both lower- and uppercase.\n *\n * Using uppercase last makes sure keys will never interact with default\n * prototypal values (such as `constructor`): nothing in the prototype of\n * `Object` is uppercase.\n *\n * @param {string} value\n * Identifier to normalize.\n * @returns {string}\n * Normalized identifier.\n */\nexport function normalizeIdentifier(value) {\n return (\n value\n // Collapse markdown whitespace.\n .replace(/[\\t\\n\\r ]+/g, ' ')\n // Trim.\n .replace(/^ | $/g, '')\n // Some characters are considered “uppercase”, but if their lowercase\n // counterpart is uppercased will result in a different uppercase\n // character.\n // Hence, to get that form, we perform both lower- and uppercase.\n // Upper case makes sure keys will not interact with default prototypal\n // methods: no method is uppercase.\n .toLowerCase()\n .toUpperCase()\n )\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Exiter} Exiter\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {blankLine} from 'micromark-core-commonmark'\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEndingOrSpace} from 'micromark-util-character'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nconst indent = {\n tokenize: tokenizeIndent,\n partial: true\n}\n\n// To do: micromark should support a `_hiddenGfmFootnoteSupport`, which only\n// affects label start (image).\n// That will let us drop `tokenizePotentialGfmFootnote*`.\n// It currently has a `_hiddenFootnoteSupport`, which affects that and more.\n// That can be removed when `micromark-extension-footnote` is archived.\n\n/**\n * Create an extension for `micromark` to enable GFM footnote syntax.\n *\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions` to\n * enable GFM footnote syntax.\n */\nexport function gfmFootnote() {\n /** @type {Extension} */\n return {\n document: {\n [91]: {\n tokenize: tokenizeDefinitionStart,\n continuation: {\n tokenize: tokenizeDefinitionContinuation\n },\n exit: gfmFootnoteDefinitionEnd\n }\n },\n text: {\n [91]: {\n tokenize: tokenizeGfmFootnoteCall\n },\n [93]: {\n add: 'after',\n tokenize: tokenizePotentialGfmFootnoteCall,\n resolveTo: resolveToPotentialGfmFootnoteCall\n }\n }\n }\n}\n\n// To do: remove after micromark update.\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizePotentialGfmFootnoteCall(effects, ok, nok) {\n const self = this\n let index = self.events.length\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n /** @type {Token} */\n let labelStart\n\n // Find an opening.\n while (index--) {\n const token = self.events[index][1]\n if (token.type === 'labelImage') {\n labelStart = token\n break\n }\n\n // Exit if we’ve walked far enough.\n if (\n token.type === 'gfmFootnoteCall' ||\n token.type === 'labelLink' ||\n token.type === 'label' ||\n token.type === 'image' ||\n token.type === 'link'\n ) {\n break\n }\n }\n return start\n\n /**\n * @type {State}\n */\n function start(code) {\n if (!labelStart || !labelStart._balanced) {\n return nok(code)\n }\n const id = normalizeIdentifier(\n self.sliceSerialize({\n start: labelStart.end,\n end: self.now()\n })\n )\n if (id.codePointAt(0) !== 94 || !defined.includes(id.slice(1))) {\n return nok(code)\n }\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n return ok(code)\n }\n}\n\n// To do: remove after micromark update.\n/** @type {Resolver} */\nfunction resolveToPotentialGfmFootnoteCall(events, context) {\n let index = events.length\n /** @type {Token | undefined} */\n let labelStart\n\n // Find an opening.\n while (index--) {\n if (\n events[index][1].type === 'labelImage' &&\n events[index][0] === 'enter'\n ) {\n labelStart = events[index][1]\n break\n }\n }\n // Change the `labelImageMarker` to a `data`.\n events[index + 1][1].type = 'data'\n events[index + 3][1].type = 'gfmFootnoteCallLabelMarker'\n\n // The whole (without `!`):\n /** @type {Token} */\n const call = {\n type: 'gfmFootnoteCall',\n start: Object.assign({}, events[index + 3][1].start),\n end: Object.assign({}, events[events.length - 1][1].end)\n }\n // The `^` marker\n /** @type {Token} */\n const marker = {\n type: 'gfmFootnoteCallMarker',\n start: Object.assign({}, events[index + 3][1].end),\n end: Object.assign({}, events[index + 3][1].end)\n }\n // Increment the end 1 character.\n marker.end.column++\n marker.end.offset++\n marker.end._bufferIndex++\n /** @type {Token} */\n const string = {\n type: 'gfmFootnoteCallString',\n start: Object.assign({}, marker.end),\n end: Object.assign({}, events[events.length - 1][1].start)\n }\n /** @type {Token} */\n const chunk = {\n type: 'chunkString',\n contentType: 'string',\n start: Object.assign({}, string.start),\n end: Object.assign({}, string.end)\n }\n\n /** @type {Array} */\n const replacement = [\n // Take the `labelImageMarker` (now `data`, the `!`)\n events[index + 1],\n events[index + 2],\n ['enter', call, context],\n // The `[`\n events[index + 3],\n events[index + 4],\n // The `^`.\n ['enter', marker, context],\n ['exit', marker, context],\n // Everything in between.\n ['enter', string, context],\n ['enter', chunk, context],\n ['exit', chunk, context],\n ['exit', string, context],\n // The ending (`]`, properly parsed and labelled).\n events[events.length - 2],\n events[events.length - 1],\n ['exit', call, context]\n ]\n events.splice(index, events.length - index + 1, ...replacement)\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeGfmFootnoteCall(effects, ok, nok) {\n const self = this\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n let size = 0\n /** @type {boolean} */\n let data\n\n // Note: the implementation of `markdown-rs` is different, because it houses\n // core *and* extensions in one project.\n // Therefore, it can include footnote logic inside `label-end`.\n // We can’t do that, but luckily, we can parse footnotes in a simpler way than\n // needed for labels.\n return start\n\n /**\n * Start of footnote label.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('gfmFootnoteCall')\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n return callStart\n }\n\n /**\n * After `[`, at `^`.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function callStart(code) {\n if (code !== 94) return nok(code)\n effects.enter('gfmFootnoteCallMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallMarker')\n effects.enter('gfmFootnoteCallString')\n effects.enter('chunkString').contentType = 'string'\n return callData\n }\n\n /**\n * In label.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function callData(code) {\n if (\n // Too long.\n size > 999 ||\n // Closing brace with nothing.\n (code === 93 && !data) ||\n // Space or tab is not supported by GFM for some reason.\n // `\\n` and `[` not being supported makes sense.\n code === null ||\n code === 91 ||\n markdownLineEndingOrSpace(code)\n ) {\n return nok(code)\n }\n if (code === 93) {\n effects.exit('chunkString')\n const token = effects.exit('gfmFootnoteCallString')\n if (!defined.includes(normalizeIdentifier(self.sliceSerialize(token)))) {\n return nok(code)\n }\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n effects.exit('gfmFootnoteCall')\n return ok\n }\n if (!markdownLineEndingOrSpace(code)) {\n data = true\n }\n size++\n effects.consume(code)\n return code === 92 ? callEscape : callData\n }\n\n /**\n * On character after escape.\n *\n * ```markdown\n * > | a [^b\\c] d\n * ^\n * ```\n *\n * @type {State}\n */\n function callEscape(code) {\n if (code === 91 || code === 92 || code === 93) {\n effects.consume(code)\n size++\n return callData\n }\n return callData(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDefinitionStart(effects, ok, nok) {\n const self = this\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n /** @type {string} */\n let identifier\n let size = 0\n /** @type {boolean | undefined} */\n let data\n return start\n\n /**\n * Start of GFM footnote definition.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('gfmFootnoteDefinition')._container = true\n effects.enter('gfmFootnoteDefinitionLabel')\n effects.enter('gfmFootnoteDefinitionLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionLabelMarker')\n return labelAtMarker\n }\n\n /**\n * In label, at caret.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelAtMarker(code) {\n if (code === 94) {\n effects.enter('gfmFootnoteDefinitionMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionMarker')\n effects.enter('gfmFootnoteDefinitionLabelString')\n effects.enter('chunkString').contentType = 'string'\n return labelInside\n }\n return nok(code)\n }\n\n /**\n * In label.\n *\n * > 👉 **Note**: `cmark-gfm` prevents whitespace from occurring in footnote\n * > definition labels.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelInside(code) {\n if (\n // Too long.\n size > 999 ||\n // Closing brace with nothing.\n (code === 93 && !data) ||\n // Space or tab is not supported by GFM for some reason.\n // `\\n` and `[` not being supported makes sense.\n code === null ||\n code === 91 ||\n markdownLineEndingOrSpace(code)\n ) {\n return nok(code)\n }\n if (code === 93) {\n effects.exit('chunkString')\n const token = effects.exit('gfmFootnoteDefinitionLabelString')\n identifier = normalizeIdentifier(self.sliceSerialize(token))\n effects.enter('gfmFootnoteDefinitionLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionLabelMarker')\n effects.exit('gfmFootnoteDefinitionLabel')\n return labelAfter\n }\n if (!markdownLineEndingOrSpace(code)) {\n data = true\n }\n size++\n effects.consume(code)\n return code === 92 ? labelEscape : labelInside\n }\n\n /**\n * After `\\`, at a special character.\n *\n * > 👉 **Note**: `cmark-gfm` currently does not support escaped brackets:\n * > \n *\n * ```markdown\n * > | [^a\\*b]: c\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEscape(code) {\n if (code === 91 || code === 92 || code === 93) {\n effects.consume(code)\n size++\n return labelInside\n }\n return labelInside(code)\n }\n\n /**\n * After definition label.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelAfter(code) {\n if (code === 58) {\n effects.enter('definitionMarker')\n effects.consume(code)\n effects.exit('definitionMarker')\n if (!defined.includes(identifier)) {\n defined.push(identifier)\n }\n\n // Any whitespace after the marker is eaten, forming indented code\n // is not possible.\n // No space is also fine, just like a block quote marker.\n return factorySpace(\n effects,\n whitespaceAfter,\n 'gfmFootnoteDefinitionWhitespace'\n )\n }\n return nok(code)\n }\n\n /**\n * After definition prefix.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function whitespaceAfter(code) {\n // `markdown-rs` has a wrapping token for the prefix that is closed here.\n return ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDefinitionContinuation(effects, ok, nok) {\n /// Start of footnote definition continuation.\n ///\n /// ```markdown\n /// | [^a]: b\n /// > | c\n /// ^\n /// ```\n //\n // Either a blank line, which is okay, or an indented thing.\n return effects.check(blankLine, ok, effects.attempt(indent, ok, nok))\n}\n\n/** @type {Exiter} */\nfunction gfmFootnoteDefinitionEnd(effects) {\n effects.exit('gfmFootnoteDefinition')\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeIndent(effects, ok, nok) {\n const self = this\n return factorySpace(\n effects,\n afterPrefix,\n 'gfmFootnoteDefinitionIndent',\n 4 + 1\n )\n\n /**\n * @type {State}\n */\n function afterPrefix(code) {\n const tail = self.events[self.events.length - 1]\n return tail &&\n tail[1].type === 'gfmFootnoteDefinitionIndent' &&\n tail[2].sliceSerialize(tail[1], true).length === 4\n ? ok(code)\n : nok(code)\n }\n}\n","/**\n * Like `Array#splice`, but smarter for giant arrays.\n *\n * `Array#splice` takes all items to be inserted as individual argument which\n * causes a stack overflow in V8 when trying to insert 100k items for instance.\n *\n * Otherwise, this does not return the removed items, and takes `items` as an\n * array instead of rest parameters.\n *\n * @template {unknown} T\n * Item type.\n * @param {Array} list\n * List to operate on.\n * @param {number} start\n * Index to remove/insert at (can be negative).\n * @param {number} remove\n * Number of items to remove.\n * @param {Array} items\n * Items to inject into `list`.\n * @returns {void}\n * Nothing.\n */\nexport function splice(list, start, remove, items) {\n const end = list.length\n let chunkStart = 0\n /** @type {Array} */\n let parameters\n\n // Make start between zero and `end` (included).\n if (start < 0) {\n start = -start > end ? 0 : end + start\n } else {\n start = start > end ? end : start\n }\n remove = remove > 0 ? remove : 0\n\n // No need to chunk the items if there’s only a couple (10k) items.\n if (items.length < 10000) {\n parameters = Array.from(items)\n parameters.unshift(start, remove)\n // @ts-expect-error Hush, it’s fine.\n list.splice(...parameters)\n } else {\n // Delete `remove` items starting from `start`\n if (remove) list.splice(start, remove)\n\n // Insert the items in chunks to not cause stack overflows.\n while (chunkStart < items.length) {\n parameters = items.slice(chunkStart, chunkStart + 10000)\n parameters.unshift(start, 0)\n // @ts-expect-error Hush, it’s fine.\n list.splice(...parameters)\n chunkStart += 10000\n start += 10000\n }\n }\n}\n\n/**\n * Append `items` (an array) at the end of `list` (another array).\n * When `list` was empty, returns `items` instead.\n *\n * This prevents a potentially expensive operation when `list` is empty,\n * and adds items in batches to prevent V8 from hanging.\n *\n * @template {unknown} T\n * Item type.\n * @param {Array} list\n * List to operate on.\n * @param {Array} items\n * Items to add to `list`.\n * @returns {Array}\n * Either `list` or `items`.\n */\nexport function push(list, items) {\n if (list.length > 0) {\n splice(list, list.length, 0, items)\n return list\n }\n return items\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {\n markdownLineEndingOrSpace,\n unicodePunctuation,\n unicodeWhitespace\n} from 'micromark-util-character'\n/**\n * Classify whether a code represents whitespace, punctuation, or something\n * else.\n *\n * Used for attention (emphasis, strong), whose sequences can open or close\n * based on the class of surrounding characters.\n *\n * > 👉 **Note**: eof (`null`) is seen as whitespace.\n *\n * @param {Code} code\n * Code.\n * @returns {typeof constants.characterGroupWhitespace | typeof constants.characterGroupPunctuation | undefined}\n * Group.\n */\nexport function classifyCharacter(code) {\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return 1\n }\n if (unicodePunctuation(code)) {\n return 2\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n */\n\n/**\n * Call all `resolveAll`s.\n *\n * @param {Array<{resolveAll?: Resolver | undefined}>} constructs\n * List of constructs, optionally with `resolveAll`s.\n * @param {Array} events\n * List of events.\n * @param {TokenizeContext} context\n * Context used by `tokenize`.\n * @returns {Array}\n * Changed events.\n */\nexport function resolveAll(constructs, events, context) {\n /** @type {Array} */\n const called = []\n let index = -1\n\n while (++index < constructs.length) {\n const resolve = constructs[index].resolveAll\n\n if (resolve && !called.includes(resolve)) {\n events = resolve(events, context)\n called.push(resolve)\n }\n }\n\n return events\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n *\n * @typedef Options\n * Configuration (optional).\n * @property {boolean} [singleTilde=true]\n * Whether to support strikethrough with a single tilde.\n *\n * Single tildes work on github.com, but are technically prohibited by the\n * GFM spec.\n */\n\nimport {splice} from 'micromark-util-chunked'\nimport {classifyCharacter} from 'micromark-util-classify-character'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/**\n * Create an extension for `micromark` to enable GFM strikethrough syntax.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable GFM strikethrough syntax.\n */\nexport function gfmStrikethrough(options) {\n const options_ = options || {}\n let single = options_.singleTilde\n const tokenizer = {\n tokenize: tokenizeStrikethrough,\n resolveAll: resolveAllStrikethrough\n }\n if (single === null || single === undefined) {\n single = true\n }\n return {\n text: {\n [126]: tokenizer\n },\n insideSpan: {\n null: [tokenizer]\n },\n attentionMarkers: {\n null: [126]\n }\n }\n\n /**\n * Take events and resolve strikethrough.\n *\n * @type {Resolver}\n */\n function resolveAllStrikethrough(events, context) {\n let index = -1\n\n // Walk through all events.\n while (++index < events.length) {\n // Find a token that can close.\n if (\n events[index][0] === 'enter' &&\n events[index][1].type === 'strikethroughSequenceTemporary' &&\n events[index][1]._close\n ) {\n let open = index\n\n // Now walk back to find an opener.\n while (open--) {\n // Find a token that can open the closer.\n if (\n events[open][0] === 'exit' &&\n events[open][1].type === 'strikethroughSequenceTemporary' &&\n events[open][1]._open &&\n // If the sizes are the same:\n events[index][1].end.offset - events[index][1].start.offset ===\n events[open][1].end.offset - events[open][1].start.offset\n ) {\n events[index][1].type = 'strikethroughSequence'\n events[open][1].type = 'strikethroughSequence'\n\n /** @type {Token} */\n const strikethrough = {\n type: 'strikethrough',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[index][1].end)\n }\n\n /** @type {Token} */\n const text = {\n type: 'strikethroughText',\n start: Object.assign({}, events[open][1].end),\n end: Object.assign({}, events[index][1].start)\n }\n\n // Opening.\n /** @type {Array} */\n const nextEvents = [\n ['enter', strikethrough, context],\n ['enter', events[open][1], context],\n ['exit', events[open][1], context],\n ['enter', text, context]\n ]\n const insideSpan = context.parser.constructs.insideSpan.null\n if (insideSpan) {\n // Between.\n splice(\n nextEvents,\n nextEvents.length,\n 0,\n resolveAll(insideSpan, events.slice(open + 1, index), context)\n )\n }\n\n // Closing.\n splice(nextEvents, nextEvents.length, 0, [\n ['exit', text, context],\n ['enter', events[index][1], context],\n ['exit', events[index][1], context],\n ['exit', strikethrough, context]\n ])\n splice(events, open - 1, index - open + 3, nextEvents)\n index = open + nextEvents.length - 2\n break\n }\n }\n }\n }\n index = -1\n while (++index < events.length) {\n if (events[index][1].type === 'strikethroughSequenceTemporary') {\n events[index][1].type = 'data'\n }\n }\n return events\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeStrikethrough(effects, ok, nok) {\n const previous = this.previous\n const events = this.events\n let size = 0\n return start\n\n /** @type {State} */\n function start(code) {\n if (\n previous === 126 &&\n events[events.length - 1][1].type !== 'characterEscape'\n ) {\n return nok(code)\n }\n effects.enter('strikethroughSequenceTemporary')\n return more(code)\n }\n\n /** @type {State} */\n function more(code) {\n const before = classifyCharacter(previous)\n if (code === 126) {\n // If this is the third marker, exit.\n if (size > 1) return nok(code)\n effects.consume(code)\n size++\n return more\n }\n if (size < 2 && !single) return nok(code)\n const token = effects.exit('strikethroughSequenceTemporary')\n const after = classifyCharacter(code)\n token._open = !after || (after === 2 && Boolean(before))\n token._close = !before || (before === 2 && Boolean(after))\n return ok(code)\n }\n }\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Effects} Effects\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenType} TokenType\n */\n\nimport {markdownSpace} from 'micromark-util-character'\n\n// To do: implement `spaceOrTab`, `spaceOrTabMinMax`, `spaceOrTabWithOptions`.\n\n/**\n * Parse spaces and tabs.\n *\n * There is no `nok` parameter:\n *\n * * spaces in markdown are often optional, in which case this factory can be\n * used and `ok` will be switched to whether spaces were found or not\n * * one line ending or space can be detected with `markdownSpace(code)` right\n * before using `factorySpace`\n *\n * ###### Examples\n *\n * Where `␉` represents a tab (plus how much it expands) and `␠` represents a\n * single space.\n *\n * ```markdown\n * ␉\n * ␠␠␠␠\n * ␉␠\n * ```\n *\n * @param {Effects} effects\n * Context.\n * @param {State} ok\n * State switched to when successful.\n * @param {TokenType} type\n * Type (`' \\t'`).\n * @param {number | undefined} [max=Infinity]\n * Max (exclusive).\n * @returns\n * Start state.\n */\nexport function factorySpace(effects, ok, type, max) {\n const limit = max ? max - 1 : Number.POSITIVE_INFINITY\n let size = 0\n return start\n\n /** @type {State} */\n function start(code) {\n if (markdownSpace(code)) {\n effects.enter(type)\n return prefix(code)\n }\n return ok(code)\n }\n\n /** @type {State} */\n function prefix(code) {\n if (markdownSpace(code) && size++ < limit) {\n effects.consume(code)\n return prefix\n }\n effects.exit(type)\n return ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\n// Port of `edit_map.rs` from `markdown-rs`.\n// This should move to `markdown-js` later.\n\n// Deal with several changes in events, batching them together.\n//\n// Preferably, changes should be kept to a minimum.\n// Sometimes, it’s needed to change the list of events, because parsing can be\n// messy, and it helps to expose a cleaner interface of events to the compiler\n// and other users.\n// It can also help to merge many adjacent similar events.\n// And, in other cases, it’s needed to parse subcontent: pass some events\n// through another tokenizer and inject the result.\n\n/**\n * @typedef {[number, number, Array]} Change\n * @typedef {[number, number, number]} Jump\n */\n\n/**\n * Tracks a bunch of edits.\n */\nexport class EditMap {\n /**\n * Create a new edit map.\n */\n constructor() {\n /**\n * Record of changes.\n *\n * @type {Array}\n */\n this.map = []\n }\n\n /**\n * Create an edit: a remove and/or add at a certain place.\n *\n * @param {number} index\n * @param {number} remove\n * @param {Array} add\n * @returns {void}\n */\n add(index, remove, add) {\n addImpl(this, index, remove, add)\n }\n\n // To do: not used here.\n // /**\n // * Create an edit: but insert `add` before existing additions.\n // *\n // * @param {number} index\n // * @param {number} remove\n // * @param {Array} add\n // * @returns {void}\n // */\n // addBefore(index, remove, add) {\n // addImpl(this, index, remove, add, true)\n // }\n\n /**\n * Done, change the events.\n *\n * @param {Array} events\n * @returns {void}\n */\n consume(events) {\n this.map.sort((a, b) => a[0] - b[0])\n\n /* c8 ignore next 3 -- `resolve` is never called without tables, so without edits. */\n if (this.map.length === 0) {\n return\n }\n\n // To do: if links are added in events, like they are in `markdown-rs`,\n // this is needed.\n // // Calculate jumps: where items in the current list move to.\n // /** @type {Array} */\n // const jumps = []\n // let index = 0\n // let addAcc = 0\n // let removeAcc = 0\n // while (index < this.map.length) {\n // const [at, remove, add] = this.map[index]\n // removeAcc += remove\n // addAcc += add.length\n // jumps.push([at, removeAcc, addAcc])\n // index += 1\n // }\n //\n // . shiftLinks(events, jumps)\n\n let index = this.map.length\n /** @type {Array>} */\n const vecs = []\n while (index > 0) {\n index -= 1\n vecs.push(events.slice(this.map[index][0] + this.map[index][1]))\n // eslint-disable-next-line unicorn/no-array-push-push\n vecs.push(this.map[index][2])\n\n // Truncate rest.\n events.length = this.map[index][0]\n }\n vecs.push([...events])\n events.length = 0\n let slice = vecs.pop()\n while (slice) {\n events.push(...slice)\n slice = vecs.pop()\n }\n\n // Truncate everything.\n this.map.length = 0\n }\n}\n\n/**\n * Create an edit.\n *\n * @param {EditMap} editMap\n * @param {number} at\n * @param {number} remove\n * @param {Array} add\n * @returns {void}\n */\nfunction addImpl(editMap, at, remove, add) {\n let index = 0\n\n /* c8 ignore next 3 -- `resolve` is never called without tables, so without edits. */\n if (remove === 0 && add.length === 0) {\n return\n }\n while (index < editMap.map.length) {\n if (editMap.map[index][0] === at) {\n editMap.map[index][1] += remove\n\n // To do: before not used.\n // if (before) {\n // add.push(...editMap.map[index][2])\n // editMap.map[index][2] = add\n // } else {\n editMap.map[index][2].push(...add)\n // }\n\n return\n }\n index += 1\n }\n editMap.map.push([at, remove, add])\n}\n\n// /**\n// * Shift `previous` and `next` links according to `jumps`.\n// *\n// * This fixes links in case there are events removed or added between them.\n// *\n// * @param {Array} events\n// * @param {Array} jumps\n// */\n// function shiftLinks(events, jumps) {\n// let jumpIndex = 0\n// let index = 0\n// let add = 0\n// let rm = 0\n\n// while (index < events.length) {\n// const rmCurr = rm\n\n// while (jumpIndex < jumps.length && jumps[jumpIndex][0] <= index) {\n// add = jumps[jumpIndex][2]\n// rm = jumps[jumpIndex][1]\n// jumpIndex += 1\n// }\n\n// // Ignore items that will be removed.\n// if (rm > rmCurr) {\n// index += rm - rmCurr\n// } else {\n// console.log('to do: links?', add, rmCurr)\n// // ?\n// // if let Some(link) = &events[index].link {\n// // if let Some(next) = link.next {\n// // events[next].link.as_mut().unwrap().previous = Some(index + add - rm);\n// // while jumpIndex < jumps.len() && jumps[jumpIndex].0 <= next {\n// // add = jumps[jumpIndex].2;\n// // rm = jumps[jumpIndex].1;\n// // jumpIndex += 1;\n// // }\n// // events[index].link.as_mut().unwrap().next = Some(next + add - rm);\n// // index = next;\n// // continue;\n// // }\n// // }\n// index += 1\n// }\n// }\n// }\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\n/**\n * @typedef {'left' | 'center' | 'right' | 'none'} Align\n */\n\n/**\n * Figure out the alignment of a GFM table.\n *\n * @param {Array} events\n * @param {number} index\n * @returns {Array}\n */\nexport function gfmTableAlign(events, index) {\n let inDelimiterRow = false\n /** @type {Array} */\n const align = []\n while (index < events.length) {\n const event = events[index]\n if (inDelimiterRow) {\n if (event[0] === 'enter') {\n // Start of alignment value: set a new column.\n // To do: `markdown-rs` uses `tableDelimiterCellValue`.\n if (event[1].type === 'tableContent') {\n align.push(\n events[index + 1][1].type === 'tableDelimiterMarker'\n ? 'left'\n : 'none'\n )\n }\n }\n // Exits:\n // End of alignment value: change the column.\n // To do: `markdown-rs` uses `tableDelimiterCellValue`.\n else if (event[1].type === 'tableContent') {\n if (events[index - 1][1].type === 'tableDelimiterMarker') {\n const alignIndex = align.length - 1\n align[alignIndex] = align[alignIndex] === 'left' ? 'center' : 'right'\n }\n }\n // Done!\n else if (event[1].type === 'tableDelimiterRow') {\n break\n }\n } else if (event[0] === 'enter' && event[1].type === 'tableDelimiterRow') {\n inDelimiterRow = true\n }\n index += 1\n }\n return align\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Point} Point\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\n/**\n * @typedef {[number, number, number, number]} Range\n * Cell info.\n *\n * @typedef {0 | 1 | 2 | 3} RowKind\n * Where we are: `1` for head row, `2` for delimiter row, `3` for body row.\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n markdownLineEnding,\n markdownLineEndingOrSpace,\n markdownSpace\n} from 'micromark-util-character'\nimport {EditMap} from './edit-map.js'\nimport {gfmTableAlign} from './infer.js'\n\n// To do: next major: expose functions.\n\n/**\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * table syntax.\n *\n * @type {Extension}\n */\nexport const gfmTable = {\n flow: {\n null: {\n tokenize: tokenizeTable,\n resolveAll: resolveTable\n }\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTable(effects, ok, nok) {\n const self = this\n let size = 0\n let sizeB = 0\n /** @type {boolean | undefined} */\n let seen\n return start\n\n /**\n * Start of a GFM table.\n *\n * If there is a valid table row or table head before, then we try to parse\n * another row.\n * Otherwise, we try to parse a head.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * > | | b |\n * ^\n * ```\n * @type {State}\n */\n function start(code) {\n let index = self.events.length - 1\n while (index > -1) {\n const type = self.events[index][1].type\n if (\n type === 'lineEnding' ||\n // Note: markdown-rs uses `whitespace` instead of `linePrefix`\n type === 'linePrefix'\n )\n index--\n else break\n }\n const tail = index > -1 ? self.events[index][1].type : null\n const next =\n tail === 'tableHead' || tail === 'tableRow' ? bodyRowStart : headRowBefore\n\n // Don’t allow lazy body rows.\n if (next === bodyRowStart && self.parser.lazy[self.now().line]) {\n return nok(code)\n }\n return next(code)\n }\n\n /**\n * Before table head row.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowBefore(code) {\n effects.enter('tableHead')\n effects.enter('tableRow')\n return headRowStart(code)\n }\n\n /**\n * Before table head row, after whitespace.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowStart(code) {\n if (code === 124) {\n return headRowBreak(code)\n }\n\n // To do: micromark-js should let us parse our own whitespace in extensions,\n // like `markdown-rs`:\n //\n // ```js\n // // 4+ spaces.\n // if (markdownSpace(code)) {\n // return nok(code)\n // }\n // ```\n\n seen = true\n // Count the first character, that isn’t a pipe, double.\n sizeB += 1\n return headRowBreak(code)\n }\n\n /**\n * At break in table head row.\n *\n * ```markdown\n * > | | a |\n * ^\n * ^\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowBreak(code) {\n if (code === null) {\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n if (markdownLineEnding(code)) {\n // If anything other than one pipe (ignoring whitespace) was used, it’s fine.\n if (sizeB > 1) {\n sizeB = 0\n // To do: check if this works.\n // Feel free to interrupt:\n self.interrupt = true\n effects.exit('tableRow')\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return headDelimiterStart\n }\n\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n if (markdownSpace(code)) {\n // To do: check if this is fine.\n // effects.attempt(State::Next(StateName::GfmTableHeadRowBreak), State::Nok)\n // State::Retry(space_or_tab(tokenizer))\n return factorySpace(effects, headRowBreak, 'whitespace')(code)\n }\n sizeB += 1\n if (seen) {\n seen = false\n // Header cell count.\n size += 1\n }\n if (code === 124) {\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n // Whether a delimiter was seen.\n seen = true\n return headRowBreak\n }\n\n // Anything else is cell data.\n effects.enter('data')\n return headRowData(code)\n }\n\n /**\n * In table head row data.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowData(code) {\n if (code === null || code === 124 || markdownLineEndingOrSpace(code)) {\n effects.exit('data')\n return headRowBreak(code)\n }\n effects.consume(code)\n return code === 92 ? headRowEscape : headRowData\n }\n\n /**\n * In table head row escape.\n *\n * ```markdown\n * > | | a\\-b |\n * ^\n * | | ---- |\n * | | c |\n * ```\n *\n * @type {State}\n */\n function headRowEscape(code) {\n if (code === 92 || code === 124) {\n effects.consume(code)\n return headRowData\n }\n return headRowData(code)\n }\n\n /**\n * Before delimiter row.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headDelimiterStart(code) {\n // Reset `interrupt`.\n self.interrupt = false\n\n // Note: in `markdown-rs`, we need to handle piercing here too.\n if (self.parser.lazy[self.now().line]) {\n return nok(code)\n }\n effects.enter('tableDelimiterRow')\n // Track if we’ve seen a `:` or `|`.\n seen = false\n if (markdownSpace(code)) {\n return factorySpace(\n effects,\n headDelimiterBefore,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n }\n return headDelimiterBefore(code)\n }\n\n /**\n * Before delimiter row, after optional whitespace.\n *\n * Reused when a `|` is found later, to parse another cell.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headDelimiterBefore(code) {\n if (code === 45 || code === 58) {\n return headDelimiterValueBefore(code)\n }\n if (code === 124) {\n seen = true\n // If we start with a pipe, we open a cell marker.\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n return headDelimiterCellBefore\n }\n\n // More whitespace / empty row not allowed at start.\n return headDelimiterNok(code)\n }\n\n /**\n * After `|`, before delimiter cell.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterCellBefore(code) {\n if (markdownSpace(code)) {\n return factorySpace(effects, headDelimiterValueBefore, 'whitespace')(code)\n }\n return headDelimiterValueBefore(code)\n }\n\n /**\n * Before delimiter cell value.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterValueBefore(code) {\n // Align: left.\n if (code === 58) {\n sizeB += 1\n seen = true\n effects.enter('tableDelimiterMarker')\n effects.consume(code)\n effects.exit('tableDelimiterMarker')\n return headDelimiterLeftAlignmentAfter\n }\n\n // Align: none.\n if (code === 45) {\n sizeB += 1\n // To do: seems weird that this *isn’t* left aligned, but that state is used?\n return headDelimiterLeftAlignmentAfter(code)\n }\n if (code === null || markdownLineEnding(code)) {\n return headDelimiterCellAfter(code)\n }\n return headDelimiterNok(code)\n }\n\n /**\n * After delimiter cell left alignment marker.\n *\n * ```markdown\n * | | a |\n * > | | :- |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterLeftAlignmentAfter(code) {\n if (code === 45) {\n effects.enter('tableDelimiterFiller')\n return headDelimiterFiller(code)\n }\n\n // Anything else is not ok after the left-align colon.\n return headDelimiterNok(code)\n }\n\n /**\n * In delimiter cell filler.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterFiller(code) {\n if (code === 45) {\n effects.consume(code)\n return headDelimiterFiller\n }\n\n // Align is `center` if it was `left`, `right` otherwise.\n if (code === 58) {\n seen = true\n effects.exit('tableDelimiterFiller')\n effects.enter('tableDelimiterMarker')\n effects.consume(code)\n effects.exit('tableDelimiterMarker')\n return headDelimiterRightAlignmentAfter\n }\n effects.exit('tableDelimiterFiller')\n return headDelimiterRightAlignmentAfter(code)\n }\n\n /**\n * After delimiter cell right alignment marker.\n *\n * ```markdown\n * | | a |\n * > | | -: |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterRightAlignmentAfter(code) {\n if (markdownSpace(code)) {\n return factorySpace(effects, headDelimiterCellAfter, 'whitespace')(code)\n }\n return headDelimiterCellAfter(code)\n }\n\n /**\n * After delimiter cell.\n *\n * ```markdown\n * | | a |\n * > | | -: |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterCellAfter(code) {\n if (code === 124) {\n return headDelimiterBefore(code)\n }\n if (code === null || markdownLineEnding(code)) {\n // Exit when:\n // * there was no `:` or `|` at all (it’s a thematic break or setext\n // underline instead)\n // * the header cell count is not the delimiter cell count\n if (!seen || size !== sizeB) {\n return headDelimiterNok(code)\n }\n\n // Note: in markdown-rs`, a reset is needed here.\n effects.exit('tableDelimiterRow')\n effects.exit('tableHead')\n // To do: in `markdown-rs`, resolvers need to be registered manually.\n // effects.register_resolver(ResolveName::GfmTable)\n return ok(code)\n }\n return headDelimiterNok(code)\n }\n\n /**\n * In delimiter row, at a disallowed byte.\n *\n * ```markdown\n * | | a |\n * > | | x |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterNok(code) {\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n\n /**\n * Before table body row.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowStart(code) {\n // Note: in `markdown-rs` we need to manually take care of a prefix,\n // but in `micromark-js` that is done for us, so if we’re here, we’re\n // never at whitespace.\n effects.enter('tableRow')\n return bodyRowBreak(code)\n }\n\n /**\n * At break in table body row.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ^\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowBreak(code) {\n if (code === 124) {\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n return bodyRowBreak\n }\n if (code === null || markdownLineEnding(code)) {\n effects.exit('tableRow')\n return ok(code)\n }\n if (markdownSpace(code)) {\n return factorySpace(effects, bodyRowBreak, 'whitespace')(code)\n }\n\n // Anything else is cell content.\n effects.enter('data')\n return bodyRowData(code)\n }\n\n /**\n * In table body row data.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowData(code) {\n if (code === null || code === 124 || markdownLineEndingOrSpace(code)) {\n effects.exit('data')\n return bodyRowBreak(code)\n }\n effects.consume(code)\n return code === 92 ? bodyRowEscape : bodyRowData\n }\n\n /**\n * In table body row escape.\n *\n * ```markdown\n * | | a |\n * | | ---- |\n * > | | b\\-c |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowEscape(code) {\n if (code === 92 || code === 124) {\n effects.consume(code)\n return bodyRowData\n }\n return bodyRowData(code)\n }\n}\n\n/** @type {Resolver} */\n// eslint-disable-next-line complexity\nfunction resolveTable(events, context) {\n let index = -1\n let inFirstCellAwaitingPipe = true\n /** @type {RowKind} */\n let rowKind = 0\n /** @type {Range} */\n let lastCell = [0, 0, 0, 0]\n /** @type {Range} */\n let cell = [0, 0, 0, 0]\n let afterHeadAwaitingFirstBodyRow = false\n let lastTableEnd = 0\n /** @type {Token | undefined} */\n let currentTable\n /** @type {Token | undefined} */\n let currentBody\n /** @type {Token | undefined} */\n let currentCell\n const map = new EditMap()\n while (++index < events.length) {\n const event = events[index]\n const token = event[1]\n if (event[0] === 'enter') {\n // Start of head.\n if (token.type === 'tableHead') {\n afterHeadAwaitingFirstBodyRow = false\n\n // Inject previous (body end and) table end.\n if (lastTableEnd !== 0) {\n flushTableEnd(map, context, lastTableEnd, currentTable, currentBody)\n currentBody = undefined\n lastTableEnd = 0\n }\n\n // Inject table start.\n currentTable = {\n type: 'table',\n start: Object.assign({}, token.start),\n // Note: correct end is set later.\n end: Object.assign({}, token.end)\n }\n map.add(index, 0, [['enter', currentTable, context]])\n } else if (\n token.type === 'tableRow' ||\n token.type === 'tableDelimiterRow'\n ) {\n inFirstCellAwaitingPipe = true\n currentCell = undefined\n lastCell = [0, 0, 0, 0]\n cell = [0, index + 1, 0, 0]\n\n // Inject table body start.\n if (afterHeadAwaitingFirstBodyRow) {\n afterHeadAwaitingFirstBodyRow = false\n currentBody = {\n type: 'tableBody',\n start: Object.assign({}, token.start),\n // Note: correct end is set later.\n end: Object.assign({}, token.end)\n }\n map.add(index, 0, [['enter', currentBody, context]])\n }\n rowKind = token.type === 'tableDelimiterRow' ? 2 : currentBody ? 3 : 1\n }\n // Cell data.\n else if (\n rowKind &&\n (token.type === 'data' ||\n token.type === 'tableDelimiterMarker' ||\n token.type === 'tableDelimiterFiller')\n ) {\n inFirstCellAwaitingPipe = false\n\n // First value in cell.\n if (cell[2] === 0) {\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n undefined,\n currentCell\n )\n lastCell = [0, 0, 0, 0]\n }\n cell[2] = index\n }\n } else if (token.type === 'tableCellDivider') {\n if (inFirstCellAwaitingPipe) {\n inFirstCellAwaitingPipe = false\n } else {\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n undefined,\n currentCell\n )\n }\n lastCell = cell\n cell = [lastCell[1], index, 0, 0]\n }\n }\n }\n // Exit events.\n else if (token.type === 'tableHead') {\n afterHeadAwaitingFirstBodyRow = true\n lastTableEnd = index\n } else if (\n token.type === 'tableRow' ||\n token.type === 'tableDelimiterRow'\n ) {\n lastTableEnd = index\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n index,\n currentCell\n )\n } else if (cell[1] !== 0) {\n currentCell = flushCell(map, context, cell, rowKind, index, currentCell)\n }\n rowKind = 0\n } else if (\n rowKind &&\n (token.type === 'data' ||\n token.type === 'tableDelimiterMarker' ||\n token.type === 'tableDelimiterFiller')\n ) {\n cell[3] = index\n }\n }\n if (lastTableEnd !== 0) {\n flushTableEnd(map, context, lastTableEnd, currentTable, currentBody)\n }\n map.consume(context.events)\n\n // To do: move this into `html`, when events are exposed there.\n // That’s what `markdown-rs` does.\n // That needs updates to `mdast-util-gfm-table`.\n index = -1\n while (++index < context.events.length) {\n const event = context.events[index]\n if (event[0] === 'enter' && event[1].type === 'table') {\n event[1]._align = gfmTableAlign(context.events, index)\n }\n }\n return events\n}\n\n/// Generate a cell.\n/**\n *\n * @param {EditMap} map\n * @param {TokenizeContext} context\n * @param {Range} range\n * @param {RowKind} rowKind\n * @param {number | undefined} rowEnd\n * @param {Token | undefined} previousCell\n * @returns {Token | undefined}\n */\n// eslint-disable-next-line max-params\nfunction flushCell(map, context, range, rowKind, rowEnd, previousCell) {\n // `markdown-rs` uses:\n // rowKind === 2 ? 'tableDelimiterCell' : 'tableCell'\n const groupName =\n rowKind === 1\n ? 'tableHeader'\n : rowKind === 2\n ? 'tableDelimiter'\n : 'tableData'\n // `markdown-rs` uses:\n // rowKind === 2 ? 'tableDelimiterCellValue' : 'tableCellText'\n const valueName = 'tableContent'\n\n // Insert an exit for the previous cell, if there is one.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- exit\n // ^^^^-- this cell\n // ```\n if (range[0] !== 0) {\n previousCell.end = Object.assign({}, getPoint(context.events, range[0]))\n map.add(range[0], 0, [['exit', previousCell, context]])\n }\n\n // Insert enter of this cell.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- enter\n // ^^^^-- this cell\n // ```\n const now = getPoint(context.events, range[1])\n previousCell = {\n type: groupName,\n start: Object.assign({}, now),\n // Note: correct end is set later.\n end: Object.assign({}, now)\n }\n map.add(range[1], 0, [['enter', previousCell, context]])\n\n // Insert text start at first data start and end at last data end, and\n // remove events between.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- enter\n // ^-- exit\n // ^^^^-- this cell\n // ```\n if (range[2] !== 0) {\n const relatedStart = getPoint(context.events, range[2])\n const relatedEnd = getPoint(context.events, range[3])\n /** @type {Token} */\n const valueToken = {\n type: valueName,\n start: Object.assign({}, relatedStart),\n end: Object.assign({}, relatedEnd)\n }\n map.add(range[2], 0, [['enter', valueToken, context]])\n if (rowKind !== 2) {\n // Fix positional info on remaining events\n const start = context.events[range[2]]\n const end = context.events[range[3]]\n start[1].end = Object.assign({}, end[1].end)\n start[1].type = 'chunkText'\n start[1].contentType = 'text'\n\n // Remove if needed.\n if (range[3] > range[2] + 1) {\n const a = range[2] + 1\n const b = range[3] - range[2] - 1\n map.add(a, b, [])\n }\n }\n map.add(range[3] + 1, 0, [['exit', valueToken, context]])\n }\n\n // Insert an exit for the last cell, if at the row end.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- exit\n // ^^^^^^-- this cell (the last one contains two “between” parts)\n // ```\n if (rowEnd !== undefined) {\n previousCell.end = Object.assign({}, getPoint(context.events, rowEnd))\n map.add(rowEnd, 0, [['exit', previousCell, context]])\n previousCell = undefined\n }\n return previousCell\n}\n\n/**\n * Generate table end (and table body end).\n *\n * @param {EditMap} map\n * @param {TokenizeContext} context\n * @param {number} index\n * @param {Token} table\n * @param {Token | undefined} tableBody\n */\n// eslint-disable-next-line max-params\nfunction flushTableEnd(map, context, index, table, tableBody) {\n /** @type {Array} */\n const exits = []\n const related = getPoint(context.events, index)\n if (tableBody) {\n tableBody.end = Object.assign({}, related)\n exits.push(['exit', tableBody, context])\n }\n table.end = Object.assign({}, related)\n exits.push(['exit', table, context])\n map.add(index + 1, 0, exits)\n}\n\n/**\n * @param {Array} events\n * @param {number} index\n * @returns {readonly Point}\n */\nfunction getPoint(events, index) {\n const event = events[index]\n const side = event[0] === 'enter' ? 'start' : 'end'\n return event[1][side]\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Effects} Effects\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenType} TokenType\n */\n\nimport {markdownSpace} from 'micromark-util-character'\n\n// To do: implement `spaceOrTab`, `spaceOrTabMinMax`, `spaceOrTabWithOptions`.\n\n/**\n * Parse spaces and tabs.\n *\n * There is no `nok` parameter:\n *\n * * spaces in markdown are often optional, in which case this factory can be\n * used and `ok` will be switched to whether spaces were found or not\n * * one line ending or space can be detected with `markdownSpace(code)` right\n * before using `factorySpace`\n *\n * ###### Examples\n *\n * Where `␉` represents a tab (plus how much it expands) and `␠` represents a\n * single space.\n *\n * ```markdown\n * ␉\n * ␠␠␠␠\n * ␉␠\n * ```\n *\n * @param {Effects} effects\n * Context.\n * @param {State} ok\n * State switched to when successful.\n * @param {TokenType} type\n * Type (`' \\t'`).\n * @param {number | undefined} [max=Infinity]\n * Max (exclusive).\n * @returns\n * Start state.\n */\nexport function factorySpace(effects, ok, type, max) {\n const limit = max ? max - 1 : Number.POSITIVE_INFINITY\n let size = 0\n return start\n\n /** @type {State} */\n function start(code) {\n if (markdownSpace(code)) {\n effects.enter(type)\n return prefix(code)\n }\n return ok(code)\n }\n\n /** @type {State} */\n function prefix(code) {\n if (markdownSpace(code) && size++ < limit) {\n effects.consume(code)\n return prefix\n }\n effects.exit(type)\n return ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n markdownLineEndingOrSpace,\n markdownLineEnding,\n markdownSpace\n} from 'micromark-util-character'\nconst tasklistCheck = {\n tokenize: tokenizeTasklistCheck\n}\n\n// To do: next major: expose function to make extension.\n\n/**\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable GFM task list items syntax.\n *\n * @type {Extension}\n */\nexport const gfmTaskListItem = {\n text: {\n [91]: tasklistCheck\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTasklistCheck(effects, ok, nok) {\n const self = this\n return open\n\n /**\n * At start of task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (\n // Exit if there’s stuff before.\n self.previous !== null ||\n // Exit if not in the first content that is the first child of a list\n // item.\n !self._gfmTasklistFirstContentOfListItem\n ) {\n return nok(code)\n }\n effects.enter('taskListCheck')\n effects.enter('taskListCheckMarker')\n effects.consume(code)\n effects.exit('taskListCheckMarker')\n return inside\n }\n\n /**\n * In task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n // Currently we match how GH works in files.\n // To match how GH works in comments, use `markdownSpace` (`[\\t ]`) instead\n // of `markdownLineEndingOrSpace` (`[\\t\\n\\r ]`).\n if (markdownLineEndingOrSpace(code)) {\n effects.enter('taskListCheckValueUnchecked')\n effects.consume(code)\n effects.exit('taskListCheckValueUnchecked')\n return close\n }\n if (code === 88 || code === 120) {\n effects.enter('taskListCheckValueChecked')\n effects.consume(code)\n effects.exit('taskListCheckValueChecked')\n return close\n }\n return nok(code)\n }\n\n /**\n * At close of task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function close(code) {\n if (code === 93) {\n effects.enter('taskListCheckMarker')\n effects.consume(code)\n effects.exit('taskListCheckMarker')\n effects.exit('taskListCheck')\n return after\n }\n return nok(code)\n }\n\n /**\n * @type {State}\n */\n function after(code) {\n // EOL in paragraph means there must be something else after it.\n if (markdownLineEnding(code)) {\n return ok(code)\n }\n\n // Space or tab?\n // Check what comes after.\n if (markdownSpace(code)) {\n return effects.check(\n {\n tokenize: spaceThenNonSpace\n },\n ok,\n nok\n )(code)\n }\n\n // EOF, or non-whitespace, both wrong.\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction spaceThenNonSpace(effects, ok, nok) {\n return factorySpace(effects, after, 'whitespace')\n\n /**\n * After whitespace, after task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // EOF means there was nothing, so bad.\n // EOL means there’s content after it, so good.\n // Impossible to have more spaces.\n // Anything else is good.\n return code === null ? nok(code) : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-extension-gfm-footnote').HtmlOptions} HtmlOptions\n * @typedef {import('micromark-extension-gfm-strikethrough').Options} Options\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').HtmlExtension} HtmlExtension\n */\n\nimport {\n combineExtensions,\n combineHtmlExtensions\n} from 'micromark-util-combine-extensions'\nimport {\n gfmAutolinkLiteral,\n gfmAutolinkLiteralHtml\n} from 'micromark-extension-gfm-autolink-literal'\nimport {gfmFootnote, gfmFootnoteHtml} from 'micromark-extension-gfm-footnote'\nimport {\n gfmStrikethrough,\n gfmStrikethroughHtml\n} from 'micromark-extension-gfm-strikethrough'\nimport {gfmTable, gfmTableHtml} from 'micromark-extension-gfm-table'\nimport {gfmTagfilterHtml} from 'micromark-extension-gfm-tagfilter'\nimport {\n gfmTaskListItem,\n gfmTaskListItemHtml\n} from 'micromark-extension-gfm-task-list-item'\n\n/**\n * Create an extension for `micromark` to enable GFM syntax.\n *\n * @param {Options | null | undefined} [options]\n * Configuration (optional).\n *\n * Passed to `micromark-extens-gfm-strikethrough`.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * syntax.\n */\nexport function gfm(options) {\n return combineExtensions([\n gfmAutolinkLiteral,\n gfmFootnote(),\n gfmStrikethrough(options),\n gfmTable,\n gfmTaskListItem\n ])\n}\n\n/**\n * Create an extension for `micromark` to support GFM when serializing to HTML.\n *\n * @param {HtmlOptions | null | undefined} [options]\n * Configuration.\n *\n * Passed to `micromark-extens-gfm-footnote`.\n * @returns {HtmlExtension}\n * Extension for `micromark` that can be passed in `htmlExtensions` to\n * support GFM when serializing to HTML.\n */\nexport function gfmHtml(options) {\n return combineHtmlExtensions([\n gfmAutolinkLiteralHtml,\n gfmFootnoteHtml(options),\n gfmStrikethroughHtml,\n gfmTableHtml,\n gfmTagfilterHtml,\n gfmTaskListItemHtml\n ])\n}\n","export default function escapeStringRegexp(string) {\n\tif (typeof string !== 'string') {\n\t\tthrow new TypeError('Expected a string');\n\t}\n\n\t// Escape characters with special meaning either inside or outside character sets.\n\t// Use a simple backslash escape when it’s always valid, and a `\\xnn` escape when the simpler form would be disallowed by Unicode patterns’ stricter grammar.\n\treturn string\n\t\t.replace(/[|\\\\{}()[\\]^$+*?.]/g, '\\\\$&')\n\t\t.replace(/-/g, '\\\\x2d');\n}\n","/**\n * @typedef {import('mdast').Parent} MdastParent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('mdast').Text} Text\n * @typedef {import('unist-util-visit-parents').Test} Test\n * @typedef {import('unist-util-visit-parents').VisitorResult} VisitorResult\n */\n\n/**\n * @typedef {Content | Root} Node\n * @typedef {Extract} Parent\n * @typedef {Exclude} ContentParent\n *\n * @typedef RegExpMatchObject\n * Info on the match.\n * @property {number} index\n * The index of the search at which the result was found.\n * @property {string} input\n * A copy of the search string in the text node.\n * @property {[Root, ...Array, Text]} stack\n * All ancestors of the text node, where the last node is the text itself.\n *\n * @callback ReplaceFunction\n * Callback called when a search matches.\n * @param {...any} parameters\n * The parameters are the result of corresponding search expression:\n *\n * * `value` (`string`) — whole match\n * * `...capture` (`Array`) — matches from regex capture groups\n * * `match` (`RegExpMatchObject`) — info on the match\n * @returns {Array | PhrasingContent | string | false | undefined | null}\n * Thing to replace with.\n *\n * * when `null`, `undefined`, `''`, remove the match\n * * …or when `false`, do not replace at all\n * * …or when `string`, replace with a text node of that value\n * * …or when `Node` or `Array`, replace with those nodes\n *\n * @typedef {string | RegExp} Find\n * Pattern to find.\n *\n * Strings are escaped and then turned into global expressions.\n *\n * @typedef {Array} FindAndReplaceList\n * Several find and replaces, in array form.\n * @typedef {Record} FindAndReplaceSchema\n * Several find and replaces, in object form.\n * @typedef {[Find, Replace]} FindAndReplaceTuple\n * Find and replace in tuple form.\n * @typedef {string | ReplaceFunction} Replace\n * Thing to replace with.\n * @typedef {[RegExp, ReplaceFunction]} Pair\n * Normalized find and replace.\n * @typedef {Array} Pairs\n * All find and replaced.\n *\n * @typedef Options\n * Configuration.\n * @property {Test | null | undefined} [ignore]\n * Test for which nodes to ignore.\n */\n\nimport escape from 'escape-string-regexp'\nimport {visitParents} from 'unist-util-visit-parents'\nimport {convert} from 'unist-util-is'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Find patterns in a tree and replace them.\n *\n * The algorithm searches the tree in *preorder* for complete values in `Text`\n * nodes.\n * Partial matches are not supported.\n *\n * @param tree\n * Tree to change.\n * @param find\n * Patterns to find.\n * @param replace\n * Things to replace with (when `find` is `Find`) or configuration.\n * @param options\n * Configuration (when `find` is not `Find`).\n * @returns\n * Given, modified, tree.\n */\n// To do: next major: remove `find` & `replace` combo, remove schema.\nexport const findAndReplace =\n /**\n * @type {(\n * ((tree: Tree, find: Find, replace?: Replace | null | undefined, options?: Options | null | undefined) => Tree) &\n * ((tree: Tree, schema: FindAndReplaceSchema | FindAndReplaceList, options?: Options | null | undefined) => Tree)\n * )}\n **/\n (\n /**\n * @template {Node} Tree\n * @param {Tree} tree\n * @param {Find | FindAndReplaceSchema | FindAndReplaceList} find\n * @param {Replace | Options | null | undefined} [replace]\n * @param {Options | null | undefined} [options]\n * @returns {Tree}\n */\n function (tree, find, replace, options) {\n /** @type {Options | null | undefined} */\n let settings\n /** @type {FindAndReplaceSchema|FindAndReplaceList} */\n let schema\n\n if (typeof find === 'string' || find instanceof RegExp) {\n // @ts-expect-error don’t expect options twice.\n schema = [[find, replace]]\n settings = options\n } else {\n schema = find\n // @ts-expect-error don’t expect replace twice.\n settings = replace\n }\n\n if (!settings) {\n settings = {}\n }\n\n const ignored = convert(settings.ignore || [])\n const pairs = toPairs(schema)\n let pairIndex = -1\n\n while (++pairIndex < pairs.length) {\n visitParents(tree, 'text', visitor)\n }\n\n // To do next major: don’t return the given tree.\n return tree\n\n /** @type {import('unist-util-visit-parents/complex-types.js').BuildVisitor} */\n function visitor(node, parents) {\n let index = -1\n /** @type {Parent | undefined} */\n let grandparent\n\n while (++index < parents.length) {\n const parent = parents[index]\n\n if (\n ignored(\n parent,\n // @ts-expect-error: TS doesn’t understand but it’s perfect.\n grandparent ? grandparent.children.indexOf(parent) : undefined,\n grandparent\n )\n ) {\n return\n }\n\n grandparent = parent\n }\n\n if (grandparent) {\n return handler(node, parents)\n }\n }\n\n /**\n * Handle a text node which is not in an ignored parent.\n *\n * @param {Text} node\n * Text node.\n * @param {Array} parents\n * Parents.\n * @returns {VisitorResult}\n * Result.\n */\n function handler(node, parents) {\n const parent = parents[parents.length - 1]\n const find = pairs[pairIndex][0]\n const replace = pairs[pairIndex][1]\n let start = 0\n // @ts-expect-error: TS is wrong, some of these children can be text.\n const index = parent.children.indexOf(node)\n let change = false\n /** @type {Array} */\n let nodes = []\n\n find.lastIndex = 0\n\n let match = find.exec(node.value)\n\n while (match) {\n const position = match.index\n /** @type {RegExpMatchObject} */\n const matchObject = {\n index: match.index,\n input: match.input,\n // @ts-expect-error: stack is fine.\n stack: [...parents, node]\n }\n let value = replace(...match, matchObject)\n\n if (typeof value === 'string') {\n value = value.length > 0 ? {type: 'text', value} : undefined\n }\n\n // It wasn’t a match after all.\n if (value !== false) {\n if (start !== position) {\n nodes.push({\n type: 'text',\n value: node.value.slice(start, position)\n })\n }\n\n if (Array.isArray(value)) {\n nodes.push(...value)\n } else if (value) {\n nodes.push(value)\n }\n\n start = position + match[0].length\n change = true\n }\n\n if (!find.global) {\n break\n }\n\n match = find.exec(node.value)\n }\n\n if (change) {\n if (start < node.value.length) {\n nodes.push({type: 'text', value: node.value.slice(start)})\n }\n\n parent.children.splice(index, 1, ...nodes)\n } else {\n nodes = [node]\n }\n\n return index + nodes.length\n }\n }\n )\n\n/**\n * Turn a schema into pairs.\n *\n * @param {FindAndReplaceSchema | FindAndReplaceList} schema\n * Schema.\n * @returns {Pairs}\n * Clean pairs.\n */\nfunction toPairs(schema) {\n /** @type {Pairs} */\n const result = []\n\n if (typeof schema !== 'object') {\n throw new TypeError('Expected array or object as schema')\n }\n\n if (Array.isArray(schema)) {\n let index = -1\n\n while (++index < schema.length) {\n result.push([\n toExpression(schema[index][0]),\n toFunction(schema[index][1])\n ])\n }\n } else {\n /** @type {string} */\n let key\n\n for (key in schema) {\n if (own.call(schema, key)) {\n result.push([toExpression(key), toFunction(schema[key])])\n }\n }\n }\n\n return result\n}\n\n/**\n * Turn a find into an expression.\n *\n * @param {Find} find\n * Find.\n * @returns {RegExp}\n * Expression.\n */\nfunction toExpression(find) {\n return typeof find === 'string' ? new RegExp(escape(find), 'g') : find\n}\n\n/**\n * Turn a replace into a function.\n *\n * @param {Replace} replace\n * Replace.\n * @returns {ReplaceFunction}\n * Function.\n */\nfunction toFunction(replace) {\n return typeof replace === 'function' ? replace : () => replace\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-from-markdown').Transform} FromMarkdownTransform\n *\n * @typedef {import('mdast-util-to-markdown').ConstructName} ConstructName\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n *\n * @typedef {import('mdast-util-find-and-replace').ReplaceFunction} ReplaceFunction\n * @typedef {import('mdast-util-find-and-replace').RegExpMatchObject} RegExpMatchObject\n */\n\nimport {ccount} from 'ccount'\nimport {findAndReplace} from 'mdast-util-find-and-replace'\nimport {unicodePunctuation, unicodeWhitespace} from 'micromark-util-character'\n\n/** @type {ConstructName} */\nconst inConstruct = 'phrasing'\n/** @type {Array} */\nconst notInConstruct = ['autolink', 'link', 'image', 'label']\n\n// To do: next major: expose functions instead of extensions.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM autolink literals.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmAutolinkLiteralFromMarkdown = {\n transforms: [transformGfmAutolinkLiterals],\n enter: {\n literalAutolink: enterLiteralAutolink,\n literalAutolinkEmail: enterLiteralAutolinkValue,\n literalAutolinkHttp: enterLiteralAutolinkValue,\n literalAutolinkWww: enterLiteralAutolinkValue\n },\n exit: {\n literalAutolink: exitLiteralAutolink,\n literalAutolinkEmail: exitLiteralAutolinkEmail,\n literalAutolinkHttp: exitLiteralAutolinkHttp,\n literalAutolinkWww: exitLiteralAutolinkWww\n }\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM autolink literals.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmAutolinkLiteralToMarkdown = {\n unsafe: [\n {\n character: '@',\n before: '[+\\\\-.\\\\w]',\n after: '[\\\\-.\\\\w]',\n inConstruct,\n notInConstruct\n },\n {\n character: '.',\n before: '[Ww]',\n after: '[\\\\-.\\\\w]',\n inConstruct,\n notInConstruct\n },\n {character: ':', before: '[ps]', after: '\\\\/', inConstruct, notInConstruct}\n ]\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterLiteralAutolink(token) {\n this.enter({type: 'link', title: null, url: '', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterLiteralAutolinkValue(token) {\n this.config.enter.autolinkProtocol.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkHttp(token) {\n this.config.exit.autolinkProtocol.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkWww(token) {\n this.config.exit.data.call(this, token)\n const node = /** @type {Link} */ (this.stack[this.stack.length - 1])\n node.url = 'http://' + this.sliceSerialize(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkEmail(token) {\n this.config.exit.autolinkEmail.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolink(token) {\n this.exit(token)\n}\n\n/** @type {FromMarkdownTransform} */\nfunction transformGfmAutolinkLiterals(tree) {\n findAndReplace(\n tree,\n [\n [/(https?:\\/\\/|www(?=\\.))([-.\\w]+)([^ \\t\\r\\n]*)/gi, findUrl],\n [/([-.\\w+]+)@([-\\w]+(?:\\.[-\\w]+)+)/g, findEmail]\n ],\n {ignore: ['link', 'linkReference']}\n )\n}\n\n/**\n * @type {ReplaceFunction}\n * @param {string} _\n * @param {string} protocol\n * @param {string} domain\n * @param {string} path\n * @param {RegExpMatchObject} match\n * @returns {Link | Array | false}\n */\n// eslint-disable-next-line max-params\nfunction findUrl(_, protocol, domain, path, match) {\n let prefix = ''\n\n // Not an expected previous character.\n if (!previous(match)) {\n return false\n }\n\n // Treat `www` as part of the domain.\n if (/^w/i.test(protocol)) {\n domain = protocol + domain\n protocol = ''\n prefix = 'http://'\n }\n\n if (!isCorrectDomain(domain)) {\n return false\n }\n\n const parts = splitUrl(domain + path)\n\n if (!parts[0]) return false\n\n /** @type {Link} */\n const result = {\n type: 'link',\n title: null,\n url: prefix + protocol + parts[0],\n children: [{type: 'text', value: protocol + parts[0]}]\n }\n\n if (parts[1]) {\n return [result, {type: 'text', value: parts[1]}]\n }\n\n return result\n}\n\n/**\n * @type {ReplaceFunction}\n * @param {string} _\n * @param {string} atext\n * @param {string} label\n * @param {RegExpMatchObject} match\n * @returns {Link | false}\n */\nfunction findEmail(_, atext, label, match) {\n if (\n // Not an expected previous character.\n !previous(match, true) ||\n // Label ends in not allowed character.\n /[-\\d_]$/.test(label)\n ) {\n return false\n }\n\n return {\n type: 'link',\n title: null,\n url: 'mailto:' + atext + '@' + label,\n children: [{type: 'text', value: atext + '@' + label}]\n }\n}\n\n/**\n * @param {string} domain\n * @returns {boolean}\n */\nfunction isCorrectDomain(domain) {\n const parts = domain.split('.')\n\n if (\n parts.length < 2 ||\n (parts[parts.length - 1] &&\n (/_/.test(parts[parts.length - 1]) ||\n !/[a-zA-Z\\d]/.test(parts[parts.length - 1]))) ||\n (parts[parts.length - 2] &&\n (/_/.test(parts[parts.length - 2]) ||\n !/[a-zA-Z\\d]/.test(parts[parts.length - 2])))\n ) {\n return false\n }\n\n return true\n}\n\n/**\n * @param {string} url\n * @returns {[string, string | undefined]}\n */\nfunction splitUrl(url) {\n const trailExec = /[!\"&'),.:;<>?\\]}]+$/.exec(url)\n\n if (!trailExec) {\n return [url, undefined]\n }\n\n url = url.slice(0, trailExec.index)\n\n let trail = trailExec[0]\n let closingParenIndex = trail.indexOf(')')\n const openingParens = ccount(url, '(')\n let closingParens = ccount(url, ')')\n\n while (closingParenIndex !== -1 && openingParens > closingParens) {\n url += trail.slice(0, closingParenIndex + 1)\n trail = trail.slice(closingParenIndex + 1)\n closingParenIndex = trail.indexOf(')')\n closingParens++\n }\n\n return [url, trail]\n}\n\n/**\n * @param {RegExpMatchObject} match\n * @param {boolean | null | undefined} [email=false]\n * @returns {boolean}\n */\nfunction previous(match, email) {\n const code = match.input.charCodeAt(match.index - 1)\n\n return (\n (match.index === 0 ||\n unicodeWhitespace(code) ||\n unicodePunctuation(code)) &&\n (!email || code !== 47)\n )\n}\n","/**\n * Normalize an identifier (as found in references, definitions).\n *\n * Collapses markdown whitespace, trim, and then lower- and uppercase.\n *\n * Some characters are considered “uppercase”, such as U+03F4 (`ϴ`), but if their\n * lowercase counterpart (U+03B8 (`θ`)) is uppercased will result in a different\n * uppercase character (U+0398 (`Θ`)).\n * So, to get a canonical form, we perform both lower- and uppercase.\n *\n * Using uppercase last makes sure keys will never interact with default\n * prototypal values (such as `constructor`): nothing in the prototype of\n * `Object` is uppercase.\n *\n * @param {string} value\n * Identifier to normalize.\n * @returns {string}\n * Normalized identifier.\n */\nexport function normalizeIdentifier(value) {\n return (\n value\n // Collapse markdown whitespace.\n .replace(/[\\t\\n\\r ]+/g, ' ')\n // Trim.\n .replace(/^ | $/g, '')\n // Some characters are considered “uppercase”, but if their lowercase\n // counterpart is uppercased will result in a different uppercase\n // character.\n // Hence, to get that form, we perform both lower- and uppercase.\n // Upper case makes sure keys will not interact with default prototypal\n // methods: no method is uppercase.\n .toLowerCase()\n .toUpperCase()\n )\n}\n","/**\n * Turn the number (in string form as either hexa- or plain decimal) coming from\n * a numeric character reference into a character.\n *\n * Sort of like `String.fromCharCode(Number.parseInt(value, base))`, but makes\n * non-characters and control characters safe.\n *\n * @param {string} value\n * Value to decode.\n * @param {number} base\n * Numeric base.\n * @returns {string}\n * Character.\n */\nexport function decodeNumericCharacterReference(value, base) {\n const code = Number.parseInt(value, base)\n if (\n // C0 except for HT, LF, FF, CR, space.\n code < 9 ||\n code === 11 ||\n (code > 13 && code < 32) ||\n // Control character (DEL) of C0, and C1 controls.\n (code > 126 && code < 160) ||\n // Lone high surrogates and low surrogates.\n (code > 55295 && code < 57344) ||\n // Noncharacters.\n (code > 64975 && code < 65008) /* eslint-disable no-bitwise */ ||\n (code & 65535) === 65535 ||\n (code & 65535) === 65534 /* eslint-enable no-bitwise */ ||\n // Out of range\n code > 1114111\n ) {\n return '\\uFFFD'\n }\n return String.fromCharCode(code)\n}\n","import {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nconst characterEscapeOrReference =\n /\\\\([!-/:-@[-`{-~])|&(#(?:\\d{1,7}|x[\\da-f]{1,6})|[\\da-z]{1,31});/gi\n\n/**\n * Decode markdown strings (which occur in places such as fenced code info\n * strings, destinations, labels, and titles).\n *\n * The “string” content type allows character escapes and -references.\n * This decodes those.\n *\n * @param {string} value\n * Value to decode.\n * @returns {string}\n * Decoded value.\n */\nexport function decodeString(value) {\n return value.replace(characterEscapeOrReference, decode)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @param {string} $2\n * @returns {string}\n */\nfunction decode($0, $1, $2) {\n if ($1) {\n // Escape.\n return $1\n }\n\n // Reference.\n const head = $2.charCodeAt(0)\n if (head === 35) {\n const head = $2.charCodeAt(1)\n const hex = head === 120 || head === 88\n return decodeNumericCharacterReference($2.slice(hex ? 2 : 1), hex ? 16 : 10)\n }\n return decodeNamedCharacterReference($2) || $0\n}\n","/**\n * @typedef {import('../types.js').AssociationId} AssociationId\n */\n\nimport {decodeString} from 'micromark-util-decode-string'\n\n/**\n * Get an identifier from an association to match it to others.\n *\n * Associations are nodes that match to something else through an ID:\n * .\n *\n * The `label` of an association is the string value: character escapes and\n * references work, and casing is intact.\n * The `identifier` is used to match one association to another:\n * controversially, character escapes and references don’t work in this\n * matching: `©` does not match `©`, and `\\+` does not match `+`.\n *\n * But casing is ignored (and whitespace) is trimmed and collapsed: ` A\\nb`\n * matches `a b`.\n * So, we do prefer the label when figuring out how we’re going to serialize:\n * it has whitespace, casing, and we can ignore most useless character\n * escapes and all character references.\n *\n * @type {AssociationId}\n */\nexport function association(node) {\n if (node.label || !node.identifier) {\n return node.label || ''\n }\n\n return decodeString(node.identifier)\n}\n","/**\n * @typedef {import('../types.js').FlowContent} FlowContent\n * @typedef {import('../types.js').Node} Node\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').TrackFields} TrackFields\n */\n\n/**\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {TrackFields} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined by (blank) lines.\n */\nexport function containerFlow(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n const tracker = state.createTracker(info)\n /** @type {Array} */\n const results = []\n let index = -1\n\n indexStack.push(-1)\n\n while (++index < children.length) {\n const child = children[index]\n\n indexStack[indexStack.length - 1] = index\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n before: '\\n',\n after: '\\n',\n ...tracker.current()\n })\n )\n )\n\n if (child.type !== 'list') {\n state.bulletLastUsed = undefined\n }\n\n if (index < children.length - 1) {\n results.push(\n tracker.move(between(child, children[index + 1], parent, state))\n )\n }\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n\n/**\n * @param {Node} left\n * @param {Node} right\n * @param {Parent} parent\n * @param {State} state\n * @returns {string}\n */\nfunction between(left, right, parent, state) {\n let index = state.join.length\n\n while (index--) {\n const result = state.join[index](left, right, parent, state)\n\n if (result === true || result === 1) {\n break\n }\n\n if (typeof result === 'number') {\n return '\\n'.repeat(1 + result)\n }\n\n if (result === false) {\n return '\\n\\n\\n\\n'\n }\n }\n\n return '\\n\\n'\n}\n","/**\n * @typedef {import('../types.js').IndentLines} IndentLines\n */\n\nconst eol = /\\r?\\n|\\r/g\n\n/**\n * @type {IndentLines}\n */\nexport function indentLines(value, map) {\n /** @type {Array} */\n const result = []\n let start = 0\n let line = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = eol.exec(value))) {\n one(value.slice(start, match.index))\n result.push(match[0])\n start = match.index + match[0].length\n line++\n }\n\n one(value.slice(start))\n\n return result.join('')\n\n /**\n * @param {string} value\n */\n function one(value) {\n result.push(map(value, line, !value))\n }\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n */\n\n/**\n * @param {Unsafe} pattern\n * @returns {RegExp}\n */\nexport function patternCompile(pattern) {\n if (!pattern._compiled) {\n const before =\n (pattern.atBreak ? '[\\\\r\\\\n][\\\\t ]*' : '') +\n (pattern.before ? '(?:' + pattern.before + ')' : '')\n\n pattern._compiled = new RegExp(\n (before ? '(' + before + ')' : '') +\n (/[|\\\\{}()[\\]^$+*?.-]/.test(pattern.character) ? '\\\\' : '') +\n pattern.character +\n (pattern.after ? '(?:' + pattern.after + ')' : ''),\n 'g'\n )\n }\n\n return pattern._compiled\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n * @typedef {import('../types.js').ConstructName} ConstructName\n */\n\n/**\n * @param {Array} stack\n * @param {Unsafe} pattern\n * @returns {boolean}\n */\nexport function patternInScope(stack, pattern) {\n return (\n listInScope(stack, pattern.inConstruct, true) &&\n !listInScope(stack, pattern.notInConstruct, false)\n )\n}\n\n/**\n * @param {Array} stack\n * @param {Unsafe['inConstruct']} list\n * @param {boolean} none\n * @returns {boolean}\n */\nfunction listInScope(stack, list, none) {\n if (typeof list === 'string') {\n list = [list]\n }\n\n if (!list || list.length === 0) {\n return none\n }\n\n let index = -1\n\n while (++index < list.length) {\n if (stack.includes(list[index])) {\n return true\n }\n }\n\n return false\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').SafeConfig} SafeConfig\n */\n\nimport {patternCompile} from './pattern-compile.js'\nimport {patternInScope} from './pattern-in-scope.js'\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What “constructs” we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @param {State} state\n * Info passed around about the current state.\n * @param {string | null | undefined} input\n * Raw value to make safe.\n * @param {SafeConfig} config\n * Configuration.\n * @returns {string}\n * Serialized markdown safe for embedding.\n */\nexport function safe(state, input, config) {\n const value = (config.before || '') + (input || '') + (config.after || '')\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const result = []\n /** @type {Record} */\n const infos = {}\n let index = -1\n\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n\n if (!patternInScope(state.stack, pattern)) {\n continue\n }\n\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(value))) {\n const before = 'before' in pattern || Boolean(pattern.atBreak)\n const after = 'after' in pattern\n const position = match.index + (before ? match[1].length : 0)\n\n if (positions.includes(position)) {\n if (infos[position].before && !before) {\n infos[position].before = false\n }\n\n if (infos[position].after && !after) {\n infos[position].after = false\n }\n } else {\n positions.push(position)\n infos[position] = {before, after}\n }\n }\n }\n\n positions.sort(numerical)\n\n let start = config.before ? config.before.length : 0\n const end = value.length - (config.after ? config.after.length : 0)\n index = -1\n\n while (++index < positions.length) {\n const position = positions[index]\n\n // Character before or after matched:\n if (position < start || position >= end) {\n continue\n }\n\n // If this character is supposed to be escaped because it has a condition on\n // the next character, and the next character is definitly being escaped,\n // then skip this escape.\n if (\n (position + 1 < end &&\n positions[index + 1] === position + 1 &&\n infos[position].after &&\n !infos[position + 1].before &&\n !infos[position + 1].after) ||\n (positions[index - 1] === position - 1 &&\n infos[position].before &&\n !infos[position - 1].before &&\n !infos[position - 1].after)\n ) {\n continue\n }\n\n if (start !== position) {\n // If we have to use a character reference, an ampersand would be more\n // correct, but as backslashes only care about punctuation, either will\n // do the trick\n result.push(escapeBackslashes(value.slice(start, position), '\\\\'))\n }\n\n start = position\n\n if (\n /[!-/:-@[-`{-~]/.test(value.charAt(position)) &&\n (!config.encode || !config.encode.includes(value.charAt(position)))\n ) {\n // Character escape.\n result.push('\\\\')\n } else {\n // Character reference.\n result.push(\n '&#x' + value.charCodeAt(position).toString(16).toUpperCase() + ';'\n )\n start++\n }\n }\n\n result.push(escapeBackslashes(value.slice(start, end), config.after))\n\n return result.join('')\n}\n\n/**\n * @param {number} a\n * @param {number} b\n * @returns {number}\n */\nfunction numerical(a, b) {\n return a - b\n}\n\n/**\n * @param {string} value\n * @param {string} after\n * @returns {string}\n */\nfunction escapeBackslashes(value, after) {\n const expression = /\\\\(?=[!-/:-@[-`{-~])/g\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const results = []\n const whole = value + after\n let index = -1\n let start = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(whole))) {\n positions.push(match.index)\n }\n\n while (++index < positions.length) {\n if (start !== positions[index]) {\n results.push(value.slice(start, positions[index]))\n }\n\n results.push('\\\\')\n start = positions[index]\n }\n\n results.push(value.slice(start))\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').CreateTracker} CreateTracker\n * @typedef {import('../types.js').TrackCurrent} TrackCurrent\n * @typedef {import('../types.js').TrackMove} TrackMove\n * @typedef {import('../types.js').TrackShift} TrackShift\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n // Defaults are used to prevent crashes when older utilities somehow activate\n // this code.\n /* c8 ignore next 5 */\n const options = config || {}\n const now = options.now || {}\n let lineShift = options.lineShift || 0\n let line = now.line || 1\n let column = now.column || 1\n\n return {move, current, shift}\n\n /**\n * Get the current tracked info.\n *\n * @type {TrackCurrent}\n */\n function current() {\n return {now: {line, column}, lineShift}\n }\n\n /**\n * Define an increased line shift (the typical indent for lines).\n *\n * @type {TrackShift}\n */\n function shift(value) {\n lineShift += value\n }\n\n /**\n * Move past some generated markdown.\n *\n * @type {TrackMove}\n */\n function move(input) {\n // eslint-disable-next-line unicorn/prefer-default-parameters\n const value = input || ''\n const chunks = value.split(/\\r?\\n|\\r/g)\n const tail = chunks[chunks.length - 1]\n line += chunks.length - 1\n column =\n chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n return value\n }\n}\n","/**\n * @typedef {import('mdast').FootnoteReference} FootnoteReference\n * @typedef {import('mdast').FootnoteDefinition} FootnoteDefinition\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Map} Map\n */\n\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {association} from 'mdast-util-to-markdown/lib/util/association.js'\nimport {containerFlow} from 'mdast-util-to-markdown/lib/util/container-flow.js'\nimport {indentLines} from 'mdast-util-to-markdown/lib/util/indent-lines.js'\nimport {safe} from 'mdast-util-to-markdown/lib/util/safe.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\nfootnoteReference.peek = footnoteReferencePeek\n\n// To do: next major: rename `context` -> `state`, `safeOptions` to `info`, use\n// utilities on `state`.