From d1da728a406dada61b04f5e37973cbec24c5f8f1 Mon Sep 17 00:00:00 2001 From: Thomas Heijligen Date: Tue, 12 Aug 2025 19:48:10 +0200 Subject: [PATCH 1/4] Thumbnail: Migrate from govips to vipsgen Follow the README [1] of govips and migrate to vipsgen This is a 1:1 port which uses the pregenerated bindings. This works only with libvips 8.17 [1] https://github.com/davidbyttow/govips?tab=readme-ov-file#project-status--future-of-govips --- go.mod | 6 +- go.sum | 26 +- .../pkg/preprocessor/preprocessor_vips.go | 21 +- .../thumbnails/pkg/thumbnail/encoding_vips.go | 10 +- .../pkg/thumbnail/generator_vips.go | 19 +- vendor/github.com/cshum/vipsgen/LICENSE | 21 + .../cshum/vipsgen/pointer/pointer.go | 100 + .../github.com/cshum/vipsgen/vips/callback.go | 76 + .../cshum/vipsgen/vips/connection.c | 48 + .../cshum/vipsgen/vips/connection.go | 97 + .../cshum/vipsgen/vips/connection.h | 19 + vendor/github.com/cshum/vipsgen/vips/image.go | 10694 ++++++++++++++++ vendor/github.com/cshum/vipsgen/vips/types.go | 818 ++ vendor/github.com/cshum/vipsgen/vips/util.c | 25 + vendor/github.com/cshum/vipsgen/vips/util.go | 466 + .../govips.h => cshum/vipsgen/vips/util.h} | 17 +- vendor/github.com/cshum/vipsgen/vips/vips.c | 6091 +++++++++ vendor/github.com/cshum/vipsgen/vips/vips.go | 6260 +++++++++ vendor/github.com/cshum/vipsgen/vips/vips.h | 884 ++ .../github.com/davidbyttow/govips/v2/LICENSE | 24 - .../davidbyttow/govips/v2/vips/arithmetic.c | 71 - .../davidbyttow/govips/v2/vips/arithmetic.go | 176 - .../davidbyttow/govips/v2/vips/arithmetic.h | 20 - .../davidbyttow/govips/v2/vips/color.c | 22 - .../davidbyttow/govips/v2/vips/color.go | 96 - .../davidbyttow/govips/v2/vips/color.h | 10 - .../davidbyttow/govips/v2/vips/composite.go | 27 - .../davidbyttow/govips/v2/vips/conversion.c | 380 - .../davidbyttow/govips/v2/vips/conversion.go | 520 - .../davidbyttow/govips/v2/vips/conversion.h | 70 - .../davidbyttow/govips/v2/vips/convolution.c | 14 - .../davidbyttow/govips/v2/vips/convolution.go | 40 - .../davidbyttow/govips/v2/vips/convolution.h | 9 - .../davidbyttow/govips/v2/vips/create.c | 24 - .../davidbyttow/govips/v2/vips/create.go | 37 - .../davidbyttow/govips/v2/vips/create.h | 12 - .../davidbyttow/govips/v2/vips/draw.c | 24 - .../davidbyttow/govips/v2/vips/draw.go | 21 - .../davidbyttow/govips/v2/vips/draw.h | 7 - .../davidbyttow/govips/v2/vips/error.go | 39 - .../davidbyttow/govips/v2/vips/foreign.c | 578 - .../davidbyttow/govips/v2/vips/foreign.go | 512 - .../davidbyttow/govips/v2/vips/foreign.h | 141 - .../davidbyttow/govips/v2/vips/govips.c | 27 - .../davidbyttow/govips/v2/vips/govips.go | 265 - .../davidbyttow/govips/v2/vips/header.c | 122 - .../davidbyttow/govips/v2/vips/header.go | 289 - .../davidbyttow/govips/v2/vips/header.h | 41 - .../govips/v2/vips/icc_profiles.go | 726 -- .../davidbyttow/govips/v2/vips/image.c | 9 - .../davidbyttow/govips/v2/vips/image.go | 2184 ---- .../davidbyttow/govips/v2/vips/image.h | 8 - .../davidbyttow/govips/v2/vips/label.c | 37 - .../davidbyttow/govips/v2/vips/label.go | 84 - .../davidbyttow/govips/v2/vips/label.h | 21 - .../davidbyttow/govips/v2/vips/lang.go | 49 - .../davidbyttow/govips/v2/vips/lang.h | 4 - .../davidbyttow/govips/v2/vips/logging.go | 98 - .../davidbyttow/govips/v2/vips/math.go | 57 - .../davidbyttow/govips/v2/vips/morphology.c | 6 - .../davidbyttow/govips/v2/vips/morphology.go | 17 - .../davidbyttow/govips/v2/vips/morphology.h | 6 - .../davidbyttow/govips/v2/vips/resample.c | 61 - .../davidbyttow/govips/v2/vips/resample.go | 146 - .../davidbyttow/govips/v2/vips/resample.h | 24 - .../davidbyttow/govips/v2/vips/stats.go | 56 - .../govips/v2/vips/test_resources.go | 6 - vendor/modules.txt | 7 +- 68 files changed, 25653 insertions(+), 7269 deletions(-) create mode 100644 vendor/github.com/cshum/vipsgen/LICENSE create mode 100644 vendor/github.com/cshum/vipsgen/pointer/pointer.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/callback.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/connection.c create mode 100644 vendor/github.com/cshum/vipsgen/vips/connection.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/connection.h create mode 100644 vendor/github.com/cshum/vipsgen/vips/image.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/types.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/util.c create mode 100644 vendor/github.com/cshum/vipsgen/vips/util.go rename vendor/github.com/{davidbyttow/govips/v2/vips/govips.h => cshum/vipsgen/vips/util.h} (55%) create mode 100644 vendor/github.com/cshum/vipsgen/vips/vips.c create mode 100644 vendor/github.com/cshum/vipsgen/vips/vips.go create mode 100644 vendor/github.com/cshum/vipsgen/vips/vips.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/LICENSE delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/color.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/color.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/color.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/composite.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/conversion.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/conversion.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/conversion.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/convolution.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/convolution.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/convolution.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/create.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/create.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/create.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/draw.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/draw.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/draw.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/error.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/foreign.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/foreign.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/foreign.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/govips.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/govips.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/header.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/header.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/header.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/icc_profiles.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/image.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/image.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/image.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/label.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/label.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/label.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/lang.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/lang.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/logging.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/math.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/morphology.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/morphology.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/morphology.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/resample.c delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/resample.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/resample.h delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/stats.go delete mode 100644 vendor/github.com/davidbyttow/govips/v2/vips/test_resources.go diff --git a/go.mod b/go.mod index 0ba51bf3cf..9cddbb1d0b 100644 --- a/go.mod +++ b/go.mod @@ -1,6 +1,8 @@ module github.com/opencloud-eu/opencloud -go 1.24.1 +go 1.24.2 + +toolchain go1.24.5 require ( dario.cat/mergo v1.0.2 @@ -15,7 +17,7 @@ require ( github.com/cenkalti/backoff v2.2.1+incompatible github.com/coreos/go-oidc/v3 v3.14.1 github.com/cs3org/go-cs3apis v0.0.0-20250725064958-2d9caef4db2a - github.com/davidbyttow/govips/v2 v2.16.0 + github.com/cshum/vipsgen v1.1.1 github.com/dhowden/tag v0.0.0-20240417053706-3d75831295e8 github.com/dutchcoders/go-clamd v0.0.0-20170520113014-b970184f4d9e github.com/egirna/icap-client v0.1.1 diff --git a/go.sum b/go.sum index 28c0879525..994765c814 100644 --- a/go.sum +++ b/go.sum @@ -246,6 +246,8 @@ github.com/crewjam/saml v0.4.14 h1:g9FBNx62osKusnFzs3QTN5L9CVA/Egfgm+stJShzw/c= github.com/crewjam/saml v0.4.14/go.mod h1:UVSZCf18jJkk6GpWNVqcyQJMD5HsRugBPf4I1nl2mME= github.com/cs3org/go-cs3apis v0.0.0-20250725064958-2d9caef4db2a h1:4IvTz3MUno/nlgngdyZhkyxzJR/w7+H+2ZXoZQKidgg= github.com/cs3org/go-cs3apis v0.0.0-20250725064958-2d9caef4db2a/go.mod h1:DedpcqXl193qF/08Y04IO0PpxyyMu8+GrkD6kWK2MEQ= +github.com/cshum/vipsgen v1.1.1 h1:uOYVqHE3+zJ8qOJIeEYspJJl64Kpw48MnLkB+FEsMZE= +github.com/cshum/vipsgen v1.1.1/go.mod h1:1GboZQcNmo4NwuNnGogM24m3O+1i6UpnvurqMcsFItE= github.com/cyberdelia/templates v0.0.0-20141128023046-ca7fffd4298c/go.mod h1:GyV+0YP4qX0UQ7r2MoYZ+AvYDp12OF5yg4q8rGnyNh4= github.com/cyphar/filepath-securejoin v0.3.6 h1:4d9N5ykBnSp5Xn2JkhocYDkOpURL/18CYMpo6xB9uWM= github.com/cyphar/filepath-securejoin v0.3.6/go.mod h1:Sdj7gXlvMcPZsbhwhQ33GguGLDGQL7h7bg04C/+u9jI= @@ -253,8 +255,6 @@ github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSs github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc h1:U9qPSI2PIWSS1VwoXQT9A3Wy9MM3WgvqSxFWenqJduM= github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= -github.com/davidbyttow/govips/v2 v2.16.0 h1:1nH/Rbx8qZP1hd+oYL9fYQjAnm1+KorX9s07ZGseQmo= -github.com/davidbyttow/govips/v2 v2.16.0/go.mod h1:clH5/IDVmG5eVyc23qYpyi7kmOT0B/1QNTKtci4RkyM= github.com/deckarep/golang-set v1.8.0 h1:sk9/l/KqpunDwP7pSjUg0keiOOLEnOBHzykLrsPppp4= github.com/deckarep/golang-set v1.8.0/go.mod h1:5nI87KwE7wgsBU1F4GKAw2Qod7p5kyS383rP6+o6qqo= github.com/deepmap/oapi-codegen v1.3.11/go.mod h1:suMvK7+rKlx3+tpa8ByptmvoXbAV70wERKTOGH3hLp0= @@ -519,7 +519,6 @@ github.com/google/go-cmp v0.5.4/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/ github.com/google/go-cmp v0.5.5/go.mod h1:v8dTdLbMG2kIc/vJvl+f65V22dbkXbowE6jgT/gNBxE= github.com/google/go-cmp v0.5.8/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= github.com/google/go-cmp v0.5.9/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= -github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= github.com/google/go-cmp v0.7.0 h1:wk8382ETsv4JYUZwIsn6YpYiWiBsYLSJiTsyBybVuN8= github.com/google/go-cmp v0.7.0/go.mod h1:pXiqmnSA92OHEEa9HXL2W4E7lf9JzCmGVUdgjX3N/iU= github.com/google/go-github/v32 v32.1.0/go.mod h1:rIEpZD9CTDQwDK9GDrtMTycQNA4JU3qBsCizh3q2WCI= @@ -830,7 +829,6 @@ github.com/nats-io/nkeys v0.4.11/go.mod h1:szDimtgmfOi9n25JpfIdGw12tZFYXqhGxjhVx github.com/nats-io/nuid v1.0.1 h1:5iA8DT8V7q8WK2EScv2padNa/rTESc1KdnPw4TC2paw= github.com/nats-io/nuid v1.0.1/go.mod h1:19wcPz3Ph3q0Jbyiqsd0kePYG7A95tJPxeL+1OSON2c= github.com/nbio/st v0.0.0-20140626010706-e9e8d9816f32/go.mod h1:9wM+0iRr9ahx58uYLpLIr5fm8diHn0JbqRycJi6w0Ms= -github.com/niemeyer/pretty v0.0.0-20200227124842-a10e7caefd8e/go.mod h1:zD1mROLANZcx1PVRCS0qkT7pwLkGfwJo4zjcN/Tysno= github.com/nrdcg/auroradns v1.0.1/go.mod h1:y4pc0i9QXYlFCWrhWrUSIETnZgrf4KuwjDIWmmXo3JI= github.com/nrdcg/desec v0.5.0/go.mod h1:2ejvMazkav1VdDbv2HeQO7w+Ta1CGHqzQr27ZBYTuEQ= github.com/nrdcg/dnspod-go v0.4.0/go.mod h1:vZSoFSFeQVm2gWLMkyX61LZ8HI3BaqtHZWgPTGKr6KQ= @@ -1234,11 +1232,9 @@ golang.org/x/crypto v0.0.0-20201016220609-9e8e0b390897/go.mod h1:LzIPMQfyMNhhGPh golang.org/x/crypto v0.0.0-20201221181555-eec23a3978ad/go.mod h1:jdWPYTVW3xRLrWPugEBEK3UY2ZEsg3UU495nc5E+M+I= golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= golang.org/x/crypto v0.0.0-20220622213112-05595931fe9d/go.mod h1:IxCIyHEi3zRg3s0A5j5BB6A9Jmi73HwBIUl50j+osU4= -golang.org/x/crypto v0.13.0/go.mod h1:y6Z2r+Rw4iayiXXAIxJIDAJ1zMW4yaTpebo8fPOliYc= golang.org/x/crypto v0.14.0/go.mod h1:MVFd36DqK4CsrnJYDkBA3VC4m2GkXAM0PvzMCn4JQf4= golang.org/x/crypto v0.19.0/go.mod h1:Iy9bg/ha4yyC70EfRS8jz+B6ybOBKMaSxLj6P6oBDfU= golang.org/x/crypto v0.21.0/go.mod h1:0BP7YvVV9gBbVKyeTG0Gyn+gZm94bibOW5BjDEYAOMs= -golang.org/x/crypto v0.23.0/go.mod h1:CKFgDieR+mRhux2Lsu27y0fO304Db0wZe70UKqHu0v8= golang.org/x/crypto v0.40.0 h1:r4x+VvoG5Fm+eJcxMaY8CQM7Lb0l1lsmjGBQ6s8BfKM= golang.org/x/crypto v0.40.0/go.mod h1:Qr1vMER5WyS2dfPHAlsOj01wgLbsyWtFn/aY+5+ZdxY= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= @@ -1255,7 +1251,6 @@ golang.org/x/exp v0.0.0-20250210185358-939b2ce775ac h1:l5+whBCLH3iH2ZNHYLbAe58bo golang.org/x/exp v0.0.0-20250210185358-939b2ce775ac/go.mod h1:hH+7mtFmImwwcMvScyxUhjuVHR3HGaDPMn9rMSUUbxo= golang.org/x/image v0.0.0-20190227222117-0694c2d4d067/go.mod h1:kZ7UVZpmo3dzQBMxlp+ypCbDeSB+sBbTgSJuh5dn5js= golang.org/x/image v0.0.0-20190802002840-cff245a6509b/go.mod h1:FeLwcggjj3mMvU+oOTbSwawSJRM1uh48EjtB4UJZlP0= -golang.org/x/image v0.18.0/go.mod h1:4yyo5vMFQjVjUcVk4jEQcU9MGy/rulF5WvUILseCM2E= golang.org/x/image v0.28.0 h1:gdem5JW1OLS4FbkWgLO+7ZeFzYtL3xClb97GaUzYMFE= golang.org/x/image v0.28.0/go.mod h1:GUJYXtnGKEUgggyzh+Vxt+AviiCcyiwpsl8iQ8MvwGY= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= @@ -1279,9 +1274,6 @@ golang.org/x/mod v0.2.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.3.0/go.mod h1:s0Qsj1ACt9ePp/hMypM3fl4fZqREWJwdYDEqhRiZZUA= golang.org/x/mod v0.6.0-dev.0.20220419223038-86c51ed26bb4/go.mod h1:jJ57K6gSWd91VN4djpZkiMVwK6gcyfeH4XE8wZrZaV4= golang.org/x/mod v0.8.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= -golang.org/x/mod v0.12.0/go.mod h1:iBbtSCu2XBx23ZKBPSOrRkjjQPZFPuis4dIYUhu/chs= -golang.org/x/mod v0.15.0/go.mod h1:hTbmBsO62+eylJbnUtE2MGJUyE7QWk4xUqPFrRgJ+7c= -golang.org/x/mod v0.17.0/go.mod h1:hTbmBsO62+eylJbnUtE2MGJUyE7QWk4xUqPFrRgJ+7c= golang.org/x/mod v0.25.0 h1:n7a+ZbQKQA/Ysbyb0/6IbB1H/X41mKgbhfv7AfG/44w= golang.org/x/mod v0.25.0/go.mod h1:IXM97Txy2VM4PJ3gI61r1YEk/gAj6zAHN3AdZt6S9Ww= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= @@ -1333,11 +1325,9 @@ golang.org/x/net v0.0.0-20220225172249-27dd8689420f/go.mod h1:CfG3xpIq0wQ8r1q4Su golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg= -golang.org/x/net v0.15.0/go.mod h1:idbUs1IY1+zTqbi8yxTbhexhEEk5ur9LInksu6HrEpk= golang.org/x/net v0.17.0/go.mod h1:NxSsAGuq816PNPmqtQdLE42eU2Fs7NoRIZrHJAlaCOE= golang.org/x/net v0.21.0/go.mod h1:bIjVDfnllIU7BJ2DNgfnXvpSvtn8VRwhlsaeUTyUS44= golang.org/x/net v0.23.0/go.mod h1:JKghWKKOSdJwpW2GEx0Ja7fmaKnMsbu+MWVZTokSYmg= -golang.org/x/net v0.25.0/go.mod h1:JkAGAh7GEvH74S6FOH42FLoXpXbE/aqXSrIQjXgsiwM= golang.org/x/net v0.42.0 h1:jzkYrhi3YQWD6MLBJcsklgQsoAcw89EcZbJw8Z614hs= golang.org/x/net v0.42.0/go.mod h1:FF1RA5d3u7nAYA4z2TkclSCKh68eSXtiFwcWQpPXdt8= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= @@ -1363,9 +1353,6 @@ golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJ golang.org/x/sync v0.0.0-20220601150217-0de741cfad7f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= -golang.org/x/sync v0.3.0/go.mod h1:FU7BRWz2tNW+3quACPkgCx/L+uEAv1htQ0V83Z9Rj+Y= -golang.org/x/sync v0.6.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk= -golang.org/x/sync v0.7.0/go.mod h1:Czt+wKu1gCyEFDUtn0jG5QVvpJ6rzVqr5aXyt9drQfk= golang.org/x/sync v0.16.0 h1:ycBJEhp9p4vXvUZNszeOq0kGTPghopOL8q0fq3vstxw= golang.org/x/sync v0.16.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA= golang.org/x/sys v0.0.0-20180622082034-63fc586f45fe/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= @@ -1446,21 +1433,17 @@ golang.org/x/sys v0.12.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.13.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= golang.org/x/sys v0.17.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/sys v0.18.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= -golang.org/x/sys v0.20.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/sys v0.21.0/go.mod h1:/VUhepiaJMQUp4+oa/7Zr1D23ma6VTLIYjOOTFZPUcA= golang.org/x/sys v0.34.0 h1:H5Y5sJ2L2JRdyv7ROF1he/lPdvFsd0mJHFw2ThKHxLA= golang.org/x/sys v0.34.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= -golang.org/x/telemetry v0.0.0-20240228155512-f48c80bd79b2/go.mod h1:TeRTkGYfJXctD9OcfyVLyj2J3IxLnKwHJR8f4D8a3YE= golang.org/x/term v0.0.0-20201117132131-f5c789dd3221/go.mod h1:Nr5EML6q2oocZ2LXRh80K7BxOlk5/8JxuGnuhpl+muw= golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k= golang.org/x/term v0.8.0/go.mod h1:xPskH00ivmX89bAKVGSKKtLOWNx2+17Eiy94tnKShWo= -golang.org/x/term v0.12.0/go.mod h1:owVbMEjm3cBLCHdkQu9b1opXd4ETQWc3BhuQGKgXgvU= golang.org/x/term v0.13.0/go.mod h1:LTmsnFJwVN6bCy1rVCoS+qHT1HhALEFxKncY3WNNh4U= golang.org/x/term v0.17.0/go.mod h1:lLRBjIVuehSbZlaOtGMbcMncT+aqLLLmKrsjNrUguwk= golang.org/x/term v0.18.0/go.mod h1:ILwASektA3OnRv7amZ1xhE/KTR+u50pbXfZ03+6Nx58= -golang.org/x/term v0.20.0/go.mod h1:8UkIAJTvZgivsXaD6/pH6U9ecQzZ45awqEOzuCvwpFY= golang.org/x/term v0.33.0 h1:NuFncQrRcaRvVmgRkvM3j/F00gWIAlcmlB8ACEKmGIg= golang.org/x/term v0.33.0/go.mod h1:s18+ql9tYWp1IfpV9DmCtQDDSRBUjKaw9M1eAv5UeF0= golang.org/x/text v0.0.0-20170915032832-14c0d48ead0c/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= @@ -1476,8 +1459,6 @@ golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= golang.org/x/text v0.13.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= golang.org/x/text v0.14.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU= -golang.org/x/text v0.15.0/go.mod h1:18ZOQIKpY8NJVqYksKHtTdi31H5itFRjB5/qKTNYzSU= -golang.org/x/text v0.16.0/go.mod h1:GhwF1Be+LQoKShO3cGOHzqOgRrGaYc9AvblQOmPVHnI= golang.org/x/text v0.27.0 h1:4fGWRpyh641NLlecmyl4LOe6yDdfaYNrGb2zdfo4JV4= golang.org/x/text v0.27.0/go.mod h1:1D28KMCvyooCX9hBiosv5Tz/+YLxj0j7XhWjpSUF7CU= golang.org/x/time v0.0.0-20181108054448-85acf8d2951c/go.mod h1:tRJNPiyCQ0inRvYxbN9jk5I+vvW/OXSQhTDSoE431IQ= @@ -1540,8 +1521,6 @@ golang.org/x/tools v0.0.0-20210106214847-113979e3529a/go.mod h1:emZCQorbCU4vsT4f golang.org/x/tools v0.0.0-20210112230658-8b4aab62c064/go.mod h1:emZCQorbCU4vsT4fOWvOPXz4eW1wZW4PmDk9uLelYpA= golang.org/x/tools v0.1.12/go.mod h1:hNGJHUnrk76NpqgfD5Aqm5Crs+Hm0VOH/i9J2+nxYbc= golang.org/x/tools v0.6.0/go.mod h1:Xwgl3UAJ/d3gWutnCtw505GrjyAbvKui8lOU390QaIU= -golang.org/x/tools v0.13.0/go.mod h1:HvlwmtVNQAhOuCjW7xxvovg8wbNq7LwfXh/k7wXUl58= -golang.org/x/tools v0.21.1-0.20240508182429-e35e4ccd0d2d/go.mod h1:aiJjzUbINMkxbQROHiO6hDPo2LHcIPhhQsa9DLh0yGk= golang.org/x/tools v0.34.0 h1:qIpSLOxeCYGg9TrcJokLBG4KFA6d795g0xkBkiESGlo= golang.org/x/tools v0.34.0/go.mod h1:pAP9OwEaY1CAW3HOmg3hLZC5Z0CCmzjAF2UQMSqNARg= golang.org/x/xerrors v0.0.0-20190717185122-a985d3407aa7/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= @@ -1650,7 +1629,6 @@ gopkg.in/cenkalti/backoff.v1 v1.1.0/go.mod h1:J6Vskwqd+OMVJl8C33mmtxTBs2gyzfv7UD gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20190902080502-41f04d3bba15/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= -gopkg.in/check.v1 v1.0.0-20200902074654-038fdea0a05b/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk= gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q= gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= diff --git a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go index 087bafb1b7..244e42007b 100644 --- a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go +++ b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go @@ -5,16 +5,31 @@ package preprocessor import ( "io" - "github.com/davidbyttow/govips/v2/vips" + "github.com/cshum/vipsgen/vips" ) func init() { - vips.LoggingSettings(nil, vips.LogLevelError) + // vips.LoggingSettings(nil, vips.LogLevelError) + + // TODO: Hookup logging + // vips.SetLogging(nil, vips.LogLevelDebug) } type ImageDecoder struct{} func (v ImageDecoder) Convert(r io.Reader) (interface{}, error) { - img, err := vips.NewImageFromReader(r) + buf, err := io.ReadAll(r) + if err != nil { + return nil, err + } + img, err := vips.NewImageFromBuffer(buf, nil) + + // Alternative with vips 1.8+ + // First test the RAW decoder, this is not implemented in NewImageFromBuffer + // + // img, err := vips.NewDcrawloadBuffer(buf, nil) + // if err != nil { + // img, err = vips.NewImageFromBuffer(buf, nil) + // } return img, err } diff --git a/services/thumbnails/pkg/thumbnail/encoding_vips.go b/services/thumbnails/pkg/thumbnail/encoding_vips.go index f9a2c920be..e72327c858 100644 --- a/services/thumbnails/pkg/thumbnail/encoding_vips.go +++ b/services/thumbnails/pkg/thumbnail/encoding_vips.go @@ -5,7 +5,7 @@ package thumbnail import ( "io" - "github.com/davidbyttow/govips/v2/vips" + "github.com/cshum/vipsgen/vips" "github.com/opencloud-eu/opencloud/services/thumbnails/pkg/errors" ) @@ -14,12 +14,12 @@ type PngEncoder struct{} // Encode encodes to png format func (e PngEncoder) Encode(w io.Writer, img interface{}) error { - m, ok := img.(*vips.ImageRef) + m, ok := img.(*vips.Image) if !ok { return errors.ErrInvalidType } - buf, _, err := m.ExportPng(vips.NewPngExportParams()) + buf, err := m.PngsaveBuffer(nil) if err != nil { return err } @@ -42,12 +42,12 @@ type JpegEncoder struct{} // Encode encodes to jpg func (e JpegEncoder) Encode(w io.Writer, img interface{}) error { - m, ok := img.(*vips.ImageRef) + m, ok := img.(*vips.Image) if !ok { return errors.ErrInvalidType } - buf, _, err := m.ExportJpeg(vips.NewJpegExportParams()) + buf, err := m.JpegsaveBuffer(nil) if err != nil { return err } diff --git a/services/thumbnails/pkg/thumbnail/generator_vips.go b/services/thumbnails/pkg/thumbnail/generator_vips.go index 129315df77..3a4daddbd9 100644 --- a/services/thumbnails/pkg/thumbnail/generator_vips.go +++ b/services/thumbnails/pkg/thumbnail/generator_vips.go @@ -7,7 +7,7 @@ import ( "image" "strings" - "github.com/davidbyttow/govips/v2/vips" + "github.com/cshum/vipsgen/vips" "github.com/opencloud-eu/opencloud/services/thumbnails/pkg/errors" "golang.org/x/image/bmp" ) @@ -39,7 +39,7 @@ func (g SimpleGenerator) ProcessorID() string { // Generate generates a alternative image version. func (g SimpleGenerator) Generate(size image.Rectangle, img interface{}) (interface{}, error) { - var m *vips.ImageRef + var m *vips.Image var err error switch img.(type) { case *image.RGBA: @@ -48,22 +48,21 @@ func (g SimpleGenerator) Generate(size image.Rectangle, img interface{}) (interf if err = bmp.Encode(&buf, img.(*image.RGBA)); err != nil { return nil, err } - m, err = vips.NewImageFromReader(&buf) + m, err = vips.NewImageFromBuffer(buf.Bytes(), nil) if err != nil { return nil, err } - case *vips.ImageRef: - m = img.(*vips.ImageRef) + case *vips.Image: + m = img.(*vips.Image) default: return nil, errors.ErrInvalidType } - - if err := m.ThumbnailWithSize(size.Dx(), 0, g.crop, g.size); err != nil { + if err := m.ThumbnailImage(size.Dx(), &vips.ThumbnailImageOptions{Crop: g.crop, Size: g.size}); err != nil { return nil, err } - if err := m.RemoveMetadata(); err != nil { + if err := m.RemoveExif(); err != nil { return nil, err } @@ -75,8 +74,8 @@ func (g SimpleGenerator) Dimensions(img interface{}) (image.Rectangle, error) { case *image.RGBA: m := img.(*image.RGBA) return m.Bounds(), nil - case *vips.ImageRef: - m := img.(*vips.ImageRef) + case *vips.Image: + m := img.(*vips.Image) return image.Rect(0, 0, m.Width(), m.Height()), nil default: return image.Rectangle{}, errors.ErrInvalidType diff --git a/vendor/github.com/cshum/vipsgen/LICENSE b/vendor/github.com/cshum/vipsgen/LICENSE new file mode 100644 index 0000000000..e202460394 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2025 Adrian Shum and contributors + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/vendor/github.com/cshum/vipsgen/pointer/pointer.go b/vendor/github.com/cshum/vipsgen/pointer/pointer.go new file mode 100644 index 0000000000..5673d1d9d5 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/pointer/pointer.go @@ -0,0 +1,100 @@ +package pointer + +// #include +import "C" + +import ( + "sync" + "unsafe" +) + +const blockSize = 1024 + +var ( + mutex sync.RWMutex + store = map[unsafe.Pointer]interface{}{} + free []unsafe.Pointer + blocks []unsafe.Pointer +) + +func allocMem() { + mem := C.malloc(blockSize) + if mem == nil { + panic("can't allocate memory block for C pointers") + } + blocks = append(blocks, mem) + for i := 0; i < blockSize; i++ { + p := unsafe.Pointer(uintptr(mem) + uintptr(blockSize-1-i)) + free = append(free, p) + } +} + +func getPtr() unsafe.Pointer { + // Generate real fake C pointer. + // This pointer will not store any data, but will be used for indexing + // purposes. Since Go doesn't allow to cast dangling pointer to + // unsafe.Pointer, we do really allocate memory. Why we need indexing? Because + // Go doest allow C code to store pointers to Go data. + if len(free) == 0 { + allocMem() + } + n := len(free) - 1 + p := free[n] + free = free[:n] + return p +} + +// Save an object in the storage and return an index pointer to it. +func Save(v interface{}) unsafe.Pointer { + if v == nil { + return nil + } + + mutex.Lock() + ptr := getPtr() + store[ptr] = v + mutex.Unlock() + + return ptr +} + +// Restore an object from the storage by its index pointer. +func Restore(ptr unsafe.Pointer) (v interface{}) { + if ptr == nil { + return nil + } + + mutex.RLock() + v = store[ptr] + mutex.RUnlock() + return +} + +// Unref removes an object from the storage and returns the index pointer to the +// pool for reuse. +func Unref(ptr unsafe.Pointer) { + if ptr == nil { + return + } + + mutex.Lock() + if _, ok := store[ptr]; ok { + delete(store, ptr) + free = append(free, ptr) + } + mutex.Unlock() +} + +// Clear storage and free all memory +func Clear() { + mutex.Lock() + for p := range store { + delete(store, p) + } + free = nil + for _, p := range blocks { + C.free(p) + } + blocks = nil + mutex.Unlock() +} diff --git a/vendor/github.com/cshum/vipsgen/vips/callback.go b/vendor/github.com/cshum/vipsgen/vips/callback.go new file mode 100644 index 0000000000..0644cd9be4 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/callback.go @@ -0,0 +1,76 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +package vips + +import "C" +import ( + "github.com/cshum/vipsgen/pointer" + "io" + "reflect" + "unsafe" +) + +//export goLoggingHandler +func goLoggingHandler(domain *C.char, level C.int, message *C.char) { + log(C.GoString(domain), LogLevel(level), C.GoString(message)) +} + +//export goSourceRead +func goSourceRead( + ptr unsafe.Pointer, buffer unsafe.Pointer, size C.longlong, +) C.longlong { + src, ok := pointer.Restore(ptr).(*Source) + if !ok { + return -1 + } + sh := &reflect.SliceHeader{ + Data: uintptr(buffer), + Len: int(size), + Cap: int(size), + } + buf := *(*[]byte)(unsafe.Pointer(sh)) + n, err := src.reader.Read(buf) + if err == io.EOF { + return C.longlong(n) + } else if err != nil { + return -1 + } + return C.longlong(n) +} + +//export goSourceSeek +func goSourceSeek( + ptr unsafe.Pointer, offset C.longlong, whence int, +) C.longlong { + src, ok := pointer.Restore(ptr).(*Source) + if ok && src.seeker != nil { + switch whence { + case io.SeekStart, io.SeekCurrent, io.SeekEnd: + if n, err := src.seeker.Seek(int64(offset), whence); err == nil { + return C.longlong(n) + } + } + } + return -1 +} + +//export goTargetWrite +func goTargetWrite( + ptr unsafe.Pointer, buffer unsafe.Pointer, size C.longlong, +) C.longlong { + target, ok := pointer.Restore(ptr).(*Target) + if !ok { + return -1 + } + sh := &reflect.SliceHeader{ + Data: uintptr(buffer), + Len: int(size), + Cap: int(size), + } + buf := *(*[]byte)(unsafe.Pointer(sh)) + n, err := target.writer.Write(buf) + if err != nil { + return -1 + } + return C.longlong(n) +} diff --git a/vendor/github.com/cshum/vipsgen/vips/connection.c b/vendor/github.com/cshum/vipsgen/vips/connection.c new file mode 100644 index 0000000000..dbe0a15dcf --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/connection.c @@ -0,0 +1,48 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +#include "connection.h" + +static gint64 go_read(VipsSourceCustom *source_custom, void *buffer, gint64 length, void* ptr) +{ + return goSourceRead(ptr, buffer, length); +} + +static gint64 go_seek(VipsSourceCustom *source_custom, gint64 offset, int whence, void* ptr) +{ + return goSourceSeek(ptr, offset, whence); +} + +static gint64 go_write(VipsTargetCustom *target_custom, void *buffer, gint64 length, void* ptr) +{ + return goTargetWrite(ptr, buffer, length); +} + +VipsSourceCustom * create_go_custom_source(void* ptr) +{ + VipsSourceCustom * source_custom = vips_source_custom_new(); + g_signal_connect(source_custom, "read", G_CALLBACK(go_read), ptr); + return source_custom; +} + +VipsSourceCustom * create_go_custom_source_with_seek(void* ptr) +{ + VipsSourceCustom * source_custom = vips_source_custom_new(); + g_signal_connect(source_custom, "read", G_CALLBACK(go_read), ptr); + g_signal_connect(source_custom, "seek", G_CALLBACK(go_seek), ptr); + return source_custom; +} + +VipsTargetCustom * create_go_custom_target(void* ptr) +{ + VipsTargetCustom * target_custom = vips_target_custom_new(); + g_signal_connect(target_custom, "write", G_CALLBACK(go_write), ptr); + return target_custom; +} + +void clear_source(VipsSourceCustom **source_custom) { + if (G_IS_OBJECT(*source_custom)) g_clear_object(source_custom); +} + +void clear_target(VipsTargetCustom **target_custom) { + if (G_IS_OBJECT(*target_custom)) g_clear_object(target_custom); +} diff --git a/vendor/github.com/cshum/vipsgen/vips/connection.go b/vendor/github.com/cshum/vipsgen/vips/connection.go new file mode 100644 index 0000000000..3a92a2381c --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/connection.go @@ -0,0 +1,97 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +package vips + +// #include "connection.h" +import "C" +import ( + "fmt" + "github.com/cshum/vipsgen/pointer" + "io" + "sync" + "unsafe" +) + +// Source contains a libvips VipsSourceCustom and manages its lifecycle. +type Source struct { + reader io.ReadCloser + seeker io.Seeker + src *C.VipsSourceCustom + ptr unsafe.Pointer + lock sync.Mutex +} + +// NewSource creates Source from reader +func NewSource(reader io.ReadCloser) *Source { + Startup(nil) + s := &Source{reader: reader} + seeker, ok := reader.