\n\n/**\n * Create an extension for `mdast-util-from-markdown` to enable GFM footnotes\n * in markdown.\n *\n * @returns {FromMarkdownExtension}\n * Extension for `mdast-util-from-markdown`.\n */\nexport function gfmFootnoteFromMarkdown() {\n return {\n enter: {\n gfmFootnoteDefinition: enterFootnoteDefinition,\n gfmFootnoteDefinitionLabelString: enterFootnoteDefinitionLabelString,\n gfmFootnoteCall: enterFootnoteCall,\n gfmFootnoteCallString: enterFootnoteCallString\n },\n exit: {\n gfmFootnoteDefinition: exitFootnoteDefinition,\n gfmFootnoteDefinitionLabelString: exitFootnoteDefinitionLabelString,\n gfmFootnoteCall: exitFootnoteCall,\n gfmFootnoteCallString: exitFootnoteCallString\n }\n }\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM footnotes\n * in markdown.\n *\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown`.\n */\nexport function gfmFootnoteToMarkdown() {\n return {\n // This is on by default already.\n unsafe: [{character: '[', inConstruct: ['phrasing', 'label', 'reference']}],\n handlers: {footnoteDefinition, footnoteReference}\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteDefinition(token) {\n this.enter(\n {type: 'footnoteDefinition', identifier: '', label: '', children: []},\n token\n )\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteDefinitionLabelString() {\n this.buffer()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteDefinitionLabelString(token) {\n const label = this.resume()\n const node = /** @type {FootnoteDefinition} */ (\n this.stack[this.stack.length - 1]\n )\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteDefinition(token) {\n this.exit(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteCall(token) {\n this.enter({type: 'footnoteReference', identifier: '', label: ''}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteCallString() {\n this.buffer()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteCallString(token) {\n const label = this.resume()\n const node = /** @type {FootnoteDefinition} */ (\n this.stack[this.stack.length - 1]\n )\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteCall(token) {\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {FootnoteReference} node\n */\nfunction footnoteReference(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n let value = tracker.move('[^')\n const exit = context.enter('footnoteReference')\n const subexit = context.enter('reference')\n value += tracker.move(\n safe(context, association(node), {\n ...tracker.current(),\n before: value,\n after: ']'\n })\n )\n subexit()\n exit()\n value += tracker.move(']')\n return value\n}\n\n/** @type {ToMarkdownHandle} */\nfunction footnoteReferencePeek() {\n return '['\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {FootnoteDefinition} node\n */\nfunction footnoteDefinition(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n let value = tracker.move('[^')\n const exit = context.enter('footnoteDefinition')\n const subexit = context.enter('label')\n value += tracker.move(\n safe(context, association(node), {\n ...tracker.current(),\n before: value,\n after: ']'\n })\n )\n subexit()\n value += tracker.move(\n ']:' + (node.children && node.children.length > 0 ? ' ' : '')\n )\n tracker.shift(4)\n value += tracker.move(\n indentLines(containerFlow(node, context, tracker.current()), map)\n )\n exit()\n\n return value\n}\n\n/** @type {Map} */\nfunction map(line, index, blank) {\n if (index === 0) {\n return line\n }\n\n return (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('../types.js').Handle} Handle\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').PhrasingContent} PhrasingContent\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nexport function containerPhrasing(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n /** @type {Array} */\n const results = []\n let index = -1\n let before = info.before\n\n indexStack.push(-1)\n let tracker = state.createTracker(info)\n\n while (++index < children.length) {\n const child = children[index]\n /** @type {string} */\n let after\n\n indexStack[indexStack.length - 1] = index\n\n if (index + 1 < children.length) {\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n let handle = state.handle.handlers[children[index + 1].type]\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n if (handle && handle.peek) handle = handle.peek\n after = handle\n ? handle(children[index + 1], parent, state, {\n before: '',\n after: '',\n ...tracker.current()\n }).charAt(0)\n : ''\n } else {\n after = info.after\n }\n\n // In some cases, html (text) can be found in phrasing right after an eol.\n // When we’d serialize that, in most cases that would be seen as html\n // (flow).\n // As we can’t escape or so to prevent it from happening, we take a somewhat\n // reasonable approach: replace that eol with a space.\n // See: \n if (\n results.length > 0 &&\n (before === '\\r' || before === '\\n') &&\n child.type === 'html'\n ) {\n results[results.length - 1] = results[results.length - 1].replace(\n /(\\r?\\n|\\r)$/,\n ' '\n )\n before = ' '\n\n // To do: does this work to reset tracker?\n tracker = state.createTracker(info)\n tracker.move(results.join(''))\n }\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n ...tracker.current(),\n before,\n after\n })\n )\n )\n\n before = results[results.length - 1].slice(-1)\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').CreateTracker} CreateTracker\n * @typedef {import('../types.js').TrackCurrent} TrackCurrent\n * @typedef {import('../types.js').TrackMove} TrackMove\n * @typedef {import('../types.js').TrackShift} TrackShift\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n // Defaults are used to prevent crashes when older utilities somehow activate\n // this code.\n /* c8 ignore next 5 */\n const options = config || {}\n const now = options.now || {}\n let lineShift = options.lineShift || 0\n let line = now.line || 1\n let column = now.column || 1\n\n return {move, current, shift}\n\n /**\n * Get the current tracked info.\n *\n * @type {TrackCurrent}\n */\n function current() {\n return {now: {line, column}, lineShift}\n }\n\n /**\n * Define an increased line shift (the typical indent for lines).\n *\n * @type {TrackShift}\n */\n function shift(value) {\n lineShift += value\n }\n\n /**\n * Move past some generated markdown.\n *\n * @type {TrackMove}\n */\n function move(input) {\n // eslint-disable-next-line unicorn/prefer-default-parameters\n const value = input || ''\n const chunks = value.split(/\\r?\\n|\\r/g)\n const tail = chunks[chunks.length - 1]\n line += chunks.length - 1\n column =\n chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n return value\n }\n}\n","/**\n * @typedef {import('mdast').Delete} Delete\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n *\n * @typedef {import('mdast-util-to-markdown').ConstructName} ConstructName\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n */\n\nimport {containerPhrasing} from 'mdast-util-to-markdown/lib/util/container-phrasing.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\n// To do: next major: expose functions.\n// To do: next major: use `state`, state utilities.\n\n/**\n * List of constructs that occur in phrasing (paragraphs, headings), but cannot\n * contain strikethrough.\n * So they sort of cancel each other out.\n * Note: could use a better name.\n *\n * Note: keep in sync with: \n *\n * @type {Array}\n */\nconst constructsWithoutStrikethrough = [\n 'autolink',\n 'destinationLiteral',\n 'destinationRaw',\n 'reference',\n 'titleQuote',\n 'titleApostrophe'\n]\n\nhandleDelete.peek = peekDelete\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM strikethrough.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmStrikethroughFromMarkdown = {\n canContainEols: ['delete'],\n enter: {strikethrough: enterStrikethrough},\n exit: {strikethrough: exitStrikethrough}\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM strikethrough.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmStrikethroughToMarkdown = {\n unsafe: [\n {\n character: '~',\n inConstruct: 'phrasing',\n notInConstruct: constructsWithoutStrikethrough\n }\n ],\n handlers: {delete: handleDelete}\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterStrikethrough(token) {\n this.enter({type: 'delete', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitStrikethrough(token) {\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {Delete} node\n */\nfunction handleDelete(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n const exit = context.enter('strikethrough')\n let value = tracker.move('~~')\n value += containerPhrasing(node, context, {\n ...tracker.current(),\n before: value,\n after: '~'\n })\n value += tracker.move('~~')\n exit()\n return value\n}\n\n/** @type {ToMarkdownHandle} */\nfunction peekDelete() {\n return '~'\n}\n","/**\n * @typedef {import('../types.js').Handle} Handle\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').PhrasingContent} PhrasingContent\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nexport function containerPhrasing(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n /** @type {Array} */\n const results = []\n let index = -1\n let before = info.before\n\n indexStack.push(-1)\n let tracker = state.createTracker(info)\n\n while (++index < children.length) {\n const child = children[index]\n /** @type {string} */\n let after\n\n indexStack[indexStack.length - 1] = index\n\n if (index + 1 < children.length) {\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n let handle = state.handle.handlers[children[index + 1].type]\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n if (handle && handle.peek) handle = handle.peek\n after = handle\n ? handle(children[index + 1], parent, state, {\n before: '',\n after: '',\n ...tracker.current()\n }).charAt(0)\n : ''\n } else {\n after = info.after\n }\n\n // In some cases, html (text) can be found in phrasing right after an eol.\n // When we’d serialize that, in most cases that would be seen as html\n // (flow).\n // As we can’t escape or so to prevent it from happening, we take a somewhat\n // reasonable approach: replace that eol with a space.\n // See: \n if (\n results.length > 0 &&\n (before === '\\r' || before === '\\n') &&\n child.type === 'html'\n ) {\n results[results.length - 1] = results[results.length - 1].replace(\n /(\\r?\\n|\\r)$/,\n ' '\n )\n before = ' '\n\n // To do: does this work to reset tracker?\n tracker = state.createTracker(info)\n tracker.move(results.join(''))\n }\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n ...tracker.current(),\n before,\n after\n })\n )\n )\n\n before = results[results.length - 1].slice(-1)\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n */\n\n/**\n * @param {Unsafe} pattern\n * @returns {RegExp}\n */\nexport function patternCompile(pattern) {\n if (!pattern._compiled) {\n const before =\n (pattern.atBreak ? '[\\\\r\\\\n][\\\\t ]*' : '') +\n (pattern.before ? '(?:' + pattern.before + ')' : '')\n\n pattern._compiled = new RegExp(\n (before ? '(' + before + ')' : '') +\n (/[|\\\\{}()[\\]^$+*?.-]/.test(pattern.character) ? '\\\\' : '') +\n pattern.character +\n (pattern.after ? '(?:' + pattern.after + ')' : ''),\n 'g'\n )\n }\n\n return pattern._compiled\n}\n","/**\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n */\n\nimport {patternCompile} from '../util/pattern-compile.js'\n\ninlineCode.peek = inlineCodePeek\n\n/**\n * @param {InlineCode} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @returns {string}\n */\nexport function inlineCode(node, _, state) {\n let value = node.value || ''\n let sequence = '`'\n let index = -1\n\n // If there is a single grave accent on its own in the code, use a fence of\n // two.\n // If there are two in a row, use one.\n while (new RegExp('(^|[^`])' + sequence + '([^`]|$)').test(value)) {\n sequence += '`'\n }\n\n // If this is not just spaces or eols (tabs don’t count), and either the\n // first or last character are a space, eol, or tick, then pad with spaces.\n if (\n /[^ \\r\\n]/.test(value) &&\n ((/^[ \\r\\n]/.test(value) && /[ \\r\\n]$/.test(value)) || /^`|`$/.test(value))\n ) {\n value = ' ' + value + ' '\n }\n\n // We have a potential problem: certain characters after eols could result in\n // blocks being seen.\n // For example, if someone injected the string `'\\n# b'`, then that would\n // result in an ATX heading.\n // We can’t escape characters in `inlineCode`, but because eols are\n // transformed to spaces when going from markdown to HTML anyway, we can swap\n // them out.\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n // Only look for `atBreak`s.\n // Btw: note that `atBreak` patterns will always start the regex at LF or\n // CR.\n if (!pattern.atBreak) continue\n\n while ((match = expression.exec(value))) {\n let position = match.index\n\n // Support CRLF (patterns only look for one of the characters).\n if (\n value.charCodeAt(position) === 10 /* `\\n` */ &&\n value.charCodeAt(position - 1) === 13 /* `\\r` */\n ) {\n position--\n }\n\n value = value.slice(0, position) + ' ' + value.slice(match.index + 1)\n }\n }\n\n return sequence + value + sequence\n}\n\n/**\n * @returns {string}\n */\nfunction inlineCodePeek() {\n return '`'\n}\n","// To do: next major: remove.\n/**\n * @typedef {Options} MarkdownTableOptions\n * Configuration.\n */\n\n/**\n * @typedef Options\n * Configuration.\n * @property {boolean | null | undefined} [alignDelimiters=true]\n * Whether to align the delimiters (default: `true`);\n * they are aligned by default:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * Pass `false` to make them staggered:\n *\n * ```markdown\n * | Alpha | B |\n * | - | - |\n * | C | Delta |\n * ```\n * @property {ReadonlyArray | string | null | undefined} [align]\n * How to align columns (default: `''`);\n * one style for all columns or styles for their respective columns;\n * each style is either `'l'` (left), `'r'` (right), or `'c'` (center);\n * other values are treated as `''`, which doesn’t place the colon in the\n * alignment row but does align left;\n * *only the lowercased first character is used, so `Right` is fine.*\n * @property {boolean | null | undefined} [delimiterEnd=true]\n * Whether to end each row with the delimiter (default: `true`).\n *\n * > 👉 **Note**: please don’t use this: it could create fragile structures\n * > that aren’t understandable to some markdown parsers.\n *\n * When `true`, there are ending delimiters:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there are no ending delimiters:\n *\n * ```markdown\n * | Alpha | B\n * | ----- | -----\n * | C | Delta\n * ```\n * @property {boolean | null | undefined} [delimiterStart=true]\n * Whether to begin each row with the delimiter (default: `true`).\n *\n * > 👉 **Note**: please don’t use this: it could create fragile structures\n * > that aren’t understandable to some markdown parsers.\n *\n * When `true`, there are starting delimiters:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there are no starting delimiters:\n *\n * ```markdown\n * Alpha | B |\n * ----- | ----- |\n * C | Delta |\n * ```\n * @property {boolean | null | undefined} [padding=true]\n * Whether to add a space of padding between delimiters and cells\n * (default: `true`).\n *\n * When `true`, there is padding:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there is no padding:\n *\n * ```markdown\n * |Alpha|B |\n * |-----|-----|\n * |C |Delta|\n * ```\n * @property {((value: string) => number) | null | undefined} [stringLength]\n * Function to detect the length of table cell content (optional);\n * this is used when aligning the delimiters (`|`) between table cells;\n * full-width characters and emoji mess up delimiter alignment when viewing\n * the markdown source;\n * to fix this, you can pass this function,\n * which receives the cell content and returns its “visible” size;\n * note that what is and isn’t visible depends on where the text is displayed.\n *\n * Without such a function, the following:\n *\n * ```js\n * markdownTable([\n * ['Alpha', 'Bravo'],\n * ['中文', 'Charlie'],\n * ['👩‍❤️‍👩', 'Delta']\n * ])\n * ```\n *\n * Yields:\n *\n * ```markdown\n * | Alpha | Bravo |\n * | - | - |\n * | 中文 | Charlie |\n * | 👩‍❤️‍👩 | Delta |\n * ```\n *\n * With [`string-width`](https://github.com/sindresorhus/string-width):\n *\n * ```js\n * import stringWidth from 'string-width'\n *\n * markdownTable(\n * [\n * ['Alpha', 'Bravo'],\n * ['中文', 'Charlie'],\n * ['👩‍❤️‍👩', 'Delta']\n * ],\n * {stringLength: stringWidth}\n * )\n * ```\n *\n * Yields:\n *\n * ```markdown\n * | Alpha | Bravo |\n * | ----- | ------- |\n * | 中文 | Charlie |\n * | 👩‍❤️‍👩 | Delta |\n * ```\n */\n\n/**\n * @param {string} value\n * Cell value.\n * @returns {number}\n * Cell size.\n */\nfunction defaultStringLength(value) {\n return value.length\n}\n\n/**\n * Generate a markdown\n * ([GFM](https://docs.github.com/en/github/writing-on-github/working-with-advanced-formatting/organizing-information-with-tables))\n * table.\n *\n * @param {ReadonlyArray>} table\n * Table data (matrix of strings).\n * @param {Readonly | null | undefined} [options]\n * Configuration (optional).\n * @returns {string}\n * Result.\n */\nexport function markdownTable(table, options) {\n const settings = options || {}\n // To do: next major: change to spread.\n const align = (settings.align || []).concat()\n const stringLength = settings.stringLength || defaultStringLength\n /** @type {Array} Character codes as symbols for alignment per column. */\n const alignments = []\n /** @type {Array>} Cells per row. */\n const cellMatrix = []\n /** @type {Array>} Sizes of each cell per row. */\n const sizeMatrix = []\n /** @type {Array} */\n const longestCellByColumn = []\n let mostCellsPerRow = 0\n let rowIndex = -1\n\n // This is a superfluous loop if we don’t align delimiters, but otherwise we’d\n // do superfluous work when aligning, so optimize for aligning.\n while (++rowIndex < table.length) {\n /** @type {Array} */\n const row = []\n /** @type {Array} */\n const sizes = []\n let columnIndex = -1\n\n if (table[rowIndex].length > mostCellsPerRow) {\n mostCellsPerRow = table[rowIndex].length\n }\n\n while (++columnIndex < table[rowIndex].length) {\n const cell = serialize(table[rowIndex][columnIndex])\n\n if (settings.alignDelimiters !== false) {\n const size = stringLength(cell)\n sizes[columnIndex] = size\n\n if (\n longestCellByColumn[columnIndex] === undefined ||\n size > longestCellByColumn[columnIndex]\n ) {\n longestCellByColumn[columnIndex] = size\n }\n }\n\n row.push(cell)\n }\n\n cellMatrix[rowIndex] = row\n sizeMatrix[rowIndex] = sizes\n }\n\n // Figure out which alignments to use.\n let columnIndex = -1\n\n if (typeof align === 'object' && 'length' in align) {\n while (++columnIndex < mostCellsPerRow) {\n alignments[columnIndex] = toAlignment(align[columnIndex])\n }\n } else {\n const code = toAlignment(align)\n\n while (++columnIndex < mostCellsPerRow) {\n alignments[columnIndex] = code\n }\n }\n\n // Inject the alignment row.\n columnIndex = -1\n /** @type {Array} */\n const row = []\n /** @type {Array} */\n const sizes = []\n\n while (++columnIndex < mostCellsPerRow) {\n const code = alignments[columnIndex]\n let before = ''\n let after = ''\n\n if (code === 99 /* `c` */) {\n before = ':'\n after = ':'\n } else if (code === 108 /* `l` */) {\n before = ':'\n } else if (code === 114 /* `r` */) {\n after = ':'\n }\n\n // There *must* be at least one hyphen-minus in each alignment cell.\n let size =\n settings.alignDelimiters === false\n ? 1\n : Math.max(\n 1,\n longestCellByColumn[columnIndex] - before.length - after.length\n )\n\n const cell = before + '-'.repeat(size) + after\n\n if (settings.alignDelimiters !== false) {\n size = before.length + size + after.length\n\n if (size > longestCellByColumn[columnIndex]) {\n longestCellByColumn[columnIndex] = size\n }\n\n sizes[columnIndex] = size\n }\n\n row[columnIndex] = cell\n }\n\n // Inject the alignment row.\n cellMatrix.splice(1, 0, row)\n sizeMatrix.splice(1, 0, sizes)\n\n rowIndex = -1\n /** @type {Array} */\n const lines = []\n\n while (++rowIndex < cellMatrix.length) {\n const row = cellMatrix[rowIndex]\n const sizes = sizeMatrix[rowIndex]\n columnIndex = -1\n /** @type {Array} */\n const line = []\n\n while (++columnIndex < mostCellsPerRow) {\n const cell = row[columnIndex] || ''\n let before = ''\n let after = ''\n\n if (settings.alignDelimiters !== false) {\n const size =\n longestCellByColumn[columnIndex] - (sizes[columnIndex] || 0)\n const code = alignments[columnIndex]\n\n if (code === 114 /* `r` */) {\n before = ' '.repeat(size)\n } else if (code === 99 /* `c` */) {\n if (size % 2) {\n before = ' '.repeat(size / 2 + 0.5)\n after = ' '.repeat(size / 2 - 0.5)\n } else {\n before = ' '.repeat(size / 2)\n after = before\n }\n } else {\n after = ' '.repeat(size)\n }\n }\n\n if (settings.delimiterStart !== false && !columnIndex) {\n line.push('|')\n }\n\n if (\n settings.padding !== false &&\n // Don’t add the opening space if we’re not aligning and the cell is\n // empty: there will be a closing space.\n !(settings.alignDelimiters === false && cell === '') &&\n (settings.delimiterStart !== false || columnIndex)\n ) {\n line.push(' ')\n }\n\n if (settings.alignDelimiters !== false) {\n line.push(before)\n }\n\n line.push(cell)\n\n if (settings.alignDelimiters !== false) {\n line.push(after)\n }\n\n if (settings.padding !== false) {\n line.push(' ')\n }\n\n if (\n settings.delimiterEnd !== false ||\n columnIndex !== mostCellsPerRow - 1\n ) {\n line.push('|')\n }\n }\n\n lines.push(\n settings.delimiterEnd === false\n ? line.join('').replace(/ +$/, '')\n : line.join('')\n )\n }\n\n return lines.join('\\n')\n}\n\n/**\n * @param {string | null | undefined} [value]\n * Value to serialize.\n * @returns {string}\n * Result.\n */\nfunction serialize(value) {\n return value === null || value === undefined ? '' : String(value)\n}\n\n/**\n * @param {string | null | undefined} value\n * Value.\n * @returns {number}\n * Alignment.\n */\nfunction toAlignment(value) {\n const code = typeof value === 'string' ? value.codePointAt(0) : 0\n\n return code === 67 /* `C` */ || code === 99 /* `c` */\n ? 99 /* `c` */\n : code === 76 /* `L` */ || code === 108 /* `l` */\n ? 108 /* `l` */\n : code === 82 /* `R` */ || code === 114 /* `r` */\n ? 114 /* `r` */\n : 0\n}\n","/**\n * @typedef {import('mdast').Table} Table\n * @typedef {import('mdast').TableRow} TableRow\n * @typedef {import('mdast').TableCell} TableCell\n * @typedef {import('mdast').InlineCode} InlineCode\n *\n * @typedef {import('markdown-table').MarkdownTableOptions} MarkdownTableOptions\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n *\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Context} ToMarkdownContext\n * @typedef {import('mdast-util-to-markdown').SafeOptions} SafeOptions\n */\n\n/**\n * @typedef Options\n * Configuration.\n * @property {boolean | null | undefined} [tableCellPadding=true]\n * Whether to add a space of padding between delimiters and cells.\n * @property {boolean | null | undefined} [tablePipeAlign=true]\n * Whether to align the delimiters.\n * @property {MarkdownTableOptions['stringLength'] | null | undefined} [stringLength]\n * Function to detect the length of table cell content, used when aligning\n * the delimiters between cells\n */\n\nimport {containerPhrasing} from 'mdast-util-to-markdown/lib/util/container-phrasing.js'\nimport {inlineCode} from 'mdast-util-to-markdown/lib/handle/inline-code.js'\nimport {markdownTable} from 'markdown-table'\n\n// To do: next major: use `state` and `state` utilities from `mdast-util-to-markdown`.\n// To do: next major: use `defaultHandlers.inlineCode`.\n// To do: next major: expose functions.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM tables.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmTableFromMarkdown = {\n enter: {\n table: enterTable,\n tableData: enterCell,\n tableHeader: enterCell,\n tableRow: enterRow\n },\n exit: {\n codeText: exitCodeText,\n table: exitTable,\n tableData: exit,\n tableHeader: exit,\n tableRow: exit\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterTable(token) {\n /** @type {Array<'left' | 'right' | 'center' | 'none'>} */\n // @ts-expect-error: `align` is custom.\n const align = token._align\n this.enter(\n {\n type: 'table',\n align: align.map((d) => (d === 'none' ? null : d)),\n children: []\n },\n token\n )\n this.setData('inTable', true)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitTable(token) {\n this.exit(token)\n this.setData('inTable')\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterRow(token) {\n this.enter({type: 'tableRow', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exit(token) {\n this.exit(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterCell(token) {\n this.enter({type: 'tableCell', children: []}, token)\n}\n\n// Overwrite the default code text data handler to unescape escaped pipes when\n// they are in tables.\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitCodeText(token) {\n let value = this.resume()\n\n if (this.getData('inTable')) {\n value = value.replace(/\\\\([\\\\|])/g, replace)\n }\n\n const node = /** @type {InlineCode} */ (this.stack[this.stack.length - 1])\n node.value = value\n this.exit(token)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @returns {string}\n */\nfunction replace($0, $1) {\n // Pipes work, backslashes don’t (but can’t escape pipes).\n return $1 === '|' ? $1 : $0\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM tables in\n * markdown.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown` to enable GFM tables.\n */\nexport function gfmTableToMarkdown(options) {\n const settings = options || {}\n const padding = settings.tableCellPadding\n const alignDelimiters = settings.tablePipeAlign\n const stringLength = settings.stringLength\n const around = padding ? ' ' : '|'\n\n return {\n unsafe: [\n {character: '\\r', inConstruct: 'tableCell'},\n {character: '\\n', inConstruct: 'tableCell'},\n // A pipe, when followed by a tab or space (padding), or a dash or colon\n // (unpadded delimiter row), could result in a table.\n {atBreak: true, character: '|', after: '[\\t :-]'},\n // A pipe in a cell must be encoded.\n {character: '|', inConstruct: 'tableCell'},\n // A colon must be followed by a dash, in which case it could start a\n // delimiter row.\n {atBreak: true, character: ':', after: '-'},\n // A delimiter row can also start with a dash, when followed by more\n // dashes, a colon, or a pipe.\n // This is a stricter version than the built in check for lists, thematic\n // breaks, and setex heading underlines though:\n // \n {atBreak: true, character: '-', after: '[:|-]'}\n ],\n handlers: {\n table: handleTable,\n tableRow: handleTableRow,\n tableCell: handleTableCell,\n inlineCode: inlineCodeWithTable\n }\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {Table} node\n */\n function handleTable(node, _, context, safeOptions) {\n return serializeData(\n handleTableAsData(node, context, safeOptions),\n node.align\n )\n }\n\n /**\n * This function isn’t really used normally, because we handle rows at the\n * table level.\n * But, if someone passes in a table row, this ensures we make somewhat sense.\n *\n * @type {ToMarkdownHandle}\n * @param {TableRow} node\n */\n function handleTableRow(node, _, context, safeOptions) {\n const row = handleTableRowAsData(node, context, safeOptions)\n const value = serializeData([row])\n // `markdown-table` will always add an align row\n return value.slice(0, value.indexOf('\\n'))\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {TableCell} node\n */\n function handleTableCell(node, _, context, safeOptions) {\n const exit = context.enter('tableCell')\n const subexit = context.enter('phrasing')\n const value = containerPhrasing(node, context, {\n ...safeOptions,\n before: around,\n after: around\n })\n subexit()\n exit()\n return value\n }\n\n /**\n * @param {Array>} matrix\n * @param {Array | null | undefined} [align]\n */\n function serializeData(matrix, align) {\n return markdownTable(matrix, {\n align,\n // @ts-expect-error: `markdown-table` types should support `null`.\n alignDelimiters,\n // @ts-expect-error: `markdown-table` types should support `null`.\n padding,\n // @ts-expect-error: `markdown-table` types should support `null`.\n stringLength\n })\n }\n\n /**\n * @param {Table} node\n * @param {ToMarkdownContext} context\n * @param {SafeOptions} safeOptions\n */\n function handleTableAsData(node, context, safeOptions) {\n const children = node.children\n let index = -1\n /** @type {Array>} */\n const result = []\n const subexit = context.enter('table')\n\n while (++index < children.length) {\n result[index] = handleTableRowAsData(\n children[index],\n context,\n safeOptions\n )\n }\n\n subexit()\n\n return result\n }\n\n /**\n * @param {TableRow} node\n * @param {ToMarkdownContext} context\n * @param {SafeOptions} safeOptions\n */\n function handleTableRowAsData(node, context, safeOptions) {\n const children = node.children\n let index = -1\n /** @type {Array} */\n const result = []\n const subexit = context.enter('tableRow')\n\n while (++index < children.length) {\n // Note: the positional info as used here is incorrect.\n // Making it correct would be impossible due to aligning cells?\n // And it would need copy/pasting `markdown-table` into this project.\n result[index] = handleTableCell(\n children[index],\n node,\n context,\n safeOptions\n )\n }\n\n subexit()\n\n return result\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {InlineCode} node\n */\n function inlineCodeWithTable(node, parent, context) {\n let value = inlineCode(node, parent, context)\n\n if (context.stack.includes('tableCell')) {\n value = value.replace(/\\|/g, '\\\\$&')\n }\n\n return value\n }\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBullet(state) {\n const marker = state.options.bullet || '*'\n\n if (marker !== '*' && marker !== '+' && marker !== '-') {\n throw new Error(\n 'Cannot serialize items with `' +\n marker +\n '` for `options.bullet`, expected `*`, `+`, or `-`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkListItemIndent(state) {\n const style = state.options.listItemIndent || 'tab'\n\n // To do: remove in a major.\n // @ts-expect-error: deprecated.\n if (style === 1 || style === '1') {\n return 'one'\n }\n\n if (style !== 'tab' && style !== 'one' && style !== 'mixed') {\n throw new Error(\n 'Cannot serialize items with `' +\n style +\n '` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`'\n )\n }\n\n return style\n}\n","/**\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('../types.js').Map} Map\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkListItemIndent} from '../util/check-list-item-indent.js'\n\n/**\n * @param {ListItem} node\n * @param {Parent | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function listItem(node, parent, state, info) {\n const listItemIndent = checkListItemIndent(state)\n let bullet = state.bulletCurrent || checkBullet(state)\n\n // Add the marker value for ordered lists.\n if (parent && parent.type === 'list' && parent.ordered) {\n bullet =\n (typeof parent.start === 'number' && parent.start > -1\n ? parent.start\n : 1) +\n (state.options.incrementListMarker === false\n ? 0\n : parent.children.indexOf(node)) +\n bullet\n }\n\n let size = bullet.length + 1\n\n if (\n listItemIndent === 'tab' ||\n (listItemIndent === 'mixed' &&\n ((parent && parent.type === 'list' && parent.spread) || node.spread))\n ) {\n size = Math.ceil(size / 4) * 4\n }\n\n const tracker = state.createTracker(info)\n tracker.move(bullet + ' '.repeat(size - bullet.length))\n tracker.shift(size)\n const exit = state.enter('listItem')\n const value = state.indentLines(\n state.containerFlow(node, tracker.current()),\n map\n )\n exit()\n\n return value\n\n /** @type {Map} */\n function map(line, index, blank) {\n if (index) {\n return (blank ? '' : ' '.repeat(size)) + line\n }\n\n return (blank ? bullet : bullet + ' '.repeat(size - bullet.length)) + line\n }\n}\n","/**\n * @typedef {import('../types.js').CreateTracker} CreateTracker\n * @typedef {import('../types.js').TrackCurrent} TrackCurrent\n * @typedef {import('../types.js').TrackMove} TrackMove\n * @typedef {import('../types.js').TrackShift} TrackShift\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n // Defaults are used to prevent crashes when older utilities somehow activate\n // this code.\n /* c8 ignore next 5 */\n const options = config || {}\n const now = options.now || {}\n let lineShift = options.lineShift || 0\n let line = now.line || 1\n let column = now.column || 1\n\n return {move, current, shift}\n\n /**\n * Get the current tracked info.\n *\n * @type {TrackCurrent}\n */\n function current() {\n return {now: {line, column}, lineShift}\n }\n\n /**\n * Define an increased line shift (the typical indent for lines).\n *\n * @type {TrackShift}\n */\n function shift(value) {\n lineShift += value\n }\n\n /**\n * Move past some generated markdown.\n *\n * @type {TrackMove}\n */\n function move(input) {\n // eslint-disable-next-line unicorn/prefer-default-parameters\n const value = input || ''\n const chunks = value.split(/\\r?\\n|\\r/g)\n const tail = chunks[chunks.length - 1]\n line += chunks.length - 1\n column =\n chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n return value\n }\n}\n","/**\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n */\n\n/**\n * @typedef {Extract} Parents\n */\n\nimport {listItem} from 'mdast-util-to-markdown/lib/handle/list-item.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\n// To do: next major: rename `context` -> `state`, `safeOptions` -> `info`, use\n// `track` from `state`.\n// To do: next major: replace exports with functions.\n// To do: next major: use `defaulthandlers.listItem`.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM task list items.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmTaskListItemFromMarkdown = {\n exit: {\n taskListCheckValueChecked: exitCheck,\n taskListCheckValueUnchecked: exitCheck,\n paragraph: exitParagraphWithTaskListItem\n }\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM task list items.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmTaskListItemToMarkdown = {\n unsafe: [{atBreak: true, character: '-', after: '[:|-]'}],\n handlers: {listItem: listItemWithTaskListItem}\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitCheck(token) {\n const node = /** @type {ListItem} */ (this.stack[this.stack.length - 2])\n // We’re always in a paragraph, in a list item.\n node.checked = token.type === 'taskListCheckValueChecked'\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitParagraphWithTaskListItem(token) {\n const parent = /** @type {Parents} */ (this.stack[this.stack.length - 2])\n\n if (\n parent &&\n parent.type === 'listItem' &&\n typeof parent.checked === 'boolean'\n ) {\n const node = /** @type {Paragraph} */ (this.stack[this.stack.length - 1])\n const head = node.children[0]\n\n if (head && head.type === 'text') {\n const siblings = parent.children\n let index = -1\n /** @type {Paragraph | undefined} */\n let firstParaghraph\n\n while (++index < siblings.length) {\n const sibling = siblings[index]\n if (sibling.type === 'paragraph') {\n firstParaghraph = sibling\n break\n }\n }\n\n if (firstParaghraph === node) {\n // Must start with a space or a tab.\n head.value = head.value.slice(1)\n\n if (head.value.length === 0) {\n node.children.shift()\n } else if (\n node.position &&\n head.position &&\n typeof head.position.start.offset === 'number'\n ) {\n head.position.start.column++\n head.position.start.offset++\n node.position.start = Object.assign({}, head.position.start)\n }\n }\n }\n }\n\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {ListItem} node\n */\nfunction listItemWithTaskListItem(node, parent, context, safeOptions) {\n const head = node.children[0]\n const checkable =\n typeof node.checked === 'boolean' && head && head.type === 'paragraph'\n const checkbox = '[' + (node.checked ? 'x' : ' ') + '] '\n const tracker = track(safeOptions)\n\n if (checkable) {\n tracker.move(checkbox)\n }\n\n let value = listItem(node, parent, context, {\n ...safeOptions,\n ...tracker.current()\n })\n\n if (checkable) {\n value = value.replace(/^(?:[*+-]|\\d+\\.)([\\r\\n]| {1,3})/, check)\n }\n\n return value\n\n /**\n * @param {string} $0\n * @returns {string}\n */\n function check($0) {\n return $0 + checkbox\n }\n}\n","/**\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n */\n\n/**\n * @typedef {import('mdast-util-gfm-table').Options} Options\n * Configuration.\n */\n\nimport {\n gfmAutolinkLiteralFromMarkdown,\n gfmAutolinkLiteralToMarkdown\n} from 'mdast-util-gfm-autolink-literal'\nimport {\n gfmFootnoteFromMarkdown,\n gfmFootnoteToMarkdown\n} from 'mdast-util-gfm-footnote'\nimport {\n gfmStrikethroughFromMarkdown,\n gfmStrikethroughToMarkdown\n} from 'mdast-util-gfm-strikethrough'\nimport {gfmTableFromMarkdown, gfmTableToMarkdown} from 'mdast-util-gfm-table'\nimport {\n gfmTaskListItemFromMarkdown,\n gfmTaskListItemToMarkdown\n} from 'mdast-util-gfm-task-list-item'\n\n/**\n * Create an extension for `mdast-util-from-markdown` to enable GFM (autolink\n * literals, footnotes, strikethrough, tables, tasklists).\n *\n * @returns {Array}\n * Extension for `mdast-util-from-markdown` to enable GFM (autolink literals,\n * footnotes, strikethrough, tables, tasklists).\n */\nexport function gfmFromMarkdown() {\n return [\n gfmAutolinkLiteralFromMarkdown,\n gfmFootnoteFromMarkdown(),\n gfmStrikethroughFromMarkdown,\n gfmTableFromMarkdown,\n gfmTaskListItemFromMarkdown\n ]\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM (autolink\n * literals, footnotes, strikethrough, tables, tasklists).\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown` to enable GFM (autolink literals,\n * footnotes, strikethrough, tables, tasklists).\n */\nexport function gfmToMarkdown(options) {\n return {\n extensions: [\n gfmAutolinkLiteralToMarkdown,\n gfmFootnoteToMarkdown(),\n gfmStrikethroughToMarkdown,\n gfmTableToMarkdown(options),\n gfmTaskListItemToMarkdown\n ]\n }\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('micromark-extension-gfm').Options & import('mdast-util-gfm').Options} Options\n */\n\nimport {gfm} from 'micromark-extension-gfm'\nimport {gfmFromMarkdown, gfmToMarkdown} from 'mdast-util-gfm'\n\n/**\n * Plugin to support GFM (autolink literals, footnotes, strikethrough, tables, tasklists).\n *\n * @type {import('unified').Plugin<[Options?]|void[], Root>}\n */\nexport default function remarkGfm(options = {}) {\n const data = this.data()\n\n add('micromarkExtensions', gfm(options))\n add('fromMarkdownExtensions', gfmFromMarkdown())\n add('toMarkdownExtensions', gfmToMarkdown(options))\n\n /**\n * @param {string} field\n * @param {unknown} value\n */\n function add(field, value) {\n const list = /** @type {unknown[]} */ (\n // Other extensions\n /* c8 ignore next 2 */\n data[field] ? data[field] : (data[field] = [])\n )\n\n list.push(value)\n }\n}\n","// This module is generated by `script/`.\n//\n// CommonMark handles attention (emphasis, strong) markers based on what comes\n// before or after them.\n// One such difference is if those characters are Unicode punctuation.\n// This script is generated from the Unicode data.\n\n/**\n * Regular expression that matches a unicode punctuation character.\n */\nexport const unicodePunctuationRegex =\n /[!-\\/:-@\\[-`\\{-~\\xA1\\xA7\\xAB\\xB6\\xB7\\xBB\\xBF\\u037E\\u0387\\u055A-\\u055F\\u0589\\u058A\\u05BE\\u05C0\\u05C3\\u05C6\\u05F3\\u05F4\\u0609\\u060A\\u060C\\u060D\\u061B\\u061D-\\u061F\\u066A-\\u066D\\u06D4\\u0700-\\u070D\\u07F7-\\u07F9\\u0830-\\u083E\\u085E\\u0964\\u0965\\u0970\\u09FD\\u0A76\\u0AF0\\u0C77\\u0C84\\u0DF4\\u0E4F\\u0E5A\\u0E5B\\u0F04-\\u0F12\\u0F14\\u0F3A-\\u0F3D\\u0F85\\u0FD0-\\u0FD4\\u0FD9\\u0FDA\\u104A-\\u104F\\u10FB\\u1360-\\u1368\\u1400\\u166E\\u169B\\u169C\\u16EB-\\u16ED\\u1735\\u1736\\u17D4-\\u17D6\\u17D8-\\u17DA\\u1800-\\u180A\\u1944\\u1945\\u1A1E\\u1A1F\\u1AA0-\\u1AA6\\u1AA8-\\u1AAD\\u1B5A-\\u1B60\\u1B7D\\u1B7E\\u1BFC-\\u1BFF\\u1C3B-\\u1C3F\\u1C7E\\u1C7F\\u1CC0-\\u1CC7\\u1CD3\\u2010-\\u2027\\u2030-\\u2043\\u2045-\\u2051\\u2053-\\u205E\\u207D\\u207E\\u208D\\u208E\\u2308-\\u230B\\u2329\\u232A\\u2768-\\u2775\\u27C5\\u27C6\\u27E6-\\u27EF\\u2983-\\u2998\\u29D8-\\u29DB\\u29FC\\u29FD\\u2CF9-\\u2CFC\\u2CFE\\u2CFF\\u2D70\\u2E00-\\u2E2E\\u2E30-\\u2E4F\\u2E52-\\u2E5D\\u3001-\\u3003\\u3008-\\u3011\\u3014-\\u301F\\u3030\\u303D\\u30A0\\u30FB\\uA4FE\\uA4FF\\uA60D-\\uA60F\\uA673\\uA67E\\uA6F2-\\uA6F7\\uA874-\\uA877\\uA8CE\\uA8CF\\uA8F8-\\uA8FA\\uA8FC\\uA92E\\uA92F\\uA95F\\uA9C1-\\uA9CD\\uA9DE\\uA9DF\\uAA5C-\\uAA5F\\uAADE\\uAADF\\uAAF0\\uAAF1\\uABEB\\uFD3E\\uFD3F\\uFE10-\\uFE19\\uFE30-\\uFE52\\uFE54-\\uFE61\\uFE63\\uFE68\\uFE6A\\uFE6B\\uFF01-\\uFF03\\uFF05-\\uFF0A\\uFF0C-\\uFF0F\\uFF1A\\uFF1B\\uFF1F\\uFF20\\uFF3B-\\uFF3D\\uFF3F\\uFF5B\\uFF5D\\uFF5F-\\uFF65]/\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {unicodePunctuationRegex} from './lib/unicode-punctuation-regex.js'\n\n/**\n * Check whether the character code represents an ASCII alpha (`a` through `z`,\n * case insensitive).\n *\n * An **ASCII alpha** is an ASCII upper alpha or ASCII lower alpha.\n *\n * An **ASCII upper alpha** is a character in the inclusive range U+0041 (`A`)\n * to U+005A (`Z`).\n *\n * An **ASCII lower alpha** is a character in the inclusive range U+0061 (`a`)\n * to U+007A (`z`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlpha = regexCheck(/[A-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII alphanumeric (`a`\n * through `z`, case insensitive, or `0` through `9`).\n *\n * An **ASCII alphanumeric** is an ASCII digit (see `asciiDigit`) or ASCII alpha\n * (see `asciiAlpha`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAlphanumeric = regexCheck(/[\\dA-Za-z]/)\n\n/**\n * Check whether the character code represents an ASCII atext.\n *\n * atext is an ASCII alphanumeric (see `asciiAlphanumeric`), or a character in\n * the inclusive ranges U+0023 NUMBER SIGN (`#`) to U+0027 APOSTROPHE (`'`),\n * U+002A ASTERISK (`*`), U+002B PLUS SIGN (`+`), U+002D DASH (`-`), U+002F\n * SLASH (`/`), U+003D EQUALS TO (`=`), U+003F QUESTION MARK (`?`), U+005E\n * CARET (`^`) to U+0060 GRAVE ACCENT (`` ` ``), or U+007B LEFT CURLY BRACE\n * (`{`) to U+007E TILDE (`~`).\n *\n * See:\n * **\\[RFC5322]**:\n * [Internet Message Format](https://tools.ietf.org/html/rfc5322).\n * P. Resnick.\n * IETF.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiAtext = regexCheck(/[#-'*+\\--9=?A-Z^-~]/)\n\n/**\n * Check whether a character code is an ASCII control character.\n *\n * An **ASCII control** is a character in the inclusive range U+0000 NULL (NUL)\n * to U+001F (US), or U+007F (DEL).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function asciiControl(code) {\n return (\n // Special whitespace codes (which have negative values), C0 and Control\n // character DEL\n code !== null && (code < 32 || code === 127)\n )\n}\n\n/**\n * Check whether the character code represents an ASCII digit (`0` through `9`).\n *\n * An **ASCII digit** is a character in the inclusive range U+0030 (`0`) to\n * U+0039 (`9`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiDigit = regexCheck(/\\d/)\n\n/**\n * Check whether the character code represents an ASCII hex digit (`a` through\n * `f`, case insensitive, or `0` through `9`).\n *\n * An **ASCII hex digit** is an ASCII digit (see `asciiDigit`), ASCII upper hex\n * digit, or an ASCII lower hex digit.\n *\n * An **ASCII upper hex digit** is a character in the inclusive range U+0041\n * (`A`) to U+0046 (`F`).\n *\n * An **ASCII lower hex digit** is a character in the inclusive range U+0061\n * (`a`) to U+0066 (`f`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiHexDigit = regexCheck(/[\\dA-Fa-f]/)\n\n/**\n * Check whether the character code represents ASCII punctuation.\n *\n * An **ASCII punctuation** is a character in the inclusive ranges U+0021\n * EXCLAMATION MARK (`!`) to U+002F SLASH (`/`), U+003A COLON (`:`) to U+0040 AT\n * SIGN (`@`), U+005B LEFT SQUARE BRACKET (`[`) to U+0060 GRAVE ACCENT\n * (`` ` ``), or U+007B LEFT CURLY BRACE (`{`) to U+007E TILDE (`~`).\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/)\n\n/**\n * Check whether a character code is a markdown line ending.\n *\n * A **markdown line ending** is the virtual characters M-0003 CARRIAGE RETURN\n * LINE FEED (CRLF), M-0004 LINE FEED (LF) and M-0005 CARRIAGE RETURN (CR).\n *\n * In micromark, the actual character U+000A LINE FEED (LF) and U+000D CARRIAGE\n * RETURN (CR) are replaced by these virtual characters depending on whether\n * they occurred together.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEnding(code) {\n return code !== null && code < -2\n}\n\n/**\n * Check whether a character code is a markdown line ending (see\n * `markdownLineEnding`) or markdown space (see `markdownSpace`).\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownLineEndingOrSpace(code) {\n return code !== null && (code < 0 || code === 32)\n}\n\n/**\n * Check whether a character code is a markdown space.\n *\n * A **markdown space** is the concrete character U+0020 SPACE (SP) and the\n * virtual characters M-0001 VIRTUAL SPACE (VS) and M-0002 HORIZONTAL TAB (HT).\n *\n * In micromark, the actual character U+0009 CHARACTER TABULATION (HT) is\n * replaced by one M-0002 HORIZONTAL TAB (HT) and between 0 and 3 M-0001 VIRTUAL\n * SPACE (VS) characters, depending on the column at which the tab occurred.\n *\n * @param {Code} code\n * Code.\n * @returns {boolean}\n * Whether it matches.\n */\nexport function markdownSpace(code) {\n return code === -2 || code === -1 || code === 32\n}\n\n// Size note: removing ASCII from the regex and using `asciiPunctuation` here\n// In fact adds to the bundle size.\n/**\n * Check whether the character code represents Unicode punctuation.\n *\n * A **Unicode punctuation** is a character in the Unicode `Pc` (Punctuation,\n * Connector), `Pd` (Punctuation, Dash), `Pe` (Punctuation, Close), `Pf`\n * (Punctuation, Final quote), `Pi` (Punctuation, Initial quote), `Po`\n * (Punctuation, Other), or `Ps` (Punctuation, Open) categories, or an ASCII\n * punctuation (see `asciiPunctuation`).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodePunctuation = regexCheck(unicodePunctuationRegex)\n\n/**\n * Check whether the character code represents Unicode whitespace.\n *\n * Note that this does handle micromark specific markdown whitespace characters.\n * See `markdownLineEndingOrSpace` to check that.\n *\n * A **Unicode whitespace** is a character in the Unicode `Zs` (Separator,\n * Space) category, or U+0009 CHARACTER TABULATION (HT), U+000A LINE FEED (LF),\n * U+000C (FF), or U+000D CARRIAGE RETURN (CR) (**\\[UNICODE]**).\n *\n * See:\n * **\\[UNICODE]**:\n * [The Unicode Standard](https://www.unicode.org/versions/).\n * Unicode Consortium.\n *\n * @param code\n * Code.\n * @returns\n * Whether it matches.\n */\nexport const unicodeWhitespace = regexCheck(/\\s/)\n\n/**\n * Create a code check from a regex.\n *\n * @param {RegExp} regex\n * @returns {(code: Code) => boolean}\n */\nfunction regexCheck(regex) {\n return check\n\n /**\n * Check whether a code matches the bound regex.\n *\n * @param {Code} code\n * Character code.\n * @returns {boolean}\n * Whether the character code matches the bound regex.\n */\n function check(code) {\n return code !== null && regex.test(String.fromCharCode(code))\n }\n}\n","import {asciiAlphanumeric} from 'micromark-util-character'\nimport {encode} from 'micromark-util-encode'\n/**\n * Make a value safe for injection as a URL.\n *\n * This encodes unsafe characters with percent-encoding and skips already\n * encoded sequences (see `normalizeUri`).\n * Further unsafe characters are encoded as character references (see\n * `micromark-util-encode`).\n *\n * A regex of allowed protocols can be given, in which case the URL is\n * sanitized.\n * For example, `/^(https?|ircs?|mailto|xmpp)$/i` can be used for `a[href]`, or\n * `/^https?$/i` for `img[src]` (this is what `github.com` allows).\n * If the URL includes an unknown protocol (one not matched by `protocol`, such\n * as a dangerous example, `javascript:`), the value is ignored.\n *\n * @param {string | undefined} url\n * URI to sanitize.\n * @param {RegExp | null | undefined} [protocol]\n * Allowed protocols.\n * @returns {string}\n * Sanitized URI.\n */\nexport function sanitizeUri(url, protocol) {\n const value = encode(normalizeUri(url || ''))\n if (!protocol) {\n return value\n }\n const colon = value.indexOf(':')\n const questionMark = value.indexOf('?')\n const numberSign = value.indexOf('#')\n const slash = value.indexOf('/')\n if (\n // If there is no protocol, it’s relative.\n colon < 0 ||\n // If the first colon is after a `?`, `#`, or `/`, it’s not a protocol.\n (slash > -1 && colon > slash) ||\n (questionMark > -1 && colon > questionMark) ||\n (numberSign > -1 && colon > numberSign) ||\n // It is a protocol, it should be allowed.\n protocol.test(value.slice(0, colon))\n ) {\n return value\n }\n return ''\n}\n\n/**\n * Normalize a URL.\n *\n * Encode unsafe characters with percent-encoding, skipping already encoded\n * sequences.\n *\n * @param {string} value\n * URI to normalize.\n * @returns {string}\n * Normalized URI.\n */\nexport function normalizeUri(value) {\n /** @type {Array} */\n const result = []\n let index = -1\n let start = 0\n let skip = 0\n while (++index < value.length) {\n const code = value.charCodeAt(index)\n /** @type {string} */\n let replace = ''\n\n // A correct percent encoded value.\n if (\n code === 37 &&\n asciiAlphanumeric(value.charCodeAt(index + 1)) &&\n asciiAlphanumeric(value.charCodeAt(index + 2))\n ) {\n skip = 2\n }\n // ASCII.\n else if (code < 128) {\n if (!/[!#$&-;=?-Z_a-z~]/.test(String.fromCharCode(code))) {\n replace = String.fromCharCode(code)\n }\n }\n // Astral.\n else if (code > 55295 && code < 57344) {\n const next = value.charCodeAt(index + 1)\n\n // A correct surrogate pair.\n if (code < 56320 && next > 56319 && next < 57344) {\n replace = String.fromCharCode(code, next)\n skip = 1\n }\n // Lone surrogate.\n else {\n replace = '\\uFFFD'\n }\n }\n // Unicode.\n else {\n replace = String.fromCharCode(code)\n }\n if (replace) {\n result.push(value.slice(start, index), encodeURIComponent(replace))\n start = index + skip + 1\n replace = ''\n }\n if (skip) {\n index += skip\n skip = 0\n }\n }\n return result.join('') + value.slice(start)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n *\n * @typedef {import('./state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Generate a hast footer for called footnote definitions.\n *\n * @param {State} state\n * Info passed around.\n * @returns {Element | undefined}\n * `section` element or `undefined`.\n */\nexport function footer(state) {\n /** @type {Array} */\n const listItems = []\n let index = -1\n\n while (++index < state.footnoteOrder.length) {\n const def = state.footnoteById[state.footnoteOrder[index]]\n\n if (!def) {\n continue\n }\n\n const content = state.all(def)\n const id = String(def.identifier).toUpperCase()\n const safeId = normalizeUri(id.toLowerCase())\n let referenceIndex = 0\n /** @type {Array} */\n const backReferences = []\n\n while (++referenceIndex <= state.footnoteCounts[id]) {\n /** @type {Element} */\n const backReference = {\n type: 'element',\n tagName: 'a',\n properties: {\n href:\n '#' +\n state.clobberPrefix +\n 'fnref-' +\n safeId +\n (referenceIndex > 1 ? '-' + referenceIndex : ''),\n dataFootnoteBackref: true,\n className: ['data-footnote-backref'],\n ariaLabel: state.footnoteBackLabel\n },\n children: [{type: 'text', value: '↩'}]\n }\n\n if (referenceIndex > 1) {\n backReference.children.push({\n type: 'element',\n tagName: 'sup',\n children: [{type: 'text', value: String(referenceIndex)}]\n })\n }\n\n if (backReferences.length > 0) {\n backReferences.push({type: 'text', value: ' '})\n }\n\n backReferences.push(backReference)\n }\n\n const tail = content[content.length - 1]\n\n if (tail && tail.type === 'element' && tail.tagName === 'p') {\n const tailTail = tail.children[tail.children.length - 1]\n if (tailTail && tailTail.type === 'text') {\n tailTail.value += ' '\n } else {\n tail.children.push({type: 'text', value: ' '})\n }\n\n tail.children.push(...backReferences)\n } else {\n content.push(...backReferences)\n }\n\n /** @type {Element} */\n const listItem = {\n type: 'element',\n tagName: 'li',\n properties: {id: state.clobberPrefix + 'fn-' + safeId},\n children: state.wrap(content, true)\n }\n\n state.patch(def, listItem)\n\n listItems.push(listItem)\n }\n\n if (listItems.length === 0) {\n return\n }\n\n return {\n type: 'element',\n tagName: 'section',\n properties: {dataFootnotes: true, className: ['footnotes']},\n children: [\n {\n type: 'element',\n tagName: state.footnoteLabelTagName,\n properties: {\n // To do: use structured clone.\n ...JSON.parse(JSON.stringify(state.footnoteLabelProperties)),\n id: 'footnote-label'\n },\n children: [{type: 'text', value: state.footnoteLabel}]\n },\n {type: 'text', value: '\\n'},\n {\n type: 'element',\n tagName: 'ol',\n properties: {},\n children: state.wrap(listItems, true)\n },\n {type: 'text', value: '\\n'}\n ]\n }\n}\n","/**\n * @typedef {import('unist').Position} Position\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Point} Point\n */\n\n/**\n * @typedef NodeLike\n * @property {string} type\n * @property {PositionLike | null | undefined} [position]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n *\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n */\n\n/**\n * Get the starting point of `node`.\n *\n * @param node\n * Node.\n * @returns\n * Point.\n */\nexport const pointStart = point('start')\n\n/**\n * Get the ending point of `node`.\n *\n * @param node\n * Node.\n * @returns\n * Point.\n */\nexport const pointEnd = point('end')\n\n/**\n * Get the positional info of `node`.\n *\n * @param {NodeLike | Node | null | undefined} [node]\n * Node.\n * @returns {Position}\n * Position.\n */\nexport function position(node) {\n return {start: pointStart(node), end: pointEnd(node)}\n}\n\n/**\n * Get the positional info of `node`.\n *\n * @param {'start' | 'end'} type\n * Side.\n * @returns\n * Getter.\n */\nfunction point(type) {\n return point\n\n /**\n * Get the point info of `node` at a bound side.\n *\n * @param {NodeLike | Node | null | undefined} [node]\n * @returns {Point}\n */\n function point(node) {\n const point = (node && node.position && node.position[type]) || {}\n\n // To do: next major: don’t return points when invalid.\n return {\n // @ts-expect-error: in practice, null is allowed.\n line: point.line || null,\n // @ts-expect-error: in practice, null is allowed.\n column: point.column || null,\n // @ts-expect-error: in practice, null is allowed.\n offset: point.offset > -1 ? point.offset : null\n }\n }\n}\n","/**\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n *\n * @typedef NodeLike\n * @property {PositionLike | null | undefined} [position]\n */\n\n/**\n * Check if `node` is generated.\n *\n * @param {NodeLike | null | undefined} [node]\n * Node to check.\n * @returns {boolean}\n * Whether `node` is generated (does not have positional info).\n */\nexport function generated(node) {\n return (\n !node ||\n !node.position ||\n !node.position.start ||\n !node.position.start.line ||\n !node.position.start.column ||\n !node.position.end ||\n !node.position.end.line ||\n !node.position.end.column\n )\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Definition} Definition\n */\n\n/**\n * @typedef {Root | Content} Node\n *\n * @callback GetDefinition\n * Get a definition by identifier.\n * @param {string | null | undefined} [identifier]\n * Identifier of definition.\n * @returns {Definition | null}\n * Definition corresponding to `identifier` or `null`.\n */\n\nimport {visit} from 'unist-util-visit'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Find definitions in `tree`.\n *\n * Uses CommonMark precedence, which means that earlier definitions are\n * preferred over duplicate later definitions.\n *\n * @param {Node} tree\n * Tree to check.\n * @returns {GetDefinition}\n * Getter.\n */\nexport function definitions(tree) {\n /** @type {Record} */\n const cache = Object.create(null)\n\n if (!tree || !tree.type) {\n throw new Error('mdast-util-definitions expected node')\n }\n\n visit(tree, 'definition', (definition) => {\n const id = clean(definition.identifier)\n if (id && !own.call(cache, id)) {\n cache[id] = definition\n }\n })\n\n return definition\n\n /** @type {GetDefinition} */\n function definition(identifier) {\n const id = clean(identifier)\n // To do: next major: return `undefined` when not found.\n return id && own.call(cache, id) ? cache[id] : null\n }\n}\n\n/**\n * @param {string | null | undefined} [value]\n * @returns {string}\n */\nfunction clean(value) {\n return String(value || '').toUpperCase()\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `blockquote` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Blockquote} node\n * mdast node.\n * @returns {Element}\n * hast node.\n */\nexport function blockquote(state, node) {\n /** @type {Element} */\n const result = {\n type: 'element',\n tagName: 'blockquote',\n properties: {},\n children: state.wrap(state.all(node), true)\n }\n state.patch(node, result)\n return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Text} Text\n * @typedef {import('mdast').Break} Break\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `break` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Break} node\n * mdast node.\n * @returns {Array}\n * hast element content.\n */\nexport function hardBreak(state, node) {\n /** @type {Element} */\n const result = {type: 'element', tagName: 'br', properties: {}, children: []}\n state.patch(node, result)\n return [state.applyData(node, result), {type: 'text', value: '\\n'}]\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../state.js').State} State\n\n */\n\n/**\n * Turn an mdast `code` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Code} node\n * mdast node.\n * @returns {Element}\n * hast node.\n */\nexport function code(state, node) {\n const value = node.value ? node.value + '\\n' : ''\n // To do: next major, use `node.lang` w/o regex, the splitting’s been going\n // on for years in remark now.\n const lang = node.lang ? node.lang.match(/^[^ \\t]+(?=[ \\t]|$)/) : null\n /** @type {Properties} */\n const properties = {}\n\n if (lang) {\n properties.className = ['language-' + lang]\n }\n\n // Create ``.\n /** @type {Element} */\n let result = {\n type: 'element',\n tagName: 'code',\n properties,\n children: [{type: 'text', value}]\n }\n\n if (node.meta) {\n result.data = {meta: node.meta}\n }\n\n state.patch(node, result)\n result = state.applyData(node, result)\n\n // Create `
`.\n  result = {type: 'element', tagName: 'pre', properties: {}, children: [result]}\n  state.patch(node, result)\n  return result\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Delete} Delete\n * @typedef {import('../state.js').State} State\n\n */\n\n/**\n * Turn an mdast `delete` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Delete} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function strikethrough(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'del',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `emphasis` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Emphasis} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function emphasis(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'em',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('mdast').FootnoteReference} FootnoteReference\n * @typedef {import('hast').Element} Element\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `footnoteReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {FootnoteReference} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function footnoteReference(state, node) {\n  const id = String(node.identifier).toUpperCase()\n  const safeId = normalizeUri(id.toLowerCase())\n  const index = state.footnoteOrder.indexOf(id)\n  /** @type {number} */\n  let counter\n\n  if (index === -1) {\n    state.footnoteOrder.push(id)\n    state.footnoteCounts[id] = 1\n    counter = state.footnoteOrder.length\n  } else {\n    state.footnoteCounts[id]++\n    counter = index + 1\n  }\n\n  const reuseCounter = state.footnoteCounts[id]\n\n  /** @type {Element} */\n  const link = {\n    type: 'element',\n    tagName: 'a',\n    properties: {\n      href: '#' + state.clobberPrefix + 'fn-' + safeId,\n      id:\n        state.clobberPrefix +\n        'fnref-' +\n        safeId +\n        (reuseCounter > 1 ? '-' + reuseCounter : ''),\n      dataFootnoteRef: true,\n      ariaDescribedBy: ['footnote-label']\n    },\n    children: [{type: 'text', value: String(counter)}]\n  }\n  state.patch(node, link)\n\n  /** @type {Element} */\n  const sup = {\n    type: 'element',\n    tagName: 'sup',\n    properties: {},\n    children: [link]\n  }\n  state.patch(node, sup)\n  return state.applyData(node, sup)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Footnote} Footnote\n * @typedef {import('../state.js').State} State\n */\n\nimport {footnoteReference} from './footnote-reference.js'\n\n// To do: when both:\n// * \n// * \n// …are archived, remove this (also from mdast).\n// These inline notes are not used in GFM.\n\n/**\n * Turn an mdast `footnote` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Footnote} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function footnote(state, node) {\n  const footnoteById = state.footnoteById\n  let no = 1\n\n  while (no in footnoteById) no++\n\n  const identifier = String(no)\n\n  footnoteById[identifier] = {\n    type: 'footnoteDefinition',\n    identifier,\n    children: [{type: 'paragraph', children: node.children}],\n    position: node.position\n  }\n\n  return footnoteReference(state, {\n    type: 'footnoteReference',\n    identifier,\n    position: node.position\n  })\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `heading` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Heading} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function heading(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'h' + node.depth,\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').HTML} Html\n * @typedef {import('../state.js').State} State\n * @typedef {import('../../index.js').Raw} Raw\n */\n\n/**\n * Turn an mdast `html` node into hast (`raw` node in dangerous mode, otherwise\n * nothing).\n *\n * @param {State} state\n *   Info passed around.\n * @param {Html} node\n *   mdast node.\n * @returns {Raw | Element | null}\n *   hast node.\n */\nexport function html(state, node) {\n  if (state.dangerous) {\n    /** @type {Raw} */\n    const result = {type: 'raw', value: node.value}\n    state.patch(node, result)\n    return state.applyData(node, result)\n  }\n\n  // To do: next major: return `undefined`.\n  return null\n}\n","/**\n * @typedef {import('hast').ElementContent} ElementContent\n *\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Reference} Reference\n * @typedef {import('mdast').Root} Root\n *\n * @typedef {import('./state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} References\n */\n\n// To do: next major: always return array.\n\n/**\n * Return the content of a reference without definition as plain text.\n *\n * @param {State} state\n *   Info passed around.\n * @param {References} node\n *   Reference node (image, link).\n * @returns {ElementContent | Array}\n *   hast content.\n */\nexport function revert(state, node) {\n  const subtype = node.referenceType\n  let suffix = ']'\n\n  if (subtype === 'collapsed') {\n    suffix += '[]'\n  } else if (subtype === 'full') {\n    suffix += '[' + (node.label || node.identifier) + ']'\n  }\n\n  if (node.type === 'imageReference') {\n    return {type: 'text', value: '![' + node.alt + suffix}\n  }\n\n  const contents = state.all(node)\n  const head = contents[0]\n\n  if (head && head.type === 'text') {\n    head.value = '[' + head.value\n  } else {\n    contents.unshift({type: 'text', value: '['})\n  }\n\n  const tail = contents[contents.length - 1]\n\n  if (tail && tail.type === 'text') {\n    tail.value += suffix\n  } else {\n    contents.push({type: 'text', value: suffix})\n  }\n\n  return contents\n}\n","/**\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\nimport {revert} from '../revert.js'\n\n/**\n * Turn an mdast `imageReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ImageReference} node\n *   mdast node.\n * @returns {ElementContent | Array}\n *   hast node.\n */\nexport function imageReference(state, node) {\n  const def = state.definition(node.identifier)\n\n  if (!def) {\n    return revert(state, node)\n  }\n\n  /** @type {Properties} */\n  const properties = {src: normalizeUri(def.url || ''), alt: node.alt}\n\n  if (def.title !== null && def.title !== undefined) {\n    properties.title = def.title\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'img', properties, children: []}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Image} Image\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `image` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Image} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function image(state, node) {\n  /** @type {Properties} */\n  const properties = {src: normalizeUri(node.url)}\n\n  if (node.alt !== null && node.alt !== undefined) {\n    properties.alt = node.alt\n  }\n\n  if (node.title !== null && node.title !== undefined) {\n    properties.title = node.title\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'img', properties, children: []}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Text} Text\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `inlineCode` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {InlineCode} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function inlineCode(state, node) {\n  /** @type {Text} */\n  const text = {type: 'text', value: node.value.replace(/\\r?\\n|\\r/g, ' ')}\n  state.patch(node, text)\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'code',\n    properties: {},\n    children: [text]\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\nimport {revert} from '../revert.js'\n\n/**\n * Turn an mdast `linkReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {LinkReference} node\n *   mdast node.\n * @returns {ElementContent | Array}\n *   hast node.\n */\nexport function linkReference(state, node) {\n  const def = state.definition(node.identifier)\n\n  if (!def) {\n    return revert(state, node)\n  }\n\n  /** @type {Properties} */\n  const properties = {href: normalizeUri(def.url || '')}\n\n  if (def.title !== null && def.title !== undefined) {\n    properties.title = def.title\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'a',\n    properties,\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `link` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Link} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function link(state, node) {\n  /** @type {Properties} */\n  const properties = {href: normalizeUri(node.url)}\n\n  if (node.title !== null && node.title !== undefined) {\n    properties.title = node.title\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'a',\n    properties,\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} Parents\n */\n\n/**\n * Turn an mdast `listItem` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ListItem} node\n *   mdast node.\n * @param {Parents | null | undefined} parent\n *   Parent of `node`.\n * @returns {Element}\n *   hast node.\n */\nexport function listItem(state, node, parent) {\n  const results = state.all(node)\n  const loose = parent ? listLoose(parent) : listItemLoose(node)\n  /** @type {Properties} */\n  const properties = {}\n  /** @type {Array} */\n  const children = []\n\n  if (typeof node.checked === 'boolean') {\n    const head = results[0]\n    /** @type {Element} */\n    let paragraph\n\n    if (head && head.type === 'element' && head.tagName === 'p') {\n      paragraph = head\n    } else {\n      paragraph = {type: 'element', tagName: 'p', properties: {}, children: []}\n      results.unshift(paragraph)\n    }\n\n    if (paragraph.children.length > 0) {\n      paragraph.children.unshift({type: 'text', value: ' '})\n    }\n\n    paragraph.children.unshift({\n      type: 'element',\n      tagName: 'input',\n      properties: {type: 'checkbox', checked: node.checked, disabled: true},\n      children: []\n    })\n\n    // According to github-markdown-css, this class hides bullet.\n    // See: .\n    properties.className = ['task-list-item']\n  }\n\n  let index = -1\n\n  while (++index < results.length) {\n    const child = results[index]\n\n    // Add eols before nodes, except if this is a loose, first paragraph.\n    if (\n      loose ||\n      index !== 0 ||\n      child.type !== 'element' ||\n      child.tagName !== 'p'\n    ) {\n      children.push({type: 'text', value: '\\n'})\n    }\n\n    if (child.type === 'element' && child.tagName === 'p' && !loose) {\n      children.push(...child.children)\n    } else {\n      children.push(child)\n    }\n  }\n\n  const tail = results[results.length - 1]\n\n  // Add a final eol.\n  if (tail && (loose || tail.type !== 'element' || tail.tagName !== 'p')) {\n    children.push({type: 'text', value: '\\n'})\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'li', properties, children}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n\n/**\n * @param {Parents} node\n * @return {Boolean}\n */\nfunction listLoose(node) {\n  let loose = false\n  if (node.type === 'list') {\n    loose = node.spread || false\n    const children = node.children\n    let index = -1\n\n    while (!loose && ++index < children.length) {\n      loose = listItemLoose(children[index])\n    }\n  }\n\n  return loose\n}\n\n/**\n * @param {ListItem} node\n * @return {Boolean}\n */\nfunction listItemLoose(node) {\n  const spread = node.spread\n\n  return spread === undefined || spread === null\n    ? node.children.length > 1\n    : spread\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').List} List\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `list` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {List} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function list(state, node) {\n  /** @type {Properties} */\n  const properties = {}\n  const results = state.all(node)\n  let index = -1\n\n  if (typeof node.start === 'number' && node.start !== 1) {\n    properties.start = node.start\n  }\n\n  // Like GitHub, add a class for custom styling.\n  while (++index < results.length) {\n    const child = results[index]\n\n    if (\n      child.type === 'element' &&\n      child.tagName === 'li' &&\n      child.properties &&\n      Array.isArray(child.properties.className) &&\n      child.properties.className.includes('task-list-item')\n    ) {\n      properties.className = ['contains-task-list']\n      break\n    }\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: node.ordered ? 'ol' : 'ul',\n    properties,\n    children: state.wrap(results, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `paragraph` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Paragraph} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function paragraph(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'p',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('mdast').Root} MdastRoot\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `root` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastRoot} node\n *   mdast node.\n * @returns {HastRoot | HastElement}\n *   hast node.\n */\nexport function root(state, node) {\n  /** @type {HastRoot} */\n  const result = {type: 'root', children: state.wrap(state.all(node))}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `strong` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Strong} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function strong(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'strong',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Table} Table\n * @typedef {import('../state.js').State} State\n */\n\nimport {pointStart, pointEnd} from 'unist-util-position'\n\n/**\n * Turn an mdast `table` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Table} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function table(state, node) {\n  const rows = state.all(node)\n  const firstRow = rows.shift()\n  /** @type {Array} */\n  const tableContent = []\n\n  if (firstRow) {\n    /** @type {Element} */\n    const head = {\n      type: 'element',\n      tagName: 'thead',\n      properties: {},\n      children: state.wrap([firstRow], true)\n    }\n    state.patch(node.children[0], head)\n    tableContent.push(head)\n  }\n\n  if (rows.length > 0) {\n    /** @type {Element} */\n    const body = {\n      type: 'element',\n      tagName: 'tbody',\n      properties: {},\n      children: state.wrap(rows, true)\n    }\n\n    const start = pointStart(node.children[1])\n    const end = pointEnd(node.children[node.children.length - 1])\n    if (start.line && end.line) body.position = {start, end}\n    tableContent.push(body)\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'table',\n    properties: {},\n    children: state.wrap(tableContent, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').TableRow} TableRow\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} Parents\n */\n\n/**\n * Turn an mdast `tableRow` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {TableRow} node\n *   mdast node.\n * @param {Parents | null | undefined} parent\n *   Parent of `node`.\n * @returns {Element}\n *   hast node.\n */\nexport function tableRow(state, node, parent) {\n  const siblings = parent ? parent.children : undefined\n  // Generate a body row when without parent.\n  const rowIndex = siblings ? siblings.indexOf(node) : 1\n  const tagName = rowIndex === 0 ? 'th' : 'td'\n  const align = parent && parent.type === 'table' ? parent.align : undefined\n  const length = align ? align.length : node.children.length\n  let cellIndex = -1\n  /** @type {Array} */\n  const cells = []\n\n  while (++cellIndex < length) {\n    // Note: can also be undefined.\n    const cell = node.children[cellIndex]\n    /** @type {Properties} */\n    const properties = {}\n    const alignValue = align ? align[cellIndex] : undefined\n\n    if (alignValue) {\n      properties.align = alignValue\n    }\n\n    /** @type {Element} */\n    let result = {type: 'element', tagName, properties, children: []}\n\n    if (cell) {\n      result.children = state.all(cell)\n      state.patch(cell, result)\n      result = state.applyData(node, result)\n    }\n\n    cells.push(result)\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'tr',\n    properties: {},\n    children: state.wrap(cells, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').TableCell} TableCell\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `tableCell` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {TableCell} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function tableCell(state, node) {\n  // Note: this function is normally not called: see `table-row` for how rows\n  // and their cells are compiled.\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'td', // Assume body cell.\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","const tab = 9 /* `\\t` */\nconst space = 32 /* ` ` */\n\n/**\n * Remove initial and final spaces and tabs at the line breaks in `value`.\n * Does not trim initial and final spaces and tabs of the value itself.\n *\n * @param {string} value\n *   Value to trim.\n * @returns {string}\n *   Trimmed value.\n */\nexport function trimLines(value) {\n  const source = String(value)\n  const search = /\\r?\\n|\\r/g\n  let match = search.exec(source)\n  let last = 0\n  /** @type {Array} */\n  const lines = []\n\n  while (match) {\n    lines.push(\n      trimLine(source.slice(last, match.index), last > 0, true),\n      match[0]\n    )\n\n    last = match.index + match[0].length\n    match = search.exec(source)\n  }\n\n  lines.push(trimLine(source.slice(last), last > 0, false))\n\n  return lines.join('')\n}\n\n/**\n * @param {string} value\n *   Line to trim.\n * @param {boolean} start\n *   Whether to trim the start of the line.\n * @param {boolean} end\n *   Whether to trim the end of the line.\n * @returns {string}\n *   Trimmed line.\n */\nfunction trimLine(value, start, end) {\n  let startIndex = 0\n  let endIndex = value.length\n\n  if (start) {\n    let code = value.codePointAt(startIndex)\n\n    while (code === tab || code === space) {\n      startIndex++\n      code = value.codePointAt(startIndex)\n    }\n  }\n\n  if (end) {\n    let code = value.codePointAt(endIndex - 1)\n\n    while (code === tab || code === space) {\n      endIndex--\n      code = value.codePointAt(endIndex - 1)\n    }\n  }\n\n  return endIndex > startIndex ? value.slice(startIndex, endIndex) : ''\n}\n","/**\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('hast').Text} HastText\n * @typedef {import('mdast').Text} MdastText\n * @typedef {import('../state.js').State} State\n */\n\nimport {trimLines} from 'trim-lines'\n\n/**\n * Turn an mdast `text` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastText} node\n *   mdast node.\n * @returns {HastText | HastElement}\n *   hast node.\n */\nexport function text(state, node) {\n  /** @type {HastText} */\n  const result = {type: 'text', value: trimLines(String(node.value))}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `thematicBreak` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ThematicBreak} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function thematicBreak(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'hr',\n    properties: {},\n    children: []\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","import {blockquote} from './blockquote.js'\nimport {hardBreak} from './break.js'\nimport {code} from './code.js'\nimport {strikethrough} from './delete.js'\nimport {emphasis} from './emphasis.js'\nimport {footnoteReference} from './footnote-reference.js'\nimport {footnote} from './footnote.js'\nimport {heading} from './heading.js'\nimport {html} from './html.js'\nimport {imageReference} from './image-reference.js'\nimport {image} from './image.js'\nimport {inlineCode} from './inline-code.js'\nimport {linkReference} from './link-reference.js'\nimport {link} from './link.js'\nimport {listItem} from './list-item.js'\nimport {list} from './list.js'\nimport {paragraph} from './paragraph.js'\nimport {root} from './root.js'\nimport {strong} from './strong.js'\nimport {table} from './table.js'\nimport {tableRow} from './table-row.js'\nimport {tableCell} from './table-cell.js'\nimport {text} from './text.js'\nimport {thematicBreak} from './thematic-break.js'\n\n/**\n * Default handlers for nodes.\n */\nexport const handlers = {\n  blockquote,\n  break: hardBreak,\n  code,\n  delete: strikethrough,\n  emphasis,\n  footnoteReference,\n  footnote,\n  heading,\n  html,\n  imageReference,\n  image,\n  inlineCode,\n  linkReference,\n  link,\n  listItem,\n  list,\n  paragraph,\n  root,\n  strong,\n  table,\n  tableCell,\n  tableRow,\n  text,\n  thematicBreak,\n  toml: ignore,\n  yaml: ignore,\n  definition: ignore,\n  footnoteDefinition: ignore\n}\n\n// Return nothing for nodes that are ignored.\nfunction ignore() {\n  // To do: next major: return `undefined`.\n  return null\n}\n","/**\n * @typedef {import('hast').Content} HastContent\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('hast').ElementContent} HastElementContent\n * @typedef {import('hast').Properties} HastProperties\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('hast').Text} HastText\n *\n * @typedef {import('mdast').Content} MdastContent\n * @typedef {import('mdast').Definition} MdastDefinition\n * @typedef {import('mdast').FootnoteDefinition} MdastFootnoteDefinition\n * @typedef {import('mdast').Parent} MdastParent\n * @typedef {import('mdast').Root} MdastRoot\n */\n\n/**\n * @typedef {HastRoot | HastContent} HastNodes\n * @typedef {MdastRoot | MdastContent} MdastNodes\n * @typedef {Extract} MdastParents\n *\n * @typedef EmbeddedHastFields\n *   hast fields.\n * @property {string | null | undefined} [hName]\n *   Generate a specific element with this tag name instead.\n * @property {HastProperties | null | undefined} [hProperties]\n *   Generate an element with these properties instead.\n * @property {Array | null | undefined} [hChildren]\n *   Generate an element with this content instead.\n *\n * @typedef {Record & EmbeddedHastFields} MdastData\n *   mdast data with embedded hast fields.\n *\n * @typedef {MdastNodes & {data?: MdastData | null | undefined}} MdastNodeWithData\n *   mdast node with embedded hast data.\n *\n * @typedef PointLike\n *   Point-like value.\n * @property {number | null | undefined} [line]\n *   Line.\n * @property {number | null | undefined} [column]\n *   Column.\n * @property {number | null | undefined} [offset]\n *   Offset.\n *\n * @typedef PositionLike\n *   Position-like value.\n * @property {PointLike | null | undefined} [start]\n *   Point-like value.\n * @property {PointLike | null | undefined} [end]\n *   Point-like value.\n *\n * @callback Handler\n *   Handle a node.\n * @param {State} state\n *   Info passed around.\n * @param {any} node\n *   mdast node to handle.\n * @param {MdastParents | null | undefined} parent\n *   Parent of `node`.\n * @returns {HastElementContent | Array | null | undefined}\n *   hast node.\n *\n * @callback HFunctionProps\n *   Signature of `state` for when props are passed.\n * @param {MdastNodes | PositionLike | null | undefined} node\n *   mdast node or unist position.\n * @param {string} tagName\n *   HTML tag name.\n * @param {HastProperties} props\n *   Properties.\n * @param {Array | null | undefined} [children]\n *   hast content.\n * @returns {HastElement}\n *   Compiled element.\n *\n * @callback HFunctionNoProps\n *   Signature of `state` for when no props are passed.\n * @param {MdastNodes | PositionLike | null | undefined} node\n *   mdast node or unist position.\n * @param {string} tagName\n *   HTML tag name.\n * @param {Array | null | undefined} [children]\n *   hast content.\n * @returns {HastElement}\n *   Compiled element.\n *\n * @typedef HFields\n *   Info on `state`.\n * @property {boolean} dangerous\n *   Whether HTML is allowed.\n * @property {string} clobberPrefix\n *   Prefix to use to prevent DOM clobbering.\n * @property {string} footnoteLabel\n *   Label to use to introduce the footnote section.\n * @property {string} footnoteLabelTagName\n *   HTML used for the footnote label.\n * @property {HastProperties} footnoteLabelProperties\n *   Properties on the HTML tag used for the footnote label.\n * @property {string} footnoteBackLabel\n *   Label to use from backreferences back to their footnote call.\n * @property {(identifier: string) => MdastDefinition | null} definition\n *   Definition cache.\n * @property {Record} footnoteById\n *   Footnote definitions by their identifier.\n * @property {Array} footnoteOrder\n *   Identifiers of order when footnote calls first appear in tree order.\n * @property {Record} footnoteCounts\n *   Counts for how often the same footnote was called.\n * @property {Handlers} handlers\n *   Applied handlers.\n * @property {Handler} unknownHandler\n *   Handler for any none not in `passThrough` or otherwise handled.\n * @property {(from: MdastNodes, node: HastNodes) => void} patch\n *   Copy a node’s positional info.\n * @property {(from: MdastNodes, to: Type) => Type | HastElement} applyData\n *   Honor the `data` of `from`, and generate an element instead of `node`.\n * @property {(node: MdastNodes, parent: MdastParents | null | undefined) => HastElementContent | Array | null | undefined} one\n *   Transform an mdast node to hast.\n * @property {(node: MdastNodes) => Array} all\n *   Transform the children of an mdast parent to hast.\n * @property {(nodes: Array, loose?: boolean | null | undefined) => Array} wrap\n *   Wrap `nodes` with line endings between each node, adds initial/final line endings when `loose`.\n * @property {(left: MdastNodeWithData | PositionLike | null | undefined, right: HastElementContent) => HastElementContent} augment\n *   Like `state` but lower-level and usable on non-elements.\n *   Deprecated: use `patch` and `applyData`.\n * @property {Array} passThrough\n *   List of node types to pass through untouched (except for their children).\n *\n * @typedef Options\n *   Configuration (optional).\n * @property {boolean | null | undefined} [allowDangerousHtml=false]\n *   Whether to persist raw HTML in markdown in the hast tree.\n * @property {string | null | undefined} [clobberPrefix='user-content-']\n *   Prefix to use before the `id` attribute on footnotes to prevent it from\n *   *clobbering*.\n * @property {string | null | undefined} [footnoteBackLabel='Back to content']\n *   Label to use from backreferences back to their footnote call (affects\n *   screen readers).\n * @property {string | null | undefined} [footnoteLabel='Footnotes']\n *   Label to use for the footnotes section (affects screen readers).\n * @property {HastProperties | null | undefined} [footnoteLabelProperties={className: ['sr-only']}]\n *   Properties to use on the footnote label (note that `id: 'footnote-label'`\n *   is always added as footnote calls use it with `aria-describedby` to\n *   provide an accessible label).\n * @property {string | null | undefined} [footnoteLabelTagName='h2']\n *   Tag name to use for the footnote label.\n * @property {Handlers | null | undefined} [handlers]\n *   Extra handlers for nodes.\n * @property {Array | null | undefined} [passThrough]\n *   List of custom mdast node types to pass through (keep) in hast (note that\n *   the node itself is passed, but eventual children are transformed).\n * @property {Handler | null | undefined} [unknownHandler]\n *   Handler for all unknown nodes.\n *\n * @typedef {Record} Handlers\n *   Handle nodes.\n *\n * @typedef {HFunctionProps & HFunctionNoProps & HFields} State\n *   Info passed around.\n */\n\nimport {visit} from 'unist-util-visit'\nimport {position, pointStart, pointEnd} from 'unist-util-position'\nimport {generated} from 'unist-util-generated'\nimport {definitions} from 'mdast-util-definitions'\nimport {handlers} from './handlers/index.js'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Create `state` from an mdast tree.\n *\n * @param {MdastNodes} tree\n *   mdast node to transform.\n * @param {Options | null | undefined} [options]\n *   Configuration.\n * @returns {State}\n *   `state` function.\n */\nexport function createState(tree, options) {\n  const settings = options || {}\n  const dangerous = settings.allowDangerousHtml || false\n  /** @type {Record} */\n  const footnoteById = {}\n\n  // To do: next major: add `options` to state, remove:\n  // `dangerous`, `clobberPrefix`, `footnoteLabel`, `footnoteLabelTagName`,\n  // `footnoteLabelProperties`, `footnoteBackLabel`, `passThrough`,\n  // `unknownHandler`.\n\n  // To do: next major: move to `state.options.allowDangerousHtml`.\n  state.dangerous = dangerous\n  // To do: next major: move to `state.options`.\n  state.clobberPrefix =\n    settings.clobberPrefix === undefined || settings.clobberPrefix === null\n      ? 'user-content-'\n      : settings.clobberPrefix\n  // To do: next major: move to `state.options`.\n  state.footnoteLabel = settings.footnoteLabel || 'Footnotes'\n  // To do: next major: move to `state.options`.\n  state.footnoteLabelTagName = settings.footnoteLabelTagName || 'h2'\n  // To do: next major: move to `state.options`.\n  state.footnoteLabelProperties = settings.footnoteLabelProperties || {\n    className: ['sr-only']\n  }\n  // To do: next major: move to `state.options`.\n  state.footnoteBackLabel = settings.footnoteBackLabel || 'Back to content'\n  // To do: next major: move to `state.options`.\n  state.unknownHandler = settings.unknownHandler\n  // To do: next major: move to `state.options`.\n  state.passThrough = settings.passThrough\n\n  state.handlers = {...handlers, ...settings.handlers}\n\n  // To do: next major: replace utility with `definitionById` object, so we\n  // only walk once (as we need footnotes too).\n  state.definition = definitions(tree)\n  state.footnoteById = footnoteById\n  /** @type {Array} */\n  state.footnoteOrder = []\n  /** @type {Record} */\n  state.footnoteCounts = {}\n\n  state.patch = patch\n  state.applyData = applyData\n  state.one = oneBound\n  state.all = allBound\n  state.wrap = wrap\n  // To do: next major: remove `augment`.\n  state.augment = augment\n\n  visit(tree, 'footnoteDefinition', (definition) => {\n    const id = String(definition.identifier).toUpperCase()\n\n    // Mimick CM behavior of link definitions.\n    // See: .\n    if (!own.call(footnoteById, id)) {\n      footnoteById[id] = definition\n    }\n  })\n\n  // @ts-expect-error Hush, it’s fine!\n  return state\n\n  /**\n   * Finalise the created `right`, a hast node, from `left`, an mdast node.\n   *\n   * @param {MdastNodeWithData | PositionLike | null | undefined} left\n   * @param {HastElementContent} right\n   * @returns {HastElementContent}\n   */\n  /* c8 ignore start */\n  // To do: next major: remove.\n  function augment(left, right) {\n    // Handle `data.hName`, `data.hProperties, `data.hChildren`.\n    if (left && 'data' in left && left.data) {\n      /** @type {MdastData} */\n      const data = left.data\n\n      if (data.hName) {\n        if (right.type !== 'element') {\n          right = {\n            type: 'element',\n            tagName: '',\n            properties: {},\n            children: []\n          }\n        }\n\n        right.tagName = data.hName\n      }\n\n      if (right.type === 'element' && data.hProperties) {\n        right.properties = {...right.properties, ...data.hProperties}\n      }\n\n      if ('children' in right && right.children && data.hChildren) {\n        right.children = data.hChildren\n      }\n    }\n\n    if (left) {\n      const ctx = 'type' in left ? left : {position: left}\n\n      if (!generated(ctx)) {\n        // @ts-expect-error: fine.\n        right.position = {start: pointStart(ctx), end: pointEnd(ctx)}\n      }\n    }\n\n    return right\n  }\n  /* c8 ignore stop */\n\n  /**\n   * Create an element for `node`.\n   *\n   * @type {HFunctionProps}\n   */\n  /* c8 ignore start */\n  // To do: next major: remove.\n  function state(node, tagName, props, children) {\n    if (Array.isArray(props)) {\n      children = props\n      props = {}\n    }\n\n    // @ts-expect-error augmenting an element yields an element.\n    return augment(node, {\n      type: 'element',\n      tagName,\n      properties: props || {},\n      children: children || []\n    })\n  }\n  /* c8 ignore stop */\n\n  /**\n   * Transform an mdast node into a hast node.\n   *\n   * @param {MdastNodes} node\n   *   mdast node.\n   * @param {MdastParents | null | undefined} [parent]\n   *   Parent of `node`.\n   * @returns {HastElementContent | Array | null | undefined}\n   *   Resulting hast node.\n   */\n  function oneBound(node, parent) {\n    // @ts-expect-error: that’s a state :)\n    return one(state, node, parent)\n  }\n\n  /**\n   * Transform the children of an mdast node into hast nodes.\n   *\n   * @param {MdastNodes} parent\n   *   mdast node to compile\n   * @returns {Array}\n   *   Resulting hast nodes.\n   */\n  function allBound(parent) {\n    // @ts-expect-error: that’s a state :)\n    return all(state, parent)\n  }\n}\n\n/**\n * Copy a node’s positional info.\n *\n * @param {MdastNodes} from\n *   mdast node to copy from.\n * @param {HastNodes} to\n *   hast node to copy into.\n * @returns {void}\n *   Nothing.\n */\nfunction patch(from, to) {\n  if (from.position) to.position = position(from)\n}\n\n/**\n * Honor the `data` of `from` and maybe generate an element instead of `to`.\n *\n * @template {HastNodes} Type\n *   Node type.\n * @param {MdastNodes} from\n *   mdast node to use data from.\n * @param {Type} to\n *   hast node to change.\n * @returns {Type | HastElement}\n *   Nothing.\n */\nfunction applyData(from, to) {\n  /** @type {Type | HastElement} */\n  let result = to\n\n  // Handle `data.hName`, `data.hProperties, `data.hChildren`.\n  if (from && from.data) {\n    const hName = from.data.hName\n    const hChildren = from.data.hChildren\n    const hProperties = from.data.hProperties\n\n    if (typeof hName === 'string') {\n      // Transforming the node resulted in an element with a different name\n      // than wanted:\n      if (result.type === 'element') {\n        result.tagName = hName\n      }\n      // Transforming the node resulted in a non-element, which happens for\n      // raw, text, and root nodes (unless custom handlers are passed).\n      // The intent is likely to keep the content around (otherwise: pass\n      // `hChildren`).\n      else {\n        result = {\n          type: 'element',\n          tagName: hName,\n          properties: {},\n          children: []\n        }\n\n        // To do: next major: take the children from the `root`, or inject the\n        // raw/text/comment or so into the element?\n        // if ('children' in node) {\n        //   // @ts-expect-error: assume `children` are allowed in elements.\n        //   result.children = node.children\n        // } else {\n        //   // @ts-expect-error: assume `node` is allowed in elements.\n        //   result.children.push(node)\n        // }\n      }\n    }\n\n    if (result.type === 'element' && hProperties) {\n      result.properties = {...result.properties, ...hProperties}\n    }\n\n    if (\n      'children' in result &&\n      result.children &&\n      hChildren !== null &&\n      hChildren !== undefined\n    ) {\n      // @ts-expect-error: assume valid children are defined.\n      result.children = hChildren\n    }\n  }\n\n  return result\n}\n\n/**\n * Transform an mdast node into a hast node.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} node\n *   mdast node.\n * @param {MdastParents | null | undefined} [parent]\n *   Parent of `node`.\n * @returns {HastElementContent | Array | null | undefined}\n *   Resulting hast node.\n */\n// To do: next major: do not expose, keep bound.\nexport function one(state, node, parent) {\n  const type = node && node.type\n\n  // Fail on non-nodes.\n  if (!type) {\n    throw new Error('Expected node, got `' + node + '`')\n  }\n\n  if (own.call(state.handlers, type)) {\n    return state.handlers[type](state, node, parent)\n  }\n\n  if (state.passThrough && state.passThrough.includes(type)) {\n    // To do: next major: deep clone.\n    // @ts-expect-error: types of passed through nodes are expected to be added manually.\n    return 'children' in node ? {...node, children: all(state, node)} : node\n  }\n\n  if (state.unknownHandler) {\n    return state.unknownHandler(state, node, parent)\n  }\n\n  return defaultUnknownHandler(state, node)\n}\n\n/**\n * Transform the children of an mdast node into hast nodes.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} parent\n *   mdast node to compile\n * @returns {Array}\n *   Resulting hast nodes.\n */\n// To do: next major: do not expose, keep bound.\nexport function all(state, parent) {\n  /** @type {Array} */\n  const values = []\n\n  if ('children' in parent) {\n    const nodes = parent.children\n    let index = -1\n    while (++index < nodes.length) {\n      const result = one(state, nodes[index], parent)\n\n      // To do: see if we van clean this? Can we merge texts?\n      if (result) {\n        if (index && nodes[index - 1].type === 'break') {\n          if (!Array.isArray(result) && result.type === 'text') {\n            result.value = result.value.replace(/^\\s+/, '')\n          }\n\n          if (!Array.isArray(result) && result.type === 'element') {\n            const head = result.children[0]\n\n            if (head && head.type === 'text') {\n              head.value = head.value.replace(/^\\s+/, '')\n            }\n          }\n        }\n\n        if (Array.isArray(result)) {\n          values.push(...result)\n        } else {\n          values.push(result)\n        }\n      }\n    }\n  }\n\n  return values\n}\n\n/**\n * Transform an unknown node.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} node\n *   Unknown mdast node.\n * @returns {HastText | HastElement}\n *   Resulting hast node.\n */\nfunction defaultUnknownHandler(state, node) {\n  const data = node.data || {}\n  /** @type {HastText | HastElement} */\n  const result =\n    'value' in node &&\n    !(own.call(data, 'hProperties') || own.call(data, 'hChildren'))\n      ? {type: 'text', value: node.value}\n      : {\n          type: 'element',\n          tagName: 'div',\n          properties: {},\n          children: all(state, node)\n        }\n\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n\n/**\n * Wrap `nodes` with line endings between each node.\n *\n * @template {HastContent} Type\n *   Node type.\n * @param {Array} nodes\n *   List of nodes to wrap.\n * @param {boolean | null | undefined} [loose=false]\n *   Whether to add line endings at start and end.\n * @returns {Array}\n *   Wrapped nodes.\n */\nexport function wrap(nodes, loose) {\n  /** @type {Array} */\n  const result = []\n  let index = -1\n\n  if (loose) {\n    result.push({type: 'text', value: '\\n'})\n  }\n\n  while (++index < nodes.length) {\n    if (index) result.push({type: 'text', value: '\\n'})\n    result.push(nodes[index])\n  }\n\n  if (loose && nodes.length > 0) {\n    result.push({type: 'text', value: '\\n'})\n  }\n\n  return result\n}\n","/**\n * @typedef {import('hast').Content} HastContent\n * @typedef {import('hast').Root} HastRoot\n *\n * @typedef {import('mdast').Content} MdastContent\n * @typedef {import('mdast').Root} MdastRoot\n *\n * @typedef {import('./state.js').Options} Options\n */\n\n/**\n * @typedef {HastRoot | HastContent} HastNodes\n * @typedef {MdastRoot | MdastContent} MdastNodes\n */\n\nimport {footer} from './footer.js'\nimport {createState} from './state.js'\n\n/**\n * Transform mdast to hast.\n *\n * ##### Notes\n *\n * ###### HTML\n *\n * Raw HTML is available in mdast as `html` nodes and can be embedded in hast\n * as semistandard `raw` nodes.\n * Most utilities ignore `raw` nodes but two notable ones don’t:\n *\n * *   `hast-util-to-html` also has an option `allowDangerousHtml` which will\n *     output the raw HTML.\n *     This is typically discouraged as noted by the option name but is useful\n *     if you completely trust authors\n * *   `hast-util-raw` can handle the raw embedded HTML strings by parsing them\n *     into standard hast nodes (`element`, `text`, etc).\n *     This is a heavy task as it needs a full HTML parser, but it is the only\n *     way to support untrusted content\n *\n * ###### Footnotes\n *\n * Many options supported here relate to footnotes.\n * Footnotes are not specified by CommonMark, which we follow by default.\n * They are supported by GitHub, so footnotes can be enabled in markdown with\n * `mdast-util-gfm`.\n *\n * The options `footnoteBackLabel` and `footnoteLabel` define natural language\n * that explains footnotes, which is hidden for sighted users but shown to\n * assistive technology.\n * When your page is not in English, you must define translated values.\n *\n * Back references use ARIA attributes, but the section label itself uses a\n * heading that is hidden with an `sr-only` class.\n * To show it to sighted users, define different attributes in\n * `footnoteLabelProperties`.\n *\n * ###### Clobbering\n *\n * Footnotes introduces a problem, as it links footnote calls to footnote\n * definitions on the page through `id` attributes generated from user content,\n * which results in DOM clobbering.\n *\n * DOM clobbering is this:\n *\n * ```html\n * 
\n * \n * ```\n *\n * Elements by their ID are made available by browsers on the `window` object,\n * which is a security risk.\n * Using a prefix solves this problem.\n *\n * More information on how to handle clobbering and the prefix is explained in\n * Example: headings (DOM clobbering) in `rehype-sanitize`.\n *\n * ###### Unknown nodes\n *\n * Unknown nodes are nodes with a type that isn’t in `handlers` or `passThrough`.\n * The default behavior for unknown nodes is:\n *\n * *   when the node has a `value` (and doesn’t have `data.hName`,\n *     `data.hProperties`, or `data.hChildren`, see later), create a hast `text`\n *     node\n * *   otherwise, create a `
` element (which could be changed with\n *     `data.hName`), with its children mapped from mdast to hast as well\n *\n * This behavior can be changed by passing an `unknownHandler`.\n *\n * @param {MdastNodes} tree\n *   mdast tree.\n * @param {Options | null | undefined} [options]\n *   Configuration.\n * @returns {HastNodes | null | undefined}\n *   hast tree.\n */\n// To do: next major: always return a single `root`.\nexport function toHast(tree, options) {\n  const state = createState(tree, options)\n  const node = state.one(tree, null)\n  const foot = footer(state)\n\n  if (foot) {\n    // @ts-expect-error If there’s a footer, there were definitions, meaning block\n    // content.\n    // So assume `node` is a parent node.\n    node.children.push({type: 'text', value: '\\n'}, foot)\n  }\n\n  // To do: next major: always return root?\n  return Array.isArray(node) ? {type: 'root', children: node} : node\n}\n","/**\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('mdast').Root} MdastRoot\n * @typedef {import('mdast-util-to-hast').Options} Options\n * @typedef {import('unified').Processor} Processor\n *\n * @typedef {import('mdast-util-to-hast')} DoNotTouchAsThisImportIncludesRawInTree\n */\n\nimport {toHast} from 'mdast-util-to-hast'\n\n// Note: the `` overload doesn’t seem to work :'(\n\n/**\n * Plugin that turns markdown into HTML to support rehype.\n *\n * *   If a destination processor is given, that processor runs with a new HTML\n *     (hast) tree (bridge-mode).\n *     As the given processor runs with a hast tree, and rehype plugins support\n *     hast, that means rehype plugins can be used with the given processor.\n *     The hast tree is discarded in the end.\n *     It’s highly unlikely that you want to do this.\n * *   The common case is to not pass a destination processor, in which case the\n *     current processor continues running with a new HTML (hast) tree\n *     (mutate-mode).\n *     As the current processor continues with a hast tree, and rehype plugins\n *     support hast, that means rehype plugins can be used after\n *     `remark-rehype`.\n *     It’s likely that this is what you want to do.\n *\n * @param destination\n *   Optional unified processor.\n * @param options\n *   Options passed to `mdast-util-to-hast`.\n */\nconst remarkRehype =\n  /** @type {(import('unified').Plugin<[Processor, Options?]|[null|undefined, Options?]|[Options]|[], MdastRoot>)} */\n  (\n    function (destination, options) {\n      return destination && 'run' in destination\n        ? bridge(destination, options)\n        : mutate(destination || options)\n    }\n  )\n\nexport default remarkRehype\n\n/**\n * Bridge-mode.\n * Runs the destination with the new hast tree.\n *\n * @type {import('unified').Plugin<[Processor, Options?], MdastRoot>}\n */\nfunction bridge(destination, options) {\n  return (node, file, next) => {\n    destination.run(toHast(node, options), file, (error) => {\n      next(error)\n    })\n  }\n}\n\n/**\n * Mutate-mode.\n * Further plugins run on the hast tree.\n *\n * @type {import('unified').Plugin<[Options?]|void[], MdastRoot, HastRoot>}\n */\nfunction mutate(options) {\n  // @ts-expect-error: assume a corresponding node is returned by `toHast`.\n  return (node) => toHast(node, options)\n}\n","/**\n * @typedef {import('vfile').VFileValue} Value\n * @typedef {import('vfile').VFileOptions} Options\n * @typedef {import('vfile').BufferEncoding} BufferEncoding\n *   Encodings supported by the buffer class.\n *\n *   This is a copy of the types from Node and `VFile`.\n *\n * @typedef ReadOptions\n *   Configuration for `fs.readFile`.\n * @property {BufferEncoding | null | undefined} [encoding]\n *   Encoding to read file as, will turn `file.value` into a string if passed.\n * @property {string | undefined} [flag]\n *   File system flags to use.\n *\n * @typedef WriteOptions\n *   Configuration for `fs.writeFile`.\n * @property {BufferEncoding | null | undefined} [encoding]\n *   Encoding to write file as.\n * @property {number | string | undefined} [mode]\n *   File mode (permission and sticky bits) if the file was newly created.\n * @property {string | undefined} [flag]\n *   File system flags to use.\n *\n * @typedef {URL | Value} Path\n *   URL to file or path to file.\n *\n *   > 👉 **Note**: `Value` is used here because it’s a smarter `Buffer`\n * @typedef {Path | Options | VFile} Compatible\n *   URL to file, path to file, options for file, or actual file.\n */\n\n/**\n * @callback Callback\n *   Callback called after reading or writing a file.\n * @param {NodeJS.ErrnoException | null} error\n *   Error when reading or writing was not successful.\n * @param {VFile | null | undefined} file\n *   File when reading or writing was successful.\n */\n\nimport fs from 'fs'\nimport path from 'path'\nimport {URL} from 'url'\nimport buffer from 'is-buffer'\nimport {VFile} from 'vfile'\n\n// To do: next major: use `node:` prefix.\n// To do: next major: use `URL` from global.\n// To do: next major: Only pass `undefined`.\n\n/**\n * Create a virtual file from a description.\n *\n * This is like `VFile`, but it accepts a file path instead of file cotnents.\n *\n * If `options` is a string, URL, or buffer, it’s used as the path.\n * Otherwise, if it’s a file, that’s returned instead.\n * Otherwise, the options are passed through to `new VFile()`.\n *\n * @param {Compatible | null | undefined} [description]\n *   Path to file, file options, or file itself.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function toVFile(description) {\n  if (typeof description === 'string' || description instanceof URL) {\n    description = {path: description}\n  } else if (buffer(description)) {\n    description = {path: String(description)}\n  }\n\n  return looksLikeAVFile(description)\n    ? description\n    : // To do: remove when `VFile` allows explicit `null`.\n      new VFile(description || undefined)\n}\n\n/**\n * Create a virtual file and read it in, synchronously.\n *\n * @param {Compatible} description\n *   Path to file, file options, or file itself.\n * @param {BufferEncoding | ReadOptions | null | undefined} [options]\n *   Encoding to use or Node.JS read options.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function readSync(description, options) {\n  const file = toVFile(description)\n  file.value = fs.readFileSync(path.resolve(file.cwd, file.path), options)\n  return file\n}\n\n/**\n * Create a virtual file and write it, synchronously.\n *\n * @param {Compatible} description\n *   Path to file, file options, or file itself.\n * @param {BufferEncoding | WriteOptions | null | undefined} [options]\n *   Encoding to use or Node.JS write options.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function writeSync(description, options) {\n  const file = toVFile(description)\n  fs.writeFileSync(path.resolve(file.cwd, file.path), file.value || '', options)\n  return file\n}\n\n/**\n * Create a virtual file and read it in, async.\n *\n * @param description\n *   Path to file, file options, or file itself.\n * @param options\n *   Encoding to use or Node.JS read options.\n * @param callback\n *   Callback called when done.\n * @returns\n *   Nothing when a callback is given, otherwise promise that resolves to given\n *   file or new file.\n */\nexport const read =\n  /**\n   * @type {{\n   *   (description: Compatible, options: BufferEncoding | ReadOptions | null | undefined, callback: Callback): void\n   *   (description: Compatible, callback: Callback): void\n   *   (description: Compatible, options?: BufferEncoding | ReadOptions | null | undefined): Promise\n   * }}\n   */\n  (\n    /**\n     * @param {Compatible} description\n     * @param {BufferEncoding | ReadOptions | null | undefined} [options]\n     * @param {Callback | null | undefined} [callback]\n     */\n    function (description, options, callback) {\n      const file = toVFile(description)\n\n      if (!callback && typeof options === 'function') {\n        callback = options\n        options = null\n      }\n\n      if (!callback) {\n        return new Promise(executor)\n      }\n\n      executor(resolve, callback)\n\n      /**\n       * @param {VFile} result\n       */\n      function resolve(result) {\n        // @ts-expect-error: `callback` always defined.\n        callback(null, result)\n      }\n\n      /**\n       * @param {(error: VFile) => void} resolve\n       * @param {(error: NodeJS.ErrnoException, file?: VFile | undefined) => void} reject\n       */\n      function executor(resolve, reject) {\n        /** @type {string} */\n        let fp\n\n        try {\n          fp = path.resolve(file.cwd, file.path)\n        } catch (error) {\n          const exception = /** @type {NodeJS.ErrnoException} */ (error)\n          return reject(exception)\n        }\n\n        fs.readFile(fp, options, done)\n\n        /**\n         * @param {NodeJS.ErrnoException | null} error\n         * @param {Value} result\n         */\n        function done(error, result) {\n          if (error) {\n            reject(error)\n          } else {\n            file.value = result\n            resolve(file)\n          }\n        }\n      }\n    }\n  )\n\n/**\n * Create a virtual file and write it, async.\n *\n * @param description\n *   Path to file, file options, or file itself.\n * @param options\n *   Encoding to use or Node.JS write options.\n * @param callback\n *   Callback called when done.\n * @returns\n *   Nothing when a callback is given, otherwise promise that resolves to given\n *   file or new file.\n */\nexport const write =\n  /**\n   * @type {{\n   *   (description: Compatible, options: BufferEncoding | WriteOptions | null | undefined, callback: Callback): void\n   *   (description: Compatible, callback: Callback): void\n   *   (description: Compatible, options?: BufferEncoding | WriteOptions | null | undefined): Promise\n   * }}\n   */\n  (\n    /**\n     * @param {Compatible} description\n     * @param {BufferEncoding | WriteOptions | null | undefined} [options]\n     * @param {Callback | null | undefined} [callback]\n     */\n    function (description, options, callback) {\n      const file = toVFile(description)\n\n      // Weird, right? Otherwise `fs` doesn’t accept it.\n      if (!callback && typeof options === 'function') {\n        callback = options\n        options = undefined\n      }\n\n      if (!callback) {\n        return new Promise(executor)\n      }\n\n      executor(resolve, callback)\n\n      /**\n       * @param {VFile} result\n       */\n      function resolve(result) {\n        // @ts-expect-error: `callback` always defined.\n        callback(null, result)\n      }\n\n      /**\n       * @param {(error: VFile) => void} resolve\n       * @param {(error: NodeJS.ErrnoException, file: VFile | null) => void} reject\n       */\n      function executor(resolve, reject) {\n        /** @type {string} */\n        let fp\n\n        try {\n          fp = path.resolve(file.cwd, file.path)\n        } catch (error) {\n          const exception = /** @type {NodeJS.ErrnoException} */ (error)\n          return reject(exception, null)\n        }\n\n        fs.writeFile(fp, file.value || '', options || null, done)\n\n        /**\n         * @param {NodeJS.ErrnoException | null} error\n         */\n        function done(error) {\n          if (error) {\n            reject(error, null)\n          } else {\n            resolve(file)\n          }\n        }\n      }\n    }\n  )\n\n/**\n * Check if something looks like a vfile.\n *\n * @param {Compatible | null | undefined} value\n *   Value.\n * @returns {value is VFile}\n *   Whether `value` looks like a `VFile`.\n */\nfunction looksLikeAVFile(value) {\n  return Boolean(\n    value &&\n      typeof value === 'object' &&\n      'message' in value &&\n      'messages' in value\n  )\n}\n\n// To do: next major: remove?\ntoVFile.readSync = readSync\ntoVFile.writeSync = writeSync\ntoVFile.read = read\ntoVFile.write = write\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nexport class InvalidTemplateError extends Error {\n}\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nimport path from \"node:path\";\nimport { visit } from \"unist-util-visit\";\nfunction isImage(node) {\n    return (node.tagName.toLowerCase() === \"img\" &&\n        node.properties != null &&\n        \"src\" in node.properties);\n}\n/**\n * Plugin to add attachments images in frontmatter\n */\nconst rehypeAddAttachmentsImages = function rehypeAddAttachmentsImages() {\n    return function (tree, file) {\n        const images = {};\n        visit(tree, \"element\", function (node) {\n            if (isImage(node)) {\n                const base = file.dirname\n                    ? path.resolve(file.cwd, file.dirname)\n                    : file.cwd;\n                const url = path.resolve(base, node.properties?.src);\n                const baseName = path.basename(url);\n                images[baseName] = url;\n                node.properties = { ...node.properties, src: baseName };\n            }\n        });\n        file.data.images = images;\n    };\n};\nexport default rehypeAddAttachmentsImages;\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nfunction composeNotice(message) {\n    return {\n        type: \"element\",\n        tagName: \"p\",\n        children: [\n            {\n                type: \"element\",\n                tagName: \"strong\",\n                children: [{ type: \"raw\", value: message }],\n            },\n        ],\n    };\n}\n/**\n * UnifiedPlugin to add a notice to the AST.\n */\nconst rehypeAddNotice = function rehypeAddNotice(options) {\n    return function (tree) {\n        tree.children.unshift(composeNotice(options.noticeMessage));\n    };\n};\nexport default rehypeAddNotice;\n","/**\n * @typedef {import('./info.js').Info} Info\n * @typedef {Record} Properties\n * @typedef {Record} Normal\n */\n\nexport class Schema {\n  /**\n   * @constructor\n   * @param {Properties} property\n   * @param {Normal} normal\n   * @param {string} [space]\n   */\n  constructor(property, normal, space) {\n    this.property = property\n    this.normal = normal\n    if (space) {\n      this.space = space\n    }\n  }\n}\n\n/** @type {Properties} */\nSchema.prototype.property = {}\n/** @type {Normal} */\nSchema.prototype.normal = {}\n/** @type {string|null} */\nSchema.prototype.space = null\n","/**\n * @typedef {import('./schema.js').Properties} Properties\n * @typedef {import('./schema.js').Normal} Normal\n */\n\nimport {Schema} from './schema.js'\n\n/**\n * @param {Schema[]} definitions\n * @param {string} [space]\n * @returns {Schema}\n */\nexport function merge(definitions, space) {\n  /** @type {Properties} */\n  const property = {}\n  /** @type {Normal} */\n  const normal = {}\n  let index = -1\n\n  while (++index < definitions.length) {\n    Object.assign(property, definitions[index].property)\n    Object.assign(normal, definitions[index].normal)\n  }\n\n  return new Schema(property, normal, space)\n}\n","/**\n * @param {string} value\n * @returns {string}\n */\nexport function normalize(value) {\n  return value.toLowerCase()\n}\n","export class Info {\n  /**\n   * @constructor\n   * @param {string} property\n   * @param {string} attribute\n   */\n  constructor(property, attribute) {\n    /** @type {string} */\n    this.property = property\n    /** @type {string} */\n    this.attribute = attribute\n  }\n}\n\n/** @type {string|null} */\nInfo.prototype.space = null\nInfo.prototype.boolean = false\nInfo.prototype.booleanish = false\nInfo.prototype.overloadedBoolean = false\nInfo.prototype.number = false\nInfo.prototype.commaSeparated = false\nInfo.prototype.spaceSeparated = false\nInfo.prototype.commaOrSpaceSeparated = false\nInfo.prototype.mustUseProperty = false\nInfo.prototype.defined = false\n","let powers = 0\n\nexport const boolean = increment()\nexport const booleanish = increment()\nexport const overloadedBoolean = increment()\nexport const number = increment()\nexport const spaceSeparated = increment()\nexport const commaSeparated = increment()\nexport const commaOrSpaceSeparated = increment()\n\nfunction increment() {\n  return 2 ** ++powers\n}\n","import {Info} from './info.js'\nimport * as types from './types.js'\n\n/** @type {Array} */\n// @ts-expect-error: hush.\nconst checks = Object.keys(types)\n\nexport class DefinedInfo extends Info {\n  /**\n   * @constructor\n   * @param {string} property\n   * @param {string} attribute\n   * @param {number|null} [mask]\n   * @param {string} [space]\n   */\n  constructor(property, attribute, mask, space) {\n    let index = -1\n\n    super(property, attribute)\n\n    mark(this, 'space', space)\n\n    if (typeof mask === 'number') {\n      while (++index < checks.length) {\n        const check = checks[index]\n        mark(this, checks[index], (mask & types[check]) === types[check])\n      }\n    }\n  }\n}\n\nDefinedInfo.prototype.defined = true\n\n/**\n * @param {DefinedInfo} values\n * @param {string} key\n * @param {unknown} value\n */\nfunction mark(values, key, value) {\n  if (value) {\n    // @ts-expect-error: assume `value` matches the expected value of `key`.\n    values[key] = value\n  }\n}\n","/**\n * @typedef {import('./schema.js').Properties} Properties\n * @typedef {import('./schema.js').Normal} Normal\n *\n * @typedef {Record} Attributes\n *\n * @typedef {Object} Definition\n * @property {Record} properties\n * @property {(attributes: Attributes, property: string) => string} transform\n * @property {string} [space]\n * @property {Attributes} [attributes]\n * @property {Array} [mustUseProperty]\n */\n\nimport {normalize} from '../normalize.js'\nimport {Schema} from './schema.js'\nimport {DefinedInfo} from './defined-info.js'\n\nconst own = {}.hasOwnProperty\n\n/**\n * @param {Definition} definition\n * @returns {Schema}\n */\nexport function create(definition) {\n  /** @type {Properties} */\n  const property = {}\n  /** @type {Normal} */\n  const normal = {}\n  /** @type {string} */\n  let prop\n\n  for (prop in definition.properties) {\n    if (own.call(definition.properties, prop)) {\n      const value = definition.properties[prop]\n      const info = new DefinedInfo(\n        prop,\n        definition.transform(definition.attributes || {}, prop),\n        value,\n        definition.space\n      )\n\n      if (\n        definition.mustUseProperty &&\n        definition.mustUseProperty.includes(prop)\n      ) {\n        info.mustUseProperty = true\n      }\n\n      property[prop] = info\n\n      normal[normalize(prop)] = prop\n      normal[normalize(info.attribute)] = prop\n    }\n  }\n\n  return new Schema(property, normal, definition.space)\n}\n","import {create} from './util/create.js'\n\nexport const xlink = create({\n  space: 'xlink',\n  transform(_, prop) {\n    return 'xlink:' + prop.slice(5).toLowerCase()\n  },\n  properties: {\n    xLinkActuate: null,\n    xLinkArcRole: null,\n    xLinkHref: null,\n    xLinkRole: null,\n    xLinkShow: null,\n    xLinkTitle: null,\n    xLinkType: null\n  }\n})\n","import {create} from './util/create.js'\n\nexport const xml = create({\n  space: 'xml',\n  transform(_, prop) {\n    return 'xml:' + prop.slice(3).toLowerCase()\n  },\n  properties: {xmlLang: null, xmlBase: null, xmlSpace: null}\n})\n","/**\n * @param {Record} attributes\n * @param {string} attribute\n * @returns {string}\n */\nexport function caseSensitiveTransform(attributes, attribute) {\n  return attribute in attributes ? attributes[attribute] : attribute\n}\n","import {caseSensitiveTransform} from './case-sensitive-transform.js'\n\n/**\n * @param {Record} attributes\n * @param {string} property\n * @returns {string}\n */\nexport function caseInsensitiveTransform(attributes, property) {\n  return caseSensitiveTransform(attributes, property.toLowerCase())\n}\n","import {create} from './util/create.js'\nimport {caseInsensitiveTransform} from './util/case-insensitive-transform.js'\n\nexport const xmlns = create({\n  space: 'xmlns',\n  attributes: {xmlnsxlink: 'xmlns:xlink'},\n  transform: caseInsensitiveTransform,\n  properties: {xmlns: null, xmlnsXLink: null}\n})\n","import {booleanish, number, spaceSeparated} from './util/types.js'\nimport {create} from './util/create.js'\n\nexport const aria = create({\n  transform(_, prop) {\n    return prop === 'role' ? prop : 'aria-' + prop.slice(4).toLowerCase()\n  },\n  properties: {\n    ariaActiveDescendant: null,\n    ariaAtomic: booleanish,\n    ariaAutoComplete: null,\n    ariaBusy: booleanish,\n    ariaChecked: booleanish,\n    ariaColCount: number,\n    ariaColIndex: number,\n    ariaColSpan: number,\n    ariaControls: spaceSeparated,\n    ariaCurrent: null,\n    ariaDescribedBy: spaceSeparated,\n    ariaDetails: null,\n    ariaDisabled: booleanish,\n    ariaDropEffect: spaceSeparated,\n    ariaErrorMessage: null,\n    ariaExpanded: booleanish,\n    ariaFlowTo: spaceSeparated,\n    ariaGrabbed: booleanish,\n    ariaHasPopup: null,\n    ariaHidden: booleanish,\n    ariaInvalid: null,\n    ariaKeyShortcuts: null,\n    ariaLabel: null,\n    ariaLabelledBy: spaceSeparated,\n    ariaLevel: number,\n    ariaLive: null,\n    ariaModal: booleanish,\n    ariaMultiLine: booleanish,\n    ariaMultiSelectable: booleanish,\n    ariaOrientation: null,\n    ariaOwns: spaceSeparated,\n    ariaPlaceholder: null,\n    ariaPosInSet: number,\n    ariaPressed: booleanish,\n    ariaReadOnly: booleanish,\n    ariaRelevant: null,\n    ariaRequired: booleanish,\n    ariaRoleDescription: spaceSeparated,\n    ariaRowCount: number,\n    ariaRowIndex: number,\n    ariaRowSpan: number,\n    ariaSelected: booleanish,\n    ariaSetSize: number,\n    ariaSort: null,\n    ariaValueMax: number,\n    ariaValueMin: number,\n    ariaValueNow: number,\n    ariaValueText: null,\n    role: null\n  }\n})\n","import {\n  boolean,\n  overloadedBoolean,\n  booleanish,\n  number,\n  spaceSeparated,\n  commaSeparated\n} from './util/types.js'\nimport {create} from './util/create.js'\nimport {caseInsensitiveTransform} from './util/case-insensitive-transform.js'\n\nexport const html = create({\n  space: 'html',\n  attributes: {\n    acceptcharset: 'accept-charset',\n    classname: 'class',\n    htmlfor: 'for',\n    httpequiv: 'http-equiv'\n  },\n  transform: caseInsensitiveTransform,\n  mustUseProperty: ['checked', 'multiple', 'muted', 'selected'],\n  properties: {\n    // Standard Properties.\n    abbr: null,\n    accept: commaSeparated,\n    acceptCharset: spaceSeparated,\n    accessKey: spaceSeparated,\n    action: null,\n    allow: null,\n    allowFullScreen: boolean,\n    allowPaymentRequest: boolean,\n    allowUserMedia: boolean,\n    alt: null,\n    as: null,\n    async: boolean,\n    autoCapitalize: null,\n    autoComplete: spaceSeparated,\n    autoFocus: boolean,\n    autoPlay: boolean,\n    blocking: spaceSeparated,\n    capture: null,\n    charSet: null,\n    checked: boolean,\n    cite: null,\n    className: spaceSeparated,\n    cols: number,\n    colSpan: null,\n    content: null,\n    contentEditable: booleanish,\n    controls: boolean,\n    controlsList: spaceSeparated,\n    coords: number | commaSeparated,\n    crossOrigin: null,\n    data: null,\n    dateTime: null,\n    decoding: null,\n    default: boolean,\n    defer: boolean,\n    dir: null,\n    dirName: null,\n    disabled: boolean,\n    download: overloadedBoolean,\n    draggable: booleanish,\n    encType: null,\n    enterKeyHint: null,\n    fetchPriority: null,\n    form: null,\n    formAction: null,\n    formEncType: null,\n    formMethod: null,\n    formNoValidate: boolean,\n    formTarget: null,\n    headers: spaceSeparated,\n    height: number,\n    hidden: boolean,\n    high: number,\n    href: null,\n    hrefLang: null,\n    htmlFor: spaceSeparated,\n    httpEquiv: spaceSeparated,\n    id: null,\n    imageSizes: null,\n    imageSrcSet: null,\n    inert: boolean,\n    inputMode: null,\n    integrity: null,\n    is: null,\n    isMap: boolean,\n    itemId: null,\n    itemProp: spaceSeparated,\n    itemRef: spaceSeparated,\n    itemScope: boolean,\n    itemType: spaceSeparated,\n    kind: null,\n    label: null,\n    lang: null,\n    language: null,\n    list: null,\n    loading: null,\n    loop: boolean,\n    low: number,\n    manifest: null,\n    max: null,\n    maxLength: number,\n    media: null,\n    method: null,\n    min: null,\n    minLength: number,\n    multiple: boolean,\n    muted: boolean,\n    name: null,\n    nonce: null,\n    noModule: boolean,\n    noValidate: boolean,\n    onAbort: null,\n    onAfterPrint: null,\n    onAuxClick: null,\n    onBeforeMatch: null,\n    onBeforePrint: null,\n    onBeforeToggle: null,\n    onBeforeUnload: null,\n    onBlur: null,\n    onCancel: null,\n    onCanPlay: null,\n    onCanPlayThrough: null,\n    onChange: null,\n    onClick: null,\n    onClose: null,\n    onContextLost: null,\n    onContextMenu: null,\n    onContextRestored: null,\n    onCopy: null,\n    onCueChange: null,\n    onCut: null,\n    onDblClick: null,\n    onDrag: null,\n    onDragEnd: null,\n    onDragEnter: null,\n    onDragExit: null,\n    onDragLeave: null,\n    onDragOver: null,\n    onDragStart: null,\n    onDrop: null,\n    onDurationChange: null,\n    onEmptied: null,\n    onEnded: null,\n    onError: null,\n    onFocus: null,\n    onFormData: null,\n    onHashChange: null,\n    onInput: null,\n    onInvalid: null,\n    onKeyDown: null,\n    onKeyPress: null,\n    onKeyUp: null,\n    onLanguageChange: null,\n    onLoad: null,\n    onLoadedData: null,\n    onLoadedMetadata: null,\n    onLoadEnd: null,\n    onLoadStart: null,\n    onMessage: null,\n    onMessageError: null,\n    onMouseDown: null,\n    onMouseEnter: null,\n    onMouseLeave: null,\n    onMouseMove: null,\n    onMouseOut: null,\n    onMouseOver: null,\n    onMouseUp: null,\n    onOffline: null,\n    onOnline: null,\n    onPageHide: null,\n    onPageShow: null,\n    onPaste: null,\n    onPause: null,\n    onPlay: null,\n    onPlaying: null,\n    onPopState: null,\n    onProgress: null,\n    onRateChange: null,\n    onRejectionHandled: null,\n    onReset: null,\n    onResize: null,\n    onScroll: null,\n    onScrollEnd: null,\n    onSecurityPolicyViolation: null,\n    onSeeked: null,\n    onSeeking: null,\n    onSelect: null,\n    onSlotChange: null,\n    onStalled: null,\n    onStorage: null,\n    onSubmit: null,\n    onSuspend: null,\n    onTimeUpdate: null,\n    onToggle: null,\n    onUnhandledRejection: null,\n    onUnload: null,\n    onVolumeChange: null,\n    onWaiting: null,\n    onWheel: null,\n    open: boolean,\n    optimum: number,\n    pattern: null,\n    ping: spaceSeparated,\n    placeholder: null,\n    playsInline: boolean,\n    popover: null,\n    popoverTarget: null,\n    popoverTargetAction: null,\n    poster: null,\n    preload: null,\n    readOnly: boolean,\n    referrerPolicy: null,\n    rel: spaceSeparated,\n    required: boolean,\n    reversed: boolean,\n    rows: number,\n    rowSpan: number,\n    sandbox: spaceSeparated,\n    scope: null,\n    scoped: boolean,\n    seamless: boolean,\n    selected: boolean,\n    shadowRootClonable: boolean,\n    shadowRootDelegatesFocus: boolean,\n    shadowRootMode: null,\n    shape: null,\n    size: number,\n    sizes: null,\n    slot: null,\n    span: number,\n    spellCheck: booleanish,\n    src: null,\n    srcDoc: null,\n    srcLang: null,\n    srcSet: null,\n    start: number,\n    step: null,\n    style: null,\n    tabIndex: number,\n    target: null,\n    title: null,\n    translate: null,\n    type: null,\n    typeMustMatch: boolean,\n    useMap: null,\n    value: booleanish,\n    width: number,\n    wrap: null,\n    writingSuggestions: null,\n\n    // Legacy.\n    // See: https://html.spec.whatwg.org/#other-elements,-attributes-and-apis\n    align: null, // Several. Use CSS `text-align` instead,\n    aLink: null, // ``. Use CSS `a:active {color}` instead\n    archive: spaceSeparated, // ``. List of URIs to archives\n    axis: null, // `
` and ``. Use `scope` on ``\n background: null, // ``. Use CSS `background-image` instead\n bgColor: null, // `` and table elements. Use CSS `background-color` instead\n border: number, // ``. Use CSS `border-width` instead,\n borderColor: null, // `
`. Use CSS `border-color` instead,\n bottomMargin: number, // ``\n cellPadding: null, // `
`\n cellSpacing: null, // `
`\n char: null, // Several table elements. When `align=char`, sets the character to align on\n charOff: null, // Several table elements. When `char`, offsets the alignment\n classId: null, // ``\n clear: null, // `
`. Use CSS `clear` instead\n code: null, // ``\n codeBase: null, // ``\n codeType: null, // ``\n color: null, // `` and `
`. Use CSS instead\n compact: boolean, // Lists. Use CSS to reduce space between items instead\n declare: boolean, // ``\n event: null, // `\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationRawTagOpen(code) {\n if (code === 47) {\n effects.consume(code)\n buffer = ''\n return continuationRawEndTag\n }\n return continuation(code)\n }\n\n /**\n * In raw continuation, after ` | \n * ^^^^^^\n * ```\n *\n * @type {State}\n */\n function continuationRawEndTag(code) {\n if (code === 62) {\n const name = buffer.toLowerCase()\n if (htmlRawNames.includes(name)) {\n effects.consume(code)\n return continuationClose\n }\n return continuation(code)\n }\n if (asciiAlpha(code) && buffer.length < 8) {\n effects.consume(code)\n // @ts-expect-error: not null.\n buffer += String.fromCharCode(code)\n return continuationRawEndTag\n }\n return continuation(code)\n }\n\n /**\n * In cdata continuation, after `]`, expecting `]>`.\n *\n * ```markdown\n * > | &<]]>\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationCdataInside(code) {\n if (code === 93) {\n effects.consume(code)\n return continuationDeclarationInside\n }\n return continuation(code)\n }\n\n /**\n * In declaration or instruction continuation, at `>`.\n *\n * ```markdown\n * > | \n * ^\n * > | \n * ^\n * > | \n * ^\n * > | \n * ^\n * > | &<]]>\n * ^\n * ```\n *\n * @type {State}\n */\n function continuationDeclarationInside(code) {\n if (code === 62) {\n effects.consume(code)\n return continuationClose\n }\n\n // More dashes.\n if (code === 45 && marker === 2) {\n effects.consume(code)\n return continuationDeclarationInside\n }\n return continuation(code)\n }\n\n /**\n * In closed continuation: everything we get until the eol/eof is part of it.\n *\n * ```markdown\n * > | \n * ^\n * ```\n *\n * @type {State}\n */\n function continuationClose(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('htmlFlowData')\n return continuationAfter(code)\n }\n effects.consume(code)\n return continuationClose\n }\n\n /**\n * Done.\n *\n * ```markdown\n * > | \n * ^\n * ```\n *\n * @type {State}\n */\n function continuationAfter(code) {\n effects.exit('htmlFlow')\n // // Feel free to interrupt.\n // tokenizer.interrupt = false\n // // No longer concrete.\n // tokenizer.concrete = false\n return ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuationStart(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * At eol, before continuation.\n *\n * ```markdown\n * > | * ```js\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n if (markdownLineEnding(code)) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return after\n }\n return nok(code)\n }\n\n /**\n * A continuation.\n *\n * ```markdown\n * | * ```js\n * > | b\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n return self.parser.lazy[self.now().line] ? nok(code) : ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeBlankLineBefore(effects, ok, nok) {\n return start\n\n /**\n * Before eol, expecting blank line.\n *\n * ```markdown\n * > |
\n * ^\n * |\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return effects.attempt(blankLine, ok, nok)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEnding, markdownSpace} from 'micromark-util-character'\n/** @type {Construct} */\nconst nonLazyContinuation = {\n tokenize: tokenizeNonLazyContinuation,\n partial: true\n}\n\n/** @type {Construct} */\nexport const codeFenced = {\n name: 'codeFenced',\n tokenize: tokenizeCodeFenced,\n concrete: true\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCodeFenced(effects, ok, nok) {\n const self = this\n /** @type {Construct} */\n const closeStart = {\n tokenize: tokenizeCloseStart,\n partial: true\n }\n let initialPrefix = 0\n let sizeOpen = 0\n /** @type {NonNullable} */\n let marker\n return start\n\n /**\n * Start of code.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // To do: parse whitespace like `markdown-rs`.\n return beforeSequenceOpen(code)\n }\n\n /**\n * In opening fence, after prefix, at sequence.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function beforeSequenceOpen(code) {\n const tail = self.events[self.events.length - 1]\n initialPrefix =\n tail && tail[1].type === 'linePrefix'\n ? tail[2].sliceSerialize(tail[1], true).length\n : 0\n marker = code\n effects.enter('codeFenced')\n effects.enter('codeFencedFence')\n effects.enter('codeFencedFenceSequence')\n return sequenceOpen(code)\n }\n\n /**\n * In opening fence sequence.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function sequenceOpen(code) {\n if (code === marker) {\n sizeOpen++\n effects.consume(code)\n return sequenceOpen\n }\n if (sizeOpen < 3) {\n return nok(code)\n }\n effects.exit('codeFencedFenceSequence')\n return markdownSpace(code)\n ? factorySpace(effects, infoBefore, 'whitespace')(code)\n : infoBefore(code)\n }\n\n /**\n * In opening fence, after the sequence (and optional whitespace), before info.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function infoBefore(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFencedFence')\n return self.interrupt\n ? ok(code)\n : effects.check(nonLazyContinuation, atNonLazyBreak, after)(code)\n }\n effects.enter('codeFencedFenceInfo')\n effects.enter('chunkString', {\n contentType: 'string'\n })\n return info(code)\n }\n\n /**\n * In info.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function info(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceInfo')\n return infoBefore(code)\n }\n if (markdownSpace(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceInfo')\n return factorySpace(effects, metaBefore, 'whitespace')(code)\n }\n if (code === 96 && code === marker) {\n return nok(code)\n }\n effects.consume(code)\n return info\n }\n\n /**\n * In opening fence, after info and whitespace, before meta.\n *\n * ```markdown\n * > | ~~~js eval\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function metaBefore(code) {\n if (code === null || markdownLineEnding(code)) {\n return infoBefore(code)\n }\n effects.enter('codeFencedFenceMeta')\n effects.enter('chunkString', {\n contentType: 'string'\n })\n return meta(code)\n }\n\n /**\n * In meta.\n *\n * ```markdown\n * > | ~~~js eval\n * ^\n * | alert(1)\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function meta(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('chunkString')\n effects.exit('codeFencedFenceMeta')\n return infoBefore(code)\n }\n if (code === 96 && code === marker) {\n return nok(code)\n }\n effects.consume(code)\n return meta\n }\n\n /**\n * At eol/eof in code, before a non-lazy closing fence or content.\n *\n * ```markdown\n * > | ~~~js\n * ^\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function atNonLazyBreak(code) {\n return effects.attempt(closeStart, after, contentBefore)(code)\n }\n\n /**\n * Before code content, not a closing fence, at eol.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentBefore(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return contentStart\n }\n\n /**\n * Before code content, not a closing fence.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentStart(code) {\n return initialPrefix > 0 && markdownSpace(code)\n ? factorySpace(\n effects,\n beforeContentChunk,\n 'linePrefix',\n initialPrefix + 1\n )(code)\n : beforeContentChunk(code)\n }\n\n /**\n * Before code content, after optional prefix.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function beforeContentChunk(code) {\n if (code === null || markdownLineEnding(code)) {\n return effects.check(nonLazyContinuation, atNonLazyBreak, after)(code)\n }\n effects.enter('codeFlowValue')\n return contentChunk(code)\n }\n\n /**\n * In code content.\n *\n * ```markdown\n * | ~~~js\n * > | alert(1)\n * ^^^^^^^^\n * | ~~~\n * ```\n *\n * @type {State}\n */\n function contentChunk(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFlowValue')\n return beforeContentChunk(code)\n }\n effects.consume(code)\n return contentChunk\n }\n\n /**\n * After code.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n effects.exit('codeFenced')\n return ok(code)\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeCloseStart(effects, ok, nok) {\n let size = 0\n return startBefore\n\n /**\n *\n *\n * @type {State}\n */\n function startBefore(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return start\n }\n\n /**\n * Before closing fence, at optional whitespace.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // Always populated by defaults.\n\n // To do: `enter` here or in next state?\n effects.enter('codeFencedFence')\n return markdownSpace(code)\n ? factorySpace(\n effects,\n beforeSequenceClose,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n : beforeSequenceClose(code)\n }\n\n /**\n * In closing fence, after optional whitespace, at sequence.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function beforeSequenceClose(code) {\n if (code === marker) {\n effects.enter('codeFencedFenceSequence')\n return sequenceClose(code)\n }\n return nok(code)\n }\n\n /**\n * In closing fence sequence.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceClose(code) {\n if (code === marker) {\n size++\n effects.consume(code)\n return sequenceClose\n }\n if (size >= sizeOpen) {\n effects.exit('codeFencedFenceSequence')\n return markdownSpace(code)\n ? factorySpace(effects, sequenceCloseAfter, 'whitespace')(code)\n : sequenceCloseAfter(code)\n }\n return nok(code)\n }\n\n /**\n * After closing fence sequence, after optional whitespace.\n *\n * ```markdown\n * | ~~~js\n * | alert(1)\n * > | ~~~\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceCloseAfter(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit('codeFencedFence')\n return ok(code)\n }\n return nok(code)\n }\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeNonLazyContinuation(effects, ok, nok) {\n const self = this\n return start\n\n /**\n *\n *\n * @type {State}\n */\n function start(code) {\n if (code === null) {\n return nok(code)\n }\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return lineStart\n }\n\n /**\n *\n *\n * @type {State}\n */\n function lineStart(code) {\n return self.parser.lazy[self.now().line] ? nok(code) : ok(code)\n }\n}\n","/**\n * Map of named character references.\n *\n * @type {Record}\n */\nexport const characterEntities = {\n AElig: 'Æ',\n AMP: '&',\n Aacute: 'Á',\n Abreve: 'Ă',\n Acirc: 'Â',\n Acy: 'А',\n Afr: '𝔄',\n Agrave: 'À',\n Alpha: 'Α',\n Amacr: 'Ā',\n And: '⩓',\n Aogon: 'Ą',\n Aopf: '𝔸',\n ApplyFunction: '⁡',\n Aring: 'Å',\n Ascr: '𝒜',\n Assign: '≔',\n Atilde: 'Ã',\n Auml: 'Ä',\n Backslash: '∖',\n Barv: '⫧',\n Barwed: '⌆',\n Bcy: 'Б',\n Because: '∵',\n Bernoullis: 'ℬ',\n Beta: 'Β',\n Bfr: '𝔅',\n Bopf: '𝔹',\n Breve: '˘',\n Bscr: 'ℬ',\n Bumpeq: '≎',\n CHcy: 'Ч',\n COPY: '©',\n Cacute: 'Ć',\n Cap: '⋒',\n CapitalDifferentialD: 'ⅅ',\n Cayleys: 'ℭ',\n Ccaron: 'Č',\n Ccedil: 'Ç',\n Ccirc: 'Ĉ',\n Cconint: '∰',\n Cdot: 'Ċ',\n Cedilla: '¸',\n CenterDot: '·',\n Cfr: 'ℭ',\n Chi: 'Χ',\n CircleDot: '⊙',\n CircleMinus: '⊖',\n CirclePlus: '⊕',\n CircleTimes: '⊗',\n ClockwiseContourIntegral: '∲',\n CloseCurlyDoubleQuote: '”',\n CloseCurlyQuote: '’',\n Colon: '∷',\n Colone: '⩴',\n Congruent: '≡',\n Conint: '∯',\n ContourIntegral: '∮',\n Copf: 'ℂ',\n Coproduct: '∐',\n CounterClockwiseContourIntegral: '∳',\n Cross: '⨯',\n Cscr: '𝒞',\n Cup: '⋓',\n CupCap: '≍',\n DD: 'ⅅ',\n DDotrahd: '⤑',\n DJcy: 'Ђ',\n DScy: 'Ѕ',\n DZcy: 'Џ',\n Dagger: '‡',\n Darr: '↡',\n Dashv: '⫤',\n Dcaron: 'Ď',\n Dcy: 'Д',\n Del: '∇',\n Delta: 'Δ',\n Dfr: '𝔇',\n DiacriticalAcute: '´',\n DiacriticalDot: '˙',\n DiacriticalDoubleAcute: '˝',\n DiacriticalGrave: '`',\n DiacriticalTilde: '˜',\n Diamond: '⋄',\n DifferentialD: 'ⅆ',\n Dopf: '𝔻',\n Dot: '¨',\n DotDot: '⃜',\n DotEqual: '≐',\n DoubleContourIntegral: '∯',\n DoubleDot: '¨',\n DoubleDownArrow: '⇓',\n DoubleLeftArrow: '⇐',\n DoubleLeftRightArrow: '⇔',\n DoubleLeftTee: '⫤',\n DoubleLongLeftArrow: '⟸',\n DoubleLongLeftRightArrow: '⟺',\n DoubleLongRightArrow: '⟹',\n DoubleRightArrow: '⇒',\n DoubleRightTee: '⊨',\n DoubleUpArrow: '⇑',\n DoubleUpDownArrow: '⇕',\n DoubleVerticalBar: '∥',\n DownArrow: '↓',\n DownArrowBar: '⤓',\n DownArrowUpArrow: '⇵',\n DownBreve: '̑',\n DownLeftRightVector: '⥐',\n DownLeftTeeVector: '⥞',\n DownLeftVector: '↽',\n DownLeftVectorBar: '⥖',\n DownRightTeeVector: '⥟',\n DownRightVector: '⇁',\n DownRightVectorBar: '⥗',\n DownTee: '⊤',\n DownTeeArrow: '↧',\n Downarrow: '⇓',\n Dscr: '𝒟',\n Dstrok: 'Đ',\n ENG: 'Ŋ',\n ETH: 'Ð',\n Eacute: 'É',\n Ecaron: 'Ě',\n Ecirc: 'Ê',\n Ecy: 'Э',\n Edot: 'Ė',\n Efr: '𝔈',\n Egrave: 'È',\n Element: '∈',\n Emacr: 'Ē',\n EmptySmallSquare: '◻',\n EmptyVerySmallSquare: '▫',\n Eogon: 'Ę',\n Eopf: '𝔼',\n Epsilon: 'Ε',\n Equal: '⩵',\n EqualTilde: '≂',\n Equilibrium: '⇌',\n Escr: 'ℰ',\n Esim: '⩳',\n Eta: 'Η',\n Euml: 'Ë',\n Exists: '∃',\n ExponentialE: 'ⅇ',\n Fcy: 'Ф',\n Ffr: '𝔉',\n FilledSmallSquare: '◼',\n FilledVerySmallSquare: '▪',\n Fopf: '𝔽',\n ForAll: '∀',\n Fouriertrf: 'ℱ',\n Fscr: 'ℱ',\n GJcy: 'Ѓ',\n GT: '>',\n Gamma: 'Γ',\n Gammad: 'Ϝ',\n Gbreve: 'Ğ',\n Gcedil: 'Ģ',\n Gcirc: 'Ĝ',\n Gcy: 'Г',\n Gdot: 'Ġ',\n Gfr: '𝔊',\n Gg: '⋙',\n Gopf: '𝔾',\n GreaterEqual: '≥',\n GreaterEqualLess: '⋛',\n GreaterFullEqual: '≧',\n GreaterGreater: '⪢',\n GreaterLess: '≷',\n GreaterSlantEqual: '⩾',\n GreaterTilde: '≳',\n Gscr: '𝒢',\n Gt: '≫',\n HARDcy: 'Ъ',\n Hacek: 'ˇ',\n Hat: '^',\n Hcirc: 'Ĥ',\n Hfr: 'ℌ',\n HilbertSpace: 'ℋ',\n Hopf: 'ℍ',\n HorizontalLine: '─',\n Hscr: 'ℋ',\n Hstrok: 'Ħ',\n HumpDownHump: '≎',\n HumpEqual: '≏',\n IEcy: 'Е',\n IJlig: 'IJ',\n IOcy: 'Ё',\n Iacute: 'Í',\n Icirc: 'Î',\n Icy: 'И',\n Idot: 'İ',\n Ifr: 'ℑ',\n Igrave: 'Ì',\n Im: 'ℑ',\n Imacr: 'Ī',\n ImaginaryI: 'ⅈ',\n Implies: '⇒',\n Int: '∬',\n Integral: '∫',\n Intersection: '⋂',\n InvisibleComma: '⁣',\n InvisibleTimes: '⁢',\n Iogon: 'Į',\n Iopf: '𝕀',\n Iota: 'Ι',\n Iscr: 'ℐ',\n Itilde: 'Ĩ',\n Iukcy: 'І',\n Iuml: 'Ï',\n Jcirc: 'Ĵ',\n Jcy: 'Й',\n Jfr: '𝔍',\n Jopf: '𝕁',\n Jscr: '𝒥',\n Jsercy: 'Ј',\n Jukcy: 'Є',\n KHcy: 'Х',\n KJcy: 'Ќ',\n Kappa: 'Κ',\n Kcedil: 'Ķ',\n Kcy: 'К',\n Kfr: '𝔎',\n Kopf: '𝕂',\n Kscr: '𝒦',\n LJcy: 'Љ',\n LT: '<',\n Lacute: 'Ĺ',\n Lambda: 'Λ',\n Lang: '⟪',\n Laplacetrf: 'ℒ',\n Larr: '↞',\n Lcaron: 'Ľ',\n Lcedil: 'Ļ',\n Lcy: 'Л',\n LeftAngleBracket: '⟨',\n LeftArrow: '←',\n LeftArrowBar: '⇤',\n LeftArrowRightArrow: '⇆',\n LeftCeiling: '⌈',\n LeftDoubleBracket: '⟦',\n LeftDownTeeVector: '⥡',\n LeftDownVector: '⇃',\n LeftDownVectorBar: '⥙',\n LeftFloor: '⌊',\n LeftRightArrow: '↔',\n LeftRightVector: '⥎',\n LeftTee: '⊣',\n LeftTeeArrow: '↤',\n LeftTeeVector: '⥚',\n LeftTriangle: '⊲',\n LeftTriangleBar: '⧏',\n LeftTriangleEqual: '⊴',\n LeftUpDownVector: '⥑',\n LeftUpTeeVector: '⥠',\n LeftUpVector: '↿',\n LeftUpVectorBar: '⥘',\n LeftVector: '↼',\n LeftVectorBar: '⥒',\n Leftarrow: '⇐',\n Leftrightarrow: '⇔',\n LessEqualGreater: '⋚',\n LessFullEqual: '≦',\n LessGreater: '≶',\n LessLess: '⪡',\n LessSlantEqual: '⩽',\n LessTilde: '≲',\n Lfr: '𝔏',\n Ll: '⋘',\n Lleftarrow: '⇚',\n Lmidot: 'Ŀ',\n LongLeftArrow: '⟵',\n LongLeftRightArrow: '⟷',\n LongRightArrow: '⟶',\n Longleftarrow: '⟸',\n Longleftrightarrow: '⟺',\n Longrightarrow: '⟹',\n Lopf: '𝕃',\n LowerLeftArrow: '↙',\n LowerRightArrow: '↘',\n Lscr: 'ℒ',\n Lsh: '↰',\n Lstrok: 'Ł',\n Lt: '≪',\n Map: '⤅',\n Mcy: 'М',\n MediumSpace: ' ',\n Mellintrf: 'ℳ',\n Mfr: '𝔐',\n MinusPlus: '∓',\n Mopf: '𝕄',\n Mscr: 'ℳ',\n Mu: 'Μ',\n NJcy: 'Њ',\n Nacute: 'Ń',\n Ncaron: 'Ň',\n Ncedil: 'Ņ',\n Ncy: 'Н',\n NegativeMediumSpace: '​',\n NegativeThickSpace: '​',\n NegativeThinSpace: '​',\n NegativeVeryThinSpace: '​',\n NestedGreaterGreater: '≫',\n NestedLessLess: '≪',\n NewLine: '\\n',\n Nfr: '𝔑',\n NoBreak: '⁠',\n NonBreakingSpace: ' ',\n Nopf: 'ℕ',\n Not: '⫬',\n NotCongruent: '≢',\n NotCupCap: '≭',\n NotDoubleVerticalBar: '∦',\n NotElement: '∉',\n NotEqual: '≠',\n NotEqualTilde: '≂̸',\n NotExists: '∄',\n NotGreater: '≯',\n NotGreaterEqual: '≱',\n NotGreaterFullEqual: '≧̸',\n NotGreaterGreater: '≫̸',\n NotGreaterLess: '≹',\n NotGreaterSlantEqual: '⩾̸',\n NotGreaterTilde: '≵',\n NotHumpDownHump: '≎̸',\n NotHumpEqual: '≏̸',\n NotLeftTriangle: '⋪',\n NotLeftTriangleBar: '⧏̸',\n NotLeftTriangleEqual: '⋬',\n NotLess: '≮',\n NotLessEqual: '≰',\n NotLessGreater: '≸',\n NotLessLess: '≪̸',\n NotLessSlantEqual: '⩽̸',\n NotLessTilde: '≴',\n NotNestedGreaterGreater: '⪢̸',\n NotNestedLessLess: '⪡̸',\n NotPrecedes: '⊀',\n NotPrecedesEqual: '⪯̸',\n NotPrecedesSlantEqual: '⋠',\n NotReverseElement: '∌',\n NotRightTriangle: '⋫',\n NotRightTriangleBar: '⧐̸',\n NotRightTriangleEqual: '⋭',\n NotSquareSubset: '⊏̸',\n NotSquareSubsetEqual: '⋢',\n NotSquareSuperset: '⊐̸',\n NotSquareSupersetEqual: '⋣',\n NotSubset: '⊂⃒',\n NotSubsetEqual: '⊈',\n NotSucceeds: '⊁',\n NotSucceedsEqual: '⪰̸',\n NotSucceedsSlantEqual: '⋡',\n NotSucceedsTilde: '≿̸',\n NotSuperset: '⊃⃒',\n NotSupersetEqual: '⊉',\n NotTilde: '≁',\n NotTildeEqual: '≄',\n NotTildeFullEqual: '≇',\n NotTildeTilde: '≉',\n NotVerticalBar: '∤',\n Nscr: '𝒩',\n Ntilde: 'Ñ',\n Nu: 'Ν',\n OElig: 'Œ',\n Oacute: 'Ó',\n Ocirc: 'Ô',\n Ocy: 'О',\n Odblac: 'Ő',\n Ofr: '𝔒',\n Ograve: 'Ò',\n Omacr: 'Ō',\n Omega: 'Ω',\n Omicron: 'Ο',\n Oopf: '𝕆',\n OpenCurlyDoubleQuote: '“',\n OpenCurlyQuote: '‘',\n Or: '⩔',\n Oscr: '𝒪',\n Oslash: 'Ø',\n Otilde: 'Õ',\n Otimes: '⨷',\n Ouml: 'Ö',\n OverBar: '‾',\n OverBrace: '⏞',\n OverBracket: '⎴',\n OverParenthesis: '⏜',\n PartialD: '∂',\n Pcy: 'П',\n Pfr: '𝔓',\n Phi: 'Φ',\n Pi: 'Π',\n PlusMinus: '±',\n Poincareplane: 'ℌ',\n Popf: 'ℙ',\n Pr: '⪻',\n Precedes: '≺',\n PrecedesEqual: '⪯',\n PrecedesSlantEqual: '≼',\n PrecedesTilde: '≾',\n Prime: '″',\n Product: '∏',\n Proportion: '∷',\n Proportional: '∝',\n Pscr: '𝒫',\n Psi: 'Ψ',\n QUOT: '\"',\n Qfr: '𝔔',\n Qopf: 'ℚ',\n Qscr: '𝒬',\n RBarr: '⤐',\n REG: '®',\n Racute: 'Ŕ',\n Rang: '⟫',\n Rarr: '↠',\n Rarrtl: '⤖',\n Rcaron: 'Ř',\n Rcedil: 'Ŗ',\n Rcy: 'Р',\n Re: 'ℜ',\n ReverseElement: '∋',\n ReverseEquilibrium: '⇋',\n ReverseUpEquilibrium: '⥯',\n Rfr: 'ℜ',\n Rho: 'Ρ',\n RightAngleBracket: '⟩',\n RightArrow: '→',\n RightArrowBar: '⇥',\n RightArrowLeftArrow: '⇄',\n RightCeiling: '⌉',\n RightDoubleBracket: '⟧',\n RightDownTeeVector: '⥝',\n RightDownVector: '⇂',\n RightDownVectorBar: '⥕',\n RightFloor: '⌋',\n RightTee: '⊢',\n RightTeeArrow: '↦',\n RightTeeVector: '⥛',\n RightTriangle: '⊳',\n RightTriangleBar: '⧐',\n RightTriangleEqual: '⊵',\n RightUpDownVector: '⥏',\n RightUpTeeVector: '⥜',\n RightUpVector: '↾',\n RightUpVectorBar: '⥔',\n RightVector: '⇀',\n RightVectorBar: '⥓',\n Rightarrow: '⇒',\n Ropf: 'ℝ',\n RoundImplies: '⥰',\n Rrightarrow: '⇛',\n Rscr: 'ℛ',\n Rsh: '↱',\n RuleDelayed: '⧴',\n SHCHcy: 'Щ',\n SHcy: 'Ш',\n SOFTcy: 'Ь',\n Sacute: 'Ś',\n Sc: '⪼',\n Scaron: 'Š',\n Scedil: 'Ş',\n Scirc: 'Ŝ',\n Scy: 'С',\n Sfr: '𝔖',\n ShortDownArrow: '↓',\n ShortLeftArrow: '←',\n ShortRightArrow: '→',\n ShortUpArrow: '↑',\n Sigma: 'Σ',\n SmallCircle: '∘',\n Sopf: '𝕊',\n Sqrt: '√',\n Square: '□',\n SquareIntersection: '⊓',\n SquareSubset: '⊏',\n SquareSubsetEqual: '⊑',\n SquareSuperset: '⊐',\n SquareSupersetEqual: '⊒',\n SquareUnion: '⊔',\n Sscr: '𝒮',\n Star: '⋆',\n Sub: '⋐',\n Subset: '⋐',\n SubsetEqual: '⊆',\n Succeeds: '≻',\n SucceedsEqual: '⪰',\n SucceedsSlantEqual: '≽',\n SucceedsTilde: '≿',\n SuchThat: '∋',\n Sum: '∑',\n Sup: '⋑',\n Superset: '⊃',\n SupersetEqual: '⊇',\n Supset: '⋑',\n THORN: 'Þ',\n TRADE: '™',\n TSHcy: 'Ћ',\n TScy: 'Ц',\n Tab: '\\t',\n Tau: 'Τ',\n Tcaron: 'Ť',\n Tcedil: 'Ţ',\n Tcy: 'Т',\n Tfr: '𝔗',\n Therefore: '∴',\n Theta: 'Θ',\n ThickSpace: '  ',\n ThinSpace: ' ',\n Tilde: '∼',\n TildeEqual: '≃',\n TildeFullEqual: '≅',\n TildeTilde: '≈',\n Topf: '𝕋',\n TripleDot: '⃛',\n Tscr: '𝒯',\n Tstrok: 'Ŧ',\n Uacute: 'Ú',\n Uarr: '↟',\n Uarrocir: '⥉',\n Ubrcy: 'Ў',\n Ubreve: 'Ŭ',\n Ucirc: 'Û',\n Ucy: 'У',\n Udblac: 'Ű',\n Ufr: '𝔘',\n Ugrave: 'Ù',\n Umacr: 'Ū',\n UnderBar: '_',\n UnderBrace: '⏟',\n UnderBracket: '⎵',\n UnderParenthesis: '⏝',\n Union: '⋃',\n UnionPlus: '⊎',\n Uogon: 'Ų',\n Uopf: '𝕌',\n UpArrow: '↑',\n UpArrowBar: '⤒',\n UpArrowDownArrow: '⇅',\n UpDownArrow: '↕',\n UpEquilibrium: '⥮',\n UpTee: '⊥',\n UpTeeArrow: '↥',\n Uparrow: '⇑',\n Updownarrow: '⇕',\n UpperLeftArrow: '↖',\n UpperRightArrow: '↗',\n Upsi: 'ϒ',\n Upsilon: 'Υ',\n Uring: 'Ů',\n Uscr: '𝒰',\n Utilde: 'Ũ',\n Uuml: 'Ü',\n VDash: '⊫',\n Vbar: '⫫',\n Vcy: 'В',\n Vdash: '⊩',\n Vdashl: '⫦',\n Vee: '⋁',\n Verbar: '‖',\n Vert: '‖',\n VerticalBar: '∣',\n VerticalLine: '|',\n VerticalSeparator: '❘',\n VerticalTilde: '≀',\n VeryThinSpace: ' ',\n Vfr: '𝔙',\n Vopf: '𝕍',\n Vscr: '𝒱',\n Vvdash: '⊪',\n Wcirc: 'Ŵ',\n Wedge: '⋀',\n Wfr: '𝔚',\n Wopf: '𝕎',\n Wscr: '𝒲',\n Xfr: '𝔛',\n Xi: 'Ξ',\n Xopf: '𝕏',\n Xscr: '𝒳',\n YAcy: 'Я',\n YIcy: 'Ї',\n YUcy: 'Ю',\n Yacute: 'Ý',\n Ycirc: 'Ŷ',\n Ycy: 'Ы',\n Yfr: '𝔜',\n Yopf: '𝕐',\n Yscr: '𝒴',\n Yuml: 'Ÿ',\n ZHcy: 'Ж',\n Zacute: 'Ź',\n Zcaron: 'Ž',\n Zcy: 'З',\n Zdot: 'Ż',\n ZeroWidthSpace: '​',\n Zeta: 'Ζ',\n Zfr: 'ℨ',\n Zopf: 'ℤ',\n Zscr: '𝒵',\n aacute: 'á',\n abreve: 'ă',\n ac: '∾',\n acE: '∾̳',\n acd: '∿',\n acirc: 'â',\n acute: '´',\n acy: 'а',\n aelig: 'æ',\n af: '⁡',\n afr: '𝔞',\n agrave: 'à',\n alefsym: 'ℵ',\n aleph: 'ℵ',\n alpha: 'α',\n amacr: 'ā',\n amalg: '⨿',\n amp: '&',\n and: '∧',\n andand: '⩕',\n andd: '⩜',\n andslope: '⩘',\n andv: '⩚',\n ang: '∠',\n ange: '⦤',\n angle: '∠',\n angmsd: '∡',\n angmsdaa: '⦨',\n angmsdab: '⦩',\n angmsdac: '⦪',\n angmsdad: '⦫',\n angmsdae: '⦬',\n angmsdaf: '⦭',\n angmsdag: '⦮',\n angmsdah: '⦯',\n angrt: '∟',\n angrtvb: '⊾',\n angrtvbd: '⦝',\n angsph: '∢',\n angst: 'Å',\n angzarr: '⍼',\n aogon: 'ą',\n aopf: '𝕒',\n ap: '≈',\n apE: '⩰',\n apacir: '⩯',\n ape: '≊',\n apid: '≋',\n apos: \"'\",\n approx: '≈',\n approxeq: '≊',\n aring: 'å',\n ascr: '𝒶',\n ast: '*',\n asymp: '≈',\n asympeq: '≍',\n atilde: 'ã',\n auml: 'ä',\n awconint: '∳',\n awint: '⨑',\n bNot: '⫭',\n backcong: '≌',\n backepsilon: '϶',\n backprime: '‵',\n backsim: '∽',\n backsimeq: '⋍',\n barvee: '⊽',\n barwed: '⌅',\n barwedge: '⌅',\n bbrk: '⎵',\n bbrktbrk: '⎶',\n bcong: '≌',\n bcy: 'б',\n bdquo: '„',\n becaus: '∵',\n because: '∵',\n bemptyv: '⦰',\n bepsi: '϶',\n bernou: 'ℬ',\n beta: 'β',\n beth: 'ℶ',\n between: '≬',\n bfr: '𝔟',\n bigcap: '⋂',\n bigcirc: '◯',\n bigcup: '⋃',\n bigodot: '⨀',\n bigoplus: '⨁',\n bigotimes: '⨂',\n bigsqcup: '⨆',\n bigstar: '★',\n bigtriangledown: '▽',\n bigtriangleup: '△',\n biguplus: '⨄',\n bigvee: '⋁',\n bigwedge: '⋀',\n bkarow: '⤍',\n blacklozenge: '⧫',\n blacksquare: '▪',\n blacktriangle: '▴',\n blacktriangledown: '▾',\n blacktriangleleft: '◂',\n blacktriangleright: '▸',\n blank: '␣',\n blk12: '▒',\n blk14: '░',\n blk34: '▓',\n block: '█',\n bne: '=⃥',\n bnequiv: '≡⃥',\n bnot: '⌐',\n bopf: '𝕓',\n bot: '⊥',\n bottom: '⊥',\n bowtie: '⋈',\n boxDL: '╗',\n boxDR: '╔',\n boxDl: '╖',\n boxDr: '╓',\n boxH: '═',\n boxHD: '╦',\n boxHU: '╩',\n boxHd: '╤',\n boxHu: '╧',\n boxUL: '╝',\n boxUR: '╚',\n boxUl: '╜',\n boxUr: '╙',\n boxV: '║',\n boxVH: '╬',\n boxVL: '╣',\n boxVR: '╠',\n boxVh: '╫',\n boxVl: '╢',\n boxVr: '╟',\n boxbox: '⧉',\n boxdL: '╕',\n boxdR: '╒',\n boxdl: '┐',\n boxdr: '┌',\n boxh: '─',\n boxhD: '╥',\n boxhU: '╨',\n boxhd: '┬',\n boxhu: '┴',\n boxminus: '⊟',\n boxplus: '⊞',\n boxtimes: '⊠',\n boxuL: '╛',\n boxuR: '╘',\n boxul: '┘',\n boxur: '└',\n boxv: '│',\n boxvH: '╪',\n boxvL: '╡',\n boxvR: '╞',\n boxvh: '┼',\n boxvl: '┤',\n boxvr: '├',\n bprime: '‵',\n breve: '˘',\n brvbar: '¦',\n bscr: '𝒷',\n bsemi: '⁏',\n bsim: '∽',\n bsime: '⋍',\n bsol: '\\\\',\n bsolb: '⧅',\n bsolhsub: '⟈',\n bull: '•',\n bullet: '•',\n bump: '≎',\n bumpE: '⪮',\n bumpe: '≏',\n bumpeq: '≏',\n cacute: 'ć',\n cap: '∩',\n capand: '⩄',\n capbrcup: '⩉',\n capcap: '⩋',\n capcup: '⩇',\n capdot: '⩀',\n caps: '∩︀',\n caret: '⁁',\n caron: 'ˇ',\n ccaps: '⩍',\n ccaron: 'č',\n ccedil: 'ç',\n ccirc: 'ĉ',\n ccups: '⩌',\n ccupssm: '⩐',\n cdot: 'ċ',\n cedil: '¸',\n cemptyv: '⦲',\n cent: '¢',\n centerdot: '·',\n cfr: '𝔠',\n chcy: 'ч',\n check: '✓',\n checkmark: '✓',\n chi: 'χ',\n cir: '○',\n cirE: '⧃',\n circ: 'ˆ',\n circeq: '≗',\n circlearrowleft: '↺',\n circlearrowright: '↻',\n circledR: '®',\n circledS: 'Ⓢ',\n circledast: '⊛',\n circledcirc: '⊚',\n circleddash: '⊝',\n cire: '≗',\n cirfnint: '⨐',\n cirmid: '⫯',\n cirscir: '⧂',\n clubs: '♣',\n clubsuit: '♣',\n colon: ':',\n colone: '≔',\n coloneq: '≔',\n comma: ',',\n commat: '@',\n comp: '∁',\n compfn: '∘',\n complement: '∁',\n complexes: 'ℂ',\n cong: '≅',\n congdot: '⩭',\n conint: '∮',\n copf: '𝕔',\n coprod: '∐',\n copy: '©',\n copysr: '℗',\n crarr: '↵',\n cross: '✗',\n cscr: '𝒸',\n csub: '⫏',\n csube: '⫑',\n csup: '⫐',\n csupe: '⫒',\n ctdot: '⋯',\n cudarrl: '⤸',\n cudarrr: '⤵',\n cuepr: '⋞',\n cuesc: '⋟',\n cularr: '↶',\n cularrp: '⤽',\n cup: '∪',\n cupbrcap: '⩈',\n cupcap: '⩆',\n cupcup: '⩊',\n cupdot: '⊍',\n cupor: '⩅',\n cups: '∪︀',\n curarr: '↷',\n curarrm: '⤼',\n curlyeqprec: '⋞',\n curlyeqsucc: '⋟',\n curlyvee: '⋎',\n curlywedge: '⋏',\n curren: '¤',\n curvearrowleft: '↶',\n curvearrowright: '↷',\n cuvee: '⋎',\n cuwed: '⋏',\n cwconint: '∲',\n cwint: '∱',\n cylcty: '⌭',\n dArr: '⇓',\n dHar: '⥥',\n dagger: '†',\n daleth: 'ℸ',\n darr: '↓',\n dash: '‐',\n dashv: '⊣',\n dbkarow: '⤏',\n dblac: '˝',\n dcaron: 'ď',\n dcy: 'д',\n dd: 'ⅆ',\n ddagger: '‡',\n ddarr: '⇊',\n ddotseq: '⩷',\n deg: '°',\n delta: 'δ',\n demptyv: '⦱',\n dfisht: '⥿',\n dfr: '𝔡',\n dharl: '⇃',\n dharr: '⇂',\n diam: '⋄',\n diamond: '⋄',\n diamondsuit: '♦',\n diams: '♦',\n die: '¨',\n digamma: 'ϝ',\n disin: '⋲',\n div: '÷',\n divide: '÷',\n divideontimes: '⋇',\n divonx: '⋇',\n djcy: 'ђ',\n dlcorn: '⌞',\n dlcrop: '⌍',\n dollar: '$',\n dopf: '𝕕',\n dot: '˙',\n doteq: '≐',\n doteqdot: '≑',\n dotminus: '∸',\n dotplus: '∔',\n dotsquare: '⊡',\n doublebarwedge: '⌆',\n downarrow: '↓',\n downdownarrows: '⇊',\n downharpoonleft: '⇃',\n downharpoonright: '⇂',\n drbkarow: '⤐',\n drcorn: '⌟',\n drcrop: '⌌',\n dscr: '𝒹',\n dscy: 'ѕ',\n dsol: '⧶',\n dstrok: 'đ',\n dtdot: '⋱',\n dtri: '▿',\n dtrif: '▾',\n duarr: '⇵',\n duhar: '⥯',\n dwangle: '⦦',\n dzcy: 'џ',\n dzigrarr: '⟿',\n eDDot: '⩷',\n eDot: '≑',\n eacute: 'é',\n easter: '⩮',\n ecaron: 'ě',\n ecir: '≖',\n ecirc: 'ê',\n ecolon: '≕',\n ecy: 'э',\n edot: 'ė',\n ee: 'ⅇ',\n efDot: '≒',\n efr: '𝔢',\n eg: '⪚',\n egrave: 'è',\n egs: '⪖',\n egsdot: '⪘',\n el: '⪙',\n elinters: '⏧',\n ell: 'ℓ',\n els: '⪕',\n elsdot: '⪗',\n emacr: 'ē',\n empty: '∅',\n emptyset: '∅',\n emptyv: '∅',\n emsp13: ' ',\n emsp14: ' ',\n emsp: ' ',\n eng: 'ŋ',\n ensp: ' ',\n eogon: 'ę',\n eopf: '𝕖',\n epar: '⋕',\n eparsl: '⧣',\n eplus: '⩱',\n epsi: 'ε',\n epsilon: 'ε',\n epsiv: 'ϵ',\n eqcirc: '≖',\n eqcolon: '≕',\n eqsim: '≂',\n eqslantgtr: '⪖',\n eqslantless: '⪕',\n equals: '=',\n equest: '≟',\n equiv: '≡',\n equivDD: '⩸',\n eqvparsl: '⧥',\n erDot: '≓',\n erarr: '⥱',\n escr: 'ℯ',\n esdot: '≐',\n esim: '≂',\n eta: 'η',\n eth: 'ð',\n euml: 'ë',\n euro: '€',\n excl: '!',\n exist: '∃',\n expectation: 'ℰ',\n exponentiale: 'ⅇ',\n fallingdotseq: '≒',\n fcy: 'ф',\n female: '♀',\n ffilig: 'ffi',\n fflig: 'ff',\n ffllig: 'ffl',\n ffr: '𝔣',\n filig: 'fi',\n fjlig: 'fj',\n flat: '♭',\n fllig: 'fl',\n fltns: '▱',\n fnof: 'ƒ',\n fopf: '𝕗',\n forall: '∀',\n fork: '⋔',\n forkv: '⫙',\n fpartint: '⨍',\n frac12: '½',\n frac13: '⅓',\n frac14: '¼',\n frac15: '⅕',\n frac16: '⅙',\n frac18: '⅛',\n frac23: '⅔',\n frac25: '⅖',\n frac34: '¾',\n frac35: '⅗',\n frac38: '⅜',\n frac45: '⅘',\n frac56: '⅚',\n frac58: '⅝',\n frac78: '⅞',\n frasl: '⁄',\n frown: '⌢',\n fscr: '𝒻',\n gE: '≧',\n gEl: '⪌',\n gacute: 'ǵ',\n gamma: 'γ',\n gammad: 'ϝ',\n gap: '⪆',\n gbreve: 'ğ',\n gcirc: 'ĝ',\n gcy: 'г',\n gdot: 'ġ',\n ge: '≥',\n gel: '⋛',\n geq: '≥',\n geqq: '≧',\n geqslant: '⩾',\n ges: '⩾',\n gescc: '⪩',\n gesdot: '⪀',\n gesdoto: '⪂',\n gesdotol: '⪄',\n gesl: '⋛︀',\n gesles: '⪔',\n gfr: '𝔤',\n gg: '≫',\n ggg: '⋙',\n gimel: 'ℷ',\n gjcy: 'ѓ',\n gl: '≷',\n