(io.ReadSeeker) + if ok { + s.seeker = seeker + s.ptr = pointer.Save(s) + s.src = C.create_go_custom_source_with_seek(s.ptr) + } else { + s.ptr = pointer.Save(s) + s.src = C.create_go_custom_source(s.ptr) + } + return s +} + +// Close source +func (s *Source) Close() { + if s == nil { + return + } + s.lock.Lock() + if s.ptr != nil { + C.clear_source(&s.src) + pointer.Unref(s.ptr) + s.ptr = nil + s.lock.Unlock() + if s.reader != nil { + _ = s.reader.Close() + s.reader = nil + } + log("vipsgen", LogLevelDebug, fmt.Sprintf("closing source %p", s)) + } else { + s.lock.Unlock() + } +} + +// Target contains a libvips VipsTargetCustom and manages its lifecycle. +type Target struct { + writer io.WriteCloser + target *C.VipsTargetCustom + ptr unsafe.Pointer + lock sync.Mutex +} + +// NewTarget creates Target from writer +func NewTarget(writer io.WriteCloser) *Target { + Startup(nil) + t := &Target{writer: writer} + t.ptr = pointer.Save(t) + t.target = C.create_go_custom_target(t.ptr) + return t +} + +// Close target +func (t *Target) Close() { + if t == nil { + return + } + t.lock.Lock() + if t.ptr != nil { + C.clear_target(&t.target) + pointer.Unref(t.ptr) + t.ptr = nil + t.lock.Unlock() + if t.writer != nil { + _ = t.writer.Close() + t.writer = nil + } + log("vipsgen", LogLevelDebug, fmt.Sprintf("closing target %p", t)) + } else { + t.lock.Unlock() + } +} diff --git a/vendor/github.com/cshum/vipsgen/vips/connection.h b/vendor/github.com/cshum/vipsgen/vips/connection.h new file mode 100644 index 0000000000..760d52983e --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/connection.h @@ -0,0 +1,19 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +#include +#include + +extern long long goSourceRead(void*, void *, long long); +extern long long goSourceSeek(void*, long long, int); +extern long long goTargetWrite(void*, void *, long long); + +static gint64 go_read(VipsSourceCustom *source_custom, void *buffer, gint64 length, void* ptr); +static gint64 go_seek(VipsSourceCustom *source_custom, gint64 offset, int whence, void* ptr); +static gint64 go_write(VipsTargetCustom *target_custom, void *buffer, gint64 length, void* ptr); + +VipsSourceCustom * create_go_custom_source(void* ptr); +VipsSourceCustom * create_go_custom_source_with_seek(void* ptr); +VipsTargetCustom * create_go_custom_target(void* ptr); + +void clear_source(VipsSourceCustom **source_custom); +void clear_target(VipsTargetCustom **target_custom); diff --git a/vendor/github.com/cshum/vipsgen/vips/image.go b/vendor/github.com/cshum/vipsgen/vips/image.go new file mode 100644 index 0000000000..944fe81e4f --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/image.go @@ -0,0 +1,10694 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +package vips + +// #include "vips.h" +import "C" + +import ( + "fmt" + "strconv" + "strings" + "sync" +) + +// Image contains a libvips image and manages its lifecycle. +type Image struct { + // NOTE: We keep a reference to this so that the input buffer is + // never garbage collected during processing. Some image loaders use random + // access transcoding and therefore need the original buffer to be in memory. + buf []byte + image *C.VipsImage + format ImageType + lock sync.Mutex + + pageHeight int // cached page height +} + + +// AnalyzeloadOptions optional arguments for vips_analyzeload +type AnalyzeloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultAnalyzeloadOptions creates default value for vips_analyzeload optional arguments +func DefaultAnalyzeloadOptions() *AnalyzeloadOptions { + return &AnalyzeloadOptions{ + } +} + +// NewAnalyzeload vips_analyzeload load an Analyze6 image +// +// The filename specifies filename to load from. +func NewAnalyzeload(filename string, options *AnalyzeloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenAnalyzeloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeAnalyze, nil), nil + } + vipsImage, err := vipsgenAnalyzeload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeAnalyze, nil), nil +} + +// ArrayjoinOptions optional arguments for vips_arrayjoin +type ArrayjoinOptions struct { + // Across Number of images across grid + Across int + // Shim Pixels between images + Shim int + // Background Colour for new pixels + Background []float64 + // Halign Align on the left, centre or right + Halign Align + // Valign Align on the top, centre or bottom + Valign Align + // Hspacing Horizontal spacing between images + Hspacing int + // Vspacing Vertical spacing between images + Vspacing int +} + +// DefaultArrayjoinOptions creates default value for vips_arrayjoin optional arguments +func DefaultArrayjoinOptions() *ArrayjoinOptions { + return &ArrayjoinOptions{ + Across: 1, + Hspacing: 1, + Vspacing: 1, + } +} + +// NewArrayjoin vips_arrayjoin join an array of images +// +// The in specifies array of input images. +func NewArrayjoin(in []*Image, options *ArrayjoinOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenArrayjoinWithOptions(convertImagesToVipsImages(in), options.Across, options.Shim, options.Background, options.Halign, options.Valign, options.Hspacing, options.Vspacing) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenArrayjoin(convertImagesToVipsImages(in)) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + + +// NewBandjoin vips_bandjoin bandwise join a set of images +// +// The in specifies array of input images. +func NewBandjoin(in []*Image) (*Image, error) { + Startup(nil) + vipsImage, err := vipsgenBandjoin(convertImagesToVipsImages(in)) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// BandrankOptions optional arguments for vips_bandrank +type BandrankOptions struct { + // Index Select this band element from sorted list + Index int +} + +// DefaultBandrankOptions creates default value for vips_bandrank optional arguments +func DefaultBandrankOptions() *BandrankOptions { + return &BandrankOptions{ + Index: -1, + } +} + +// NewBandrank vips_bandrank band-wise rank of a set of images +// +// The in specifies array of input images. +func NewBandrank(in []*Image, options *BandrankOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenBandrankWithOptions(convertImagesToVipsImages(in), options.Index) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenBandrank(convertImagesToVipsImages(in)) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// BlackOptions optional arguments for vips_black +type BlackOptions struct { + // Bands Number of bands in image + Bands int +} + +// DefaultBlackOptions creates default value for vips_black optional arguments +func DefaultBlackOptions() *BlackOptions { + return &BlackOptions{ + Bands: 1, + } +} + +// NewBlack vips_black make a black image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewBlack(width int, height int, options *BlackOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenBlackWithOptions(width, height, options.Bands) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenBlack(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// CompositeOptions optional arguments for vips_composite +type CompositeOptions struct { + // X Array of x coordinates to join at + X []int + // Y Array of y coordinates to join at + Y []int + // CompositingSpace Composite images in this colour space + CompositingSpace Interpretation + // Premultiplied Images have premultiplied alpha + Premultiplied bool +} + +// DefaultCompositeOptions creates default value for vips_composite optional arguments +func DefaultCompositeOptions() *CompositeOptions { + return &CompositeOptions{ + CompositingSpace: Interpretation(22), + } +} + +// NewComposite vips_composite blend an array of images with an array of blend modes +// +// The in specifies array of input images. +// The mode specifies array of VipsBlendMode to join with. +func NewComposite(in []*Image, mode []BlendMode, options *CompositeOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenCompositeWithOptions(convertImagesToVipsImages(in), mode, options.X, options.Y, options.CompositingSpace, options.Premultiplied) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenComposite(convertImagesToVipsImages(in), mode) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// CsvloadOptions optional arguments for vips_csvload +type CsvloadOptions struct { + // Skip Skip this many lines at the start of the file + Skip int + // Lines Read this many lines from the file + Lines int + // Whitespace Set of whitespace characters + Whitespace string + // Separator Set of separator characters + Separator string + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultCsvloadOptions creates default value for vips_csvload optional arguments +func DefaultCsvloadOptions() *CsvloadOptions { + return &CsvloadOptions{ + Lines: -1, + Whitespace: " ", + Separator: ";,\t", + } +} + +// NewCsvload vips_csvload load csv +// +// The filename specifies filename to load from. +func NewCsvload(filename string, options *CsvloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenCsvloadWithOptions(filename, options.Skip, options.Lines, options.Whitespace, options.Separator, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeCsv, nil), nil + } + vipsImage, err := vipsgenCsvload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeCsv, nil), nil +} + +// CsvloadSourceOptions optional arguments for vips_csvload_source +type CsvloadSourceOptions struct { + // Skip Skip this many lines at the start of the file + Skip int + // Lines Read this many lines from the file + Lines int + // Whitespace Set of whitespace characters + Whitespace string + // Separator Set of separator characters + Separator string + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultCsvloadSourceOptions creates default value for vips_csvload_source optional arguments +func DefaultCsvloadSourceOptions() *CsvloadSourceOptions { + return &CsvloadSourceOptions{ + Lines: -1, + Whitespace: " ", + Separator: ";,\t", + } +} + +// NewCsvloadSource vips_csvload_source load csv +// +// The source specifies source to load from. +func NewCsvloadSource(source *Source, options *CsvloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenCsvloadSourceWithOptions(source.src, options.Skip, options.Lines, options.Whitespace, options.Separator, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeCsv, nil), nil + } + vipsImage, err := vipsgenCsvloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeCsv, nil), nil +} + +// EyeOptions optional arguments for vips_eye +type EyeOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Factor Maximum spatial frequency + Factor float64 +} + +// DefaultEyeOptions creates default value for vips_eye optional arguments +func DefaultEyeOptions() *EyeOptions { + return &EyeOptions{ + Factor: 0.5, + } +} + +// NewEye vips_eye make an image showing the eye's spatial response +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewEye(width int, height int, options *EyeOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenEyeWithOptions(width, height, options.Uchar, options.Factor) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenEye(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// FitsloadOptions optional arguments for vips_fitsload +type FitsloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultFitsloadOptions creates default value for vips_fitsload optional arguments +func DefaultFitsloadOptions() *FitsloadOptions { + return &FitsloadOptions{ + } +} + +// NewFitsload vips_fitsload load a FITS image +// +// The filename specifies filename to load from. +func NewFitsload(filename string, options *FitsloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenFitsloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeFits, nil), nil + } + vipsImage, err := vipsgenFitsload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeFits, nil), nil +} + + +// NewFractsurf vips_fractsurf make a fractal surface +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The fractalDimension specifies fractal dimension. +func NewFractsurf(width int, height int, fractalDimension float64) (*Image, error) { + Startup(nil) + vipsImage, err := vipsgenFractsurf(width, height, fractalDimension) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// GaussmatOptions optional arguments for vips_gaussmat +type GaussmatOptions struct { + // Separable Generate separable Gaussian + Separable bool + // Precision Generate with this precision + Precision Precision +} + +// DefaultGaussmatOptions creates default value for vips_gaussmat optional arguments +func DefaultGaussmatOptions() *GaussmatOptions { + return &GaussmatOptions{ + } +} + +// NewGaussmat vips_gaussmat make a gaussian image +// +// The sigma specifies sigma of Gaussian. +// The minAmpl specifies minimum amplitude of Gaussian. +func NewGaussmat(sigma float64, minAmpl float64, options *GaussmatOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenGaussmatWithOptions(sigma, minAmpl, options.Separable, options.Precision) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenGaussmat(sigma, minAmpl) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// GaussnoiseOptions optional arguments for vips_gaussnoise +type GaussnoiseOptions struct { + // Sigma Standard deviation of pixels in generated image + Sigma float64 + // Mean Mean of pixels in generated image + Mean float64 + // Seed Random number seed + Seed int +} + +// DefaultGaussnoiseOptions creates default value for vips_gaussnoise optional arguments +func DefaultGaussnoiseOptions() *GaussnoiseOptions { + return &GaussnoiseOptions{ + Sigma: 30, + Mean: 128, + } +} + +// NewGaussnoise vips_gaussnoise make a gaussnoise image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewGaussnoise(width int, height int, options *GaussnoiseOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenGaussnoiseWithOptions(width, height, options.Sigma, options.Mean, options.Seed) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenGaussnoise(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// GifloadOptions optional arguments for vips_gifload +type GifloadOptions struct { + // N Number of pages to load, -1 for all + N int + // Page First page to load + Page int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultGifloadOptions creates default value for vips_gifload optional arguments +func DefaultGifloadOptions() *GifloadOptions { + return &GifloadOptions{ + N: 1, + } +} + +// NewGifload vips_gifload load GIF with libnsgif +// +// The filename specifies filename to load from. +func NewGifload(filename string, options *GifloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenGifloadWithOptions(filename, options.N, options.Page, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, nil), nil + } + vipsImage, err := vipsgenGifload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, nil), nil +} + +// GifloadBufferOptions optional arguments for vips_gifload_buffer +type GifloadBufferOptions struct { + // N Number of pages to load, -1 for all + N int + // Page First page to load + Page int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultGifloadBufferOptions creates default value for vips_gifload_buffer optional arguments +func DefaultGifloadBufferOptions() *GifloadBufferOptions { + return &GifloadBufferOptions{ + N: 1, + } +} + +// NewGifloadBuffer vips_gifload_buffer load GIF with libnsgif +func NewGifloadBuffer(buf []byte, options *GifloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("gifload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenGifloadBufferWithOptions(buf, options.N, options.Page, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, buf), nil + } + vipsImage, err := vipsgenGifloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, buf), nil +} + +// GifloadSourceOptions optional arguments for vips_gifload_source +type GifloadSourceOptions struct { + // N Number of pages to load, -1 for all + N int + // Page First page to load + Page int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultGifloadSourceOptions creates default value for vips_gifload_source optional arguments +func DefaultGifloadSourceOptions() *GifloadSourceOptions { + return &GifloadSourceOptions{ + N: 1, + } +} + +// NewGifloadSource vips_gifload_source load gif from source +// +// The source specifies source to load from. +func NewGifloadSource(source *Source, options *GifloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenGifloadSourceWithOptions(source.src, options.N, options.Page, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, nil), nil + } + vipsImage, err := vipsgenGifloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeGif, nil), nil +} + +// GreyOptions optional arguments for vips_grey +type GreyOptions struct { + // Uchar Output an unsigned char image + Uchar bool +} + +// DefaultGreyOptions creates default value for vips_grey optional arguments +func DefaultGreyOptions() *GreyOptions { + return &GreyOptions{ + } +} + +// NewGrey vips_grey make a grey ramp image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewGrey(width int, height int, options *GreyOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenGreyWithOptions(width, height, options.Uchar) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenGrey(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// HeifloadOptions optional arguments for vips_heifload +type HeifloadOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Thumbnail Fetch thumbnail image + Thumbnail bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultHeifloadOptions creates default value for vips_heifload optional arguments +func DefaultHeifloadOptions() *HeifloadOptions { + return &HeifloadOptions{ + N: 1, + } +} + +// NewHeifload vips_heifload load a HEIF image +// +// The filename specifies filename to load from. +func NewHeifload(filename string, options *HeifloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenHeifloadWithOptions(filename, options.Page, options.N, options.Thumbnail, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, nil), nil + } + vipsImage, err := vipsgenHeifload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, nil), nil +} + +// HeifloadBufferOptions optional arguments for vips_heifload_buffer +type HeifloadBufferOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Thumbnail Fetch thumbnail image + Thumbnail bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultHeifloadBufferOptions creates default value for vips_heifload_buffer optional arguments +func DefaultHeifloadBufferOptions() *HeifloadBufferOptions { + return &HeifloadBufferOptions{ + N: 1, + } +} + +// NewHeifloadBuffer vips_heifload_buffer load a HEIF image +func NewHeifloadBuffer(buf []byte, options *HeifloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("heifload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenHeifloadBufferWithOptions(buf, options.Page, options.N, options.Thumbnail, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, buf), nil + } + vipsImage, err := vipsgenHeifloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, buf), nil +} + +// HeifloadSourceOptions optional arguments for vips_heifload_source +type HeifloadSourceOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Thumbnail Fetch thumbnail image + Thumbnail bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultHeifloadSourceOptions creates default value for vips_heifload_source optional arguments +func DefaultHeifloadSourceOptions() *HeifloadSourceOptions { + return &HeifloadSourceOptions{ + N: 1, + } +} + +// NewHeifloadSource vips_heifload_source load a HEIF image +// +// The source specifies source to load from. +func NewHeifloadSource(source *Source, options *HeifloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenHeifloadSourceWithOptions(source.src, options.Page, options.N, options.Thumbnail, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, nil), nil + } + vipsImage, err := vipsgenHeifloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeHeif, nil), nil +} + +// IdentityOptions optional arguments for vips_identity +type IdentityOptions struct { + // Bands Number of bands in LUT + Bands int + // Ushort Create a 16-bit LUT + Ushort bool + // Size Size of 16-bit LUT + Size int +} + +// DefaultIdentityOptions creates default value for vips_identity optional arguments +func DefaultIdentityOptions() *IdentityOptions { + return &IdentityOptions{ + Bands: 1, + Size: 65536, + } +} + +// NewIdentity vips_identity make a 1D image where pixel values are indexes +func NewIdentity(options *IdentityOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenIdentityWithOptions(options.Bands, options.Ushort, options.Size) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenIdentity() + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// Jp2kloadOptions optional arguments for vips_jp2kload +type Jp2kloadOptions struct { + // Page Load this page from the image + Page int + // Oneshot Load images a frame at a time + Oneshot bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJp2kloadOptions creates default value for vips_jp2kload optional arguments +func DefaultJp2kloadOptions() *Jp2kloadOptions { + return &Jp2kloadOptions{ + } +} + +// NewJp2kload vips_jp2kload load JPEG2000 image +// +// The filename specifies filename to load from. +func NewJp2kload(filename string, options *Jp2kloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJp2kloadWithOptions(filename, options.Page, options.Oneshot, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, nil), nil + } + vipsImage, err := vipsgenJp2kload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, nil), nil +} + +// Jp2kloadBufferOptions optional arguments for vips_jp2kload_buffer +type Jp2kloadBufferOptions struct { + // Page Load this page from the image + Page int + // Oneshot Load images a frame at a time + Oneshot bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJp2kloadBufferOptions creates default value for vips_jp2kload_buffer optional arguments +func DefaultJp2kloadBufferOptions() *Jp2kloadBufferOptions { + return &Jp2kloadBufferOptions{ + } +} + +// NewJp2kloadBuffer vips_jp2kload_buffer load JPEG2000 image +func NewJp2kloadBuffer(buf []byte, options *Jp2kloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("jp2kload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenJp2kloadBufferWithOptions(buf, options.Page, options.Oneshot, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, buf), nil + } + vipsImage, err := vipsgenJp2kloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, buf), nil +} + +// Jp2kloadSourceOptions optional arguments for vips_jp2kload_source +type Jp2kloadSourceOptions struct { + // Page Load this page from the image + Page int + // Oneshot Load images a frame at a time + Oneshot bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJp2kloadSourceOptions creates default value for vips_jp2kload_source optional arguments +func DefaultJp2kloadSourceOptions() *Jp2kloadSourceOptions { + return &Jp2kloadSourceOptions{ + } +} + +// NewJp2kloadSource vips_jp2kload_source load JPEG2000 image +// +// The source specifies source to load from. +func NewJp2kloadSource(source *Source, options *Jp2kloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJp2kloadSourceWithOptions(source.src, options.Page, options.Oneshot, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, nil), nil + } + vipsImage, err := vipsgenJp2kloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJp2k, nil), nil +} + +// JpegloadOptions optional arguments for vips_jpegload +type JpegloadOptions struct { + // Shrink Shrink factor on load + Shrink int + // Autorotate Rotate image using exif orientation + Autorotate bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJpegloadOptions creates default value for vips_jpegload optional arguments +func DefaultJpegloadOptions() *JpegloadOptions { + return &JpegloadOptions{ + Shrink: 1, + } +} + +// NewJpegload vips_jpegload load jpeg from file +// +// The filename specifies filename to load from. +func NewJpegload(filename string, options *JpegloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJpegloadWithOptions(filename, options.Shrink, options.Autorotate, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, nil), nil + } + vipsImage, err := vipsgenJpegload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, nil), nil +} + +// JpegloadBufferOptions optional arguments for vips_jpegload_buffer +type JpegloadBufferOptions struct { + // Shrink Shrink factor on load + Shrink int + // Autorotate Rotate image using exif orientation + Autorotate bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJpegloadBufferOptions creates default value for vips_jpegload_buffer optional arguments +func DefaultJpegloadBufferOptions() *JpegloadBufferOptions { + return &JpegloadBufferOptions{ + Shrink: 1, + } +} + +// NewJpegloadBuffer vips_jpegload_buffer load jpeg from buffer +func NewJpegloadBuffer(buf []byte, options *JpegloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("jpegload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenJpegloadBufferWithOptions(buf, options.Shrink, options.Autorotate, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, buf), nil + } + vipsImage, err := vipsgenJpegloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, buf), nil +} + +// JpegloadSourceOptions optional arguments for vips_jpegload_source +type JpegloadSourceOptions struct { + // Shrink Shrink factor on load + Shrink int + // Autorotate Rotate image using exif orientation + Autorotate bool + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJpegloadSourceOptions creates default value for vips_jpegload_source optional arguments +func DefaultJpegloadSourceOptions() *JpegloadSourceOptions { + return &JpegloadSourceOptions{ + Shrink: 1, + } +} + +// NewJpegloadSource vips_jpegload_source load image from jpeg source +// +// The source specifies source to load from. +func NewJpegloadSource(source *Source, options *JpegloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJpegloadSourceWithOptions(source.src, options.Shrink, options.Autorotate, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, nil), nil + } + vipsImage, err := vipsgenJpegloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJpeg, nil), nil +} + +// JxlloadOptions optional arguments for vips_jxlload +type JxlloadOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJxlloadOptions creates default value for vips_jxlload optional arguments +func DefaultJxlloadOptions() *JxlloadOptions { + return &JxlloadOptions{ + N: 1, + } +} + +// NewJxlload vips_jxlload load JPEG-XL image +// +// The filename specifies filename to load from. +func NewJxlload(filename string, options *JxlloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJxlloadWithOptions(filename, options.Page, options.N, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, nil), nil + } + vipsImage, err := vipsgenJxlload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, nil), nil +} + +// JxlloadBufferOptions optional arguments for vips_jxlload_buffer +type JxlloadBufferOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJxlloadBufferOptions creates default value for vips_jxlload_buffer optional arguments +func DefaultJxlloadBufferOptions() *JxlloadBufferOptions { + return &JxlloadBufferOptions{ + N: 1, + } +} + +// NewJxlloadBuffer vips_jxlload_buffer load JPEG-XL image +func NewJxlloadBuffer(buf []byte, options *JxlloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("jxlload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenJxlloadBufferWithOptions(buf, options.Page, options.N, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, buf), nil + } + vipsImage, err := vipsgenJxlloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, buf), nil +} + +// JxlloadSourceOptions optional arguments for vips_jxlload_source +type JxlloadSourceOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultJxlloadSourceOptions creates default value for vips_jxlload_source optional arguments +func DefaultJxlloadSourceOptions() *JxlloadSourceOptions { + return &JxlloadSourceOptions{ + N: 1, + } +} + +// NewJxlloadSource vips_jxlload_source load JPEG-XL image +// +// The source specifies source to load from. +func NewJxlloadSource(source *Source, options *JxlloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenJxlloadSourceWithOptions(source.src, options.Page, options.N, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, nil), nil + } + vipsImage, err := vipsgenJxlloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeJxl, nil), nil +} + +// LogmatOptions optional arguments for vips_logmat +type LogmatOptions struct { + // Separable Generate separable Gaussian + Separable bool + // Precision Generate with this precision + Precision Precision +} + +// DefaultLogmatOptions creates default value for vips_logmat optional arguments +func DefaultLogmatOptions() *LogmatOptions { + return &LogmatOptions{ + } +} + +// NewLogmat vips_logmat make a Laplacian of Gaussian image +// +// The sigma specifies radius of Gaussian. +// The minAmpl specifies minimum amplitude of Gaussian. +func NewLogmat(sigma float64, minAmpl float64, options *LogmatOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenLogmatWithOptions(sigma, minAmpl, options.Separable, options.Precision) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenLogmat(sigma, minAmpl) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MagickloadOptions optional arguments for vips_magickload +type MagickloadOptions struct { + // Density Canvas resolution for rendering vector formats like SVG + Density string + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultMagickloadOptions creates default value for vips_magickload optional arguments +func DefaultMagickloadOptions() *MagickloadOptions { + return &MagickloadOptions{ + N: 1, + } +} + +// NewMagickload vips_magickload load file with ImageMagick +// +// The filename specifies filename to load from. +func NewMagickload(filename string, options *MagickloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMagickloadWithOptions(filename, options.Density, options.Page, options.N, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMagick, nil), nil + } + vipsImage, err := vipsgenMagickload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMagick, nil), nil +} + +// MagickloadBufferOptions optional arguments for vips_magickload_buffer +type MagickloadBufferOptions struct { + // Density Canvas resolution for rendering vector formats like SVG + Density string + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultMagickloadBufferOptions creates default value for vips_magickload_buffer optional arguments +func DefaultMagickloadBufferOptions() *MagickloadBufferOptions { + return &MagickloadBufferOptions{ + N: 1, + } +} + +// NewMagickloadBuffer vips_magickload_buffer load buffer with ImageMagick +func NewMagickloadBuffer(buf []byte, options *MagickloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("magickload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenMagickloadBufferWithOptions(buf, options.Density, options.Page, options.N, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMagick, buf), nil + } + vipsImage, err := vipsgenMagickloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMagick, buf), nil +} + +// MaskButterworthOptions optional arguments for vips_mask_butterworth +type MaskButterworthOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskButterworthOptions creates default value for vips_mask_butterworth optional arguments +func DefaultMaskButterworthOptions() *MaskButterworthOptions { + return &MaskButterworthOptions{ + } +} + +// NewMaskButterworth vips_mask_butterworth make a butterworth filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The order specifies filter order. +// The frequencyCutoff specifies frequency cutoff. +// The amplitudeCutoff specifies amplitude cutoff. +func NewMaskButterworth(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64, options *MaskButterworthOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskButterworthWithOptions(width, height, order, frequencyCutoff, amplitudeCutoff, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskButterworth(width, height, order, frequencyCutoff, amplitudeCutoff) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskButterworthBandOptions optional arguments for vips_mask_butterworth_band +type MaskButterworthBandOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskButterworthBandOptions creates default value for vips_mask_butterworth_band optional arguments +func DefaultMaskButterworthBandOptions() *MaskButterworthBandOptions { + return &MaskButterworthBandOptions{ + } +} + +// NewMaskButterworthBand vips_mask_butterworth_band make a butterworth_band filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The order specifies filter order. +// The frequencyCutoffX specifies frequency cutoff x. +// The frequencyCutoffY specifies frequency cutoff y. +// The radius specifies radius of circle. +// The amplitudeCutoff specifies amplitude cutoff. +func NewMaskButterworthBand(width int, height int, order float64, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64, options *MaskButterworthBandOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskButterworthBandWithOptions(width, height, order, frequencyCutoffX, frequencyCutoffY, radius, amplitudeCutoff, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskButterworthBand(width, height, order, frequencyCutoffX, frequencyCutoffY, radius, amplitudeCutoff) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskButterworthRingOptions optional arguments for vips_mask_butterworth_ring +type MaskButterworthRingOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskButterworthRingOptions creates default value for vips_mask_butterworth_ring optional arguments +func DefaultMaskButterworthRingOptions() *MaskButterworthRingOptions { + return &MaskButterworthRingOptions{ + } +} + +// NewMaskButterworthRing vips_mask_butterworth_ring make a butterworth ring filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The order specifies filter order. +// The frequencyCutoff specifies frequency cutoff. +// The amplitudeCutoff specifies amplitude cutoff. +// The ringwidth specifies ringwidth. +func NewMaskButterworthRing(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64, options *MaskButterworthRingOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskButterworthRingWithOptions(width, height, order, frequencyCutoff, amplitudeCutoff, ringwidth, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskButterworthRing(width, height, order, frequencyCutoff, amplitudeCutoff, ringwidth) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskFractalOptions optional arguments for vips_mask_fractal +type MaskFractalOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskFractalOptions creates default value for vips_mask_fractal optional arguments +func DefaultMaskFractalOptions() *MaskFractalOptions { + return &MaskFractalOptions{ + } +} + +// NewMaskFractal vips_mask_fractal make fractal filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The fractalDimension specifies fractal dimension. +func NewMaskFractal(width int, height int, fractalDimension float64, options *MaskFractalOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskFractalWithOptions(width, height, fractalDimension, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskFractal(width, height, fractalDimension) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskGaussianOptions optional arguments for vips_mask_gaussian +type MaskGaussianOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskGaussianOptions creates default value for vips_mask_gaussian optional arguments +func DefaultMaskGaussianOptions() *MaskGaussianOptions { + return &MaskGaussianOptions{ + } +} + +// NewMaskGaussian vips_mask_gaussian make a gaussian filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoff specifies frequency cutoff. +// The amplitudeCutoff specifies amplitude cutoff. +func NewMaskGaussian(width int, height int, frequencyCutoff float64, amplitudeCutoff float64, options *MaskGaussianOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskGaussianWithOptions(width, height, frequencyCutoff, amplitudeCutoff, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskGaussian(width, height, frequencyCutoff, amplitudeCutoff) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskGaussianBandOptions optional arguments for vips_mask_gaussian_band +type MaskGaussianBandOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskGaussianBandOptions creates default value for vips_mask_gaussian_band optional arguments +func DefaultMaskGaussianBandOptions() *MaskGaussianBandOptions { + return &MaskGaussianBandOptions{ + } +} + +// NewMaskGaussianBand vips_mask_gaussian_band make a gaussian filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoffX specifies frequency cutoff x. +// The frequencyCutoffY specifies frequency cutoff y. +// The radius specifies radius of circle. +// The amplitudeCutoff specifies amplitude cutoff. +func NewMaskGaussianBand(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64, options *MaskGaussianBandOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskGaussianBandWithOptions(width, height, frequencyCutoffX, frequencyCutoffY, radius, amplitudeCutoff, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskGaussianBand(width, height, frequencyCutoffX, frequencyCutoffY, radius, amplitudeCutoff) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskGaussianRingOptions optional arguments for vips_mask_gaussian_ring +type MaskGaussianRingOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskGaussianRingOptions creates default value for vips_mask_gaussian_ring optional arguments +func DefaultMaskGaussianRingOptions() *MaskGaussianRingOptions { + return &MaskGaussianRingOptions{ + } +} + +// NewMaskGaussianRing vips_mask_gaussian_ring make a gaussian ring filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoff specifies frequency cutoff. +// The amplitudeCutoff specifies amplitude cutoff. +// The ringwidth specifies ringwidth. +func NewMaskGaussianRing(width int, height int, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64, options *MaskGaussianRingOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskGaussianRingWithOptions(width, height, frequencyCutoff, amplitudeCutoff, ringwidth, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskGaussianRing(width, height, frequencyCutoff, amplitudeCutoff, ringwidth) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskIdealOptions optional arguments for vips_mask_ideal +type MaskIdealOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskIdealOptions creates default value for vips_mask_ideal optional arguments +func DefaultMaskIdealOptions() *MaskIdealOptions { + return &MaskIdealOptions{ + } +} + +// NewMaskIdeal vips_mask_ideal make an ideal filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoff specifies frequency cutoff. +func NewMaskIdeal(width int, height int, frequencyCutoff float64, options *MaskIdealOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskIdealWithOptions(width, height, frequencyCutoff, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskIdeal(width, height, frequencyCutoff) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskIdealBandOptions optional arguments for vips_mask_ideal_band +type MaskIdealBandOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskIdealBandOptions creates default value for vips_mask_ideal_band optional arguments +func DefaultMaskIdealBandOptions() *MaskIdealBandOptions { + return &MaskIdealBandOptions{ + } +} + +// NewMaskIdealBand vips_mask_ideal_band make an ideal band filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoffX specifies frequency cutoff x. +// The frequencyCutoffY specifies frequency cutoff y. +// The radius specifies radius of circle. +func NewMaskIdealBand(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, options *MaskIdealBandOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskIdealBandWithOptions(width, height, frequencyCutoffX, frequencyCutoffY, radius, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskIdealBand(width, height, frequencyCutoffX, frequencyCutoffY, radius) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MaskIdealRingOptions optional arguments for vips_mask_ideal_ring +type MaskIdealRingOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Nodc Remove DC component + Nodc bool + // Reject Invert the sense of the filter + Reject bool + // Optical Rotate quadrants to optical space + Optical bool +} + +// DefaultMaskIdealRingOptions creates default value for vips_mask_ideal_ring optional arguments +func DefaultMaskIdealRingOptions() *MaskIdealRingOptions { + return &MaskIdealRingOptions{ + } +} + +// NewMaskIdealRing vips_mask_ideal_ring make an ideal ring filter +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The frequencyCutoff specifies frequency cutoff. +// The ringwidth specifies ringwidth. +func NewMaskIdealRing(width int, height int, frequencyCutoff float64, ringwidth float64, options *MaskIdealRingOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMaskIdealRingWithOptions(width, height, frequencyCutoff, ringwidth, options.Uchar, options.Nodc, options.Reject, options.Optical) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenMaskIdealRing(width, height, frequencyCutoff, ringwidth) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// MatloadOptions optional arguments for vips_matload +type MatloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultMatloadOptions creates default value for vips_matload optional arguments +func DefaultMatloadOptions() *MatloadOptions { + return &MatloadOptions{ + } +} + +// NewMatload vips_matload load mat from file +// +// The filename specifies filename to load from. +func NewMatload(filename string, options *MatloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMatloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMat, nil), nil + } + vipsImage, err := vipsgenMatload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMat, nil), nil +} + +// MatrixloadOptions optional arguments for vips_matrixload +type MatrixloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultMatrixloadOptions creates default value for vips_matrixload optional arguments +func DefaultMatrixloadOptions() *MatrixloadOptions { + return &MatrixloadOptions{ + } +} + +// NewMatrixload vips_matrixload load matrix +// +// The filename specifies filename to load from. +func NewMatrixload(filename string, options *MatrixloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMatrixloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMatrix, nil), nil + } + vipsImage, err := vipsgenMatrixload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMatrix, nil), nil +} + +// MatrixloadSourceOptions optional arguments for vips_matrixload_source +type MatrixloadSourceOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultMatrixloadSourceOptions creates default value for vips_matrixload_source optional arguments +func DefaultMatrixloadSourceOptions() *MatrixloadSourceOptions { + return &MatrixloadSourceOptions{ + } +} + +// NewMatrixloadSource vips_matrixload_source load matrix +// +// The source specifies source to load from. +func NewMatrixloadSource(source *Source, options *MatrixloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenMatrixloadSourceWithOptions(source.src, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMatrix, nil), nil + } + vipsImage, err := vipsgenMatrixloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeMatrix, nil), nil +} + +// NiftiloadOptions optional arguments for vips_niftiload +type NiftiloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultNiftiloadOptions creates default value for vips_niftiload optional arguments +func DefaultNiftiloadOptions() *NiftiloadOptions { + return &NiftiloadOptions{ + } +} + +// NewNiftiload vips_niftiload load NIfTI volume +// +// The filename specifies filename to load from. +func NewNiftiload(filename string, options *NiftiloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenNiftiloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenNiftiload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// NiftiloadSourceOptions optional arguments for vips_niftiload_source +type NiftiloadSourceOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultNiftiloadSourceOptions creates default value for vips_niftiload_source optional arguments +func DefaultNiftiloadSourceOptions() *NiftiloadSourceOptions { + return &NiftiloadSourceOptions{ + } +} + +// NewNiftiloadSource vips_niftiload_source load NIfTI volumes +// +// The source specifies source to load from. +func NewNiftiloadSource(source *Source, options *NiftiloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenNiftiloadSourceWithOptions(source.src, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenNiftiloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// OpenexrloadOptions optional arguments for vips_openexrload +type OpenexrloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultOpenexrloadOptions creates default value for vips_openexrload optional arguments +func DefaultOpenexrloadOptions() *OpenexrloadOptions { + return &OpenexrloadOptions{ + } +} + +// NewOpenexrload vips_openexrload load an OpenEXR image +// +// The filename specifies filename to load from. +func NewOpenexrload(filename string, options *OpenexrloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenOpenexrloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenexr, nil), nil + } + vipsImage, err := vipsgenOpenexrload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenexr, nil), nil +} + +// OpenslideloadOptions optional arguments for vips_openslideload +type OpenslideloadOptions struct { + // Level Load this level from the file + Level int + // Autocrop Crop to image bounds + Autocrop bool + // Associated Load this associated image + Associated string + // AttachAssociated Attach all associated images + AttachAssociated bool + // Rgb Output RGB (not RGBA) + Rgb bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultOpenslideloadOptions creates default value for vips_openslideload optional arguments +func DefaultOpenslideloadOptions() *OpenslideloadOptions { + return &OpenslideloadOptions{ + } +} + +// NewOpenslideload vips_openslideload load file with OpenSlide +// +// The filename specifies filename to load from. +func NewOpenslideload(filename string, options *OpenslideloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenOpenslideloadWithOptions(filename, options.Level, options.Autocrop, options.Associated, options.AttachAssociated, options.Rgb, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenslide, nil), nil + } + vipsImage, err := vipsgenOpenslideload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenslide, nil), nil +} + +// OpenslideloadSourceOptions optional arguments for vips_openslideload_source +type OpenslideloadSourceOptions struct { + // Level Load this level from the file + Level int + // Autocrop Crop to image bounds + Autocrop bool + // Associated Load this associated image + Associated string + // AttachAssociated Attach all associated images + AttachAssociated bool + // Rgb Output RGB (not RGBA) + Rgb bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultOpenslideloadSourceOptions creates default value for vips_openslideload_source optional arguments +func DefaultOpenslideloadSourceOptions() *OpenslideloadSourceOptions { + return &OpenslideloadSourceOptions{ + } +} + +// NewOpenslideloadSource vips_openslideload_source load source with OpenSlide +// +// The source specifies source to load from. +func NewOpenslideloadSource(source *Source, options *OpenslideloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenOpenslideloadSourceWithOptions(source.src, options.Level, options.Autocrop, options.Associated, options.AttachAssociated, options.Rgb, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenslide, nil), nil + } + vipsImage, err := vipsgenOpenslideloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeOpenslide, nil), nil +} + +// PdfloadOptions optional arguments for vips_pdfload +type PdfloadOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Dpi DPI to render at + Dpi float64 + // Scale Factor to scale by + Scale float64 + // Background Background colour + Background []float64 + // Password Password to decrypt with + Password string + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPdfloadOptions creates default value for vips_pdfload optional arguments +func DefaultPdfloadOptions() *PdfloadOptions { + return &PdfloadOptions{ + N: 1, + Dpi: 72, + Scale: 1, + } +} + +// NewPdfload vips_pdfload load PDF from file +// +// The filename specifies filename to load from. +func NewPdfload(filename string, options *PdfloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPdfloadWithOptions(filename, options.Page, options.N, options.Dpi, options.Scale, options.Background, options.Password, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, nil), nil + } + vipsImage, err := vipsgenPdfload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, nil), nil +} + +// PdfloadBufferOptions optional arguments for vips_pdfload_buffer +type PdfloadBufferOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Dpi DPI to render at + Dpi float64 + // Scale Factor to scale by + Scale float64 + // Background Background colour + Background []float64 + // Password Password to decrypt with + Password string + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPdfloadBufferOptions creates default value for vips_pdfload_buffer optional arguments +func DefaultPdfloadBufferOptions() *PdfloadBufferOptions { + return &PdfloadBufferOptions{ + N: 1, + Dpi: 72, + Scale: 1, + } +} + +// NewPdfloadBuffer vips_pdfload_buffer load PDF from buffer +func NewPdfloadBuffer(buf []byte, options *PdfloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("pdfload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenPdfloadBufferWithOptions(buf, options.Page, options.N, options.Dpi, options.Scale, options.Background, options.Password, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, buf), nil + } + vipsImage, err := vipsgenPdfloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, buf), nil +} + +// PdfloadSourceOptions optional arguments for vips_pdfload_source +type PdfloadSourceOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Dpi DPI to render at + Dpi float64 + // Scale Factor to scale by + Scale float64 + // Background Background colour + Background []float64 + // Password Password to decrypt with + Password string + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPdfloadSourceOptions creates default value for vips_pdfload_source optional arguments +func DefaultPdfloadSourceOptions() *PdfloadSourceOptions { + return &PdfloadSourceOptions{ + N: 1, + Dpi: 72, + Scale: 1, + } +} + +// NewPdfloadSource vips_pdfload_source load PDF from source +// +// The source specifies source to load from. +func NewPdfloadSource(source *Source, options *PdfloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPdfloadSourceWithOptions(source.src, options.Page, options.N, options.Dpi, options.Scale, options.Background, options.Password, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, nil), nil + } + vipsImage, err := vipsgenPdfloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePdf, nil), nil +} + +// PerlinOptions optional arguments for vips_perlin +type PerlinOptions struct { + // CellSize Size of Perlin cells + CellSize int + // Uchar Output an unsigned char image + Uchar bool + // Seed Random number seed + Seed int +} + +// DefaultPerlinOptions creates default value for vips_perlin optional arguments +func DefaultPerlinOptions() *PerlinOptions { + return &PerlinOptions{ + CellSize: 256, + } +} + +// NewPerlin vips_perlin make a perlin noise image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewPerlin(width int, height int, options *PerlinOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPerlinWithOptions(width, height, options.CellSize, options.Uchar, options.Seed) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenPerlin(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// PngloadOptions optional arguments for vips_pngload +type PngloadOptions struct { + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPngloadOptions creates default value for vips_pngload optional arguments +func DefaultPngloadOptions() *PngloadOptions { + return &PngloadOptions{ + } +} + +// NewPngload vips_pngload load png from file +// +// The filename specifies filename to load from. +func NewPngload(filename string, options *PngloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPngloadWithOptions(filename, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, nil), nil + } + vipsImage, err := vipsgenPngload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, nil), nil +} + +// PngloadBufferOptions optional arguments for vips_pngload_buffer +type PngloadBufferOptions struct { + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPngloadBufferOptions creates default value for vips_pngload_buffer optional arguments +func DefaultPngloadBufferOptions() *PngloadBufferOptions { + return &PngloadBufferOptions{ + } +} + +// NewPngloadBuffer vips_pngload_buffer load png from buffer +func NewPngloadBuffer(buf []byte, options *PngloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("pngload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenPngloadBufferWithOptions(buf, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, buf), nil + } + vipsImage, err := vipsgenPngloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, buf), nil +} + +// PngloadSourceOptions optional arguments for vips_pngload_source +type PngloadSourceOptions struct { + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPngloadSourceOptions creates default value for vips_pngload_source optional arguments +func DefaultPngloadSourceOptions() *PngloadSourceOptions { + return &PngloadSourceOptions{ + } +} + +// NewPngloadSource vips_pngload_source load png from source +// +// The source specifies source to load from. +func NewPngloadSource(source *Source, options *PngloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPngloadSourceWithOptions(source.src, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, nil), nil + } + vipsImage, err := vipsgenPngloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePng, nil), nil +} + +// PpmloadOptions optional arguments for vips_ppmload +type PpmloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPpmloadOptions creates default value for vips_ppmload optional arguments +func DefaultPpmloadOptions() *PpmloadOptions { + return &PpmloadOptions{ + } +} + +// NewPpmload vips_ppmload load ppm from file +// +// The filename specifies filename to load from. +func NewPpmload(filename string, options *PpmloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPpmloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, nil), nil + } + vipsImage, err := vipsgenPpmload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, nil), nil +} + +// PpmloadBufferOptions optional arguments for vips_ppmload_buffer +type PpmloadBufferOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPpmloadBufferOptions creates default value for vips_ppmload_buffer optional arguments +func DefaultPpmloadBufferOptions() *PpmloadBufferOptions { + return &PpmloadBufferOptions{ + } +} + +// NewPpmloadBuffer vips_ppmload_buffer load ppm from buffer +func NewPpmloadBuffer(buf []byte, options *PpmloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("ppmload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenPpmloadBufferWithOptions(buf, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, buf), nil + } + vipsImage, err := vipsgenPpmloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, buf), nil +} + +// PpmloadSourceOptions optional arguments for vips_ppmload_source +type PpmloadSourceOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultPpmloadSourceOptions creates default value for vips_ppmload_source optional arguments +func DefaultPpmloadSourceOptions() *PpmloadSourceOptions { + return &PpmloadSourceOptions{ + } +} + +// NewPpmloadSource vips_ppmload_source load ppm from source +// +// The source specifies source to load from. +func NewPpmloadSource(source *Source, options *PpmloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenPpmloadSourceWithOptions(source.src, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, nil), nil + } + vipsImage, err := vipsgenPpmloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypePpm, nil), nil +} + +// RadloadOptions optional arguments for vips_radload +type RadloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultRadloadOptions creates default value for vips_radload optional arguments +func DefaultRadloadOptions() *RadloadOptions { + return &RadloadOptions{ + } +} + +// NewRadload vips_radload load a Radiance image from a file +// +// The filename specifies filename to load from. +func NewRadload(filename string, options *RadloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenRadloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, nil), nil + } + vipsImage, err := vipsgenRadload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, nil), nil +} + +// RadloadBufferOptions optional arguments for vips_radload_buffer +type RadloadBufferOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultRadloadBufferOptions creates default