glE: '⪒',\n gla: '⪥',\n glj: '⪤',\n gnE: '≩',\n gnap: '⪊',\n gnapprox: '⪊',\n gne: '⪈',\n gneq: '⪈',\n gneqq: '≩',\n gnsim: '⋧',\n gopf: '𝕘',\n grave: '`',\n gscr: 'ℊ',\n gsim: '≳',\n gsime: '⪎',\n gsiml: '⪐',\n gt: '>',\n gtcc: '⪧',\n gtcir: '⩺',\n gtdot: '⋗',\n gtlPar: '⦕',\n gtquest: '⩼',\n gtrapprox: '⪆',\n gtrarr: '⥸',\n gtrdot: '⋗',\n gtreqless: '⋛',\n gtreqqless: '⪌',\n gtrless: '≷',\n gtrsim: '≳',\n gvertneqq: '≩︀',\n gvnE: '≩︀',\n hArr: '⇔',\n hairsp: ' ',\n half: '½',\n hamilt: 'ℋ',\n hardcy: 'ъ',\n harr: '↔',\n harrcir: '⥈',\n harrw: '↭',\n hbar: 'ℏ',\n hcirc: 'ĥ',\n hearts: '♥',\n heartsuit: '♥',\n hellip: '…',\n hercon: '⊹',\n hfr: '𝔥',\n hksearow: '⤥',\n hkswarow: '⤦',\n hoarr: '⇿',\n homtht: '∻',\n hookleftarrow: '↩',\n hookrightarrow: '↪',\n hopf: '𝕙',\n horbar: '―',\n hscr: '𝒽',\n hslash: 'ℏ',\n hstrok: 'ħ',\n hybull: '⁃',\n hyphen: '‐',\n iacute: 'í',\n ic: '⁣',\n icirc: 'î',\n icy: 'и',\n iecy: 'е',\n iexcl: '¡',\n iff: '⇔',\n ifr: '𝔦',\n igrave: 'ì',\n ii: 'ⅈ',\n iiiint: '⨌',\n iiint: '∭',\n iinfin: '⧜',\n iiota: '℩',\n ijlig: 'ij',\n imacr: 'ī',\n image: 'ℑ',\n imagline: 'ℐ',\n imagpart: 'ℑ',\n imath: 'ı',\n imof: '⊷',\n imped: 'Ƶ',\n in: '∈',\n incare: '℅',\n infin: '∞',\n infintie: '⧝',\n inodot: 'ı',\n int: '∫',\n intcal: '⊺',\n integers: 'ℤ',\n intercal: '⊺',\n intlarhk: '⨗',\n intprod: '⨼',\n iocy: 'ё',\n iogon: 'į',\n iopf: '𝕚',\n iota: 'ι',\n iprod: '⨼',\n iquest: '¿',\n iscr: '𝒾',\n isin: '∈',\n isinE: '⋹',\n isindot: '⋵',\n isins: '⋴',\n isinsv: '⋳',\n isinv: '∈',\n it: '⁢',\n itilde: 'ĩ',\n iukcy: 'і',\n iuml: 'ï',\n jcirc: 'ĵ',\n jcy: 'й',\n jfr: '𝔧',\n jmath: 'ȷ',\n jopf: '𝕛',\n jscr: '𝒿',\n jsercy: 'ј',\n jukcy: 'є',\n kappa: 'κ',\n kappav: 'ϰ',\n kcedil: 'ķ',\n kcy: 'к',\n kfr: '𝔨',\n kgreen: 'ĸ',\n khcy: 'х',\n kjcy: 'ќ',\n kopf: '𝕜',\n kscr: '𝓀',\n lAarr: '⇚',\n lArr: '⇐',\n lAtail: '⤛',\n lBarr: '⤎',\n lE: '≦',\n lEg: '⪋',\n lHar: '⥢',\n lacute: 'ĺ',\n laemptyv: '⦴',\n lagran: 'ℒ',\n lambda: 'λ',\n lang: '⟨',\n langd: '⦑',\n langle: '⟨',\n lap: '⪅',\n laquo: '«',\n larr: '←',\n larrb: '⇤',\n larrbfs: '⤟',\n larrfs: '⤝',\n larrhk: '↩',\n larrlp: '↫',\n larrpl: '⤹',\n larrsim: '⥳',\n larrtl: '↢',\n lat: '⪫',\n latail: '⤙',\n late: '⪭',\n lates: '⪭︀',\n lbarr: '⤌',\n lbbrk: '❲',\n lbrace: '{',\n lbrack: '[',\n lbrke: '⦋',\n lbrksld: '⦏',\n lbrkslu: '⦍',\n lcaron: 'ľ',\n lcedil: 'ļ',\n lceil: '⌈',\n lcub: '{',\n lcy: 'л',\n ldca: '⤶',\n ldquo: '“',\n ldquor: '„',\n ldrdhar: '⥧',\n ldrushar: '⥋',\n ldsh: '↲',\n le: '≤',\n leftarrow: '←',\n leftarrowtail: '↢',\n leftharpoondown: '↽',\n leftharpoonup: '↼',\n leftleftarrows: '⇇',\n leftrightarrow: '↔',\n leftrightarrows: '⇆',\n leftrightharpoons: '⇋',\n leftrightsquigarrow: '↭',\n leftthreetimes: '⋋',\n leg: '⋚',\n leq: '≤',\n leqq: '≦',\n leqslant: '⩽',\n les: '⩽',\n lescc: '⪨',\n lesdot: '⩿',\n lesdoto: '⪁',\n lesdotor: '⪃',\n lesg: '⋚︀',\n lesges: '⪓',\n lessapprox: '⪅',\n lessdot: '⋖',\n lesseqgtr: '⋚',\n lesseqqgtr: '⪋',\n lessgtr: '≶',\n lesssim: '≲',\n lfisht: '⥼',\n lfloor: '⌊',\n lfr: '𝔩',\n lg: '≶',\n lgE: '⪑',\n lhard: '↽',\n lharu: '↼',\n lharul: '⥪',\n lhblk: '▄',\n ljcy: 'љ',\n ll: '≪',\n llarr: '⇇',\n llcorner: '⌞',\n llhard: '⥫',\n lltri: '◺',\n lmidot: 'ŀ',\n lmoust: '⎰',\n lmoustache: '⎰',\n lnE: '≨',\n lnap: '⪉',\n lnapprox: '⪉',\n lne: '⪇',\n lneq: '⪇',\n lneqq: '≨',\n lnsim: '⋦',\n loang: '⟬',\n loarr: '⇽',\n lobrk: '⟦',\n longleftarrow: '⟵',\n longleftrightarrow: '⟷',\n longmapsto: '⟼',\n longrightarrow: '⟶',\n looparrowleft: '↫',\n looparrowright: '↬',\n lopar: '⦅',\n lopf: '𝕝',\n loplus: '⨭',\n lotimes: '⨴',\n lowast: '∗',\n lowbar: '_',\n loz: '◊',\n lozenge: '◊',\n lozf: '⧫',\n lpar: '(',\n lparlt: '⦓',\n lrarr: '⇆',\n lrcorner: '⌟',\n lrhar: '⇋',\n lrhard: '⥭',\n lrm: '‎',\n lrtri: '⊿',\n lsaquo: '‹',\n lscr: '𝓁',\n lsh: '↰',\n lsim: '≲',\n lsime: '⪍',\n lsimg: '⪏',\n lsqb: '[',\n lsquo: '‘',\n lsquor: '‚',\n lstrok: 'ł',\n lt: '<',\n ltcc: '⪦',\n ltcir: '⩹',\n ltdot: '⋖',\n lthree: '⋋',\n ltimes: '⋉',\n ltlarr: '⥶',\n ltquest: '⩻',\n ltrPar: '⦖',\n ltri: '◃',\n ltrie: '⊴',\n ltrif: '◂',\n lurdshar: '⥊',\n luruhar: '⥦',\n lvertneqq: '≨︀',\n lvnE: '≨︀',\n mDDot: '∺',\n macr: '¯',\n male: '♂',\n malt: '✠',\n maltese: '✠',\n map: '↦',\n mapsto: '↦',\n mapstodown: '↧',\n mapstoleft: '↤',\n mapstoup: '↥',\n marker: '▮',\n mcomma: '⨩',\n mcy: 'м',\n mdash: '—',\n measuredangle: '∡',\n mfr: '𝔪',\n mho: '℧',\n micro: 'µ',\n mid: '∣',\n midast: '*',\n midcir: '⫰',\n middot: '·',\n minus: '−',\n minusb: '⊟',\n minusd: '∸',\n minusdu: '⨪',\n mlcp: '⫛',\n mldr: '…',\n mnplus: '∓',\n models: '⊧',\n mopf: '𝕞',\n mp: '∓',\n mscr: '𝓂',\n mstpos: '∾',\n mu: 'μ',\n multimap: '⊸',\n mumap: '⊸',\n nGg: '⋙̸',\n nGt: '≫⃒',\n nGtv: '≫̸',\n nLeftarrow: '⇍',\n nLeftrightarrow: '⇎',\n nLl: '⋘̸',\n nLt: '≪⃒',\n nLtv: '≪̸',\n nRightarrow: '⇏',\n nVDash: '⊯',\n nVdash: '⊮',\n nabla: '∇',\n nacute: 'ń',\n nang: '∠⃒',\n nap: '≉',\n napE: '⩰̸',\n napid: '≋̸',\n napos: 'ʼn',\n napprox: '≉',\n natur: '♮',\n natural: '♮',\n naturals: 'ℕ',\n nbsp: ' ',\n nbump: '≎̸',\n nbumpe: '≏̸',\n ncap: '⩃',\n ncaron: 'ň',\n ncedil: 'ņ',\n ncong: '≇',\n ncongdot: '⩭̸',\n ncup: '⩂',\n ncy: 'н',\n ndash: '–',\n ne: '≠',\n neArr: '⇗',\n nearhk: '⤤',\n nearr: '↗',\n nearrow: '↗',\n nedot: '≐̸',\n nequiv: '≢',\n nesear: '⤨',\n nesim: '≂̸',\n nexist: '∄',\n nexists: '∄',\n nfr: '𝔫',\n ngE: '≧̸',\n nge: '≱',\n ngeq: '≱',\n ngeqq: '≧̸',\n ngeqslant: '⩾̸',\n nges: '⩾̸',\n ngsim: '≵',\n ngt: '≯',\n ngtr: '≯',\n nhArr: '⇎',\n nharr: '↮',\n nhpar: '⫲',\n ni: '∋',\n nis: '⋼',\n nisd: '⋺',\n niv: '∋',\n njcy: 'њ',\n nlArr: '⇍',\n nlE: '≦̸',\n nlarr: '↚',\n nldr: '‥',\n nle: '≰',\n nleftarrow: '↚',\n nleftrightarrow: '↮',\n nleq: '≰',\n nleqq: '≦̸',\n nleqslant: '⩽̸',\n nles: '⩽̸',\n nless: '≮',\n nlsim: '≴',\n nlt: '≮',\n nltri: '⋪',\n nltrie: '⋬',\n nmid: '∤',\n nopf: '𝕟',\n not: '¬',\n notin: '∉',\n notinE: '⋹̸',\n notindot: '⋵̸',\n notinva: '∉',\n notinvb: '⋷',\n notinvc: '⋶',\n notni: '∌',\n notniva: '∌',\n notnivb: '⋾',\n notnivc: '⋽',\n npar: '∦',\n nparallel: '∦',\n nparsl: '⫽⃥',\n npart: '∂̸',\n npolint: '⨔',\n npr: '⊀',\n nprcue: '⋠',\n npre: '⪯̸',\n nprec: '⊀',\n npreceq: '⪯̸',\n nrArr: '⇏',\n nrarr: '↛',\n nrarrc: '⤳̸',\n nrarrw: '↝̸',\n nrightarrow: '↛',\n nrtri: '⋫',\n nrtrie: '⋭',\n nsc: '⊁',\n nsccue: '⋡',\n nsce: '⪰̸',\n nscr: '𝓃',\n nshortmid: '∤',\n nshortparallel: '∦',\n nsim: '≁',\n nsime: '≄',\n nsimeq: '≄',\n nsmid: '∤',\n nspar: '∦',\n nsqsube: '⋢',\n nsqsupe: '⋣',\n nsub: '⊄',\n nsubE: '⫅̸',\n nsube: '⊈',\n nsubset: '⊂⃒',\n nsubseteq: '⊈',\n nsubseteqq: '⫅̸',\n nsucc: '⊁',\n nsucceq: '⪰̸',\n nsup: '⊅',\n nsupE: '⫆̸',\n nsupe: '⊉',\n nsupset: '⊃⃒',\n nsupseteq: '⊉',\n nsupseteqq: '⫆̸',\n ntgl: '≹',\n ntilde: 'ñ',\n ntlg: '≸',\n ntriangleleft: '⋪',\n ntrianglelefteq: '⋬',\n ntriangleright: '⋫',\n ntrianglerighteq: '⋭',\n nu: 'ν',\n num: '#',\n numero: '№',\n numsp: ' ',\n nvDash: '⊭',\n nvHarr: '⤄',\n nvap: '≍⃒',\n nvdash: '⊬',\n nvge: '≥⃒',\n nvgt: '>⃒',\n nvinfin: '⧞',\n nvlArr: '⤂',\n nvle: '≤⃒',\n nvlt: '<⃒',\n nvltrie: '⊴⃒',\n nvrArr: '⤃',\n nvrtrie: '⊵⃒',\n nvsim: '∼⃒',\n nwArr: '⇖',\n nwarhk: '⤣',\n nwarr: '↖',\n nwarrow: '↖',\n nwnear: '⤧',\n oS: 'Ⓢ',\n oacute: 'ó',\n oast: '⊛',\n ocir: '⊚',\n ocirc: 'ô',\n ocy: 'о',\n odash: '⊝',\n odblac: 'ő',\n odiv: '⨸',\n odot: '⊙',\n odsold: '⦼',\n oelig: 'œ',\n ofcir: '⦿',\n ofr: '𝔬',\n ogon: '˛',\n ograve: 'ò',\n ogt: '⧁',\n ohbar: '⦵',\n ohm: 'Ω',\n oint: '∮',\n olarr: '↺',\n olcir: '⦾',\n olcross: '⦻',\n oline: '‾',\n olt: '⧀',\n omacr: 'ō',\n omega: 'ω',\n omicron: 'ο',\n omid: '⦶',\n ominus: '⊖',\n oopf: '𝕠',\n opar: '⦷',\n operp: '⦹',\n oplus: '⊕',\n or: '∨',\n orarr: '↻',\n ord: '⩝',\n order: 'ℴ',\n orderof: 'ℴ',\n ordf: 'ª',\n ordm: 'º',\n origof: '⊶',\n oror: '⩖',\n orslope: '⩗',\n orv: '⩛',\n oscr: 'ℴ',\n oslash: 'ø',\n osol: '⊘',\n otilde: 'õ',\n otimes: '⊗',\n otimesas: '⨶',\n ouml: 'ö',\n ovbar: '⌽',\n par: '∥',\n para: '¶',\n parallel: '∥',\n parsim: '⫳',\n parsl: '⫽',\n part: '∂',\n pcy: 'п',\n percnt: '%',\n period: '.',\n permil: '‰',\n perp: '⊥',\n pertenk: '‱',\n pfr: '𝔭',\n phi: 'φ',\n phiv: 'ϕ',\n phmmat: 'ℳ',\n phone: '☎',\n pi: 'π',\n pitchfork: '⋔',\n piv: 'ϖ',\n planck: 'ℏ',\n planckh: 'ℎ',\n plankv: 'ℏ',\n plus: '+',\n plusacir: '⨣',\n plusb: '⊞',\n pluscir: '⨢',\n plusdo: '∔',\n plusdu: '⨥',\n pluse: '⩲',\n plusmn: '±',\n plussim: '⨦',\n plustwo: '⨧',\n pm: '±',\n pointint: '⨕',\n popf: '𝕡',\n pound: '£',\n pr: '≺',\n prE: '⪳',\n prap: '⪷',\n prcue: '≼',\n pre: '⪯',\n prec: '≺',\n precapprox: '⪷',\n preccurlyeq: '≼',\n preceq: '⪯',\n precnapprox: '⪹',\n precneqq: '⪵',\n precnsim: '⋨',\n precsim: '≾',\n prime: '′',\n primes: 'ℙ',\n prnE: '⪵',\n prnap: '⪹',\n prnsim: '⋨',\n prod: '∏',\n profalar: '⌮',\n profline: '⌒',\n profsurf: '⌓',\n prop: '∝',\n propto: '∝',\n prsim: '≾',\n prurel: '⊰',\n pscr: '𝓅',\n psi: 'ψ',\n puncsp: ' ',\n qfr: '𝔮',\n qint: '⨌',\n qopf: '𝕢',\n qprime: '⁗',\n qscr: '𝓆',\n quaternions: 'ℍ',\n quatint: '⨖',\n quest: '?',\n questeq: '≟',\n quot: '\"',\n rAarr: '⇛',\n rArr: '⇒',\n rAtail: '⤜',\n rBarr: '⤏',\n rHar: '⥤',\n race: '∽̱',\n racute: 'ŕ',\n radic: '√',\n raemptyv: '⦳',\n rang: '⟩',\n rangd: '⦒',\n range: '⦥',\n rangle: '⟩',\n raquo: '»',\n rarr: '→',\n rarrap: '⥵',\n rarrb: '⇥',\n rarrbfs: '⤠',\n rarrc: '⤳',\n rarrfs: '⤞',\n rarrhk: '↪',\n rarrlp: '↬',\n rarrpl: '⥅',\n rarrsim: '⥴',\n rarrtl: '↣',\n rarrw: '↝',\n ratail: '⤚',\n ratio: '∶',\n rationals: 'ℚ',\n rbarr: '⤍',\n rbbrk: '❳',\n rbrace: '}',\n rbrack: ']',\n rbrke: '⦌',\n rbrksld: '⦎',\n rbrkslu: '⦐',\n rcaron: 'ř',\n rcedil: 'ŗ',\n rceil: '⌉',\n rcub: '}',\n rcy: 'р',\n rdca: '⤷',\n rdldhar: '⥩',\n rdquo: '”',\n rdquor: '”',\n rdsh: '↳',\n real: 'ℜ',\n realine: 'ℛ',\n realpart: 'ℜ',\n reals: 'ℝ',\n rect: '▭',\n reg: '®',\n rfisht: '⥽',\n rfloor: '⌋',\n rfr: '𝔯',\n rhard: '⇁',\n rharu: '⇀',\n rharul: '⥬',\n rho: 'ρ',\n rhov: 'ϱ',\n rightarrow: '→',\n rightarrowtail: '↣',\n rightharpoondown: '⇁',\n rightharpoonup: '⇀',\n rightleftarrows: '⇄',\n rightleftharpoons: '⇌',\n rightrightarrows: '⇉',\n rightsquigarrow: '↝',\n rightthreetimes: '⋌',\n ring: '˚',\n risingdotseq: '≓',\n rlarr: '⇄',\n rlhar: '⇌',\n rlm: '‏',\n rmoust: '⎱',\n rmoustache: '⎱',\n rnmid: '⫮',\n roang: '⟭',\n roarr: '⇾',\n robrk: '⟧',\n ropar: '⦆',\n ropf: '𝕣',\n roplus: '⨮',\n rotimes: '⨵',\n rpar: ')',\n rpargt: '⦔',\n rppolint: '⨒',\n rrarr: '⇉',\n rsaquo: '›',\n rscr: '𝓇',\n rsh: '↱',\n rsqb: ']',\n rsquo: '’',\n rsquor: '’',\n rthree: '⋌',\n rtimes: '⋊',\n rtri: '▹',\n rtrie: '⊵',\n rtrif: '▸',\n rtriltri: '⧎',\n ruluhar: '⥨',\n rx: '℞',\n sacute: 'ś',\n sbquo: '‚',\n sc: '≻',\n scE: '⪴',\n scap: '⪸',\n scaron: 'š',\n sccue: '≽',\n sce: '⪰',\n scedil: 'ş',\n scirc: 'ŝ',\n scnE: '⪶',\n scnap: '⪺',\n scnsim: '⋩',\n scpolint: '⨓',\n scsim: '≿',\n scy: 'с',\n sdot: '⋅',\n sdotb: '⊡',\n sdote: '⩦',\n seArr: '⇘',\n searhk: '⤥',\n searr: '↘',\n searrow: '↘',\n sect: '§',\n semi: ';',\n seswar: '⤩',\n setminus: '∖',\n setmn: '∖',\n sext: '✶',\n sfr: '𝔰',\n sfrown: '⌢',\n sharp: '♯',\n shchcy: 'щ',\n shcy: 'ш',\n shortmid: '∣',\n shortparallel: '∥',\n shy: '­',\n sigma: 'σ',\n sigmaf: 'ς',\n sigmav: 'ς',\n sim: '∼',\n simdot: '⩪',\n sime: '≃',\n simeq: '≃',\n simg: '⪞',\n simgE: '⪠',\n siml: '⪝',\n simlE: '⪟',\n simne: '≆',\n simplus: '⨤',\n simrarr: '⥲',\n slarr: '←',\n smallsetminus: '∖',\n smashp: '⨳',\n smeparsl: '⧤',\n smid: '∣',\n smile: '⌣',\n smt: '⪪',\n smte: '⪬',\n smtes: '⪬︀',\n softcy: 'ь',\n sol: '/',\n solb: '⧄',\n solbar: '⌿',\n sopf: '𝕤',\n spades: '♠',\n spadesuit: '♠',\n spar: '∥',\n sqcap: '⊓',\n sqcaps: '⊓︀',\n sqcup: '⊔',\n sqcups: '⊔︀',\n sqsub: '⊏',\n sqsube: '⊑',\n sqsubset: '⊏',\n sqsubseteq: '⊑',\n sqsup: '⊐',\n sqsupe: '⊒',\n sqsupset: '⊐',\n sqsupseteq: '⊒',\n squ: '□',\n square: '□',\n squarf: '▪',\n squf: '▪',\n srarr: '→',\n sscr: '𝓈',\n ssetmn: '∖',\n ssmile: '⌣',\n sstarf: '⋆',\n star: '☆',\n starf: '★',\n straightepsilon: 'ϵ',\n straightphi: 'ϕ',\n strns: '¯',\n sub: '⊂',\n subE: '⫅',\n subdot: '⪽',\n sube: '⊆',\n subedot: '⫃',\n submult: '⫁',\n subnE: '⫋',\n subne: '⊊',\n subplus: '⪿',\n subrarr: '⥹',\n subset: '⊂',\n subseteq: '⊆',\n subseteqq: '⫅',\n subsetneq: '⊊',\n subsetneqq: '⫋',\n subsim: '⫇',\n subsub: '⫕',\n subsup: '⫓',\n succ: '≻',\n succapprox: '⪸',\n succcurlyeq: '≽',\n succeq: '⪰',\n succnapprox: '⪺',\n succneqq: '⪶',\n succnsim: '⋩',\n succsim: '≿',\n sum: '∑',\n sung: '♪',\n sup1: '¹',\n sup2: '²',\n sup3: '³',\n sup: '⊃',\n supE: '⫆',\n supdot: '⪾',\n supdsub: '⫘',\n supe: '⊇',\n supedot: '⫄',\n suphsol: '⟉',\n suphsub: '⫗',\n suplarr: '⥻',\n supmult: '⫂',\n supnE: '⫌',\n supne: '⊋',\n supplus: '⫀',\n supset: '⊃',\n supseteq: '⊇',\n supseteqq: '⫆',\n supsetneq: '⊋',\n supsetneqq: '⫌',\n supsim: '⫈',\n supsub: '⫔',\n supsup: '⫖',\n swArr: '⇙',\n swarhk: '⤦',\n swarr: '↙',\n swarrow: '↙',\n swnwar: '⤪',\n szlig: 'ß',\n target: '⌖',\n tau: 'τ',\n tbrk: '⎴',\n tcaron: 'ť',\n tcedil: 'ţ',\n tcy: 'т',\n tdot: '⃛',\n telrec: '⌕',\n tfr: '𝔱',\n there4: '∴',\n therefore: '∴',\n theta: 'θ',\n thetasym: 'ϑ',\n thetav: 'ϑ',\n thickapprox: '≈',\n thicksim: '∼',\n thinsp: ' ',\n thkap: '≈',\n thksim: '∼',\n thorn: 'þ',\n tilde: '˜',\n times: '×',\n timesb: '⊠',\n timesbar: '⨱',\n timesd: '⨰',\n tint: '∭',\n toea: '⤨',\n top: '⊤',\n topbot: '⌶',\n topcir: '⫱',\n topf: '𝕥',\n topfork: '⫚',\n tosa: '⤩',\n tprime: '‴',\n trade: '™',\n triangle: '▵',\n triangledown: '▿',\n triangleleft: '◃',\n trianglelefteq: '⊴',\n triangleq: '≜',\n triangleright: '▹',\n trianglerighteq: '⊵',\n tridot: '◬',\n trie: '≜',\n triminus: '⨺',\n triplus: '⨹',\n trisb: '⧍',\n tritime: '⨻',\n trpezium: '⏢',\n tscr: '𝓉',\n tscy: 'ц',\n tshcy: 'ћ',\n tstrok: 'ŧ',\n twixt: '≬',\n twoheadleftarrow: '↞',\n twoheadrightarrow: '↠',\n uArr: '⇑',\n uHar: '⥣',\n uacute: 'ú',\n uarr: '↑',\n ubrcy: 'ў',\n ubreve: 'ŭ',\n ucirc: 'û',\n ucy: 'у',\n udarr: '⇅',\n udblac: 'ű',\n udhar: '⥮',\n ufisht: '⥾',\n ufr: '𝔲',\n ugrave: 'ù',\n uharl: '↿',\n uharr: '↾',\n uhblk: '▀',\n ulcorn: '⌜',\n ulcorner: '⌜',\n ulcrop: '⌏',\n ultri: '◸',\n umacr: 'ū',\n uml: '¨',\n uogon: 'ų',\n uopf: '𝕦',\n uparrow: '↑',\n updownarrow: '↕',\n upharpoonleft: '↿',\n upharpoonright: '↾',\n uplus: '⊎',\n upsi: 'υ',\n upsih: 'ϒ',\n upsilon: 'υ',\n upuparrows: '⇈',\n urcorn: '⌝',\n urcorner: '⌝',\n urcrop: '⌎',\n uring: 'ů',\n urtri: '◹',\n uscr: '𝓊',\n utdot: '⋰',\n utilde: 'ũ',\n utri: '▵',\n utrif: '▴',\n uuarr: '⇈',\n uuml: 'ü',\n uwangle: '⦧',\n vArr: '⇕',\n vBar: '⫨',\n vBarv: '⫩',\n vDash: '⊨',\n vangrt: '⦜',\n varepsilon: 'ϵ',\n varkappa: 'ϰ',\n varnothing: '∅',\n varphi: 'ϕ',\n varpi: 'ϖ',\n varpropto: '∝',\n varr: '↕',\n varrho: 'ϱ',\n varsigma: 'ς',\n varsubsetneq: '⊊︀',\n varsubsetneqq: '⫋︀',\n varsupsetneq: '⊋︀',\n varsupsetneqq: '⫌︀',\n vartheta: 'ϑ',\n vartriangleleft: '⊲',\n vartriangleright: '⊳',\n vcy: 'в',\n vdash: '⊢',\n vee: '∨',\n veebar: '⊻',\n veeeq: '≚',\n vellip: '⋮',\n verbar: '|',\n vert: '|',\n vfr: '𝔳',\n vltri: '⊲',\n vnsub: '⊂⃒',\n vnsup: '⊃⃒',\n vopf: '𝕧',\n vprop: '∝',\n vrtri: '⊳',\n vscr: '𝓋',\n vsubnE: '⫋︀',\n vsubne: '⊊︀',\n vsupnE: '⫌︀',\n vsupne: '⊋︀',\n vzigzag: '⦚',\n wcirc: 'ŵ',\n wedbar: '⩟',\n wedge: '∧',\n wedgeq: '≙',\n weierp: '℘',\n wfr: '𝔴',\n wopf: '𝕨',\n wp: '℘',\n wr: '≀',\n wreath: '≀',\n wscr: '𝓌',\n xcap: '⋂',\n xcirc: '◯',\n xcup: '⋃',\n xdtri: '▽',\n xfr: '𝔵',\n xhArr: '⟺',\n xharr: '⟷',\n xi: 'ξ',\n xlArr: '⟸',\n xlarr: '⟵',\n xmap: '⟼',\n xnis: '⋻',\n xodot: '⨀',\n xopf: '𝕩',\n xoplus: '⨁',\n xotime: '⨂',\n xrArr: '⟹',\n xrarr: '⟶',\n xscr: '𝓍',\n xsqcup: '⨆',\n xuplus: '⨄',\n xutri: '△',\n xvee: '⋁',\n xwedge: '⋀',\n yacute: 'ý',\n yacy: 'я',\n ycirc: 'ŷ',\n ycy: 'ы',\n yen: '¥',\n yfr: '𝔶',\n yicy: 'ї',\n yopf: '𝕪',\n yscr: '𝓎',\n yucy: 'ю',\n yuml: 'ÿ',\n zacute: 'ź',\n zcaron: 'ž',\n zcy: 'з',\n zdot: 'ż',\n zeetrf: 'ℨ',\n zeta: 'ζ',\n zfr: '𝔷',\n zhcy: 'ж',\n zigrarr: '⇝',\n zopf: '𝕫',\n zscr: '𝓏',\n zwj: '‍',\n zwnj: '‌'\n}\n","import {characterEntities} from 'character-entities'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Decode a single character reference (without the `&` or `;`).\n * You probably only need this when you’re building parsers yourself that follow\n * different rules compared to HTML.\n * This is optimized to be tiny in browsers.\n *\n * @param {string} value\n * `notin` (named), `#123` (deci), `#x123` (hexa).\n * @returns {string|false}\n * Decoded reference.\n */\nexport function decodeNamedCharacterReference(value) {\n return own.call(characterEntities, value) ? characterEntities[value] : false\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {\n asciiAlphanumeric,\n asciiDigit,\n asciiHexDigit\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const characterReference = {\n name: 'characterReference',\n tokenize: tokenizeCharacterReference\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterReference(effects, ok, nok) {\n const self = this\n let size = 0\n /** @type {number} */\n let max\n /** @type {(code: Code) => boolean} */\n let test\n return start\n\n /**\n * Start of character reference.\n *\n * ```markdown\n * > | a&b\n * ^\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('characterReference')\n effects.enter('characterReferenceMarker')\n effects.consume(code)\n effects.exit('characterReferenceMarker')\n return open\n }\n\n /**\n * After `&`, at `#` for numeric references or alphanumeric for named\n * references.\n *\n * ```markdown\n * > | a&b\n * ^\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 35) {\n effects.enter('characterReferenceMarkerNumeric')\n effects.consume(code)\n effects.exit('characterReferenceMarkerNumeric')\n return numeric\n }\n effects.enter('characterReferenceValue')\n max = 31\n test = asciiAlphanumeric\n return value(code)\n }\n\n /**\n * After `#`, at `x` for hexadecimals or digit for decimals.\n *\n * ```markdown\n * > | a{b\n * ^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function numeric(code) {\n if (code === 88 || code === 120) {\n effects.enter('characterReferenceMarkerHexadecimal')\n effects.consume(code)\n effects.exit('characterReferenceMarkerHexadecimal')\n effects.enter('characterReferenceValue')\n max = 6\n test = asciiHexDigit\n return value\n }\n effects.enter('characterReferenceValue')\n max = 7\n test = asciiDigit\n return value(code)\n }\n\n /**\n * After markers (`&#x`, `&#`, or `&`), in value, before `;`.\n *\n * The character reference kind defines what and how many characters are\n * allowed.\n *\n * ```markdown\n * > | a&b\n * ^^^\n * > | a{b\n * ^^^\n * > | a b\n * ^\n * ```\n *\n * @type {State}\n */\n function value(code) {\n if (code === 59 && size) {\n const token = effects.exit('characterReferenceValue')\n if (\n test === asciiAlphanumeric &&\n !decodeNamedCharacterReference(self.sliceSerialize(token))\n ) {\n return nok(code)\n }\n\n // To do: `markdown-rs` uses a different name:\n // `CharacterReferenceMarkerSemi`.\n effects.enter('characterReferenceMarker')\n effects.consume(code)\n effects.exit('characterReferenceMarker')\n effects.exit('characterReference')\n return ok\n }\n if (test(code) && size++ < max) {\n effects.consume(code)\n return value\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {asciiPunctuation} from 'micromark-util-character'\n/** @type {Construct} */\nexport const characterEscape = {\n name: 'characterEscape',\n tokenize: tokenizeCharacterEscape\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCharacterEscape(effects, ok, nok) {\n return start\n\n /**\n * Start of character escape.\n *\n * ```markdown\n * > | a\\*b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('characterEscape')\n effects.enter('escapeMarker')\n effects.consume(code)\n effects.exit('escapeMarker')\n return inside\n }\n\n /**\n * After `\\`, at punctuation.\n *\n * ```markdown\n * > | a\\*b\n * ^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n // ASCII punctuation.\n if (asciiPunctuation(code)) {\n effects.enter('characterEscapeValue')\n effects.consume(code)\n effects.exit('characterEscapeValue')\n effects.exit('characterEscape')\n return ok\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const lineEnding = {\n name: 'lineEnding',\n tokenize: tokenizeLineEnding\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLineEnding(effects, ok) {\n return start\n\n /** @type {State} */\n function start(code) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return factorySpace(effects, ok, 'linePrefix')\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factoryDestination} from 'micromark-factory-destination'\nimport {factoryLabel} from 'micromark-factory-label'\nimport {factoryTitle} from 'micromark-factory-title'\nimport {factoryWhitespace} from 'micromark-factory-whitespace'\nimport {markdownLineEndingOrSpace} from 'micromark-util-character'\nimport {push, splice} from 'micromark-util-chunked'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/** @type {Construct} */\nexport const labelEnd = {\n name: 'labelEnd',\n tokenize: tokenizeLabelEnd,\n resolveTo: resolveToLabelEnd,\n resolveAll: resolveAllLabelEnd\n}\n\n/** @type {Construct} */\nconst resourceConstruct = {\n tokenize: tokenizeResource\n}\n/** @type {Construct} */\nconst referenceFullConstruct = {\n tokenize: tokenizeReferenceFull\n}\n/** @type {Construct} */\nconst referenceCollapsedConstruct = {\n tokenize: tokenizeReferenceCollapsed\n}\n\n/** @type {Resolver} */\nfunction resolveAllLabelEnd(events) {\n let index = -1\n while (++index < events.length) {\n const token = events[index][1]\n if (\n token.type === 'labelImage' ||\n token.type === 'labelLink' ||\n token.type === 'labelEnd'\n ) {\n // Remove the marker.\n events.splice(index + 1, token.type === 'labelImage' ? 4 : 2)\n token.type = 'data'\n index++\n }\n }\n return events\n}\n\n/** @type {Resolver} */\nfunction resolveToLabelEnd(events, context) {\n let index = events.length\n let offset = 0\n /** @type {Token} */\n let token\n /** @type {number | undefined} */\n let open\n /** @type {number | undefined} */\n let close\n /** @type {Array} */\n let media\n\n // Find an opening.\n while (index--) {\n token = events[index][1]\n if (open) {\n // If we see another link, or inactive link label, we’ve been here before.\n if (\n token.type === 'link' ||\n (token.type === 'labelLink' && token._inactive)\n ) {\n break\n }\n\n // Mark other link openings as inactive, as we can’t have links in\n // links.\n if (events[index][0] === 'enter' && token.type === 'labelLink') {\n token._inactive = true\n }\n } else if (close) {\n if (\n events[index][0] === 'enter' &&\n (token.type === 'labelImage' || token.type === 'labelLink') &&\n !token._balanced\n ) {\n open = index\n if (token.type !== 'labelLink') {\n offset = 2\n break\n }\n }\n } else if (token.type === 'labelEnd') {\n close = index\n }\n }\n const group = {\n type: events[open][1].type === 'labelLink' ? 'link' : 'image',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[events.length - 1][1].end)\n }\n const label = {\n type: 'label',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[close][1].end)\n }\n const text = {\n type: 'labelText',\n start: Object.assign({}, events[open + offset + 2][1].end),\n end: Object.assign({}, events[close - 2][1].start)\n }\n media = [\n ['enter', group, context],\n ['enter', label, context]\n ]\n\n // Opening marker.\n media = push(media, events.slice(open + 1, open + offset + 3))\n\n // Text open.\n media = push(media, [['enter', text, context]])\n\n // Always populated by defaults.\n\n // Between.\n media = push(\n media,\n resolveAll(\n context.parser.constructs.insideSpan.null,\n events.slice(open + offset + 4, close - 3),\n context\n )\n )\n\n // Text close, marker close, label close.\n media = push(media, [\n ['exit', text, context],\n events[close - 2],\n events[close - 1],\n ['exit', label, context]\n ])\n\n // Reference, resource, or so.\n media = push(media, events.slice(close + 1))\n\n // Media close.\n media = push(media, [['exit', group, context]])\n splice(events, open, events.length, media)\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelEnd(effects, ok, nok) {\n const self = this\n let index = self.events.length\n /** @type {Token} */\n let labelStart\n /** @type {boolean} */\n let defined\n\n // Find an opening.\n while (index--) {\n if (\n (self.events[index][1].type === 'labelImage' ||\n self.events[index][1].type === 'labelLink') &&\n !self.events[index][1]._balanced\n ) {\n labelStart = self.events[index][1]\n break\n }\n }\n return start\n\n /**\n * Start of label end.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // If there is not an okay opening.\n if (!labelStart) {\n return nok(code)\n }\n\n // If the corresponding label (link) start is marked as inactive,\n // it means we’d be wrapping a link, like this:\n //\n // ```markdown\n // > | a [b [c](d) e](f) g.\n // ^\n // ```\n //\n // We can’t have that, so it’s just balanced brackets.\n if (labelStart._inactive) {\n return labelEndNok(code)\n }\n defined = self.parser.defined.includes(\n normalizeIdentifier(\n self.sliceSerialize({\n start: labelStart.end,\n end: self.now()\n })\n )\n )\n effects.enter('labelEnd')\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelEnd')\n return after\n }\n\n /**\n * After `]`.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // Note: `markdown-rs` also parses GFM footnotes here, which for us is in\n // an extension.\n\n // Resource (`[asd](fgh)`)?\n if (code === 40) {\n return effects.attempt(\n resourceConstruct,\n labelEndOk,\n defined ? labelEndOk : labelEndNok\n )(code)\n }\n\n // Full (`[asd][fgh]`) or collapsed (`[asd][]`) reference?\n if (code === 91) {\n return effects.attempt(\n referenceFullConstruct,\n labelEndOk,\n defined ? referenceNotFull : labelEndNok\n )(code)\n }\n\n // Shortcut (`[asd]`) reference?\n return defined ? labelEndOk(code) : labelEndNok(code)\n }\n\n /**\n * After `]`, at `[`, but not at a full reference.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceNotFull(code) {\n return effects.attempt(\n referenceCollapsedConstruct,\n labelEndOk,\n labelEndNok\n )(code)\n }\n\n /**\n * Done, we found something.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * > | [a][b] c\n * ^\n * > | [a][] b\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEndOk(code) {\n // Note: `markdown-rs` does a bunch of stuff here.\n return ok(code)\n }\n\n /**\n * Done, it’s nothing.\n *\n * There was an okay opening, but we didn’t match anything.\n *\n * ```markdown\n * > | [a](b c\n * ^\n * > | [a][b c\n * ^\n * > | [a] b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEndNok(code) {\n labelStart._balanced = true\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeResource(effects, ok, nok) {\n return resourceStart\n\n /**\n * At a resource.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceStart(code) {\n effects.enter('resource')\n effects.enter('resourceMarker')\n effects.consume(code)\n effects.exit('resourceMarker')\n return resourceBefore\n }\n\n /**\n * In resource, after `(`, at optional whitespace.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceBefore(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceOpen)(code)\n : resourceOpen(code)\n }\n\n /**\n * In resource, after optional whitespace, at `)` or a destination.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceOpen(code) {\n if (code === 41) {\n return resourceEnd(code)\n }\n return factoryDestination(\n effects,\n resourceDestinationAfter,\n resourceDestinationMissing,\n 'resourceDestination',\n 'resourceDestinationLiteral',\n 'resourceDestinationLiteralMarker',\n 'resourceDestinationRaw',\n 'resourceDestinationString',\n 32\n )(code)\n }\n\n /**\n * In resource, after destination, at optional whitespace.\n *\n * ```markdown\n * > | [a](b) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceDestinationAfter(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceBetween)(code)\n : resourceEnd(code)\n }\n\n /**\n * At invalid destination.\n *\n * ```markdown\n * > | [a](<<) b\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceDestinationMissing(code) {\n return nok(code)\n }\n\n /**\n * In resource, after destination and whitespace, at `(` or title.\n *\n * ```markdown\n * > | [a](b ) c\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceBetween(code) {\n if (code === 34 || code === 39 || code === 40) {\n return factoryTitle(\n effects,\n resourceTitleAfter,\n nok,\n 'resourceTitle',\n 'resourceTitleMarker',\n 'resourceTitleString'\n )(code)\n }\n return resourceEnd(code)\n }\n\n /**\n * In resource, after title, at optional whitespace.\n *\n * ```markdown\n * > | [a](b \"c\") d\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceTitleAfter(code) {\n return markdownLineEndingOrSpace(code)\n ? factoryWhitespace(effects, resourceEnd)(code)\n : resourceEnd(code)\n }\n\n /**\n * In resource, at `)`.\n *\n * ```markdown\n * > | [a](b) d\n * ^\n * ```\n *\n * @type {State}\n */\n function resourceEnd(code) {\n if (code === 41) {\n effects.enter('resourceMarker')\n effects.consume(code)\n effects.exit('resourceMarker')\n effects.exit('resource')\n return ok\n }\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceFull(effects, ok, nok) {\n const self = this\n return referenceFull\n\n /**\n * In a reference (full), at the `[`.\n *\n * ```markdown\n * > | [a][b] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFull(code) {\n return factoryLabel.call(\n self,\n effects,\n referenceFullAfter,\n referenceFullMissing,\n 'reference',\n 'referenceMarker',\n 'referenceString'\n )(code)\n }\n\n /**\n * In a reference (full), after `]`.\n *\n * ```markdown\n * > | [a][b] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFullAfter(code) {\n return self.parser.defined.includes(\n normalizeIdentifier(\n self.sliceSerialize(self.events[self.events.length - 1][1]).slice(1, -1)\n )\n )\n ? ok(code)\n : nok(code)\n }\n\n /**\n * In reference (full) that was missing.\n *\n * ```markdown\n * > | [a][b d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceFullMissing(code) {\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeReferenceCollapsed(effects, ok, nok) {\n return referenceCollapsedStart\n\n /**\n * In reference (collapsed), at `[`.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceCollapsedStart(code) {\n // We only attempt a collapsed label if there’s a `[`.\n\n effects.enter('reference')\n effects.enter('referenceMarker')\n effects.consume(code)\n effects.exit('referenceMarker')\n return referenceCollapsedOpen\n }\n\n /**\n * In reference (collapsed), at `]`.\n *\n * > 👉 **Note**: we only get here if the label is defined.\n *\n * ```markdown\n * > | [a][] d\n * ^\n * ```\n *\n * @type {State}\n */\n function referenceCollapsedOpen(code) {\n if (code === 93) {\n effects.enter('referenceMarker')\n effects.consume(code)\n effects.exit('referenceMarker')\n effects.exit('reference')\n return ok\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {labelEnd} from './label-end.js'\n\n/** @type {Construct} */\nexport const labelStartImage = {\n name: 'labelStartImage',\n tokenize: tokenizeLabelStartImage,\n resolveAll: labelEnd.resolveAll\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartImage(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of label (image) start.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('labelImage')\n effects.enter('labelImageMarker')\n effects.consume(code)\n effects.exit('labelImageMarker')\n return open\n }\n\n /**\n * After `!`, at `[`.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 91) {\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelImage')\n return after\n }\n return nok(code)\n }\n\n /**\n * After `![`.\n *\n * ```markdown\n * > | a ![b] c\n * ^\n * ```\n *\n * This is needed in because, when GFM footnotes are enabled, images never\n * form when started with a `^`.\n * Instead, links form:\n *\n * ```markdown\n * ![^a](b)\n *\n * ![^a][b]\n *\n * [b]: c\n * ```\n *\n * ```html\n *

!^a

\n *

!^a

\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // To do: use a new field to do this, this is still needed for\n // `micromark-extension-gfm-footnote`, but the `label-start-link`\n // behavior isn’t.\n // Hidden footnotes hook.\n /* c8 ignore next 3 */\n return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs\n ? nok(code)\n : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n */\n\nimport {\n markdownLineEndingOrSpace,\n unicodePunctuation,\n unicodeWhitespace\n} from 'micromark-util-character'\n/**\n * Classify whether a code represents whitespace, punctuation, or something\n * else.\n *\n * Used for attention (emphasis, strong), whose sequences can open or close\n * based on the class of surrounding characters.\n *\n * > 👉 **Note**: eof (`null`) is seen as whitespace.\n *\n * @param {Code} code\n * Code.\n * @returns {typeof constants.characterGroupWhitespace | typeof constants.characterGroupPunctuation | undefined}\n * Group.\n */\nexport function classifyCharacter(code) {\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return 1\n }\n if (unicodePunctuation(code)) {\n return 2\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Point} Point\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {push, splice} from 'micromark-util-chunked'\nimport {classifyCharacter} from 'micromark-util-classify-character'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/** @type {Construct} */\nexport const attention = {\n name: 'attention',\n tokenize: tokenizeAttention,\n resolveAll: resolveAllAttention\n}\n\n/**\n * Take all events and resolve attention to emphasis or strong.\n *\n * @type {Resolver}\n */\nfunction resolveAllAttention(events, context) {\n let index = -1\n /** @type {number} */\n let open\n /** @type {Token} */\n let group\n /** @type {Token} */\n let text\n /** @type {Token} */\n let openingSequence\n /** @type {Token} */\n let closingSequence\n /** @type {number} */\n let use\n /** @type {Array} */\n let nextEvents\n /** @type {number} */\n let offset\n\n // Walk through all events.\n //\n // Note: performance of this is fine on an mb of normal markdown, but it’s\n // a bottleneck for malicious stuff.\n while (++index < events.length) {\n // Find a token that can close.\n if (\n events[index][0] === 'enter' &&\n events[index][1].type === 'attentionSequence' &&\n events[index][1]._close\n ) {\n open = index\n\n // Now walk back to find an opener.\n while (open--) {\n // Find a token that can open the closer.\n if (\n events[open][0] === 'exit' &&\n events[open][1].type === 'attentionSequence' &&\n events[open][1]._open &&\n // If the markers are the same:\n context.sliceSerialize(events[open][1]).charCodeAt(0) ===\n context.sliceSerialize(events[index][1]).charCodeAt(0)\n ) {\n // If the opening can close or the closing can open,\n // and the close size *is not* a multiple of three,\n // but the sum of the opening and closing size *is* multiple of three,\n // then don’t match.\n if (\n (events[open][1]._close || events[index][1]._open) &&\n (events[index][1].end.offset - events[index][1].start.offset) % 3 &&\n !(\n (events[open][1].end.offset -\n events[open][1].start.offset +\n events[index][1].end.offset -\n events[index][1].start.offset) %\n 3\n )\n ) {\n continue\n }\n\n // Number of markers to use from the sequence.\n use =\n events[open][1].end.offset - events[open][1].start.offset > 1 &&\n events[index][1].end.offset - events[index][1].start.offset > 1\n ? 2\n : 1\n const start = Object.assign({}, events[open][1].end)\n const end = Object.assign({}, events[index][1].start)\n movePoint(start, -use)\n movePoint(end, use)\n openingSequence = {\n type: use > 1 ? 'strongSequence' : 'emphasisSequence',\n start,\n end: Object.assign({}, events[open][1].end)\n }\n closingSequence = {\n type: use > 1 ? 'strongSequence' : 'emphasisSequence',\n start: Object.assign({}, events[index][1].start),\n end\n }\n text = {\n type: use > 1 ? 'strongText' : 'emphasisText',\n start: Object.assign({}, events[open][1].end),\n end: Object.assign({}, events[index][1].start)\n }\n group = {\n type: use > 1 ? 'strong' : 'emphasis',\n start: Object.assign({}, openingSequence.start),\n end: Object.assign({}, closingSequence.end)\n }\n events[open][1].end = Object.assign({}, openingSequence.start)\n events[index][1].start = Object.assign({}, closingSequence.end)\n nextEvents = []\n\n // If there are more markers in the opening, add them before.\n if (events[open][1].end.offset - events[open][1].start.offset) {\n nextEvents = push(nextEvents, [\n ['enter', events[open][1], context],\n ['exit', events[open][1], context]\n ])\n }\n\n // Opening.\n nextEvents = push(nextEvents, [\n ['enter', group, context],\n ['enter', openingSequence, context],\n ['exit', openingSequence, context],\n ['enter', text, context]\n ])\n\n // Always populated by defaults.\n\n // Between.\n nextEvents = push(\n nextEvents,\n resolveAll(\n context.parser.constructs.insideSpan.null,\n events.slice(open + 1, index),\n context\n )\n )\n\n // Closing.\n nextEvents = push(nextEvents, [\n ['exit', text, context],\n ['enter', closingSequence, context],\n ['exit', closingSequence, context],\n ['exit', group, context]\n ])\n\n // If there are more markers in the closing, add them after.\n if (events[index][1].end.offset - events[index][1].start.offset) {\n offset = 2\n nextEvents = push(nextEvents, [\n ['enter', events[index][1], context],\n ['exit', events[index][1], context]\n ])\n } else {\n offset = 0\n }\n splice(events, open - 1, index - open + 3, nextEvents)\n index = open + nextEvents.length - offset - 2\n break\n }\n }\n }\n }\n\n // Remove remaining sequences.\n index = -1\n while (++index < events.length) {\n if (events[index][1].type === 'attentionSequence') {\n events[index][1].type = 'data'\n }\n }\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeAttention(effects, ok) {\n const attentionMarkers = this.parser.constructs.attentionMarkers.null\n const previous = this.previous\n const before = classifyCharacter(previous)\n\n /** @type {NonNullable} */\n let marker\n return start\n\n /**\n * Before a sequence.\n *\n * ```markdown\n * > | **\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n marker = code\n effects.enter('attentionSequence')\n return inside(code)\n }\n\n /**\n * In a sequence.\n *\n * ```markdown\n * > | **\n * ^^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n if (code === marker) {\n effects.consume(code)\n return inside\n }\n const token = effects.exit('attentionSequence')\n\n // To do: next major: move this to resolver, just like `markdown-rs`.\n const after = classifyCharacter(code)\n\n // Always populated by defaults.\n\n const open =\n !after || (after === 2 && before) || attentionMarkers.includes(code)\n const close =\n !before || (before === 2 && after) || attentionMarkers.includes(previous)\n token._open = Boolean(marker === 42 ? open : open && (before || !close))\n token._close = Boolean(marker === 42 ? close : close && (after || !open))\n return ok(code)\n }\n}\n\n/**\n * Move a point a bit.\n *\n * Note: `move` only works inside lines! It’s not possible to move past other\n * chunks (replacement characters, tabs, or line endings).\n *\n * @param {Point} point\n * @param {number} offset\n * @returns {void}\n */\nfunction movePoint(point, offset) {\n point.column += offset\n point.offset += offset\n point._bufferIndex += offset\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n asciiAtext,\n asciiControl\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const autolink = {\n name: 'autolink',\n tokenize: tokenizeAutolink\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeAutolink(effects, ok, nok) {\n let size = 0\n return start\n\n /**\n * Start of an autolink.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('autolink')\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.enter('autolinkProtocol')\n return open\n }\n\n /**\n * After `<`, at protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (asciiAlpha(code)) {\n effects.consume(code)\n return schemeOrEmailAtext\n }\n return emailAtext(code)\n }\n\n /**\n * At second byte of protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function schemeOrEmailAtext(code) {\n // ASCII alphanumeric and `+`, `-`, and `.`.\n if (code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) {\n // Count the previous alphabetical from `open` too.\n size = 1\n return schemeInsideOrEmailAtext(code)\n }\n return emailAtext(code)\n }\n\n /**\n * In ambiguous protocol or atext.\n *\n * ```markdown\n * > | ab\n * ^\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function schemeInsideOrEmailAtext(code) {\n if (code === 58) {\n effects.consume(code)\n size = 0\n return urlInside\n }\n\n // ASCII alphanumeric and `+`, `-`, and `.`.\n if (\n (code === 43 || code === 45 || code === 46 || asciiAlphanumeric(code)) &&\n size++ < 32\n ) {\n effects.consume(code)\n return schemeInsideOrEmailAtext\n }\n size = 0\n return emailAtext(code)\n }\n\n /**\n * After protocol, in URL.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function urlInside(code) {\n if (code === 62) {\n effects.exit('autolinkProtocol')\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.exit('autolink')\n return ok\n }\n\n // ASCII control, space, or `<`.\n if (code === null || code === 32 || code === 60 || asciiControl(code)) {\n return nok(code)\n }\n effects.consume(code)\n return urlInside\n }\n\n /**\n * In email atext.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailAtext(code) {\n if (code === 64) {\n effects.consume(code)\n return emailAtSignOrDot\n }\n if (asciiAtext(code)) {\n effects.consume(code)\n return emailAtext\n }\n return nok(code)\n }\n\n /**\n * In label, after at-sign or dot.\n *\n * ```markdown\n * > | ab\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function emailAtSignOrDot(code) {\n return asciiAlphanumeric(code) ? emailLabel(code) : nok(code)\n }\n\n /**\n * In label, where `.` and `>` are allowed.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailLabel(code) {\n if (code === 46) {\n effects.consume(code)\n size = 0\n return emailAtSignOrDot\n }\n if (code === 62) {\n // Exit, then change the token type.\n effects.exit('autolinkProtocol').type = 'autolinkEmail'\n effects.enter('autolinkMarker')\n effects.consume(code)\n effects.exit('autolinkMarker')\n effects.exit('autolink')\n return ok\n }\n return emailValue(code)\n }\n\n /**\n * In label, where `.` and `>` are *not* allowed.\n *\n * Though, this is also used in `emailLabel` to parse other values.\n *\n * ```markdown\n * > | ab\n * ^\n * ```\n *\n * @type {State}\n */\n function emailValue(code) {\n // ASCII alphanumeric or `-`.\n if ((code === 45 || asciiAlphanumeric(code)) && size++ < 63) {\n const next = code === 45 ? emailValue : emailLabel\n effects.consume(code)\n return next\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n markdownLineEnding,\n markdownLineEndingOrSpace,\n markdownSpace\n} from 'micromark-util-character'\n/** @type {Construct} */\nexport const htmlText = {\n name: 'htmlText',\n tokenize: tokenizeHtmlText\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeHtmlText(effects, ok, nok) {\n const self = this\n /** @type {NonNullable | undefined} */\n let marker\n /** @type {number} */\n let index\n /** @type {State} */\n let returnState\n return start\n\n /**\n * Start of HTML (text).\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('htmlText')\n effects.enter('htmlTextData')\n effects.consume(code)\n return open\n }\n\n /**\n * After `<`, at tag name or other stuff.\n *\n * ```markdown\n * > | a c\n * ^\n * > | a c\n * ^\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (code === 33) {\n effects.consume(code)\n return declarationOpen\n }\n if (code === 47) {\n effects.consume(code)\n return tagCloseStart\n }\n if (code === 63) {\n effects.consume(code)\n return instruction\n }\n\n // ASCII alphabetical.\n if (asciiAlpha(code)) {\n effects.consume(code)\n return tagOpen\n }\n return nok(code)\n }\n\n /**\n * After ` | a c\n * ^\n * > | a c\n * ^\n * > | a &<]]> c\n * ^\n * ```\n *\n * @type {State}\n */\n function declarationOpen(code) {\n if (code === 45) {\n effects.consume(code)\n return commentOpenInside\n }\n if (code === 91) {\n effects.consume(code)\n index = 0\n return cdataOpenInside\n }\n if (asciiAlpha(code)) {\n effects.consume(code)\n return declaration\n }\n return nok(code)\n }\n\n /**\n * In a comment, after ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentOpenInside(code) {\n if (code === 45) {\n effects.consume(code)\n return commentEnd\n }\n return nok(code)\n }\n\n /**\n * In comment.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function comment(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 45) {\n effects.consume(code)\n return commentClose\n }\n if (markdownLineEnding(code)) {\n returnState = comment\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return comment\n }\n\n /**\n * In comment, after `-`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentClose(code) {\n if (code === 45) {\n effects.consume(code)\n return commentEnd\n }\n return comment(code)\n }\n\n /**\n * In comment, after `--`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function commentEnd(code) {\n return code === 62\n ? end(code)\n : code === 45\n ? commentClose(code)\n : comment(code)\n }\n\n /**\n * After ` | a &<]]> b\n * ^^^^^^\n * ```\n *\n * @type {State}\n */\n function cdataOpenInside(code) {\n const value = 'CDATA['\n if (code === value.charCodeAt(index++)) {\n effects.consume(code)\n return index === value.length ? cdata : cdataOpenInside\n }\n return nok(code)\n }\n\n /**\n * In CDATA.\n *\n * ```markdown\n * > | a &<]]> b\n * ^^^\n * ```\n *\n * @type {State}\n */\n function cdata(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 93) {\n effects.consume(code)\n return cdataClose\n }\n if (markdownLineEnding(code)) {\n returnState = cdata\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return cdata\n }\n\n /**\n * In CDATA, after `]`, at another `]`.\n *\n * ```markdown\n * > | a &<]]> b\n * ^\n * ```\n *\n * @type {State}\n */\n function cdataClose(code) {\n if (code === 93) {\n effects.consume(code)\n return cdataEnd\n }\n return cdata(code)\n }\n\n /**\n * In CDATA, after `]]`, at `>`.\n *\n * ```markdown\n * > | a &<]]> b\n * ^\n * ```\n *\n * @type {State}\n */\n function cdataEnd(code) {\n if (code === 62) {\n return end(code)\n }\n if (code === 93) {\n effects.consume(code)\n return cdataEnd\n }\n return cdata(code)\n }\n\n /**\n * In declaration.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function declaration(code) {\n if (code === null || code === 62) {\n return end(code)\n }\n if (markdownLineEnding(code)) {\n returnState = declaration\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return declaration\n }\n\n /**\n * In instruction.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function instruction(code) {\n if (code === null) {\n return nok(code)\n }\n if (code === 63) {\n effects.consume(code)\n return instructionClose\n }\n if (markdownLineEnding(code)) {\n returnState = instruction\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return instruction\n }\n\n /**\n * In instruction, after `?`, at `>`.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function instructionClose(code) {\n return code === 62 ? end(code) : instruction(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagCloseStart(code) {\n // ASCII alphabetical.\n if (asciiAlpha(code)) {\n effects.consume(code)\n return tagClose\n }\n return nok(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagClose(code) {\n // ASCII alphanumerical and `-`.\n if (code === 45 || asciiAlphanumeric(code)) {\n effects.consume(code)\n return tagClose\n }\n return tagCloseBetween(code)\n }\n\n /**\n * In closing tag, after tag name.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagCloseBetween(code) {\n if (markdownLineEnding(code)) {\n returnState = tagCloseBetween\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagCloseBetween\n }\n return end(code)\n }\n\n /**\n * After ` | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpen(code) {\n // ASCII alphanumerical and `-`.\n if (code === 45 || asciiAlphanumeric(code)) {\n effects.consume(code)\n return tagOpen\n }\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n return nok(code)\n }\n\n /**\n * In opening tag, after tag name.\n *\n * ```markdown\n * > | a c\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenBetween(code) {\n if (code === 47) {\n effects.consume(code)\n return end\n }\n\n // ASCII alphabetical and `:` and `_`.\n if (code === 58 || code === 95 || asciiAlpha(code)) {\n effects.consume(code)\n return tagOpenAttributeName\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenBetween\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenBetween\n }\n return end(code)\n }\n\n /**\n * In attribute name.\n *\n * ```markdown\n * > | a d\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeName(code) {\n // ASCII alphabetical and `-`, `.`, `:`, and `_`.\n if (\n code === 45 ||\n code === 46 ||\n code === 58 ||\n code === 95 ||\n asciiAlphanumeric(code)\n ) {\n effects.consume(code)\n return tagOpenAttributeName\n }\n return tagOpenAttributeNameAfter(code)\n }\n\n /**\n * After attribute name, before initializer, the end of the tag, or\n * whitespace.\n *\n * ```markdown\n * > | a d\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeNameAfter(code) {\n if (code === 61) {\n effects.consume(code)\n return tagOpenAttributeValueBefore\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeNameAfter\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenAttributeNameAfter\n }\n return tagOpenBetween(code)\n }\n\n /**\n * Before unquoted, double quoted, or single quoted attribute value, allowing\n * whitespace.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueBefore(code) {\n if (\n code === null ||\n code === 60 ||\n code === 61 ||\n code === 62 ||\n code === 96\n ) {\n return nok(code)\n }\n if (code === 34 || code === 39) {\n effects.consume(code)\n marker = code\n return tagOpenAttributeValueQuoted\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeValueBefore\n return lineEndingBefore(code)\n }\n if (markdownSpace(code)) {\n effects.consume(code)\n return tagOpenAttributeValueBefore\n }\n effects.consume(code)\n return tagOpenAttributeValueUnquoted\n }\n\n /**\n * In double or single quoted attribute value.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueQuoted(code) {\n if (code === marker) {\n effects.consume(code)\n marker = undefined\n return tagOpenAttributeValueQuotedAfter\n }\n if (code === null) {\n return nok(code)\n }\n if (markdownLineEnding(code)) {\n returnState = tagOpenAttributeValueQuoted\n return lineEndingBefore(code)\n }\n effects.consume(code)\n return tagOpenAttributeValueQuoted\n }\n\n /**\n * In unquoted attribute value.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueUnquoted(code) {\n if (\n code === null ||\n code === 34 ||\n code === 39 ||\n code === 60 ||\n code === 61 ||\n code === 96\n ) {\n return nok(code)\n }\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n effects.consume(code)\n return tagOpenAttributeValueUnquoted\n }\n\n /**\n * After double or single quoted attribute value, before whitespace or the end\n * of the tag.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function tagOpenAttributeValueQuotedAfter(code) {\n if (code === 47 || code === 62 || markdownLineEndingOrSpace(code)) {\n return tagOpenBetween(code)\n }\n return nok(code)\n }\n\n /**\n * In certain circumstances of a tag where only an `>` is allowed.\n *\n * ```markdown\n * > | a e\n * ^\n * ```\n *\n * @type {State}\n */\n function end(code) {\n if (code === 62) {\n effects.consume(code)\n effects.exit('htmlTextData')\n effects.exit('htmlText')\n return ok\n }\n return nok(code)\n }\n\n /**\n * At eol.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * > | a \n * ```\n *\n * @type {State}\n */\n function lineEndingBefore(code) {\n effects.exit('htmlTextData')\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return lineEndingAfter\n }\n\n /**\n * After eol, at optional whitespace.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * | a \n * ^\n * ```\n *\n * @type {State}\n */\n function lineEndingAfter(code) {\n // Always populated by defaults.\n\n return markdownSpace(code)\n ? factorySpace(\n effects,\n lineEndingAfterPrefix,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n : lineEndingAfterPrefix(code)\n }\n\n /**\n * After eol, after optional whitespace.\n *\n * > 👉 **Note**: we can’t have blank lines in text, so no need to worry about\n * > empty tokens.\n *\n * ```markdown\n * | a \n * ^\n * ```\n *\n * @type {State}\n */\n function lineEndingAfterPrefix(code) {\n effects.enter('htmlTextData')\n return returnState(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {labelEnd} from './label-end.js'\n\n/** @type {Construct} */\nexport const labelStartLink = {\n name: 'labelStartLink',\n tokenize: tokenizeLabelStartLink,\n resolveAll: labelEnd.resolveAll\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeLabelStartLink(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of label (link) start.\n *\n * ```markdown\n * > | a [b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('labelLink')\n effects.enter('labelMarker')\n effects.consume(code)\n effects.exit('labelMarker')\n effects.exit('labelLink')\n return after\n }\n\n /** @type {State} */\n function after(code) {\n // To do: this isn’t needed in `micromark-extension-gfm-footnote`,\n // remove.\n // Hidden footnotes hook.\n /* c8 ignore next 3 */\n return code === 94 && '_hiddenFootnoteSupport' in self.parser.constructs\n ? nok(code)\n : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const hardBreakEscape = {\n name: 'hardBreakEscape',\n tokenize: tokenizeHardBreakEscape\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeHardBreakEscape(effects, ok, nok) {\n return start\n\n /**\n * Start of a hard break (escape).\n *\n * ```markdown\n * > | a\\\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('hardBreakEscape')\n effects.consume(code)\n return after\n }\n\n /**\n * After `\\`, at eol.\n *\n * ```markdown\n * > | a\\\n * ^\n * | b\n * ```\n *\n * @type {State}\n */\n function after(code) {\n if (markdownLineEnding(code)) {\n effects.exit('hardBreakEscape')\n return ok(code)\n }\n return nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').Previous} Previous\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {markdownLineEnding} from 'micromark-util-character'\n/** @type {Construct} */\nexport const codeText = {\n name: 'codeText',\n tokenize: tokenizeCodeText,\n resolve: resolveCodeText,\n previous\n}\n\n// To do: next major: don’t resolve, like `markdown-rs`.\n/** @type {Resolver} */\nfunction resolveCodeText(events) {\n let tailExitIndex = events.length - 4\n let headEnterIndex = 3\n /** @type {number} */\n let index\n /** @type {number | undefined} */\n let enter\n\n // If we start and end with an EOL or a space.\n if (\n (events[headEnterIndex][1].type === 'lineEnding' ||\n events[headEnterIndex][1].type === 'space') &&\n (events[tailExitIndex][1].type === 'lineEnding' ||\n events[tailExitIndex][1].type === 'space')\n ) {\n index = headEnterIndex\n\n // And we have data.\n while (++index < tailExitIndex) {\n if (events[index][1].type === 'codeTextData') {\n // Then we have padding.\n events[headEnterIndex][1].type = 'codeTextPadding'\n events[tailExitIndex][1].type = 'codeTextPadding'\n headEnterIndex += 2\n tailExitIndex -= 2\n break\n }\n }\n }\n\n // Merge adjacent spaces and data.\n index = headEnterIndex - 1\n tailExitIndex++\n while (++index <= tailExitIndex) {\n if (enter === undefined) {\n if (index !== tailExitIndex && events[index][1].type !== 'lineEnding') {\n enter = index\n }\n } else if (\n index === tailExitIndex ||\n events[index][1].type === 'lineEnding'\n ) {\n events[enter][1].type = 'codeTextData'\n if (index !== enter + 2) {\n events[enter][1].end = events[index - 1][1].end\n events.splice(enter + 2, index - enter - 2)\n tailExitIndex -= index - enter - 2\n index = enter + 2\n }\n enter = undefined\n }\n }\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Previous}\n */\nfunction previous(code) {\n // If there is a previous code, there will always be a tail.\n return (\n code !== 96 ||\n this.events[this.events.length - 1][1].type === 'characterEscape'\n )\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeCodeText(effects, ok, nok) {\n const self = this\n let sizeOpen = 0\n /** @type {number} */\n let size\n /** @type {Token} */\n let token\n return start\n\n /**\n * Start of code (text).\n *\n * ```markdown\n * > | `a`\n * ^\n * > | \\`a`\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('codeText')\n effects.enter('codeTextSequence')\n return sequenceOpen(code)\n }\n\n /**\n * In opening sequence.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceOpen(code) {\n if (code === 96) {\n effects.consume(code)\n sizeOpen++\n return sequenceOpen\n }\n effects.exit('codeTextSequence')\n return between(code)\n }\n\n /**\n * Between something and something else.\n *\n * ```markdown\n * > | `a`\n * ^^\n * ```\n *\n * @type {State}\n */\n function between(code) {\n // EOF.\n if (code === null) {\n return nok(code)\n }\n\n // To do: next major: don’t do spaces in resolve, but when compiling,\n // like `markdown-rs`.\n // Tabs don’t work, and virtual spaces don’t make sense.\n if (code === 32) {\n effects.enter('space')\n effects.consume(code)\n effects.exit('space')\n return between\n }\n\n // Closing fence? Could also be data.\n if (code === 96) {\n token = effects.enter('codeTextSequence')\n size = 0\n return sequenceClose(code)\n }\n if (markdownLineEnding(code)) {\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return between\n }\n\n // Data.\n effects.enter('codeTextData')\n return data(code)\n }\n\n /**\n * In data.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function data(code) {\n if (\n code === null ||\n code === 32 ||\n code === 96 ||\n markdownLineEnding(code)\n ) {\n effects.exit('codeTextData')\n return between(code)\n }\n effects.consume(code)\n return data\n }\n\n /**\n * In closing sequence.\n *\n * ```markdown\n * > | `a`\n * ^\n * ```\n *\n * @type {State}\n */\n function sequenceClose(code) {\n // More.\n if (code === 96) {\n effects.consume(code)\n size++\n return sequenceClose\n }\n\n // Done!\n if (size === sizeOpen) {\n effects.exit('codeTextSequence')\n effects.exit('codeText')\n return ok(code)\n }\n\n // More or less accents: mark as data.\n token.type = 'codeTextData'\n return data(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Extension} Extension\n */\n\nimport {\n attention,\n autolink,\n blockQuote,\n characterEscape,\n characterReference,\n codeFenced,\n codeIndented,\n codeText,\n definition,\n hardBreakEscape,\n headingAtx,\n htmlFlow,\n htmlText,\n labelEnd,\n labelStartImage,\n labelStartLink,\n lineEnding,\n list,\n setextUnderline,\n thematicBreak\n} from 'micromark-core-commonmark'\nimport {resolver as resolveText} from './initialize/text.js'\n\n/** @satisfies {Extension['document']} */\nexport const document = {\n [42]: list,\n [43]: list,\n [45]: list,\n [48]: list,\n [49]: list,\n [50]: list,\n [51]: list,\n [52]: list,\n [53]: list,\n [54]: list,\n [55]: list,\n [56]: list,\n [57]: list,\n [62]: blockQuote\n}\n\n/** @satisfies {Extension['contentInitial']} */\nexport const contentInitial = {\n [91]: definition\n}\n\n/** @satisfies {Extension['flowInitial']} */\nexport const flowInitial = {\n [-2]: codeIndented,\n [-1]: codeIndented,\n [32]: codeIndented\n}\n\n/** @satisfies {Extension['flow']} */\nexport const flow = {\n [35]: headingAtx,\n [42]: thematicBreak,\n [45]: [setextUnderline, thematicBreak],\n [60]: htmlFlow,\n [61]: setextUnderline,\n [95]: thematicBreak,\n [96]: codeFenced,\n [126]: codeFenced\n}\n\n/** @satisfies {Extension['string']} */\nexport const string = {\n [38]: characterReference,\n [92]: characterEscape\n}\n\n/** @satisfies {Extension['text']} */\nexport const text = {\n [-5]: lineEnding,\n [-4]: lineEnding,\n [-3]: lineEnding,\n [33]: labelStartImage,\n [38]: characterReference,\n [42]: attention,\n [60]: [autolink, htmlText],\n [91]: labelStartLink,\n [92]: [hardBreakEscape, characterEscape],\n [93]: labelEnd,\n [95]: attention,\n [96]: codeText\n}\n\n/** @satisfies {Extension['insideSpan']} */\nexport const insideSpan = {\n null: [attention, resolveText]\n}\n\n/** @satisfies {Extension['attentionMarkers']} */\nexport const attentionMarkers = {\n null: [42, 95]\n}\n\n/** @satisfies {Extension['disable']} */\nexport const disable = {\n null: []\n}\n","/**\n * @typedef {import('micromark-util-types').Create} Create\n * @typedef {import('micromark-util-types').FullNormalizedExtension} FullNormalizedExtension\n * @typedef {import('micromark-util-types').InitialConstruct} InitialConstruct\n * @typedef {import('micromark-util-types').ParseContext} ParseContext\n * @typedef {import('micromark-util-types').ParseOptions} ParseOptions\n */\n\nimport {combineExtensions} from 'micromark-util-combine-extensions'\nimport {content} from './initialize/content.js'\nimport {document} from './initialize/document.js'\nimport {flow} from './initialize/flow.js'\nimport {text, string} from './initialize/text.js'\nimport {createTokenizer} from './create-tokenizer.js'\nimport * as defaultConstructs from './constructs.js'\n\n/**\n * @param {ParseOptions | null | undefined} [options]\n * @returns {ParseContext}\n */\nexport function parse(options) {\n const settings = options || {}\n const constructs =\n /** @type {FullNormalizedExtension} */\n combineExtensions([defaultConstructs, ...(settings.extensions || [])])\n\n /** @type {ParseContext} */\n const parser = {\n defined: [],\n lazy: {},\n constructs,\n content: create(content),\n document: create(document),\n flow: create(flow),\n string: create(string),\n text: create(text)\n }\n return parser\n\n /**\n * @param {InitialConstruct} initial\n */\n function create(initial) {\n return creator\n /** @type {Create} */\n function creator(from) {\n return createTokenizer(parser, initial, from)\n }\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Chunk} Chunk\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').Encoding} Encoding\n * @typedef {import('micromark-util-types').Value} Value\n */\n\n/**\n * @callback Preprocessor\n * @param {Value} value\n * @param {Encoding | null | undefined} [encoding]\n * @param {boolean | null | undefined} [end=false]\n * @returns {Array}\n */\n\nconst search = /[\\0\\t\\n\\r]/g\n\n/**\n * @returns {Preprocessor}\n */\nexport function preprocess() {\n let column = 1\n let buffer = ''\n /** @type {boolean | undefined} */\n let start = true\n /** @type {boolean | undefined} */\n let atCarriageReturn\n return preprocessor\n\n /** @type {Preprocessor} */\n function preprocessor(value, encoding, end) {\n /** @type {Array} */\n const chunks = []\n /** @type {RegExpMatchArray | null} */\n let match\n /** @type {number} */\n let next\n /** @type {number} */\n let startPosition\n /** @type {number} */\n let endPosition\n /** @type {Code} */\n let code\n\n // @ts-expect-error `Buffer` does allow an encoding.\n value = buffer + value.toString(encoding)\n startPosition = 0\n buffer = ''\n if (start) {\n // To do: `markdown-rs` actually parses BOMs (byte order mark).\n if (value.charCodeAt(0) === 65279) {\n startPosition++\n }\n start = undefined\n }\n while (startPosition < value.length) {\n search.lastIndex = startPosition\n match = search.exec(value)\n endPosition =\n match && match.index !== undefined ? match.index : value.length\n code = value.charCodeAt(endPosition)\n if (!match) {\n buffer = value.slice(startPosition)\n break\n }\n if (code === 10 && startPosition === endPosition && atCarriageReturn) {\n chunks.push(-3)\n atCarriageReturn = undefined\n } else {\n if (atCarriageReturn) {\n chunks.push(-5)\n atCarriageReturn = undefined\n }\n if (startPosition < endPosition) {\n chunks.push(value.slice(startPosition, endPosition))\n column += endPosition - startPosition\n }\n switch (code) {\n case 0: {\n chunks.push(65533)\n column++\n break\n }\n case 9: {\n next = Math.ceil(column / 4) * 4\n chunks.push(-2)\n while (column++ < next) chunks.push(-1)\n break\n }\n case 10: {\n chunks.push(-4)\n column = 1\n break\n }\n default: {\n atCarriageReturn = true\n column = 1\n }\n }\n }\n startPosition = endPosition + 1\n }\n if (end) {\n if (atCarriageReturn) chunks.push(-5)\n if (buffer) chunks.push(buffer)\n chunks.push(null)\n }\n return chunks\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\nimport {subtokenize} from 'micromark-util-subtokenize'\n\n/**\n * @param {Array} events\n * @returns {Array}\n */\nexport function postprocess(events) {\n while (!subtokenize(events)) {\n // Empty\n }\n return events\n}\n","/**\n * Turn the number (in string form as either hexa- or plain decimal) coming from\n * a numeric character reference into a character.\n *\n * Sort of like `String.fromCharCode(Number.parseInt(value, base))`, but makes\n * non-characters and control characters safe.\n *\n * @param {string} value\n * Value to decode.\n * @param {number} base\n * Numeric base.\n * @returns {string}\n * Character.\n */\nexport function decodeNumericCharacterReference(value, base) {\n const code = Number.parseInt(value, base)\n if (\n // C0 except for HT, LF, FF, CR, space.\n code < 9 ||\n code === 11 ||\n (code > 13 && code < 32) ||\n // Control character (DEL) of C0, and C1 controls.\n (code > 126 && code < 160) ||\n // Lone high surrogates and low surrogates.\n (code > 55295 && code < 57344) ||\n // Noncharacters.\n (code > 64975 && code < 65008) /* eslint-disable no-bitwise */ ||\n (code & 65535) === 65535 ||\n (code & 65535) === 65534 /* eslint-enable no-bitwise */ ||\n // Out of range\n code > 1114111\n ) {\n return '\\uFFFD'\n }\n return String.fromCharCode(code)\n}\n","import {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nconst characterEscapeOrReference =\n /\\\\([!-/:-@[-`{-~])|&(#(?:\\d{1,7}|x[\\da-f]{1,6})|[\\da-z]{1,31});/gi\n\n/**\n * Decode markdown strings (which occur in places such as fenced code info\n * strings, destinations, labels, and titles).\n *\n * The “string” content type allows character escapes and -references.\n * This decodes those.\n *\n * @param {string} value\n * Value to decode.\n * @returns {string}\n * Decoded value.\n */\nexport function decodeString(value) {\n return value.replace(characterEscapeOrReference, decode)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @param {string} $2\n * @returns {string}\n */\nfunction decode($0, $1, $2) {\n if ($1) {\n // Escape.\n return $1\n }\n\n // Reference.\n const head = $2.charCodeAt(0)\n if (head === 35) {\n const head = $2.charCodeAt(1)\n const hex = head === 120 || head === 88\n return decodeNumericCharacterReference($2.slice(hex ? 2 : 1), hex ? 16 : 10)\n }\n return decodeNamedCharacterReference($2) || $0\n}\n","/**\n * @typedef {import('micromark-util-types').Encoding} Encoding\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').ParseOptions} ParseOptions\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Value} Value\n *\n * @typedef {import('unist').Parent} UnistParent\n * @typedef {import('unist').Point} Point\n *\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('mdast').StaticPhrasingContent} StaticPhrasingContent\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Break} Break\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('mdast').Code} Code\n * @typedef {import('mdast').Definition} Definition\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('mdast').HTML} HTML\n * @typedef {import('mdast').Image} Image\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('mdast').Link} Link\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('mdast').List} List\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('mdast').Text} Text\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('mdast').ReferenceType} ReferenceType\n * @typedef {import('../index.js').CompileData} CompileData\n */\n\n/**\n * @typedef {Root | Content} Node\n * @typedef {Extract} Parent\n *\n * @typedef {Omit & {type: 'fragment', children: Array}} Fragment\n */\n\n/**\n * @callback Transform\n * Extra transform, to change the AST afterwards.\n * @param {Root} tree\n * Tree to transform.\n * @returns {Root | undefined | null | void}\n * New tree or nothing (in which case the current tree is used).\n *\n * @callback Handle\n * Handle a token.\n * @param {CompileContext} this\n * Context.\n * @param {Token} token\n * Current token.\n * @returns {void}\n * Nothing.\n *\n * @typedef {Record} Handles\n * Token types mapping to handles\n *\n * @callback OnEnterError\n * Handle the case where the `right` token is open, but it is closed (by the\n * `left` token) or because we reached the end of the document.\n * @param {Omit} this\n * Context.\n * @param {Token | undefined} left\n * Left token.\n * @param {Token} right\n * Right token.\n * @returns {void}\n * Nothing.\n *\n * @callback OnExitError\n * Handle the case where the `right` token is open but it is closed by\n * exiting the `left` token.\n * @param {Omit} this\n * Context.\n * @param {Token} left\n * Left token.\n * @param {Token} right\n * Right token.\n * @returns {void}\n * Nothing.\n *\n * @typedef {[Token, OnEnterError | undefined]} TokenTuple\n * Open token on the stack, with an optional error handler for when\n * that token isn’t closed properly.\n */\n\n/**\n * @typedef Config\n * Configuration.\n *\n * We have our defaults, but extensions will add more.\n * @property {Array} canContainEols\n * Token types where line endings are used.\n * @property {Handles} enter\n * Opening handles.\n * @property {Handles} exit\n * Closing handles.\n * @property {Array} transforms\n * Tree transforms.\n *\n * @typedef {Partial} Extension\n * Change how markdown tokens from micromark are turned into mdast.\n *\n * @typedef CompileContext\n * mdast compiler context.\n * @property {Array} stack\n * Stack of nodes.\n * @property {Array} tokenStack\n * Stack of tokens.\n * @property {(key: Key) => CompileData[Key]} getData\n * Get data from the key/value store.\n * @property {(key: Key, value?: CompileData[Key]) => void} setData\n * Set data into the key/value store.\n * @property {(this: CompileContext) => void} buffer\n * Capture some of the output data.\n * @property {(this: CompileContext) => string} resume\n * Stop capturing and access the output data.\n * @property {(this: CompileContext, node: Kind, token: Token, onError?: OnEnterError) => Kind} enter\n * Enter a token.\n * @property {(this: CompileContext, token: Token, onError?: OnExitError) => Node} exit\n * Exit a token.\n * @property {TokenizeContext['sliceSerialize']} sliceSerialize\n * Get the string value of a token.\n * @property {Config} config\n * Configuration.\n *\n * @typedef FromMarkdownOptions\n * Configuration for how to build mdast.\n * @property {Array> | null | undefined} [mdastExtensions]\n * Extensions for this utility to change how tokens are turned into a tree.\n *\n * @typedef {ParseOptions & FromMarkdownOptions} Options\n * Configuration.\n */\n\n// To do: micromark: create a registry of tokens?\n// To do: next major: don’t return given `Node` from `enter`.\n// To do: next major: remove setter/getter.\n\nimport {toString} from 'mdast-util-to-string'\nimport {parse} from 'micromark/lib/parse.js'\nimport {preprocess} from 'micromark/lib/preprocess.js'\nimport {postprocess} from 'micromark/lib/postprocess.js'\nimport {decodeNumericCharacterReference} from 'micromark-util-decode-numeric-character-reference'\nimport {decodeString} from 'micromark-util-decode-string'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {decodeNamedCharacterReference} from 'decode-named-character-reference'\nimport {stringifyPosition} from 'unist-util-stringify-position'\nconst own = {}.hasOwnProperty\n\n/**\n * @param value\n * Markdown to parse.\n * @param encoding\n * Character encoding for when `value` is `Buffer`.\n * @param options\n * Configuration.\n * @returns\n * mdast tree.\n */\nexport const fromMarkdown =\n /**\n * @type {(\n * ((value: Value, encoding: Encoding, options?: Options | null | undefined) => Root) &\n * ((value: Value, options?: Options | null | undefined) => Root)\n * )}\n */\n\n /**\n * @param {Value} value\n * @param {Encoding | Options | null | undefined} [encoding]\n * @param {Options | null | undefined} [options]\n * @returns {Root}\n */\n function (value, encoding, options) {\n if (typeof encoding !== 'string') {\n options = encoding\n encoding = undefined\n }\n return compiler(options)(\n postprocess(\n parse(options).document().write(preprocess()(value, encoding, true))\n )\n )\n }\n\n/**\n * Note this compiler only understand complete buffering, not streaming.\n *\n * @param {Options | null | undefined} [options]\n */\nfunction compiler(options) {\n /** @type {Config} */\n const config = {\n transforms: [],\n canContainEols: ['emphasis', 'fragment', 'heading', 'paragraph', 'strong'],\n enter: {\n autolink: opener(link),\n autolinkProtocol: onenterdata,\n autolinkEmail: onenterdata,\n atxHeading: opener(heading),\n blockQuote: opener(blockQuote),\n characterEscape: onenterdata,\n characterReference: onenterdata,\n codeFenced: opener(codeFlow),\n codeFencedFenceInfo: buffer,\n codeFencedFenceMeta: buffer,\n codeIndented: opener(codeFlow, buffer),\n codeText: opener(codeText, buffer),\n codeTextData: onenterdata,\n data: onenterdata,\n codeFlowValue: onenterdata,\n definition: opener(definition),\n definitionDestinationString: buffer,\n definitionLabelString: buffer,\n definitionTitleString: buffer,\n emphasis: opener(emphasis),\n hardBreakEscape: opener(hardBreak),\n hardBreakTrailing: opener(hardBreak),\n htmlFlow: opener(html, buffer),\n htmlFlowData: onenterdata,\n htmlText: opener(html, buffer),\n htmlTextData: onenterdata,\n image: opener(image),\n label: buffer,\n link: opener(link),\n listItem: opener(listItem),\n listItemValue: onenterlistitemvalue,\n listOrdered: opener(list, onenterlistordered),\n listUnordered: opener(list),\n paragraph: opener(paragraph),\n reference: onenterreference,\n referenceString: buffer,\n resourceDestinationString: buffer,\n resourceTitleString: buffer,\n setextHeading: opener(heading),\n strong: opener(strong),\n thematicBreak: opener(thematicBreak)\n },\n exit: {\n atxHeading: closer(),\n atxHeadingSequence: onexitatxheadingsequence,\n autolink: closer(),\n autolinkEmail: onexitautolinkemail,\n autolinkProtocol: onexitautolinkprotocol,\n blockQuote: closer(),\n characterEscapeValue: onexitdata,\n characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,\n characterReferenceMarkerNumeric: onexitcharacterreferencemarker,\n characterReferenceValue: onexitcharacterreferencevalue,\n codeFenced: closer(onexitcodefenced),\n codeFencedFence: onexitcodefencedfence,\n codeFencedFenceInfo: onexitcodefencedfenceinfo,\n codeFencedFenceMeta: onexitcodefencedfencemeta,\n codeFlowValue: onexitdata,\n codeIndented: closer(onexitcodeindented),\n codeText: closer(onexitcodetext),\n codeTextData: onexitdata,\n data: onexitdata,\n definition: closer(),\n definitionDestinationString: onexitdefinitiondestinationstring,\n definitionLabelString: onexitdefinitionlabelstring,\n definitionTitleString: onexitdefinitiontitlestring,\n emphasis: closer(),\n hardBreakEscape: closer(onexithardbreak),\n hardBreakTrailing: closer(onexithardbreak),\n htmlFlow: closer(onexithtmlflow),\n htmlFlowData: onexitdata,\n htmlText: closer(onexithtmltext),\n htmlTextData: onexitdata,\n image: closer(onexitimage),\n label: onexitlabel,\n labelText: onexitlabeltext,\n lineEnding: onexitlineending,\n link: closer(onexitlink),\n listItem: closer(),\n listOrdered: closer(),\n listUnordered: closer(),\n paragraph: closer(),\n referenceString: onexitreferencestring,\n resourceDestinationString: onexitresourcedestinationstring,\n resourceTitleString: onexitresourcetitlestring,\n resource: onexitresource,\n setextHeading: closer(onexitsetextheading),\n setextHeadingLineSequence: onexitsetextheadinglinesequence,\n setextHeadingText: onexitsetextheadingtext,\n strong: closer(),\n thematicBreak: closer()\n }\n }\n configure(config, (options || {}).mdastExtensions || [])\n\n /** @type {CompileData} */\n const data = {}\n return compile\n\n /**\n * Turn micromark events into an mdast tree.\n *\n * @param {Array} events\n * Events.\n * @returns {Root}\n * mdast tree.\n */\n function compile(events) {\n /** @type {Root} */\n let tree = {\n type: 'root',\n children: []\n }\n /** @type {Omit} */\n const context = {\n stack: [tree],\n tokenStack: [],\n config,\n enter,\n exit,\n buffer,\n resume,\n setData,\n getData\n }\n /** @type {Array} */\n const listStack = []\n let index = -1\n while (++index < events.length) {\n // We preprocess lists to add `listItem` tokens, and to infer whether\n // items the list itself are spread out.\n if (\n events[index][1].type === 'listOrdered' ||\n events[index][1].type === 'listUnordered'\n ) {\n if (events[index][0] === 'enter') {\n listStack.push(index)\n } else {\n const tail = listStack.pop()\n index = prepareList(events, tail, index)\n }\n }\n }\n index = -1\n while (++index < events.length) {\n const handler = config[events[index][0]]\n if (own.call(handler, events[index][1].type)) {\n handler[events[index][1].type].call(\n Object.assign(\n {\n sliceSerialize: events[index][2].sliceSerialize\n },\n context\n ),\n events[index][1]\n )\n }\n }\n\n // Handle tokens still being open.\n if (context.tokenStack.length > 0) {\n const tail = context.tokenStack[context.tokenStack.length - 1]\n const handler = tail[1] || defaultOnError\n handler.call(context, undefined, tail[0])\n }\n\n // Figure out `root` position.\n tree.position = {\n start: point(\n events.length > 0\n ? events[0][1].start\n : {\n line: 1,\n column: 1,\n offset: 0\n }\n ),\n end: point(\n events.length > 0\n ? events[events.length - 2][1].end\n : {\n line: 1,\n column: 1,\n offset: 0\n }\n )\n }\n\n // Call transforms.