value for vips_radload_buffer optional arguments +func DefaultRadloadBufferOptions() *RadloadBufferOptions { + return &RadloadBufferOptions{ + } +} + +// NewRadloadBuffer vips_radload_buffer load rad from buffer +func NewRadloadBuffer(buf []byte, options *RadloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("radload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenRadloadBufferWithOptions(buf, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, buf), nil + } + vipsImage, err := vipsgenRadloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, buf), nil +} + +// RadloadSourceOptions optional arguments for vips_radload_source +type RadloadSourceOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultRadloadSourceOptions creates default value for vips_radload_source optional arguments +func DefaultRadloadSourceOptions() *RadloadSourceOptions { + return &RadloadSourceOptions{ + } +} + +// NewRadloadSource vips_radload_source load rad from source +// +// The source specifies source to load from. +func NewRadloadSource(source *Source, options *RadloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenRadloadSourceWithOptions(source.src, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, nil), nil + } + vipsImage, err := vipsgenRadloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRad, nil), nil +} + +// RawloadOptions optional arguments for vips_rawload +type RawloadOptions struct { + // Offset Offset in bytes from start of file + Offset uint64 + // Format Pixel format in image + Format BandFormat + // Interpretation Pixel interpretation + Interpretation Interpretation + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultRawloadOptions creates default value for vips_rawload optional arguments +func DefaultRawloadOptions() *RawloadOptions { + return &RawloadOptions{ + } +} + +// NewRawload vips_rawload load raw data from a file +// +// The filename specifies filename to load from. +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The bands specifies number of bands in image. +func NewRawload(filename string, width int, height int, bands int, options *RawloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenRawloadWithOptions(filename, width, height, bands, options.Offset, options.Format, options.Interpretation, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRaw, nil), nil + } + vipsImage, err := vipsgenRawload(filename, width, height, bands) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeRaw, nil), nil +} + +// SdfOptions optional arguments for vips_sdf +type SdfOptions struct { + // R Radius + R float64 + // A Point a + A []float64 + // B Point b + B []float64 + // Corners Corner radii + Corners []float64 +} + +// DefaultSdfOptions creates default value for vips_sdf optional arguments +func DefaultSdfOptions() *SdfOptions { + return &SdfOptions{ + R: 50, + } +} + +// NewSdf vips_sdf create an SDF image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +// The shape specifies sDF shape to create. +func NewSdf(width int, height int, shape SdfShape, options *SdfOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenSdfWithOptions(width, height, shape, options.R, options.A, options.B, options.Corners) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenSdf(width, height, shape) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// SinesOptions optional arguments for vips_sines +type SinesOptions struct { + // Uchar Output an unsigned char image + Uchar bool + // Hfreq Horizontal spatial frequency + Hfreq float64 + // Vfreq Vertical spatial frequency + Vfreq float64 +} + +// DefaultSinesOptions creates default value for vips_sines optional arguments +func DefaultSinesOptions() *SinesOptions { + return &SinesOptions{ + Hfreq: 0.5, + Vfreq: 0.5, + } +} + +// NewSines vips_sines make a 2D sine wave +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewSines(width int, height int, options *SinesOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenSinesWithOptions(width, height, options.Uchar, options.Hfreq, options.Vfreq) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenSines(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + + +// NewSum vips_sum sum an array of images +// +// The in specifies array of input images. +func NewSum(in []*Image) (*Image, error) { + Startup(nil) + vipsImage, err := vipsgenSum(convertImagesToVipsImages(in)) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// SvgloadOptions optional arguments for vips_svgload +type SvgloadOptions struct { + // Dpi Render at this DPI + Dpi float64 + // Scale Scale output by this factor + Scale float64 + // Unlimited Allow SVG of any size + Unlimited bool + // Stylesheet Custom CSS + Stylesheet string + // HighBitdepth Enable scRGB 128-bit output (32-bit per channel) + HighBitdepth bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultSvgloadOptions creates default value for vips_svgload optional arguments +func DefaultSvgloadOptions() *SvgloadOptions { + return &SvgloadOptions{ + Dpi: 72, + Scale: 1, + } +} + +// NewSvgload vips_svgload load SVG with rsvg +// +// The filename specifies filename to load from. +func NewSvgload(filename string, options *SvgloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenSvgloadWithOptions(filename, options.Dpi, options.Scale, options.Unlimited, options.Stylesheet, options.HighBitdepth, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, nil), nil + } + vipsImage, err := vipsgenSvgload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, nil), nil +} + +// SvgloadBufferOptions optional arguments for vips_svgload_buffer +type SvgloadBufferOptions struct { + // Dpi Render at this DPI + Dpi float64 + // Scale Scale output by this factor + Scale float64 + // Unlimited Allow SVG of any size + Unlimited bool + // Stylesheet Custom CSS + Stylesheet string + // HighBitdepth Enable scRGB 128-bit output (32-bit per channel) + HighBitdepth bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultSvgloadBufferOptions creates default value for vips_svgload_buffer optional arguments +func DefaultSvgloadBufferOptions() *SvgloadBufferOptions { + return &SvgloadBufferOptions{ + Dpi: 72, + Scale: 1, + } +} + +// NewSvgloadBuffer vips_svgload_buffer load SVG with rsvg +func NewSvgloadBuffer(buf []byte, options *SvgloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("svgload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenSvgloadBufferWithOptions(buf, options.Dpi, options.Scale, options.Unlimited, options.Stylesheet, options.HighBitdepth, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, buf), nil + } + vipsImage, err := vipsgenSvgloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, buf), nil +} + +// SvgloadSourceOptions optional arguments for vips_svgload_source +type SvgloadSourceOptions struct { + // Dpi Render at this DPI + Dpi float64 + // Scale Scale output by this factor + Scale float64 + // Unlimited Allow SVG of any size + Unlimited bool + // Stylesheet Custom CSS + Stylesheet string + // HighBitdepth Enable scRGB 128-bit output (32-bit per channel) + HighBitdepth bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultSvgloadSourceOptions creates default value for vips_svgload_source optional arguments +func DefaultSvgloadSourceOptions() *SvgloadSourceOptions { + return &SvgloadSourceOptions{ + Dpi: 72, + Scale: 1, + } +} + +// NewSvgloadSource vips_svgload_source load svg from source +// +// The source specifies source to load from. +func NewSvgloadSource(source *Source, options *SvgloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenSvgloadSourceWithOptions(source.src, options.Dpi, options.Scale, options.Unlimited, options.Stylesheet, options.HighBitdepth, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, nil), nil + } + vipsImage, err := vipsgenSvgloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeSvg, nil), nil +} + + +// NewSwitch vips_switch find the index of the first non-zero pixel in tests +// +// The tests specifies table of images to test. +func NewSwitch(tests []*Image) (*Image, error) { + Startup(nil) + vipsImage, err := vipsgenSwitch(convertImagesToVipsImages(tests)) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// SystemOptions optional arguments for vips_system +type SystemOptions struct { + // In Array of input images + In []*Image + // OutFormat Format for output filename + OutFormat string + // InFormat Format for input filename + InFormat string +} + +// DefaultSystemOptions creates default value for vips_system optional arguments +func DefaultSystemOptions() *SystemOptions { + return &SystemOptions{ + } +} + +// NewSystem vips_system run an external command +// +// The cmdFormat specifies command to run. +func NewSystem(cmdFormat string, options *SystemOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenSystemWithOptions(cmdFormat, convertImagesToVipsImages(options.In), options.OutFormat, options.InFormat) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenSystem(cmdFormat) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// TextOptions optional arguments for vips_text +type TextOptions struct { + // Font Font to render with + Font string + // Width Maximum image width in pixels + Width int + // Height Maximum image height in pixels + Height int + // Align Align on the low, centre or high edge + Align Align + // Justify Justify lines + Justify bool + // Dpi DPI to render at + Dpi int + // Spacing Line spacing + Spacing int + // Fontfile Load this font file + Fontfile string + // Rgba Enable RGBA output + Rgba bool + // Wrap Wrap lines on word or character boundaries + Wrap TextWrap +} + +// DefaultTextOptions creates default value for vips_text optional arguments +func DefaultTextOptions() *TextOptions { + return &TextOptions{ + Dpi: 72, + } +} + +// NewText vips_text make a text image +// +// The text specifies text to render. +func NewText(text string, options *TextOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenTextWithOptions(text, options.Font, options.Width, options.Height, options.Align, options.Justify, options.Dpi, options.Spacing, options.Fontfile, options.Rgba, options.Wrap) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenText(text) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// ThumbnailOptions optional arguments for vips_thumbnail +type ThumbnailOptions struct { + // Height Size to this height + Height int + // Size Only upsize, only downsize, or both + Size Size + // NoRotate Don't use orientation tags to rotate image upright + NoRotate bool + // Crop Reduce to fill target rectangle, then crop + Crop Interesting + // Linear Reduce in linear light + Linear bool + // InputProfile Fallback input profile + InputProfile string + // OutputProfile Fallback output profile + OutputProfile string + // Intent Rendering intent + Intent Intent + // FailOn Error level to fail on + FailOn FailOn +} + +// DefaultThumbnailOptions creates default value for vips_thumbnail optional arguments +func DefaultThumbnailOptions() *ThumbnailOptions { + return &ThumbnailOptions{ + Height: 1, + Intent: Intent(1), + } +} + +// NewThumbnail vips_thumbnail generate thumbnail from file +// +// The filename specifies filename to read from. +// The width specifies size to this width. +func NewThumbnail(filename string, width int, options *ThumbnailOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenThumbnailWithOptions(filename, width, options.Height, options.Size, options.NoRotate, options.Crop, options.Linear, options.InputProfile, options.OutputProfile, options.Intent, options.FailOn) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil + } + vipsImage, err := vipsgenThumbnail(filename, width) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil +} + +// ThumbnailBufferOptions optional arguments for vips_thumbnail_buffer +type ThumbnailBufferOptions struct { + // OptionString Options that are passed on to the underlying loader + OptionString string + // Height Size to this height + Height int + // Size Only upsize, only downsize, or both + Size Size + // NoRotate Don't use orientation tags to rotate image upright + NoRotate bool + // Crop Reduce to fill target rectangle, then crop + Crop Interesting + // Linear Reduce in linear light + Linear bool + // InputProfile Fallback input profile + InputProfile string + // OutputProfile Fallback output profile + OutputProfile string + // Intent Rendering intent + Intent Intent + // FailOn Error level to fail on + FailOn FailOn +} + +// DefaultThumbnailBufferOptions creates default value for vips_thumbnail_buffer optional arguments +func DefaultThumbnailBufferOptions() *ThumbnailBufferOptions { + return &ThumbnailBufferOptions{ + Height: 1, + Intent: Intent(1), + } +} + +// NewThumbnailBuffer vips_thumbnail_buffer generate thumbnail from buffer +// +// The width specifies size to this width. +func NewThumbnailBuffer(buf []byte, width int, options *ThumbnailBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("thumbnail_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenThumbnailBufferWithOptions(buf, width, options.OptionString, options.Height, options.Size, options.NoRotate, options.Crop, options.Linear, options.InputProfile, options.OutputProfile, options.Intent, options.FailOn) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), buf), nil + } + vipsImage, err := vipsgenThumbnailBuffer(buf, width) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), buf), nil +} + +// ThumbnailSourceOptions optional arguments for vips_thumbnail_source +type ThumbnailSourceOptions struct { + // OptionString Options that are passed on to the underlying loader + OptionString string + // Height Size to this height + Height int + // Size Only upsize, only downsize, or both + Size Size + // NoRotate Don't use orientation tags to rotate image upright + NoRotate bool + // Crop Reduce to fill target rectangle, then crop + Crop Interesting + // Linear Reduce in linear light + Linear bool + // InputProfile Fallback input profile + InputProfile string + // OutputProfile Fallback output profile + OutputProfile string + // Intent Rendering intent + Intent Intent + // FailOn Error level to fail on + FailOn FailOn +} + +// DefaultThumbnailSourceOptions creates default value for vips_thumbnail_source optional arguments +func DefaultThumbnailSourceOptions() *ThumbnailSourceOptions { + return &ThumbnailSourceOptions{ + Height: 1, + Intent: Intent(1), + } +} + +// NewThumbnailSource vips_thumbnail_source generate thumbnail from source +// +// The source specifies source to load from. +// The width specifies size to this width. +func NewThumbnailSource(source *Source, width int, options *ThumbnailSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenThumbnailSourceWithOptions(source.src, width, options.OptionString, options.Height, options.Size, options.NoRotate, options.Crop, options.Linear, options.InputProfile, options.OutputProfile, options.Intent, options.FailOn) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil + } + vipsImage, err := vipsgenThumbnailSource(source.src, width) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil +} + +// TiffloadOptions optional arguments for vips_tiffload +type TiffloadOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Autorotate Rotate image using orientation tag + Autorotate bool + // Subifd Subifd index + Subifd int + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultTiffloadOptions creates default value for vips_tiffload optional arguments +func DefaultTiffloadOptions() *TiffloadOptions { + return &TiffloadOptions{ + N: 1, + Subifd: -1, + } +} + +// NewTiffload vips_tiffload load tiff from file +// +// The filename specifies filename to load from. +func NewTiffload(filename string, options *TiffloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenTiffloadWithOptions(filename, options.Page, options.N, options.Autorotate, options.Subifd, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, nil), nil + } + vipsImage, err := vipsgenTiffload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, nil), nil +} + +// TiffloadBufferOptions optional arguments for vips_tiffload_buffer +type TiffloadBufferOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Autorotate Rotate image using orientation tag + Autorotate bool + // Subifd Subifd index + Subifd int + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultTiffloadBufferOptions creates default value for vips_tiffload_buffer optional arguments +func DefaultTiffloadBufferOptions() *TiffloadBufferOptions { + return &TiffloadBufferOptions{ + N: 1, + Subifd: -1, + } +} + +// NewTiffloadBuffer vips_tiffload_buffer load tiff from buffer +func NewTiffloadBuffer(buf []byte, options *TiffloadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("tiffload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenTiffloadBufferWithOptions(buf, options.Page, options.N, options.Autorotate, options.Subifd, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, buf), nil + } + vipsImage, err := vipsgenTiffloadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, buf), nil +} + +// TiffloadSourceOptions optional arguments for vips_tiffload_source +type TiffloadSourceOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Autorotate Rotate image using orientation tag + Autorotate bool + // Subifd Subifd index + Subifd int + // Unlimited Remove all denial of service limits + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultTiffloadSourceOptions creates default value for vips_tiffload_source optional arguments +func DefaultTiffloadSourceOptions() *TiffloadSourceOptions { + return &TiffloadSourceOptions{ + N: 1, + Subifd: -1, + } +} + +// NewTiffloadSource vips_tiffload_source load tiff from source +// +// The source specifies source to load from. +func NewTiffloadSource(source *Source, options *TiffloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenTiffloadSourceWithOptions(source.src, options.Page, options.N, options.Autorotate, options.Subifd, options.Unlimited, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, nil), nil + } + vipsImage, err := vipsgenTiffloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeTiff, nil), nil +} + +// TonelutOptions optional arguments for vips_tonelut +type TonelutOptions struct { + // InMax Size of LUT to build + InMax int + // OutMax Maximum value in output LUT + OutMax int + // Lb Lowest value in output + Lb float64 + // Lw Highest value in output + Lw float64 + // Ps Position of shadow + Ps float64 + // Pm Position of mid-tones + Pm float64 + // Ph Position of highlights + Ph float64 + // S Adjust shadows by this much + S float64 + // M Adjust mid-tones by this much + M float64 + // H Adjust highlights by this much + H float64 +} + +// DefaultTonelutOptions creates default value for vips_tonelut optional arguments +func DefaultTonelutOptions() *TonelutOptions { + return &TonelutOptions{ + InMax: 32767, + OutMax: 32767, + Lw: 100, + Ps: 0.2, + Pm: 0.5, + Ph: 0.8, + } +} + +// NewTonelut vips_tonelut build a look-up table +func NewTonelut(options *TonelutOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenTonelutWithOptions(options.InMax, options.OutMax, options.Lb, options.Lw, options.Ps, options.Pm, options.Ph, options.S, options.M, options.H) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenTonelut() + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// VipsloadOptions optional arguments for vips_vipsload +type VipsloadOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultVipsloadOptions creates default value for vips_vipsload optional arguments +func DefaultVipsloadOptions() *VipsloadOptions { + return &VipsloadOptions{ + } +} + +// NewVipsload vips_vipsload load vips from file +// +// The filename specifies filename to load from. +func NewVipsload(filename string, options *VipsloadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenVipsloadWithOptions(filename, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeVips, nil), nil + } + vipsImage, err := vipsgenVipsload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeVips, nil), nil +} + +// VipsloadSourceOptions optional arguments for vips_vipsload_source +type VipsloadSourceOptions struct { + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultVipsloadSourceOptions creates default value for vips_vipsload_source optional arguments +func DefaultVipsloadSourceOptions() *VipsloadSourceOptions { + return &VipsloadSourceOptions{ + } +} + +// NewVipsloadSource vips_vipsload_source load vips from source +// +// The source specifies source to load from. +func NewVipsloadSource(source *Source, options *VipsloadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenVipsloadSourceWithOptions(source.src, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeVips, nil), nil + } + vipsImage, err := vipsgenVipsloadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeVips, nil), nil +} + +// WebploadOptions optional arguments for vips_webpload +type WebploadOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Scale Factor to scale by + Scale float64 + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultWebploadOptions creates default value for vips_webpload optional arguments +func DefaultWebploadOptions() *WebploadOptions { + return &WebploadOptions{ + N: 1, + Scale: 1, + } +} + +// NewWebpload vips_webpload load webp from file +// +// The filename specifies filename to load from. +func NewWebpload(filename string, options *WebploadOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenWebploadWithOptions(filename, options.Page, options.N, options.Scale, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, nil), nil + } + vipsImage, err := vipsgenWebpload(filename) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, nil), nil +} + +// WebploadBufferOptions optional arguments for vips_webpload_buffer +type WebploadBufferOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Scale Factor to scale by + Scale float64 + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultWebploadBufferOptions creates default value for vips_webpload_buffer optional arguments +func DefaultWebploadBufferOptions() *WebploadBufferOptions { + return &WebploadBufferOptions{ + N: 1, + Scale: 1, + } +} + +// NewWebploadBuffer vips_webpload_buffer load webp from buffer +func NewWebploadBuffer(buf []byte, options *WebploadBufferOptions) (*Image, error) { + Startup(nil) + if len(buf) == 0 { + return nil, fmt.Errorf("webpload_buffer: buffer is empty") + } + if options != nil { + vipsImage, err := vipsgenWebploadBufferWithOptions(buf, options.Page, options.N, options.Scale, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, buf), nil + } + vipsImage, err := vipsgenWebploadBuffer(buf) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, buf), nil +} + +// WebploadSourceOptions optional arguments for vips_webpload_source +type WebploadSourceOptions struct { + // Page First page to load + Page int + // N Number of pages to load, -1 for all + N int + // Scale Factor to scale by + Scale float64 + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access + // FailOn Error level to fail on + FailOn FailOn + // Revalidate Don't use a cached result for this operation + Revalidate bool +} + +// DefaultWebploadSourceOptions creates default value for vips_webpload_source optional arguments +func DefaultWebploadSourceOptions() *WebploadSourceOptions { + return &WebploadSourceOptions{ + N: 1, + Scale: 1, + } +} + +// NewWebploadSource vips_webpload_source load webp from source +// +// The source specifies source to load from. +func NewWebploadSource(source *Source, options *WebploadSourceOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenWebploadSourceWithOptions(source.src, options.Page, options.N, options.Scale, options.Memory, options.Access, options.FailOn, options.Revalidate) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, nil), nil + } + vipsImage, err := vipsgenWebploadSource(source.src) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeWebp, nil), nil +} + +// WorleyOptions optional arguments for vips_worley +type WorleyOptions struct { + // CellSize Size of Worley cells + CellSize int + // Seed Random number seed + Seed int +} + +// DefaultWorleyOptions creates default value for vips_worley optional arguments +func DefaultWorleyOptions() *WorleyOptions { + return &WorleyOptions{ + CellSize: 256, + } +} + +// NewWorley vips_worley make a worley noise image +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewWorley(width int, height int, options *WorleyOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenWorleyWithOptions(width, height, options.CellSize, options.Seed) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenWorley(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// XyzOptions optional arguments for vips_xyz +type XyzOptions struct { + // Csize Size of third dimension + Csize int + // Dsize Size of fourth dimension + Dsize int + // Esize Size of fifth dimension + Esize int +} + +// DefaultXyzOptions creates default value for vips_xyz optional arguments +func DefaultXyzOptions() *XyzOptions { + return &XyzOptions{ + Csize: 1, + Dsize: 1, + Esize: 1, + } +} + +// NewXyz vips_xyz make an image where pixel values are coordinates +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewXyz(width int, height int, options *XyzOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenXyzWithOptions(width, height, options.Csize, options.Dsize, options.Esize) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenXyz(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + +// ZoneOptions optional arguments for vips_zone +type ZoneOptions struct { + // Uchar Output an unsigned char image + Uchar bool +} + +// DefaultZoneOptions creates default value for vips_zone optional arguments +func DefaultZoneOptions() *ZoneOptions { + return &ZoneOptions{ + } +} + +// NewZone vips_zone make a zone plate +// +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func NewZone(width int, height int, options *ZoneOptions) (*Image, error) { + Startup(nil) + if options != nil { + vipsImage, err := vipsgenZoneWithOptions(width, height, options.Uchar) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil + } + vipsImage, err := vipsgenZone(width, height) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, nil), nil +} + + + + +// CMC2LCh vips_CMC2LCh transform LCh to CMC +func (r *Image) CMC2LCh() (error) { + out, err := vipsgenCMC2LCh(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// CMYK2XYZ vips_CMYK2XYZ transform CMYK to XYZ +func (r *Image) CMYK2XYZ() (error) { + out, err := vipsgenCMYK2XYZ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HSV2sRGB vips_HSV2sRGB transform HSV to sRGB +func (r *Image) HSV2sRGB() (error) { + out, err := vipsgenHSV2sRGB(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LCh2CMC vips_LCh2CMC transform LCh to CMC +func (r *Image) LCh2CMC() (error) { + out, err := vipsgenLCh2CMC(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LCh2Lab vips_LCh2Lab transform LCh to Lab +func (r *Image) LCh2Lab() (error) { + out, err := vipsgenLCh2Lab(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Lab2LCh vips_Lab2LCh transform Lab to LCh +func (r *Image) Lab2LCh() (error) { + out, err := vipsgenLab2LCh(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Lab2LabQ vips_Lab2LabQ transform float Lab to LabQ coding +func (r *Image) Lab2LabQ() (error) { + out, err := vipsgenLab2LabQ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Lab2LabS vips_Lab2LabS transform float Lab to signed short +func (r *Image) Lab2LabS() (error) { + out, err := vipsgenLab2LabS(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Lab2XYZOptions optional arguments for vips_Lab2XYZ +type Lab2XYZOptions struct { + // Temp Color temperature + Temp []float64 +} + +// DefaultLab2XYZOptions creates default value for vips_Lab2XYZ optional arguments +func DefaultLab2XYZOptions() *Lab2XYZOptions { + return &Lab2XYZOptions{ + } +} + +// Lab2XYZ vips_Lab2XYZ transform CIELAB to XYZ +func (r *Image) Lab2XYZ(options *Lab2XYZOptions) (error) { + if options != nil { + out, err := vipsgenLab2XYZWithOptions(r.image, options.Temp) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenLab2XYZ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LabQ2Lab vips_LabQ2Lab unpack a LabQ image to float Lab +func (r *Image) LabQ2Lab() (error) { + out, err := vipsgenLabQ2Lab(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LabQ2LabS vips_LabQ2LabS unpack a LabQ image to short Lab +func (r *Image) LabQ2LabS() (error) { + out, err := vipsgenLabQ2LabS(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LabQ2sRGB vips_LabQ2sRGB convert a LabQ image to sRGB +func (r *Image) LabQ2sRGB() (error) { + out, err := vipsgenLabQ2sRGB(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LabS2Lab vips_LabS2Lab transform signed short Lab to float +func (r *Image) LabS2Lab() (error) { + out, err := vipsgenLabS2Lab(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// LabS2LabQ vips_LabS2LabQ transform short Lab to LabQ coding +func (r *Image) LabS2LabQ() (error) { + out, err := vipsgenLabS2LabQ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// XYZ2CMYK vips_XYZ2CMYK transform XYZ to CMYK +func (r *Image) XYZ2CMYK() (error) { + out, err := vipsgenXYZ2CMYK(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// XYZ2LabOptions optional arguments for vips_XYZ2Lab +type XYZ2LabOptions struct { + // Temp Colour temperature + Temp []float64 +} + +// DefaultXYZ2LabOptions creates default value for vips_XYZ2Lab optional arguments +func DefaultXYZ2LabOptions() *XYZ2LabOptions { + return &XYZ2LabOptions{ + } +} + +// XYZ2Lab vips_XYZ2Lab transform XYZ to Lab +func (r *Image) XYZ2Lab(options *XYZ2LabOptions) (error) { + if options != nil { + out, err := vipsgenXYZ2LabWithOptions(r.image, options.Temp) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenXYZ2Lab(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// XYZ2Yxy vips_XYZ2Yxy transform XYZ to Yxy +func (r *Image) XYZ2Yxy() (error) { + out, err := vipsgenXYZ2Yxy(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// XYZ2scRGB vips_XYZ2scRGB transform XYZ to scRGB +func (r *Image) XYZ2scRGB() (error) { + out, err := vipsgenXYZ2scRGB(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Yxy2XYZ vips_Yxy2XYZ transform Yxy to XYZ +func (r *Image) Yxy2XYZ() (error) { + out, err := vipsgenYxy2XYZ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Abs vips_abs absolute value of an image +func (r *Image) Abs() (error) { + out, err := vipsgenAbs(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Add vips_add add two images +// +// The right specifies right-hand image argument. +func (r *Image) Add(right *Image) (error) { + out, err := vipsgenAdd(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Addalpha vips_addalpha append an alpha channel +func (r *Image) Addalpha() (error) { + out, err := vipsgenAddalpha(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// AffineOptions optional arguments for vips_affine +type AffineOptions struct { + // Interpolate Interpolate pixels with this + Interpolate *Interpolate + // Oarea Area of output to generate + Oarea []int + // Odx Horizontal output displacement + Odx float64 + // Ody Vertical output displacement + Ody float64 + // Idx Horizontal input displacement + Idx float64 + // Idy Vertical input displacement + Idy float64 + // Background Background value + Background []float64 + // Premultiplied Images have premultiplied alpha + Premultiplied bool + // Extend How to generate the extra pixels + Extend Extend +} + +// DefaultAffineOptions creates default value for vips_affine optional arguments +func DefaultAffineOptions() *AffineOptions { + return &AffineOptions{ + Extend: Extend(5), + } +} + +// Affine vips_affine affine transform of an image +// +// The a specifies coefficient a (horizontal scale). +// The b specifies coefficient b (horizontal shear). +// The c specifies coefficient c (vertical shear). +// The d specifies coefficient d (vertical scale). +func (r *Image) Affine(a float64, b float64, c float64, d float64, options *AffineOptions) (error) { + if options != nil { + out, err := vipsgenAffineWithOptions(r.image, a, b, c, d, options.Interpolate, options.Oarea, options.Odx, options.Ody, options.Idx, options.Idy, options.Background, options.Premultiplied, options.Extend) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenAffine(r.image, a, b, c, d) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Autorot vips_autorot autorotate image by exif tag +func (r *Image) Autorot() (error) { + out, err := vipsgenAutorot(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Avg vips_avg find image average +func (r *Image) Avg() (float64, error) { + out, err := vipsgenAvg(r.image) + if err != nil { + return 0, err + } + return out, nil +} + + +// Bandbool vips_bandbool boolean operation across image bands +// +// The boolean specifies boolean to perform. +func (r *Image) Bandbool(boolean OperationBoolean) (error) { + out, err := vipsgenBandbool(r.image, boolean) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// BandfoldOptions optional arguments for vips_bandfold +type BandfoldOptions struct { + // Factor Fold by this factor + Factor int +} + +// DefaultBandfoldOptions creates default value for vips_bandfold optional arguments +func DefaultBandfoldOptions() *BandfoldOptions { + return &BandfoldOptions{ + } +} + +// Bandfold vips_bandfold fold up x axis into bands +func (r *Image) Bandfold(options *BandfoldOptions) (error) { + if options != nil { + out, err := vipsgenBandfoldWithOptions(r.image, options.Factor) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenBandfold(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// BandjoinConst vips_bandjoin_const append a constant band to an image +// +// The c specifies array of constants to add. +func (r *Image) BandjoinConst(c []float64) (error) { + out, err := vipsgenBandjoinConst(r.image, c) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Bandmean vips_bandmean band-wise average +func (r *Image) Bandmean() (error) { + out, err := vipsgenBandmean(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// BandunfoldOptions optional arguments for vips_bandunfold +type BandunfoldOptions struct { + // Factor Unfold by this factor + Factor int +} + +// DefaultBandunfoldOptions creates default value for vips_bandunfold optional arguments +func DefaultBandunfoldOptions() *BandunfoldOptions { + return &BandunfoldOptions{ + } +} + +// Bandunfold vips_bandunfold unfold image bands into x axis +func (r *Image) Bandunfold(options *BandunfoldOptions) (error) { + if options != nil { + out, err := vipsgenBandunfoldWithOptions(r.image, options.Factor) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenBandunfold(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Boolean vips_boolean boolean operation on two images +// +// The right specifies right-hand image argument. +// The boolean specifies boolean to perform. +func (r *Image) Boolean(right *Image, boolean OperationBoolean) (error) { + out, err := vipsgenBoolean(r.image, right.image, boolean) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// BooleanConst vips_boolean_const boolean operations against a constant +// +// The boolean specifies boolean to perform. +// The c specifies array of constants. +func (r *Image) BooleanConst(boolean OperationBoolean, c []float64) (error) { + out, err := vipsgenBooleanConst(r.image, boolean, c) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Buildlut vips_buildlut build a look-up table +func (r *Image) Buildlut() (error) { + out, err := vipsgenBuildlut(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Byteswap vips_byteswap byteswap an image +func (r *Image) Byteswap() (error) { + out, err := vipsgenByteswap(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// CannyOptions optional arguments for vips_canny +type CannyOptions struct { + // Sigma Sigma of Gaussian + Sigma float64 + // Precision Convolve with this precision + Precision Precision +} + +// DefaultCannyOptions creates default value for vips_canny optional arguments +func DefaultCannyOptions() *CannyOptions { + return &CannyOptions{ + Sigma: 1.4, + Precision: Precision(1), + } +} + +// Canny vips_canny Canny edge detector +func (r *Image) Canny(options *CannyOptions) (error) { + if options != nil { + out, err := vipsgenCannyWithOptions(r.image, options.Sigma, options.Precision) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenCanny(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Case vips_case use pixel values to pick cases from an array of images +// +// The cases specifies array of case images. +func (r *Image) Case(cases []*Image) (error) { + out, err := vipsgenCase(r.image, convertImagesToVipsImages(cases)) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// CastOptions optional arguments for vips_cast +type CastOptions struct { + // Shift Shift integer values up and down + Shift bool +} + +// DefaultCastOptions creates default value for vips_cast optional arguments +func DefaultCastOptions() *CastOptions { + return &CastOptions{ + } +} + +// Cast vips_cast cast an image +// +// The format specifies format to cast to. +func (r *Image) Cast(format BandFormat, options *CastOptions) (error) { + if options != nil { + out, err := vipsgenCastWithOptions(r.image, format, options.Shift) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenCast(r.image, format) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ClampOptions optional arguments for vips_clamp +type ClampOptions struct { + // Min Minimum value + Min float64 + // Max Maximum value + Max float64 +} + +// DefaultClampOptions creates default value for vips_clamp optional arguments +func DefaultClampOptions() *ClampOptions { + return &ClampOptions{ + Max: 1, + } +} + +// Clamp vips_clamp clamp values of an image +func (r *Image) Clamp(options *ClampOptions) (error) { + if options != nil { + out, err := vipsgenClampWithOptions(r.image, options.Min, options.Max) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenClamp(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ColourspaceOptions optional arguments for vips_colourspace +type ColourspaceOptions struct { + // SourceSpace Source color space + SourceSpace Interpretation +} + +// DefaultColourspaceOptions creates default value for vips_colourspace optional arguments +func DefaultColourspaceOptions() *ColourspaceOptions { + return &ColourspaceOptions{ + SourceSpace: Interpretation(22), + } +} + +// Colourspace vips_colourspace convert to a new colorspace +// +// The space specifies destination color space. +func (r *Image) Colourspace(space Interpretation, options *ColourspaceOptions) (error) { + if options != nil { + out, err := vipsgenColourspaceWithOptions(r.image, space, options.SourceSpace) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenColourspace(r.image, space) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// CompassOptions optional arguments for vips_compass +type CompassOptions struct { + // Times Rotate and convolve this many times + Times int + // Angle Rotate mask by this much between convolutions + Angle Angle45 + // Combine Combine convolution results like this + Combine Combine + // Precision Convolve with this precision + Precision Precision + // Layers Use this many layers in approximation + Layers int + // Cluster Cluster lines closer than this in approximation + Cluster int +} + +// DefaultCompassOptions creates default value for vips_compass optional arguments +func DefaultCompassOptions() *CompassOptions { + return &CompassOptions{ + Times: 2, + Angle: Angle45(2), + Precision: Precision(1), + Layers: 5, + Cluster: 1, + } +} + +// Compass vips_compass convolve with rotating mask +// +// The mask specifies input matrix image. +func (r *Image) Compass(mask *Image, options *CompassOptions) (error) { + if options != nil { + out, err := vipsgenCompassWithOptions(r.image, mask.image, options.Times, options.Angle, options.Combine, options.Precision, options.Layers, options.Cluster) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenCompass(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Complex vips_complex perform a complex operation on an image +// +// The cmplx specifies complex to perform. +func (r *Image) Complex(cmplx OperationComplex) (error) { + out, err := vipsgenComplex(r.image, cmplx) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Complex2 vips_complex2 complex binary operations on two images +// +// The right specifies right-hand image argument. +// The cmplx specifies binary complex operation to perform. +func (r *Image) Complex2(right *Image, cmplx OperationComplex2) (error) { + out, err := vipsgenComplex2(r.image, right.image, cmplx) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Complexform vips_complexform form a complex image from two real images +// +// The right specifies right-hand image argument. +func (r *Image) Complexform(right *Image) (error) { + out, err := vipsgenComplexform(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Complexget vips_complexget get a component from a complex image +// +// The get specifies complex to perform. +func (r *Image) Complexget(get OperationComplexget) (error) { + out, err := vipsgenComplexget(r.image, get) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Composite2Options optional arguments for vips_composite2 +type Composite2Options struct { + // X x position of overlay + X int + // Y y position of overlay + Y int + // CompositingSpace Composite images in this colour space + CompositingSpace Interpretation + // Premultiplied Images have premultiplied alpha + Premultiplied bool +} + +// DefaultComposite2Options creates default value for vips_composite2 optional arguments +func DefaultComposite2Options() *Composite2Options { + return &Composite2Options{ + CompositingSpace: Interpretation(22), + } +} + +// Composite2 vips_composite2 blend a pair of images with a blend mode +// +// The overlay specifies overlay image. +// The mode specifies vipsBlendMode to join with. +func (r *Image) Composite2(overlay *Image, mode BlendMode, options *Composite2Options) (error) { + if options != nil { + out, err := vipsgenComposite2WithOptions(r.image, overlay.image, mode, options.X, options.Y, options.CompositingSpace, options.Premultiplied) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenComposite2(r.image, overlay.image, mode) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ConvOptions optional arguments for vips_conv +type ConvOptions struct { + // Precision Convolve with this precision + Precision Precision + // Layers Use this many layers in approximation + Layers int + // Cluster Cluster lines closer than this in approximation + Cluster int +} + +// DefaultConvOptions creates default value for vips_conv optional arguments +func DefaultConvOptions() *ConvOptions { + return &ConvOptions{ + Precision: Precision(1), + Layers: 5, + Cluster: 1, + } +} + +// Conv vips_conv convolution operation +// +// The mask specifies input matrix image. +func (r *Image) Conv(mask *Image, options *ConvOptions) (error) { + if options != nil { + out, err := vipsgenConvWithOptions(r.image, mask.image, options.Precision, options.Layers, options.Cluster) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenConv(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ConvaOptions optional arguments for vips_conva +type ConvaOptions struct { + // Layers Use this many layers in approximation + Layers int + // Cluster Cluster lines closer than this in approximation + Cluster int +} + +// DefaultConvaOptions creates default value for vips_conva optional arguments +func DefaultConvaOptions() *ConvaOptions { + return &ConvaOptions{ + Layers: 5, + Cluster: 1, + } +} + +// Conva vips_conva approximate integer convolution +// +// The mask specifies input matrix image. +func (r *Image) Conva(mask *Image, options *ConvaOptions) (error) { + if options != nil { + out, err := vipsgenConvaWithOptions(r.image, mask.image, options.Layers, options.Cluster) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenConva(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ConvasepOptions optional arguments for vips_convasep +type ConvasepOptions struct { + // Layers Use this many layers in approximation + Layers int +} + +// DefaultConvasepOptions creates default value for vips_convasep optional arguments +func DefaultConvasepOptions() *ConvasepOptions { + return &ConvasepOptions{ + Layers: 5, + } +} + +// Convasep vips_convasep approximate separable integer convolution +// +// The mask specifies input matrix image. +func (r *Image) Convasep(mask *Image, options *ConvasepOptions) (error) { + if options != nil { + out, err := vipsgenConvasepWithOptions(r.image, mask.image, options.Layers) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenConvasep(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Convf vips_convf float convolution operation +// +// The mask specifies input matrix image. +func (r *Image) Convf(mask *Image) (error) { + out, err := vipsgenConvf(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Convi vips_convi int convolution operation +// +// The mask specifies input matrix image. +func (r *Image) Convi(mask *Image) (error) { + out, err := vipsgenConvi(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ConvsepOptions optional arguments for vips_convsep +type ConvsepOptions struct { + // Precision Convolve with this precision + Precision Precision + // Layers Use this many layers in approximation + Layers int + // Cluster Cluster lines closer than this in approximation + Cluster int +} + +// DefaultConvsepOptions creates default value for vips_convsep optional arguments +func DefaultConvsepOptions() *ConvsepOptions { + return &ConvsepOptions{ + Precision: Precision(1), + Layers: 5, + Cluster: 1, + } +} + +// Convsep vips_convsep separable convolution operation +// +// The mask specifies input matrix image. +func (r *Image) Convsep(mask *Image, options *ConvsepOptions) (error) { + if options != nil { + out, err := vipsgenConvsepWithOptions(r.image, mask.image, options.Precision, options.Layers, options.Cluster) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenConvsep(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// CopyOptions optional arguments for vips_copy +type CopyOptions struct { + // Width Image width in pixels + Width int + // Height Image height in pixels + Height int + // Bands Number of bands in image + Bands int + // Format Pixel format in image + Format BandFormat + // Coding Pixel coding + Coding Coding + // Interpretation Pixel interpretation + Interpretation Interpretation + // Xres Horizontal resolution in pixels/mm + Xres float64 + // Yres Vertical resolution in pixels/mm + Yres float64 + // Xoffset Horizontal offset of origin + Xoffset int + // Yoffset Vertical offset of origin + Yoffset int +} + +// DefaultCopyOptions creates default value for vips_copy optional arguments +func DefaultCopyOptions() *CopyOptions { + return &CopyOptions{ + } +} + +// Copy vips_copy copy an image +func (r *Image) Copy(options *CopyOptions) (*Image, error) { + if options != nil { + out, err := vipsgenCopyWithOptions(r.image, options.Width, options.Height, options.Bands, options.Format, options.Coding, options.Interpretation, options.Xres, options.Yres, options.Xoffset, options.Yoffset) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil + } + out, err := vipsgenCopy(r.image) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil +} + + +// Countlines vips_countlines count lines in an image +// +// The direction specifies countlines left-right or up-down. +func (r *Image) Countlines(direction Direction) (float64, error) { + out, err := vipsgenCountlines(r.image, direction) + if err != nil { + return 0, err + } + return out, nil +} + +// CsvsaveOptions optional arguments for vips_csvsave +type CsvsaveOptions struct { + // Separator Separator characters + Separator string + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultCsvsaveOptions creates default value for vips_csvsave optional arguments +func DefaultCsvsaveOptions() *CsvsaveOptions { + return &CsvsaveOptions{ + Separator: "\t", + } +} + +// Csvsave vips_csvsave save image to csv +// +// The filename specifies filename to save to. +func (r *Image) Csvsave(filename string, options *CsvsaveOptions) (error) { + if options != nil { + err := vipsgenCsvsaveWithOptions(r.image, filename, options.Separator, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenCsvsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// CsvsaveTargetOptions optional arguments for vips_csvsave_target +type CsvsaveTargetOptions struct { + // Separator Separator characters + Separator string + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultCsvsaveTargetOptions creates default value for vips_csvsave_target optional arguments +func DefaultCsvsaveTargetOptions() *CsvsaveTargetOptions { + return &CsvsaveTargetOptions{ + Separator: "\t", + } +} + +// CsvsaveTarget vips_csvsave_target save image to csv +// +// The target specifies target to save to. +func (r *Image) CsvsaveTarget(target *Target, options *CsvsaveTargetOptions) (error) { + if options != nil { + err := vipsgenCsvsaveTargetWithOptions(r.image, target.target, options.Separator, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenCsvsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + + +// DE00 vips_dE00 calculate dE00 +// +// The right specifies right-hand input image. +func (r *Image) DE00(right *Image) (error) { + out, err := vipsgenDE00(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// DE76 vips_dE76 calculate dE76 +// +// The right specifies right-hand input image. +func (r *Image) DE76(right *Image) (error) { + out, err := vipsgenDE76(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// DECMC vips_dECMC calculate dECMC +// +// The right specifies right-hand input image. +func (r *Image) DECMC(right *Image) (error) { + out, err := vipsgenDECMC(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Deviate vips_deviate find image standard deviation +func (r *Image) Deviate() (float64, error) { + out, err := vipsgenDeviate(r.image) + if err != nil { + return 0, err + } + return out, nil +} + + +// Divide vips_divide divide two images +// +// The right specifies right-hand image argument. +func (r *Image) Divide(right *Image) (error) { + out, err := vipsgenDivide(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// DrawCircleOptions optional arguments for vips_draw_circle +type DrawCircleOptions struct { + // Fill Draw a solid object + Fill bool +} + +// DefaultDrawCircleOptions creates default value for vips_draw_circle optional arguments +func DefaultDrawCircleOptions() *DrawCircleOptions { + return &DrawCircleOptions{ + } +} + +// DrawCircle vips_draw_circle draw a circle on an image +// +// The ink specifies color for pixels. +// The cx specifies centre of draw_circle. +// The cy specifies centre of draw_circle. +// The radius specifies radius in pixels. +func (r *Image) DrawCircle(ink []float64, cx int, cy int, radius int, options *DrawCircleOptions) (error) { + if options != nil { + err := vipsgenDrawCircleWithOptions(r.image, ink, cx, cy, radius, options.Fill) + if err != nil { + return err + } + return nil + } + err := vipsgenDrawCircle(r.image, ink, cx, cy, radius) + if err != nil { + return err + } + return nil +} + +// DrawFloodOptions optional arguments for vips_draw_flood +type DrawFloodOptions struct { + // Test Test pixels in this image + Test *Image + // Equal DrawFlood while equal to edge + Equal bool +} + +// DefaultDrawFloodOptions creates default value for vips_draw_flood optional arguments +func DefaultDrawFloodOptions() *DrawFloodOptions { + return &DrawFloodOptions{ + } +} + +// DrawFlood vips_draw_flood flood-fill an area +// +// The ink specifies color for pixels. +// The x specifies drawFlood start point. +// The y specifies drawFlood start point. +func (r *Image) DrawFlood(ink []float64, x int, y int, options *DrawFloodOptions) (error) { + if options != nil { + err := vipsgenDrawFloodWithOptions(r.image, ink, x, y, options.Test.image, options.Equal) + if err != nil { + return err + } + return nil + } + err := vipsgenDrawFlood(r.image, ink, x, y) + if err != nil { + return err + } + return nil +} + +// DrawImageOptions optional arguments for vips_draw_image +type DrawImageOptions struct { + // Mode Combining mode + Mode CombineMode +} + +// DefaultDrawImageOptions creates default value for vips_draw_image optional arguments +func DefaultDrawImageOptions() *DrawImageOptions { + return &DrawImageOptions{ + } +} + +// DrawImage vips_draw_image paint an image into another image +// +// The sub specifies sub-image to insert into main image. +// The x specifies draw image here. +// The y specifies draw image here. +func (r *Image) DrawImage(sub *Image, x int, y int, options *DrawImageOptions) (error) { + if options != nil { + err := vipsgenDrawImageWithOptions(r.image, sub.image, x, y, options.Mode) + if err != nil { + return err + } + return nil + } + err := vipsgenDrawImage(r.image, sub.image, x, y) + if err != nil { + return err + } + return nil +} + + +// DrawLine vips_draw_line draw a line on an image +// +// The ink specifies color for pixels. +// The x1 specifies start of draw_line. +// The y1 specifies start of draw_line. +// The x2 specifies end of draw_line. +// The y2 specifies end of draw_line. +func (r *Image) DrawLine(ink []float64, x1 int, y1 int, x2 int, y2 int) (error) { + err := vipsgenDrawLine(r.image, ink, x1, y1, x2, y2) + if err != nil { + return err + } + return nil +} + + +// DrawMask vips_draw_mask draw a mask on an image +// +// The ink specifies color for pixels. +// The mask specifies mask of pixels to draw. +// The x specifies draw mask here. +// The y specifies draw mask here. +func (r *Image) DrawMask(ink []float64, mask *Image, x int, y int) (error) { + err := vipsgenDrawMask(r.image, ink, mask.image, x, y) + if err != nil { + return err + } + return nil +} + +// DrawRectOptions optional arguments for vips_draw_rect +type DrawRectOptions struct { + // Fill Draw a solid object + Fill bool +} + +// DefaultDrawRectOptions creates default value for vips_draw_rect optional arguments +func DefaultDrawRectOptions() *DrawRectOptions { + return &DrawRectOptions{ + } +} + +// DrawRect vips_draw_rect paint a rectangle on an image +// +// The ink specifies color for pixels. +// The left specifies rect to fill. +// The top specifies rect to fill. +// The width specifies rect to fill. +// The height specifies rect to fill. +func (r *Image) DrawRect(ink []float64, left int, top int, width int, height int, options *DrawRectOptions) (error) { + if options != nil { + err := vipsgenDrawRectWithOptions(r.image, ink, left, top, width, height, options.Fill) + if err != nil { + return err + } + return nil + } + err := vipsgenDrawRect(r.image, ink, left, top, width, height) + if err != nil { + return err + } + return nil +} + + +// DrawSmudge vips_draw_smudge blur a rectangle on an image +// +// The left specifies rect to fill. +// The top specifies rect to fill. +// The width specifies rect to fill. +// The height specifies rect to fill. +func (r *Image) DrawSmudge(left int, top int, width int, height int) (error) { + err := vipsgenDrawSmudge(r.image, left, top, width, height) + if err != nil { + return err + } + return nil +} + +// DzsaveOptions optional arguments for vips_dzsave +type DzsaveOptions struct { + // Imagename Image name + Imagename string + // Layout Directory layout + Layout DzLayout + // Suffix Filename suffix for tiles + Suffix string + // Overlap Tile overlap in pixels + Overlap int + // TileSize Tile size in pixels + TileSize int + // Centre Center image in tile + Centre bool + // Depth Pyramid depth + Depth DzDepth + // Angle Rotate image during save + Angle Angle + // Container Pyramid container type + Container DzContainer + // Compression ZIP deflate compression level + Compression int + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // SkipBlanks Skip tiles which are nearly equal to the background + SkipBlanks int + // Id Resource ID + Id string + // Q Q factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultDzsaveOptions creates default value for vips_dzsave optional arguments +func DefaultDzsaveOptions() *DzsaveOptions { + return &DzsaveOptions{ + Suffix: ".jpeg", + Overlap: 1, + TileSize: 254, + SkipBlanks: -1, + Id: "https://example.com/iiif", + Q: 75, + } +} + +// Dzsave vips_dzsave save image to deepzoom file +// +// The filename specifies filename to save to. +func (r *Image) Dzsave(filename string, options *DzsaveOptions) (error) { + if options != nil { + err := vipsgenDzsaveWithOptions(r.image, filename, options.Imagename, options.Layout, options.Suffix, options.Overlap, options.TileSize, options.Centre, options.Depth, options.Angle, options.Container, options.Compression, options.RegionShrink, options.SkipBlanks, options.Id, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenDzsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// DzsaveBufferOptions optional arguments for vips_dzsave_buffer +type DzsaveBufferOptions struct { + // Imagename Image name + Imagename string + // Layout Directory layout + Layout DzLayout + // Suffix Filename suffix for tiles + Suffix string + // Overlap Tile overlap in pixels + Overlap int + // TileSize Tile size in pixels + TileSize int + // Centre Center image in tile + Centre bool + // Depth Pyramid depth + Depth DzDepth + // Angle Rotate image during save + Angle Angle + // Container Pyramid container type + Container DzContainer + // Compression ZIP deflate compression level + Compression int + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // SkipBlanks Skip tiles which are nearly equal to the background + SkipBlanks int + // Id Resource ID + Id string + // Q Q factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultDzsaveBufferOptions creates default value for vips_dzsave_buffer optional arguments +func DefaultDzsaveBufferOptions() *DzsaveBufferOptions { + return &DzsaveBufferOptions{ + Suffix: ".jpeg", + Overlap: 1, + TileSize: 254, + SkipBlanks: -1, + Id: "https://example.com/iiif", + Q: 75, + } +} + +// DzsaveBuffer vips_dzsave_buffer save image to dz