\n index = -1\n while (++index < config.transforms.length) {\n tree = config.transforms[index](tree) || tree\n }\n return tree\n }\n\n /**\n * @param {Array} events\n * @param {number} start\n * @param {number} length\n * @returns {number}\n */\n function prepareList(events, start, length) {\n let index = start - 1\n let containerBalance = -1\n let listSpread = false\n /** @type {Token | undefined} */\n let listItem\n /** @type {number | undefined} */\n let lineIndex\n /** @type {number | undefined} */\n let firstBlankLineIndex\n /** @type {boolean | undefined} */\n let atMarker\n while (++index <= length) {\n const event = events[index]\n if (\n event[1].type === 'listUnordered' ||\n event[1].type === 'listOrdered' ||\n event[1].type === 'blockQuote'\n ) {\n if (event[0] === 'enter') {\n containerBalance++\n } else {\n containerBalance--\n }\n atMarker = undefined\n } else if (event[1].type === 'lineEndingBlank') {\n if (event[0] === 'enter') {\n if (\n listItem &&\n !atMarker &&\n !containerBalance &&\n !firstBlankLineIndex\n ) {\n firstBlankLineIndex = index\n }\n atMarker = undefined\n }\n } else if (\n event[1].type === 'linePrefix' ||\n event[1].type === 'listItemValue' ||\n event[1].type === 'listItemMarker' ||\n event[1].type === 'listItemPrefix' ||\n event[1].type === 'listItemPrefixWhitespace'\n ) {\n // Empty.\n } else {\n atMarker = undefined\n }\n if (\n (!containerBalance &&\n event[0] === 'enter' &&\n event[1].type === 'listItemPrefix') ||\n (containerBalance === -1 &&\n event[0] === 'exit' &&\n (event[1].type === 'listUnordered' ||\n event[1].type === 'listOrdered'))\n ) {\n if (listItem) {\n let tailIndex = index\n lineIndex = undefined\n while (tailIndex--) {\n const tailEvent = events[tailIndex]\n if (\n tailEvent[1].type === 'lineEnding' ||\n tailEvent[1].type === 'lineEndingBlank'\n ) {\n if (tailEvent[0] === 'exit') continue\n if (lineIndex) {\n events[lineIndex][1].type = 'lineEndingBlank'\n listSpread = true\n }\n tailEvent[1].type = 'lineEnding'\n lineIndex = tailIndex\n } else if (\n tailEvent[1].type === 'linePrefix' ||\n tailEvent[1].type === 'blockQuotePrefix' ||\n tailEvent[1].type === 'blockQuotePrefixWhitespace' ||\n tailEvent[1].type === 'blockQuoteMarker' ||\n tailEvent[1].type === 'listItemIndent'\n ) {\n // Empty\n } else {\n break\n }\n }\n if (\n firstBlankLineIndex &&\n (!lineIndex || firstBlankLineIndex < lineIndex)\n ) {\n listItem._spread = true\n }\n\n // Fix position.\n listItem.end = Object.assign(\n {},\n lineIndex ? events[lineIndex][1].start : event[1].end\n )\n events.splice(lineIndex || index, 0, ['exit', listItem, event[2]])\n index++\n length++\n }\n\n // Create a new list item.\n if (event[1].type === 'listItemPrefix') {\n listItem = {\n type: 'listItem',\n _spread: false,\n start: Object.assign({}, event[1].start),\n // @ts-expect-error: we’ll add `end` in a second.\n end: undefined\n }\n // @ts-expect-error: `listItem` is most definitely defined, TS...\n events.splice(index, 0, ['enter', listItem, event[2]])\n index++\n length++\n firstBlankLineIndex = undefined\n atMarker = true\n }\n }\n }\n events[start][1]._spread = listSpread\n return length\n }\n\n /**\n * Set data.\n *\n * @template {keyof CompileData} Key\n * Field type.\n * @param {Key} key\n * Key of field.\n * @param {CompileData[Key]} [value]\n * New value.\n * @returns {void}\n * Nothing.\n */\n function setData(key, value) {\n data[key] = value\n }\n\n /**\n * Get data.\n *\n * @template {keyof CompileData} Key\n * Field type.\n * @param {Key} key\n * Key of field.\n * @returns {CompileData[Key]}\n * Value.\n */\n function getData(key) {\n return data[key]\n }\n\n /**\n * Create an opener handle.\n *\n * @param {(token: Token) => Node} create\n * Create a node.\n * @param {Handle} [and]\n * Optional function to also run.\n * @returns {Handle}\n * Handle.\n */\n function opener(create, and) {\n return open\n\n /**\n * @this {CompileContext}\n * @param {Token} token\n * @returns {void}\n */\n function open(token) {\n enter.call(this, create(token), token)\n if (and) and.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * @returns {void}\n */\n function buffer() {\n this.stack.push({\n type: 'fragment',\n children: []\n })\n }\n\n /**\n * @template {Node} Kind\n * Node type.\n * @this {CompileContext}\n * Context.\n * @param {Kind} node\n * Node to enter.\n * @param {Token} token\n * Corresponding token.\n * @param {OnEnterError | undefined} [errorHandler]\n * Handle the case where this token is open, but it is closed by something else.\n * @returns {Kind}\n * The given node.\n */\n function enter(node, token, errorHandler) {\n const parent = this.stack[this.stack.length - 1]\n // @ts-expect-error: Assume `Node` can exist as a child of `parent`.\n parent.children.push(node)\n this.stack.push(node)\n this.tokenStack.push([token, errorHandler])\n // @ts-expect-error: `end` will be patched later.\n node.position = {\n start: point(token.start)\n }\n return node\n }\n\n /**\n * Create a closer handle.\n *\n * @param {Handle} [and]\n * Optional function to also run.\n * @returns {Handle}\n * Handle.\n */\n function closer(and) {\n return close\n\n /**\n * @this {CompileContext}\n * @param {Token} token\n * @returns {void}\n */\n function close(token) {\n if (and) and.call(this, token)\n exit.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * Context.\n * @param {Token} token\n * Corresponding token.\n * @param {OnExitError | undefined} [onExitError]\n * Handle the case where another token is open.\n * @returns {Node}\n * The closed node.\n */\n function exit(token, onExitError) {\n const node = this.stack.pop()\n const open = this.tokenStack.pop()\n if (!open) {\n throw new Error(\n 'Cannot close `' +\n token.type +\n '` (' +\n stringifyPosition({\n start: token.start,\n end: token.end\n }) +\n '): it’s not open'\n )\n } else if (open[0].type !== token.type) {\n if (onExitError) {\n onExitError.call(this, token, open[0])\n } else {\n const handler = open[1] || defaultOnError\n handler.call(this, token, open[0])\n }\n }\n node.position.end = point(token.end)\n return node\n }\n\n /**\n * @this {CompileContext}\n * @returns {string}\n */\n function resume() {\n return toString(this.stack.pop())\n }\n\n //\n // Handlers.\n //\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onenterlistordered() {\n setData('expectingFirstListItemValue', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onenterlistitemvalue(token) {\n if (getData('expectingFirstListItemValue')) {\n const ancestor = this.stack[this.stack.length - 2]\n ancestor.start = Number.parseInt(this.sliceSerialize(token), 10)\n setData('expectingFirstListItemValue')\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfenceinfo() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.lang = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfencemeta() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.meta = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefencedfence() {\n // Exit if this is the closing fence.\n if (getData('flowCodeInside')) return\n this.buffer()\n setData('flowCodeInside', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodefenced() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data.replace(/^(\\r?\\n|\\r)|(\\r?\\n|\\r)$/g, '')\n setData('flowCodeInside')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcodeindented() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data.replace(/(\\r?\\n|\\r)$/g, '')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitionlabelstring(token) {\n const label = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitiontitlestring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.title = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitdefinitiondestinationstring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.url = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitatxheadingsequence(token) {\n const node = this.stack[this.stack.length - 1]\n if (!node.depth) {\n const depth = this.sliceSerialize(token).length\n node.depth = depth\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheadingtext() {\n setData('setextHeadingSlurpLineEnding', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheadinglinesequence(token) {\n const node = this.stack[this.stack.length - 1]\n node.depth = this.sliceSerialize(token).charCodeAt(0) === 61 ? 1 : 2\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitsetextheading() {\n setData('setextHeadingSlurpLineEnding')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onenterdata(token) {\n const node = this.stack[this.stack.length - 1]\n let tail = node.children[node.children.length - 1]\n if (!tail || tail.type !== 'text') {\n // Add a new text node.\n tail = text()\n // @ts-expect-error: we’ll add `end` later.\n tail.position = {\n start: point(token.start)\n }\n // @ts-expect-error: Assume `parent` accepts `text`.\n node.children.push(tail)\n }\n this.stack.push(tail)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitdata(token) {\n const tail = this.stack.pop()\n tail.value += this.sliceSerialize(token)\n tail.position.end = point(token.end)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlineending(token) {\n const context = this.stack[this.stack.length - 1]\n // If we’re at a hard break, include the line ending in there.\n if (getData('atHardBreak')) {\n const tail = context.children[context.children.length - 1]\n tail.position.end = point(token.end)\n setData('atHardBreak')\n return\n }\n if (\n !getData('setextHeadingSlurpLineEnding') &&\n config.canContainEols.includes(context.type)\n ) {\n onenterdata.call(this, token)\n onexitdata.call(this, token)\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithardbreak() {\n setData('atHardBreak', true)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithtmlflow() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexithtmltext() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitcodetext() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.value = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlink() {\n const node = this.stack[this.stack.length - 1]\n // Note: there are also `identifier` and `label` fields on this link node!\n // These are used / cleaned here.\n // To do: clean.\n if (getData('inReference')) {\n /** @type {ReferenceType} */\n const referenceType = getData('referenceType') || 'shortcut'\n node.type += 'Reference'\n // @ts-expect-error: mutate.\n node.referenceType = referenceType\n // @ts-expect-error: mutate.\n delete node.url\n delete node.title\n } else {\n // @ts-expect-error: mutate.\n delete node.identifier\n // @ts-expect-error: mutate.\n delete node.label\n }\n setData('referenceType')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitimage() {\n const node = this.stack[this.stack.length - 1]\n // Note: there are also `identifier` and `label` fields on this link node!\n // These are used / cleaned here.\n // To do: clean.\n if (getData('inReference')) {\n /** @type {ReferenceType} */\n const referenceType = getData('referenceType') || 'shortcut'\n node.type += 'Reference'\n // @ts-expect-error: mutate.\n node.referenceType = referenceType\n // @ts-expect-error: mutate.\n delete node.url\n delete node.title\n } else {\n // @ts-expect-error: mutate.\n delete node.identifier\n // @ts-expect-error: mutate.\n delete node.label\n }\n setData('referenceType')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlabeltext(token) {\n const string = this.sliceSerialize(token)\n const ancestor = this.stack[this.stack.length - 2]\n // @ts-expect-error: stash this on the node, as it might become a reference\n // later.\n ancestor.label = decodeString(string)\n // @ts-expect-error: same as above.\n ancestor.identifier = normalizeIdentifier(string).toLowerCase()\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitlabel() {\n const fragment = this.stack[this.stack.length - 1]\n const value = this.resume()\n const node = this.stack[this.stack.length - 1]\n // Assume a reference.\n setData('inReference', true)\n if (node.type === 'link') {\n /** @type {Array} */\n // @ts-expect-error: Assume static phrasing content.\n const children = fragment.children\n node.children = children\n } else {\n node.alt = value\n }\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresourcedestinationstring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.url = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresourcetitlestring() {\n const data = this.resume()\n const node = this.stack[this.stack.length - 1]\n node.title = data\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitresource() {\n setData('inReference')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onenterreference() {\n setData('referenceType', 'collapsed')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitreferencestring(token) {\n const label = this.resume()\n const node = this.stack[this.stack.length - 1]\n // @ts-expect-error: stash this on the node, as it might become a reference\n // later.\n node.label = label\n // @ts-expect-error: same as above.\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n setData('referenceType', 'full')\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n\n function onexitcharacterreferencemarker(token) {\n setData('characterReferenceType', token.type)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitcharacterreferencevalue(token) {\n const data = this.sliceSerialize(token)\n const type = getData('characterReferenceType')\n /** @type {string} */\n let value\n if (type) {\n value = decodeNumericCharacterReference(\n data,\n type === 'characterReferenceMarkerNumeric' ? 10 : 16\n )\n setData('characterReferenceType')\n } else {\n const result = decodeNamedCharacterReference(data)\n value = result\n }\n const tail = this.stack.pop()\n tail.value += value\n tail.position.end = point(token.end)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitautolinkprotocol(token) {\n onexitdata.call(this, token)\n const node = this.stack[this.stack.length - 1]\n node.url = this.sliceSerialize(token)\n }\n\n /**\n * @this {CompileContext}\n * @type {Handle}\n */\n function onexitautolinkemail(token) {\n onexitdata.call(this, token)\n const node = this.stack[this.stack.length - 1]\n node.url = 'mailto:' + this.sliceSerialize(token)\n }\n\n //\n // Creaters.\n //\n\n /** @returns {Blockquote} */\n function blockQuote() {\n return {\n type: 'blockquote',\n children: []\n }\n }\n\n /** @returns {Code} */\n function codeFlow() {\n return {\n type: 'code',\n lang: null,\n meta: null,\n value: ''\n }\n }\n\n /** @returns {InlineCode} */\n function codeText() {\n return {\n type: 'inlineCode',\n value: ''\n }\n }\n\n /** @returns {Definition} */\n function definition() {\n return {\n type: 'definition',\n identifier: '',\n label: null,\n title: null,\n url: ''\n }\n }\n\n /** @returns {Emphasis} */\n function emphasis() {\n return {\n type: 'emphasis',\n children: []\n }\n }\n\n /** @returns {Heading} */\n function heading() {\n // @ts-expect-error `depth` will be set later.\n return {\n type: 'heading',\n depth: undefined,\n children: []\n }\n }\n\n /** @returns {Break} */\n function hardBreak() {\n return {\n type: 'break'\n }\n }\n\n /** @returns {HTML} */\n function html() {\n return {\n type: 'html',\n value: ''\n }\n }\n\n /** @returns {Image} */\n function image() {\n return {\n type: 'image',\n title: null,\n url: '',\n alt: null\n }\n }\n\n /** @returns {Link} */\n function link() {\n return {\n type: 'link',\n title: null,\n url: '',\n children: []\n }\n }\n\n /**\n * @param {Token} token\n * @returns {List}\n */\n function list(token) {\n return {\n type: 'list',\n ordered: token.type === 'listOrdered',\n start: null,\n spread: token._spread,\n children: []\n }\n }\n\n /**\n * @param {Token} token\n * @returns {ListItem}\n */\n function listItem(token) {\n return {\n type: 'listItem',\n spread: token._spread,\n checked: null,\n children: []\n }\n }\n\n /** @returns {Paragraph} */\n function paragraph() {\n return {\n type: 'paragraph',\n children: []\n }\n }\n\n /** @returns {Strong} */\n function strong() {\n return {\n type: 'strong',\n children: []\n }\n }\n\n /** @returns {Text} */\n function text() {\n return {\n type: 'text',\n value: ''\n }\n }\n\n /** @returns {ThematicBreak} */\n function thematicBreak() {\n return {\n type: 'thematicBreak'\n }\n }\n}\n\n/**\n * Copy a point-like value.\n *\n * @param {Point} d\n * Point-like value.\n * @returns {Point}\n * unist point.\n */\nfunction point(d) {\n return {\n line: d.line,\n column: d.column,\n offset: d.offset\n }\n}\n\n/**\n * @param {Config} combined\n * @param {Array>} extensions\n * @returns {void}\n */\nfunction configure(combined, extensions) {\n let index = -1\n while (++index < extensions.length) {\n const value = extensions[index]\n if (Array.isArray(value)) {\n configure(combined, value)\n } else {\n extension(combined, value)\n }\n }\n}\n\n/**\n * @param {Config} combined\n * @param {Extension} extension\n * @returns {void}\n */\nfunction extension(combined, extension) {\n /** @type {keyof Extension} */\n let key\n for (key in extension) {\n if (own.call(extension, key)) {\n if (key === 'canContainEols') {\n const right = extension[key]\n if (right) {\n combined[key].push(...right)\n }\n } else if (key === 'transforms') {\n const right = extension[key]\n if (right) {\n combined[key].push(...right)\n }\n } else if (key === 'enter' || key === 'exit') {\n const right = extension[key]\n if (right) {\n Object.assign(combined[key], right)\n }\n }\n }\n }\n}\n\n/** @type {OnEnterError} */\nfunction defaultOnError(left, right) {\n if (left) {\n throw new Error(\n 'Cannot close `' +\n left.type +\n '` (' +\n stringifyPosition({\n start: left.start,\n end: left.end\n }) +\n '): a different token (`' +\n right.type +\n '`, ' +\n stringifyPosition({\n start: right.start,\n end: right.end\n }) +\n ') is open'\n )\n } else {\n throw new Error(\n 'Cannot close document, a token (`' +\n right.type +\n '`, ' +\n stringifyPosition({\n start: right.start,\n end: right.end\n }) +\n ') is still open'\n )\n }\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-from-markdown').Options} Options\n */\n\nimport {fromMarkdown} from 'mdast-util-from-markdown'\n\n/**\n * @this {import('unified').Processor}\n * @type {import('unified').Plugin<[Options?] | void[], string, Root>}\n */\nexport default function remarkParse(options) {\n /** @type {import('unified').ParserFunction} */\n const parser = (doc) => {\n // Assume options.\n const settings = /** @type {Options} */ (this.data('settings'))\n\n return fromMarkdown(\n doc,\n Object.assign({}, settings, options, {\n // Note: these options are not in the readme.\n // The goal is for them to be set by plugins on `data` instead of being\n // passed by users.\n extensions: this.data('micromarkExtensions') || [],\n mdastExtensions: this.data('fromMarkdownExtensions') || []\n })\n )\n }\n\n Object.assign(this, {Parser: parser})\n}\n","/**\n * @typedef {import('./types.js').Options} Options\n * @typedef {import('./types.js').State} State\n */\n\n/**\n * @param {State} base\n * @param {Options} extension\n * @returns {State}\n */\nexport function configure(base, extension) {\n let index = -1\n /** @type {keyof Options} */\n let key\n\n // First do subextensions.\n if (extension.extensions) {\n while (++index < extension.extensions.length) {\n configure(base, extension.extensions[index])\n }\n }\n\n for (key in extension) {\n if (key === 'extensions') {\n // Empty.\n } else if (key === 'unsafe' || key === 'join') {\n /* c8 ignore next 2 */\n // @ts-expect-error: hush.\n base[key] = [...(base[key] || []), ...(extension[key] || [])]\n } else if (key === 'handlers') {\n base[key] = Object.assign(base[key], extension[key] || {})\n } else {\n // @ts-expect-error: hush.\n base.options[key] = extension[key]\n }\n }\n\n return base\n}\n","/**\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Map} Map\n */\n\n/**\n * @param {Blockquote} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function blockquote(node, _, state, info) {\n const exit = state.enter('blockquote')\n const tracker = state.createTracker(info)\n tracker.move('> ')\n tracker.shift(2)\n const value = state.indentLines(\n state.containerFlow(node, tracker.current()),\n map\n )\n exit()\n return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n return '>' + (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n * @typedef {import('../types.js').ConstructName} ConstructName\n */\n\n/**\n * @param {Array} stack\n * @param {Unsafe} pattern\n * @returns {boolean}\n */\nexport function patternInScope(stack, pattern) {\n return (\n listInScope(stack, pattern.inConstruct, true) &&\n !listInScope(stack, pattern.notInConstruct, false)\n )\n}\n\n/**\n * @param {Array} stack\n * @param {Unsafe['inConstruct']} list\n * @param {boolean} none\n * @returns {boolean}\n */\nfunction listInScope(stack, list, none) {\n if (typeof list === 'string') {\n list = [list]\n }\n\n if (!list || list.length === 0) {\n return none\n }\n\n let index = -1\n\n while (++index < list.length) {\n if (stack.includes(list[index])) {\n return true\n }\n }\n\n return false\n}\n","/**\n * @typedef {import('mdast').Break} Break\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {patternInScope} from '../util/pattern-in-scope.js'\n\n/**\n * @param {Break} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function hardBreak(_, _1, state, info) {\n let index = -1\n\n while (++index < state.unsafe.length) {\n // If we can’t put eols in this construct (setext headings, tables), use a\n // space instead.\n if (\n state.unsafe[index].character === '\\n' &&\n patternInScope(state.stack, state.unsafe[index])\n ) {\n return /[ \\t]/.test(info.before) ? '' : ' '\n }\n }\n\n return '\\\\\\n'\n}\n","/**\n * Get the count of the longest repeating streak of `substring` in `value`.\n *\n * @param {string} value\n * Content to search in.\n * @param {string} substring\n * Substring to look for, typically one character.\n * @returns {number}\n * Count of most frequent adjacent `substring`s in `value`.\n */\nexport function longestStreak(value, substring) {\n const source = String(value)\n let index = source.indexOf(substring)\n let expected = index\n let count = 0\n let max = 0\n\n if (typeof substring !== 'string') {\n throw new TypeError('Expected substring')\n }\n\n while (index !== -1) {\n if (index === expected) {\n if (++count > max) {\n max = count\n }\n } else {\n count = 1\n }\n\n expected = index + substring.length\n index = source.indexOf(substring, expected)\n }\n\n return max\n}\n","/**\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * @param {Code} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatCodeAsIndented(node, state) {\n return Boolean(\n !state.options.fences &&\n node.value &&\n // If there’s no info…\n !node.lang &&\n // And there’s a non-whitespace character…\n /[^ \\r\\n]/.test(node.value) &&\n // And the value doesn’t start or end in a blank…\n !/^[\\t ]*(?:[\\r\\n]|$)|(?:^|[\\r\\n])[\\t ]*$/.test(node.value)\n )\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkFence(state) {\n const marker = state.options.fence || '`'\n\n if (marker !== '`' && marker !== '~') {\n throw new Error(\n 'Cannot serialize code with `' +\n marker +\n '` for `options.fence`, expected `` ` `` or `~`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Map} Map\n */\n\nimport {longestStreak} from 'longest-streak'\nimport {formatCodeAsIndented} from '../util/format-code-as-indented.js'\nimport {checkFence} from '../util/check-fence.js'\n\n/**\n * @param {Code} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function code(node, _, state, info) {\n const marker = checkFence(state)\n const raw = node.value || ''\n const suffix = marker === '`' ? 'GraveAccent' : 'Tilde'\n\n if (formatCodeAsIndented(node, state)) {\n const exit = state.enter('codeIndented')\n const value = state.indentLines(raw, map)\n exit()\n return value\n }\n\n const tracker = state.createTracker(info)\n const sequence = marker.repeat(Math.max(longestStreak(raw, marker) + 1, 3))\n const exit = state.enter('codeFenced')\n let value = tracker.move(sequence)\n\n if (node.lang) {\n const subexit = state.enter(`codeFencedLang${suffix}`)\n value += tracker.move(\n state.safe(node.lang, {\n before: value,\n after: ' ',\n encode: ['`'],\n ...tracker.current()\n })\n )\n subexit()\n }\n\n if (node.lang && node.meta) {\n const subexit = state.enter(`codeFencedMeta${suffix}`)\n value += tracker.move(' ')\n value += tracker.move(\n state.safe(node.meta, {\n before: value,\n after: '\\n',\n encode: ['`'],\n ...tracker.current()\n })\n )\n subexit()\n }\n\n value += tracker.move('\\n')\n\n if (raw) {\n value += tracker.move(raw + '\\n')\n }\n\n value += tracker.move(sequence)\n exit()\n return value\n}\n\n/** @type {Map} */\nfunction map(line, _, blank) {\n return (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkQuote(state) {\n const marker = state.options.quote || '\"'\n\n if (marker !== '\"' && marker !== \"'\") {\n throw new Error(\n 'Cannot serialize title with `' +\n marker +\n '` for `options.quote`, expected `\"`, or `\\'`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Definition} Definition\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\n/**\n * @param {Definition} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function definition(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const exit = state.enter('definition')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('[')\n value += tracker.move(\n state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n )\n value += tracker.move(']: ')\n\n subexit()\n\n if (\n // If there’s no url, or…\n !node.url ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : '\\n',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n exit()\n\n return value\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkEmphasis(state) {\n const marker = state.options.emphasis || '*'\n\n if (marker !== '*' && marker !== '_') {\n throw new Error(\n 'Cannot serialize emphasis with `' +\n marker +\n '` for `options.emphasis`, expected `*`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkEmphasis} from '../util/check-emphasis.js'\n\nemphasis.peek = emphasisPeek\n\n// To do: there are cases where emphasis cannot “form” depending on the\n// previous or next character of sequences.\n// There’s no way around that though, except for injecting zero-width stuff.\n// Do we need to safeguard against that?\n/**\n * @param {Emphasis} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function emphasis(node, _, state, info) {\n const marker = checkEmphasis(state)\n const exit = state.enter('emphasis')\n const tracker = state.createTracker(info)\n let value = tracker.move(marker)\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: marker,\n ...tracker.current()\n })\n )\n value += tracker.move(marker)\n exit()\n return value\n}\n\n/**\n * @param {Emphasis} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction emphasisPeek(_, _1, state) {\n return state.options.emphasis || '*'\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n */\n\n/**\n * @typedef {Record} Props\n * @typedef {null | undefined | string | Props | TestFunctionAnything | Array} Test\n * Check for an arbitrary node, unaware of TypeScript inferral.\n *\n * @callback TestFunctionAnything\n * Check if a node passes a test, unaware of TypeScript inferral.\n * @param {unknown} this\n * The given context.\n * @param {Node} node\n * A node.\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {boolean | void}\n * Whether this node passes the test.\n */\n\n/**\n * @template {Node} Kind\n * Node type.\n * @typedef {Kind['type'] | Partial | TestFunctionPredicate | Array | TestFunctionPredicate>} PredicateTest\n * Check for a node that can be inferred by TypeScript.\n */\n\n/**\n * Check if a node passes a certain test.\n *\n * @template {Node} Kind\n * Node type.\n * @callback TestFunctionPredicate\n * Complex test function for a node that can be inferred by TypeScript.\n * @param {Node} node\n * A node.\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {node is Kind}\n * Whether this node passes the test.\n */\n\n/**\n * @callback AssertAnything\n * Check that an arbitrary value is a node, unaware of TypeScript inferral.\n * @param {unknown} [node]\n * Anything (typically a node).\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {boolean}\n * Whether this is a node and passes a test.\n */\n\n/**\n * Check if a node is a node and passes a certain node test.\n *\n * @template {Node} Kind\n * Node type.\n * @callback AssertPredicate\n * Check that an arbitrary value is a specific node, aware of TypeScript.\n * @param {unknown} [node]\n * Anything (typically a node).\n * @param {number | null | undefined} [index]\n * The node’s position in its parent.\n * @param {Parent | null | undefined} [parent]\n * The node’s parent.\n * @returns {node is Kind}\n * Whether this is a node and passes a test.\n */\n\n/**\n * Check if `node` is a `Node` and whether it passes the given test.\n *\n * @param node\n * Thing to check, typically `Node`.\n * @param test\n * A check for a specific node.\n * @param index\n * The node’s position in its parent.\n * @param parent\n * The node’s parent.\n * @returns\n * Whether `node` is a node and passes a test.\n */\nexport const is =\n /**\n * @type {(\n * (() => false) &\n * ((node: unknown, test: PredicateTest, index: number, parent: Parent, context?: unknown) => node is Kind) &\n * ((node: unknown, test: PredicateTest, index?: null | undefined, parent?: null | undefined, context?: unknown) => node is Kind) &\n * ((node: unknown, test: Test, index: number, parent: Parent, context?: unknown) => boolean) &\n * ((node: unknown, test?: Test, index?: null | undefined, parent?: null | undefined, context?: unknown) => boolean)\n * )}\n */\n (\n /**\n * @param {unknown} [node]\n * @param {Test} [test]\n * @param {number | null | undefined} [index]\n * @param {Parent | null | undefined} [parent]\n * @param {unknown} [context]\n * @returns {boolean}\n */\n // eslint-disable-next-line max-params\n function is(node, test, index, parent, context) {\n const check = convert(test)\n\n if (\n index !== undefined &&\n index !== null &&\n (typeof index !== 'number' ||\n index < 0 ||\n index === Number.POSITIVE_INFINITY)\n ) {\n throw new Error('Expected positive finite index')\n }\n\n if (\n parent !== undefined &&\n parent !== null &&\n (!is(parent) || !parent.children)\n ) {\n throw new Error('Expected parent node')\n }\n\n if (\n (parent === undefined || parent === null) !==\n (index === undefined || index === null)\n ) {\n throw new Error('Expected both parent and index')\n }\n\n // @ts-expect-error Looks like a node.\n return node && node.type && typeof node.type === 'string'\n ? Boolean(check.call(context, node, index, parent))\n : false\n }\n )\n\n/**\n * Generate an assertion from a test.\n *\n * Useful if you’re going to test many nodes, for example when creating a\n * utility where something else passes a compatible test.\n *\n * The created function is a bit faster because it expects valid input only:\n * a `node`, `index`, and `parent`.\n *\n * @param test\n * * when nullish, checks if `node` is a `Node`.\n * * when `string`, works like passing `(node) => node.type === test`.\n * * when `function` checks if function passed the node is true.\n * * when `object`, checks that all keys in test are in node, and that they have (strictly) equal values.\n * * when `array`, checks if any one of the subtests pass.\n * @returns\n * An assertion.\n */\nexport const convert =\n /**\n * @type {(\n * ((test: PredicateTest) => AssertPredicate) &\n * ((test?: Test) => AssertAnything)\n * )}\n */\n (\n /**\n * @param {Test} [test]\n * @returns {AssertAnything}\n */\n function (test) {\n if (test === undefined || test === null) {\n return ok\n }\n\n if (typeof test === 'string') {\n return typeFactory(test)\n }\n\n if (typeof test === 'object') {\n return Array.isArray(test) ? anyFactory(test) : propsFactory(test)\n }\n\n if (typeof test === 'function') {\n return castFactory(test)\n }\n\n throw new Error('Expected function, string, or object as test')\n }\n )\n\n/**\n * @param {Array} tests\n * @returns {AssertAnything}\n */\nfunction anyFactory(tests) {\n /** @type {Array} */\n const checks = []\n let index = -1\n\n while (++index < tests.length) {\n checks[index] = convert(tests[index])\n }\n\n return castFactory(any)\n\n /**\n * @this {unknown}\n * @param {Array} parameters\n * @returns {boolean}\n */\n function any(...parameters) {\n let index = -1\n\n while (++index < checks.length) {\n if (checks[index].call(this, ...parameters)) return true\n }\n\n return false\n }\n}\n\n/**\n * Turn an object into a test for a node with a certain fields.\n *\n * @param {Props} check\n * @returns {AssertAnything}\n */\nfunction propsFactory(check) {\n return castFactory(all)\n\n /**\n * @param {Node} node\n * @returns {boolean}\n */\n function all(node) {\n /** @type {string} */\n let key\n\n for (key in check) {\n // @ts-expect-error: hush, it sure works as an index.\n if (node[key] !== check[key]) return false\n }\n\n return true\n }\n}\n\n/**\n * Turn a string into a test for a node with a certain type.\n *\n * @param {string} check\n * @returns {AssertAnything}\n */\nfunction typeFactory(check) {\n return castFactory(type)\n\n /**\n * @param {Node} node\n */\n function type(node) {\n return node && node.type === check\n }\n}\n\n/**\n * Turn a custom test into a test for a node that passes that test.\n *\n * @param {TestFunctionAnything} check\n * @returns {AssertAnything}\n */\nfunction castFactory(check) {\n return assertion\n\n /**\n * @this {unknown}\n * @param {unknown} node\n * @param {Array} parameters\n * @returns {boolean}\n */\n function assertion(node, ...parameters) {\n return Boolean(\n node &&\n typeof node === 'object' &&\n 'type' in node &&\n // @ts-expect-error: fine.\n Boolean(check.call(this, node, ...parameters))\n )\n }\n}\n\nfunction ok() {\n return true\n}\n","/**\n * @param {string} d\n * @returns {string}\n */\nexport function color(d) {\n return '\\u001B[33m' + d + '\\u001B[39m'\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n * @typedef {import('unist-util-is').Test} Test\n */\n\n/**\n * @typedef {boolean | 'skip'} Action\n * Union of the action types.\n *\n * @typedef {number} Index\n * Move to the sibling at `index` next (after node itself is completely\n * traversed).\n *\n * Useful if mutating the tree, such as removing the node the visitor is\n * currently on, or any of its previous siblings.\n * Results less than 0 or greater than or equal to `children.length` stop\n * traversing the parent.\n *\n * @typedef {[(Action | null | undefined | void)?, (Index | null | undefined)?]} ActionTuple\n * List with one or two values, the first an action, the second an index.\n *\n * @typedef {Action | ActionTuple | Index | null | undefined | void} VisitorResult\n * Any value that can be returned from a visitor.\n */\n\n/**\n * @template {Node} [Visited=Node]\n * Visited node type.\n * @template {Parent} [Ancestor=Parent]\n * Ancestor type.\n * @callback Visitor\n * Handle a node (matching `test`, if given).\n *\n * Visitors are free to transform `node`.\n * They can also transform the parent of node (the last of `ancestors`).\n *\n * Replacing `node` itself, if `SKIP` is not returned, still causes its\n * descendants to be walked (which is a bug).\n *\n * When adding or removing previous siblings of `node` (or next siblings, in\n * case of reverse), the `Visitor` should return a new `Index` to specify the\n * sibling to traverse after `node` is traversed.\n * Adding or removing next siblings of `node` (or previous siblings, in case\n * of reverse) is handled as expected without needing to return a new `Index`.\n *\n * Removing the children property of an ancestor still results in them being\n * traversed.\n * @param {Visited} node\n * Found node.\n * @param {Array} ancestors\n * Ancestors of `node`.\n * @returns {VisitorResult}\n * What to do next.\n *\n * An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n * An `Action` is treated as a tuple of `[Action]`.\n *\n * Passing a tuple back only makes sense if the `Action` is `SKIP`.\n * When the `Action` is `EXIT`, that action can be returned.\n * When the `Action` is `CONTINUE`, `Index` can be returned.\n */\n\n/**\n * @template {Node} [Tree=Node]\n * Tree type.\n * @template {Test} [Check=string]\n * Test type.\n * @typedef {Visitor, Check>, Extract, Parent>>} BuildVisitor\n * Build a typed `Visitor` function from a tree and a test.\n *\n * It will infer which values are passed as `node` and which as `parents`.\n */\n\nimport {convert} from 'unist-util-is'\nimport {color} from './color.js'\n\n/**\n * Continue traversing as normal.\n */\nexport const CONTINUE = true\n\n/**\n * Stop traversing immediately.\n */\nexport const EXIT = false\n\n/**\n * Do not traverse this node’s children.\n */\nexport const SKIP = 'skip'\n\n/**\n * Visit nodes, with ancestral information.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @param tree\n * Tree to traverse.\n * @param test\n * `unist-util-is`-compatible test\n * @param visitor\n * Handle each node.\n * @param reverse\n * Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns\n * Nothing.\n */\nexport const visitParents =\n /**\n * @type {(\n * ((tree: Tree, test: Check, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void) &\n * ((tree: Tree, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void)\n * )}\n */\n (\n /**\n * @param {Node} tree\n * @param {Test} test\n * @param {Visitor} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {void}\n */\n function (tree, test, visitor, reverse) {\n if (typeof test === 'function' && typeof visitor !== 'function') {\n reverse = visitor\n // @ts-expect-error no visitor given, so `visitor` is test.\n visitor = test\n test = null\n }\n\n const is = convert(test)\n const step = reverse ? -1 : 1\n\n factory(tree, undefined, [])()\n\n /**\n * @param {Node} node\n * @param {number | undefined} index\n * @param {Array} parents\n */\n function factory(node, index, parents) {\n /** @type {Record} */\n // @ts-expect-error: hush\n const value = node && typeof node === 'object' ? node : {}\n\n if (typeof value.type === 'string') {\n const name =\n // `hast`\n typeof value.tagName === 'string'\n ? value.tagName\n : // `xast`\n typeof value.name === 'string'\n ? value.name\n : undefined\n\n Object.defineProperty(visit, 'name', {\n value:\n 'node (' + color(node.type + (name ? '<' + name + '>' : '')) + ')'\n })\n }\n\n return visit\n\n function visit() {\n /** @type {ActionTuple} */\n let result = []\n /** @type {ActionTuple} */\n let subresult\n /** @type {number} */\n let offset\n /** @type {Array} */\n let grandparents\n\n if (!test || is(node, index, parents[parents.length - 1] || null)) {\n result = toResult(visitor(node, parents))\n\n if (result[0] === EXIT) {\n return result\n }\n }\n\n // @ts-expect-error looks like a parent.\n if (node.children && result[0] !== SKIP) {\n // @ts-expect-error looks like a parent.\n offset = (reverse ? node.children.length : -1) + step\n // @ts-expect-error looks like a parent.\n grandparents = parents.concat(node)\n\n // @ts-expect-error looks like a parent.\n while (offset > -1 && offset < node.children.length) {\n // @ts-expect-error looks like a parent.\n subresult = factory(node.children[offset], offset, grandparents)()\n\n if (subresult[0] === EXIT) {\n return subresult\n }\n\n offset =\n typeof subresult[1] === 'number' ? subresult[1] : offset + step\n }\n }\n\n return result\n }\n }\n }\n )\n\n/**\n * Turn a return value into a clean result.\n *\n * @param {VisitorResult} value\n * Valid return values from visitors.\n * @returns {ActionTuple}\n * Clean result.\n */\nfunction toResult(value) {\n if (Array.isArray(value)) {\n return value\n }\n\n if (typeof value === 'number') {\n return [CONTINUE, value]\n }\n\n return [value]\n}\n","/**\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Parent} Parent\n * @typedef {import('unist-util-is').Test} Test\n * @typedef {import('unist-util-visit-parents').VisitorResult} VisitorResult\n */\n\n/**\n * Check if `Child` can be a child of `Ancestor`.\n *\n * Returns the ancestor when `Child` can be a child of `Ancestor`, or returns\n * `never`.\n *\n * @template {Node} Ancestor\n * Node type.\n * @template {Node} Child\n * Node type.\n * @typedef {(\n * Ancestor extends Parent\n * ? Child extends Ancestor['children'][number]\n * ? Ancestor\n * : never\n * : never\n * )} ParentsOf\n */\n\n/**\n * @template {Node} [Visited=Node]\n * Visited node type.\n * @template {Parent} [Ancestor=Parent]\n * Ancestor type.\n * @callback Visitor\n * Handle a node (matching `test`, if given).\n *\n * Visitors are free to transform `node`.\n * They can also transform `parent`.\n *\n * Replacing `node` itself, if `SKIP` is not returned, still causes its\n * descendants to be walked (which is a bug).\n *\n * When adding or removing previous siblings of `node` (or next siblings, in\n * case of reverse), the `Visitor` should return a new `Index` to specify the\n * sibling to traverse after `node` is traversed.\n * Adding or removing next siblings of `node` (or previous siblings, in case\n * of reverse) is handled as expected without needing to return a new `Index`.\n *\n * Removing the children property of `parent` still results in them being\n * traversed.\n * @param {Visited} node\n * Found node.\n * @param {Visited extends Node ? number | null : never} index\n * Index of `node` in `parent`.\n * @param {Ancestor extends Node ? Ancestor | null : never} parent\n * Parent of `node`.\n * @returns {VisitorResult}\n * What to do next.\n *\n * An `Index` is treated as a tuple of `[CONTINUE, Index]`.\n * An `Action` is treated as a tuple of `[Action]`.\n *\n * Passing a tuple back only makes sense if the `Action` is `SKIP`.\n * When the `Action` is `EXIT`, that action can be returned.\n * When the `Action` is `CONTINUE`, `Index` can be returned.\n */\n\n/**\n * Build a typed `Visitor` function from a node and all possible parents.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} Visited\n * Node type.\n * @template {Parent} Ancestor\n * Parent type.\n * @typedef {Visitor>} BuildVisitorFromMatch\n */\n\n/**\n * Build a typed `Visitor` function from a list of descendants and a test.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} Descendant\n * Node type.\n * @template {Test} Check\n * Test type.\n * @typedef {(\n * BuildVisitorFromMatch<\n * import('unist-util-visit-parents/complex-types.js').Matches,\n * Extract\n * >\n * )} BuildVisitorFromDescendants\n */\n\n/**\n * Build a typed `Visitor` function from a tree and a test.\n *\n * It will infer which values are passed as `node` and which as `parent`.\n *\n * @template {Node} [Tree=Node]\n * Node type.\n * @template {Test} [Check=string]\n * Test type.\n * @typedef {(\n * BuildVisitorFromDescendants<\n * import('unist-util-visit-parents/complex-types.js').InclusiveDescendant,\n * Check\n * >\n * )} BuildVisitor\n */\n\nimport {visitParents} from 'unist-util-visit-parents'\n\n/**\n * Visit nodes.\n *\n * This algorithm performs *depth-first* *tree traversal* in *preorder*\n * (**NLR**) or if `reverse` is given, in *reverse preorder* (**NRL**).\n *\n * You can choose for which nodes `visitor` is called by passing a `test`.\n * For complex tests, you should test yourself in `visitor`, as it will be\n * faster and will have improved type information.\n *\n * Walking the tree is an intensive task.\n * Make use of the return values of the visitor when possible.\n * Instead of walking a tree multiple times, walk it once, use `unist-util-is`\n * to check if a node matches, and then perform different operations.\n *\n * You can change the tree.\n * See `Visitor` for more info.\n *\n * @param tree\n * Tree to traverse.\n * @param test\n * `unist-util-is`-compatible test\n * @param visitor\n * Handle each node.\n * @param reverse\n * Traverse in reverse preorder (NRL) instead of the default preorder (NLR).\n * @returns\n * Nothing.\n */\nexport const visit =\n /**\n * @type {(\n * ((tree: Tree, test: Check, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void) &\n * ((tree: Tree, visitor: BuildVisitor, reverse?: boolean | null | undefined) => void)\n * )}\n */\n (\n /**\n * @param {Node} tree\n * @param {Test} test\n * @param {Visitor} visitor\n * @param {boolean | null | undefined} [reverse]\n * @returns {void}\n */\n function (tree, test, visitor, reverse) {\n if (typeof test === 'function' && typeof visitor !== 'function') {\n reverse = visitor\n visitor = test\n test = null\n }\n\n visitParents(tree, test, overload, reverse)\n\n /**\n * @param {Node} node\n * @param {Array} parents\n */\n function overload(node, parents) {\n const parent = parents[parents.length - 1]\n return visitor(\n node,\n parent ? parent.children.indexOf(node) : null,\n parent\n )\n }\n }\n )\n\nexport {CONTINUE, EXIT, SKIP} from 'unist-util-visit-parents'\n","/**\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../types.js').State} State\n */\n\nimport {visit, EXIT} from 'unist-util-visit'\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Heading} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatHeadingAsSetext(node, state) {\n let literalWithBreak = false\n\n // Look for literals with a line break.\n // Note that this also\n visit(node, (node) => {\n if (\n ('value' in node && /\\r?\\n|\\r/.test(node.value)) ||\n node.type === 'break'\n ) {\n literalWithBreak = true\n return EXIT\n }\n })\n\n return Boolean(\n (!node.depth || node.depth < 3) &&\n toString(node) &&\n (state.options.setext || literalWithBreak)\n )\n}\n","/**\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {formatHeadingAsSetext} from '../util/format-heading-as-setext.js'\n\n/**\n * @param {Heading} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function heading(node, _, state, info) {\n const rank = Math.max(Math.min(6, node.depth || 1), 1)\n const tracker = state.createTracker(info)\n\n if (formatHeadingAsSetext(node, state)) {\n const exit = state.enter('headingSetext')\n const subexit = state.enter('phrasing')\n const value = state.containerPhrasing(node, {\n ...tracker.current(),\n before: '\\n',\n after: '\\n'\n })\n subexit()\n exit()\n\n return (\n value +\n '\\n' +\n (rank === 1 ? '=' : '-').repeat(\n // The whole size…\n value.length -\n // Minus the position of the character after the last EOL (or\n // 0 if there is none)…\n (Math.max(value.lastIndexOf('\\r'), value.lastIndexOf('\\n')) + 1)\n )\n )\n }\n\n const sequence = '#'.repeat(rank)\n const exit = state.enter('headingAtx')\n const subexit = state.enter('phrasing')\n\n // Note: for proper tracking, we should reset the output positions when there\n // is no content returned, because then the space is not output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n tracker.move(sequence + ' ')\n\n let value = state.containerPhrasing(node, {\n before: '# ',\n after: '\\n',\n ...tracker.current()\n })\n\n if (/^[\\t ]/.test(value)) {\n // To do: what effect has the character reference on tracking?\n value =\n '&#x' +\n value.charCodeAt(0).toString(16).toUpperCase() +\n ';' +\n value.slice(1)\n }\n\n value = value ? sequence + ' ' + value : sequence\n\n if (state.options.closeAtx) {\n value += ' ' + sequence\n }\n\n subexit()\n exit()\n\n return value\n}\n","/**\n * @typedef {import('mdast').HTML} HTML\n */\n\nhtml.peek = htmlPeek\n\n/**\n * @param {HTML} node\n * @returns {string}\n */\nexport function html(node) {\n return node.value || ''\n}\n\n/**\n * @returns {string}\n */\nfunction htmlPeek() {\n return '<'\n}\n","/**\n * @typedef {import('mdast').Image} Image\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkQuote} from '../util/check-quote.js'\n\nimage.peek = imagePeek\n\n/**\n * @param {Image} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function image(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const exit = state.enter('image')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('![')\n value += tracker.move(\n state.safe(node.alt, {before: value, after: ']', ...tracker.current()})\n )\n value += tracker.move('](')\n\n subexit()\n\n if (\n // If there’s no url but there is a title…\n (!node.url && node.title) ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : ')',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n value += tracker.move(')')\n exit()\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction imagePeek() {\n return '!'\n}\n","/**\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimageReference.peek = imageReferencePeek\n\n/**\n * @param {ImageReference} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function imageReference(node, _, state, info) {\n const type = node.referenceType\n const exit = state.enter('imageReference')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('![')\n const alt = state.safe(node.alt, {\n before: value,\n after: ']',\n ...tracker.current()\n })\n value += tracker.move(alt + '][')\n\n subexit()\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n subexit = state.enter('reference')\n // Note: for proper tracking, we should reset the output positions when we end\n // up making a `shortcut` reference, because then there is no brace output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n const reference = state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n subexit()\n state.stack = stack\n exit()\n\n if (type === 'full' || !alt || alt !== reference) {\n value += tracker.move(reference + ']')\n } else if (type === 'shortcut') {\n // Remove the unwanted `[`.\n value = value.slice(0, -1)\n } else {\n value += tracker.move(']')\n }\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction imageReferencePeek() {\n return '!'\n}\n","/**\n * @typedef {import('../types.js').Unsafe} Unsafe\n */\n\n/**\n * @param {Unsafe} pattern\n * @returns {RegExp}\n */\nexport function patternCompile(pattern) {\n if (!pattern._compiled) {\n const before =\n (pattern.atBreak ? '[\\\\r\\\\n][\\\\t ]*' : '') +\n (pattern.before ? '(?:' + pattern.before + ')' : '')\n\n pattern._compiled = new RegExp(\n (before ? '(' + before + ')' : '') +\n (/[|\\\\{}()[\\]^$+*?.-]/.test(pattern.character) ? '\\\\' : '') +\n pattern.character +\n (pattern.after ? '(?:' + pattern.after + ')' : ''),\n 'g'\n )\n }\n\n return pattern._compiled\n}\n","/**\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n */\n\nimport {patternCompile} from '../util/pattern-compile.js'\n\ninlineCode.peek = inlineCodePeek\n\n/**\n * @param {InlineCode} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @returns {string}\n */\nexport function inlineCode(node, _, state) {\n let value = node.value || ''\n let sequence = '`'\n let index = -1\n\n // If there is a single grave accent on its own in the code, use a fence of\n // two.\n // If there are two in a row, use one.\n while (new RegExp('(^|[^`])' + sequence + '([^`]|$)').test(value)) {\n sequence += '`'\n }\n\n // If this is not just spaces or eols (tabs don’t count), and either the\n // first or last character are a space, eol, or tick, then pad with spaces.\n if (\n /[^ \\r\\n]/.test(value) &&\n ((/^[ \\r\\n]/.test(value) && /[ \\r\\n]$/.test(value)) || /^`|`$/.test(value))\n ) {\n value = ' ' + value + ' '\n }\n\n // We have a potential problem: certain characters after eols could result in\n // blocks being seen.\n // For example, if someone injected the string `'\\n# b'`, then that would\n // result in an ATX heading.\n // We can’t escape characters in `inlineCode`, but because eols are\n // transformed to spaces when going from markdown to HTML anyway, we can swap\n // them out.\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n // Only look for `atBreak`s.\n // Btw: note that `atBreak` patterns will always start the regex at LF or\n // CR.\n if (!pattern.atBreak) continue\n\n while ((match = expression.exec(value))) {\n let position = match.index\n\n // Support CRLF (patterns only look for one of the characters).\n if (\n value.charCodeAt(position) === 10 /* `\\n` */ &&\n value.charCodeAt(position - 1) === 13 /* `\\r` */\n ) {\n position--\n }\n\n value = value.slice(0, position) + ' ' + value.slice(match.index + 1)\n }\n }\n\n return sequence + value + sequence\n}\n\n/**\n * @returns {string}\n */\nfunction inlineCodePeek() {\n return '`'\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../types.js').State} State\n */\n\nimport {toString} from 'mdast-util-to-string'\n\n/**\n * @param {Link} node\n * @param {State} state\n * @returns {boolean}\n */\nexport function formatLinkAsAutolink(node, state) {\n const raw = toString(node)\n\n return Boolean(\n !state.options.resourceLink &&\n // If there’s a url…\n node.url &&\n // And there’s a no title…\n !node.title &&\n // And the content of `node` is a single text node…\n node.children &&\n node.children.length === 1 &&\n node.children[0].type === 'text' &&\n // And if the url is the same as the content…\n (raw === node.url || 'mailto:' + raw === node.url) &&\n // And that starts w/ a protocol…\n /^[a-z][a-z+.-]+:/i.test(node.url) &&\n // And that doesn’t contain ASCII control codes (character escapes and\n // references don’t work), space, or angle brackets…\n !/[\\0- <>\\u007F]/.test(node.url)\n )\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Exit} Exit\n */\n\nimport {checkQuote} from '../util/check-quote.js'\nimport {formatLinkAsAutolink} from '../util/format-link-as-autolink.js'\n\nlink.peek = linkPeek\n\n/**\n * @param {Link} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function link(node, _, state, info) {\n const quote = checkQuote(state)\n const suffix = quote === '\"' ? 'Quote' : 'Apostrophe'\n const tracker = state.createTracker(info)\n /** @type {Exit} */\n let exit\n /** @type {Exit} */\n let subexit\n\n if (formatLinkAsAutolink(node, state)) {\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n exit = state.enter('autolink')\n let value = tracker.move('<')\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: '>',\n ...tracker.current()\n })\n )\n value += tracker.move('>')\n exit()\n state.stack = stack\n return value\n }\n\n exit = state.enter('link')\n subexit = state.enter('label')\n let value = tracker.move('[')\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: '](',\n ...tracker.current()\n })\n )\n value += tracker.move('](')\n subexit()\n\n if (\n // If there’s no url but there is a title…\n (!node.url && node.title) ||\n // If there are control characters or whitespace.\n /[\\0- \\u007F]/.test(node.url)\n ) {\n subexit = state.enter('destinationLiteral')\n value += tracker.move('<')\n value += tracker.move(\n state.safe(node.url, {before: value, after: '>', ...tracker.current()})\n )\n value += tracker.move('>')\n } else {\n // No whitespace, raw is prettier.\n subexit = state.enter('destinationRaw')\n value += tracker.move(\n state.safe(node.url, {\n before: value,\n after: node.title ? ' ' : ')',\n ...tracker.current()\n })\n )\n }\n\n subexit()\n\n if (node.title) {\n subexit = state.enter(`title${suffix}`)\n value += tracker.move(' ' + quote)\n value += tracker.move(\n state.safe(node.title, {\n before: value,\n after: quote,\n ...tracker.current()\n })\n )\n value += tracker.move(quote)\n subexit()\n }\n\n value += tracker.move(')')\n\n exit()\n return value\n}\n\n/**\n * @param {Link} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @returns {string}\n */\nfunction linkPeek(node, _, state) {\n return formatLinkAsAutolink(node, state) ? '<' : '['\n}\n","/**\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nlinkReference.peek = linkReferencePeek\n\n/**\n * @param {LinkReference} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function linkReference(node, _, state, info) {\n const type = node.referenceType\n const exit = state.enter('linkReference')\n let subexit = state.enter('label')\n const tracker = state.createTracker(info)\n let value = tracker.move('[')\n const text = state.containerPhrasing(node, {\n before: value,\n after: ']',\n ...tracker.current()\n })\n value += tracker.move(text + '][')\n\n subexit()\n // Hide the fact that we’re in phrasing, because escapes don’t work.\n const stack = state.stack\n state.stack = []\n subexit = state.enter('reference')\n // Note: for proper tracking, we should reset the output positions when we end\n // up making a `shortcut` reference, because then there is no brace output.\n // Practically, in that case, there is no content, so it doesn’t matter that\n // we’ve tracked one too many characters.\n const reference = state.safe(state.associationId(node), {\n before: value,\n after: ']',\n ...tracker.current()\n })\n subexit()\n state.stack = stack\n exit()\n\n if (type === 'full' || !text || text !== reference) {\n value += tracker.move(reference + ']')\n } else if (type === 'shortcut') {\n // Remove the unwanted `[`.\n value = value.slice(0, -1)\n } else {\n value += tracker.move(']')\n }\n\n return value\n}\n\n/**\n * @returns {string}\n */\nfunction linkReferencePeek() {\n return '['\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBullet(state) {\n const marker = state.options.bullet || '*'\n\n if (marker !== '*' && marker !== '+' && marker !== '-') {\n throw new Error(\n 'Cannot serialize items with `' +\n marker +\n '` for `options.bullet`, expected `*`, `+`, or `-`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\nimport {checkBullet} from './check-bullet.js'\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOther(state) {\n const bullet = checkBullet(state)\n const bulletOther = state.options.bulletOther\n\n if (!bulletOther) {\n return bullet === '*' ? '-' : '*'\n }\n\n if (bulletOther !== '*' && bulletOther !== '+' && bulletOther !== '-') {\n throw new Error(\n 'Cannot serialize items with `' +\n bulletOther +\n '` for `options.bulletOther`, expected `*`, `+`, or `-`'\n )\n }\n\n if (bulletOther === bullet) {\n throw new Error(\n 'Expected `bullet` (`' +\n bullet +\n '`) and `bulletOther` (`' +\n bulletOther +\n '`) to be different'\n )\n }\n\n return bulletOther\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOrdered(state) {\n const marker = state.options.bulletOrdered || '.'\n\n if (marker !== '.' && marker !== ')') {\n throw new Error(\n 'Cannot serialize items with `' +\n marker +\n '` for `options.bulletOrdered`, expected `.` or `)`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\nimport {checkBulletOrdered} from './check-bullet-ordered.js'\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkBulletOrderedOther(state) {\n const bulletOrdered = checkBulletOrdered(state)\n const bulletOrderedOther = state.options.bulletOrderedOther\n\n if (!bulletOrderedOther) {\n return bulletOrdered === '.' ? ')' : '.'\n }\n\n if (bulletOrderedOther !== '.' && bulletOrderedOther !== ')') {\n throw new Error(\n 'Cannot serialize items with `' +\n bulletOrderedOther +\n '` for `options.bulletOrderedOther`, expected `*`, `+`, or `-`'\n )\n }\n\n if (bulletOrderedOther === bulletOrdered) {\n throw new Error(\n 'Expected `bulletOrdered` (`' +\n bulletOrdered +\n '`) and `bulletOrderedOther` (`' +\n bulletOrderedOther +\n '`) to be different'\n )\n }\n\n return bulletOrderedOther\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkRule(state) {\n const marker = state.options.rule || '*'\n\n if (marker !== '*' && marker !== '-' && marker !== '_') {\n throw new Error(\n 'Cannot serialize rules with `' +\n marker +\n '` for `options.rule`, expected `*`, `-`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').List} List\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkBulletOther} from '../util/check-bullet-other.js'\nimport {checkBulletOrdered} from '../util/check-bullet-ordered.js'\nimport {checkBulletOrderedOther} from '../util/check-bullet-ordered-other.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {List} node\n * @param {Parent | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function list(node, parent, state, info) {\n const exit = state.enter('list')\n const bulletCurrent = state.bulletCurrent\n /** @type {string} */\n let bullet = node.ordered ? checkBulletOrdered(state) : checkBullet(state)\n /** @type {string} */\n const bulletOther = node.ordered\n ? checkBulletOrderedOther(state)\n : checkBulletOther(state)\n const bulletLastUsed = state.bulletLastUsed\n let useDifferentMarker = false\n\n if (\n parent &&\n // Explicit `other` set.\n (node.ordered\n ? state.options.bulletOrderedOther\n : state.options.bulletOther) &&\n bulletLastUsed &&\n bullet === bulletLastUsed\n ) {\n useDifferentMarker = true\n }\n\n if (!node.ordered) {\n const firstListItem = node.children ? node.children[0] : undefined\n\n // If there’s an empty first list item directly in two list items,\n // we have to use a different bullet:\n //\n // ```markdown\n // * - *\n // ```\n //\n // …because otherwise it would become one big thematic break.\n if (\n // Bullet could be used as a thematic break marker:\n (bullet === '*' || bullet === '-') &&\n // Empty first list item:\n firstListItem &&\n (!firstListItem.children || !firstListItem.children[0]) &&\n // Directly in two other list items:\n state.stack[state.stack.length - 1] === 'list' &&\n state.stack[state.stack.length - 2] === 'listItem' &&\n state.stack[state.stack.length - 3] === 'list' &&\n state.stack[state.stack.length - 4] === 'listItem' &&\n // That are each the first child.\n state.indexStack[state.indexStack.length - 1] === 0 &&\n state.indexStack[state.indexStack.length - 2] === 0 &&\n state.indexStack[state.indexStack.length - 3] === 0\n ) {\n useDifferentMarker = true\n }\n\n // If there’s a thematic break at the start of the first list item,\n // we have to use a different bullet:\n //\n // ```markdown\n // * ---\n // ```\n //\n // …because otherwise it would become one big thematic break.\n if (checkRule(state) === bullet && firstListItem) {\n let index = -1\n\n while (++index < node.children.length) {\n const item = node.children[index]\n\n if (\n item &&\n item.type === 'listItem' &&\n item.children &&\n item.children[0] &&\n item.children[0].type === 'thematicBreak'\n ) {\n useDifferentMarker = true\n break\n }\n }\n }\n }\n\n if (useDifferentMarker) {\n bullet = bulletOther\n }\n\n state.bulletCurrent = bullet\n const value = state.containerFlow(node, info)\n state.bulletLastUsed = bullet\n state.bulletCurrent = bulletCurrent\n exit()\n return value\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkListItemIndent(state) {\n const style = state.options.listItemIndent || 'tab'\n\n // To do: remove in a major.\n // @ts-expect-error: deprecated.\n if (style === 1 || style === '1') {\n return 'one'\n }\n\n if (style !== 'tab' && style !== 'one' && style !== 'mixed') {\n throw new Error(\n 'Cannot serialize items with `' +\n style +\n '` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`'\n )\n }\n\n return style\n}\n","/**\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('../types.js').Map} Map\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkBullet} from '../util/check-bullet.js'\nimport {checkListItemIndent} from '../util/check-list-item-indent.js'\n\n/**\n * @param {ListItem} node\n * @param {Parent | undefined} parent\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function listItem(node, parent, state, info) {\n const listItemIndent = checkListItemIndent(state)\n let bullet = state.bulletCurrent || checkBullet(state)\n\n // Add the marker value for ordered lists.\n if (parent && parent.type === 'list' && parent.ordered) {\n bullet =\n (typeof parent.start === 'number' && parent.start > -1\n ? parent.start\n : 1) +\n (state.options.incrementListMarker === false\n ? 0\n : parent.children.indexOf(node)) +\n bullet\n }\n\n let size = bullet.length + 1\n\n if (\n listItemIndent === 'tab' ||\n (listItemIndent === 'mixed' &&\n ((parent && parent.type === 'list' && parent.spread) || node.spread))\n ) {\n size = Math.ceil(size / 4) * 4\n }\n\n const tracker = state.createTracker(info)\n tracker.move(bullet + ' '.repeat(size - bullet.length))\n tracker.shift(size)\n const exit = state.enter('listItem')\n const value = state.indentLines(\n state.containerFlow(node, tracker.current()),\n map\n )\n exit()\n\n return value\n\n /** @type {Map} */\n function map(line, index, blank) {\n if (index) {\n return (blank ? '' : ' '.repeat(size)) + line\n }\n\n return (blank ? bullet : bullet + ' '.repeat(size - bullet.length)) + line\n }\n}\n","/**\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\n/**\n * @param {Paragraph} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function paragraph(node, _, state, info) {\n const exit = state.enter('paragraph')\n const subexit = state.enter('phrasing')\n const value = state.containerPhrasing(node, info)\n subexit()\n exit()\n return value\n}\n","/**\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('unist-util-is').AssertPredicate} AssertPredicatePhrasing\n */\n\nimport {convert} from 'unist-util-is'\n\n/**\n * Check if the given value is *phrasing content*.\n *\n * @param\n * Thing to check, typically `Node`.\n * @returns\n * Whether `value` is phrasing content.\n */\nexport const phrasing = /** @type {AssertPredicatePhrasing} */ (\n convert([\n 'break',\n 'delete',\n 'emphasis',\n 'footnote',\n 'footnoteReference',\n 'image',\n 'imageReference',\n 'inlineCode',\n 'link',\n 'linkReference',\n 'strong',\n 'text'\n ])\n)\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {phrasing} from 'mdast-util-phrasing'\n\n/**\n * @param {Root} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function root(node, _, state, info) {\n // Note: `html` nodes are ambiguous.\n const hasPhrasing = node.children.some((d) => phrasing(d))\n const fn = hasPhrasing ? state.containerPhrasing : state.containerFlow\n // @ts-expect-error: `root`s are supposed to have one type of content\n return fn.call(state, node, info)\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkStrong(state) {\n const marker = state.options.strong || '*'\n\n if (marker !== '*' && marker !== '_') {\n throw new Error(\n 'Cannot serialize strong with `' +\n marker +\n '` for `options.strong`, expected `*`, or `_`'\n )\n }\n\n return marker\n}\n","/**\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\nimport {checkStrong} from '../util/check-strong.js'\n\nstrong.peek = strongPeek\n\n// To do: there are cases where emphasis cannot “form” depending on the\n// previous or next character of sequences.\n// There’s no way around that though, except for injecting zero-width stuff.\n// Do we need to safeguard against that?\n/**\n * @param {Strong} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function strong(node, _, state, info) {\n const marker = checkStrong(state)\n const exit = state.enter('strong')\n const tracker = state.createTracker(info)\n let value = tracker.move(marker + marker)\n value += tracker.move(\n state.containerPhrasing(node, {\n before: value,\n after: marker,\n ...tracker.current()\n })\n )\n value += tracker.move(marker + marker)\n exit()\n return value\n}\n\n/**\n * @param {Strong} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nfunction strongPeek(_, _1, state) {\n return state.options.strong || '*'\n}\n","/**\n * @typedef {import('mdast').Text} Text\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Info} Info\n */\n\n/**\n * @param {Text} node\n * @param {Parent | undefined} _\n * @param {State} state\n * @param {Info} info\n * @returns {string}\n */\nexport function text(node, _, state, info) {\n return state.safe(node.value, info)\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').Options} Options\n */\n\n/**\n * @param {State} state\n * @returns {Exclude}\n */\nexport function checkRuleRepetition(state) {\n const repetition = state.options.ruleRepetition || 3\n\n if (repetition < 3) {\n throw new Error(\n 'Cannot serialize rules with repetition `' +\n repetition +\n '` for `options.ruleRepetition`, expected `3` or more'\n )\n }\n\n return repetition\n}\n","/**\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n */\n\nimport {checkRuleRepetition} from '../util/check-rule-repetition.js'\nimport {checkRule} from '../util/check-rule.js'\n\n/**\n * @param {ThematicBreak} _\n * @param {Parent | undefined} _1\n * @param {State} state\n * @returns {string}\n */\nexport function thematicBreak(_, _1, state) {\n const value = (\n checkRule(state) + (state.options.ruleSpaces ? ' ' : '')\n ).repeat(checkRuleRepetition(state))\n\n return state.options.ruleSpaces ? value.slice(0, -1) : value\n}\n","import {blockquote} from './blockquote.js'\nimport {hardBreak} from './break.js'\nimport {code} from './code.js'\nimport {definition} from './definition.js'\nimport {emphasis} from './emphasis.js'\nimport {heading} from './heading.js'\nimport {html} from './html.js'\nimport {image} from './image.js'\nimport {imageReference} from './image-reference.js'\nimport {inlineCode} from './inline-code.js'\nimport {link} from './link.js'\nimport {linkReference} from './link-reference.js'\nimport {list} from './list.js'\nimport {listItem} from './list-item.js'\nimport {paragraph} from './paragraph.js'\nimport {root} from './root.js'\nimport {strong} from './strong.js'\nimport {text} from './text.js'\nimport {thematicBreak} from './thematic-break.js'\n\n/**\n * Default (CommonMark) handlers.\n */\nexport const handle = {\n blockquote,\n break: hardBreak,\n code,\n definition,\n emphasis,\n hardBreak,\n heading,\n html,\n image,\n imageReference,\n inlineCode,\n link,\n linkReference,\n list,\n listItem,\n paragraph,\n root,\n strong,\n text,\n thematicBreak\n}\n","/**\n * @typedef {import('./types.js').Join} Join\n */\n\nimport {formatCodeAsIndented} from './util/format-code-as-indented.js'\nimport {formatHeadingAsSetext} from './util/format-heading-as-setext.js'\n\n/** @type {Array} */\nexport const join = [joinDefaults]\n\n/** @type {Join} */\nfunction joinDefaults(left, right, parent, state) {\n // Indented code after list or another indented code.\n if (\n right.type === 'code' &&\n formatCodeAsIndented(right, state) &&\n (left.type === 'list' ||\n (left.type === right.type && formatCodeAsIndented(left, state)))\n ) {\n return false\n }\n\n // Two lists with the same marker.\n if (\n left.type === 'list' &&\n left.type === right.type &&\n Boolean(left.ordered) === Boolean(right.ordered) &&\n !(left.ordered\n ? state.options.bulletOrderedOther\n : state.options.bulletOther)\n ) {\n return false\n }\n\n // Join children of a list or an item.\n // In which case, `parent` has a `spread` field.\n if ('spread' in parent && typeof parent.spread === 'boolean') {\n if (\n left.type === 'paragraph' &&\n // Two paragraphs.\n (left.type === right.type ||\n right.type === 'definition' ||\n // Paragraph followed by a setext heading.\n (right.type === 'heading' && formatHeadingAsSetext(right, state)))\n ) {\n return\n }\n\n return parent.spread ? 1 : 0\n }\n}\n","/**\n * @typedef {import('./types.js').Unsafe} Unsafe\n * @typedef {import('./types.js').ConstructName} ConstructName\n */\n\n/**\n * List of constructs that occur in phrasing (paragraphs, headings), but cannot\n * contain things like attention (emphasis, strong), images, or links.\n * So they sort of cancel each other out.\n * Note: could use a better name.\n *\n * @type {Array}\n */\nconst fullPhrasingSpans = [\n 'autolink',\n 'destinationLiteral',\n 'destinationRaw',\n 'reference',\n 'titleQuote',\n 'titleApostrophe'\n]\n\n/** @type {Array} */\nexport const unsafe = [\n {character: '\\t', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {character: '\\t', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {\n character: '\\t',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n },\n {\n character: '\\r',\n inConstruct: [\n 'codeFencedLangGraveAccent',\n 'codeFencedLangTilde',\n 'codeFencedMetaGraveAccent',\n 'codeFencedMetaTilde',\n 'destinationLiteral',\n 'headingAtx'\n ]\n },\n {\n character: '\\n',\n inConstruct: [\n 'codeFencedLangGraveAccent',\n 'codeFencedLangTilde',\n 'codeFencedMetaGraveAccent',\n 'codeFencedMetaTilde',\n 'destinationLiteral',\n 'headingAtx'\n ]\n },\n {character: ' ', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {character: ' ', before: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n {\n character: ' ',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedLangTilde']\n },\n // An exclamation mark can start an image, if it is followed by a link or\n // a link reference.\n {\n character: '!',\n after: '\\\\[',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n // A quote can break out of a title.\n {character: '\"', inConstruct: 'titleQuote'},\n // A number sign could start an ATX heading if it starts a line.\n {atBreak: true, character: '#'},\n {character: '#', inConstruct: 'headingAtx', after: '(?:[\\r\\n]|$)'},\n // Dollar sign and percentage are not used in markdown.\n // An ampersand could start a character reference.\n {character: '&', after: '[#A-Za-z]', inConstruct: 'phrasing'},\n // An apostrophe can break out of a title.\n {character: \"'\", inConstruct: 'titleApostrophe'},\n // A left paren could break out of a destination raw.\n {character: '(', inConstruct: 'destinationRaw'},\n // A left paren followed by `]` could make something into a link or image.\n {\n before: '\\\\]',\n character: '(',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n // A right paren could start a list item or break out of a destination\n // raw.\n {atBreak: true, before: '\\\\d+', character: ')'},\n {character: ')', inConstruct: 'destinationRaw'},\n // An asterisk can start thematic breaks, list items, emphasis, strong.\n {atBreak: true, character: '*', after: '(?:[ \\t\\r\\n*])'},\n {character: '*', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // A plus sign could start a list item.\n {atBreak: true, character: '+', after: '(?:[ \\t\\r\\n])'},\n // A dash can start thematic breaks, list items, and setext heading\n // underlines.\n {atBreak: true, character: '-', after: '(?:[ \\t\\r\\n-])'},\n // A dot could start a list item.\n {atBreak: true, before: '\\\\d+', character: '.', after: '(?:[ \\t\\r\\n]|$)'},\n // Slash, colon, and semicolon are not used in markdown for constructs.\n // A less than can start html (flow or text) or an autolink.\n // HTML could start with an exclamation mark (declaration, cdata, comment),\n // slash (closing tag), question mark (instruction), or a letter (tag).\n // An autolink also starts with a letter.\n // Finally, it could break out of a destination literal.\n {atBreak: true, character: '<', after: '[!/?A-Za-z]'},\n {\n character: '<',\n after: '[!/?A-Za-z]',\n inConstruct: 'phrasing',\n notInConstruct: fullPhrasingSpans\n },\n {character: '<', inConstruct: 'destinationLiteral'},\n // An equals to can start setext heading underlines.\n {atBreak: true, character: '='},\n // A greater than can start block quotes and it can break out of a\n // destination literal.\n {atBreak: true, character: '>'},\n {character: '>', inConstruct: 'destinationLiteral'},\n // Question mark and at sign are not used in markdown for constructs.\n // A left bracket can start definitions, references, labels,\n {atBreak: true, character: '['},\n {character: '[', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n {character: '[', inConstruct: ['label', 'reference']},\n // A backslash can start an escape (when followed by punctuation) or a\n // hard break (when followed by an eol).\n // Note: typical escapes are handled in `safe`!\n {character: '\\\\', after: '[\\\\r\\\\n]', inConstruct: 'phrasing'},\n // A right bracket can exit labels.\n {character: ']', inConstruct: ['label', 'reference']},\n // Caret is not used in markdown for constructs.\n // An underscore can start emphasis, strong, or a thematic break.\n {atBreak: true, character: '_'},\n {character: '_', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // A grave accent can start code (fenced or text), or it can break out of\n // a grave accent code fence.\n {atBreak: true, character: '`'},\n {\n character: '`',\n inConstruct: ['codeFencedLangGraveAccent', 'codeFencedMetaGraveAccent']\n },\n {character: '`', inConstruct: 'phrasing', notInConstruct: fullPhrasingSpans},\n // Left brace, vertical bar, right brace are not used in markdown for\n // constructs.\n // A tilde can start code (fenced).\n {atBreak: true, character: '~'}\n]\n","/**\n * @typedef {import('../types.js').AssociationId} AssociationId\n */\n\nimport {decodeString} from 'micromark-util-decode-string'\n\n/**\n * Get an identifier from an association to match it to others.\n *\n * Associations are nodes that match to something else through an ID:\n * .\n *\n * The `label` of an association is the string value: character escapes and\n * references work, and casing is intact.\n * The `identifier` is used to match one association to another:\n * controversially, character escapes and references don’t work in this\n * matching: `©` does not match `©`, and `\\+` does not match `+`.\n *\n * But casing is ignored (and whitespace) is trimmed and collapsed: ` A\\nb`\n * matches `a b`.\n * So, we do prefer the label when figuring out how we’re going to serialize:\n * it has whitespace, casing, and we can ignore most useless character\n * escapes and all character references.\n *\n * @type {AssociationId}\n */\nexport function association(node) {\n if (node.label || !node.identifier) {\n return node.label || ''\n }\n\n return decodeString(node.identifier)\n}\n","/**\n * @typedef {import('../types.js').Handle} Handle\n * @typedef {import('../types.js').Info} Info\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').PhrasingContent} PhrasingContent\n * @typedef {import('../types.js').State} State\n */\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nexport function containerPhrasing(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n /** @type {Array} */\n const results = []\n let index = -1\n let before = info.before\n\n indexStack.push(-1)\n let tracker = state.createTracker(info)\n\n while (++index < children.length) {\n const child = children[index]\n /** @type {string} */\n let after\n\n indexStack[indexStack.length - 1] = index\n\n if (index + 1 < children.length) {\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n let handle = state.handle.handlers[children[index + 1].type]\n /** @type {Handle} */\n // @ts-expect-error: hush, it’s actually a `zwitch`.\n if (handle && handle.peek) handle = handle.peek\n after = handle\n ? handle(children[index + 1], parent, state, {\n before: '',\n after: '',\n ...tracker.current()\n }).charAt(0)\n : ''\n } else {\n after = info.after\n }\n\n // In some cases, html (text) can be found in phrasing right after an eol.\n // When we’d serialize that, in most cases that would be seen as html\n // (flow).\n // As we can’t escape or so to prevent it from happening, we take a somewhat\n // reasonable approach: replace that eol with a space.\n // See: \n if (\n results.length > 0 &&\n (before === '\\r' || before === '\\n') &&\n child.type === 'html'\n ) {\n results[results.length - 1] = results[results.length - 1].replace(\n /(\\r?\\n|\\r)$/,\n ' '\n )\n before = ' '\n\n // To do: does this work to reset tracker?\n tracker = state.createTracker(info)\n tracker.move(results.join(''))\n }\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n ...tracker.current(),\n before,\n after\n })\n )\n )\n\n before = results[results.length - 1].slice(-1)\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').FlowContent} FlowContent\n * @typedef {import('../types.js').Node} Node\n * @typedef {import('../types.js').Parent} Parent\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').TrackFields} TrackFields\n */\n\n/**\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {State} state\n * Info passed around about the current state.\n * @param {TrackFields} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined by (blank) lines.\n */\nexport function containerFlow(parent, state, info) {\n const indexStack = state.indexStack\n const children = parent.children || []\n const tracker = state.createTracker(info)\n /** @type {Array} */\n const results = []\n let index = -1\n\n indexStack.push(-1)\n\n while (++index < children.length) {\n const child = children[index]\n\n indexStack[indexStack.length - 1] = index\n\n results.push(\n tracker.move(\n state.handle(child, parent, state, {\n before: '\\n',\n after: '\\n',\n ...tracker.current()\n })\n )\n )\n\n if (child.type !== 'list') {\n state.bulletLastUsed = undefined\n }\n\n if (index < children.length - 1) {\n results.push(\n tracker.move(between(child, children[index + 1], parent, state))\n )\n }\n }\n\n indexStack.pop()\n\n return results.join('')\n}\n\n/**\n * @param {Node} left\n * @param {Node} right\n * @param {Parent} parent\n * @param {State} state\n * @returns {string}\n */\nfunction between(left, right, parent, state) {\n let index = state.join.length\n\n while (index--) {\n const result = state.join[index](left, right, parent, state)\n\n if (result === true || result === 1) {\n break\n }\n\n if (typeof result === 'number') {\n return '\\n'.repeat(1 + result)\n }\n\n if (result === false) {\n return '\\n\\n\\n\\n'\n }\n }\n\n return '\\n\\n'\n}\n","/**\n * @typedef {import('../types.js').IndentLines} IndentLines\n */\n\nconst eol = /\\r?\\n|\\r/g\n\n/**\n * @type {IndentLines}\n */\nexport function indentLines(value, map) {\n /** @type {Array} */\n const result = []\n let start = 0\n let line = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = eol.exec(value))) {\n one(value.slice(start, match.index))\n result.push(match[0])\n start = match.index + match[0].length\n line++\n }\n\n one(value.slice(start))\n\n return result.join('')\n\n /**\n * @param {string} value\n */\n function one(value) {\n result.push(map(value, line, !value))\n }\n}\n","/**\n * @typedef {import('../types.js').State} State\n * @typedef {import('../types.js').SafeConfig} SafeConfig\n */\n\nimport {patternCompile} from './pattern-compile.js'\nimport {patternInScope} from './pattern-in-scope.js'\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What “constructs” we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @param {State} state\n * Info passed around about the current state.\n * @param {string | null | undefined} input\n * Raw value to make safe.\n * @param {SafeConfig} config\n * Configuration.\n * @returns {string}\n * Serialized markdown safe for embedding.\n */\nexport function safe(state, input, config) {\n const value = (config.before || '') + (input || '') + (config.after || '')\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const result = []\n /** @type {Record} */\n const infos = {}\n let index = -1\n\n while (++index < state.unsafe.length) {\n const pattern = state.unsafe[index]\n\n if (!patternInScope(state.stack, pattern)) {\n continue\n }\n\n const expression = patternCompile(pattern)\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(value))) {\n const before = 'before' in pattern || Boolean(pattern.atBreak)\n const after = 'after' in pattern\n const position = match.index + (before ? match[1].length : 0)\n\n if (positions.includes(position)) {\n if (infos[position].before && !before) {\n infos[position].before = false\n }\n\n if (infos[position].after && !after) {\n infos[position].after = false\n }\n } else {\n positions.push(position)\n infos[position] = {before, after}\n }\n }\n }\n\n positions.sort(numerical)\n\n let start = config.before ? config.before.length : 0\n const end = value.length - (config.after ? config.after.length : 0)\n index = -1\n\n while (++index < positions.length) {\n const position = positions[index]\n\n // Character before or after matched:\n if (position < start || position >= end) {\n continue\n }\n\n // If this character is supposed to be escaped because it has a condition on\n // the next character, and the next character is definitly being escaped,\n // then skip this escape.\n if (\n (position + 1 < end &&\n positions[index + 1] === position + 1 &&\n infos[position].after &&\n !infos[position + 1].before &&\n !infos[position + 1].after) ||\n (positions[index - 1] === position - 1 &&\n infos[position].before &&\n !infos[position - 1].before &&\n !infos[position - 1].after)\n ) {\n continue\n }\n\n if (start !== position) {\n // If we have to use a character reference, an ampersand would be more\n // correct, but as backslashes only care about punctuation, either will\n // do the trick\n result.push(escapeBackslashes(value.slice(start, position), '\\\\'))\n }\n\n start = position\n\n if (\n /[!-/:-@[-`{-~]/.test(value.charAt(position)) &&\n (!config.encode || !config.encode.includes(value.charAt(position)))\n ) {\n // Character escape.\n result.push('\\\\')\n } else {\n // Character reference.\n result.push(\n '&#x' + value.charCodeAt(position).toString(16).toUpperCase() + ';'\n )\n start++\n }\n }\n\n result.push(escapeBackslashes(value.slice(start, end), config.after))\n\n return result.join('')\n}\n\n/**\n * @param {number} a\n * @param {number} b\n * @returns {number}\n */\nfunction numerical(a, b) {\n return a - b\n}\n\n/**\n * @param {string} value\n * @param {string} after\n * @returns {string}\n */\nfunction escapeBackslashes(value, after) {\n const expression = /\\\\(?=[!-/:-@[-`{-~])/g\n /** @type {Array} */\n const positions = []\n /** @type {Array} */\n const results = []\n const whole = value + after\n let index = -1\n let start = 0\n /** @type {RegExpExecArray | null} */\n let match\n\n while ((match = expression.exec(whole))) {\n positions.push(match.index)\n }\n\n while (++index < positions.length) {\n if (start !== positions[index]) {\n results.push(value.slice(start, positions[index]))\n }\n\n results.push('\\\\')\n start = positions[index]\n }\n\n results.push(value.slice(start))\n\n return results.join('')\n}\n","/**\n * @typedef {import('../types.js').CreateTracker} CreateTracker\n * @typedef {import('../types.js').TrackCurrent} TrackCurrent\n * @typedef {import('../types.js').TrackMove} TrackMove\n * @typedef {import('../types.js').TrackShift} TrackShift\n */\n\n/**\n * Track positional info in the output.\n *\n * @type {CreateTracker}\n */\nexport function track(config) {\n // Defaults are used to prevent crashes when older utilities somehow activate\n // this code.\n /* c8 ignore next 5 */\n const options = config || {}\n const now = options.now || {}\n let lineShift = options.lineShift || 0\n let line = now.line || 1\n let column = now.column || 1\n\n return {move, current, shift}\n\n /**\n * Get the current tracked info.\n *\n * @type {TrackCurrent}\n */\n function current() {\n return {now: {line, column}, lineShift}\n }\n\n /**\n * Define an increased line shift (the typical indent for lines).\n *\n * @type {TrackShift}\n */\n function shift(value) {\n lineShift += value\n }\n\n /**\n * Move past some generated markdown.\n *\n * @type {TrackMove}\n */\n function move(input) {\n // eslint-disable-next-line unicorn/prefer-default-parameters\n const value = input || ''\n const chunks = value.split(/\\r?\\n|\\r/g)\n const tail = chunks[chunks.length - 1]\n line += chunks.length - 1\n column =\n chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift\n return value\n }\n}\n","/**\n * @typedef {import('./types.js').Enter} Enter\n * @typedef {import('./types.js').Info} Info\n * @typedef {import('./types.js').Join} Join\n * @typedef {import('./types.js').FlowContent} FlowContent\n * @typedef {import('./types.js').Node} Node\n * @typedef {import('./types.js').Options} Options\n * @typedef {import('./types.js').Parent} Parent\n * @typedef {import('./types.js').PhrasingContent} PhrasingContent\n * @typedef {import('./types.js').SafeConfig} SafeConfig\n * @typedef {import('./types.js').State} State\n * @typedef {import('./types.js').TrackFields} TrackFields\n */\n\nimport {zwitch} from 'zwitch'\nimport {configure} from './configure.js'\nimport {handle as handlers} from './handle/index.js'\nimport {join} from './join.js'\nimport {unsafe} from './unsafe.js'\nimport {association} from './util/association.js'\nimport {containerPhrasing} from './util/container-phrasing.js'\nimport {containerFlow} from './util/container-flow.js'\nimport {indentLines} from './util/indent-lines.js'\nimport {safe} from './util/safe.js'\nimport {track} from './util/track.js'\n\n/**\n * Turn an mdast syntax tree into markdown.\n *\n * @param {Node} tree\n * Tree to serialize.\n * @param {Options} [options]\n * Configuration (optional).\n * @returns {string}\n * Serialized markdown representing `tree`.\n */\nexport function toMarkdown(tree, options = {}) {\n /** @type {State} */\n const state = {\n enter,\n indentLines,\n associationId: association,\n containerPhrasing: containerPhrasingBound,\n containerFlow: containerFlowBound,\n createTracker: track,\n safe: safeBound,\n stack: [],\n unsafe: [],\n join: [],\n // @ts-expect-error: we’ll fill it next.\n handlers: {},\n options: {},\n indexStack: [],\n // @ts-expect-error: we’ll add `handle` later.\n handle: undefined\n }\n\n configure(state, {unsafe, join, handlers})\n configure(state, options)\n\n if (state.options.tightDefinitions) {\n configure(state, {join: [joinDefinition]})\n }\n\n state.handle = zwitch('type', {\n invalid,\n unknown,\n handlers: state.handlers\n })\n\n let result = state.handle(tree, undefined, state, {\n before: '\\n',\n after: '\\n',\n now: {line: 1, column: 1},\n lineShift: 0\n })\n\n if (\n result &&\n result.charCodeAt(result.length - 1) !== 10 &&\n result.charCodeAt(result.length - 1) !== 13\n ) {\n result += '\\n'\n }\n\n return result\n\n /** @type {Enter} */\n function enter(name) {\n state.stack.push(name)\n return exit\n\n function exit() {\n state.stack.pop()\n }\n }\n}\n\n/**\n * @param {unknown} value\n * @returns {never}\n */\nfunction invalid(value) {\n throw new Error('Cannot handle value `' + value + '`, expected node')\n}\n\n/**\n * @param {unknown} node\n * @returns {never}\n */\nfunction unknown(node) {\n // @ts-expect-error: fine.\n throw new Error('Cannot handle unknown node `' + node.type + '`')\n}\n\n/** @type {Join} */\nfunction joinDefinition(left, right) {\n // No blank line between adjacent definitions.\n if (left.type === 'definition' && left.type === right.type) {\n return 0\n }\n}\n\n/**\n * Serialize the children of a parent that contains phrasing children.\n *\n * These children will be joined flush together.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {Info} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined together.\n */\nfunction containerPhrasingBound(parent, info) {\n return containerPhrasing(parent, this, info)\n}\n\n/**\n * Serialize the children of a parent that contains flow children.\n *\n * These children will typically be joined by blank lines.\n * What they are joined by exactly is defined by `Join` functions.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {Parent & {children: Array}} parent\n * Parent of flow nodes.\n * @param {TrackFields} info\n * Info on where we are in the document we are generating.\n * @returns {string}\n * Serialized children, joined by (blank) lines.\n */\nfunction containerFlowBound(parent, info) {\n return containerFlow(parent, this, info)\n}\n\n/**\n * Make a string safe for embedding in markdown constructs.\n *\n * In markdown, almost all punctuation characters can, in certain cases,\n * result in something.\n * Whether they do is highly subjective to where they happen and in what\n * they happen.\n *\n * To solve this, `mdast-util-to-markdown` tracks:\n *\n * * Characters before and after something;\n * * What “constructs” we are in.\n *\n * This information is then used by this function to escape or encode\n * special characters.\n *\n * @this {State}\n * Info passed around about the current state.\n * @param {string | null | undefined} value\n * Raw value to make safe.\n * @param {SafeConfig} config\n * Configuration.\n * @returns {string}\n * Serialized markdown safe for embedding.\n */\nfunction safeBound(value, config) {\n return safe(this, value, config)\n}\n","/**\n * @typedef {import('mdast').Root|import('mdast').Content} Node\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownOptions\n * @typedef {Omit} Options\n */\n\nimport {toMarkdown} from 'mdast-util-to-markdown'\n\n/**\n * @this {import('unified').Processor}\n * @type {import('unified').Plugin<[Options?]|void[], Node, string>}\n */\nexport default function remarkStringify(options) {\n /** @type {import('unified').CompilerFunction} */\n const compiler = (tree) => {\n // Assume options.\n const settings = /** @type {Options} */ (this.data('settings'))\n\n return toMarkdown(\n tree,\n Object.assign({}, settings, options, {\n // Note: this option is not in the readme.\n // The goal is for it to be set by plugins on `data` instead of being\n // passed by users.\n extensions:\n /** @type {ToMarkdownOptions['extensions']} */ (\n this.data('toMarkdownExtensions')\n ) || []\n })\n )\n }\n\n Object.assign(this, {Compiler: compiler})\n}\n","import {unified} from 'unified'\nimport remarkParse from 'remark-parse'\nimport remarkStringify from 'remark-stringify'\n\nexport const remark = unified().use(remarkParse).use(remarkStringify).freeze()\n","// @ts-expect-error\nimport formatter from 'format'\n\nexport const fault = Object.assign(create(Error), {\n eval: create(EvalError),\n range: create(RangeError),\n reference: create(ReferenceError),\n syntax: create(SyntaxError),\n type: create(TypeError),\n uri: create(URIError)\n})\n\n/**\n * Create a new `EConstructor`, with the formatted `format` as a first argument.\n *\n * @template {Error} Fault\n * @template {new (reason: string) => Fault} Class\n * @param {Class} Constructor\n */\nexport function create(Constructor) {\n /** @type {string} */\n // @ts-expect-error\n FormattedError.displayName = Constructor.displayName || Constructor.name\n\n return FormattedError\n\n /**\n * Create an error with a printf-like formatted message.\n *\n * @param {string|null} [format]\n * Template string.\n * @param {...unknown} values\n * Values to render in `format`.\n * @returns {Fault}\n */\n function FormattedError(format, ...values) {\n /** @type {string} */\n const reason = format ? formatter(format, ...values) : format\n return new Constructor(reason)\n }\n}\n","/**\n * @typedef {'toml' | 'yaml'} Preset\n * Known name of a frontmatter style.\n *\n * @typedef Info\n * Sequence.\n *\n * Depending on how this structure is used, it reflects a marker or a fence.\n * @property {string} open\n * Opening.\n * @property {string} close\n * Closing.\n *\n * @typedef MatterProps\n * Fields describing a kind of matter.\n * @property {string} type\n * Node type to tokenize as.\n * @property {boolean | null | undefined} [anywhere=false]\n * Whether matter can be found anywhere in the document, normally, only matter\n * at the start of the document is recognized.\n *\n * > 👉 **Note**: using this is a terrible idea.\n * > It’s called frontmatter, not matter-in-the-middle or so.\n * > This makes your markdown less portable.\n *\n * @typedef MarkerProps\n * Marker configuration.\n * @property {Info | string} marker\n * Character repeated 3 times, used as complete fences.\n *\n * For example the character `'-'` will result in `'---'` being used as the\n * fence\n * Pass `open` and `close` to specify different characters for opening and\n * closing fences.\n * @property {never} [fence]\n * If `marker` is set, `fence` must not be set.\n *\n * @typedef FenceProps\n * Fence configuration.\n * @property {Info | string} fence\n * Complete fences.\n *\n * This can be used when fences contain different characters or lengths\n * other than 3.\n * Pass `open` and `close` to interface to specify different characters for opening and\n * closing fences.\n * @property {never} [marker]\n * If `fence` is set, `marker` must not be set.\n *\n * @typedef {(MatterProps & FenceProps) | (MatterProps & MarkerProps)} Matter\n * Fields describing a kind of matter.\n *\n * > 👉 **Note**: using `anywhere` is a terrible idea.\n * > It’s called frontmatter, not matter-in-the-middle or so.\n * > This makes your markdown less portable.\n *\n * > 👉 **Note**: `marker` and `fence` are mutually exclusive.\n * > If `marker` is set, `fence` must not be set, and vice versa.\n *\n * @typedef {Matter | Preset | Array} Options\n * Configuration.\n */\n\nimport {fault} from 'fault'\nconst own = {}.hasOwnProperty\nconst markers = {\n yaml: '-',\n toml: '+'\n}\n\n/**\n * Simplify one or more options.\n *\n * @param {Options | null | undefined} [options='yaml']\n * Configuration.\n * @returns {Array}\n * List of matters.\n */\nexport function matters(options) {\n /** @type {Array} */\n const result = []\n let index = -1\n\n /** @type {Array} */\n const presetsOrMatters = Array.isArray(options)\n ? options\n : options\n ? [options]\n : ['yaml']\n while (++index < presetsOrMatters.length) {\n result[index] = matter(presetsOrMatters[index])\n }\n return result\n}\n\n/**\n * Simplify an option.\n *\n * @param {Matter | Preset} option\n * Configuration.\n * @returns {Matter}\n * Matters.\n */\nfunction matter(option) {\n let result = option\n if (typeof result === 'string') {\n if (!own.call(markers, result)) {\n throw fault('Missing matter definition for `%s`', result)\n }\n result = {\n type: result,\n marker: markers[result]\n }\n } else if (typeof result !== 'object') {\n throw fault('Expected matter to be an object, not `%j`', result)\n }\n if (!own.call(result, 'type')) {\n throw fault('Missing `type` in matter `%j`', result)\n }\n if (!own.call(result, 'fence') && !own.call(result, 'marker')) {\n throw fault('Missing `marker` or `fence` in matter `%j`', result)\n }\n return result\n}\n","/**\n * @typedef {import('micromark-util-types').Construct} Construct\n * @typedef {import('micromark-util-types').ConstructRecord} ConstructRecord\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenType} TokenType\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n *\n * @typedef {import('../matters.js').Info} Info\n * @typedef {import('../matters.js').Matter} Matter\n * @typedef {import('../matters.js').Options} Options\n */\n\nimport {markdownLineEnding, markdownSpace} from 'micromark-util-character'\nimport {matters} from '../matters.js'\n\n/**\n * Create an extension for `micromark` to enable frontmatter syntax.\n *\n * @param {Options | null | undefined} [options='yaml']\n * Configuration.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable frontmatter syntax.\n */\nexport function frontmatter(options) {\n const listOfMatters = matters(options)\n /** @type {ConstructRecord} */\n const flow = {}\n let index = -1\n while (++index < listOfMatters.length) {\n const matter = listOfMatters[index]\n const code = fence(matter, 'open').charCodeAt(0)\n const construct = createConstruct(matter)\n const existing = flow[code]\n if (Array.isArray(existing)) {\n existing.push(construct)\n } else {\n // Never a single object, always an array.\n flow[code] = [construct]\n }\n }\n return {\n flow\n }\n}\n\n/**\n * @param {Matter} matter\n * @returns {Construct}\n */\nfunction createConstruct(matter) {\n const anywhere = matter.anywhere\n const frontmatterType = /** @type {TokenType} */ matter.type\n const fenceType = /** @type {TokenType} */ frontmatterType + 'Fence'\n const sequenceType = /** @type {TokenType} */ fenceType + 'Sequence'\n const valueType = /** @type {TokenType} */ frontmatterType + 'Value'\n const closingFenceConstruct = {\n tokenize: tokenizeClosingFence,\n partial: true\n }\n\n /**\n * Fence to look for.\n *\n * @type {string}\n */\n let buffer\n let bufferIndex = 0\n return {\n tokenize: tokenizeFrontmatter,\n concrete: true\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeFrontmatter(effects, ok, nok) {\n const self = this\n return start\n\n /**\n * Start of frontmatter.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function start(code) {\n const position = self.now()\n if (\n // Indent not allowed.\n position.column === 1 &&\n // Normally, only allowed in first line.\n (position.line === 1 || anywhere)\n ) {\n buffer = fence(matter, 'open')\n bufferIndex = 0\n if (code === buffer.charCodeAt(bufferIndex)) {\n effects.enter(frontmatterType)\n effects.enter(fenceType)\n effects.enter(sequenceType)\n return openSequence(code)\n }\n }\n return nok(code)\n }\n\n /**\n * In open sequence.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openSequence(code) {\n if (bufferIndex === buffer.length) {\n effects.exit(sequenceType)\n if (markdownSpace(code)) {\n effects.enter('whitespace')\n return openSequenceWhitespace(code)\n }\n return openAfter(code)\n }\n if (code === buffer.charCodeAt(bufferIndex++)) {\n effects.consume(code)\n return openSequence\n }\n return nok(code)\n }\n\n /**\n * In whitespace after open sequence.\n *\n * ```markdown\n * > | ---␠\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openSequenceWhitespace(code) {\n if (markdownSpace(code)) {\n effects.consume(code)\n return openSequenceWhitespace\n }\n effects.exit('whitespace')\n return openAfter(code)\n }\n\n /**\n * After open sequence.\n *\n * ```markdown\n * > | ---\n * ^\n * | title: \"Venus\"\n * | ---\n * ```\n *\n * @type {State}\n */\n function openAfter(code) {\n if (markdownLineEnding(code)) {\n effects.exit(fenceType)\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n // Get ready for closing fence.\n buffer = fence(matter, 'close')\n bufferIndex = 0\n return effects.attempt(closingFenceConstruct, after, contentStart)\n }\n\n // EOF is not okay.\n return nok(code)\n }\n\n /**\n * Start of content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentStart(code) {\n if (code === null || markdownLineEnding(code)) {\n return contentEnd(code)\n }\n effects.enter(valueType)\n return contentInside(code)\n }\n\n /**\n * In content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentInside(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit(valueType)\n return contentEnd(code)\n }\n effects.consume(code)\n return contentInside\n }\n\n /**\n * End of content chunk.\n *\n * ```markdown\n * | ---\n * > | title: \"Venus\"\n * ^\n * | ---\n * ```\n *\n * @type {State}\n */\n function contentEnd(code) {\n // Require a closing fence.\n if (code === null) {\n return nok(code)\n }\n\n // Can only be an eol.\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return effects.attempt(closingFenceConstruct, after, contentStart)\n }\n\n /**\n * After frontmatter.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // `code` must be eol/eof.\n effects.exit(frontmatterType)\n return ok(code)\n }\n }\n\n /** @type {Tokenizer} */\n function tokenizeClosingFence(effects, ok, nok) {\n let bufferIndex = 0\n return closeStart\n\n /**\n * Start of close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeStart(code) {\n if (code === buffer.charCodeAt(bufferIndex)) {\n effects.enter(fenceType)\n effects.enter(sequenceType)\n return closeSequence(code)\n }\n return nok(code)\n }\n\n /**\n * In close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeSequence(code) {\n if (bufferIndex === buffer.length) {\n effects.exit(sequenceType)\n if (markdownSpace(code)) {\n effects.enter('whitespace')\n return closeSequenceWhitespace(code)\n }\n return closeAfter(code)\n }\n if (code === buffer.charCodeAt(bufferIndex++)) {\n effects.consume(code)\n return closeSequence\n }\n return nok(code)\n }\n\n /**\n * In whitespace after close sequence.\n *\n * ```markdown\n * > | ---\n * | title: \"Venus\"\n * | ---␠\n * ^\n * ```\n *\n * @type {State}\n */\n function closeSequenceWhitespace(code) {\n if (markdownSpace(code)) {\n effects.consume(code)\n return closeSequenceWhitespace\n }\n effects.exit('whitespace')\n return closeAfter(code)\n }\n\n /**\n * After close sequence.\n *\n * ```markdown\n * | ---\n * | title: \"Venus\"\n * > | ---\n * ^\n * ```\n *\n * @type {State}\n */\n function closeAfter(code) {\n if (code === null || markdownLineEnding(code)) {\n effects.exit(fenceType)\n return ok(code)\n }\n return nok(code)\n }\n }\n}\n\n/**\n * @param {Matter} matter\n * @param {'open' | 'close'} prop\n * @returns {string}\n */\nfunction fence(matter, prop) {\n return matter.marker\n ? pick(matter.marker, prop).repeat(3)\n : // @ts-expect-error: They’re mutually exclusive.\n pick(matter.fence, prop)\n}\n\n/**\n * @param {Info | string} schema\n * @param {'open' | 'close'} prop\n * @returns {string}\n */\nfunction pick(schema, prop) {\n return typeof schema === 'string' ? schema : schema[prop]\n}\n","/**\n * @typedef {import('mdast').Literal} Literal\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n *\n * @typedef {import('micromark-extension-frontmatter').Options} Options\n * @typedef {import('micromark-extension-frontmatter/matters.js').Matter} Matter\n * @typedef {import('micromark-extension-frontmatter/matters.js').Info} Info\n */\n\nimport {matters} from 'micromark-extension-frontmatter/matters.js'\n\n/**\n * Create an extension for `mdast-util-from-markdown`.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {FromMarkdownExtension}\n * Extension for `mdast-util-from-markdown`.\n */\nexport function frontmatterFromMarkdown(options) {\n // @ts-expect-error: `micromark-extension-frontmatter` should fix types to\n // accept `null` as options.\n const settings = matters(options)\n /** @type {FromMarkdownExtension['enter']} */\n const enter = {}\n /** @type {FromMarkdownExtension['exit']} */\n const exit = {}\n let index = -1\n\n while (++index < settings.length) {\n const matter = settings[index]\n enter[matter.type] = opener(matter)\n exit[matter.type] = close\n exit[matter.type + 'Value'] = value\n }\n\n return {enter, exit}\n}\n\n/**\n * @param {Matter} matter\n * @returns {FromMarkdownHandle} enter\n */\nfunction opener(matter) {\n return open\n\n /**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\n function open(token) {\n // @ts-expect-error: custom.\n this.enter({type: matter.type, value: ''}, token)\n this.buffer()\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction close(token) {\n const data = this.resume()\n const node = /** @type {Literal} */ (this.exit(token))\n // Remove the initial and final eol.\n node.value = data.replace(/^(\\r?\\n|\\r)|(\\r?\\n|\\r)$/g, '')\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction value(token) {\n this.config.enter.data.call(this, token)\n this.config.exit.data.call(this, token)\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown`.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown`.\n */\nexport function frontmatterToMarkdown(options) {\n // To do: use an extension object with `satisfies` later.\n /** @type {ToMarkdownExtension['unsafe']} */\n const unsafe = []\n /** @type {ToMarkdownExtension['handlers']} */\n const handlers = {}\n // @ts-expect-error: `micromark-extension-frontmatter` should fix types to\n // accept `null` as options.\n const settings = matters(options)\n let index = -1\n\n while (++index < settings.length) {\n const matter = settings[index]\n\n // @ts-expect-error: this can add custom frontmatter nodes.\n // Typing those is the responsibility of the end user.\n handlers[matter.type] = handler(matter)\n\n // To do: idea: perhaps make this smarter, with an `after` of the second char?\n unsafe.push({atBreak: true, character: fence(matter, 'open').charAt(0)})\n }\n\n return {unsafe, handlers}\n}\n\n/**\n * Create a handle that can serialize a frontmatter node as markdown.\n *\n * @param {Matter} matter\n * Structure.\n * @returns {(node: Literal) => string} enter\n * Handler.\n */\nfunction handler(matter) {\n const open = fence(matter, 'open')\n const close = fence(matter, 'close')\n\n return handle\n\n /**\n * Serialize a frontmatter node as markdown.\n *\n * @param {Literal} node\n * Node to serialize.\n * @returns {string}\n * Serialized node.\n */\n function handle(node) {\n return open + (node.value ? '\\n' + node.value : '') + '\\n' + close\n }\n}\n\n/**\n * Get an `open` or `close` fence.\n *\n * @param {Matter} matter\n * Structure.\n * @param {'open' | 'close'} prop\n * Field to get.\n * @returns {string}\n * Fence.\n */\nfunction fence(matter, prop) {\n return matter.marker\n ? pick(matter.marker, prop).repeat(3)\n : // @ts-expect-error: They’re mutually exclusive.\n pick(matter.fence, prop)\n}\n\n/**\n * Take `open` or `close` fields when schema is an info object, or use the\n * given value when it is a string.\n *\n * @param {Info | string} schema\n * Info object or value.\n * @param {'open' | 'close'} prop\n * Field to get.\n * @returns {string}\n * Thing to use for the opening or closing.\n */\nfunction pick(schema, prop) {\n return typeof schema === 'string' ? schema : schema[prop]\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('micromark-extension-frontmatter').Options} Options\n */\n\nimport {frontmatter} from 'micromark-extension-frontmatter'\nimport {\n frontmatterFromMarkdown,\n frontmatterToMarkdown\n} from 'mdast-util-frontmatter'\n\n/**\n * Plugin to add support for frontmatter.\n *\n * @type {import('unified').Plugin<[Options?]|void[], Root>}\n */\nexport default function remarkFrontmatter(options = 'yaml') {\n const data = this.data()\n\n add('micromarkExtensions', frontmatter(options))\n add('fromMarkdownExtensions', frontmatterFromMarkdown(options))\n add('toMarkdownExtensions', frontmatterToMarkdown(options))\n\n /**\n * @param {string} field\n * @param {unknown} value\n */\n function add(field, value) {\n const list = /** @type {unknown[]} */ (\n // Other extensions\n /* c8 ignore next 2 */\n data[field] ? data[field] : (data[field] = [])\n )\n\n list.push(value)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Code} Code\n * @typedef {import('micromark-util-types').ConstructRecord} ConstructRecord\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Previous} Previous\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {\n asciiAlpha,\n asciiAlphanumeric,\n asciiControl,\n markdownLineEndingOrSpace,\n unicodePunctuation,\n unicodeWhitespace\n} from 'micromark-util-character'\nconst wwwPrefix = {\n tokenize: tokenizeWwwPrefix,\n partial: true\n}\nconst domain = {\n tokenize: tokenizeDomain,\n partial: true\n}\nconst path = {\n tokenize: tokenizePath,\n partial: true\n}\nconst trail = {\n tokenize: tokenizeTrail,\n partial: true\n}\nconst emailDomainDotTrail = {\n tokenize: tokenizeEmailDomainDotTrail,\n partial: true\n}\nconst wwwAutolink = {\n tokenize: tokenizeWwwAutolink,\n previous: previousWww\n}\nconst protocolAutolink = {\n tokenize: tokenizeProtocolAutolink,\n previous: previousProtocol\n}\nconst emailAutolink = {\n tokenize: tokenizeEmailAutolink,\n previous: previousEmail\n}\n\n/** @type {ConstructRecord} */\nconst text = {}\n\n// To do: next major: expose functions that yields extension.\n\n/**\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * autolink literal syntax.\n *\n * @type {Extension}\n */\nexport const gfmAutolinkLiteral = {\n text\n}\n\n/** @type {Code} */\nlet code = 48\n\n// Add alphanumerics.\nwhile (code < 123) {\n text[code] = emailAutolink\n code++\n if (code === 58) code = 65\n else if (code === 91) code = 97\n}\ntext[43] = emailAutolink\ntext[45] = emailAutolink\ntext[46] = emailAutolink\ntext[95] = emailAutolink\ntext[72] = [emailAutolink, protocolAutolink]\ntext[104] = [emailAutolink, protocolAutolink]\ntext[87] = [emailAutolink, wwwAutolink]\ntext[119] = [emailAutolink, wwwAutolink]\n\n// To do: perform email autolink literals on events, afterwards.\n// That’s where `markdown-rs` and `cmark-gfm` perform it.\n// It should look for `@`, then for atext backwards, and then for a label\n// forwards.\n// To do: `mailto:`, `xmpp:` protocol as prefix.\n\n/**\n * Email autolink literal.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^^^^^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeEmailAutolink(effects, ok, nok) {\n const self = this\n /** @type {boolean | undefined} */\n let dot\n /** @type {boolean} */\n let data\n return start\n\n /**\n * Start of email autolink literal.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n if (\n !gfmAtext(code) ||\n !previousEmail.call(self, self.previous) ||\n previousUnbalanced(self.events)\n ) {\n return nok(code)\n }\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkEmail')\n return atext(code)\n }\n\n /**\n * In email atext.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function atext(code) {\n if (gfmAtext(code)) {\n effects.consume(code)\n return atext\n }\n if (code === 64) {\n effects.consume(code)\n return emailDomain\n }\n return nok(code)\n }\n\n /**\n * In email domain.\n *\n * The reference code is a bit overly complex as it handles the `@`, of which\n * there may be just one.\n * Source: \n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomain(code) {\n // Dot followed by alphanumerical (not `-` or `_`).\n if (code === 46) {\n return effects.check(\n emailDomainDotTrail,\n emailDomainAfter,\n emailDomainDot\n )(code)\n }\n\n // Alphanumerical, `-`, and `_`.\n if (code === 45 || code === 95 || asciiAlphanumeric(code)) {\n data = true\n effects.consume(code)\n return emailDomain\n }\n\n // To do: `/` if xmpp.\n\n // Note: normally we’d truncate trailing punctuation from the link.\n // However, email autolink literals cannot contain any of those markers,\n // except for `.`, but that can only occur if it isn’t trailing.\n // So we can ignore truncating!\n return emailDomainAfter(code)\n }\n\n /**\n * In email domain, on dot that is not a trail.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomainDot(code) {\n effects.consume(code)\n dot = true\n return emailDomain\n }\n\n /**\n * After email domain.\n *\n * ```markdown\n * > | a contact@example.org b\n * ^\n * ```\n *\n * @type {State}\n */\n function emailDomainAfter(code) {\n // Domain must not be empty, must include a dot, and must end in alphabetical.\n // Source: .\n if (data && dot && asciiAlpha(self.previous)) {\n effects.exit('literalAutolinkEmail')\n effects.exit('literalAutolink')\n return ok(code)\n }\n return nok(code)\n }\n}\n\n/**\n * `www` autolink literal.\n *\n * ```markdown\n * > | a www.example.org b\n * ^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeWwwAutolink(effects, ok, nok) {\n const self = this\n return wwwStart\n\n /**\n * Start of www autolink literal.\n *\n * ```markdown\n * > | www.example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwStart(code) {\n if (\n (code !== 87 && code !== 119) ||\n !previousWww.call(self, self.previous) ||\n previousUnbalanced(self.events)\n ) {\n return nok(code)\n }\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkWww')\n // Note: we *check*, so we can discard the `www.` we parsed.\n // If it worked, we consider it as a part of the domain.\n return effects.check(\n wwwPrefix,\n effects.attempt(domain, effects.attempt(path, wwwAfter), nok),\n nok\n )(code)\n }\n\n /**\n * After a www autolink literal.\n *\n * ```markdown\n * > | www.example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwAfter(code) {\n effects.exit('literalAutolinkWww')\n effects.exit('literalAutolink')\n return ok(code)\n }\n}\n\n/**\n * Protocol autolink literal.\n *\n * ```markdown\n * > | a https://example.org b\n * ^^^^^^^^^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeProtocolAutolink(effects, ok, nok) {\n const self = this\n let buffer = ''\n let seen = false\n return protocolStart\n\n /**\n * Start of protocol autolink literal.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function protocolStart(code) {\n if (\n (code === 72 || code === 104) &&\n previousProtocol.call(self, self.previous) &&\n !previousUnbalanced(self.events)\n ) {\n effects.enter('literalAutolink')\n effects.enter('literalAutolinkHttp')\n buffer += String.fromCodePoint(code)\n effects.consume(code)\n return protocolPrefixInside\n }\n return nok(code)\n }\n\n /**\n * In protocol.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^^^^^\n * ```\n *\n * @type {State}\n */\n function protocolPrefixInside(code) {\n // `5` is size of `https`\n if (asciiAlpha(code) && buffer.length < 5) {\n // @ts-expect-error: definitely number.\n buffer += String.fromCodePoint(code)\n effects.consume(code)\n return protocolPrefixInside\n }\n if (code === 58) {\n const protocol = buffer.toLowerCase()\n if (protocol === 'http' || protocol === 'https') {\n effects.consume(code)\n return protocolSlashesInside\n }\n }\n return nok(code)\n }\n\n /**\n * In slashes.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^^\n * ```\n *\n * @type {State}\n */\n function protocolSlashesInside(code) {\n if (code === 47) {\n effects.consume(code)\n if (seen) {\n return afterProtocol\n }\n seen = true\n return protocolSlashesInside\n }\n return nok(code)\n }\n\n /**\n * After protocol, before domain.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function afterProtocol(code) {\n // To do: this is different from `markdown-rs`:\n // https://github.com/wooorm/markdown-rs/blob/b3a921c761309ae00a51fe348d8a43adbc54b518/src/construct/gfm_autolink_literal.rs#L172-L182\n return code === null ||\n asciiControl(code) ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code) ||\n unicodePunctuation(code)\n ? nok(code)\n : effects.attempt(domain, effects.attempt(path, protocolAfter), nok)(code)\n }\n\n /**\n * After a protocol autolink literal.\n *\n * ```markdown\n * > | https://example.com/a?b#c\n * ^\n * ```\n *\n * @type {State}\n */\n function protocolAfter(code) {\n effects.exit('literalAutolinkHttp')\n effects.exit('literalAutolink')\n return ok(code)\n }\n}\n\n/**\n * `www` prefix.\n *\n * ```markdown\n * > | a www.example.org b\n * ^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeWwwPrefix(effects, ok, nok) {\n let size = 0\n return wwwPrefixInside\n\n /**\n * In www prefix.\n *\n * ```markdown\n * > | www.example.com\n * ^^^^\n * ```\n *\n * @type {State}\n */\n function wwwPrefixInside(code) {\n if ((code === 87 || code === 119) && size < 3) {\n size++\n effects.consume(code)\n return wwwPrefixInside\n }\n if (code === 46 && size === 3) {\n effects.consume(code)\n return wwwPrefixAfter\n }\n return nok(code)\n }\n\n /**\n * After www prefix.\n *\n * ```markdown\n * > | www.example.com\n * ^\n * ```\n *\n * @type {State}\n */\n function wwwPrefixAfter(code) {\n // If there is *anything*, we can link.\n return code === null ? nok(code) : ok(code)\n }\n}\n\n/**\n * Domain.\n *\n * ```markdown\n * > | a https://example.org b\n * ^^^^^^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDomain(effects, ok, nok) {\n /** @type {boolean | undefined} */\n let underscoreInLastSegment\n /** @type {boolean | undefined} */\n let underscoreInLastLastSegment\n /** @type {boolean | undefined} */\n let seen\n return domainInside\n\n /**\n * In domain.\n *\n * ```markdown\n * > | https://example.com/a\n * ^^^^^^^^^^^\n * ```\n *\n * @type {State}\n */\n function domainInside(code) {\n // Check whether this marker, which is a trailing punctuation\n // marker, optionally followed by more trailing markers, and then\n // followed by an end.\n if (code === 46 || code === 95) {\n return effects.check(trail, domainAfter, domainAtPunctuation)(code)\n }\n\n // GH documents that only alphanumerics (other than `-`, `.`, and `_`) can\n // occur, which sounds like ASCII only, but they also support `www.點看.com`,\n // so that’s Unicode.\n // Instead of some new production for Unicode alphanumerics, markdown\n // already has that for Unicode punctuation and whitespace, so use those.\n // Source: .\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code) ||\n (code !== 45 && unicodePunctuation(code))\n ) {\n return domainAfter(code)\n }\n seen = true\n effects.consume(code)\n return domainInside\n }\n\n /**\n * In domain, at potential trailing punctuation, that was not trailing.\n *\n * ```markdown\n * > | https://example.com\n * ^\n * ```\n *\n * @type {State}\n */\n function domainAtPunctuation(code) {\n // There is an underscore in the last segment of the domain\n if (code === 95) {\n underscoreInLastSegment = true\n }\n // Otherwise, it’s a `.`: save the last segment underscore in the\n // penultimate segment slot.\n else {\n underscoreInLastLastSegment = underscoreInLastSegment\n underscoreInLastSegment = undefined\n }\n effects.consume(code)\n return domainInside\n }\n\n /**\n * After domain.\n *\n * ```markdown\n * > | https://example.com/a\n * ^\n * ```\n *\n * @type {State} */\n function domainAfter(code) {\n // Note: that’s GH says a dot is needed, but it’s not true:\n // \n if (underscoreInLastLastSegment || underscoreInLastSegment || !seen) {\n return nok(code)\n }\n return ok(code)\n }\n}\n\n/**\n * Path.\n *\n * ```markdown\n * > | a https://example.org/stuff b\n * ^^^^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizePath(effects, ok) {\n let sizeOpen = 0\n let sizeClose = 0\n return pathInside\n\n /**\n * In path.\n *\n * ```markdown\n * > | https://example.com/a\n * ^^\n * ```\n *\n * @type {State}\n */\n function pathInside(code) {\n if (code === 40) {\n sizeOpen++\n effects.consume(code)\n return pathInside\n }\n\n // To do: `markdown-rs` also needs this.\n // If this is a paren, and there are less closings than openings,\n // we don’t check for a trail.\n if (code === 41 && sizeClose < sizeOpen) {\n return pathAtPunctuation(code)\n }\n\n // Check whether this trailing punctuation marker is optionally\n // followed by more trailing markers, and then followed\n // by an end.\n if (\n code === 33 ||\n code === 34 ||\n code === 38 ||\n code === 39 ||\n code === 41 ||\n code === 42 ||\n code === 44 ||\n code === 46 ||\n code === 58 ||\n code === 59 ||\n code === 60 ||\n code === 63 ||\n code === 93 ||\n code === 95 ||\n code === 126\n ) {\n return effects.check(trail, ok, pathAtPunctuation)(code)\n }\n if (\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n effects.consume(code)\n return pathInside\n }\n\n /**\n * In path, at potential trailing punctuation, that was not trailing.\n *\n * ```markdown\n * > | https://example.com/a\"b\n * ^\n * ```\n *\n * @type {State}\n */\n function pathAtPunctuation(code) {\n // Count closing parens.\n if (code === 41) {\n sizeClose++\n }\n effects.consume(code)\n return pathInside\n }\n}\n\n/**\n * Trail.\n *\n * This calls `ok` if this *is* the trail, followed by an end, which means\n * the entire trail is not part of the link.\n * It calls `nok` if this *is* part of the link.\n *\n * ```markdown\n * > | https://example.com\").\n * ^^^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTrail(effects, ok, nok) {\n return trail\n\n /**\n * In trail of domain or path.\n *\n * ```markdown\n * > | https://example.com\").\n * ^\n * ```\n *\n * @type {State}\n */\n function trail(code) {\n // Regular trailing punctuation.\n if (\n code === 33 ||\n code === 34 ||\n code === 39 ||\n code === 41 ||\n code === 42 ||\n code === 44 ||\n code === 46 ||\n code === 58 ||\n code === 59 ||\n code === 63 ||\n code === 95 ||\n code === 126\n ) {\n effects.consume(code)\n return trail\n }\n\n // `&` followed by one or more alphabeticals and then a `;`, is\n // as a whole considered as trailing punctuation.\n // In all other cases, it is considered as continuation of the URL.\n if (code === 38) {\n effects.consume(code)\n return trailCharRefStart\n }\n\n // Needed because we allow literals after `[`, as we fix:\n // .\n // Check that it is not followed by `(` or `[`.\n if (code === 93) {\n effects.consume(code)\n return trailBracketAfter\n }\n if (\n // `<` is an end.\n code === 60 ||\n // So is whitespace.\n code === null ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n return nok(code)\n }\n\n /**\n * In trail, after `]`.\n *\n * > 👉 **Note**: this deviates from `cmark-gfm` to fix a bug.\n * > See end of for more.\n *\n * ```markdown\n * > | https://example.com](\n * ^\n * ```\n *\n * @type {State}\n */\n function trailBracketAfter(code) {\n // Whitespace or something that could start a resource or reference is the end.\n // Switch back to trail otherwise.\n if (\n code === null ||\n code === 40 ||\n code === 91 ||\n markdownLineEndingOrSpace(code) ||\n unicodeWhitespace(code)\n ) {\n return ok(code)\n }\n return trail(code)\n }\n\n /**\n * In character-reference like trail, after `&`.\n *\n * ```markdown\n * > | https://example.com&).\n * ^\n * ```\n *\n * @type {State}\n */\n function trailCharRefStart(code) {\n // When non-alpha, it’s not a trail.\n return asciiAlpha(code) ? trailCharRefInside(code) : nok(code)\n }\n\n /**\n * In character-reference like trail.\n *\n * ```markdown\n * > | https://example.com&).\n * ^\n * ```\n *\n * @type {State}\n */\n function trailCharRefInside(code) {\n // Switch back to trail if this is well-formed.\n if (code === 59) {\n effects.consume(code)\n return trail\n }\n if (asciiAlpha(code)) {\n effects.consume(code)\n return trailCharRefInside\n }\n\n // It’s not a trail.\n return nok(code)\n }\n}\n\n/**\n * Dot in email domain trail.\n *\n * This calls `ok` if this *is* the trail, followed by an end, which means\n * the trail is not part of the link.\n * It calls `nok` if this *is* part of the link.\n *\n * ```markdown\n * > | contact@example.org.\n * ^\n * ```\n *\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeEmailDomainDotTrail(effects, ok, nok) {\n return start\n\n /**\n * Dot.\n *\n * ```markdown\n * > | contact@example.org.\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n // Must be dot.\n effects.consume(code)\n return after\n }\n\n /**\n * After dot.\n *\n * ```markdown\n * > | contact@example.org.\n * ^ ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // Not a trail if alphanumeric.\n return asciiAlphanumeric(code) ? nok(code) : ok(code)\n }\n}\n\n/**\n * See:\n * .\n *\n * @type {Previous}\n */\nfunction previousWww(code) {\n return (\n code === null ||\n code === 40 ||\n code === 42 ||\n code === 95 ||\n code === 91 ||\n code === 93 ||\n code === 126 ||\n markdownLineEndingOrSpace(code)\n )\n}\n\n/**\n * See:\n * .\n *\n * @type {Previous}\n */\nfunction previousProtocol(code) {\n return !asciiAlpha(code)\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Previous}\n */\nfunction previousEmail(code) {\n // Do not allow a slash “inside” atext.\n // The reference code is a bit weird, but that’s what it results in.\n // Source: .\n // Other than slash, every preceding character is allowed.\n return !(code === 47 || gfmAtext(code))\n}\n\n/**\n * @param {Code} code\n * @returns {boolean}\n */\nfunction gfmAtext(code) {\n return (\n code === 43 ||\n code === 45 ||\n code === 46 ||\n code === 95 ||\n asciiAlphanumeric(code)\n )\n}\n\n/**\n * @param {Array} events\n * @returns {boolean}\n */\nfunction previousUnbalanced(events) {\n let index = events.length\n let result = false\n while (index--) {\n const token = events[index][1]\n if (\n (token.type === 'labelLink' || token.type === 'labelImage') &&\n !token._balanced\n ) {\n result = true\n break\n }\n\n // If we’ve seen this token, and it was marked as not having any unbalanced\n // bracket before it, we can exit.\n if (token._gfmAutolinkLiteralWalkedInto) {\n result = false\n break\n }\n }\n if (events.length > 0 && !result) {\n // Mark the last token as “walked into” w/o finding\n // anything.\n events[events.length - 1][1]._gfmAutolinkLiteralWalkedInto = true\n }\n return result\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Exiter} Exiter\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {blankLine} from 'micromark-core-commonmark'\nimport {factorySpace} from 'micromark-factory-space'\nimport {markdownLineEndingOrSpace} from 'micromark-util-character'\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nconst indent = {\n tokenize: tokenizeIndent,\n partial: true\n}\n\n// To do: micromark should support a `_hiddenGfmFootnoteSupport`, which only\n// affects label start (image).\n// That will let us drop `tokenizePotentialGfmFootnote*`.\n// It currently has a `_hiddenFootnoteSupport`, which affects that and more.\n// That can be removed when `micromark-extension-footnote` is archived.\n\n/**\n * Create an extension for `micromark` to enable GFM footnote syntax.\n *\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions` to\n * enable GFM footnote syntax.\n */\nexport function gfmFootnote() {\n /** @type {Extension} */\n return {\n document: {\n [91]: {\n tokenize: tokenizeDefinitionStart,\n continuation: {\n tokenize: tokenizeDefinitionContinuation\n },\n exit: gfmFootnoteDefinitionEnd\n }\n },\n text: {\n [91]: {\n tokenize: tokenizeGfmFootnoteCall\n },\n [93]: {\n add: 'after',\n tokenize: tokenizePotentialGfmFootnoteCall,\n resolveTo: resolveToPotentialGfmFootnoteCall\n }\n }\n }\n}\n\n// To do: remove after micromark update.\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizePotentialGfmFootnoteCall(effects, ok, nok) {\n const self = this\n let index = self.events.length\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n /** @type {Token} */\n let labelStart\n\n // Find an opening.\n while (index--) {\n const token = self.events[index][1]\n if (token.type === 'labelImage') {\n labelStart = token\n break\n }\n\n // Exit if we’ve walked far enough.\n if (\n token.type === 'gfmFootnoteCall' ||\n token.type === 'labelLink' ||\n token.type === 'label' ||\n token.type === 'image' ||\n token.type === 'link'\n ) {\n break\n }\n }\n return start\n\n /**\n * @type {State}\n */\n function start(code) {\n if (!labelStart || !labelStart._balanced) {\n return nok(code)\n }\n const id = normalizeIdentifier(\n self.sliceSerialize({\n start: labelStart.end,\n end: self.now()\n })\n )\n if (id.codePointAt(0) !== 94 || !defined.includes(id.slice(1))) {\n return nok(code)\n }\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n return ok(code)\n }\n}\n\n// To do: remove after micromark update.\n/** @type {Resolver} */\nfunction resolveToPotentialGfmFootnoteCall(events, context) {\n let index = events.length\n /** @type {Token | undefined} */\n let labelStart\n\n // Find an opening.\n while (index--) {\n if (\n events[index][1].type === 'labelImage' &&\n events[index][0] === 'enter'\n ) {\n labelStart = events[index][1]\n break\n }\n }\n // Change the `labelImageMarker` to a `data`.\n events[index + 1][1].type = 'data'\n events[index + 3][1].type = 'gfmFootnoteCallLabelMarker'\n\n // The whole (without `!`):\n /** @type {Token} */\n const call = {\n type: 'gfmFootnoteCall',\n start: Object.assign({}, events[index + 3][1].start),\n end: Object.assign({}, events[events.length - 1][1].end)\n }\n // The `^` marker\n /** @type {Token} */\n const marker = {\n type: 'gfmFootnoteCallMarker',\n start: Object.assign({}, events[index + 3][1].end),\n end: Object.assign({}, events[index + 3][1].end)\n }\n // Increment the end 1 character.\n marker.end.column++\n marker.end.offset++\n marker.end._bufferIndex++\n /** @type {Token} */\n const string = {\n type: 'gfmFootnoteCallString',\n start: Object.assign({}, marker.end),\n end: Object.assign({}, events[events.length - 1][1].start)\n }\n /** @type {Token} */\n const chunk = {\n type: 'chunkString',\n contentType: 'string',\n start: Object.assign({}, string.start),\n end: Object.assign({}, string.end)\n }\n\n /** @type {Array} */\n const replacement = [\n // Take the `labelImageMarker` (now `data`, the `!`)\n events[index + 1],\n events[index + 2],\n ['enter', call, context],\n // The `[`\n events[index + 3],\n events[index + 4],\n // The `^`.\n ['enter', marker, context],\n ['exit', marker, context],\n // Everything in between.\n ['enter', string, context],\n ['enter', chunk, context],\n ['exit', chunk, context],\n ['exit', string, context],\n // The ending (`]`, properly parsed and labelled).\n events[events.length - 2],\n events[events.length - 1],\n ['exit', call, context]\n ]\n events.splice(index, events.length - index + 1, ...replacement)\n return events\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeGfmFootnoteCall(effects, ok, nok) {\n const self = this\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n let size = 0\n /** @type {boolean} */\n let data\n\n // Note: the implementation of `markdown-rs` is different, because it houses\n // core *and* extensions in one project.\n // Therefore, it can include footnote logic inside `label-end`.\n // We can’t do that, but luckily, we can parse footnotes in a simpler way than\n // needed for labels.\n return start\n\n /**\n * Start of footnote label.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('gfmFootnoteCall')\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n return callStart\n }\n\n /**\n * After `[`, at `^`.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function callStart(code) {\n if (code !== 94) return nok(code)\n effects.enter('gfmFootnoteCallMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallMarker')\n effects.enter('gfmFootnoteCallString')\n effects.enter('chunkString').contentType = 'string'\n return callData\n }\n\n /**\n * In label.\n *\n * ```markdown\n * > | a [^b] c\n * ^\n * ```\n *\n * @type {State}\n */\n function callData(code) {\n if (\n // Too long.\n size > 999 ||\n // Closing brace with nothing.\n (code === 93 && !data) ||\n // Space or tab is not supported by GFM for some reason.\n // `\\n` and `[` not being supported makes sense.\n code === null ||\n code === 91 ||\n markdownLineEndingOrSpace(code)\n ) {\n return nok(code)\n }\n if (code === 93) {\n effects.exit('chunkString')\n const token = effects.exit('gfmFootnoteCallString')\n if (!defined.includes(normalizeIdentifier(self.sliceSerialize(token)))) {\n return nok(code)\n }\n effects.enter('gfmFootnoteCallLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteCallLabelMarker')\n effects.exit('gfmFootnoteCall')\n return ok\n }\n if (!markdownLineEndingOrSpace(code)) {\n data = true\n }\n size++\n effects.consume(code)\n return code === 92 ? callEscape : callData\n }\n\n /**\n * On character after escape.\n *\n * ```markdown\n * > | a [^b\\c] d\n * ^\n * ```\n *\n * @type {State}\n */\n function callEscape(code) {\n if (code === 91 || code === 92 || code === 93) {\n effects.consume(code)\n size++\n return callData\n }\n return callData(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDefinitionStart(effects, ok, nok) {\n const self = this\n /** @type {Array} */\n // @ts-expect-error It’s fine!\n const defined = self.parser.gfmFootnotes || (self.parser.gfmFootnotes = [])\n /** @type {string} */\n let identifier\n let size = 0\n /** @type {boolean | undefined} */\n let data\n return start\n\n /**\n * Start of GFM footnote definition.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function start(code) {\n effects.enter('gfmFootnoteDefinition')._container = true\n effects.enter('gfmFootnoteDefinitionLabel')\n effects.enter('gfmFootnoteDefinitionLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionLabelMarker')\n return labelAtMarker\n }\n\n /**\n * In label, at caret.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelAtMarker(code) {\n if (code === 94) {\n effects.enter('gfmFootnoteDefinitionMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionMarker')\n effects.enter('gfmFootnoteDefinitionLabelString')\n effects.enter('chunkString').contentType = 'string'\n return labelInside\n }\n return nok(code)\n }\n\n /**\n * In label.\n *\n * > 👉 **Note**: `cmark-gfm` prevents whitespace from occurring in footnote\n * > definition labels.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelInside(code) {\n if (\n // Too long.\n size > 999 ||\n // Closing brace with nothing.\n (code === 93 && !data) ||\n // Space or tab is not supported by GFM for some reason.\n // `\\n` and `[` not being supported makes sense.\n code === null ||\n code === 91 ||\n markdownLineEndingOrSpace(code)\n ) {\n return nok(code)\n }\n if (code === 93) {\n effects.exit('chunkString')\n const token = effects.exit('gfmFootnoteDefinitionLabelString')\n identifier = normalizeIdentifier(self.sliceSerialize(token))\n effects.enter('gfmFootnoteDefinitionLabelMarker')\n effects.consume(code)\n effects.exit('gfmFootnoteDefinitionLabelMarker')\n effects.exit('gfmFootnoteDefinitionLabel')\n return labelAfter\n }\n if (!markdownLineEndingOrSpace(code)) {\n data = true\n }\n size++\n effects.consume(code)\n return code === 92 ? labelEscape : labelInside\n }\n\n /**\n * After `\\`, at a special character.\n *\n * > 👉 **Note**: `cmark-gfm` currently does not support escaped brackets:\n * > \n *\n * ```markdown\n * > | [^a\\*b]: c\n * ^\n * ```\n *\n * @type {State}\n */\n function labelEscape(code) {\n if (code === 91 || code === 92 || code === 93) {\n effects.consume(code)\n size++\n return labelInside\n }\n return labelInside(code)\n }\n\n /**\n * After definition label.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function labelAfter(code) {\n if (code === 58) {\n effects.enter('definitionMarker')\n effects.consume(code)\n effects.exit('definitionMarker')\n if (!defined.includes(identifier)) {\n defined.push(identifier)\n }\n\n // Any whitespace after the marker is eaten, forming indented code\n // is not possible.\n // No space is also fine, just like a block quote marker.\n return factorySpace(\n effects,\n whitespaceAfter,\n 'gfmFootnoteDefinitionWhitespace'\n )\n }\n return nok(code)\n }\n\n /**\n * After definition prefix.\n *\n * ```markdown\n * > | [^a]: b\n * ^\n * ```\n *\n * @type {State}\n */\n function whitespaceAfter(code) {\n // `markdown-rs` has a wrapping token for the prefix that is closed here.\n return ok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeDefinitionContinuation(effects, ok, nok) {\n /// Start of footnote definition continuation.\n ///\n /// ```markdown\n /// | [^a]: b\n /// > | c\n /// ^\n /// ```\n //\n // Either a blank line, which is okay, or an indented thing.\n return effects.check(blankLine, ok, effects.attempt(indent, ok, nok))\n}\n\n/** @type {Exiter} */\nfunction gfmFootnoteDefinitionEnd(effects) {\n effects.exit('gfmFootnoteDefinition')\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeIndent(effects, ok, nok) {\n const self = this\n return factorySpace(\n effects,\n afterPrefix,\n 'gfmFootnoteDefinitionIndent',\n 4 + 1\n )\n\n /**\n * @type {State}\n */\n function afterPrefix(code) {\n const tail = self.events[self.events.length - 1]\n return tail &&\n tail[1].type === 'gfmFootnoteDefinitionIndent' &&\n tail[2].sliceSerialize(tail[1], true).length === 4\n ? ok(code)\n : nok(code)\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n *\n * @typedef Options\n * Configuration (optional).\n * @property {boolean} [singleTilde=true]\n * Whether to support strikethrough with a single tilde.\n *\n * Single tildes work on github.com, but are technically prohibited by the\n * GFM spec.\n */\n\nimport {splice} from 'micromark-util-chunked'\nimport {classifyCharacter} from 'micromark-util-classify-character'\nimport {resolveAll} from 'micromark-util-resolve-all'\n/**\n * Create an extension for `micromark` to enable GFM strikethrough syntax.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable GFM strikethrough syntax.\n */\nexport function gfmStrikethrough(options) {\n const options_ = options || {}\n let single = options_.singleTilde\n const tokenizer = {\n tokenize: tokenizeStrikethrough,\n resolveAll: resolveAllStrikethrough\n }\n if (single === null || single === undefined) {\n single = true\n }\n return {\n text: {\n [126]: tokenizer\n },\n insideSpan: {\n null: [tokenizer]\n },\n attentionMarkers: {\n null: [126]\n }\n }\n\n /**\n * Take events and resolve strikethrough.\n *\n * @type {Resolver}\n */\n function resolveAllStrikethrough(events, context) {\n let index = -1\n\n // Walk through all events.\n while (++index < events.length) {\n // Find a token that can close.\n if (\n events[index][0] === 'enter' &&\n events[index][1].type === 'strikethroughSequenceTemporary' &&\n events[index][1]._close\n ) {\n let open = index\n\n // Now walk back to find an opener.\n while (open--) {\n // Find a token that can open the closer.\n if (\n events[open][0] === 'exit' &&\n events[open][1].type === 'strikethroughSequenceTemporary' &&\n events[open][1]._open &&\n // If the sizes are the same:\n events[index][1].end.offset - events[index][1].start.offset ===\n events[open][1].end.offset - events[open][1].start.offset\n ) {\n events[index][1].type = 'strikethroughSequence'\n events[open][1].type = 'strikethroughSequence'\n\n /** @type {Token} */\n const strikethrough = {\n type: 'strikethrough',\n start: Object.assign({}, events[open][1].start),\n end: Object.assign({}, events[index][1].end)\n }\n\n /** @type {Token} */\n const text = {\n type: 'strikethroughText',\n start: Object.assign({}, events[open][1].end),\n end: Object.assign({}, events[index][1].start)\n }\n\n // Opening.\n /** @type {Array} */\n const nextEvents = [\n ['enter', strikethrough, context],\n ['enter', events[open][1], context],\n ['exit', events[open][1], context],\n ['enter', text, context]\n ]\n const insideSpan = context.parser.constructs.insideSpan.null\n if (insideSpan) {\n // Between.\n splice(\n nextEvents,\n nextEvents.length,\n 0,\n resolveAll(insideSpan, events.slice(open + 1, index), context)\n )\n }\n\n // Closing.\n splice(nextEvents, nextEvents.length, 0, [\n ['exit', text, context],\n ['enter', events[index][1], context],\n ['exit', events[index][1], context],\n ['exit', strikethrough, context]\n ])\n splice(events, open - 1, index - open + 3, nextEvents)\n index = open + nextEvents.length - 2\n break\n }\n }\n }\n }\n index = -1\n while (++index < events.length) {\n if (events[index][1].type === 'strikethroughSequenceTemporary') {\n events[index][1].type = 'data'\n }\n }\n return events\n }\n\n /**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\n function tokenizeStrikethrough(effects, ok, nok) {\n const previous = this.previous\n const events = this.events\n let size = 0\n return start\n\n /** @type {State} */\n function start(code) {\n if (\n previous === 126 &&\n events[events.length - 1][1].type !== 'characterEscape'\n ) {\n return nok(code)\n }\n effects.enter('strikethroughSequenceTemporary')\n return more(code)\n }\n\n /** @type {State} */\n function more(code) {\n const before = classifyCharacter(previous)\n if (code === 126) {\n // If this is the third marker, exit.\n if (size > 1) return nok(code)\n effects.consume(code)\n size++\n return more\n }\n if (size < 2 && !single) return nok(code)\n const token = effects.exit('strikethroughSequenceTemporary')\n const after = classifyCharacter(code)\n token._open = !after || (after === 2 && Boolean(before))\n token._close = !before || (before === 2 && Boolean(after))\n return ok(code)\n }\n }\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\n// Port of `edit_map.rs` from `markdown-rs`.\n// This should move to `markdown-js` later.\n\n// Deal with several changes in events, batching them together.\n//\n// Preferably, changes should be kept to a minimum.\n// Sometimes, it’s needed to change the list of events, because parsing can be\n// messy, and it helps to expose a cleaner interface of events to the compiler\n// and other users.\n// It can also help to merge many adjacent similar events.\n// And, in other cases, it’s needed to parse subcontent: pass some events\n// through another tokenizer and inject the result.\n\n/**\n * @typedef {[number, number, Array]} Change\n * @typedef {[number, number, number]} Jump\n */\n\n/**\n * Tracks a bunch of edits.\n */\nexport class EditMap {\n /**\n * Create a new edit map.\n */\n constructor() {\n /**\n * Record of changes.\n *\n * @type {Array}\n */\n this.map = []\n }\n\n /**\n * Create an edit: a remove and/or add at a certain place.\n *\n * @param {number} index\n * @param {number} remove\n * @param {Array} add\n * @returns {void}\n */\n add(index, remove, add) {\n addImpl(this, index, remove, add)\n }\n\n // To do: not used here.\n // /**\n // * Create an edit: but insert `add` before existing additions.\n // *\n // * @param {number} index\n // * @param {number} remove\n // * @param {Array} add\n // * @returns {void}\n // */\n // addBefore(index, remove, add) {\n // addImpl(this, index, remove, add, true)\n // }\n\n /**\n * Done, change the events.\n *\n * @param {Array} events\n * @returns {void}\n */\n consume(events) {\n this.map.sort((a, b) => a[0] - b[0])\n\n /* c8 ignore next 3 -- `resolve` is never called without tables, so without edits. */\n if (this.map.length === 0) {\n return\n }\n\n // To do: if links are added in events, like they are in `markdown-rs`,\n // this is needed.\n // // Calculate jumps: where items in the current list move to.\n // /** @type {Array} */\n // const jumps = []\n // let index = 0\n // let addAcc = 0\n // let removeAcc = 0\n // while (index < this.map.length) {\n // const [at, remove, add] = this.map[index]\n // removeAcc += remove\n // addAcc += add.length\n // jumps.push([at, removeAcc, addAcc])\n // index += 1\n // }\n //\n // . shiftLinks(events, jumps)\n\n let index = this.map.length\n /** @type {Array>} */\n const vecs = []\n while (index > 0) {\n index -= 1\n vecs.push(events.slice(this.map[index][0] + this.map[index][1]))\n // eslint-disable-next-line unicorn/no-array-push-push\n vecs.push(this.map[index][2])\n\n // Truncate rest.\n events.length = this.map[index][0]\n }\n vecs.push([...events])\n events.length = 0\n let slice = vecs.pop()\n while (slice) {\n events.push(...slice)\n slice = vecs.pop()\n }\n\n // Truncate everything.\n this.map.length = 0\n }\n}\n\n/**\n * Create an edit.\n *\n * @param {EditMap} editMap\n * @param {number} at\n * @param {number} remove\n * @param {Array} add\n * @returns {void}\n */\nfunction addImpl(editMap, at, remove, add) {\n let index = 0\n\n /* c8 ignore next 3 -- `resolve` is never called without tables, so without edits. */\n if (remove === 0 && add.length === 0) {\n return\n }\n while (index < editMap.map.length) {\n if (editMap.map[index][0] === at) {\n editMap.map[index][1] += remove\n\n // To do: before not used.\n // if (before) {\n // add.push(...editMap.map[index][2])\n // editMap.map[index][2] = add\n // } else {\n editMap.map[index][2].push(...add)\n // }\n\n return\n }\n index += 1\n }\n editMap.map.push([at, remove, add])\n}\n\n// /**\n// * Shift `previous` and `next` links according to `jumps`.\n// *\n// * This fixes links in case there are events removed or added between them.\n// *\n// * @param {Array} events\n// * @param {Array} jumps\n// */\n// function shiftLinks(events, jumps) {\n// let jumpIndex = 0\n// let index = 0\n// let add = 0\n// let rm = 0\n\n// while (index < events.length) {\n// const rmCurr = rm\n\n// while (jumpIndex < jumps.length && jumps[jumpIndex][0] <= index) {\n// add = jumps[jumpIndex][2]\n// rm = jumps[jumpIndex][1]\n// jumpIndex += 1\n// }\n\n// // Ignore items that will be removed.\n// if (rm > rmCurr) {\n// index += rm - rmCurr\n// } else {\n// console.log('to do: links?', add, rmCurr)\n// // ?\n// // if let Some(link) = &events[index].link {\n// // if let Some(next) = link.next {\n// // events[next].link.as_mut().unwrap().previous = Some(index + add - rm);\n// // while jumpIndex < jumps.len() && jumps[jumpIndex].0 <= next {\n// // add = jumps[jumpIndex].2;\n// // rm = jumps[jumpIndex].1;\n// // jumpIndex += 1;\n// // }\n// // events[index].link.as_mut().unwrap().next = Some(next + add - rm);\n// // index = next;\n// // continue;\n// // }\n// // }\n// index += 1\n// }\n// }\n// }\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n */\n\n/**\n * @typedef {'left' | 'center' | 'right' | 'none'} Align\n */\n\n/**\n * Figure out the alignment of a GFM table.\n *\n * @param {Array} events\n * @param {number} index\n * @returns {Array}\n */\nexport function gfmTableAlign(events, index) {\n let inDelimiterRow = false\n /** @type {Array} */\n const align = []\n while (index < events.length) {\n const event = events[index]\n if (inDelimiterRow) {\n if (event[0] === 'enter') {\n // Start of alignment value: set a new column.\n // To do: `markdown-rs` uses `tableDelimiterCellValue`.\n if (event[1].type === 'tableContent') {\n align.push(\n events[index + 1][1].type === 'tableDelimiterMarker'\n ? 'left'\n : 'none'\n )\n }\n }\n // Exits:\n // End of alignment value: change the column.\n // To do: `markdown-rs` uses `tableDelimiterCellValue`.\n else if (event[1].type === 'tableContent') {\n if (events[index - 1][1].type === 'tableDelimiterMarker') {\n const alignIndex = align.length - 1\n align[alignIndex] = align[alignIndex] === 'left' ? 'center' : 'right'\n }\n }\n // Done!\n else if (event[1].type === 'tableDelimiterRow') {\n break\n }\n } else if (event[0] === 'enter' && event[1].type === 'tableDelimiterRow') {\n inDelimiterRow = true\n }\n index += 1\n }\n return align\n}\n","/**\n * @typedef {import('micromark-util-types').Event} Event\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').Point} Point\n * @typedef {import('micromark-util-types').Resolver} Resolver\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').Token} Token\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\n/**\n * @typedef {[number, number, number, number]} Range\n * Cell info.\n *\n * @typedef {0 | 1 | 2 | 3} RowKind\n * Where we are: `1` for head row, `2` for delimiter row, `3` for body row.\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n markdownLineEnding,\n markdownLineEndingOrSpace,\n markdownSpace\n} from 'micromark-util-character'\nimport {EditMap} from './edit-map.js'\nimport {gfmTableAlign} from './infer.js'\n\n// To do: next major: expose functions.\n\n/**\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * table syntax.\n *\n * @type {Extension}\n */\nexport const gfmTable = {\n flow: {\n null: {\n tokenize: tokenizeTable,\n resolveAll: resolveTable\n }\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTable(effects, ok, nok) {\n const self = this\n let size = 0\n let sizeB = 0\n /** @type {boolean | undefined} */\n let seen\n return start\n\n /**\n * Start of a GFM table.\n *\n * If there is a valid table row or table head before, then we try to parse\n * another row.\n * Otherwise, we try to parse a head.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * > | | b |\n * ^\n * ```\n * @type {State}\n */\n function start(code) {\n let index = self.events.length - 1\n while (index > -1) {\n const type = self.events[index][1].type\n if (\n type === 'lineEnding' ||\n // Note: markdown-rs uses `whitespace` instead of `linePrefix`\n type === 'linePrefix'\n )\n index--\n else break\n }\n const tail = index > -1 ? self.events[index][1].type : null\n const next =\n tail === 'tableHead' || tail === 'tableRow' ? bodyRowStart : headRowBefore\n\n // Don’t allow lazy body rows.\n if (next === bodyRowStart && self.parser.lazy[self.now().line]) {\n return nok(code)\n }\n return next(code)\n }\n\n /**\n * Before table head row.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowBefore(code) {\n effects.enter('tableHead')\n effects.enter('tableRow')\n return headRowStart(code)\n }\n\n /**\n * Before table head row, after whitespace.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowStart(code) {\n if (code === 124) {\n return headRowBreak(code)\n }\n\n // To do: micromark-js should let us parse our own whitespace in extensions,\n // like `markdown-rs`:\n //\n // ```js\n // // 4+ spaces.\n // if (markdownSpace(code)) {\n // return nok(code)\n // }\n // ```\n\n seen = true\n // Count the first character, that isn’t a pipe, double.\n sizeB += 1\n return headRowBreak(code)\n }\n\n /**\n * At break in table head row.\n *\n * ```markdown\n * > | | a |\n * ^\n * ^\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowBreak(code) {\n if (code === null) {\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n if (markdownLineEnding(code)) {\n // If anything other than one pipe (ignoring whitespace) was used, it’s fine.\n if (sizeB > 1) {\n sizeB = 0\n // To do: check if this works.\n // Feel free to interrupt:\n self.interrupt = true\n effects.exit('tableRow')\n effects.enter('lineEnding')\n effects.consume(code)\n effects.exit('lineEnding')\n return headDelimiterStart\n }\n\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n if (markdownSpace(code)) {\n // To do: check if this is fine.\n // effects.attempt(State::Next(StateName::GfmTableHeadRowBreak), State::Nok)\n // State::Retry(space_or_tab(tokenizer))\n return factorySpace(effects, headRowBreak, 'whitespace')(code)\n }\n sizeB += 1\n if (seen) {\n seen = false\n // Header cell count.\n size += 1\n }\n if (code === 124) {\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n // Whether a delimiter was seen.\n seen = true\n return headRowBreak\n }\n\n // Anything else is cell data.\n effects.enter('data')\n return headRowData(code)\n }\n\n /**\n * In table head row data.\n *\n * ```markdown\n * > | | a |\n * ^\n * | | - |\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headRowData(code) {\n if (code === null || code === 124 || markdownLineEndingOrSpace(code)) {\n effects.exit('data')\n return headRowBreak(code)\n }\n effects.consume(code)\n return code === 92 ? headRowEscape : headRowData\n }\n\n /**\n * In table head row escape.\n *\n * ```markdown\n * > | | a\\-b |\n * ^\n * | | ---- |\n * | | c |\n * ```\n *\n * @type {State}\n */\n function headRowEscape(code) {\n if (code === 92 || code === 124) {\n effects.consume(code)\n return headRowData\n }\n return headRowData(code)\n }\n\n /**\n * Before delimiter row.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headDelimiterStart(code) {\n // Reset `interrupt`.\n self.interrupt = false\n\n // Note: in `markdown-rs`, we need to handle piercing here too.\n if (self.parser.lazy[self.now().line]) {\n return nok(code)\n }\n effects.enter('tableDelimiterRow')\n // Track if we’ve seen a `:` or `|`.\n seen = false\n if (markdownSpace(code)) {\n return factorySpace(\n effects,\n headDelimiterBefore,\n 'linePrefix',\n self.parser.constructs.disable.null.includes('codeIndented')\n ? undefined\n : 4\n )(code)\n }\n return headDelimiterBefore(code)\n }\n\n /**\n * Before delimiter row, after optional whitespace.\n *\n * Reused when a `|` is found later, to parse another cell.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * | | b |\n * ```\n *\n * @type {State}\n */\n function headDelimiterBefore(code) {\n if (code === 45 || code === 58) {\n return headDelimiterValueBefore(code)\n }\n if (code === 124) {\n seen = true\n // If we start with a pipe, we open a cell marker.\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n return headDelimiterCellBefore\n }\n\n // More whitespace / empty row not allowed at start.\n return headDelimiterNok(code)\n }\n\n /**\n * After `|`, before delimiter cell.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterCellBefore(code) {\n if (markdownSpace(code)) {\n return factorySpace(effects, headDelimiterValueBefore, 'whitespace')(code)\n }\n return headDelimiterValueBefore(code)\n }\n\n /**\n * Before delimiter cell value.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterValueBefore(code) {\n // Align: left.\n if (code === 58) {\n sizeB += 1\n seen = true\n effects.enter('tableDelimiterMarker')\n effects.consume(code)\n effects.exit('tableDelimiterMarker')\n return headDelimiterLeftAlignmentAfter\n }\n\n // Align: none.\n if (code === 45) {\n sizeB += 1\n // To do: seems weird that this *isn’t* left aligned, but that state is used?\n return headDelimiterLeftAlignmentAfter(code)\n }\n if (code === null || markdownLineEnding(code)) {\n return headDelimiterCellAfter(code)\n }\n return headDelimiterNok(code)\n }\n\n /**\n * After delimiter cell left alignment marker.\n *\n * ```markdown\n * | | a |\n * > | | :- |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterLeftAlignmentAfter(code) {\n if (code === 45) {\n effects.enter('tableDelimiterFiller')\n return headDelimiterFiller(code)\n }\n\n // Anything else is not ok after the left-align colon.\n return headDelimiterNok(code)\n }\n\n /**\n * In delimiter cell filler.\n *\n * ```markdown\n * | | a |\n * > | | - |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterFiller(code) {\n if (code === 45) {\n effects.consume(code)\n return headDelimiterFiller\n }\n\n // Align is `center` if it was `left`, `right` otherwise.\n if (code === 58) {\n seen = true\n effects.exit('tableDelimiterFiller')\n effects.enter('tableDelimiterMarker')\n effects.consume(code)\n effects.exit('tableDelimiterMarker')\n return headDelimiterRightAlignmentAfter\n }\n effects.exit('tableDelimiterFiller')\n return headDelimiterRightAlignmentAfter(code)\n }\n\n /**\n * After delimiter cell right alignment marker.\n *\n * ```markdown\n * | | a |\n * > | | -: |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterRightAlignmentAfter(code) {\n if (markdownSpace(code)) {\n return factorySpace(effects, headDelimiterCellAfter, 'whitespace')(code)\n }\n return headDelimiterCellAfter(code)\n }\n\n /**\n * After delimiter cell.\n *\n * ```markdown\n * | | a |\n * > | | -: |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterCellAfter(code) {\n if (code === 124) {\n return headDelimiterBefore(code)\n }\n if (code === null || markdownLineEnding(code)) {\n // Exit when:\n // * there was no `:` or `|` at all (it’s a thematic break or setext\n // underline instead)\n // * the header cell count is not the delimiter cell count\n if (!seen || size !== sizeB) {\n return headDelimiterNok(code)\n }\n\n // Note: in markdown-rs`, a reset is needed here.\n effects.exit('tableDelimiterRow')\n effects.exit('tableHead')\n // To do: in `markdown-rs`, resolvers need to be registered manually.\n // effects.register_resolver(ResolveName::GfmTable)\n return ok(code)\n }\n return headDelimiterNok(code)\n }\n\n /**\n * In delimiter row, at a disallowed byte.