buffer +func (r *Image) DzsaveBuffer(options *DzsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenDzsaveBufferWithOptions(r.image, options.Imagename, options.Layout, options.Suffix, options.Overlap, options.TileSize, options.Centre, options.Depth, options.Angle, options.Container, options.Compression, options.RegionShrink, options.SkipBlanks, options.Id, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenDzsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// DzsaveTargetOptions optional arguments for vips_dzsave_target +type DzsaveTargetOptions struct { + // Imagename Image name + Imagename string + // Layout Directory layout + Layout DzLayout + // Suffix Filename suffix for tiles + Suffix string + // Overlap Tile overlap in pixels + Overlap int + // TileSize Tile size in pixels + TileSize int + // Centre Center image in tile + Centre bool + // Depth Pyramid depth + Depth DzDepth + // Angle Rotate image during save + Angle Angle + // Container Pyramid container type + Container DzContainer + // Compression ZIP deflate compression level + Compression int + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // SkipBlanks Skip tiles which are nearly equal to the background + SkipBlanks int + // Id Resource ID + Id string + // Q Q factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultDzsaveTargetOptions creates default value for vips_dzsave_target optional arguments +func DefaultDzsaveTargetOptions() *DzsaveTargetOptions { + return &DzsaveTargetOptions{ + Suffix: ".jpeg", + Overlap: 1, + TileSize: 254, + SkipBlanks: -1, + Id: "https://example.com/iiif", + Q: 75, + } +} + +// DzsaveTarget vips_dzsave_target save image to deepzoom target +// +// The target specifies target to save to. +func (r *Image) DzsaveTarget(target *Target, options *DzsaveTargetOptions) (error) { + if options != nil { + err := vipsgenDzsaveTargetWithOptions(r.image, target.target, options.Imagename, options.Layout, options.Suffix, options.Overlap, options.TileSize, options.Centre, options.Depth, options.Angle, options.Container, options.Compression, options.RegionShrink, options.SkipBlanks, options.Id, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenDzsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// EmbedOptions optional arguments for vips_embed +type EmbedOptions struct { + // Extend How to generate the extra pixels + Extend Extend + // Background Color for background pixels + Background []float64 +} + +// DefaultEmbedOptions creates default value for vips_embed optional arguments +func DefaultEmbedOptions() *EmbedOptions { + return &EmbedOptions{ + } +} + +// Embed vips_embed embed an image in a larger image +// +// The x specifies left edge of input in output. +// The y specifies top edge of input in output. +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func (r *Image) Embed(x int, y int, width int, height int, options *EmbedOptions) (error) { + if options != nil { + out, err := vipsgenEmbedWithOptions(r.image, x, y, width, height, options.Extend, options.Background) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenEmbed(r.image, x, y, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// ExtractArea vips_extract_area extract an area from an image +// +// The left specifies left edge of extract area. +// The top specifies top edge of extract area. +// The width specifies width of extract area. +// The height specifies height of extract area. +func (r *Image) ExtractArea(left int, top int, width int, height int) (error) { + out, err := vipsgenExtractArea(r.image, left, top, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ExtractBandOptions optional arguments for vips_extract_band +type ExtractBandOptions struct { + // N Number of bands to extract + N int +} + +// DefaultExtractBandOptions creates default value for vips_extract_band optional arguments +func DefaultExtractBandOptions() *ExtractBandOptions { + return &ExtractBandOptions{ + N: 1, + } +} + +// ExtractBand vips_extract_band extract band from an image +// +// The band specifies band to extract. +func (r *Image) ExtractBand(band int, options *ExtractBandOptions) (error) { + if options != nil { + out, err := vipsgenExtractBandWithOptions(r.image, band, options.N) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenExtractBand(r.image, band) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Falsecolour vips_falsecolour false-color an image +func (r *Image) Falsecolour() (error) { + out, err := vipsgenFalsecolour(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Fastcor vips_fastcor fast correlation +// +// The ref specifies input reference image. +func (r *Image) Fastcor(ref *Image) (error) { + out, err := vipsgenFastcor(r.image, ref.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// FillNearest vips_fill_nearest fill image zeros with nearest non-zero pixel +func (r *Image) FillNearest() (*Image, error) { + out, err := vipsgenFillNearest(r.image) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil +} + +// FindTrimOptions optional arguments for vips_find_trim +type FindTrimOptions struct { + // Threshold Object threshold + Threshold float64 + // Background Color for background pixels + Background []float64 + // LineArt Enable line art mode + LineArt bool +} + +// DefaultFindTrimOptions creates default value for vips_find_trim optional arguments +func DefaultFindTrimOptions() *FindTrimOptions { + return &FindTrimOptions{ + Threshold: 10, + } +} + +// FindTrim vips_find_trim search an image for non-edge areas +func (r *Image) FindTrim(options *FindTrimOptions) (int, int, int, int, error) { + if options != nil { + left, top, width, height, err := vipsgenFindTrimWithOptions(r.image, options.Threshold, options.Background, options.LineArt) + if err != nil { + return 0, 0, 0, 0, err + } + return left, top, width, height, nil + } + left, top, width, height, err := vipsgenFindTrim(r.image) + if err != nil { + return 0, 0, 0, 0, err + } + return left, top, width, height, nil +} + +// FitssaveOptions optional arguments for vips_fitssave +type FitssaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultFitssaveOptions creates default value for vips_fitssave optional arguments +func DefaultFitssaveOptions() *FitssaveOptions { + return &FitssaveOptions{ + } +} + +// Fitssave vips_fitssave save image to fits file +// +// The filename specifies filename to save to. +func (r *Image) Fitssave(filename string, options *FitssaveOptions) (error) { + if options != nil { + err := vipsgenFitssaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenFitssave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// FlattenOptions optional arguments for vips_flatten +type FlattenOptions struct { + // Background Background value + Background []float64 + // MaxAlpha Maximum value of alpha channel + MaxAlpha float64 +} + +// DefaultFlattenOptions creates default value for vips_flatten optional arguments +func DefaultFlattenOptions() *FlattenOptions { + return &FlattenOptions{ + MaxAlpha: 255, + } +} + +// Flatten vips_flatten flatten alpha out of an image +func (r *Image) Flatten(options *FlattenOptions) (error) { + if options != nil { + out, err := vipsgenFlattenWithOptions(r.image, options.Background, options.MaxAlpha) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenFlatten(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Flip vips_flip flip an image +// +// The direction specifies direction to flip image. +func (r *Image) Flip(direction Direction) (error) { + out, err := vipsgenFlip(r.image, direction) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Float2rad vips_float2rad transform float RGB to Radiance coding +func (r *Image) Float2rad() (error) { + out, err := vipsgenFloat2rad(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Freqmult vips_freqmult frequency-domain filtering +// +// The mask specifies input mask image. +func (r *Image) Freqmult(mask *Image) (error) { + out, err := vipsgenFreqmult(r.image, mask.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Fwfft vips_fwfft forward FFT +func (r *Image) Fwfft() (error) { + out, err := vipsgenFwfft(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// GammaOptions optional arguments for vips_gamma +type GammaOptions struct { + // Exponent Gamma factor + Exponent float64 +} + +// DefaultGammaOptions creates default value for vips_gamma optional arguments +func DefaultGammaOptions() *GammaOptions { + return &GammaOptions{ + Exponent: 0.4166666666666667, + } +} + +// Gamma vips_gamma gamma an image +func (r *Image) Gamma(options *GammaOptions) (error) { + if options != nil { + out, err := vipsgenGammaWithOptions(r.image, options.Exponent) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenGamma(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// GaussblurOptions optional arguments for vips_gaussblur +type GaussblurOptions struct { + // MinAmpl Minimum amplitude of Gaussian + MinAmpl float64 + // Precision Convolve with this precision + Precision Precision +} + +// DefaultGaussblurOptions creates default value for vips_gaussblur optional arguments +func DefaultGaussblurOptions() *GaussblurOptions { + return &GaussblurOptions{ + MinAmpl: 0.2, + } +} + +// Gaussblur vips_gaussblur gaussian blur +// +// The sigma specifies sigma of Gaussian. +func (r *Image) Gaussblur(sigma float64, options *GaussblurOptions) (error) { + if options != nil { + out, err := vipsgenGaussblurWithOptions(r.image, sigma, options.MinAmpl, options.Precision) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenGaussblur(r.image, sigma) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// GetpointOptions optional arguments for vips_getpoint +type GetpointOptions struct { + // UnpackComplex Complex pixels should be unpacked + UnpackComplex bool +} + +// DefaultGetpointOptions creates default value for vips_getpoint optional arguments +func DefaultGetpointOptions() *GetpointOptions { + return &GetpointOptions{ + } +} + +// Getpoint vips_getpoint read a point from an image +// +// The x specifies point to read. +// The y specifies point to read. +func (r *Image) Getpoint(x int, y int, options *GetpointOptions) ([]float64, error) { + if options != nil { + outArray, err := vipsgenGetpointWithOptions(r.image, x, y, options.UnpackComplex) + if err != nil { + return nil, err + } + return outArray, nil + } + outArray, err := vipsgenGetpoint(r.image, x, y) + if err != nil { + return nil, err + } + return outArray, nil +} + +// GifsaveOptions optional arguments for vips_gifsave +type GifsaveOptions struct { + // Dither Amount of dithering + Dither float64 + // Effort Quantisation effort + Effort int + // Bitdepth Number of bits per pixel + Bitdepth int + // InterframeMaxerror Maximum inter-frame error for transparency + InterframeMaxerror float64 + // Reuse Reuse palette from input + Reuse bool + // InterpaletteMaxerror Maximum inter-palette error for palette reusage + InterpaletteMaxerror float64 + // Interlace Generate an interlaced (progressive) GIF + Interlace bool + // KeepDuplicateFrames Keep duplicate frames in the output instead of combining them + KeepDuplicateFrames bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultGifsaveOptions creates default value for vips_gifsave optional arguments +func DefaultGifsaveOptions() *GifsaveOptions { + return &GifsaveOptions{ + Dither: 1, + Effort: 7, + Bitdepth: 8, + InterpaletteMaxerror: 3, + } +} + +// Gifsave vips_gifsave save as gif +// +// The filename specifies filename to save to. +func (r *Image) Gifsave(filename string, options *GifsaveOptions) (error) { + if options != nil { + err := vipsgenGifsaveWithOptions(r.image, filename, options.Dither, options.Effort, options.Bitdepth, options.InterframeMaxerror, options.Reuse, options.InterpaletteMaxerror, options.Interlace, options.KeepDuplicateFrames, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenGifsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// GifsaveBufferOptions optional arguments for vips_gifsave_buffer +type GifsaveBufferOptions struct { + // Dither Amount of dithering + Dither float64 + // Effort Quantisation effort + Effort int + // Bitdepth Number of bits per pixel + Bitdepth int + // InterframeMaxerror Maximum inter-frame error for transparency + InterframeMaxerror float64 + // Reuse Reuse palette from input + Reuse bool + // InterpaletteMaxerror Maximum inter-palette error for palette reusage + InterpaletteMaxerror float64 + // Interlace Generate an interlaced (progressive) GIF + Interlace bool + // KeepDuplicateFrames Keep duplicate frames in the output instead of combining them + KeepDuplicateFrames bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultGifsaveBufferOptions creates default value for vips_gifsave_buffer optional arguments +func DefaultGifsaveBufferOptions() *GifsaveBufferOptions { + return &GifsaveBufferOptions{ + Dither: 1, + Effort: 7, + Bitdepth: 8, + InterpaletteMaxerror: 3, + } +} + +// GifsaveBuffer vips_gifsave_buffer save as gif +func (r *Image) GifsaveBuffer(options *GifsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenGifsaveBufferWithOptions(r.image, options.Dither, options.Effort, options.Bitdepth, options.InterframeMaxerror, options.Reuse, options.InterpaletteMaxerror, options.Interlace, options.KeepDuplicateFrames, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenGifsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// GifsaveTargetOptions optional arguments for vips_gifsave_target +type GifsaveTargetOptions struct { + // Dither Amount of dithering + Dither float64 + // Effort Quantisation effort + Effort int + // Bitdepth Number of bits per pixel + Bitdepth int + // InterframeMaxerror Maximum inter-frame error for transparency + InterframeMaxerror float64 + // Reuse Reuse palette from input + Reuse bool + // InterpaletteMaxerror Maximum inter-palette error for palette reusage + InterpaletteMaxerror float64 + // Interlace Generate an interlaced (progressive) GIF + Interlace bool + // KeepDuplicateFrames Keep duplicate frames in the output instead of combining them + KeepDuplicateFrames bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultGifsaveTargetOptions creates default value for vips_gifsave_target optional arguments +func DefaultGifsaveTargetOptions() *GifsaveTargetOptions { + return &GifsaveTargetOptions{ + Dither: 1, + Effort: 7, + Bitdepth: 8, + InterpaletteMaxerror: 3, + } +} + +// GifsaveTarget vips_gifsave_target save as gif +// +// The target specifies target to save to. +func (r *Image) GifsaveTarget(target *Target, options *GifsaveTargetOptions) (error) { + if options != nil { + err := vipsgenGifsaveTargetWithOptions(r.image, target.target, options.Dither, options.Effort, options.Bitdepth, options.InterframeMaxerror, options.Reuse, options.InterpaletteMaxerror, options.Interlace, options.KeepDuplicateFrames, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenGifsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// GlobalbalanceOptions optional arguments for vips_globalbalance +type GlobalbalanceOptions struct { + // Gamma Image gamma + Gamma float64 + // IntOutput Integer output + IntOutput bool +} + +// DefaultGlobalbalanceOptions creates default value for vips_globalbalance optional arguments +func DefaultGlobalbalanceOptions() *GlobalbalanceOptions { + return &GlobalbalanceOptions{ + Gamma: 1.6, + } +} + +// Globalbalance vips_globalbalance global balance an image mosaic +func (r *Image) Globalbalance(options *GlobalbalanceOptions) (error) { + if options != nil { + out, err := vipsgenGlobalbalanceWithOptions(r.image, options.Gamma, options.IntOutput) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenGlobalbalance(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// GravityOptions optional arguments for vips_gravity +type GravityOptions struct { + // Extend How to generate the extra pixels + Extend Extend + // Background Color for background pixels + Background []float64 +} + +// DefaultGravityOptions creates default value for vips_gravity optional arguments +func DefaultGravityOptions() *GravityOptions { + return &GravityOptions{ + } +} + +// Gravity vips_gravity place an image within a larger image with a certain gravity +// +// The direction specifies direction to place image within width/height. +// The width specifies image width in pixels. +// The height specifies image height in pixels. +func (r *Image) Gravity(direction CompassDirection, width int, height int, options *GravityOptions) (error) { + if options != nil { + out, err := vipsgenGravityWithOptions(r.image, direction, width, height, options.Extend, options.Background) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenGravity(r.image, direction, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Grid vips_grid grid an image +// +// The tileHeight specifies chop into tiles this high. +// The across specifies number of tiles across. +// The down specifies number of tiles down. +func (r *Image) Grid(tileHeight int, across int, down int) (error) { + out, err := vipsgenGrid(r.image, tileHeight, across, down) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HeifsaveOptions optional arguments for vips_heifsave +type HeifsaveOptions struct { + // Q Q factor + Q int + // Bitdepth Number of bits per pixel + Bitdepth int + // Lossless Enable lossless compression + Lossless bool + // Compression Compression format + Compression HeifCompression + // Effort CPU effort + Effort int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Encoder Select encoder to use + Encoder HeifEncoder + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultHeifsaveOptions creates default value for vips_heifsave optional arguments +func DefaultHeifsaveOptions() *HeifsaveOptions { + return &HeifsaveOptions{ + Q: 50, + Bitdepth: 12, + Compression: HeifCompression(1), + Effort: 4, + } +} + +// Heifsave vips_heifsave save image in HEIF format +// +// The filename specifies filename to save to. +func (r *Image) Heifsave(filename string, options *HeifsaveOptions) (error) { + if options != nil { + err := vipsgenHeifsaveWithOptions(r.image, filename, options.Q, options.Bitdepth, options.Lossless, options.Compression, options.Effort, options.SubsampleMode, options.Encoder, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenHeifsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// HeifsaveBufferOptions optional arguments for vips_heifsave_buffer +type HeifsaveBufferOptions struct { + // Q Q factor + Q int + // Bitdepth Number of bits per pixel + Bitdepth int + // Lossless Enable lossless compression + Lossless bool + // Compression Compression format + Compression HeifCompression + // Effort CPU effort + Effort int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Encoder Select encoder to use + Encoder HeifEncoder + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultHeifsaveBufferOptions creates default value for vips_heifsave_buffer optional arguments +func DefaultHeifsaveBufferOptions() *HeifsaveBufferOptions { + return &HeifsaveBufferOptions{ + Q: 50, + Bitdepth: 12, + Compression: HeifCompression(1), + Effort: 4, + } +} + +// HeifsaveBuffer vips_heifsave_buffer save image in HEIF format +func (r *Image) HeifsaveBuffer(options *HeifsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenHeifsaveBufferWithOptions(r.image, options.Q, options.Bitdepth, options.Lossless, options.Compression, options.Effort, options.SubsampleMode, options.Encoder, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenHeifsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// HeifsaveTargetOptions optional arguments for vips_heifsave_target +type HeifsaveTargetOptions struct { + // Q Q factor + Q int + // Bitdepth Number of bits per pixel + Bitdepth int + // Lossless Enable lossless compression + Lossless bool + // Compression Compression format + Compression HeifCompression + // Effort CPU effort + Effort int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Encoder Select encoder to use + Encoder HeifEncoder + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultHeifsaveTargetOptions creates default value for vips_heifsave_target optional arguments +func DefaultHeifsaveTargetOptions() *HeifsaveTargetOptions { + return &HeifsaveTargetOptions{ + Q: 50, + Bitdepth: 12, + Compression: HeifCompression(1), + Effort: 4, + } +} + +// HeifsaveTarget vips_heifsave_target save image in HEIF format +// +// The target specifies target to save to. +func (r *Image) HeifsaveTarget(target *Target, options *HeifsaveTargetOptions) (error) { + if options != nil { + err := vipsgenHeifsaveTargetWithOptions(r.image, target.target, options.Q, options.Bitdepth, options.Lossless, options.Compression, options.Effort, options.SubsampleMode, options.Encoder, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenHeifsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + + +// HistCum vips_hist_cum form cumulative histogram +func (r *Image) HistCum() (error) { + out, err := vipsgenHistCum(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HistEntropy vips_hist_entropy estimate image entropy +func (r *Image) HistEntropy() (float64, error) { + out, err := vipsgenHistEntropy(r.image) + if err != nil { + return 0, err + } + return out, nil +} + +// HistEqualOptions optional arguments for vips_hist_equal +type HistEqualOptions struct { + // Band Equalise with this band + Band int +} + +// DefaultHistEqualOptions creates default value for vips_hist_equal optional arguments +func DefaultHistEqualOptions() *HistEqualOptions { + return &HistEqualOptions{ + Band: -1, + } +} + +// HistEqual vips_hist_equal histogram equalisation +func (r *Image) HistEqual(options *HistEqualOptions) (error) { + if options != nil { + out, err := vipsgenHistEqualWithOptions(r.image, options.Band) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHistEqual(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HistFindOptions optional arguments for vips_hist_find +type HistFindOptions struct { + // Band Find histogram of band + Band int +} + +// DefaultHistFindOptions creates default value for vips_hist_find optional arguments +func DefaultHistFindOptions() *HistFindOptions { + return &HistFindOptions{ + Band: -1, + } +} + +// HistFind vips_hist_find find image histogram +func (r *Image) HistFind(options *HistFindOptions) (error) { + if options != nil { + out, err := vipsgenHistFindWithOptions(r.image, options.Band) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHistFind(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HistFindIndexedOptions optional arguments for vips_hist_find_indexed +type HistFindIndexedOptions struct { + // Combine Combine bins like this + Combine Combine +} + +// DefaultHistFindIndexedOptions creates default value for vips_hist_find_indexed optional arguments +func DefaultHistFindIndexedOptions() *HistFindIndexedOptions { + return &HistFindIndexedOptions{ + Combine: Combine(1), + } +} + +// HistFindIndexed vips_hist_find_indexed find indexed image histogram +// +// The index specifies index image. +func (r *Image) HistFindIndexed(index *Image, options *HistFindIndexedOptions) (error) { + if options != nil { + out, err := vipsgenHistFindIndexedWithOptions(r.image, index.image, options.Combine) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHistFindIndexed(r.image, index.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HistFindNdimOptions optional arguments for vips_hist_find_ndim +type HistFindNdimOptions struct { + // Bins Number of bins in each dimension + Bins int +} + +// DefaultHistFindNdimOptions creates default value for vips_hist_find_ndim optional arguments +func DefaultHistFindNdimOptions() *HistFindNdimOptions { + return &HistFindNdimOptions{ + Bins: 10, + } +} + +// HistFindNdim vips_hist_find_ndim find n-dimensional image histogram +func (r *Image) HistFindNdim(options *HistFindNdimOptions) (error) { + if options != nil { + out, err := vipsgenHistFindNdimWithOptions(r.image, options.Bins) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHistFindNdim(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HistIsmonotonic vips_hist_ismonotonic test for monotonicity +func (r *Image) HistIsmonotonic() (bool, error) { + monotonic, err := vipsgenHistIsmonotonic(r.image) + if err != nil { + return false, err + } + return monotonic, nil +} + +// HistLocalOptions optional arguments for vips_hist_local +type HistLocalOptions struct { + // MaxSlope Maximum slope (CLAHE) + MaxSlope int +} + +// DefaultHistLocalOptions creates default value for vips_hist_local optional arguments +func DefaultHistLocalOptions() *HistLocalOptions { + return &HistLocalOptions{ + } +} + +// HistLocal vips_hist_local local histogram equalisation +// +// The width specifies window width in pixels. +// The height specifies window height in pixels. +func (r *Image) HistLocal(width int, height int, options *HistLocalOptions) (error) { + if options != nil { + out, err := vipsgenHistLocalWithOptions(r.image, width, height, options.MaxSlope) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHistLocal(r.image, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HistMatch vips_hist_match match two histograms +// +// The ref specifies reference histogram. +func (r *Image) HistMatch(ref *Image) (error) { + out, err := vipsgenHistMatch(r.image, ref.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HistNorm vips_hist_norm normalise histogram +func (r *Image) HistNorm() (error) { + out, err := vipsgenHistNorm(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// HistPlot vips_hist_plot plot histogram +func (r *Image) HistPlot() (error) { + out, err := vipsgenHistPlot(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HoughCircleOptions optional arguments for vips_hough_circle +type HoughCircleOptions struct { + // Scale Scale down dimensions by this factor + Scale int + // MinRadius Smallest radius to search for + MinRadius int + // MaxRadius Largest radius to search for + MaxRadius int +} + +// DefaultHoughCircleOptions creates default value for vips_hough_circle optional arguments +func DefaultHoughCircleOptions() *HoughCircleOptions { + return &HoughCircleOptions{ + Scale: 1, + MinRadius: 10, + MaxRadius: 20, + } +} + +// HoughCircle vips_hough_circle find hough circle transform +func (r *Image) HoughCircle(options *HoughCircleOptions) (error) { + if options != nil { + out, err := vipsgenHoughCircleWithOptions(r.image, options.Scale, options.MinRadius, options.MaxRadius) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHoughCircle(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// HoughLineOptions optional arguments for vips_hough_line +type HoughLineOptions struct { + // Width Horizontal size of parameter space + Width int + // Height Vertical size of parameter space + Height int +} + +// DefaultHoughLineOptions creates default value for vips_hough_line optional arguments +func DefaultHoughLineOptions() *HoughLineOptions { + return &HoughLineOptions{ + Width: 256, + Height: 256, + } +} + +// HoughLine vips_hough_line find hough line transform +func (r *Image) HoughLine(options *HoughLineOptions) (error) { + if options != nil { + out, err := vipsgenHoughLineWithOptions(r.image, options.Width, options.Height) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenHoughLine(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// IccExportOptions optional arguments for vips_icc_export +type IccExportOptions struct { + // Pcs Set Profile Connection Space + Pcs PCS + // Intent Rendering intent + Intent Intent + // BlackPointCompensation Enable black point compensation + BlackPointCompensation bool + // OutputProfile Filename to load output profile from + OutputProfile string + // Depth Output device space depth in bits + Depth int +} + +// DefaultIccExportOptions creates default value for vips_icc_export optional arguments +func DefaultIccExportOptions() *IccExportOptions { + return &IccExportOptions{ + Intent: Intent(1), + Depth: 8, + } +} + +// IccExport vips_icc_export output to device with ICC profile +func (r *Image) IccExport(options *IccExportOptions) (error) { + if options != nil { + out, err := vipsgenIccExportWithOptions(r.image, options.Pcs, options.Intent, options.BlackPointCompensation, options.OutputProfile, options.Depth) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenIccExport(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// IccImportOptions optional arguments for vips_icc_import +type IccImportOptions struct { + // Pcs Set Profile Connection Space + Pcs PCS + // Intent Rendering intent + Intent Intent + // BlackPointCompensation Enable black point compensation + BlackPointCompensation bool + // Embedded Use embedded input profile, if available + Embedded bool + // InputProfile Filename to load input profile from + InputProfile string +} + +// DefaultIccImportOptions creates default value for vips_icc_import optional arguments +func DefaultIccImportOptions() *IccImportOptions { + return &IccImportOptions{ + Intent: Intent(1), + } +} + +// IccImport vips_icc_import import from device with ICC profile +func (r *Image) IccImport(options *IccImportOptions) (error) { + if options != nil { + out, err := vipsgenIccImportWithOptions(r.image, options.Pcs, options.Intent, options.BlackPointCompensation, options.Embedded, options.InputProfile) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenIccImport(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// IccTransformOptions optional arguments for vips_icc_transform +type IccTransformOptions struct { + // Pcs Set Profile Connection Space + Pcs PCS + // Intent Rendering intent + Intent Intent + // BlackPointCompensation Enable black point compensation + BlackPointCompensation bool + // Embedded Use embedded input profile, if available + Embedded bool + // InputProfile Filename to load input profile from + InputProfile string + // Depth Output device space depth in bits + Depth int +} + +// DefaultIccTransformOptions creates default value for vips_icc_transform optional arguments +func DefaultIccTransformOptions() *IccTransformOptions { + return &IccTransformOptions{ + Intent: Intent(1), + Depth: 8, + } +} + +// IccTransform vips_icc_transform transform between devices with ICC profiles +// +// The outputProfile specifies filename to load output profile from. +func (r *Image) IccTransform(outputProfile string, options *IccTransformOptions) (error) { + if options != nil { + out, err := vipsgenIccTransformWithOptions(r.image, outputProfile, options.Pcs, options.Intent, options.BlackPointCompensation, options.Embedded, options.InputProfile, options.Depth) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenIccTransform(r.image, outputProfile) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// IfthenelseOptions optional arguments for vips_ifthenelse +type IfthenelseOptions struct { + // Blend Blend smoothly between then and else parts + Blend bool +} + +// DefaultIfthenelseOptions creates default value for vips_ifthenelse optional arguments +func DefaultIfthenelseOptions() *IfthenelseOptions { + return &IfthenelseOptions{ + } +} + +// Ifthenelse vips_ifthenelse ifthenelse an image +// +// The in1 specifies source for TRUE pixels. +// The in2 specifies source for FALSE pixels. +func (r *Image) Ifthenelse(in1 *Image, in2 *Image, options *IfthenelseOptions) (error) { + if options != nil { + out, err := vipsgenIfthenelseWithOptions(r.image, in1.image, in2.image, options.Blend) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenIfthenelse(r.image, in1.image, in2.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// InsertOptions optional arguments for vips_insert +type InsertOptions struct { + // Expand Expand output to hold all of both inputs + Expand bool + // Background Color for new pixels + Background []float64 +} + +// DefaultInsertOptions creates default value for vips_insert optional arguments +func DefaultInsertOptions() *InsertOptions { + return &InsertOptions{ + } +} + +// Insert vips_insert insert image @sub into @main at @x, @y +// +// The sub specifies sub-image to insert into main image. +// The x specifies left edge of sub in main. +// The y specifies top edge of sub in main. +func (r *Image) Insert(sub *Image, x int, y int, options *InsertOptions) (error) { + if options != nil { + out, err := vipsgenInsertWithOptions(r.image, sub.image, x, y, options.Expand, options.Background) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenInsert(r.image, sub.image, x, y) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Invert vips_invert invert an image +func (r *Image) Invert() (error) { + out, err := vipsgenInvert(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// InvertlutOptions optional arguments for vips_invertlut +type InvertlutOptions struct { + // Size LUT size to generate + Size int +} + +// DefaultInvertlutOptions creates default value for vips_invertlut optional arguments +func DefaultInvertlutOptions() *InvertlutOptions { + return &InvertlutOptions{ + Size: 256, + } +} + +// Invertlut vips_invertlut build an inverted look-up table +func (r *Image) Invertlut(options *InvertlutOptions) (error) { + if options != nil { + out, err := vipsgenInvertlutWithOptions(r.image, options.Size) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenInvertlut(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// InvfftOptions optional arguments for vips_invfft +type InvfftOptions struct { + // Real Output only the real part of the transform + Real bool +} + +// DefaultInvfftOptions creates default value for vips_invfft optional arguments +func DefaultInvfftOptions() *InvfftOptions { + return &InvfftOptions{ + } +} + +// Invfft vips_invfft inverse FFT +func (r *Image) Invfft(options *InvfftOptions) (error) { + if options != nil { + out, err := vipsgenInvfftWithOptions(r.image, options.Real) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenInvfft(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// JoinOptions optional arguments for vips_join +type JoinOptions struct { + // Expand Expand output to hold all of both inputs + Expand bool + // Shim Pixels between images + Shim int + // Background Colour for new pixels + Background []float64 + // Align Align on the low, centre or high coordinate edge + Align Align +} + +// DefaultJoinOptions creates default value for vips_join optional arguments +func DefaultJoinOptions() *JoinOptions { + return &JoinOptions{ + } +} + +// Join vips_join join a pair of images +// +// The in2 specifies second input image. +// The direction specifies join left-right or up-down. +func (r *Image) Join(in2 *Image, direction Direction, options *JoinOptions) (error) { + if options != nil { + out, err := vipsgenJoinWithOptions(r.image, in2.image, direction, options.Expand, options.Shim, options.Background, options.Align) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenJoin(r.image, in2.image, direction) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Jp2ksaveOptions optional arguments for vips_jp2ksave +type Jp2ksaveOptions struct { + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Lossless Enable lossless compression + Lossless bool + // Q Q factor + Q int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJp2ksaveOptions creates default value for vips_jp2ksave optional arguments +func DefaultJp2ksaveOptions() *Jp2ksaveOptions { + return &Jp2ksaveOptions{ + TileWidth: 512, + TileHeight: 512, + Q: 48, + SubsampleMode: Subsample(2), + } +} + +// Jp2ksave vips_jp2ksave save image in JPEG2000 format +// +// The filename specifies filename to save to. +func (r *Image) Jp2ksave(filename string, options *Jp2ksaveOptions) (error) { + if options != nil { + err := vipsgenJp2ksaveWithOptions(r.image, filename, options.TileWidth, options.TileHeight, options.Lossless, options.Q, options.SubsampleMode, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJp2ksave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// Jp2ksaveBufferOptions optional arguments for vips_jp2ksave_buffer +type Jp2ksaveBufferOptions struct { + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Lossless Enable lossless compression + Lossless bool + // Q Q factor + Q int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJp2ksaveBufferOptions creates default value for vips_jp2ksave_buffer optional arguments +func DefaultJp2ksaveBufferOptions() *Jp2ksaveBufferOptions { + return &Jp2ksaveBufferOptions{ + TileWidth: 512, + TileHeight: 512, + Q: 48, + SubsampleMode: Subsample(2), + } +} + +// Jp2ksaveBuffer vips_jp2ksave_buffer save image in JPEG2000 format +func (r *Image) Jp2ksaveBuffer(options *Jp2ksaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenJp2ksaveBufferWithOptions(r.image, options.TileWidth, options.TileHeight, options.Lossless, options.Q, options.SubsampleMode, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenJp2ksaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// Jp2ksaveTargetOptions optional arguments for vips_jp2ksave_target +type Jp2ksaveTargetOptions struct { + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Lossless Enable lossless compression + Lossless bool + // Q Q factor + Q int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJp2ksaveTargetOptions creates default value for vips_jp2ksave_target optional arguments +func DefaultJp2ksaveTargetOptions() *Jp2ksaveTargetOptions { + return &Jp2ksaveTargetOptions{ + TileWidth: 512, + TileHeight: 512, + Q: 48, + SubsampleMode: Subsample(2), + } +} + +// Jp2ksaveTarget vips_jp2ksave_target save image in JPEG2000 format +// +// The target specifies target to save to. +func (r *Image) Jp2ksaveTarget(target *Target, options *Jp2ksaveTargetOptions) (error) { + if options != nil { + err := vipsgenJp2ksaveTargetWithOptions(r.image, target.target, options.TileWidth, options.TileHeight, options.Lossless, options.Q, options.SubsampleMode, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJp2ksaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// JpegsaveOptions optional arguments for vips_jpegsave +type JpegsaveOptions struct { + // Q Q factor + Q int + // OptimizeCoding Compute optimal Huffman coding tables + OptimizeCoding bool + // Interlace Generate an interlaced (progressive) jpeg + Interlace bool + // TrellisQuant Apply trellis quantisation to each 8x8 block + TrellisQuant bool + // OvershootDeringing Apply overshooting to samples with extreme values + OvershootDeringing bool + // OptimizeScans Split spectrum of DCT coefficients into separate scans + OptimizeScans bool + // QuantTable Use predefined quantization table with given index + QuantTable int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // RestartInterval Add restart markers every specified number of mcu + RestartInterval int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJpegsaveOptions creates default value for vips_jpegsave optional arguments +func DefaultJpegsaveOptions() *JpegsaveOptions { + return &JpegsaveOptions{ + Q: 75, + } +} + +// Jpegsave vips_jpegsave save image to jpeg file +// +// The filename specifies filename to save to. +func (r *Image) Jpegsave(filename string, options *JpegsaveOptions) (error) { + if options != nil { + err := vipsgenJpegsaveWithOptions(r.image, filename, options.Q, options.OptimizeCoding, options.Interlace, options.TrellisQuant, options.OvershootDeringing, options.OptimizeScans, options.QuantTable, options.SubsampleMode, options.RestartInterval, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJpegsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// JpegsaveBufferOptions optional arguments for vips_jpegsave_buffer +type JpegsaveBufferOptions struct { + // Q Q factor + Q int + // OptimizeCoding Compute optimal Huffman coding tables + OptimizeCoding bool + // Interlace Generate an interlaced (progressive) jpeg + Interlace bool + // TrellisQuant Apply trellis quantisation to each 8x8 block + TrellisQuant bool + // OvershootDeringing Apply overshooting to samples with extreme values + OvershootDeringing bool + // OptimizeScans Split spectrum of DCT coefficients into separate scans + OptimizeScans bool + // QuantTable Use predefined quantization table with given index + QuantTable int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // RestartInterval Add restart markers every specified number of mcu + RestartInterval int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJpegsaveBufferOptions creates default value for vips_jpegsave_buffer optional arguments +func DefaultJpegsaveBufferOptions() *JpegsaveBufferOptions { + return &JpegsaveBufferOptions{ + Q: 75, + } +} + +// JpegsaveBuffer vips_jpegsave_buffer save image to jpeg buffer +func (r *Image) JpegsaveBuffer(options *JpegsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenJpegsaveBufferWithOptions(r.image, options.Q, options.OptimizeCoding, options.Interlace, options.TrellisQuant, options.OvershootDeringing, options.OptimizeScans, options.QuantTable, options.SubsampleMode, options.RestartInterval, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenJpegsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// JpegsaveTargetOptions optional arguments for vips_jpegsave_target +type JpegsaveTargetOptions struct { + // Q Q factor + Q int + // OptimizeCoding Compute optimal Huffman coding tables + OptimizeCoding bool + // Interlace Generate an interlaced (progressive) jpeg + Interlace bool + // TrellisQuant Apply trellis quantisation to each 8x8 block + TrellisQuant bool + // OvershootDeringing Apply overshooting to samples with extreme values + OvershootDeringing bool + // OptimizeScans Split spectrum of DCT coefficients into separate scans + OptimizeScans bool + // QuantTable Use predefined quantization table with given index + QuantTable int + // SubsampleMode Select chroma subsample operation mode + SubsampleMode Subsample + // RestartInterval Add restart markers every specified number of mcu + RestartInterval int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJpegsaveTargetOptions creates default value for vips_jpegsave_target optional arguments +func DefaultJpegsaveTargetOptions() *JpegsaveTargetOptions { + return &JpegsaveTargetOptions{ + Q: 75, + } +} + +// JpegsaveTarget vips_jpegsave_target save image to jpeg target +// +// The target specifies target to save to. +func (r *Image) JpegsaveTarget(target *Target, options *JpegsaveTargetOptions) (error) { + if options != nil { + err := vipsgenJpegsaveTargetWithOptions(r.image, target.target, options.Q, options.OptimizeCoding, options.Interlace, options.TrellisQuant, options.OvershootDeringing, options.OptimizeScans, options.QuantTable, options.SubsampleMode, options.RestartInterval, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJpegsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// JxlsaveOptions optional arguments for vips_jxlsave +type JxlsaveOptions struct { + // Tier Decode speed tier + Tier int + // Distance Target butteraugli distance + Distance float64 + // Effort Encoding effort + Effort int + // Lossless Enable lossless compression + Lossless bool + // Q Quality factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJxlsaveOptions creates default value for vips_jxlsave optional arguments +func DefaultJxlsaveOptions() *JxlsaveOptions { + return &JxlsaveOptions{ + Distance: 1, + Effort: 7, + Q: 75, + } +} + +// Jxlsave vips_jxlsave save image in JPEG-XL format +// +// The filename specifies filename to save to. +func (r *Image) Jxlsave(filename string, options *JxlsaveOptions) (error) { + if options != nil { + err := vipsgenJxlsaveWithOptions(r.image, filename, options.Tier, options.Distance, options.Effort, options.Lossless, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJxlsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// JxlsaveBufferOptions optional arguments for vips_jxlsave_buffer +type JxlsaveBufferOptions struct { + // Tier Decode speed tier + Tier int + // Distance Target butteraugli distance + Distance float64 + // Effort Encoding effort + Effort int + // Lossless Enable lossless compression + Lossless bool + // Q Quality factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJxlsaveBufferOptions creates default value for vips_jxlsave_buffer optional arguments +func DefaultJxlsaveBufferOptions() *JxlsaveBufferOptions { + return &JxlsaveBufferOptions{ + Distance: 1, + Effort: 7, + Q: 75, + } +} + +// JxlsaveBuffer vips_jxlsave_buffer save image in JPEG-XL format +func (r *Image) JxlsaveBuffer(options *JxlsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenJxlsaveBufferWithOptions(r.image, options.Tier, options.Distance, options.Effort, options.Lossless, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenJxlsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// JxlsaveTargetOptions optional arguments for vips_jxlsave_target +type JxlsaveTargetOptions struct { + // Tier Decode speed tier + Tier int + // Distance Target butteraugli distance + Distance float64 + // Effort Encoding effort + Effort int + // Lossless Enable lossless compression + Lossless bool + // Q Quality factor + Q int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultJxlsaveTargetOptions creates default value for vips_jxlsave_target optional arguments +func DefaultJxlsaveTargetOptions() *JxlsaveTargetOptions { + return &JxlsaveTargetOptions{ + Distance: 1, + Effort: 7, + Q: 75, + } +} + +// JxlsaveTarget vips_jxlsave_target save image in JPEG-XL format +// +// The target specifies target to save to. +func (r *Image) JxlsaveTarget(target *Target, options *JxlsaveTargetOptions) (error) { + if options != nil { + err := vipsgenJxlsaveTargetWithOptions(r.image, target.target, options.Tier, options.Distance, options.Effort, options.Lossless, options.Q, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenJxlsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + + +// Labelregions vips_labelregions label regions in an image +func (r *Image) Labelregions() (error) { + out, err := vipsgenLabelregions(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// LinearOptions optional arguments for vips_linear +type LinearOptions struct { + // Uchar Output should be uchar + Uchar bool +} + +// DefaultLinearOptions creates default value for vips_linear optional arguments +func DefaultLinearOptions() *LinearOptions { + return &LinearOptions{ + } +} + +// Linear vips_linear calculate (a * in + b) +// +// The a specifies multiply by this. +// The b specifies add this. +func (r *Image) Linear(a []float64, b []float64, options *LinearOptions) (error) { + if options != nil { + out, err := vipsgenLinearWithOptions(r.image, a, b, options.Uchar) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenLinear(r.image, a, b) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// LinecacheOptions optional arguments for vips_linecache +type LinecacheOptions struct { + // TileHeight Tile height in pixels + TileHeight int + // Access Expected access pattern + Access Access + // Threaded Allow threaded access + Threaded bool + // Persistent Keep cache between evaluations + Persistent bool +} + +// DefaultLinecacheOptions creates default value for vips_linecache optional arguments +func DefaultLinecacheOptions() *LinecacheOptions { + return &LinecacheOptions{ + TileHeight: 128, + } +} + +// Linecache vips_linecache cache an image as a set of lines +func (r *Image) Linecache(options *LinecacheOptions) (*Image, error) { + if options != nil { + out, err := vipsgenLinecacheWithOptions(r.image, options.TileHeight, options.Access, options.Threaded, options.Persistent) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil + } + out, err := vipsgenLinecache(r.image) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil +} + +// MagicksaveOptions optional arguments for vips_magicksave +type MagicksaveOptions struct { + // Format Format to save in + Format string + // Quality Quality to use + Quality int + // OptimizeGifFrames Apply GIF frames optimization + OptimizeGifFrames bool + // OptimizeGifTransparency Apply GIF transparency optimization + OptimizeGifTransparency bool + // Bitdepth Number of bits per pixel + Bitdepth int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultMagicksaveOptions creates default value for vips_magicksave optional arguments +func DefaultMagicksaveOptions() *MagicksaveOptions { + return &MagicksaveOptions{ + } +} + +// Magicksave vips_magicksave save file with ImageMagick +// +// The filename specifies filename to save to. +func (r *Image) Magicksave(filename string, options *MagicksaveOptions) (error) { + if options != nil { + err := vipsgenMagicksaveWithOptions(r.image, filename, options.Format, options.Quality, options.OptimizeGifFrames, options.OptimizeGifTransparency, options.Bitdepth, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenMagicksave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// MagicksaveBufferOptions optional arguments for vips_magicksave_buffer +type MagicksaveBufferOptions struct { + // Format Format to save in + Format string + // Quality Quality to use + Quality int + // OptimizeGifFrames Apply GIF frames optimization + OptimizeGifFrames bool + // OptimizeGifTransparency Apply GIF transparency optimization + OptimizeGifTransparency bool + // Bitdepth Number of bits per pixel + Bitdepth int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultMagicksaveBufferOptions creates default value for vips_magicksave_buffer optional arguments +func DefaultMagicksaveBufferOptions() *MagicksaveBufferOptions { + return &MagicksaveBufferOptions{ + } +} + +// MagicksaveBuffer vips_magicksave_buffer save image to magick buffer +func (r *Image) MagicksaveBuffer(options *MagicksaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenMagicksaveBufferWithOptions(r.image, options.Format, options.Quality, options.OptimizeGifFrames, options.OptimizeGifTransparency, options.Bitdepth, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenMagicksaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// MapimOptions optional arguments for vips_mapim +type MapimOptions struct { + // Interpolate Interpolate pixels with this + Interpolate *Interpolate + // Background Background value + Background []float64 + // Premultiplied Images have premultiplied alpha + Premultiplied bool + // Extend How to generate the extra pixels + Extend Extend +} + +// DefaultMapimOptions creates default value for vips_mapim optional arguments +func DefaultMapimOptions() *MapimOptions { + return &MapimOptions{ + Extend: Extend(5), + } +} + +// Mapim vips_mapim resample with a map image +// +// The index specifies index pixels with this. +func (r *Image) Mapim(index *Image, options *MapimOptions) (error) { + if options != nil { + out, err := vipsgenMapimWithOptions(r.image, index.image, options.Interpolate, options.Background, options.Premultiplied, options.Extend) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMapim(r.image, index.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MaplutOptions optional arguments for vips_maplut +type MaplutOptions struct { + // Band Apply one-band lut to this band of in + Band int +} + +// DefaultMaplutOptions creates default value for vips_maplut optional arguments +func DefaultMaplutOptions() *MaplutOptions { + return &MaplutOptions{ + Band: -1, + } +} + +// Maplut vips_maplut map an image though a lut +// +// The lut specifies look-up table image. +func (r *Image) Maplut(lut *Image, options *MaplutOptions) (error) { + if options != nil { + out, err := vipsgenMaplutWithOptions(r.image, lut.image, options.Band) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMaplut(r.image, lut.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MatchOptions optional arguments for vips_match +type MatchOptions struct { + // Hwindow Half window size + Hwindow int + // Harea Half area size + Harea int + // Search Search to improve tie-points + Search bool + // Interpolate Interpolate pixels with this + Interpolate *Interpolate +} + +// DefaultMatchOptions creates default value for vips_match optional arguments +func DefaultMatchOptions() *MatchOptions { + return &MatchOptions{ + Hwindow: 5, + Harea: 15, + } +} + +// Match vips_match first-order match of two images +// +// The sec specifies secondary image. +// The xr1 specifies position of first reference tie-point. +// The yr1 specifies position of first reference tie-point. +// The xs1 specifies position of first secondary tie-point. +// The ys1 specifies position of first secondary tie-point. +// The xr2 specifies position of second reference tie-point. +// The yr2 specifies position of second reference tie-point. +// The xs2 specifies position of second secondary tie-point. +// The ys2 specifies position of second secondary tie-point. +func (r *Image) Match(sec *Image, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int, options *MatchOptions) (error) { + if options != nil { + out, err := vipsgenMatchWithOptions(r.image, sec.image, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2, options.Hwindow, options.Harea, options.Search, options.Interpolate) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMatch(r.image, sec.image, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Math vips_math apply a math operation to an image +// +// The math specifies math to perform. +func (r *Image) Math(math OperationMath) (error) { + out, err := vipsgenMath(r.image, math) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Math2 vips_math2 binary math operations +// +// The right specifies right-hand image argument. +// The math2 specifies math to perform. +func (r *Image) Math2(right *Image, math2 OperationMath2) (error) { + out, err := vipsgenMath2(r.image, right.image, math2) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Math2Const vips_math2_const binary math operations with a constant +// +// The math2 specifies math to perform. +// The c specifies array of constants. +func (r *Image) Math2Const(math2 OperationMath2, c []float64) (error) { + out, err := vipsgenMath2Const(r.image, math2, c) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Matrixinvert vips_matrixinvert invert a matrix +func (r *Image) Matrixinvert() (error) { + out, err := vipsgenMatrixinvert(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Matrixmultiply vips_matrixmultiply multiply two matrices +// +// The right specifies second matrix to multiply. +func (r *Image) Matrixmultiply(right *Image) (error) { + out, err := vipsgenMatrixmultiply(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MatrixprintOptions optional arguments for vips_matrixprint +type MatrixprintOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultMatrixprintOptions creates default value for vips_matrixprint optional arguments +func DefaultMatrixprintOptions() *MatrixprintOptions { + return &MatrixprintOptions{ + } +} + +// Matrixprint vips_matrixprint print matrix +func (r *Image) Matrixprint(options *MatrixprintOptions) (error) { + if options != nil { + err := vipsgenMatrixprintWithOptions(r.image, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenMatrixprint(r.image) + if err != nil { + return err + } + return nil +} + +// MatrixsaveOptions optional arguments for vips_matrixsave +type MatrixsaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultMatrixsaveOptions creates default value for vips_matrixsave optional arguments +func DefaultMatrixsaveOptions() *MatrixsaveOptions { + return &MatrixsaveOptions{ + } +} + +// Matrixsave vips_matrixsave save image to matrix +// +// The filename specifies filename to save to. +func (r *Image) Matrixsave(filename string, options *MatrixsaveOptions) (error) { + if options != nil { + err := vipsgenMatrixsaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenMatrixsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// MatrixsaveTargetOptions optional arguments for vips_matrixsave_target +type MatrixsaveTargetOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultMatrixsaveTargetOptions creates default value for vips_matrixsave_target optional arguments +func DefaultMatrixsaveTargetOptions() *MatrixsaveTargetOptions { + return &MatrixsaveTargetOptions{ + } +} + +// MatrixsaveTarget vips_matrixsave_target save image to matrix +// +// The target specifies target to save to. +func (r *Image) MatrixsaveTarget(target *Target, options *MatrixsaveTargetOptions) (error) { + if options != nil { + err := vipsgenMatrixsaveTargetWithOptions(r.image, target.target, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenMatrixsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// MaxOptions optional arguments for vips_max +type MaxOptions struct { + // Size Number of maximum values to find + Size int +} + +// DefaultMaxOptions creates default value for vips_max optional arguments +func DefaultMaxOptions() *MaxOptions { + return &MaxOptions{ + Size: 1, + } +} + +// Max vips_max find image maximum +func (r *Image) Max(options *MaxOptions) (float64, error) { + if options != nil { + out, err := vipsgenMaxWithOptions(r.image, options.Size) + if err != nil { + return 0, err + } + return out, nil + } + out, err := vipsgenMax(r.image) + if err != nil { + return 0, err + } + return out, nil +} + + +// Maxpair vips_maxpair maximum of a pair of images +// +// The right specifies right-hand image argument. +func (r *Image) Maxpair(right *Image) (error) { + out, err := vipsgenMaxpair(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MeasureOptions optional arguments for vips_measure +type MeasureOptions struct { + // Left Left edge of extract area + Left int + // Top Top edge of extract area + Top int + // Width Width of extract area + Width int + // Height Height of extract area + Height int +} + +// DefaultMeasureOptions creates default value for vips_measure optional arguments +func DefaultMeasureOptions() *MeasureOptions { + return &MeasureOptions{ + Width: 1, + Height: 1, + } +} + +// Measure vips_measure measure a set of patches on a color chart +// +// The h specifies number of patches across chart. +// The v specifies number of patches down chart. +func (r *Image) Measure(h int, v int, options *MeasureOptions) (error) { + if options != nil { + out, err := vipsgenMeasureWithOptions(r.image, h, v, options.Left, options.Top, options.Width, options.Height) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMeasure(r.image, h, v) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MergeOptions optional arguments for