\n *\n * ```markdown\n * | | a |\n * > | | x |\n * ^\n * ```\n *\n * @type {State}\n */\n function headDelimiterNok(code) {\n // Note: in `markdown-rs`, we need to reset, in `micromark-js` we don‘t.\n return nok(code)\n }\n\n /**\n * Before table body row.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowStart(code) {\n // Note: in `markdown-rs` we need to manually take care of a prefix,\n // but in `micromark-js` that is done for us, so if we’re here, we’re\n // never at whitespace.\n effects.enter('tableRow')\n return bodyRowBreak(code)\n }\n\n /**\n * At break in table body row.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ^\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowBreak(code) {\n if (code === 124) {\n effects.enter('tableCellDivider')\n effects.consume(code)\n effects.exit('tableCellDivider')\n return bodyRowBreak\n }\n if (code === null || markdownLineEnding(code)) {\n effects.exit('tableRow')\n return ok(code)\n }\n if (markdownSpace(code)) {\n return factorySpace(effects, bodyRowBreak, 'whitespace')(code)\n }\n\n // Anything else is cell content.\n effects.enter('data')\n return bodyRowData(code)\n }\n\n /**\n * In table body row data.\n *\n * ```markdown\n * | | a |\n * | | - |\n * > | | b |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowData(code) {\n if (code === null || code === 124 || markdownLineEndingOrSpace(code)) {\n effects.exit('data')\n return bodyRowBreak(code)\n }\n effects.consume(code)\n return code === 92 ? bodyRowEscape : bodyRowData\n }\n\n /**\n * In table body row escape.\n *\n * ```markdown\n * | | a |\n * | | ---- |\n * > | | b\\-c |\n * ^\n * ```\n *\n * @type {State}\n */\n function bodyRowEscape(code) {\n if (code === 92 || code === 124) {\n effects.consume(code)\n return bodyRowData\n }\n return bodyRowData(code)\n }\n}\n\n/** @type {Resolver} */\n// eslint-disable-next-line complexity\nfunction resolveTable(events, context) {\n let index = -1\n let inFirstCellAwaitingPipe = true\n /** @type {RowKind} */\n let rowKind = 0\n /** @type {Range} */\n let lastCell = [0, 0, 0, 0]\n /** @type {Range} */\n let cell = [0, 0, 0, 0]\n let afterHeadAwaitingFirstBodyRow = false\n let lastTableEnd = 0\n /** @type {Token | undefined} */\n let currentTable\n /** @type {Token | undefined} */\n let currentBody\n /** @type {Token | undefined} */\n let currentCell\n const map = new EditMap()\n while (++index < events.length) {\n const event = events[index]\n const token = event[1]\n if (event[0] === 'enter') {\n // Start of head.\n if (token.type === 'tableHead') {\n afterHeadAwaitingFirstBodyRow = false\n\n // Inject previous (body end and) table end.\n if (lastTableEnd !== 0) {\n flushTableEnd(map, context, lastTableEnd, currentTable, currentBody)\n currentBody = undefined\n lastTableEnd = 0\n }\n\n // Inject table start.\n currentTable = {\n type: 'table',\n start: Object.assign({}, token.start),\n // Note: correct end is set later.\n end: Object.assign({}, token.end)\n }\n map.add(index, 0, [['enter', currentTable, context]])\n } else if (\n token.type === 'tableRow' ||\n token.type === 'tableDelimiterRow'\n ) {\n inFirstCellAwaitingPipe = true\n currentCell = undefined\n lastCell = [0, 0, 0, 0]\n cell = [0, index + 1, 0, 0]\n\n // Inject table body start.\n if (afterHeadAwaitingFirstBodyRow) {\n afterHeadAwaitingFirstBodyRow = false\n currentBody = {\n type: 'tableBody',\n start: Object.assign({}, token.start),\n // Note: correct end is set later.\n end: Object.assign({}, token.end)\n }\n map.add(index, 0, [['enter', currentBody, context]])\n }\n rowKind = token.type === 'tableDelimiterRow' ? 2 : currentBody ? 3 : 1\n }\n // Cell data.\n else if (\n rowKind &&\n (token.type === 'data' ||\n token.type === 'tableDelimiterMarker' ||\n token.type === 'tableDelimiterFiller')\n ) {\n inFirstCellAwaitingPipe = false\n\n // First value in cell.\n if (cell[2] === 0) {\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n undefined,\n currentCell\n )\n lastCell = [0, 0, 0, 0]\n }\n cell[2] = index\n }\n } else if (token.type === 'tableCellDivider') {\n if (inFirstCellAwaitingPipe) {\n inFirstCellAwaitingPipe = false\n } else {\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n undefined,\n currentCell\n )\n }\n lastCell = cell\n cell = [lastCell[1], index, 0, 0]\n }\n }\n }\n // Exit events.\n else if (token.type === 'tableHead') {\n afterHeadAwaitingFirstBodyRow = true\n lastTableEnd = index\n } else if (\n token.type === 'tableRow' ||\n token.type === 'tableDelimiterRow'\n ) {\n lastTableEnd = index\n if (lastCell[1] !== 0) {\n cell[0] = cell[1]\n currentCell = flushCell(\n map,\n context,\n lastCell,\n rowKind,\n index,\n currentCell\n )\n } else if (cell[1] !== 0) {\n currentCell = flushCell(map, context, cell, rowKind, index, currentCell)\n }\n rowKind = 0\n } else if (\n rowKind &&\n (token.type === 'data' ||\n token.type === 'tableDelimiterMarker' ||\n token.type === 'tableDelimiterFiller')\n ) {\n cell[3] = index\n }\n }\n if (lastTableEnd !== 0) {\n flushTableEnd(map, context, lastTableEnd, currentTable, currentBody)\n }\n map.consume(context.events)\n\n // To do: move this into `html`, when events are exposed there.\n // That’s what `markdown-rs` does.\n // That needs updates to `mdast-util-gfm-table`.\n index = -1\n while (++index < context.events.length) {\n const event = context.events[index]\n if (event[0] === 'enter' && event[1].type === 'table') {\n event[1]._align = gfmTableAlign(context.events, index)\n }\n }\n return events\n}\n\n/// Generate a cell.\n/**\n *\n * @param {EditMap} map\n * @param {TokenizeContext} context\n * @param {Range} range\n * @param {RowKind} rowKind\n * @param {number | undefined} rowEnd\n * @param {Token | undefined} previousCell\n * @returns {Token | undefined}\n */\n// eslint-disable-next-line max-params\nfunction flushCell(map, context, range, rowKind, rowEnd, previousCell) {\n // `markdown-rs` uses:\n // rowKind === 2 ? 'tableDelimiterCell' : 'tableCell'\n const groupName =\n rowKind === 1\n ? 'tableHeader'\n : rowKind === 2\n ? 'tableDelimiter'\n : 'tableData'\n // `markdown-rs` uses:\n // rowKind === 2 ? 'tableDelimiterCellValue' : 'tableCellText'\n const valueName = 'tableContent'\n\n // Insert an exit for the previous cell, if there is one.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- exit\n // ^^^^-- this cell\n // ```\n if (range[0] !== 0) {\n previousCell.end = Object.assign({}, getPoint(context.events, range[0]))\n map.add(range[0], 0, [['exit', previousCell, context]])\n }\n\n // Insert enter of this cell.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- enter\n // ^^^^-- this cell\n // ```\n const now = getPoint(context.events, range[1])\n previousCell = {\n type: groupName,\n start: Object.assign({}, now),\n // Note: correct end is set later.\n end: Object.assign({}, now)\n }\n map.add(range[1], 0, [['enter', previousCell, context]])\n\n // Insert text start at first data start and end at last data end, and\n // remove events between.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- enter\n // ^-- exit\n // ^^^^-- this cell\n // ```\n if (range[2] !== 0) {\n const relatedStart = getPoint(context.events, range[2])\n const relatedEnd = getPoint(context.events, range[3])\n /** @type {Token} */\n const valueToken = {\n type: valueName,\n start: Object.assign({}, relatedStart),\n end: Object.assign({}, relatedEnd)\n }\n map.add(range[2], 0, [['enter', valueToken, context]])\n if (rowKind !== 2) {\n // Fix positional info on remaining events\n const start = context.events[range[2]]\n const end = context.events[range[3]]\n start[1].end = Object.assign({}, end[1].end)\n start[1].type = 'chunkText'\n start[1].contentType = 'text'\n\n // Remove if needed.\n if (range[3] > range[2] + 1) {\n const a = range[2] + 1\n const b = range[3] - range[2] - 1\n map.add(a, b, [])\n }\n }\n map.add(range[3] + 1, 0, [['exit', valueToken, context]])\n }\n\n // Insert an exit for the last cell, if at the row end.\n //\n // ```markdown\n // > | | aa | bb | cc |\n // ^-- exit\n // ^^^^^^-- this cell (the last one contains two “between” parts)\n // ```\n if (rowEnd !== undefined) {\n previousCell.end = Object.assign({}, getPoint(context.events, rowEnd))\n map.add(rowEnd, 0, [['exit', previousCell, context]])\n previousCell = undefined\n }\n return previousCell\n}\n\n/**\n * Generate table end (and table body end).\n *\n * @param {EditMap} map\n * @param {TokenizeContext} context\n * @param {number} index\n * @param {Token} table\n * @param {Token | undefined} tableBody\n */\n// eslint-disable-next-line max-params\nfunction flushTableEnd(map, context, index, table, tableBody) {\n /** @type {Array} */\n const exits = []\n const related = getPoint(context.events, index)\n if (tableBody) {\n tableBody.end = Object.assign({}, related)\n exits.push(['exit', tableBody, context])\n }\n table.end = Object.assign({}, related)\n exits.push(['exit', table, context])\n map.add(index + 1, 0, exits)\n}\n\n/**\n * @param {Array} events\n * @param {number} index\n * @returns {readonly Point}\n */\nfunction getPoint(events, index) {\n const event = events[index]\n const side = event[0] === 'enter' ? 'start' : 'end'\n return event[1][side]\n}\n","/**\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').State} State\n * @typedef {import('micromark-util-types').TokenizeContext} TokenizeContext\n * @typedef {import('micromark-util-types').Tokenizer} Tokenizer\n */\n\nimport {factorySpace} from 'micromark-factory-space'\nimport {\n markdownLineEndingOrSpace,\n markdownLineEnding,\n markdownSpace\n} from 'micromark-util-character'\nconst tasklistCheck = {\n tokenize: tokenizeTasklistCheck\n}\n\n// To do: next major: expose function to make extension.\n\n/**\n * Extension for `micromark` that can be passed in `extensions`, to\n * enable GFM task list items syntax.\n *\n * @type {Extension}\n */\nexport const gfmTaskListItem = {\n text: {\n [91]: tasklistCheck\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction tokenizeTasklistCheck(effects, ok, nok) {\n const self = this\n return open\n\n /**\n * At start of task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function open(code) {\n if (\n // Exit if there’s stuff before.\n self.previous !== null ||\n // Exit if not in the first content that is the first child of a list\n // item.\n !self._gfmTasklistFirstContentOfListItem\n ) {\n return nok(code)\n }\n effects.enter('taskListCheck')\n effects.enter('taskListCheckMarker')\n effects.consume(code)\n effects.exit('taskListCheckMarker')\n return inside\n }\n\n /**\n * In task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function inside(code) {\n // Currently we match how GH works in files.\n // To match how GH works in comments, use `markdownSpace` (`[\\t ]`) instead\n // of `markdownLineEndingOrSpace` (`[\\t\\n\\r ]`).\n if (markdownLineEndingOrSpace(code)) {\n effects.enter('taskListCheckValueUnchecked')\n effects.consume(code)\n effects.exit('taskListCheckValueUnchecked')\n return close\n }\n if (code === 88 || code === 120) {\n effects.enter('taskListCheckValueChecked')\n effects.consume(code)\n effects.exit('taskListCheckValueChecked')\n return close\n }\n return nok(code)\n }\n\n /**\n * At close of task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function close(code) {\n if (code === 93) {\n effects.enter('taskListCheckMarker')\n effects.consume(code)\n effects.exit('taskListCheckMarker')\n effects.exit('taskListCheck')\n return after\n }\n return nok(code)\n }\n\n /**\n * @type {State}\n */\n function after(code) {\n // EOL in paragraph means there must be something else after it.\n if (markdownLineEnding(code)) {\n return ok(code)\n }\n\n // Space or tab?\n // Check what comes after.\n if (markdownSpace(code)) {\n return effects.check(\n {\n tokenize: spaceThenNonSpace\n },\n ok,\n nok\n )(code)\n }\n\n // EOF, or non-whitespace, both wrong.\n return nok(code)\n }\n}\n\n/**\n * @this {TokenizeContext}\n * @type {Tokenizer}\n */\nfunction spaceThenNonSpace(effects, ok, nok) {\n return factorySpace(effects, after, 'whitespace')\n\n /**\n * After whitespace, after task list item check.\n *\n * ```markdown\n * > | * [x] y.\n * ^\n * ```\n *\n * @type {State}\n */\n function after(code) {\n // EOF means there was nothing, so bad.\n // EOL means there’s content after it, so good.\n // Impossible to have more spaces.\n // Anything else is good.\n return code === null ? nok(code) : ok(code)\n }\n}\n","/**\n * @typedef {import('micromark-extension-gfm-footnote').HtmlOptions} HtmlOptions\n * @typedef {import('micromark-extension-gfm-strikethrough').Options} Options\n * @typedef {import('micromark-util-types').Extension} Extension\n * @typedef {import('micromark-util-types').HtmlExtension} HtmlExtension\n */\n\nimport {\n combineExtensions,\n combineHtmlExtensions\n} from 'micromark-util-combine-extensions'\nimport {\n gfmAutolinkLiteral,\n gfmAutolinkLiteralHtml\n} from 'micromark-extension-gfm-autolink-literal'\nimport {gfmFootnote, gfmFootnoteHtml} from 'micromark-extension-gfm-footnote'\nimport {\n gfmStrikethrough,\n gfmStrikethroughHtml\n} from 'micromark-extension-gfm-strikethrough'\nimport {gfmTable, gfmTableHtml} from 'micromark-extension-gfm-table'\nimport {gfmTagfilterHtml} from 'micromark-extension-gfm-tagfilter'\nimport {\n gfmTaskListItem,\n gfmTaskListItemHtml\n} from 'micromark-extension-gfm-task-list-item'\n\n/**\n * Create an extension for `micromark` to enable GFM syntax.\n *\n * @param {Options | null | undefined} [options]\n * Configuration (optional).\n *\n * Passed to `micromark-extens-gfm-strikethrough`.\n * @returns {Extension}\n * Extension for `micromark` that can be passed in `extensions` to enable GFM\n * syntax.\n */\nexport function gfm(options) {\n return combineExtensions([\n gfmAutolinkLiteral,\n gfmFootnote(),\n gfmStrikethrough(options),\n gfmTable,\n gfmTaskListItem\n ])\n}\n\n/**\n * Create an extension for `micromark` to support GFM when serializing to HTML.\n *\n * @param {HtmlOptions | null | undefined} [options]\n * Configuration.\n *\n * Passed to `micromark-extens-gfm-footnote`.\n * @returns {HtmlExtension}\n * Extension for `micromark` that can be passed in `htmlExtensions` to\n * support GFM when serializing to HTML.\n */\nexport function gfmHtml(options) {\n return combineHtmlExtensions([\n gfmAutolinkLiteralHtml,\n gfmFootnoteHtml(options),\n gfmStrikethroughHtml,\n gfmTableHtml,\n gfmTagfilterHtml,\n gfmTaskListItemHtml\n ])\n}\n","export default function escapeStringRegexp(string) {\n\tif (typeof string !== 'string') {\n\t\tthrow new TypeError('Expected a string');\n\t}\n\n\t// Escape characters with special meaning either inside or outside character sets.\n\t// Use a simple backslash escape when it’s always valid, and a `\\xnn` escape when the simpler form would be disallowed by Unicode patterns’ stricter grammar.\n\treturn string\n\t\t.replace(/[|\\\\{}()[\\]^$+*?.]/g, '\\\\$&')\n\t\t.replace(/-/g, '\\\\x2d');\n}\n","/**\n * @typedef {import('mdast').Parent} MdastParent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n * @typedef {import('mdast').Text} Text\n * @typedef {import('unist-util-visit-parents').Test} Test\n * @typedef {import('unist-util-visit-parents').VisitorResult} VisitorResult\n */\n\n/**\n * @typedef {Content | Root} Node\n * @typedef {Extract} Parent\n * @typedef {Exclude} ContentParent\n *\n * @typedef RegExpMatchObject\n * Info on the match.\n * @property {number} index\n * The index of the search at which the result was found.\n * @property {string} input\n * A copy of the search string in the text node.\n * @property {[Root, ...Array, Text]} stack\n * All ancestors of the text node, where the last node is the text itself.\n *\n * @callback ReplaceFunction\n * Callback called when a search matches.\n * @param {...any} parameters\n * The parameters are the result of corresponding search expression:\n *\n * * `value` (`string`) — whole match\n * * `...capture` (`Array`) — matches from regex capture groups\n * * `match` (`RegExpMatchObject`) — info on the match\n * @returns {Array | PhrasingContent | string | false | undefined | null}\n * Thing to replace with.\n *\n * * when `null`, `undefined`, `''`, remove the match\n * * …or when `false`, do not replace at all\n * * …or when `string`, replace with a text node of that value\n * * …or when `Node` or `Array`, replace with those nodes\n *\n * @typedef {string | RegExp} Find\n * Pattern to find.\n *\n * Strings are escaped and then turned into global expressions.\n *\n * @typedef {Array} FindAndReplaceList\n * Several find and replaces, in array form.\n * @typedef {Record} FindAndReplaceSchema\n * Several find and replaces, in object form.\n * @typedef {[Find, Replace]} FindAndReplaceTuple\n * Find and replace in tuple form.\n * @typedef {string | ReplaceFunction} Replace\n * Thing to replace with.\n * @typedef {[RegExp, ReplaceFunction]} Pair\n * Normalized find and replace.\n * @typedef {Array} Pairs\n * All find and replaced.\n *\n * @typedef Options\n * Configuration.\n * @property {Test | null | undefined} [ignore]\n * Test for which nodes to ignore.\n */\n\nimport escape from 'escape-string-regexp'\nimport {visitParents} from 'unist-util-visit-parents'\nimport {convert} from 'unist-util-is'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Find patterns in a tree and replace them.\n *\n * The algorithm searches the tree in *preorder* for complete values in `Text`\n * nodes.\n * Partial matches are not supported.\n *\n * @param tree\n * Tree to change.\n * @param find\n * Patterns to find.\n * @param replace\n * Things to replace with (when `find` is `Find`) or configuration.\n * @param options\n * Configuration (when `find` is not `Find`).\n * @returns\n * Given, modified, tree.\n */\n// To do: next major: remove `find` & `replace` combo, remove schema.\nexport const findAndReplace =\n /**\n * @type {(\n * ((tree: Tree, find: Find, replace?: Replace | null | undefined, options?: Options | null | undefined) => Tree) &\n * ((tree: Tree, schema: FindAndReplaceSchema | FindAndReplaceList, options?: Options | null | undefined) => Tree)\n * )}\n **/\n (\n /**\n * @template {Node} Tree\n * @param {Tree} tree\n * @param {Find | FindAndReplaceSchema | FindAndReplaceList} find\n * @param {Replace | Options | null | undefined} [replace]\n * @param {Options | null | undefined} [options]\n * @returns {Tree}\n */\n function (tree, find, replace, options) {\n /** @type {Options | null | undefined} */\n let settings\n /** @type {FindAndReplaceSchema|FindAndReplaceList} */\n let schema\n\n if (typeof find === 'string' || find instanceof RegExp) {\n // @ts-expect-error don’t expect options twice.\n schema = [[find, replace]]\n settings = options\n } else {\n schema = find\n // @ts-expect-error don’t expect replace twice.\n settings = replace\n }\n\n if (!settings) {\n settings = {}\n }\n\n const ignored = convert(settings.ignore || [])\n const pairs = toPairs(schema)\n let pairIndex = -1\n\n while (++pairIndex < pairs.length) {\n visitParents(tree, 'text', visitor)\n }\n\n // To do next major: don’t return the given tree.\n return tree\n\n /** @type {import('unist-util-visit-parents/complex-types.js').BuildVisitor} */\n function visitor(node, parents) {\n let index = -1\n /** @type {Parent | undefined} */\n let grandparent\n\n while (++index < parents.length) {\n const parent = parents[index]\n\n if (\n ignored(\n parent,\n // @ts-expect-error: TS doesn’t understand but it’s perfect.\n grandparent ? grandparent.children.indexOf(parent) : undefined,\n grandparent\n )\n ) {\n return\n }\n\n grandparent = parent\n }\n\n if (grandparent) {\n return handler(node, parents)\n }\n }\n\n /**\n * Handle a text node which is not in an ignored parent.\n *\n * @param {Text} node\n * Text node.\n * @param {Array} parents\n * Parents.\n * @returns {VisitorResult}\n * Result.\n */\n function handler(node, parents) {\n const parent = parents[parents.length - 1]\n const find = pairs[pairIndex][0]\n const replace = pairs[pairIndex][1]\n let start = 0\n // @ts-expect-error: TS is wrong, some of these children can be text.\n const index = parent.children.indexOf(node)\n let change = false\n /** @type {Array} */\n let nodes = []\n\n find.lastIndex = 0\n\n let match = find.exec(node.value)\n\n while (match) {\n const position = match.index\n /** @type {RegExpMatchObject} */\n const matchObject = {\n index: match.index,\n input: match.input,\n // @ts-expect-error: stack is fine.\n stack: [...parents, node]\n }\n let value = replace(...match, matchObject)\n\n if (typeof value === 'string') {\n value = value.length > 0 ? {type: 'text', value} : undefined\n }\n\n // It wasn’t a match after all.\n if (value !== false) {\n if (start !== position) {\n nodes.push({\n type: 'text',\n value: node.value.slice(start, position)\n })\n }\n\n if (Array.isArray(value)) {\n nodes.push(...value)\n } else if (value) {\n nodes.push(value)\n }\n\n start = position + match[0].length\n change = true\n }\n\n if (!find.global) {\n break\n }\n\n match = find.exec(node.value)\n }\n\n if (change) {\n if (start < node.value.length) {\n nodes.push({type: 'text', value: node.value.slice(start)})\n }\n\n parent.children.splice(index, 1, ...nodes)\n } else {\n nodes = [node]\n }\n\n return index + nodes.length\n }\n }\n )\n\n/**\n * Turn a schema into pairs.\n *\n * @param {FindAndReplaceSchema | FindAndReplaceList} schema\n * Schema.\n * @returns {Pairs}\n * Clean pairs.\n */\nfunction toPairs(schema) {\n /** @type {Pairs} */\n const result = []\n\n if (typeof schema !== 'object') {\n throw new TypeError('Expected array or object as schema')\n }\n\n if (Array.isArray(schema)) {\n let index = -1\n\n while (++index < schema.length) {\n result.push([\n toExpression(schema[index][0]),\n toFunction(schema[index][1])\n ])\n }\n } else {\n /** @type {string} */\n let key\n\n for (key in schema) {\n if (own.call(schema, key)) {\n result.push([toExpression(key), toFunction(schema[key])])\n }\n }\n }\n\n return result\n}\n\n/**\n * Turn a find into an expression.\n *\n * @param {Find} find\n * Find.\n * @returns {RegExp}\n * Expression.\n */\nfunction toExpression(find) {\n return typeof find === 'string' ? new RegExp(escape(find), 'g') : find\n}\n\n/**\n * Turn a replace into a function.\n *\n * @param {Replace} replace\n * Replace.\n * @returns {ReplaceFunction}\n * Function.\n */\nfunction toFunction(replace) {\n return typeof replace === 'function' ? replace : () => replace\n}\n","/**\n * @typedef {import('mdast').Link} Link\n * @typedef {import('mdast').PhrasingContent} PhrasingContent\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-from-markdown').Transform} FromMarkdownTransform\n *\n * @typedef {import('mdast-util-to-markdown').ConstructName} ConstructName\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n *\n * @typedef {import('mdast-util-find-and-replace').ReplaceFunction} ReplaceFunction\n * @typedef {import('mdast-util-find-and-replace').RegExpMatchObject} RegExpMatchObject\n */\n\nimport {ccount} from 'ccount'\nimport {findAndReplace} from 'mdast-util-find-and-replace'\nimport {unicodePunctuation, unicodeWhitespace} from 'micromark-util-character'\n\n/** @type {ConstructName} */\nconst inConstruct = 'phrasing'\n/** @type {Array} */\nconst notInConstruct = ['autolink', 'link', 'image', 'label']\n\n// To do: next major: expose functions instead of extensions.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM autolink literals.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmAutolinkLiteralFromMarkdown = {\n transforms: [transformGfmAutolinkLiterals],\n enter: {\n literalAutolink: enterLiteralAutolink,\n literalAutolinkEmail: enterLiteralAutolinkValue,\n literalAutolinkHttp: enterLiteralAutolinkValue,\n literalAutolinkWww: enterLiteralAutolinkValue\n },\n exit: {\n literalAutolink: exitLiteralAutolink,\n literalAutolinkEmail: exitLiteralAutolinkEmail,\n literalAutolinkHttp: exitLiteralAutolinkHttp,\n literalAutolinkWww: exitLiteralAutolinkWww\n }\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM autolink literals.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmAutolinkLiteralToMarkdown = {\n unsafe: [\n {\n character: '@',\n before: '[+\\\\-.\\\\w]',\n after: '[\\\\-.\\\\w]',\n inConstruct,\n notInConstruct\n },\n {\n character: '.',\n before: '[Ww]',\n after: '[\\\\-.\\\\w]',\n inConstruct,\n notInConstruct\n },\n {character: ':', before: '[ps]', after: '\\\\/', inConstruct, notInConstruct}\n ]\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterLiteralAutolink(token) {\n this.enter({type: 'link', title: null, url: '', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterLiteralAutolinkValue(token) {\n this.config.enter.autolinkProtocol.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkHttp(token) {\n this.config.exit.autolinkProtocol.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkWww(token) {\n this.config.exit.data.call(this, token)\n const node = /** @type {Link} */ (this.stack[this.stack.length - 1])\n node.url = 'http://' + this.sliceSerialize(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolinkEmail(token) {\n this.config.exit.autolinkEmail.call(this, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitLiteralAutolink(token) {\n this.exit(token)\n}\n\n/** @type {FromMarkdownTransform} */\nfunction transformGfmAutolinkLiterals(tree) {\n findAndReplace(\n tree,\n [\n [/(https?:\\/\\/|www(?=\\.))([-.\\w]+)([^ \\t\\r\\n]*)/gi, findUrl],\n [/([-.\\w+]+)@([-\\w]+(?:\\.[-\\w]+)+)/g, findEmail]\n ],\n {ignore: ['link', 'linkReference']}\n )\n}\n\n/**\n * @type {ReplaceFunction}\n * @param {string} _\n * @param {string} protocol\n * @param {string} domain\n * @param {string} path\n * @param {RegExpMatchObject} match\n * @returns {Link | Array | false}\n */\n// eslint-disable-next-line max-params\nfunction findUrl(_, protocol, domain, path, match) {\n let prefix = ''\n\n // Not an expected previous character.\n if (!previous(match)) {\n return false\n }\n\n // Treat `www` as part of the domain.\n if (/^w/i.test(protocol)) {\n domain = protocol + domain\n protocol = ''\n prefix = 'http://'\n }\n\n if (!isCorrectDomain(domain)) {\n return false\n }\n\n const parts = splitUrl(domain + path)\n\n if (!parts[0]) return false\n\n /** @type {Link} */\n const result = {\n type: 'link',\n title: null,\n url: prefix + protocol + parts[0],\n children: [{type: 'text', value: protocol + parts[0]}]\n }\n\n if (parts[1]) {\n return [result, {type: 'text', value: parts[1]}]\n }\n\n return result\n}\n\n/**\n * @type {ReplaceFunction}\n * @param {string} _\n * @param {string} atext\n * @param {string} label\n * @param {RegExpMatchObject} match\n * @returns {Link | false}\n */\nfunction findEmail(_, atext, label, match) {\n if (\n // Not an expected previous character.\n !previous(match, true) ||\n // Label ends in not allowed character.\n /[-\\d_]$/.test(label)\n ) {\n return false\n }\n\n return {\n type: 'link',\n title: null,\n url: 'mailto:' + atext + '@' + label,\n children: [{type: 'text', value: atext + '@' + label}]\n }\n}\n\n/**\n * @param {string} domain\n * @returns {boolean}\n */\nfunction isCorrectDomain(domain) {\n const parts = domain.split('.')\n\n if (\n parts.length < 2 ||\n (parts[parts.length - 1] &&\n (/_/.test(parts[parts.length - 1]) ||\n !/[a-zA-Z\\d]/.test(parts[parts.length - 1]))) ||\n (parts[parts.length - 2] &&\n (/_/.test(parts[parts.length - 2]) ||\n !/[a-zA-Z\\d]/.test(parts[parts.length - 2])))\n ) {\n return false\n }\n\n return true\n}\n\n/**\n * @param {string} url\n * @returns {[string, string | undefined]}\n */\nfunction splitUrl(url) {\n const trailExec = /[!\"&'),.:;<>?\\]}]+$/.exec(url)\n\n if (!trailExec) {\n return [url, undefined]\n }\n\n url = url.slice(0, trailExec.index)\n\n let trail = trailExec[0]\n let closingParenIndex = trail.indexOf(')')\n const openingParens = ccount(url, '(')\n let closingParens = ccount(url, ')')\n\n while (closingParenIndex !== -1 && openingParens > closingParens) {\n url += trail.slice(0, closingParenIndex + 1)\n trail = trail.slice(closingParenIndex + 1)\n closingParenIndex = trail.indexOf(')')\n closingParens++\n }\n\n return [url, trail]\n}\n\n/**\n * @param {RegExpMatchObject} match\n * @param {boolean | null | undefined} [email=false]\n * @returns {boolean}\n */\nfunction previous(match, email) {\n const code = match.input.charCodeAt(match.index - 1)\n\n return (\n (match.index === 0 ||\n unicodeWhitespace(code) ||\n unicodePunctuation(code)) &&\n (!email || code !== 47)\n )\n}\n","/**\n * @typedef {import('mdast').FootnoteReference} FootnoteReference\n * @typedef {import('mdast').FootnoteDefinition} FootnoteDefinition\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Map} Map\n */\n\nimport {normalizeIdentifier} from 'micromark-util-normalize-identifier'\nimport {association} from 'mdast-util-to-markdown/lib/util/association.js'\nimport {containerFlow} from 'mdast-util-to-markdown/lib/util/container-flow.js'\nimport {indentLines} from 'mdast-util-to-markdown/lib/util/indent-lines.js'\nimport {safe} from 'mdast-util-to-markdown/lib/util/safe.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\nfootnoteReference.peek = footnoteReferencePeek\n\n// To do: next major: rename `context` -> `state`, `safeOptions` to `info`, use\n// utilities on `state`.\n\n/**\n * Create an extension for `mdast-util-from-markdown` to enable GFM footnotes\n * in markdown.\n *\n * @returns {FromMarkdownExtension}\n * Extension for `mdast-util-from-markdown`.\n */\nexport function gfmFootnoteFromMarkdown() {\n return {\n enter: {\n gfmFootnoteDefinition: enterFootnoteDefinition,\n gfmFootnoteDefinitionLabelString: enterFootnoteDefinitionLabelString,\n gfmFootnoteCall: enterFootnoteCall,\n gfmFootnoteCallString: enterFootnoteCallString\n },\n exit: {\n gfmFootnoteDefinition: exitFootnoteDefinition,\n gfmFootnoteDefinitionLabelString: exitFootnoteDefinitionLabelString,\n gfmFootnoteCall: exitFootnoteCall,\n gfmFootnoteCallString: exitFootnoteCallString\n }\n }\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM footnotes\n * in markdown.\n *\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown`.\n */\nexport function gfmFootnoteToMarkdown() {\n return {\n // This is on by default already.\n unsafe: [{character: '[', inConstruct: ['phrasing', 'label', 'reference']}],\n handlers: {footnoteDefinition, footnoteReference}\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteDefinition(token) {\n this.enter(\n {type: 'footnoteDefinition', identifier: '', label: '', children: []},\n token\n )\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteDefinitionLabelString() {\n this.buffer()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteDefinitionLabelString(token) {\n const label = this.resume()\n const node = /** @type {FootnoteDefinition} */ (\n this.stack[this.stack.length - 1]\n )\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteDefinition(token) {\n this.exit(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteCall(token) {\n this.enter({type: 'footnoteReference', identifier: '', label: ''}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterFootnoteCallString() {\n this.buffer()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteCallString(token) {\n const label = this.resume()\n const node = /** @type {FootnoteDefinition} */ (\n this.stack[this.stack.length - 1]\n )\n node.label = label\n node.identifier = normalizeIdentifier(\n this.sliceSerialize(token)\n ).toLowerCase()\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitFootnoteCall(token) {\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {FootnoteReference} node\n */\nfunction footnoteReference(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n let value = tracker.move('[^')\n const exit = context.enter('footnoteReference')\n const subexit = context.enter('reference')\n value += tracker.move(\n safe(context, association(node), {\n ...tracker.current(),\n before: value,\n after: ']'\n })\n )\n subexit()\n exit()\n value += tracker.move(']')\n return value\n}\n\n/** @type {ToMarkdownHandle} */\nfunction footnoteReferencePeek() {\n return '['\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {FootnoteDefinition} node\n */\nfunction footnoteDefinition(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n let value = tracker.move('[^')\n const exit = context.enter('footnoteDefinition')\n const subexit = context.enter('label')\n value += tracker.move(\n safe(context, association(node), {\n ...tracker.current(),\n before: value,\n after: ']'\n })\n )\n subexit()\n value += tracker.move(\n ']:' + (node.children && node.children.length > 0 ? ' ' : '')\n )\n tracker.shift(4)\n value += tracker.move(\n indentLines(containerFlow(node, context, tracker.current()), map)\n )\n exit()\n\n return value\n}\n\n/** @type {Map} */\nfunction map(line, index, blank) {\n if (index === 0) {\n return line\n }\n\n return (blank ? '' : ' ') + line\n}\n","/**\n * @typedef {import('mdast').Delete} Delete\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n *\n * @typedef {import('mdast-util-to-markdown').ConstructName} ConstructName\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n */\n\nimport {containerPhrasing} from 'mdast-util-to-markdown/lib/util/container-phrasing.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\n// To do: next major: expose functions.\n// To do: next major: use `state`, state utilities.\n\n/**\n * List of constructs that occur in phrasing (paragraphs, headings), but cannot\n * contain strikethrough.\n * So they sort of cancel each other out.\n * Note: could use a better name.\n *\n * Note: keep in sync with: \n *\n * @type {Array}\n */\nconst constructsWithoutStrikethrough = [\n 'autolink',\n 'destinationLiteral',\n 'destinationRaw',\n 'reference',\n 'titleQuote',\n 'titleApostrophe'\n]\n\nhandleDelete.peek = peekDelete\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM strikethrough.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmStrikethroughFromMarkdown = {\n canContainEols: ['delete'],\n enter: {strikethrough: enterStrikethrough},\n exit: {strikethrough: exitStrikethrough}\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM strikethrough.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmStrikethroughToMarkdown = {\n unsafe: [\n {\n character: '~',\n inConstruct: 'phrasing',\n notInConstruct: constructsWithoutStrikethrough\n }\n ],\n handlers: {delete: handleDelete}\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterStrikethrough(token) {\n this.enter({type: 'delete', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitStrikethrough(token) {\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {Delete} node\n */\nfunction handleDelete(node, _, context, safeOptions) {\n const tracker = track(safeOptions)\n const exit = context.enter('strikethrough')\n let value = tracker.move('~~')\n value += containerPhrasing(node, context, {\n ...tracker.current(),\n before: value,\n after: '~'\n })\n value += tracker.move('~~')\n exit()\n return value\n}\n\n/** @type {ToMarkdownHandle} */\nfunction peekDelete() {\n return '~'\n}\n","// To do: next major: remove.\n/**\n * @typedef {Options} MarkdownTableOptions\n * Configuration.\n */\n\n/**\n * @typedef Options\n * Configuration.\n * @property {boolean | null | undefined} [alignDelimiters=true]\n * Whether to align the delimiters (default: `true`);\n * they are aligned by default:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * Pass `false` to make them staggered:\n *\n * ```markdown\n * | Alpha | B |\n * | - | - |\n * | C | Delta |\n * ```\n * @property {ReadonlyArray | string | null | undefined} [align]\n * How to align columns (default: `''`);\n * one style for all columns or styles for their respective columns;\n * each style is either `'l'` (left), `'r'` (right), or `'c'` (center);\n * other values are treated as `''`, which doesn’t place the colon in the\n * alignment row but does align left;\n * *only the lowercased first character is used, so `Right` is fine.*\n * @property {boolean | null | undefined} [delimiterEnd=true]\n * Whether to end each row with the delimiter (default: `true`).\n *\n * > 👉 **Note**: please don’t use this: it could create fragile structures\n * > that aren’t understandable to some markdown parsers.\n *\n * When `true`, there are ending delimiters:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there are no ending delimiters:\n *\n * ```markdown\n * | Alpha | B\n * | ----- | -----\n * | C | Delta\n * ```\n * @property {boolean | null | undefined} [delimiterStart=true]\n * Whether to begin each row with the delimiter (default: `true`).\n *\n * > 👉 **Note**: please don’t use this: it could create fragile structures\n * > that aren’t understandable to some markdown parsers.\n *\n * When `true`, there are starting delimiters:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there are no starting delimiters:\n *\n * ```markdown\n * Alpha | B |\n * ----- | ----- |\n * C | Delta |\n * ```\n * @property {boolean | null | undefined} [padding=true]\n * Whether to add a space of padding between delimiters and cells\n * (default: `true`).\n *\n * When `true`, there is padding:\n *\n * ```markdown\n * | Alpha | B |\n * | ----- | ----- |\n * | C | Delta |\n * ```\n *\n * When `false`, there is no padding:\n *\n * ```markdown\n * |Alpha|B |\n * |-----|-----|\n * |C |Delta|\n * ```\n * @property {((value: string) => number) | null | undefined} [stringLength]\n * Function to detect the length of table cell content (optional);\n * this is used when aligning the delimiters (`|`) between table cells;\n * full-width characters and emoji mess up delimiter alignment when viewing\n * the markdown source;\n * to fix this, you can pass this function,\n * which receives the cell content and returns its “visible” size;\n * note that what is and isn’t visible depends on where the text is displayed.\n *\n * Without such a function, the following:\n *\n * ```js\n * markdownTable([\n * ['Alpha', 'Bravo'],\n * ['中文', 'Charlie'],\n * ['👩‍❤️‍👩', 'Delta']\n * ])\n * ```\n *\n * Yields:\n *\n * ```markdown\n * | Alpha | Bravo |\n * | - | - |\n * | 中文 | Charlie |\n * | 👩‍❤️‍👩 | Delta |\n * ```\n *\n * With [`string-width`](https://github.com/sindresorhus/string-width):\n *\n * ```js\n * import stringWidth from 'string-width'\n *\n * markdownTable(\n * [\n * ['Alpha', 'Bravo'],\n * ['中文', 'Charlie'],\n * ['👩‍❤️‍👩', 'Delta']\n * ],\n * {stringLength: stringWidth}\n * )\n * ```\n *\n * Yields:\n *\n * ```markdown\n * | Alpha | Bravo |\n * | ----- | ------- |\n * | 中文 | Charlie |\n * | 👩‍❤️‍👩 | Delta |\n * ```\n */\n\n/**\n * @param {string} value\n * Cell value.\n * @returns {number}\n * Cell size.\n */\nfunction defaultStringLength(value) {\n return value.length\n}\n\n/**\n * Generate a markdown\n * ([GFM](https://docs.github.com/en/github/writing-on-github/working-with-advanced-formatting/organizing-information-with-tables))\n * table.\n *\n * @param {ReadonlyArray>} table\n * Table data (matrix of strings).\n * @param {Readonly | null | undefined} [options]\n * Configuration (optional).\n * @returns {string}\n * Result.\n */\nexport function markdownTable(table, options) {\n const settings = options || {}\n // To do: next major: change to spread.\n const align = (settings.align || []).concat()\n const stringLength = settings.stringLength || defaultStringLength\n /** @type {Array} Character codes as symbols for alignment per column. */\n const alignments = []\n /** @type {Array>} Cells per row. */\n const cellMatrix = []\n /** @type {Array>} Sizes of each cell per row. */\n const sizeMatrix = []\n /** @type {Array} */\n const longestCellByColumn = []\n let mostCellsPerRow = 0\n let rowIndex = -1\n\n // This is a superfluous loop if we don’t align delimiters, but otherwise we’d\n // do superfluous work when aligning, so optimize for aligning.\n while (++rowIndex < table.length) {\n /** @type {Array} */\n const row = []\n /** @type {Array} */\n const sizes = []\n let columnIndex = -1\n\n if (table[rowIndex].length > mostCellsPerRow) {\n mostCellsPerRow = table[rowIndex].length\n }\n\n while (++columnIndex < table[rowIndex].length) {\n const cell = serialize(table[rowIndex][columnIndex])\n\n if (settings.alignDelimiters !== false) {\n const size = stringLength(cell)\n sizes[columnIndex] = size\n\n if (\n longestCellByColumn[columnIndex] === undefined ||\n size > longestCellByColumn[columnIndex]\n ) {\n longestCellByColumn[columnIndex] = size\n }\n }\n\n row.push(cell)\n }\n\n cellMatrix[rowIndex] = row\n sizeMatrix[rowIndex] = sizes\n }\n\n // Figure out which alignments to use.\n let columnIndex = -1\n\n if (typeof align === 'object' && 'length' in align) {\n while (++columnIndex < mostCellsPerRow) {\n alignments[columnIndex] = toAlignment(align[columnIndex])\n }\n } else {\n const code = toAlignment(align)\n\n while (++columnIndex < mostCellsPerRow) {\n alignments[columnIndex] = code\n }\n }\n\n // Inject the alignment row.\n columnIndex = -1\n /** @type {Array} */\n const row = []\n /** @type {Array} */\n const sizes = []\n\n while (++columnIndex < mostCellsPerRow) {\n const code = alignments[columnIndex]\n let before = ''\n let after = ''\n\n if (code === 99 /* `c` */) {\n before = ':'\n after = ':'\n } else if (code === 108 /* `l` */) {\n before = ':'\n } else if (code === 114 /* `r` */) {\n after = ':'\n }\n\n // There *must* be at least one hyphen-minus in each alignment cell.\n let size =\n settings.alignDelimiters === false\n ? 1\n : Math.max(\n 1,\n longestCellByColumn[columnIndex] - before.length - after.length\n )\n\n const cell = before + '-'.repeat(size) + after\n\n if (settings.alignDelimiters !== false) {\n size = before.length + size + after.length\n\n if (size > longestCellByColumn[columnIndex]) {\n longestCellByColumn[columnIndex] = size\n }\n\n sizes[columnIndex] = size\n }\n\n row[columnIndex] = cell\n }\n\n // Inject the alignment row.\n cellMatrix.splice(1, 0, row)\n sizeMatrix.splice(1, 0, sizes)\n\n rowIndex = -1\n /** @type {Array} */\n const lines = []\n\n while (++rowIndex < cellMatrix.length) {\n const row = cellMatrix[rowIndex]\n const sizes = sizeMatrix[rowIndex]\n columnIndex = -1\n /** @type {Array} */\n const line = []\n\n while (++columnIndex < mostCellsPerRow) {\n const cell = row[columnIndex] || ''\n let before = ''\n let after = ''\n\n if (settings.alignDelimiters !== false) {\n const size =\n longestCellByColumn[columnIndex] - (sizes[columnIndex] || 0)\n const code = alignments[columnIndex]\n\n if (code === 114 /* `r` */) {\n before = ' '.repeat(size)\n } else if (code === 99 /* `c` */) {\n if (size % 2) {\n before = ' '.repeat(size / 2 + 0.5)\n after = ' '.repeat(size / 2 - 0.5)\n } else {\n before = ' '.repeat(size / 2)\n after = before\n }\n } else {\n after = ' '.repeat(size)\n }\n }\n\n if (settings.delimiterStart !== false && !columnIndex) {\n line.push('|')\n }\n\n if (\n settings.padding !== false &&\n // Don’t add the opening space if we’re not aligning and the cell is\n // empty: there will be a closing space.\n !(settings.alignDelimiters === false && cell === '') &&\n (settings.delimiterStart !== false || columnIndex)\n ) {\n line.push(' ')\n }\n\n if (settings.alignDelimiters !== false) {\n line.push(before)\n }\n\n line.push(cell)\n\n if (settings.alignDelimiters !== false) {\n line.push(after)\n }\n\n if (settings.padding !== false) {\n line.push(' ')\n }\n\n if (\n settings.delimiterEnd !== false ||\n columnIndex !== mostCellsPerRow - 1\n ) {\n line.push('|')\n }\n }\n\n lines.push(\n settings.delimiterEnd === false\n ? line.join('').replace(/ +$/, '')\n : line.join('')\n )\n }\n\n return lines.join('\\n')\n}\n\n/**\n * @param {string | null | undefined} [value]\n * Value to serialize.\n * @returns {string}\n * Result.\n */\nfunction serialize(value) {\n return value === null || value === undefined ? '' : String(value)\n}\n\n/**\n * @param {string | null | undefined} value\n * Value.\n * @returns {number}\n * Alignment.\n */\nfunction toAlignment(value) {\n const code = typeof value === 'string' ? value.codePointAt(0) : 0\n\n return code === 67 /* `C` */ || code === 99 /* `c` */\n ? 99 /* `c` */\n : code === 76 /* `L` */ || code === 108 /* `l` */\n ? 108 /* `l` */\n : code === 82 /* `R` */ || code === 114 /* `r` */\n ? 114 /* `r` */\n : 0\n}\n","/**\n * @typedef {import('mdast').Table} Table\n * @typedef {import('mdast').TableRow} TableRow\n * @typedef {import('mdast').TableCell} TableCell\n * @typedef {import('mdast').InlineCode} InlineCode\n *\n * @typedef {import('markdown-table').MarkdownTableOptions} MarkdownTableOptions\n *\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n *\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Context} ToMarkdownContext\n * @typedef {import('mdast-util-to-markdown').SafeOptions} SafeOptions\n */\n\n/**\n * @typedef Options\n * Configuration.\n * @property {boolean | null | undefined} [tableCellPadding=true]\n * Whether to add a space of padding between delimiters and cells.\n * @property {boolean | null | undefined} [tablePipeAlign=true]\n * Whether to align the delimiters.\n * @property {MarkdownTableOptions['stringLength'] | null | undefined} [stringLength]\n * Function to detect the length of table cell content, used when aligning\n * the delimiters between cells\n */\n\nimport {containerPhrasing} from 'mdast-util-to-markdown/lib/util/container-phrasing.js'\nimport {inlineCode} from 'mdast-util-to-markdown/lib/handle/inline-code.js'\nimport {markdownTable} from 'markdown-table'\n\n// To do: next major: use `state` and `state` utilities from `mdast-util-to-markdown`.\n// To do: next major: use `defaultHandlers.inlineCode`.\n// To do: next major: expose functions.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM tables.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmTableFromMarkdown = {\n enter: {\n table: enterTable,\n tableData: enterCell,\n tableHeader: enterCell,\n tableRow: enterRow\n },\n exit: {\n codeText: exitCodeText,\n table: exitTable,\n tableData: exit,\n tableHeader: exit,\n tableRow: exit\n }\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterTable(token) {\n /** @type {Array<'left' | 'right' | 'center' | 'none'>} */\n // @ts-expect-error: `align` is custom.\n const align = token._align\n this.enter(\n {\n type: 'table',\n align: align.map((d) => (d === 'none' ? null : d)),\n children: []\n },\n token\n )\n this.setData('inTable', true)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitTable(token) {\n this.exit(token)\n this.setData('inTable')\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterRow(token) {\n this.enter({type: 'tableRow', children: []}, token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exit(token) {\n this.exit(token)\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction enterCell(token) {\n this.enter({type: 'tableCell', children: []}, token)\n}\n\n// Overwrite the default code text data handler to unescape escaped pipes when\n// they are in tables.\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitCodeText(token) {\n let value = this.resume()\n\n if (this.getData('inTable')) {\n value = value.replace(/\\\\([\\\\|])/g, replace)\n }\n\n const node = /** @type {InlineCode} */ (this.stack[this.stack.length - 1])\n node.value = value\n this.exit(token)\n}\n\n/**\n * @param {string} $0\n * @param {string} $1\n * @returns {string}\n */\nfunction replace($0, $1) {\n // Pipes work, backslashes don’t (but can’t escape pipes).\n return $1 === '|' ? $1 : $0\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM tables in\n * markdown.\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown` to enable GFM tables.\n */\nexport function gfmTableToMarkdown(options) {\n const settings = options || {}\n const padding = settings.tableCellPadding\n const alignDelimiters = settings.tablePipeAlign\n const stringLength = settings.stringLength\n const around = padding ? ' ' : '|'\n\n return {\n unsafe: [\n {character: '\\r', inConstruct: 'tableCell'},\n {character: '\\n', inConstruct: 'tableCell'},\n // A pipe, when followed by a tab or space (padding), or a dash or colon\n // (unpadded delimiter row), could result in a table.\n {atBreak: true, character: '|', after: '[\\t :-]'},\n // A pipe in a cell must be encoded.\n {character: '|', inConstruct: 'tableCell'},\n // A colon must be followed by a dash, in which case it could start a\n // delimiter row.\n {atBreak: true, character: ':', after: '-'},\n // A delimiter row can also start with a dash, when followed by more\n // dashes, a colon, or a pipe.\n // This is a stricter version than the built in check for lists, thematic\n // breaks, and setex heading underlines though:\n // \n {atBreak: true, character: '-', after: '[:|-]'}\n ],\n handlers: {\n table: handleTable,\n tableRow: handleTableRow,\n tableCell: handleTableCell,\n inlineCode: inlineCodeWithTable\n }\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {Table} node\n */\n function handleTable(node, _, context, safeOptions) {\n return serializeData(\n handleTableAsData(node, context, safeOptions),\n node.align\n )\n }\n\n /**\n * This function isn’t really used normally, because we handle rows at the\n * table level.\n * But, if someone passes in a table row, this ensures we make somewhat sense.\n *\n * @type {ToMarkdownHandle}\n * @param {TableRow} node\n */\n function handleTableRow(node, _, context, safeOptions) {\n const row = handleTableRowAsData(node, context, safeOptions)\n const value = serializeData([row])\n // `markdown-table` will always add an align row\n return value.slice(0, value.indexOf('\\n'))\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {TableCell} node\n */\n function handleTableCell(node, _, context, safeOptions) {\n const exit = context.enter('tableCell')\n const subexit = context.enter('phrasing')\n const value = containerPhrasing(node, context, {\n ...safeOptions,\n before: around,\n after: around\n })\n subexit()\n exit()\n return value\n }\n\n /**\n * @param {Array>} matrix\n * @param {Array | null | undefined} [align]\n */\n function serializeData(matrix, align) {\n return markdownTable(matrix, {\n align,\n // @ts-expect-error: `markdown-table` types should support `null`.\n alignDelimiters,\n // @ts-expect-error: `markdown-table` types should support `null`.\n padding,\n // @ts-expect-error: `markdown-table` types should support `null`.\n stringLength\n })\n }\n\n /**\n * @param {Table} node\n * @param {ToMarkdownContext} context\n * @param {SafeOptions} safeOptions\n */\n function handleTableAsData(node, context, safeOptions) {\n const children = node.children\n let index = -1\n /** @type {Array>} */\n const result = []\n const subexit = context.enter('table')\n\n while (++index < children.length) {\n result[index] = handleTableRowAsData(\n children[index],\n context,\n safeOptions\n )\n }\n\n subexit()\n\n return result\n }\n\n /**\n * @param {TableRow} node\n * @param {ToMarkdownContext} context\n * @param {SafeOptions} safeOptions\n */\n function handleTableRowAsData(node, context, safeOptions) {\n const children = node.children\n let index = -1\n /** @type {Array} */\n const result = []\n const subexit = context.enter('tableRow')\n\n while (++index < children.length) {\n // Note: the positional info as used here is incorrect.\n // Making it correct would be impossible due to aligning cells?\n // And it would need copy/pasting `markdown-table` into this project.\n result[index] = handleTableCell(\n children[index],\n node,\n context,\n safeOptions\n )\n }\n\n subexit()\n\n return result\n }\n\n /**\n * @type {ToMarkdownHandle}\n * @param {InlineCode} node\n */\n function inlineCodeWithTable(node, parent, context) {\n let value = inlineCode(node, parent, context)\n\n if (context.stack.includes('tableCell')) {\n value = value.replace(/\\|/g, '\\\\$&')\n }\n\n return value\n }\n}\n","/**\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast-util-from-markdown').CompileContext} CompileContext\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-from-markdown').Handle} FromMarkdownHandle\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Handle} ToMarkdownHandle\n */\n\n/**\n * @typedef {Extract} Parents\n */\n\nimport {listItem} from 'mdast-util-to-markdown/lib/handle/list-item.js'\nimport {track} from 'mdast-util-to-markdown/lib/util/track.js'\n\n// To do: next major: rename `context` -> `state`, `safeOptions` -> `info`, use\n// `track` from `state`.\n// To do: next major: replace exports with functions.\n// To do: next major: use `defaulthandlers.listItem`.\n\n/**\n * Extension for `mdast-util-from-markdown` to enable GFM task list items.\n *\n * @type {FromMarkdownExtension}\n */\nexport const gfmTaskListItemFromMarkdown = {\n exit: {\n taskListCheckValueChecked: exitCheck,\n taskListCheckValueUnchecked: exitCheck,\n paragraph: exitParagraphWithTaskListItem\n }\n}\n\n/**\n * Extension for `mdast-util-to-markdown` to enable GFM task list items.\n *\n * @type {ToMarkdownExtension}\n */\nexport const gfmTaskListItemToMarkdown = {\n unsafe: [{atBreak: true, character: '-', after: '[:|-]'}],\n handlers: {listItem: listItemWithTaskListItem}\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitCheck(token) {\n const node = /** @type {ListItem} */ (this.stack[this.stack.length - 2])\n // We’re always in a paragraph, in a list item.\n node.checked = token.type === 'taskListCheckValueChecked'\n}\n\n/**\n * @this {CompileContext}\n * @type {FromMarkdownHandle}\n */\nfunction exitParagraphWithTaskListItem(token) {\n const parent = /** @type {Parents} */ (this.stack[this.stack.length - 2])\n\n if (\n parent &&\n parent.type === 'listItem' &&\n typeof parent.checked === 'boolean'\n ) {\n const node = /** @type {Paragraph} */ (this.stack[this.stack.length - 1])\n const head = node.children[0]\n\n if (head && head.type === 'text') {\n const siblings = parent.children\n let index = -1\n /** @type {Paragraph | undefined} */\n let firstParaghraph\n\n while (++index < siblings.length) {\n const sibling = siblings[index]\n if (sibling.type === 'paragraph') {\n firstParaghraph = sibling\n break\n }\n }\n\n if (firstParaghraph === node) {\n // Must start with a space or a tab.\n head.value = head.value.slice(1)\n\n if (head.value.length === 0) {\n node.children.shift()\n } else if (\n node.position &&\n head.position &&\n typeof head.position.start.offset === 'number'\n ) {\n head.position.start.column++\n head.position.start.offset++\n node.position.start = Object.assign({}, head.position.start)\n }\n }\n }\n }\n\n this.exit(token)\n}\n\n/**\n * @type {ToMarkdownHandle}\n * @param {ListItem} node\n */\nfunction listItemWithTaskListItem(node, parent, context, safeOptions) {\n const head = node.children[0]\n const checkable =\n typeof node.checked === 'boolean' && head && head.type === 'paragraph'\n const checkbox = '[' + (node.checked ? 'x' : ' ') + '] '\n const tracker = track(safeOptions)\n\n if (checkable) {\n tracker.move(checkbox)\n }\n\n let value = listItem(node, parent, context, {\n ...safeOptions,\n ...tracker.current()\n })\n\n if (checkable) {\n value = value.replace(/^(?:[*+-]|\\d+\\.)([\\r\\n]| {1,3})/, check)\n }\n\n return value\n\n /**\n * @param {string} $0\n * @returns {string}\n */\n function check($0) {\n return $0 + checkbox\n }\n}\n","/**\n * @typedef {import('mdast-util-from-markdown').Extension} FromMarkdownExtension\n * @typedef {import('mdast-util-to-markdown').Options} ToMarkdownExtension\n */\n\n/**\n * @typedef {import('mdast-util-gfm-table').Options} Options\n * Configuration.\n */\n\nimport {\n gfmAutolinkLiteralFromMarkdown,\n gfmAutolinkLiteralToMarkdown\n} from 'mdast-util-gfm-autolink-literal'\nimport {\n gfmFootnoteFromMarkdown,\n gfmFootnoteToMarkdown\n} from 'mdast-util-gfm-footnote'\nimport {\n gfmStrikethroughFromMarkdown,\n gfmStrikethroughToMarkdown\n} from 'mdast-util-gfm-strikethrough'\nimport {gfmTableFromMarkdown, gfmTableToMarkdown} from 'mdast-util-gfm-table'\nimport {\n gfmTaskListItemFromMarkdown,\n gfmTaskListItemToMarkdown\n} from 'mdast-util-gfm-task-list-item'\n\n/**\n * Create an extension for `mdast-util-from-markdown` to enable GFM (autolink\n * literals, footnotes, strikethrough, tables, tasklists).\n *\n * @returns {Array}\n * Extension for `mdast-util-from-markdown` to enable GFM (autolink literals,\n * footnotes, strikethrough, tables, tasklists).\n */\nexport function gfmFromMarkdown() {\n return [\n gfmAutolinkLiteralFromMarkdown,\n gfmFootnoteFromMarkdown(),\n gfmStrikethroughFromMarkdown,\n gfmTableFromMarkdown,\n gfmTaskListItemFromMarkdown\n ]\n}\n\n/**\n * Create an extension for `mdast-util-to-markdown` to enable GFM (autolink\n * literals, footnotes, strikethrough, tables, tasklists).\n *\n * @param {Options | null | undefined} [options]\n * Configuration.\n * @returns {ToMarkdownExtension}\n * Extension for `mdast-util-to-markdown` to enable GFM (autolink literals,\n * footnotes, strikethrough, tables, tasklists).\n */\nexport function gfmToMarkdown(options) {\n return {\n extensions: [\n gfmAutolinkLiteralToMarkdown,\n gfmFootnoteToMarkdown(),\n gfmStrikethroughToMarkdown,\n gfmTableToMarkdown(options),\n gfmTaskListItemToMarkdown\n ]\n }\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('micromark-extension-gfm').Options & import('mdast-util-gfm').Options} Options\n */\n\nimport {gfm} from 'micromark-extension-gfm'\nimport {gfmFromMarkdown, gfmToMarkdown} from 'mdast-util-gfm'\n\n/**\n * Plugin to support GFM (autolink literals, footnotes, strikethrough, tables, tasklists).\n *\n * @type {import('unified').Plugin<[Options?]|void[], Root>}\n */\nexport default function remarkGfm(options = {}) {\n const data = this.data()\n\n add('micromarkExtensions', gfm(options))\n add('fromMarkdownExtensions', gfmFromMarkdown())\n add('toMarkdownExtensions', gfmToMarkdown(options))\n\n /**\n * @param {string} field\n * @param {unknown} value\n */\n function add(field, value) {\n const list = /** @type {unknown[]} */ (\n // Other extensions\n /* c8 ignore next 2 */\n data[field] ? data[field] : (data[field] = [])\n )\n\n list.push(value)\n }\n}\n","import {asciiAlphanumeric} from 'micromark-util-character'\nimport {encode} from 'micromark-util-encode'\n/**\n * Make a value safe for injection as a URL.\n *\n * This encodes unsafe characters with percent-encoding and skips already\n * encoded sequences (see `normalizeUri`).\n * Further unsafe characters are encoded as character references (see\n * `micromark-util-encode`).\n *\n * A regex of allowed protocols can be given, in which case the URL is\n * sanitized.\n * For example, `/^(https?|ircs?|mailto|xmpp)$/i` can be used for `a[href]`, or\n * `/^https?$/i` for `img[src]` (this is what `github.com` allows).\n * If the URL includes an unknown protocol (one not matched by `protocol`, such\n * as a dangerous example, `javascript:`), the value is ignored.\n *\n * @param {string | undefined} url\n * URI to sanitize.\n * @param {RegExp | null | undefined} [protocol]\n * Allowed protocols.\n * @returns {string}\n * Sanitized URI.\n */\nexport function sanitizeUri(url, protocol) {\n const value = encode(normalizeUri(url || ''))\n if (!protocol) {\n return value\n }\n const colon = value.indexOf(':')\n const questionMark = value.indexOf('?')\n const numberSign = value.indexOf('#')\n const slash = value.indexOf('/')\n if (\n // If there is no protocol, it’s relative.\n colon < 0 ||\n // If the first colon is after a `?`, `#`, or `/`, it’s not a protocol.\n (slash > -1 && colon > slash) ||\n (questionMark > -1 && colon > questionMark) ||\n (numberSign > -1 && colon > numberSign) ||\n // It is a protocol, it should be allowed.\n protocol.test(value.slice(0, colon))\n ) {\n return value\n }\n return ''\n}\n\n/**\n * Normalize a URL.\n *\n * Encode unsafe characters with percent-encoding, skipping already encoded\n * sequences.\n *\n * @param {string} value\n * URI to normalize.\n * @returns {string}\n * Normalized URI.\n */\nexport function normalizeUri(value) {\n /** @type {Array} */\n const result = []\n let index = -1\n let start = 0\n let skip = 0\n while (++index < value.length) {\n const code = value.charCodeAt(index)\n /** @type {string} */\n let replace = ''\n\n // A correct percent encoded value.\n if (\n code === 37 &&\n asciiAlphanumeric(value.charCodeAt(index + 1)) &&\n asciiAlphanumeric(value.charCodeAt(index + 2))\n ) {\n skip = 2\n }\n // ASCII.\n else if (code < 128) {\n if (!/[!#$&-;=?-Z_a-z~]/.test(String.fromCharCode(code))) {\n replace = String.fromCharCode(code)\n }\n }\n // Astral.\n else if (code > 55295 && code < 57344) {\n const next = value.charCodeAt(index + 1)\n\n // A correct surrogate pair.\n if (code < 56320 && next > 56319 && next < 57344) {\n replace = String.fromCharCode(code, next)\n skip = 1\n }\n // Lone surrogate.\n else {\n replace = '\\uFFFD'\n }\n }\n // Unicode.\n else {\n replace = String.fromCharCode(code)\n }\n if (replace) {\n result.push(value.slice(start, index), encodeURIComponent(replace))\n start = index + skip + 1\n replace = ''\n }\n if (skip) {\n index += skip\n skip = 0\n }\n }\n return result.join('') + value.slice(start)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n *\n * @typedef {import('./state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Generate a hast footer for called footnote definitions.\n *\n * @param {State} state\n * Info passed around.\n * @returns {Element | undefined}\n * `section` element or `undefined`.\n */\nexport function footer(state) {\n /** @type {Array} */\n const listItems = []\n let index = -1\n\n while (++index < state.footnoteOrder.length) {\n const def = state.footnoteById[state.footnoteOrder[index]]\n\n if (!def) {\n continue\n }\n\n const content = state.all(def)\n const id = String(def.identifier).toUpperCase()\n const safeId = normalizeUri(id.toLowerCase())\n let referenceIndex = 0\n /** @type {Array} */\n const backReferences = []\n\n while (++referenceIndex <= state.footnoteCounts[id]) {\n /** @type {Element} */\n const backReference = {\n type: 'element',\n tagName: 'a',\n properties: {\n href:\n '#' +\n state.clobberPrefix +\n 'fnref-' +\n safeId +\n (referenceIndex > 1 ? '-' + referenceIndex : ''),\n dataFootnoteBackref: true,\n className: ['data-footnote-backref'],\n ariaLabel: state.footnoteBackLabel\n },\n children: [{type: 'text', value: '↩'}]\n }\n\n if (referenceIndex > 1) {\n backReference.children.push({\n type: 'element',\n tagName: 'sup',\n children: [{type: 'text', value: String(referenceIndex)}]\n })\n }\n\n if (backReferences.length > 0) {\n backReferences.push({type: 'text', value: ' '})\n }\n\n backReferences.push(backReference)\n }\n\n const tail = content[content.length - 1]\n\n if (tail && tail.type === 'element' && tail.tagName === 'p') {\n const tailTail = tail.children[tail.children.length - 1]\n if (tailTail && tailTail.type === 'text') {\n tailTail.value += ' '\n } else {\n tail.children.push({type: 'text', value: ' '})\n }\n\n tail.children.push(...backReferences)\n } else {\n content.push(...backReferences)\n }\n\n /** @type {Element} */\n const listItem = {\n type: 'element',\n tagName: 'li',\n properties: {id: state.clobberPrefix + 'fn-' + safeId},\n children: state.wrap(content, true)\n }\n\n state.patch(def, listItem)\n\n listItems.push(listItem)\n }\n\n if (listItems.length === 0) {\n return\n }\n\n return {\n type: 'element',\n tagName: 'section',\n properties: {dataFootnotes: true, className: ['footnotes']},\n children: [\n {\n type: 'element',\n tagName: state.footnoteLabelTagName,\n properties: {\n // To do: use structured clone.\n ...JSON.parse(JSON.stringify(state.footnoteLabelProperties)),\n id: 'footnote-label'\n },\n children: [{type: 'text', value: state.footnoteLabel}]\n },\n {type: 'text', value: '\\n'},\n {\n type: 'element',\n tagName: 'ol',\n properties: {},\n children: state.wrap(listItems, true)\n },\n {type: 'text', value: '\\n'}\n ]\n }\n}\n","/**\n * @typedef {import('unist').Position} Position\n * @typedef {import('unist').Node} Node\n * @typedef {import('unist').Point} Point\n */\n\n/**\n * @typedef NodeLike\n * @property {string} type\n * @property {PositionLike | null | undefined} [position]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n *\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n */\n\n/**\n * Get the starting point of `node`.\n *\n * @param node\n * Node.\n * @returns\n * Point.\n */\nexport const pointStart = point('start')\n\n/**\n * Get the ending point of `node`.\n *\n * @param node\n * Node.\n * @returns\n * Point.\n */\nexport const pointEnd = point('end')\n\n/**\n * Get the positional info of `node`.\n *\n * @param {NodeLike | Node | null | undefined} [node]\n * Node.\n * @returns {Position}\n * Position.\n */\nexport function position(node) {\n return {start: pointStart(node), end: pointEnd(node)}\n}\n\n/**\n * Get the positional info of `node`.\n *\n * @param {'start' | 'end'} type\n * Side.\n * @returns\n * Getter.\n */\nfunction point(type) {\n return point\n\n /**\n * Get the point info of `node` at a bound side.\n *\n * @param {NodeLike | Node | null | undefined} [node]\n * @returns {Point}\n */\n function point(node) {\n const point = (node && node.position && node.position[type]) || {}\n\n // To do: next major: don’t return points when invalid.\n return {\n // @ts-expect-error: in practice, null is allowed.\n line: point.line || null,\n // @ts-expect-error: in practice, null is allowed.\n column: point.column || null,\n // @ts-expect-error: in practice, null is allowed.\n offset: point.offset > -1 ? point.offset : null\n }\n }\n}\n","/**\n * @typedef PointLike\n * @property {number | null | undefined} [line]\n * @property {number | null | undefined} [column]\n * @property {number | null | undefined} [offset]\n *\n * @typedef PositionLike\n * @property {PointLike | null | undefined} [start]\n * @property {PointLike | null | undefined} [end]\n *\n * @typedef NodeLike\n * @property {PositionLike | null | undefined} [position]\n */\n\n/**\n * Check if `node` is generated.\n *\n * @param {NodeLike | null | undefined} [node]\n * Node to check.\n * @returns {boolean}\n * Whether `node` is generated (does not have positional info).\n */\nexport function generated(node) {\n return (\n !node ||\n !node.position ||\n !node.position.start ||\n !node.position.start.line ||\n !node.position.start.column ||\n !node.position.end ||\n !node.position.end.line ||\n !node.position.end.column\n )\n}\n","/**\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Definition} Definition\n */\n\n/**\n * @typedef {Root | Content} Node\n *\n * @callback GetDefinition\n * Get a definition by identifier.\n * @param {string | null | undefined} [identifier]\n * Identifier of definition.\n * @returns {Definition | null}\n * Definition corresponding to `identifier` or `null`.\n */\n\nimport {visit} from 'unist-util-visit'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Find definitions in `tree`.\n *\n * Uses CommonMark precedence, which means that earlier definitions are\n * preferred over duplicate later definitions.\n *\n * @param {Node} tree\n * Tree to check.\n * @returns {GetDefinition}\n * Getter.\n */\nexport function definitions(tree) {\n /** @type {Record} */\n const cache = Object.create(null)\n\n if (!tree || !tree.type) {\n throw new Error('mdast-util-definitions expected node')\n }\n\n visit(tree, 'definition', (definition) => {\n const id = clean(definition.identifier)\n if (id && !own.call(cache, id)) {\n cache[id] = definition\n }\n })\n\n return definition\n\n /** @type {GetDefinition} */\n function definition(identifier) {\n const id = clean(identifier)\n // To do: next major: return `undefined` when not found.\n return id && own.call(cache, id) ? cache[id] : null\n }\n}\n\n/**\n * @param {string | null | undefined} [value]\n * @returns {string}\n */\nfunction clean(value) {\n return String(value || '').toUpperCase()\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Blockquote} Blockquote\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `blockquote` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Blockquote} node\n * mdast node.\n * @returns {Element}\n * hast node.\n */\nexport function blockquote(state, node) {\n /** @type {Element} */\n const result = {\n type: 'element',\n tagName: 'blockquote',\n properties: {},\n children: state.wrap(state.all(node), true)\n }\n state.patch(node, result)\n return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Text} Text\n * @typedef {import('mdast').Break} Break\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `break` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Break} node\n * mdast node.\n * @returns {Array}\n * hast element content.\n */\nexport function hardBreak(state, node) {\n /** @type {Element} */\n const result = {type: 'element', tagName: 'br', properties: {}, children: []}\n state.patch(node, result)\n return [state.applyData(node, result), {type: 'text', value: '\\n'}]\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Code} Code\n * @typedef {import('../state.js').State} State\n\n */\n\n/**\n * Turn an mdast `code` node into hast.\n *\n * @param {State} state\n * Info passed around.\n * @param {Code} node\n * mdast node.\n * @returns {Element}\n * hast node.\n */\nexport function code(state, node) {\n const value = node.value ? node.value + '\\n' : ''\n // To do: next major, use `node.lang` w/o regex, the splitting’s been going\n // on for years in remark now.\n const lang = node.lang ? node.lang.match(/^[^ \\t]+(?=[ \\t]|$)/) : null\n /** @type {Properties} */\n const properties = {}\n\n if (lang) {\n properties.className = ['language-' + lang]\n }\n\n // Create ``.\n /** @type {Element} */\n let result = {\n type: 'element',\n tagName: 'code',\n properties,\n children: [{type: 'text', value}]\n }\n\n if (node.meta) {\n result.data = {meta: node.meta}\n }\n\n state.patch(node, result)\n result = state.applyData(node, result)\n\n // Create `
`.\n  result = {type: 'element', tagName: 'pre', properties: {}, children: [result]}\n  state.patch(node, result)\n  return result\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Delete} Delete\n * @typedef {import('../state.js').State} State\n\n */\n\n/**\n * Turn an mdast `delete` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Delete} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function strikethrough(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'del',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Emphasis} Emphasis\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `emphasis` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Emphasis} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function emphasis(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'em',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('mdast').FootnoteReference} FootnoteReference\n * @typedef {import('hast').Element} Element\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `footnoteReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {FootnoteReference} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function footnoteReference(state, node) {\n  const id = String(node.identifier).toUpperCase()\n  const safeId = normalizeUri(id.toLowerCase())\n  const index = state.footnoteOrder.indexOf(id)\n  /** @type {number} */\n  let counter\n\n  if (index === -1) {\n    state.footnoteOrder.push(id)\n    state.footnoteCounts[id] = 1\n    counter = state.footnoteOrder.length\n  } else {\n    state.footnoteCounts[id]++\n    counter = index + 1\n  }\n\n  const reuseCounter = state.footnoteCounts[id]\n\n  /** @type {Element} */\n  const link = {\n    type: 'element',\n    tagName: 'a',\n    properties: {\n      href: '#' + state.clobberPrefix + 'fn-' + safeId,\n      id:\n        state.clobberPrefix +\n        'fnref-' +\n        safeId +\n        (reuseCounter > 1 ? '-' + reuseCounter : ''),\n      dataFootnoteRef: true,\n      ariaDescribedBy: ['footnote-label']\n    },\n    children: [{type: 'text', value: String(counter)}]\n  }\n  state.patch(node, link)\n\n  /** @type {Element} */\n  const sup = {\n    type: 'element',\n    tagName: 'sup',\n    properties: {},\n    children: [link]\n  }\n  state.patch(node, sup)\n  return state.applyData(node, sup)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Footnote} Footnote\n * @typedef {import('../state.js').State} State\n */\n\nimport {footnoteReference} from './footnote-reference.js'\n\n// To do: when both:\n// * \n// * \n// …are archived, remove this (also from mdast).\n// These inline notes are not used in GFM.\n\n/**\n * Turn an mdast `footnote` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Footnote} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function footnote(state, node) {\n  const footnoteById = state.footnoteById\n  let no = 1\n\n  while (no in footnoteById) no++\n\n  const identifier = String(no)\n\n  footnoteById[identifier] = {\n    type: 'footnoteDefinition',\n    identifier,\n    children: [{type: 'paragraph', children: node.children}],\n    position: node.position\n  }\n\n  return footnoteReference(state, {\n    type: 'footnoteReference',\n    identifier,\n    position: node.position\n  })\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Heading} Heading\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `heading` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Heading} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function heading(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'h' + node.depth,\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').HTML} Html\n * @typedef {import('../state.js').State} State\n * @typedef {import('../../index.js').Raw} Raw\n */\n\n/**\n * Turn an mdast `html` node into hast (`raw` node in dangerous mode, otherwise\n * nothing).\n *\n * @param {State} state\n *   Info passed around.\n * @param {Html} node\n *   mdast node.\n * @returns {Raw | Element | null}\n *   hast node.\n */\nexport function html(state, node) {\n  if (state.dangerous) {\n    /** @type {Raw} */\n    const result = {type: 'raw', value: node.value}\n    state.patch(node, result)\n    return state.applyData(node, result)\n  }\n\n  // To do: next major: return `undefined`.\n  return null\n}\n","/**\n * @typedef {import('hast').ElementContent} ElementContent\n *\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Reference} Reference\n * @typedef {import('mdast').Root} Root\n *\n * @typedef {import('./state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} References\n */\n\n// To do: next major: always return array.\n\n/**\n * Return the content of a reference without definition as plain text.\n *\n * @param {State} state\n *   Info passed around.\n * @param {References} node\n *   Reference node (image, link).\n * @returns {ElementContent | Array}\n *   hast content.\n */\nexport function revert(state, node) {\n  const subtype = node.referenceType\n  let suffix = ']'\n\n  if (subtype === 'collapsed') {\n    suffix += '[]'\n  } else if (subtype === 'full') {\n    suffix += '[' + (node.label || node.identifier) + ']'\n  }\n\n  if (node.type === 'imageReference') {\n    return {type: 'text', value: '![' + node.alt + suffix}\n  }\n\n  const contents = state.all(node)\n  const head = contents[0]\n\n  if (head && head.type === 'text') {\n    head.value = '[' + head.value\n  } else {\n    contents.unshift({type: 'text', value: '['})\n  }\n\n  const tail = contents[contents.length - 1]\n\n  if (tail && tail.type === 'text') {\n    tail.value += suffix\n  } else {\n    contents.push({type: 'text', value: suffix})\n  }\n\n  return contents\n}\n","/**\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').ImageReference} ImageReference\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\nimport {revert} from '../revert.js'\n\n/**\n * Turn an mdast `imageReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ImageReference} node\n *   mdast node.\n * @returns {ElementContent | Array}\n *   hast node.\n */\nexport function imageReference(state, node) {\n  const def = state.definition(node.identifier)\n\n  if (!def) {\n    return revert(state, node)\n  }\n\n  /** @type {Properties} */\n  const properties = {src: normalizeUri(def.url || ''), alt: node.alt}\n\n  if (def.title !== null && def.title !== undefined) {\n    properties.title = def.title\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'img', properties, children: []}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Image} Image\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `image` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Image} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function image(state, node) {\n  /** @type {Properties} */\n  const properties = {src: normalizeUri(node.url)}\n\n  if (node.alt !== null && node.alt !== undefined) {\n    properties.alt = node.alt\n  }\n\n  if (node.title !== null && node.title !== undefined) {\n    properties.title = node.title\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'img', properties, children: []}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Text} Text\n * @typedef {import('mdast').InlineCode} InlineCode\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `inlineCode` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {InlineCode} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function inlineCode(state, node) {\n  /** @type {Text} */\n  const text = {type: 'text', value: node.value.replace(/\\r?\\n|\\r/g, ' ')}\n  state.patch(node, text)\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'code',\n    properties: {},\n    children: [text]\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').LinkReference} LinkReference\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\nimport {revert} from '../revert.js'\n\n/**\n * Turn an mdast `linkReference` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {LinkReference} node\n *   mdast node.\n * @returns {ElementContent | Array}\n *   hast node.\n */\nexport function linkReference(state, node) {\n  const def = state.definition(node.identifier)\n\n  if (!def) {\n    return revert(state, node)\n  }\n\n  /** @type {Properties} */\n  const properties = {href: normalizeUri(def.url || '')}\n\n  if (def.title !== null && def.title !== undefined) {\n    properties.title = def.title\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'a',\n    properties,\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Link} Link\n * @typedef {import('../state.js').State} State\n */\n\nimport {normalizeUri} from 'micromark-util-sanitize-uri'\n\n/**\n * Turn an mdast `link` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Link} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function link(state, node) {\n  /** @type {Properties} */\n  const properties = {href: normalizeUri(node.url)}\n\n  if (node.title !== null && node.title !== undefined) {\n    properties.title = node.title\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'a',\n    properties,\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').ListItem} ListItem\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} Parents\n */\n\n/**\n * Turn an mdast `listItem` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ListItem} node\n *   mdast node.\n * @param {Parents | null | undefined} parent\n *   Parent of `node`.\n * @returns {Element}\n *   hast node.\n */\nexport function listItem(state, node, parent) {\n  const results = state.all(node)\n  const loose = parent ? listLoose(parent) : listItemLoose(node)\n  /** @type {Properties} */\n  const properties = {}\n  /** @type {Array} */\n  const children = []\n\n  if (typeof node.checked === 'boolean') {\n    const head = results[0]\n    /** @type {Element} */\n    let paragraph\n\n    if (head && head.type === 'element' && head.tagName === 'p') {\n      paragraph = head\n    } else {\n      paragraph = {type: 'element', tagName: 'p', properties: {}, children: []}\n      results.unshift(paragraph)\n    }\n\n    if (paragraph.children.length > 0) {\n      paragraph.children.unshift({type: 'text', value: ' '})\n    }\n\n    paragraph.children.unshift({\n      type: 'element',\n      tagName: 'input',\n      properties: {type: 'checkbox', checked: node.checked, disabled: true},\n      children: []\n    })\n\n    // According to github-markdown-css, this class hides bullet.\n    // See: .\n    properties.className = ['task-list-item']\n  }\n\n  let index = -1\n\n  while (++index < results.length) {\n    const child = results[index]\n\n    // Add eols before nodes, except if this is a loose, first paragraph.\n    if (\n      loose ||\n      index !== 0 ||\n      child.type !== 'element' ||\n      child.tagName !== 'p'\n    ) {\n      children.push({type: 'text', value: '\\n'})\n    }\n\n    if (child.type === 'element' && child.tagName === 'p' && !loose) {\n      children.push(...child.children)\n    } else {\n      children.push(child)\n    }\n  }\n\n  const tail = results[results.length - 1]\n\n  // Add a final eol.\n  if (tail && (loose || tail.type !== 'element' || tail.tagName !== 'p')) {\n    children.push({type: 'text', value: '\\n'})\n  }\n\n  /** @type {Element} */\n  const result = {type: 'element', tagName: 'li', properties, children}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n\n/**\n * @param {Parents} node\n * @return {Boolean}\n */\nfunction listLoose(node) {\n  let loose = false\n  if (node.type === 'list') {\n    loose = node.spread || false\n    const children = node.children\n    let index = -1\n\n    while (!loose && ++index < children.length) {\n      loose = listItemLoose(children[index])\n    }\n  }\n\n  return loose\n}\n\n/**\n * @param {ListItem} node\n * @return {Boolean}\n */\nfunction listItemLoose(node) {\n  const spread = node.spread\n\n  return spread === undefined || spread === null\n    ? node.children.length > 1\n    : spread\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('mdast').List} List\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `list` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {List} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function list(state, node) {\n  /** @type {Properties} */\n  const properties = {}\n  const results = state.all(node)\n  let index = -1\n\n  if (typeof node.start === 'number' && node.start !== 1) {\n    properties.start = node.start\n  }\n\n  // Like GitHub, add a class for custom styling.\n  while (++index < results.length) {\n    const child = results[index]\n\n    if (\n      child.type === 'element' &&\n      child.tagName === 'li' &&\n      child.properties &&\n      Array.isArray(child.properties.className) &&\n      child.properties.className.includes('task-list-item')\n    ) {\n      properties.className = ['contains-task-list']\n      break\n    }\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: node.ordered ? 'ol' : 'ul',\n    properties,\n    children: state.wrap(results, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Paragraph} Paragraph\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `paragraph` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Paragraph} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function paragraph(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'p',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('mdast').Root} MdastRoot\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `root` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastRoot} node\n *   mdast node.\n * @returns {HastRoot | HastElement}\n *   hast node.\n */\nexport function root(state, node) {\n  /** @type {HastRoot} */\n  const result = {type: 'root', children: state.wrap(state.all(node))}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Strong} Strong\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `strong` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Strong} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function strong(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'strong',\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').Table} Table\n * @typedef {import('../state.js').State} State\n */\n\nimport {pointStart, pointEnd} from 'unist-util-position'\n\n/**\n * Turn an mdast `table` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {Table} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function table(state, node) {\n  const rows = state.all(node)\n  const firstRow = rows.shift()\n  /** @type {Array} */\n  const tableContent = []\n\n  if (firstRow) {\n    /** @type {Element} */\n    const head = {\n      type: 'element',\n      tagName: 'thead',\n      properties: {},\n      children: state.wrap([firstRow], true)\n    }\n    state.patch(node.children[0], head)\n    tableContent.push(head)\n  }\n\n  if (rows.length > 0) {\n    /** @type {Element} */\n    const body = {\n      type: 'element',\n      tagName: 'tbody',\n      properties: {},\n      children: state.wrap(rows, true)\n    }\n\n    const start = pointStart(node.children[1])\n    const end = pointEnd(node.children[node.children.length - 1])\n    if (start.line && end.line) body.position = {start, end}\n    tableContent.push(body)\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'table',\n    properties: {},\n    children: state.wrap(tableContent, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').ElementContent} ElementContent\n * @typedef {import('mdast').Content} Content\n * @typedef {import('mdast').Parent} Parent\n * @typedef {import('mdast').Root} Root\n * @typedef {import('mdast').TableRow} TableRow\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * @typedef {Root | Content} Nodes\n * @typedef {Extract} Parents\n */\n\n/**\n * Turn an mdast `tableRow` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {TableRow} node\n *   mdast node.\n * @param {Parents | null | undefined} parent\n *   Parent of `node`.\n * @returns {Element}\n *   hast node.\n */\nexport function tableRow(state, node, parent) {\n  const siblings = parent ? parent.children : undefined\n  // Generate a body row when without parent.\n  const rowIndex = siblings ? siblings.indexOf(node) : 1\n  const tagName = rowIndex === 0 ? 'th' : 'td'\n  const align = parent && parent.type === 'table' ? parent.align : undefined\n  const length = align ? align.length : node.children.length\n  let cellIndex = -1\n  /** @type {Array} */\n  const cells = []\n\n  while (++cellIndex < length) {\n    // Note: can also be undefined.\n    const cell = node.children[cellIndex]\n    /** @type {Properties} */\n    const properties = {}\n    const alignValue = align ? align[cellIndex] : undefined\n\n    if (alignValue) {\n      properties.align = alignValue\n    }\n\n    /** @type {Element} */\n    let result = {type: 'element', tagName, properties, children: []}\n\n    if (cell) {\n      result.children = state.all(cell)\n      state.patch(cell, result)\n      result = state.applyData(node, result)\n    }\n\n    cells.push(result)\n  }\n\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'tr',\n    properties: {},\n    children: state.wrap(cells, true)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').TableCell} TableCell\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `tableCell` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {TableCell} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function tableCell(state, node) {\n  // Note: this function is normally not called: see `table-row` for how rows\n  // and their cells are compiled.\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'td', // Assume body cell.\n    properties: {},\n    children: state.all(node)\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","const tab = 9 /* `\\t` */\nconst space = 32 /* ` ` */\n\n/**\n * Remove initial and final spaces and tabs at the line breaks in `value`.\n * Does not trim initial and final spaces and tabs of the value itself.\n *\n * @param {string} value\n *   Value to trim.\n * @returns {string}\n *   Trimmed value.\n */\nexport function trimLines(value) {\n  const source = String(value)\n  const search = /\\r?\\n|\\r/g\n  let match = search.exec(source)\n  let last = 0\n  /** @type {Array} */\n  const lines = []\n\n  while (match) {\n    lines.push(\n      trimLine(source.slice(last, match.index), last > 0, true),\n      match[0]\n    )\n\n    last = match.index + match[0].length\n    match = search.exec(source)\n  }\n\n  lines.push(trimLine(source.slice(last), last > 0, false))\n\n  return lines.join('')\n}\n\n/**\n * @param {string} value\n *   Line to trim.\n * @param {boolean} start\n *   Whether to trim the start of the line.\n * @param {boolean} end\n *   Whether to trim the end of the line.\n * @returns {string}\n *   Trimmed line.\n */\nfunction trimLine(value, start, end) {\n  let startIndex = 0\n  let endIndex = value.length\n\n  if (start) {\n    let code = value.codePointAt(startIndex)\n\n    while (code === tab || code === space) {\n      startIndex++\n      code = value.codePointAt(startIndex)\n    }\n  }\n\n  if (end) {\n    let code = value.codePointAt(endIndex - 1)\n\n    while (code === tab || code === space) {\n      endIndex--\n      code = value.codePointAt(endIndex - 1)\n    }\n  }\n\n  return endIndex > startIndex ? value.slice(startIndex, endIndex) : ''\n}\n","/**\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('hast').Text} HastText\n * @typedef {import('mdast').Text} MdastText\n * @typedef {import('../state.js').State} State\n */\n\nimport {trimLines} from 'trim-lines'\n\n/**\n * Turn an mdast `text` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastText} node\n *   mdast node.\n * @returns {HastText | HastElement}\n *   hast node.\n */\nexport function text(state, node) {\n  /** @type {HastText} */\n  const result = {type: 'text', value: trimLines(String(node.value))}\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","/**\n * @typedef {import('hast').Element} Element\n * @typedef {import('mdast').ThematicBreak} ThematicBreak\n * @typedef {import('../state.js').State} State\n */\n\n/**\n * Turn an mdast `thematicBreak` node into hast.\n *\n * @param {State} state\n *   Info passed around.\n * @param {ThematicBreak} node\n *   mdast node.\n * @returns {Element}\n *   hast node.\n */\nexport function thematicBreak(state, node) {\n  /** @type {Element} */\n  const result = {\n    type: 'element',\n    tagName: 'hr',\n    properties: {},\n    children: []\n  }\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n","import {blockquote} from './blockquote.js'\nimport {hardBreak} from './break.js'\nimport {code} from './code.js'\nimport {strikethrough} from './delete.js'\nimport {emphasis} from './emphasis.js'\nimport {footnoteReference} from './footnote-reference.js'\nimport {footnote} from './footnote.js'\nimport {heading} from './heading.js'\nimport {html} from './html.js'\nimport {imageReference} from './image-reference.js'\nimport {image} from './image.js'\nimport {inlineCode} from './inline-code.js'\nimport {linkReference} from './link-reference.js'\nimport {link} from './link.js'\nimport {listItem} from './list-item.js'\nimport {list} from './list.js'\nimport {paragraph} from './paragraph.js'\nimport {root} from './root.js'\nimport {strong} from './strong.js'\nimport {table} from './table.js'\nimport {tableRow} from './table-row.js'\nimport {tableCell} from './table-cell.js'\nimport {text} from './text.js'\nimport {thematicBreak} from './thematic-break.js'\n\n/**\n * Default handlers for nodes.\n */\nexport const handlers = {\n  blockquote,\n  break: hardBreak,\n  code,\n  delete: strikethrough,\n  emphasis,\n  footnoteReference,\n  footnote,\n  heading,\n  html,\n  imageReference,\n  image,\n  inlineCode,\n  linkReference,\n  link,\n  listItem,\n  list,\n  paragraph,\n  root,\n  strong,\n  table,\n  tableCell,\n  tableRow,\n  text,\n  thematicBreak,\n  toml: ignore,\n  yaml: ignore,\n  definition: ignore,\n  footnoteDefinition: ignore\n}\n\n// Return nothing for nodes that are ignored.\nfunction ignore() {\n  // To do: next major: return `undefined`.\n  return null\n}\n","/**\n * @typedef {import('hast').Content} HastContent\n * @typedef {import('hast').Element} HastElement\n * @typedef {import('hast').ElementContent} HastElementContent\n * @typedef {import('hast').Properties} HastProperties\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('hast').Text} HastText\n *\n * @typedef {import('mdast').Content} MdastContent\n * @typedef {import('mdast').Definition} MdastDefinition\n * @typedef {import('mdast').FootnoteDefinition} MdastFootnoteDefinition\n * @typedef {import('mdast').Parent} MdastParent\n * @typedef {import('mdast').Root} MdastRoot\n */\n\n/**\n * @typedef {HastRoot | HastContent} HastNodes\n * @typedef {MdastRoot | MdastContent} MdastNodes\n * @typedef {Extract} MdastParents\n *\n * @typedef EmbeddedHastFields\n *   hast fields.\n * @property {string | null | undefined} [hName]\n *   Generate a specific element with this tag name instead.\n * @property {HastProperties | null | undefined} [hProperties]\n *   Generate an element with these properties instead.\n * @property {Array | null | undefined} [hChildren]\n *   Generate an element with this content instead.\n *\n * @typedef {Record & EmbeddedHastFields} MdastData\n *   mdast data with embedded hast fields.\n *\n * @typedef {MdastNodes & {data?: MdastData | null | undefined}} MdastNodeWithData\n *   mdast node with embedded hast data.\n *\n * @typedef PointLike\n *   Point-like value.\n * @property {number | null | undefined} [line]\n *   Line.\n * @property {number | null | undefined} [column]\n *   Column.\n * @property {number | null | undefined} [offset]\n *   Offset.\n *\n * @typedef PositionLike\n *   Position-like value.\n * @property {PointLike | null | undefined} [start]\n *   Point-like value.\n * @property {PointLike | null | undefined} [end]\n *   Point-like value.\n *\n * @callback Handler\n *   Handle a node.\n * @param {State} state\n *   Info passed around.\n * @param {any} node\n *   mdast node to handle.\n * @param {MdastParents | null | undefined} parent\n *   Parent of `node`.\n * @returns {HastElementContent | Array | null | undefined}\n *   hast node.\n *\n * @callback HFunctionProps\n *   Signature of `state` for when props are passed.\n * @param {MdastNodes | PositionLike | null | undefined} node\n *   mdast node or unist position.\n * @param {string} tagName\n *   HTML tag name.\n * @param {HastProperties} props\n *   Properties.\n * @param {Array | null | undefined} [children]\n *   hast content.\n * @returns {HastElement}\n *   Compiled element.\n *\n * @callback HFunctionNoProps\n *   Signature of `state` for when no props are passed.\n * @param {MdastNodes | PositionLike | null | undefined} node\n *   mdast node or unist position.\n * @param {string} tagName\n *   HTML tag name.\n * @param {Array | null | undefined} [children]\n *   hast content.\n * @returns {HastElement}\n *   Compiled element.\n *\n * @typedef HFields\n *   Info on `state`.\n * @property {boolean} dangerous\n *   Whether HTML is allowed.\n * @property {string} clobberPrefix\n *   Prefix to use to prevent DOM clobbering.\n * @property {string} footnoteLabel\n *   Label to use to introduce the footnote section.\n * @property {string} footnoteLabelTagName\n *   HTML used for the footnote label.\n * @property {HastProperties} footnoteLabelProperties\n *   Properties on the HTML tag used for the footnote label.\n * @property {string} footnoteBackLabel\n *   Label to use from backreferences back to their footnote call.\n * @property {(identifier: string) => MdastDefinition | null} definition\n *   Definition cache.\n * @property {Record} footnoteById\n *   Footnote definitions by their identifier.\n * @property {Array} footnoteOrder\n *   Identifiers of order when footnote calls first appear in tree order.\n * @property {Record} footnoteCounts\n *   Counts for how often the same footnote was called.\n * @property {Handlers} handlers\n *   Applied handlers.\n * @property {Handler} unknownHandler\n *   Handler for any none not in `passThrough` or otherwise handled.\n * @property {(from: MdastNodes, node: HastNodes) => void} patch\n *   Copy a node’s positional info.\n * @property {(from: MdastNodes, to: Type) => Type | HastElement} applyData\n *   Honor the `data` of `from`, and generate an element instead of `node`.\n * @property {(node: MdastNodes, parent: MdastParents | null | undefined) => HastElementContent | Array | null | undefined} one\n *   Transform an mdast node to hast.\n * @property {(node: MdastNodes) => Array} all\n *   Transform the children of an mdast parent to hast.\n * @property {(nodes: Array, loose?: boolean | null | undefined) => Array} wrap\n *   Wrap `nodes` with line endings between each node, adds initial/final line endings when `loose`.\n * @property {(left: MdastNodeWithData | PositionLike | null | undefined, right: HastElementContent) => HastElementContent} augment\n *   Like `state` but lower-level and usable on non-elements.\n *   Deprecated: use `patch` and `applyData`.\n * @property {Array} passThrough\n *   List of node types to pass through untouched (except for their children).\n *\n * @typedef Options\n *   Configuration (optional).\n * @property {boolean | null | undefined} [allowDangerousHtml=false]\n *   Whether to persist raw HTML in markdown in the hast tree.\n * @property {string | null | undefined} [clobberPrefix='user-content-']\n *   Prefix to use before the `id` attribute on footnotes to prevent it from\n *   *clobbering*.\n * @property {string | null | undefined} [footnoteBackLabel='Back to content']\n *   Label to use from backreferences back to their footnote call (affects\n *   screen readers).\n * @property {string | null | undefined} [footnoteLabel='Footnotes']\n *   Label to use for the footnotes section (affects screen readers).\n * @property {HastProperties | null | undefined} [footnoteLabelProperties={className: ['sr-only']}]\n *   Properties to use on the footnote label (note that `id: 'footnote-label'`\n *   is always added as footnote calls use it with `aria-describedby` to\n *   provide an accessible label).\n * @property {string | null | undefined} [footnoteLabelTagName='h2']\n *   Tag name to use for the footnote label.\n * @property {Handlers | null | undefined} [handlers]\n *   Extra handlers for nodes.\n * @property {Array | null | undefined} [passThrough]\n *   List of custom mdast node types to pass through (keep) in hast (note that\n *   the node itself is passed, but eventual children are transformed).\n * @property {Handler | null | undefined} [unknownHandler]\n *   Handler for all unknown nodes.\n *\n * @typedef {Record} Handlers\n *   Handle nodes.\n *\n * @typedef {HFunctionProps & HFunctionNoProps & HFields} State\n *   Info passed around.\n */\n\nimport {visit} from 'unist-util-visit'\nimport {position, pointStart, pointEnd} from 'unist-util-position'\nimport {generated} from 'unist-util-generated'\nimport {definitions} from 'mdast-util-definitions'\nimport {handlers} from './handlers/index.js'\n\nconst own = {}.hasOwnProperty\n\n/**\n * Create `state` from an mdast tree.\n *\n * @param {MdastNodes} tree\n *   mdast node to transform.\n * @param {Options | null | undefined} [options]\n *   Configuration.\n * @returns {State}\n *   `state` function.\n */\nexport function createState(tree, options) {\n  const settings = options || {}\n  const dangerous = settings.allowDangerousHtml || false\n  /** @type {Record} */\n  const footnoteById = {}\n\n  // To do: next major: add `options` to state, remove:\n  // `dangerous`, `clobberPrefix`, `footnoteLabel`, `footnoteLabelTagName`,\n  // `footnoteLabelProperties`, `footnoteBackLabel`, `passThrough`,\n  // `unknownHandler`.\n\n  // To do: next major: move to `state.options.allowDangerousHtml`.\n  state.dangerous = dangerous\n  // To do: next major: move to `state.options`.\n  state.clobberPrefix =\n    settings.clobberPrefix === undefined || settings.clobberPrefix === null\n      ? 'user-content-'\n      : settings.clobberPrefix\n  // To do: next major: move to `state.options`.\n  state.footnoteLabel = settings.footnoteLabel || 'Footnotes'\n  // To do: next major: move to `state.options`.\n  state.footnoteLabelTagName = settings.footnoteLabelTagName || 'h2'\n  // To do: next major: move to `state.options`.\n  state.footnoteLabelProperties = settings.footnoteLabelProperties || {\n    className: ['sr-only']\n  }\n  // To do: next major: move to `state.options`.\n  state.footnoteBackLabel = settings.footnoteBackLabel || 'Back to content'\n  // To do: next major: move to `state.options`.\n  state.unknownHandler = settings.unknownHandler\n  // To do: next major: move to `state.options`.\n  state.passThrough = settings.passThrough\n\n  state.handlers = {...handlers, ...settings.handlers}\n\n  // To do: next major: replace utility with `definitionById` object, so we\n  // only walk once (as we need footnotes too).\n  state.definition = definitions(tree)\n  state.footnoteById = footnoteById\n  /** @type {Array} */\n  state.footnoteOrder = []\n  /** @type {Record} */\n  state.footnoteCounts = {}\n\n  state.patch = patch\n  state.applyData = applyData\n  state.one = oneBound\n  state.all = allBound\n  state.wrap = wrap\n  // To do: next major: remove `augment`.\n  state.augment = augment\n\n  visit(tree, 'footnoteDefinition', (definition) => {\n    const id = String(definition.identifier).toUpperCase()\n\n    // Mimick CM behavior of link definitions.\n    // See: .\n    if (!own.call(footnoteById, id)) {\n      footnoteById[id] = definition\n    }\n  })\n\n  // @ts-expect-error Hush, it’s fine!\n  return state\n\n  /**\n   * Finalise the created `right`, a hast node, from `left`, an mdast node.\n   *\n   * @param {MdastNodeWithData | PositionLike | null | undefined} left\n   * @param {HastElementContent} right\n   * @returns {HastElementContent}\n   */\n  /* c8 ignore start */\n  // To do: next major: remove.\n  function augment(left, right) {\n    // Handle `data.hName`, `data.hProperties, `data.hChildren`.\n    if (left && 'data' in left && left.data) {\n      /** @type {MdastData} */\n      const data = left.data\n\n      if (data.hName) {\n        if (right.type !== 'element') {\n          right = {\n            type: 'element',\n            tagName: '',\n            properties: {},\n            children: []\n          }\n        }\n\n        right.tagName = data.hName\n      }\n\n      if (right.type === 'element' && data.hProperties) {\n        right.properties = {...right.properties, ...data.hProperties}\n      }\n\n      if ('children' in right && right.children && data.hChildren) {\n        right.children = data.hChildren\n      }\n    }\n\n    if (left) {\n      const ctx = 'type' in left ? left : {position: left}\n\n      if (!generated(ctx)) {\n        // @ts-expect-error: fine.\n        right.position = {start: pointStart(ctx), end: pointEnd(ctx)}\n      }\n    }\n\n    return right\n  }\n  /* c8 ignore stop */\n\n  /**\n   * Create an element for `node`.\n   *\n   * @type {HFunctionProps}\n   */\n  /* c8 ignore start */\n  // To do: next major: remove.\n  function state(node, tagName, props, children) {\n    if (Array.isArray(props)) {\n      children = props\n      props = {}\n    }\n\n    // @ts-expect-error augmenting an element yields an element.\n    return augment(node, {\n      type: 'element',\n      tagName,\n      properties: props || {},\n      children: children || []\n    })\n  }\n  /* c8 ignore stop */\n\n  /**\n   * Transform an mdast node into a hast node.\n   *\n   * @param {MdastNodes} node\n   *   mdast node.\n   * @param {MdastParents | null | undefined} [parent]\n   *   Parent of `node`.\n   * @returns {HastElementContent | Array | null | undefined}\n   *   Resulting hast node.\n   */\n  function oneBound(node, parent) {\n    // @ts-expect-error: that’s a state :)\n    return one(state, node, parent)\n  }\n\n  /**\n   * Transform the children of an mdast node into hast nodes.\n   *\n   * @param {MdastNodes} parent\n   *   mdast node to compile\n   * @returns {Array}\n   *   Resulting hast nodes.\n   */\n  function allBound(parent) {\n    // @ts-expect-error: that’s a state :)\n    return all(state, parent)\n  }\n}\n\n/**\n * Copy a node’s positional info.\n *\n * @param {MdastNodes} from\n *   mdast node to copy from.\n * @param {HastNodes} to\n *   hast node to copy into.\n * @returns {void}\n *   Nothing.\n */\nfunction patch(from, to) {\n  if (from.position) to.position = position(from)\n}\n\n/**\n * Honor the `data` of `from` and maybe generate an element instead of `to`.\n *\n * @template {HastNodes} Type\n *   Node type.\n * @param {MdastNodes} from\n *   mdast node to use data from.\n * @param {Type} to\n *   hast node to change.\n * @returns {Type | HastElement}\n *   Nothing.\n */\nfunction applyData(from, to) {\n  /** @type {Type | HastElement} */\n  let result = to\n\n  // Handle `data.hName`, `data.hProperties, `data.hChildren`.\n  if (from && from.data) {\n    const hName = from.data.hName\n    const hChildren = from.data.hChildren\n    const hProperties = from.data.hProperties\n\n    if (typeof hName === 'string') {\n      // Transforming the node resulted in an element with a different name\n      // than wanted:\n      if (result.type === 'element') {\n        result.tagName = hName\n      }\n      // Transforming the node resulted in a non-element, which happens for\n      // raw, text, and root nodes (unless custom handlers are passed).\n      // The intent is likely to keep the content around (otherwise: pass\n      // `hChildren`).\n      else {\n        result = {\n          type: 'element',\n          tagName: hName,\n          properties: {},\n          children: []\n        }\n\n        // To do: next major: take the children from the `root`, or inject the\n        // raw/text/comment or so into the element?\n        // if ('children' in node) {\n        //   // @ts-expect-error: assume `children` are allowed in elements.\n        //   result.children = node.children\n        // } else {\n        //   // @ts-expect-error: assume `node` is allowed in elements.\n        //   result.children.push(node)\n        // }\n      }\n    }\n\n    if (result.type === 'element' && hProperties) {\n      result.properties = {...result.properties, ...hProperties}\n    }\n\n    if (\n      'children' in result &&\n      result.children &&\n      hChildren !== null &&\n      hChildren !== undefined\n    ) {\n      // @ts-expect-error: assume valid children are defined.\n      result.children = hChildren\n    }\n  }\n\n  return result\n}\n\n/**\n * Transform an mdast node into a hast node.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} node\n *   mdast node.\n * @param {MdastParents | null | undefined} [parent]\n *   Parent of `node`.\n * @returns {HastElementContent | Array | null | undefined}\n *   Resulting hast node.\n */\n// To do: next major: do not expose, keep bound.\nexport function one(state, node, parent) {\n  const type = node && node.type\n\n  // Fail on non-nodes.\n  if (!type) {\n    throw new Error('Expected node, got `' + node + '`')\n  }\n\n  if (own.call(state.handlers, type)) {\n    return state.handlers[type](state, node, parent)\n  }\n\n  if (state.passThrough && state.passThrough.includes(type)) {\n    // To do: next major: deep clone.\n    // @ts-expect-error: types of passed through nodes are expected to be added manually.\n    return 'children' in node ? {...node, children: all(state, node)} : node\n  }\n\n  if (state.unknownHandler) {\n    return state.unknownHandler(state, node, parent)\n  }\n\n  return defaultUnknownHandler(state, node)\n}\n\n/**\n * Transform the children of an mdast node into hast nodes.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} parent\n *   mdast node to compile\n * @returns {Array}\n *   Resulting hast nodes.\n */\n// To do: next major: do not expose, keep bound.\nexport function all(state, parent) {\n  /** @type {Array} */\n  const values = []\n\n  if ('children' in parent) {\n    const nodes = parent.children\n    let index = -1\n    while (++index < nodes.length) {\n      const result = one(state, nodes[index], parent)\n\n      // To do: see if we van clean this? Can we merge texts?\n      if (result) {\n        if (index && nodes[index - 1].type === 'break') {\n          if (!Array.isArray(result) && result.type === 'text') {\n            result.value = result.value.replace(/^\\s+/, '')\n          }\n\n          if (!Array.isArray(result) && result.type === 'element') {\n            const head = result.children[0]\n\n            if (head && head.type === 'text') {\n              head.value = head.value.replace(/^\\s+/, '')\n            }\n          }\n        }\n\n        if (Array.isArray(result)) {\n          values.push(...result)\n        } else {\n          values.push(result)\n        }\n      }\n    }\n  }\n\n  return values\n}\n\n/**\n * Transform an unknown node.\n *\n * @param {State} state\n *   Info passed around.\n * @param {MdastNodes} node\n *   Unknown mdast node.\n * @returns {HastText | HastElement}\n *   Resulting hast node.\n */\nfunction defaultUnknownHandler(state, node) {\n  const data = node.data || {}\n  /** @type {HastText | HastElement} */\n  const result =\n    'value' in node &&\n    !(own.call(data, 'hProperties') || own.call(data, 'hChildren'))\n      ? {type: 'text', value: node.value}\n      : {\n          type: 'element',\n          tagName: 'div',\n          properties: {},\n          children: all(state, node)\n        }\n\n  state.patch(node, result)\n  return state.applyData(node, result)\n}\n\n/**\n * Wrap `nodes` with line endings between each node.\n *\n * @template {HastContent} Type\n *   Node type.\n * @param {Array} nodes\n *   List of nodes to wrap.\n * @param {boolean | null | undefined} [loose=false]\n *   Whether to add line endings at start and end.\n * @returns {Array}\n *   Wrapped nodes.\n */\nexport function wrap(nodes, loose) {\n  /** @type {Array} */\n  const result = []\n  let index = -1\n\n  if (loose) {\n    result.push({type: 'text', value: '\\n'})\n  }\n\n  while (++index < nodes.length) {\n    if (index) result.push({type: 'text', value: '\\n'})\n    result.push(nodes[index])\n  }\n\n  if (loose && nodes.length > 0) {\n    result.push({type: 'text', value: '\\n'})\n  }\n\n  return result\n}\n","/**\n * @typedef {import('hast').Content} HastContent\n * @typedef {import('hast').Root} HastRoot\n *\n * @typedef {import('mdast').Content} MdastContent\n * @typedef {import('mdast').Root} MdastRoot\n *\n * @typedef {import('./state.js').Options} Options\n */\n\n/**\n * @typedef {HastRoot | HastContent} HastNodes\n * @typedef {MdastRoot | MdastContent} MdastNodes\n */\n\nimport {footer} from './footer.js'\nimport {createState} from './state.js'\n\n/**\n * Transform mdast to hast.\n *\n * ##### Notes\n *\n * ###### HTML\n *\n * Raw HTML is available in mdast as `html` nodes and can be embedded in hast\n * as semistandard `raw` nodes.\n * Most utilities ignore `raw` nodes but two notable ones don’t:\n *\n * *   `hast-util-to-html` also has an option `allowDangerousHtml` which will\n *     output the raw HTML.\n *     This is typically discouraged as noted by the option name but is useful\n *     if you completely trust authors\n * *   `hast-util-raw` can handle the raw embedded HTML strings by parsing them\n *     into standard hast nodes (`element`, `text`, etc).\n *     This is a heavy task as it needs a full HTML parser, but it is the only\n *     way to support untrusted content\n *\n * ###### Footnotes\n *\n * Many options supported here relate to footnotes.\n * Footnotes are not specified by CommonMark, which we follow by default.\n * They are supported by GitHub, so footnotes can be enabled in markdown with\n * `mdast-util-gfm`.\n *\n * The options `footnoteBackLabel` and `footnoteLabel` define natural language\n * that explains footnotes, which is hidden for sighted users but shown to\n * assistive technology.\n * When your page is not in English, you must define translated values.\n *\n * Back references use ARIA attributes, but the section label itself uses a\n * heading that is hidden with an `sr-only` class.\n * To show it to sighted users, define different attributes in\n * `footnoteLabelProperties`.\n *\n * ###### Clobbering\n *\n * Footnotes introduces a problem, as it links footnote calls to footnote\n * definitions on the page through `id` attributes generated from user content,\n * which results in DOM clobbering.\n *\n * DOM clobbering is this:\n *\n * ```html\n * 
\n * \n * ```\n *\n * Elements by their ID are made available by browsers on the `window` object,\n * which is a security risk.\n * Using a prefix solves this problem.\n *\n * More information on how to handle clobbering and the prefix is explained in\n * Example: headings (DOM clobbering) in `rehype-sanitize`.\n *\n * ###### Unknown nodes\n *\n * Unknown nodes are nodes with a type that isn’t in `handlers` or `passThrough`.\n * The default behavior for unknown nodes is:\n *\n * *   when the node has a `value` (and doesn’t have `data.hName`,\n *     `data.hProperties`, or `data.hChildren`, see later), create a hast `text`\n *     node\n * *   otherwise, create a `
` element (which could be changed with\n *     `data.hName`), with its children mapped from mdast to hast as well\n *\n * This behavior can be changed by passing an `unknownHandler`.\n *\n * @param {MdastNodes} tree\n *   mdast tree.\n * @param {Options | null | undefined} [options]\n *   Configuration.\n * @returns {HastNodes | null | undefined}\n *   hast tree.\n */\n// To do: next major: always return a single `root`.\nexport function toHast(tree, options) {\n  const state = createState(tree, options)\n  const node = state.one(tree, null)\n  const foot = footer(state)\n\n  if (foot) {\n    // @ts-expect-error If there’s a footer, there were definitions, meaning block\n    // content.\n    // So assume `node` is a parent node.\n    node.children.push({type: 'text', value: '\\n'}, foot)\n  }\n\n  // To do: next major: always return root?\n  return Array.isArray(node) ? {type: 'root', children: node} : node\n}\n","/**\n * @typedef {import('hast').Root} HastRoot\n * @typedef {import('mdast').Root} MdastRoot\n * @typedef {import('mdast-util-to-hast').Options} Options\n * @typedef {import('unified').Processor} Processor\n *\n * @typedef {import('mdast-util-to-hast')} DoNotTouchAsThisImportIncludesRawInTree\n */\n\nimport {toHast} from 'mdast-util-to-hast'\n\n// Note: the `` overload doesn’t seem to work :'(\n\n/**\n * Plugin that turns markdown into HTML to support rehype.\n *\n * *   If a destination processor is given, that processor runs with a new HTML\n *     (hast) tree (bridge-mode).\n *     As the given processor runs with a hast tree, and rehype plugins support\n *     hast, that means rehype plugins can be used with the given processor.\n *     The hast tree is discarded in the end.\n *     It’s highly unlikely that you want to do this.\n * *   The common case is to not pass a destination processor, in which case the\n *     current processor continues running with a new HTML (hast) tree\n *     (mutate-mode).\n *     As the current processor continues with a hast tree, and rehype plugins\n *     support hast, that means rehype plugins can be used after\n *     `remark-rehype`.\n *     It’s likely that this is what you want to do.\n *\n * @param destination\n *   Optional unified processor.\n * @param options\n *   Options passed to `mdast-util-to-hast`.\n */\nconst remarkRehype =\n  /** @type {(import('unified').Plugin<[Processor, Options?]|[null|undefined, Options?]|[Options]|[], MdastRoot>)} */\n  (\n    function (destination, options) {\n      return destination && 'run' in destination\n        ? bridge(destination, options)\n        : mutate(destination || options)\n    }\n  )\n\nexport default remarkRehype\n\n/**\n * Bridge-mode.\n * Runs the destination with the new hast tree.\n *\n * @type {import('unified').Plugin<[Processor, Options?], MdastRoot>}\n */\nfunction bridge(destination, options) {\n  return (node, file, next) => {\n    destination.run(toHast(node, options), file, (error) => {\n      next(error)\n    })\n  }\n}\n\n/**\n * Mutate-mode.\n * Further plugins run on the hast tree.\n *\n * @type {import('unified').Plugin<[Options?]|void[], MdastRoot, HastRoot>}\n */\nfunction mutate(options) {\n  // @ts-expect-error: assume a corresponding node is returned by `toHast`.\n  return (node) => toHast(node, options)\n}\n","/**\n * @typedef {import('vfile').VFileValue} Value\n * @typedef {import('vfile').VFileOptions} Options\n * @typedef {import('vfile').BufferEncoding} BufferEncoding\n *   Encodings supported by the buffer class.\n *\n *   This is a copy of the types from Node and `VFile`.\n *\n * @typedef ReadOptions\n *   Configuration for `fs.readFile`.\n * @property {BufferEncoding | null | undefined} [encoding]\n *   Encoding to read file as, will turn `file.value` into a string if passed.\n * @property {string | undefined} [flag]\n *   File system flags to use.\n *\n * @typedef WriteOptions\n *   Configuration for `fs.writeFile`.\n * @property {BufferEncoding | null | undefined} [encoding]\n *   Encoding to write file as.\n * @property {number | string | undefined} [mode]\n *   File mode (permission and sticky bits) if the file was newly created.\n * @property {string | undefined} [flag]\n *   File system flags to use.\n *\n * @typedef {URL | Value} Path\n *   URL to file or path to file.\n *\n *   > 👉 **Note**: `Value` is used here because it’s a smarter `Buffer`\n * @typedef {Path | Options | VFile} Compatible\n *   URL to file, path to file, options for file, or actual file.\n */\n\n/**\n * @callback Callback\n *   Callback called after reading or writing a file.\n * @param {NodeJS.ErrnoException | null} error\n *   Error when reading or writing was not successful.\n * @param {VFile | null | undefined} file\n *   File when reading or writing was successful.\n */\n\nimport fs from 'fs'\nimport path from 'path'\nimport {URL} from 'url'\nimport buffer from 'is-buffer'\nimport {VFile} from 'vfile'\n\n// To do: next major: use `node:` prefix.\n// To do: next major: use `URL` from global.\n// To do: next major: Only pass `undefined`.\n\n/**\n * Create a virtual file from a description.\n *\n * This is like `VFile`, but it accepts a file path instead of file cotnents.\n *\n * If `options` is a string, URL, or buffer, it’s used as the path.\n * Otherwise, if it’s a file, that’s returned instead.\n * Otherwise, the options are passed through to `new VFile()`.\n *\n * @param {Compatible | null | undefined} [description]\n *   Path to file, file options, or file itself.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function toVFile(description) {\n  if (typeof description === 'string' || description instanceof URL) {\n    description = {path: description}\n  } else if (buffer(description)) {\n    description = {path: String(description)}\n  }\n\n  return looksLikeAVFile(description)\n    ? description\n    : // To do: remove when `VFile` allows explicit `null`.\n      new VFile(description || undefined)\n}\n\n/**\n * Create a virtual file and read it in, synchronously.\n *\n * @param {Compatible} description\n *   Path to file, file options, or file itself.\n * @param {BufferEncoding | ReadOptions | null | undefined} [options]\n *   Encoding to use or Node.JS read options.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function readSync(description, options) {\n  const file = toVFile(description)\n  file.value = fs.readFileSync(path.resolve(file.cwd, file.path), options)\n  return file\n}\n\n/**\n * Create a virtual file and write it, synchronously.\n *\n * @param {Compatible} description\n *   Path to file, file options, or file itself.\n * @param {BufferEncoding | WriteOptions | null | undefined} [options]\n *   Encoding to use or Node.JS write options.\n * @returns {VFile}\n *   Given file or new file.\n */\nexport function writeSync(description, options) {\n  const file = toVFile(description)\n  fs.writeFileSync(path.resolve(file.cwd, file.path), file.value || '', options)\n  return file\n}\n\n/**\n * Create a virtual file and read it in, async.\n *\n * @param description\n *   Path to file, file options, or file itself.\n * @param options\n *   Encoding to use or Node.JS read options.\n * @param callback\n *   Callback called when done.\n * @returns\n *   Nothing when a callback is given, otherwise promise that resolves to given\n *   file or new file.\n */\nexport const read =\n  /**\n   * @type {{\n   *   (description: Compatible, options: BufferEncoding | ReadOptions | null | undefined, callback: Callback): void\n   *   (description: Compatible, callback: Callback): void\n   *   (description: Compatible, options?: BufferEncoding | ReadOptions | null | undefined): Promise\n   * }}\n   */\n  (\n    /**\n     * @param {Compatible} description\n     * @param {BufferEncoding | ReadOptions | null | undefined} [options]\n     * @param {Callback | null | undefined} [callback]\n     */\n    function (description, options, callback) {\n      const file = toVFile(description)\n\n      if (!callback && typeof options === 'function') {\n        callback = options\n        options = null\n      }\n\n      if (!callback) {\n        return new Promise(executor)\n      }\n\n      executor(resolve, callback)\n\n      /**\n       * @param {VFile} result\n       */\n      function resolve(result) {\n        // @ts-expect-error: `callback` always defined.\n        callback(null, result)\n      }\n\n      /**\n       * @param {(error: VFile) => void} resolve\n       * @param {(error: NodeJS.ErrnoException, file?: VFile | undefined) => void} reject\n       */\n      function executor(resolve, reject) {\n        /** @type {string} */\n        let fp\n\n        try {\n          fp = path.resolve(file.cwd, file.path)\n        } catch (error) {\n          const exception = /** @type {NodeJS.ErrnoException} */ (error)\n          return reject(exception)\n        }\n\n        fs.readFile(fp, options, done)\n\n        /**\n         * @param {NodeJS.ErrnoException | null} error\n         * @param {Value} result\n         */\n        function done(error, result) {\n          if (error) {\n            reject(error)\n          } else {\n            file.value = result\n            resolve(file)\n          }\n        }\n      }\n    }\n  )\n\n/**\n * Create a virtual file and write it, async.\n *\n * @param description\n *   Path to file, file options, or file itself.\n * @param options\n *   Encoding to use or Node.JS write options.\n * @param callback\n *   Callback called when done.\n * @returns\n *   Nothing when a callback is given, otherwise promise that resolves to given\n *   file or new file.\n */\nexport const write =\n  /**\n   * @type {{\n   *   (description: Compatible, options: BufferEncoding | WriteOptions | null | undefined, callback: Callback): void\n   *   (description: Compatible, callback: Callback): void\n   *   (description: Compatible, options?: BufferEncoding | WriteOptions | null | undefined): Promise\n   * }}\n   */\n  (\n    /**\n     * @param {Compatible} description\n     * @param {BufferEncoding | WriteOptions | null | undefined} [options]\n     * @param {Callback | null | undefined} [callback]\n     */\n    function (description, options, callback) {\n      const file = toVFile(description)\n\n      // Weird, right? Otherwise `fs` doesn’t accept it.\n      if (!callback && typeof options === 'function') {\n        callback = options\n        options = undefined\n      }\n\n      if (!callback) {\n        return new Promise(executor)\n      }\n\n      executor(resolve, callback)\n\n      /**\n       * @param {VFile} result\n       */\n      function resolve(result) {\n        // @ts-expect-error: `callback` always defined.\n        callback(null, result)\n      }\n\n      /**\n       * @param {(error: VFile) => void} resolve\n       * @param {(error: NodeJS.ErrnoException, file: VFile | null) => void} reject\n       */\n      function executor(resolve, reject) {\n        /** @type {string} */\n        let fp\n\n        try {\n          fp = path.resolve(file.cwd, file.path)\n        } catch (error) {\n          const exception = /** @type {NodeJS.ErrnoException} */ (error)\n          return reject(exception, null)\n        }\n\n        fs.writeFile(fp, file.value || '', options || null, done)\n\n        /**\n         * @param {NodeJS.ErrnoException | null} error\n         */\n        function done(error) {\n          if (error) {\n            reject(error, null)\n          } else {\n            resolve(file)\n          }\n        }\n      }\n    }\n  )\n\n/**\n * Check if something looks like a vfile.\n *\n * @param {Compatible | null | undefined} value\n *   Value.\n * @returns {value is VFile}\n *   Whether `value` looks like a `VFile`.\n */\nfunction looksLikeAVFile(value) {\n  return Boolean(\n    value &&\n      typeof value === 'object' &&\n      'message' in value &&\n      'messages' in value\n  )\n}\n\n// To do: next major: remove?\ntoVFile.readSync = readSync\ntoVFile.writeSync = writeSync\ntoVFile.read = read\ntoVFile.write = write\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nexport class InvalidTemplateError extends Error {\n}\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nimport path from \"node:path\";\nimport { visit } from \"unist-util-visit\";\nfunction isImage(node) {\n    return (node.tagName.toLowerCase() === \"img\" &&\n        node.properties != null &&\n        \"src\" in node.properties);\n}\n/**\n * Plugin to add attachments images in frontmatter\n */\nconst rehypeAddAttachmentsImages = function rehypeAddAttachmentsImages() {\n    return function (tree, file) {\n        const images = {};\n        visit(tree, \"element\", function (node) {\n            if (isImage(node)) {\n                const base = file.dirname\n                    ? path.resolve(file.cwd, file.dirname)\n                    : file.cwd;\n                const url = path.resolve(base, node.properties?.src);\n                const baseName = path.basename(url);\n                images[baseName] = url;\n                node.properties = { ...node.properties, src: baseName };\n            }\n        });\n        file.data.images = images;\n    };\n};\nexport default rehypeAddAttachmentsImages;\n","// SPDX-FileCopyrightText: 2024 Telefónica Innovación Digital\n// SPDX-License-Identifier: Apache-2.0\nfunction composeNotice(message) {\n    return {\n        type: \"element\",\n        tagName: \"p\",\n        children: [\n            {\n                type: \"element\",\n                tagName: \"strong\",\n                children: [{ type: \"raw\", value: message }],\n            },\n        ],\n    };\n}\n/**\n * UnifiedPlugin to add a notice to the AST.\n */\nconst rehypeAddNotice = function rehypeAddNotice(options) {\n    return function (tree) {\n        tree.children.unshift(composeNotice(options.noticeMessage));\n    };\n};\nexport default rehypeAddNotice;\n","/**\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('hast').Element} Element\n */\n\nconst search = /[#.]/g\n\n/**\n * Create a hast element from a simple CSS selector.\n *\n * @template {string} Selector\n *   Type of selector.\n * @template {string} [DefaultTagName='div']\n *   Type of default tag name.\n * @param {Selector | null | undefined} [selector]\n *   Simple CSS selector.\n *\n *   Can contain a tag name (`foo`), classes (`.bar`), and an ID (`#baz`).\n *   Multiple classes are allowed.\n *   Uses the last ID if multiple IDs are found.\n * @param {DefaultTagName | null | undefined} [defaultTagName='div']\n *   Tag name to use if `selector` does not specify one (default: `'div'`).\n * @returns {Element & {tagName: import('./extract.js').ExtractTagName}}\n *   Built element.\n */\nexport function parseSelector(selector, defaultTagName) {\n  const value = selector || ''\n  /** @type {Properties} */\n  const props = {}\n  let start = 0\n  /** @type {string | undefined} */\n  let previous\n  /** @type {string | undefined} */\n  let tagName\n\n  while (start < value.length) {\n    search.lastIndex = start\n    const match = search.exec(value)\n    const subvalue = value.slice(start, match ? match.index : value.length)\n\n    if (subvalue) {\n      if (!previous) {\n        tagName = subvalue\n      } else if (previous === '#') {\n        props.id = subvalue\n      } else if (Array.isArray(props.className)) {\n        props.className.push(subvalue)\n      } else {\n        props.className = [subvalue]\n      }\n\n      start += subvalue.length\n    }\n\n    if (match) {\n      previous = match[0]\n      start++\n    }\n  }\n\n  return {\n    type: 'element',\n    // @ts-expect-error: fine.\n    tagName: tagName || defaultTagName || 'div',\n    properties: props,\n    children: []\n  }\n}\n","/**\n * @typedef {import('hast').Root} Root\n * @typedef {import('hast').Content} Content\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Properties} Properties\n * @typedef {import('property-information').Info} Info\n * @typedef {import('property-information').Schema} Schema\n */\n\n/**\n * @typedef {Content | Root} Node\n *   Any concrete `hast` node.\n * @typedef {Root | Element} HResult\n *   Result from a `h` (or `s`) call.\n *\n * @typedef {string | number} HStyleValue\n *   Value for a CSS style field.\n * @typedef {Record} HStyle\n *   Supported value of a `style` prop.\n * @typedef {string | number | boolean | null | undefined} HPrimitiveValue\n *   Primitive property value.\n * @typedef {Array} HArrayValue\n *   List of property values for space- or comma separated values (such as `className`).\n * @typedef {HPrimitiveValue | HArrayValue} HPropertyValue\n *   Primitive value or list value.\n * @typedef {{[property: string]: HPropertyValue | HStyle}} HProperties\n *   Acceptable value for element properties.\n *\n * @typedef {string | number | null | undefined} HPrimitiveChild\n *   Primitive children, either ignored (nullish), or turned into text nodes.\n * @typedef {Array} HArrayChild\n *   List of children.\n * @typedef {Node | HPrimitiveChild | HArrayChild} HChild\n *   Acceptable child value.\n */\n\nimport {find, normalize} from 'property-information'\nimport {parseSelector} from 'hast-util-parse-selector'\nimport {parse as spaces} from 'space-separated-tokens'\nimport {parse as commas} from 'comma-separated-tokens'\n\nconst buttonTypes = new Set(['menu', 'submit', 'reset', 'button'])\n\nconst own = {}.hasOwnProperty\n\n/**\n * @param {Schema} schema\n * @param {string} defaultTagName\n * @param {Array} [caseSensitive]\n */\nexport function core(schema, defaultTagName, caseSensitive) {\n  const adjust = caseSensitive && createAdjustMap(caseSensitive)\n\n  const h =\n    /**\n     * @type {{\n     *   (): Root\n     *   (selector: null | undefined, ...children: Array): Root\n     *   (selector: string, properties?: HProperties, ...children: Array): Element\n     *   (selector: string, ...children: Array): Element\n     * }}\n     */\n    (\n      /**\n       * Hyperscript compatible DSL for creating virtual hast trees.\n       *\n       * @param {string | null} [selector]\n       * @param {HProperties | HChild} [properties]\n       * @param {Array} children\n       * @returns {HResult}\n       */\n      function (selector, properties, ...children) {\n        let index = -1\n        /** @type {HResult} */\n        let node\n\n        if (selector === undefined || selector === null) {\n          node = {type: 'root', children: []}\n          // @ts-expect-error Properties are not supported for roots.\n          children.unshift(properties)\n        } else {\n          node = parseSelector(selector, defaultTagName)\n          // Normalize the name.\n          node.tagName = node.tagName.toLowerCase()\n          if (adjust && own.call(adjust, node.tagName)) {\n            node.tagName = adjust[node.tagName]\n          }\n\n          // Handle props.\n          if (isProperties(properties, node.tagName)) {\n            /** @type {string} */\n            let key\n\n            for (key in properties) {\n              if (own.call(properties, key)) {\n                // @ts-expect-error `node.properties` is set.\n                addProperty(schema, node.properties, key, properties[key])\n              }\n            }\n          } else {\n            children.unshift(properties)\n          }\n        }\n\n        // Handle children.\n        while (++index < children.length) {\n          addChild(node.children, children[index])\n        }\n\n        if (node.type === 'element' && node.tagName === 'template') {\n          node.content = {type: 'root', children: node.children}\n          node.children = []\n        }\n\n        return node\n      }\n    )\n\n  return h\n}\n\n/**\n * @param {HProperties | HChild} value\n * @param {string} name\n * @returns {value is HProperties}\n */\nfunction isProperties(value, name) {\n  if (\n    value === null ||\n    value === undefined ||\n    typeof value !== 'object' ||\n    Array.isArray(value)\n  ) {\n    return false\n  }\n\n  if (name === 'input' || !value.type || typeof value.type !== 'string') {\n    return true\n  }\n\n  if ('children' in value && Array.isArray(value.children)) {\n    return false\n  }\n\n  if (name === 'button') {\n    return buttonTypes.has(value.type.toLowerCase())\n  }\n\n  return !('value' in value)\n}\n\n/**\n * @param {Schema} schema\n * @param {Properties} properties\n * @param {string} key\n * @param {HStyle | HPropertyValue} value\n * @returns {void}\n */\nfunction addProperty(schema, properties, key, value) {\n  const info = find(schema, key)\n  let index = -1\n  /** @type {HPropertyValue} */\n  let result\n\n  // Ignore nullish and NaN values.\n  if (value === undefined || value === null) return\n\n  if (typeof value === 'number') {\n    // Ignore NaN.\n    if (Number.isNaN(value)) return\n\n    result = value\n  }\n  // Booleans.\n  else if (typeof value === 'boolean') {\n    result = value\n  }\n  // Handle list values.\n  else if (typeof value === 'string') {\n    if (info.spaceSeparated) {\n      result = spaces(value)\n    } else if (info.commaSeparated) {\n      result = commas(value)\n    } else if (info.commaOrSpaceSeparated) {\n      result = spaces(commas(value).join(' '))\n    } else {\n      result = parsePrimitive(info, info.property, value)\n    }\n  } else if (Array.isArray(value)) {\n    result = value.concat()\n  } else {\n    result = info.property === 'style' ? style(value) : String(value)\n  }\n\n  if (Array.isArray(result)) {\n    /** @type {Array} */\n    const finalResult = []\n\n    while (++index < result.length) {\n      // @ts-expect-error Assume no booleans in array.\n      finalResult[index] = parsePrimitive(info, info.property, result[index])\n    }\n\n    result = finalResult\n  }\n\n  // Class names (which can be added both on the `selector` and here).\n  if (info.property === 'className' && Array.isArray(properties.className)) {\n    // @ts-expect-error Assume no booleans in `className`.\n    result = properties.className.concat(result)\n  }\n\n  properties[info.property] = result\n}\n\n/**\n * @param {Array} nodes\n * @param {HChild} value\n * @returns {void}\n */\nfunction addChild(nodes, value) {\n  let index = -1\n\n  if (value === undefined || value === null) {\n    // Empty.\n  } else if (typeof value === 'string' || typeof value === 'number') {\n    nodes.push({type: 'text', value: String(value)})\n  } else if (Array.isArray(value)) {\n    while (++index < value.length) {\n      addChild(nodes, value[index])\n    }\n  } else if (typeof value === 'object' && 'type' in value) {\n    if (value.type === 'root') {\n      addChild(nodes, value.children)\n    } else {\n      nodes.push(value)\n    }\n  } else {\n    throw new Error('Expected node, nodes, or string, got `' + value + '`')\n  }\n}\n\n/**\n * Parse a single primitives.\n *\n * @param {Info} info\n * @param {string} name\n * @param {HPrimitiveValue} value\n * @returns {HPrimitiveValue}\n */\nfunction parsePrimitive(info, name, value) {\n  if (typeof value === 'string') {\n    if (info.number && value && !Number.isNaN(Number(value))) {\n      return Number(value)\n    }\n\n    if (\n      (info.boolean || info.overloadedBoolean) &&\n      (value === '' || normalize(value) === normalize(name))\n    ) {\n      return true\n    }\n  }\n\n  return value\n}\n\n/**\n * Serialize a `style` object as a string.\n *\n * @param {HStyle} value\n *   Style object.\n * @returns {string}\n *   CSS string.\n */\nfunction style(value) {\n  /** @type {Array} */\n  const result = []\n  /** @type {string} */\n  let key\n\n  for (key in value) {\n    if (own.call(value, key)) {\n      result.push([key, value[key]].join(': '))\n    }\n  }\n\n  return result.join('; ')\n}\n\n/**\n * Create a map to adjust casing.\n *\n * @param {Array} values\n *   List of properly cased keys.\n * @returns {Record}\n *   Map of lowercase keys to uppercase keys.\n */\nfunction createAdjustMap(values) {\n  /** @type {Record} */\n  const result = {}\n  let index = -1\n\n  while (++index < values.length) {\n    result[values[index].toLowerCase()] = values[index]\n  }\n\n  return result\n}\n","export const svgCaseSensitiveTagNames = [\n  'altGlyph',\n  'altGlyphDef',\n  'altGlyphItem',\n  'animateColor',\n  'animateMotion',\n  'animateTransform',\n  'clipPath',\n  'feBlend',\n  'feColorMatrix',\n  'feComponentTransfer',\n  'feComposite',\n  'feConvolveMatrix',\n  'feDiffuseLighting',\n  'feDisplacementMap',\n  'feDistantLight',\n  'feDropShadow',\n  'feFlood',\n  'feFuncA',\n  'feFuncB',\n  'feFuncG',\n  'feFuncR',\n  'feGaussianBlur',\n  'feImage',\n  'feMerge',\n  'feMergeNode',\n  'feMorphology',\n  'feOffset',\n  'fePointLight',\n  'feSpecularLighting',\n  'feSpotLight',\n  'feTile',\n  'feTurbulence',\n  'foreignObject',\n  'glyphRef',\n  'linearGradient',\n  'radialGradient',\n  'solidColor',\n  'textArea',\n  'textPath'\n]\n","/**\n * @typedef {import('./core.js').HChild} Child\n *   Acceptable child value.\n * @typedef {import('./core.js').HProperties} Properties\n *   Acceptable value for element properties.\n * @typedef {import('./core.js').HResult} Result\n *   Result from a `h` (or `s`) call.\n *\n * @typedef {import('./jsx-classic.js').Element} s.JSX.Element\n * @typedef {import('./jsx-classic.js').IntrinsicAttributes} s.JSX.IntrinsicAttributes\n * @typedef {import('./jsx-classic.js').IntrinsicElements} s.JSX.IntrinsicElements\n * @typedef {import('./jsx-classic.js').ElementChildrenAttribute} s.JSX.ElementChildrenAttribute\n */\n\nimport {svg} from 'property-information'\nimport {core} from './core.js'\nimport {svgCaseSensitiveTagNames} from './svg-case-sensitive-tag-names.js'\n\nexport const s = core(svg, 'g', svgCaseSensitiveTagNames)\n","/**\n * @typedef {import('./core.js').HChild} Child\n *   Acceptable child value.\n * @typedef {import('./core.js').HProperties} Properties\n *   Acceptable value for element properties.\n * @typedef {import('./core.js').HResult} Result\n *   Result from a `h` (or `s`) call.\n *\n * @typedef {import('./jsx-classic.js').Element} h.JSX.Element\n * @typedef {import('./jsx-classic.js').IntrinsicAttributes} h.JSX.IntrinsicAttributes\n * @typedef {import('./jsx-classic.js').IntrinsicElements} h.JSX.IntrinsicElements\n * @typedef {import('./jsx-classic.js').ElementChildrenAttribute} h.JSX.ElementChildrenAttribute\n */\n\nimport {html} from 'property-information'\nimport {core} from './core.js'\n\nexport const h = core(html, 'div')\n","/**\n * @typedef {import('vfile').VFile} VFile\n * @typedef {import('vfile').Value} Value\n */\n\n/**\n * @typedef Point\n *   unist point, where `line` and `column` can be `undefined`.\n * @property {number | undefined} line\n *   Line.\n * @property {number | undefined} column\n *   Column.\n * @property {number | undefined} [offset]\n *   Offset.\n *\n * @typedef PointLike\n *   unist point, allowed as input.\n * @property {number | null | undefined} [line]\n *   Line.\n * @property {number | null | undefined} [column]\n *   Column.\n * @property {number | null | undefined} [offset]\n *   Offset.\n *\n * @callback ToPoint\n *   Get a line/column-based `point` from `offset`.\n * @param {number | null | undefined} [offset]\n *   Something that should be an `offset.\n * @returns {Point}\n *   Point, line/column are undefined for invalid or out of bounds input.\n *\n * @callback ToOffset\n *   Get an offset from a line/column-based `point`.\n * @param {Point | null | undefined} [point]\n *   Something that should be a `point.\n * @returns {number}\n *   Offset or `-1` for invalid or out of bounds input.\n *\n * @typedef Location\n *   Accessors for index.\n * @property {ToPoint} toPoint\n *   Get a line/column-based `point` from `offset`.\n * @property {ToOffset} toOffset\n *   Get an offset from a line/column-based `point`.\n */\n\n/**\n * Index the given document so you can translate between line/column and offset\n * based positional info.\n *\n * @param {VFile | Value} file\n *   File to index.\n * @returns {Location}\n *   Accessors for index.\n */\nexport function location(file) {\n  const value = String(file)\n  /** @type {Array} */\n  const indices = []\n  const search = /\\r?\\n|\\r/g\n\n  while (search.test(value)) {\n    indices.push(search.lastIndex)\n  }\n\n  indices.push(value.length + 1)\n\n  return {toPoint, toOffset}\n\n  /** @type {ToPoint} */\n  function toPoint(offset) {\n    let index = -1\n\n    if (\n      typeof offset === 'number' &&\n      offset > -1 &&\n      offset < indices[indices.length - 1]\n    ) {\n      while (++index < indices.length) {\n        if (indices[index] > offset) {\n          return {\n            line: index + 1,\n            column: offset - (index > 0 ? indices[index - 1] : 0) + 1,\n            offset\n          }\n        }\n      }\n    }\n\n    return {line: undefined, column: undefined, offset: undefined}\n  }\n\n  /** @type {ToOffset} */\n  function toOffset(point) {\n    const line = point && point.line\n    const column = point && point.column\n\n    if (\n      typeof line === 'number' &&\n      typeof column === 'number' &&\n      !Number.isNaN(line) &&\n      !Number.isNaN(column) &&\n      line - 1 in indices\n    ) {\n      const offset = (indices[line - 2] || 0) + column - 1 || 0\n\n      if (offset > -1 && offset < indices[indices.length - 1]) {\n        return offset\n      }\n    }\n\n    return -1\n  }\n}\n","/**\n * Map of web namespaces.\n *\n * @type {Record}\n */\nexport const webNamespaces = {\n  html: 'http://www.w3.org/1999/xhtml',\n  mathml: 'http://www.w3.org/1998/Math/MathML',\n  svg: 'http://www.w3.org/2000/svg',\n  xlink: 'http://www.w3.org/1999/xlink',\n  xml: 'http://www.w3.org/XML/1998/namespace',\n  xmlns: 'http://www.w3.org/2000/xmlns/'\n}\n","/**\n * @typedef {import('vfile').VFile} VFile\n * @typedef {import('property-information').Schema} Schema\n * @typedef {import('unist').Position} Position\n * @typedef {import('unist').Point} Point\n * @typedef {import('hast').Element} Element\n * @typedef {import('hast').Root} Root\n * @typedef {import('hast').Content} Content\n * @typedef {import('parse5').DefaultTreeAdapterMap} DefaultTreeAdapterMap\n * @typedef {import('parse5').Token.ElementLocation} P5ElementLocation\n * @typedef {import('parse5').Token.Location} P5Location\n */\n\n/**\n * @typedef {Content | Root} Node\n * @typedef {DefaultTreeAdapterMap['document']} P5Document\n * @typedef {DefaultTreeAdapterMap['documentFragment']} P5DocumentFragment\n * @typedef {DefaultTreeAdapterMap['documentType']} P5DocumentType\n * @typedef {DefaultTreeAdapterMap['commentNode']} P5Comment\n * @typedef {DefaultTreeAdapterMap['textNode']} P5Text\n * @typedef {DefaultTreeAdapterMap['element']} P5Element\n * @typedef {DefaultTreeAdapterMap['node']} P5Node\n * @typedef {DefaultTreeAdapterMap['template']} P5Template\n *\n * @typedef {'html' | 'svg'} Space\n *   Namespace.\n *\n * @typedef Options\n *   Configuration.\n * @property {Space | null | undefined} [space='html']\n *   Which space the document is in.\n *\n *   When an `` element is found in the HTML space, this package already\n *   automatically switches to and from the SVG space when entering and exiting\n *   it.\n * @property {VFile | null | undefined} [file]\n *   File used to add positional info to nodes.\n *\n *   If given, the file should represent the original HTML source.\n * @property {boolean} [verbose=false]\n *   Whether to add extra positional info about starting tags, closing tags,\n *   and attributes to elements.\n *\n *   > 👉 **Note**: only used when `file` is given.\n *\n * @typedef State\n *   Info passed around about the current state.\n * @property {Schema} schema\n *   Current schema.\n * @property {VFile | undefined} file\n *   Corresponding file.\n * @property {boolean | undefined} verbose\n *   Add extra positional info.\n * @property {boolean} location\n *   Whether location info was found.\n */\n\nimport {h, s} from 'hastscript'\nimport {html, svg, find} from 'property-information'\nimport {location} from 'vfile-location'\nimport {webNamespaces} from 'web-namespaces'\n\nconst own = {}.hasOwnProperty\n/** @type {unknown} */\n// type-coverage:ignore-next-line\nconst proto = Object.prototype\n\n/**\n * Transform a `parse5` AST to hast.\n *\n * @param {P5Node} tree\n *   `parse5` tree to transform.\n * @param {Options | VFile | null | undefined} [options]\n *   Configuration.\n * @returns {Node}\n *   hast tree.\n */\nexport function fromParse5(tree, options) {\n  const options_ = options || {}\n  /** @type {Options} */\n  let settings\n  /** @type {VFile | undefined} */\n  let file\n\n  if (isFile(options_)) {\n    file = options_\n    settings = {}\n  } else {\n    file = options_.file || undefined\n    settings = options_\n  }\n\n  return one(\n    {\n      schema: settings.space === 'svg' ? svg : html,\n      file,\n      verbose: settings.verbose,\n      location: false\n    },\n    tree\n  )\n}\n\n/**\n * Transform a node.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {P5Node} node\n *   p5 node.\n * @returns {Node}\n *   hast node.\n */\nfunction one(state, node) {\n  /** @type {Node} */\n  let result\n\n  switch (node.nodeName) {\n    case '#comment': {\n      const reference = /** @type {P5Comment} */ (node)\n      result = {type: 'comment', value: reference.data}\n      patch(state, reference, result)\n      return result\n    }\n\n    case '#document':\n    case '#document-fragment': {\n      const reference = /** @type {P5Document | P5DocumentFragment} */ (node)\n      const quirksMode =\n        'mode' in reference\n          ? reference.mode === 'quirks' || reference.mode === 'limited-quirks'\n          : false\n\n      result = {\n        type: 'root',\n        children: all(state, node.childNodes),\n        data: {quirksMode}\n      }\n\n      if (state.file && state.location) {\n        const doc = String(state.file)\n        const loc = location(doc)\n        const start = loc.toPoint(0)\n        const end = loc.toPoint(doc.length)\n        // @ts-expect-error: always defined as we give valid input.\n        result.position = {start, end}\n      }\n\n      return result\n    }\n\n    case '#documentType': {\n      const reference = /** @type {P5DocumentType} */ (node)\n      // @ts-expect-error Types are out of date.\n      result = {type: 'doctype'}\n      patch(state, reference, result)\n      return result\n    }\n\n    case '#text': {\n      const reference = /** @type {P5Text} */ (node)\n      result = {type: 'text', value: reference.value}\n      patch(state, reference, result)\n      return result\n    }\n\n    // Element.\n    default: {\n      const reference = /** @type {P5Element} */ (node)\n      result = element(state, reference)\n      return result\n    }\n  }\n}\n\n/**\n * Transform children.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {Array} nodes\n *   Nodes.\n * @returns {Array}\n *   hast nodes.\n */\nfunction all(state, nodes) {\n  let index = -1\n  /** @type {Array} */\n  const result = []\n\n  while (++index < nodes.length) {\n    // @ts-expect-error Assume no roots in `nodes`.\n    result[index] = one(state, nodes[index])\n  }\n\n  return result\n}\n\n/**\n * Transform an element.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {P5Element} node\n *   `parse5` node to transform.\n * @returns {Element}\n *   hast node.\n */\nfunction element(state, node) {\n  const schema = state.schema\n\n  state.schema = node.namespaceURI === webNamespaces.svg ? svg : html\n\n  // Props.\n  let index = -1\n  /** @type {Record} */\n  const props = {}\n\n  while (++index < node.attrs.length) {\n    const attribute = node.attrs[index]\n    const name =\n      (attribute.prefix ? attribute.prefix + ':' : '') + attribute.name\n    if (!own.call(proto, name)) {\n      props[name] = attribute.value\n    }\n  }\n\n  // Build.\n  const fn = state.schema.space === 'svg' ? s : h\n  const result = fn(node.tagName, props, all(state, node.childNodes))\n  patch(state, node, result)\n\n  // Switch content.\n  if (result.tagName === 'template') {\n    const reference = /** @type {P5Template} */ (node)\n    const pos = reference.sourceCodeLocation\n    const startTag = pos && pos.startTag && position(pos.startTag)\n    const endTag = pos && pos.endTag && position(pos.endTag)\n\n    /** @type {Root} */\n    // @ts-expect-error Types are wrong.\n    const content = one(state, reference.content)\n\n    if (startTag && endTag && state.file) {\n      content.position = {start: startTag.end, end: endTag.start}\n    }\n\n    result.content = content\n  }\n\n  state.schema = schema\n\n  return result\n}\n\n/**\n * Patch positional info from `from` onto `to`.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {P5Node} from\n *   p5 node.\n * @param {Node} to\n *   hast node.\n * @returns {void}\n *   Nothing.\n */\nfunction patch(state, from, to) {\n  if ('sourceCodeLocation' in from && from.sourceCodeLocation && state.file) {\n    const position = createLocation(state, to, from.sourceCodeLocation)\n\n    if (position) {\n      state.location = true\n      to.position = position\n    }\n  }\n}\n\n/**\n * Create clean positional information.\n *\n * @param {State} state\n *   Info passed around about the current state.\n * @param {Node} node\n *   hast node.\n * @param {P5ElementLocation} location\n *   p5 location info.\n * @returns {Position | undefined}\n *   Position, or nothing.\n */\nfunction createLocation(state, node, location) {\n  const result = position(location)\n\n  if (node.type === 'element') {\n    const tail = node.children[node.children.length - 1]\n\n    // Bug for unclosed with children.\n    // See: .\n    if (\n      result &&\n      !location.endTag &&\n      tail &&\n      tail.position &&\n      tail.position.end\n    ) {\n      result.end = Object.assign({}, tail.position.end)\n    }\n\n    if (state.verbose) {\n      /** @type {Record} */\n      const props = {}\n      /** @type {string} */\n      let key\n\n      if (location.attrs) {\n        for (key in location.attrs) {\n          if (own.call(location.attrs, key)) {\n            props[find(state.schema, key).property] = position(\n              location.attrs[key]\n            )\n          }\n        }\n      }\n\n      node.data = {\n        position: {\n          // @ts-expect-error: assume not `undefined`.\n          opening: position(location.startTag),\n          closing: location.endTag ? position(location.endTag) : null,\n          properties: props\n        }\n      }\n    }\n  }\n\n  return result\n}\n\n/**\n * Turn a p5 location into a position.\n *\n * @param {P5Location} loc\n *   Location.\n * @returns {Position | undefined}\n *   Position or nothing.\n */\nfunction position(loc) {\n  const start = point({\n    line: loc.startLine,\n    column: loc.startCol,\n    offset: loc.startOffset\n  })\n  const end = point({\n    line: loc.endLine,\n    column: loc.endCol,\n    offset: loc.endOffset\n  })\n  // @ts-expect-error `undefined` is fine.\n  return start || end ? {start, end} : undefined\n}\n\n/**\n * Filter out invalid points.\n *\n * @param {Point} point\n *   Point with potentially `undefined` values.\n * @returns {Point | undefined}\n *   Point or nothing.\n */\nfunction point(point) {\n  return point.line && point.column ? point : undefined\n}\n\n/**\n * Check if something is a file.\n *\n * @param {VFile | Options} value\n *   File or options.\n * @returns {value is VFile}\n *   Whether `value` is a file.\n */\nfunction isFile(value) {\n  return 'messages' in value\n}\n","export const errors = {\n  abandonedHeadElementChild: {\n    reason: 'Unexpected metadata element after head',\n    description:\n      'Unexpected element after head. Expected the element before ``',\n    url: false\n  },\n  abruptClosingOfEmptyComment: {\n    reason: 'Unexpected abruptly closed empty comment',\n    description: 'Unexpected `>` or `->`. Expected `-->` to close comments'\n  },\n  abruptDoctypePublicIdentifier: {\n    reason: 'Unexpected abruptly closed public identifier',\n    description:\n      'Unexpected `>`. Expected a closing `\"` or `\\'` after the public identifier'\n  },\n  abruptDoctypeSystemIdentifier: {\n    reason: 'Unexpected abruptly closed system identifier',\n    description:\n      'Unexpected `>`. Expected a closing `\"` or `\\'` after the identifier identifier'\n  },\n  absenceOfDigitsInNumericCharacterReference: {\n    reason: 'Unexpected non-digit at start of numeric character reference',\n    description:\n      'Unexpected `%c`. Expected `[0-9]` for decimal references or `[0-9a-fA-F]` for hexadecimal references'\n  },\n  cdataInHtmlContent: {\n    reason: 'Unexpected CDATA section in HTML',\n    description:\n      'Unexpected `` in HTML. Remove it, use a comment, or encode special characters instead'\n  },\n  characterReferenceOutsideUnicodeRange: {\n    reason: 'Unexpected too big numeric character reference',\n    description:\n      'Unexpectedly high character reference. Expected character references to be at most hexadecimal 10ffff (or decimal 1114111)'\n  },\n  closingOfElementWithOpenChildElements: {\n    reason: 'Unexpected closing tag with open child elements',\n    description:\n      'Unexpectedly closing tag. Expected other tags to be closed first',\n    url: false\n  },\n  controlCharacterInInputStream: {\n    reason: 'Unexpected control character',\n    description:\n      'Unexpected control character `%x`. Expected a non-control code point, 0x00, or ASCII whitespace'\n  },\n  controlCharacterReference: {\n    reason: 'Unexpected control character reference',\n    description:\n      'Unexpectedly control character in reference. Expected a non-control code point, 0x00, or ASCII whitespace'\n  },\n  disallowedContentInNoscriptInHead: {\n    reason: 'Disallowed content inside `<noscript>` in `<head>`',\n    description:\n      'Unexpected text character `%c`. Only use text in `<noscript>`s in `<body>`',\n    url: false\n  },\n  duplicateAttribute: {\n    reason: 'Unexpected duplicate attribute',\n    description:\n      'Unexpectedly double attribute. Expected attributes to occur only once'\n  },\n  endTagWithAttributes: {\n    reason: 'Unexpected attribute on closing tag',\n    description: 'Unexpected attribute. Expected `>` instead'\n  },\n  endTagWithTrailingSolidus: {\n    reason: 'Unexpected slash at end of closing tag',\n    description: 'Unexpected `%c-1`. Expected `>` instead'\n  },\n  endTagWithoutMatchingOpenElement: {\n    reason: 'Unexpected unopened end tag',\n    description: 'Unexpected end tag. Expected no end tag or another end tag',\n    url: false\n  },\n  eofBeforeTagName: {\n    reason: 'Unexpected end of file',\n    description: 'Unexpected end of file. Expected tag name instead'\n  },\n  eofInCdata: {\n    reason: 'Unexpected end of file in CDATA',\n    description: 'Unexpected end of file. Expected `` to close the CDATA'\n  },\n  eofInComment: {\n    reason: 'Unexpected end of file in comment',\n    description: 'Unexpected end of file. Expected `-->` to close the comment'\n  },\n  eofInDoctype: {\n    reason: 'Unexpected end of file in doctype',\n    description:\n      'Unexpected end of file. Expected a valid doctype (such as ``)'\n  },\n  eofInElementThatCanContainOnlyText: {\n    reason: 'Unexpected end of file in element that can only contain text',\n    description: 'Unexpected end of file. Expected text or a closing tag',\n    url: false\n  },\n  eofInScriptHtmlCommentLikeText: {\n    reason: 'Unexpected end of file in comment inside script',\n    description: 'Unexpected end of file. Expected `-->` to close the comment'\n  },\n  eofInTag: {\n    reason: 'Unexpected end of file in tag',\n    description: 'Unexpected end of file. Expected `>` to close the tag'\n  },\n  incorrectlyClosedComment: {\n    reason: 'Incorrectly closed comment',\n    description: 'Unexpected `%c-1`. Expected `-->` to close the comment'\n  },\n  incorrectlyOpenedComment: {\n    reason: 'Incorrectly opened comment',\n    description: 'Unexpected `%c`. Expected ``'\n  },\n  nestedNoscriptInHead: {\n    reason: 'Unexpected nested ``',\n    description:\n      'Unexpected `