vips_merge +type MergeOptions struct { + // Mblend Maximum blend size + Mblend int +} + +// DefaultMergeOptions creates default value for vips_merge optional arguments +func DefaultMergeOptions() *MergeOptions { + return &MergeOptions{ + Mblend: 10, + } +} + +// Merge vips_merge merge two images +// +// The sec specifies secondary image. +// The direction specifies horizontal or vertical merge. +// The dx specifies horizontal displacement from sec to ref. +// The dy specifies vertical displacement from sec to ref. +func (r *Image) Merge(sec *Image, direction Direction, dx int, dy int, options *MergeOptions) (error) { + if options != nil { + out, err := vipsgenMergeWithOptions(r.image, sec.image, direction, dx, dy, options.Mblend) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMerge(r.image, sec.image, direction, dx, dy) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MinOptions optional arguments for vips_min +type MinOptions struct { + // Size Number of minimum values to find + Size int +} + +// DefaultMinOptions creates default value for vips_min optional arguments +func DefaultMinOptions() *MinOptions { + return &MinOptions{ + Size: 1, + } +} + +// Min vips_min find image minimum +func (r *Image) Min(options *MinOptions) (float64, error) { + if options != nil { + out, err := vipsgenMinWithOptions(r.image, options.Size) + if err != nil { + return 0, err + } + return out, nil + } + out, err := vipsgenMin(r.image) + if err != nil { + return 0, err + } + return out, nil +} + + +// Minpair vips_minpair minimum of a pair of images +// +// The right specifies right-hand image argument. +func (r *Image) Minpair(right *Image) (error) { + out, err := vipsgenMinpair(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Morph vips_morph morphology operation +// +// The mask specifies input matrix image. +// The morph specifies morphological operation to perform. +func (r *Image) Morph(mask *Image, morph OperationMorphology) (error) { + out, err := vipsgenMorph(r.image, mask.image, morph) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MosaicOptions optional arguments for vips_mosaic +type MosaicOptions struct { + // Hwindow Half window size + Hwindow int + // Harea Half area size + Harea int + // Mblend Maximum blend size + Mblend int + // Bandno Band to search for features on + Bandno int +} + +// DefaultMosaicOptions creates default value for vips_mosaic optional arguments +func DefaultMosaicOptions() *MosaicOptions { + return &MosaicOptions{ + Hwindow: 5, + Harea: 15, + Mblend: 10, + } +} + +// Mosaic vips_mosaic mosaic two images +// +// The sec specifies secondary image. +// The direction specifies horizontal or vertical mosaic. +// The xref specifies position of reference tie-point. +// The yref specifies position of reference tie-point. +// The xsec specifies position of secondary tie-point. +// The ysec specifies position of secondary tie-point. +func (r *Image) Mosaic(sec *Image, direction Direction, xref int, yref int, xsec int, ysec int, options *MosaicOptions) (error) { + if options != nil { + out, err := vipsgenMosaicWithOptions(r.image, sec.image, direction, xref, yref, xsec, ysec, options.Hwindow, options.Harea, options.Mblend, options.Bandno) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMosaic(r.image, sec.image, direction, xref, yref, xsec, ysec) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Mosaic1Options optional arguments for vips_mosaic1 +type Mosaic1Options struct { + // Hwindow Half window size + Hwindow int + // Harea Half area size + Harea int + // Search Search to improve tie-points + Search bool + // Interpolate Interpolate pixels with this + Interpolate *Interpolate + // Mblend Maximum blend size + Mblend int +} + +// DefaultMosaic1Options creates default value for vips_mosaic1 optional arguments +func DefaultMosaic1Options() *Mosaic1Options { + return &Mosaic1Options{ + Hwindow: 5, + Harea: 15, + Mblend: 10, + } +} + +// Mosaic1 vips_mosaic1 first-order mosaic of two images +// +// The sec specifies secondary image. +// The direction specifies horizontal or vertical mosaic. +// The xr1 specifies position of first reference tie-point. +// The yr1 specifies position of first reference tie-point. +// The xs1 specifies position of first secondary tie-point. +// The ys1 specifies position of first secondary tie-point. +// The xr2 specifies position of second reference tie-point. +// The yr2 specifies position of second reference tie-point. +// The xs2 specifies position of second secondary tie-point. +// The ys2 specifies position of second secondary tie-point. +func (r *Image) Mosaic1(sec *Image, direction Direction, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int, options *Mosaic1Options) (error) { + if options != nil { + out, err := vipsgenMosaic1WithOptions(r.image, sec.image, direction, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2, options.Hwindow, options.Harea, options.Search, options.Interpolate, options.Mblend) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMosaic1(r.image, sec.image, direction, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// MsbOptions optional arguments for vips_msb +type MsbOptions struct { + // Band Band to msb + Band int +} + +// DefaultMsbOptions creates default value for vips_msb optional arguments +func DefaultMsbOptions() *MsbOptions { + return &MsbOptions{ + Band: -1, + } +} + +// Msb vips_msb pick most-significant byte from an image +func (r *Image) Msb(options *MsbOptions) (error) { + if options != nil { + out, err := vipsgenMsbWithOptions(r.image, options.Band) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenMsb(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Multiply vips_multiply multiply two images +// +// The right specifies right-hand image argument. +func (r *Image) Multiply(right *Image) (error) { + out, err := vipsgenMultiply(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// NiftisaveOptions optional arguments for vips_niftisave +type NiftisaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultNiftisaveOptions creates default value for vips_niftisave optional arguments +func DefaultNiftisaveOptions() *NiftisaveOptions { + return &NiftisaveOptions{ + } +} + +// Niftisave vips_niftisave save image to nifti file +// +// The filename specifies filename to save to. +func (r *Image) Niftisave(filename string, options *NiftisaveOptions) (error) { + if options != nil { + err := vipsgenNiftisaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenNiftisave(r.image, filename) + if err != nil { + return err + } + return nil +} + + +// Percent vips_percent find threshold for percent of pixels +// +// The percent specifies percent of pixels. +func (r *Image) Percent(percent float64) (int, error) { + threshold, err := vipsgenPercent(r.image, percent) + if err != nil { + return 0, err + } + return threshold, nil +} + + +// Phasecor vips_phasecor calculate phase correlation +// +// The in2 specifies second input image. +func (r *Image) Phasecor(in2 *Image) (error) { + out, err := vipsgenPhasecor(r.image, in2.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// PngsaveOptions optional arguments for vips_pngsave +type PngsaveOptions struct { + // Compression Compression factor + Compression int + // Interlace Interlace image + Interlace bool + // Filter libpng row filter flag(s) + Filter PngFilter + // Palette Quantise to 8bpp palette + Palette bool + // Q Quantisation quality + Q int + // Dither Amount of dithering + Dither float64 + // Bitdepth Write as a 1, 2, 4, 8 or 16 bit image + Bitdepth int + // Effort Quantisation CPU effort + Effort int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultPngsaveOptions creates default value for vips_pngsave optional arguments +func DefaultPngsaveOptions() *PngsaveOptions { + return &PngsaveOptions{ + Compression: 6, + Q: 100, + Dither: 1, + Bitdepth: 8, + Effort: 7, + } +} + +// Pngsave vips_pngsave save image to png file +// +// The filename specifies filename to save to. +func (r *Image) Pngsave(filename string, options *PngsaveOptions) (error) { + if options != nil { + err := vipsgenPngsaveWithOptions(r.image, filename, options.Compression, options.Interlace, options.Filter, options.Palette, options.Q, options.Dither, options.Bitdepth, options.Effort, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenPngsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// PngsaveBufferOptions optional arguments for vips_pngsave_buffer +type PngsaveBufferOptions struct { + // Compression Compression factor + Compression int + // Interlace Interlace image + Interlace bool + // Filter libpng row filter flag(s) + Filter PngFilter + // Palette Quantise to 8bpp palette + Palette bool + // Q Quantisation quality + Q int + // Dither Amount of dithering + Dither float64 + // Bitdepth Write as a 1, 2, 4, 8 or 16 bit image + Bitdepth int + // Effort Quantisation CPU effort + Effort int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultPngsaveBufferOptions creates default value for vips_pngsave_buffer optional arguments +func DefaultPngsaveBufferOptions() *PngsaveBufferOptions { + return &PngsaveBufferOptions{ + Compression: 6, + Q: 100, + Dither: 1, + Bitdepth: 8, + Effort: 7, + } +} + +// PngsaveBuffer vips_pngsave_buffer save image to png buffer +func (r *Image) PngsaveBuffer(options *PngsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenPngsaveBufferWithOptions(r.image, options.Compression, options.Interlace, options.Filter, options.Palette, options.Q, options.Dither, options.Bitdepth, options.Effort, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenPngsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// PngsaveTargetOptions optional arguments for vips_pngsave_target +type PngsaveTargetOptions struct { + // Compression Compression factor + Compression int + // Interlace Interlace image + Interlace bool + // Filter libpng row filter flag(s) + Filter PngFilter + // Palette Quantise to 8bpp palette + Palette bool + // Q Quantisation quality + Q int + // Dither Amount of dithering + Dither float64 + // Bitdepth Write as a 1, 2, 4, 8 or 16 bit image + Bitdepth int + // Effort Quantisation CPU effort + Effort int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultPngsaveTargetOptions creates default value for vips_pngsave_target optional arguments +func DefaultPngsaveTargetOptions() *PngsaveTargetOptions { + return &PngsaveTargetOptions{ + Compression: 6, + Q: 100, + Dither: 1, + Bitdepth: 8, + Effort: 7, + } +} + +// PngsaveTarget vips_pngsave_target save image to target as PNG +// +// The target specifies target to save to. +func (r *Image) PngsaveTarget(target *Target, options *PngsaveTargetOptions) (error) { + if options != nil { + err := vipsgenPngsaveTargetWithOptions(r.image, target.target, options.Compression, options.Interlace, options.Filter, options.Palette, options.Q, options.Dither, options.Bitdepth, options.Effort, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenPngsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// PpmsaveOptions optional arguments for vips_ppmsave +type PpmsaveOptions struct { + // Format Format to save in + Format PpmFormat + // Ascii Save as ascii + Ascii bool + // Bitdepth Set to 1 to write as a 1 bit image + Bitdepth int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultPpmsaveOptions creates default value for vips_ppmsave optional arguments +func DefaultPpmsaveOptions() *PpmsaveOptions { + return &PpmsaveOptions{ + Format: PpmFormat(2), + } +} + +// Ppmsave vips_ppmsave save image to ppm file +// +// The filename specifies filename to save to. +func (r *Image) Ppmsave(filename string, options *PpmsaveOptions) (error) { + if options != nil { + err := vipsgenPpmsaveWithOptions(r.image, filename, options.Format, options.Ascii, options.Bitdepth, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenPpmsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// PpmsaveTargetOptions optional arguments for vips_ppmsave_target +type PpmsaveTargetOptions struct { + // Format Format to save in + Format PpmFormat + // Ascii Save as ascii + Ascii bool + // Bitdepth Set to 1 to write as a 1 bit image + Bitdepth int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultPpmsaveTargetOptions creates default value for vips_ppmsave_target optional arguments +func DefaultPpmsaveTargetOptions() *PpmsaveTargetOptions { + return &PpmsaveTargetOptions{ + Format: PpmFormat(2), + } +} + +// PpmsaveTarget vips_ppmsave_target save to ppm +// +// The target specifies target to save to. +func (r *Image) PpmsaveTarget(target *Target, options *PpmsaveTargetOptions) (error) { + if options != nil { + err := vipsgenPpmsaveTargetWithOptions(r.image, target.target, options.Format, options.Ascii, options.Bitdepth, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenPpmsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// PremultiplyOptions optional arguments for vips_premultiply +type PremultiplyOptions struct { + // MaxAlpha Maximum value of alpha channel + MaxAlpha float64 +} + +// DefaultPremultiplyOptions creates default value for vips_premultiply optional arguments +func DefaultPremultiplyOptions() *PremultiplyOptions { + return &PremultiplyOptions{ + MaxAlpha: 255, + } +} + +// Premultiply vips_premultiply premultiply image alpha +func (r *Image) Premultiply(options *PremultiplyOptions) (error) { + if options != nil { + out, err := vipsgenPremultiplyWithOptions(r.image, options.MaxAlpha) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenPremultiply(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Prewitt vips_prewitt Prewitt edge detector +func (r *Image) Prewitt() (error) { + out, err := vipsgenPrewitt(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Profile vips_profile find image profiles +func (r *Image) Profile() (*Image, *Image, error) { + columns, rows, err := vipsgenProfile(r.image) + if err != nil { + return nil, nil, err + } + columnsImage := newImageRef(columns, r.format, nil) + rowsImage := newImageRef(rows, r.format, nil) + return columnsImage, rowsImage, nil +} + + +// Project vips_project find image projections +func (r *Image) Project() (*Image, *Image, error) { + columns, rows, err := vipsgenProject(r.image) + if err != nil { + return nil, nil, err + } + columnsImage := newImageRef(columns, r.format, nil) + rowsImage := newImageRef(rows, r.format, nil) + return columnsImage, rowsImage, nil +} + +// QuadraticOptions optional arguments for vips_quadratic +type QuadraticOptions struct { + // Interpolate Interpolate values with this + Interpolate *Interpolate +} + +// DefaultQuadraticOptions creates default value for vips_quadratic optional arguments +func DefaultQuadraticOptions() *QuadraticOptions { + return &QuadraticOptions{ + } +} + +// Quadratic vips_quadratic resample an image with a quadratic transform +// +// The coeff specifies coefficient matrix. +func (r *Image) Quadratic(coeff *Image, options *QuadraticOptions) (error) { + if options != nil { + out, err := vipsgenQuadraticWithOptions(r.image, coeff.image, options.Interpolate) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenQuadratic(r.image, coeff.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Rad2float vips_rad2float unpack Radiance coding to float RGB +func (r *Image) Rad2float() (error) { + out, err := vipsgenRad2float(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// RadsaveOptions optional arguments for vips_radsave +type RadsaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRadsaveOptions creates default value for vips_radsave optional arguments +func DefaultRadsaveOptions() *RadsaveOptions { + return &RadsaveOptions{ + } +} + +// Radsave vips_radsave save image to Radiance file +// +// The filename specifies filename to save to. +func (r *Image) Radsave(filename string, options *RadsaveOptions) (error) { + if options != nil { + err := vipsgenRadsaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenRadsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// RadsaveBufferOptions optional arguments for vips_radsave_buffer +type RadsaveBufferOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRadsaveBufferOptions creates default value for vips_radsave_buffer optional arguments +func DefaultRadsaveBufferOptions() *RadsaveBufferOptions { + return &RadsaveBufferOptions{ + } +} + +// RadsaveBuffer vips_radsave_buffer save image to Radiance buffer +func (r *Image) RadsaveBuffer(options *RadsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenRadsaveBufferWithOptions(r.image, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenRadsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// RadsaveTargetOptions optional arguments for vips_radsave_target +type RadsaveTargetOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRadsaveTargetOptions creates default value for vips_radsave_target optional arguments +func DefaultRadsaveTargetOptions() *RadsaveTargetOptions { + return &RadsaveTargetOptions{ + } +} + +// RadsaveTarget vips_radsave_target save image to Radiance target +// +// The target specifies target to save to. +func (r *Image) RadsaveTarget(target *Target, options *RadsaveTargetOptions) (error) { + if options != nil { + err := vipsgenRadsaveTargetWithOptions(r.image, target.target, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenRadsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + + +// Rank vips_rank rank filter +// +// The width specifies window width in pixels. +// The height specifies window height in pixels. +// The index specifies select pixel at index. +func (r *Image) Rank(width int, height int, index int) (error) { + out, err := vipsgenRank(r.image, width, height, index) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// RawsaveOptions optional arguments for vips_rawsave +type RawsaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRawsaveOptions creates default value for vips_rawsave optional arguments +func DefaultRawsaveOptions() *RawsaveOptions { + return &RawsaveOptions{ + } +} + +// Rawsave vips_rawsave save image to raw file +// +// The filename specifies filename to save to. +func (r *Image) Rawsave(filename string, options *RawsaveOptions) (error) { + if options != nil { + err := vipsgenRawsaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenRawsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// RawsaveBufferOptions optional arguments for vips_rawsave_buffer +type RawsaveBufferOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRawsaveBufferOptions creates default value for vips_rawsave_buffer optional arguments +func DefaultRawsaveBufferOptions() *RawsaveBufferOptions { + return &RawsaveBufferOptions{ + } +} + +// RawsaveBuffer vips_rawsave_buffer write raw image to buffer +func (r *Image) RawsaveBuffer(options *RawsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenRawsaveBufferWithOptions(r.image, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenRawsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// RawsaveTargetOptions optional arguments for vips_rawsave_target +type RawsaveTargetOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultRawsaveTargetOptions creates default value for vips_rawsave_target optional arguments +func DefaultRawsaveTargetOptions() *RawsaveTargetOptions { + return &RawsaveTargetOptions{ + } +} + +// RawsaveTarget vips_rawsave_target write raw image to target +// +// The target specifies target to save to. +func (r *Image) RawsaveTarget(target *Target, options *RawsaveTargetOptions) (error) { + if options != nil { + err := vipsgenRawsaveTargetWithOptions(r.image, target.target, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenRawsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + + +// Recomb vips_recomb linear recombination with matrix +// +// The m specifies matrix of coefficients. +func (r *Image) Recomb(m *Image) (error) { + out, err := vipsgenRecomb(r.image, m.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ReduceOptions optional arguments for vips_reduce +type ReduceOptions struct { + // Kernel Resampling kernel + Kernel Kernel + // Gap Reducing gap + Gap float64 +} + +// DefaultReduceOptions creates default value for vips_reduce optional arguments +func DefaultReduceOptions() *ReduceOptions { + return &ReduceOptions{ + Kernel: Kernel(5), + } +} + +// Reduce vips_reduce reduce an image +// +// The hshrink specifies horizontal shrink factor. +// The vshrink specifies vertical shrink factor. +func (r *Image) Reduce(hshrink float64, vshrink float64, options *ReduceOptions) (error) { + if options != nil { + out, err := vipsgenReduceWithOptions(r.image, hshrink, vshrink, options.Kernel, options.Gap) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenReduce(r.image, hshrink, vshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ReducehOptions optional arguments for vips_reduceh +type ReducehOptions struct { + // Kernel Resampling kernel + Kernel Kernel + // Gap Reducing gap + Gap float64 +} + +// DefaultReducehOptions creates default value for vips_reduceh optional arguments +func DefaultReducehOptions() *ReducehOptions { + return &ReducehOptions{ + Kernel: Kernel(5), + } +} + +// Reduceh vips_reduceh shrink an image horizontally +// +// The hshrink specifies horizontal shrink factor. +func (r *Image) Reduceh(hshrink float64, options *ReducehOptions) (error) { + if options != nil { + out, err := vipsgenReducehWithOptions(r.image, hshrink, options.Kernel, options.Gap) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenReduceh(r.image, hshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ReducevOptions optional arguments for vips_reducev +type ReducevOptions struct { + // Kernel Resampling kernel + Kernel Kernel + // Gap Reducing gap + Gap float64 +} + +// DefaultReducevOptions creates default value for vips_reducev optional arguments +func DefaultReducevOptions() *ReducevOptions { + return &ReducevOptions{ + Kernel: Kernel(5), + } +} + +// Reducev vips_reducev shrink an image vertically +// +// The vshrink specifies vertical shrink factor. +func (r *Image) Reducev(vshrink float64, options *ReducevOptions) (error) { + if options != nil { + out, err := vipsgenReducevWithOptions(r.image, vshrink, options.Kernel, options.Gap) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenReducev(r.image, vshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Relational vips_relational relational operation on two images +// +// The right specifies right-hand image argument. +// The relational specifies relational to perform. +func (r *Image) Relational(right *Image, relational OperationRelational) (error) { + out, err := vipsgenRelational(r.image, right.image, relational) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// RelationalConst vips_relational_const relational operations against a constant +// +// The relational specifies relational to perform. +// The c specifies array of constants. +func (r *Image) RelationalConst(relational OperationRelational, c []float64) (error) { + out, err := vipsgenRelationalConst(r.image, relational, c) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Remainder vips_remainder remainder after integer division of two images +// +// The right specifies right-hand image argument. +func (r *Image) Remainder(right *Image) (error) { + out, err := vipsgenRemainder(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// RemainderConst vips_remainder_const remainder after integer division of an image and a constant +// +// The c specifies array of constants. +func (r *Image) RemainderConst(c []float64) (error) { + out, err := vipsgenRemainderConst(r.image, c) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Remosaic vips_remosaic rebuild an mosaiced image +// +// The oldStr specifies search for this string. +// The newStr specifies and swap for this string. +func (r *Image) Remosaic(oldStr string, newStr string) (error) { + out, err := vipsgenRemosaic(r.image, oldStr, newStr) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Replicate vips_replicate replicate an image +// +// The across specifies repeat this many times horizontally. +// The down specifies repeat this many times vertically. +func (r *Image) Replicate(across int, down int) (error) { + out, err := vipsgenReplicate(r.image, across, down) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ResizeOptions optional arguments for vips_resize +type ResizeOptions struct { + // Kernel Resampling kernel + Kernel Kernel + // Gap Reducing gap + Gap float64 + // Vscale Vertical scale image by this factor + Vscale float64 +} + +// DefaultResizeOptions creates default value for vips_resize optional arguments +func DefaultResizeOptions() *ResizeOptions { + return &ResizeOptions{ + Kernel: Kernel(5), + Gap: 2, + } +} + +// Resize vips_resize resize an image +// +// The scale specifies scale image by this factor. +func (r *Image) Resize(scale float64, options *ResizeOptions) (error) { + if options != nil { + out, err := vipsgenResizeWithOptions(r.image, scale, options.Kernel, options.Gap, options.Vscale) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenResize(r.image, scale) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Rot vips_rot rotate an image +// +// The angle specifies angle to rotate image. +func (r *Image) Rot(angle Angle) (error) { + out, err := vipsgenRot(r.image, angle) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Rot45Options optional arguments for vips_rot45 +type Rot45Options struct { + // Angle Angle to rotate image + Angle Angle45 +} + +// DefaultRot45Options creates default value for vips_rot45 optional arguments +func DefaultRot45Options() *Rot45Options { + return &Rot45Options{ + Angle: Angle45(1), + } +} + +// Rot45 vips_rot45 rotate an image +func (r *Image) Rot45(options *Rot45Options) (error) { + if options != nil { + out, err := vipsgenRot45WithOptions(r.image, options.Angle) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenRot45(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// RotateOptions optional arguments for vips_rotate +type RotateOptions struct { + // Interpolate Interpolate pixels with this + Interpolate *Interpolate + // Background Background value + Background []float64 + // Odx Horizontal output displacement + Odx float64 + // Ody Vertical output displacement + Ody float64 + // Idx Horizontal input displacement + Idx float64 + // Idy Vertical input displacement + Idy float64 +} + +// DefaultRotateOptions creates default value for vips_rotate optional arguments +func DefaultRotateOptions() *RotateOptions { + return &RotateOptions{ + } +} + +// Rotate vips_rotate rotate an image by a number of degrees +// +// The angle specifies rotate clockwise by this many degrees. +func (r *Image) Rotate(angle float64, options *RotateOptions) (error) { + if options != nil { + out, err := vipsgenRotateWithOptions(r.image, angle, options.Interpolate, options.Background, options.Odx, options.Ody, options.Idx, options.Idy) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenRotate(r.image, angle) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Round vips_round perform a round function on an image +// +// The round specifies rounding operation to perform. +func (r *Image) Round(round OperationRound) (error) { + out, err := vipsgenRound(r.image, round) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// SRGB2HSV vips_sRGB2HSV transform sRGB to HSV +func (r *Image) SRGB2HSV() (error) { + out, err := vipsgenSRGB2HSV(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// SRGB2scRGB vips_sRGB2scRGB convert an sRGB image to scRGB +func (r *Image) SRGB2scRGB() (error) { + out, err := vipsgenSRGB2scRGB(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ScRGB2BWOptions optional arguments for vips_scRGB2BW +type ScRGB2BWOptions struct { + // Depth Output device space depth in bits + Depth int +} + +// DefaultScRGB2BWOptions creates default value for vips_scRGB2BW optional arguments +func DefaultScRGB2BWOptions() *ScRGB2BWOptions { + return &ScRGB2BWOptions{ + Depth: 8, + } +} + +// ScRGB2BW vips_scRGB2BW convert scRGB to BW +func (r *Image) ScRGB2BW(options *ScRGB2BWOptions) (error) { + if options != nil { + out, err := vipsgenScRGB2BWWithOptions(r.image, options.Depth) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenScRGB2BW(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// ScRGB2XYZ vips_scRGB2XYZ transform scRGB to XYZ +func (r *Image) ScRGB2XYZ() (error) { + out, err := vipsgenScRGB2XYZ(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ScRGB2sRGBOptions optional arguments for vips_scRGB2sRGB +type ScRGB2sRGBOptions struct { + // Depth Output device space depth in bits + Depth int +} + +// DefaultScRGB2sRGBOptions creates default value for vips_scRGB2sRGB optional arguments +func DefaultScRGB2sRGBOptions() *ScRGB2sRGBOptions { + return &ScRGB2sRGBOptions{ + Depth: 8, + } +} + +// ScRGB2sRGB vips_scRGB2sRGB convert scRGB to sRGB +func (r *Image) ScRGB2sRGB(options *ScRGB2sRGBOptions) (error) { + if options != nil { + out, err := vipsgenScRGB2sRGBWithOptions(r.image, options.Depth) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenScRGB2sRGB(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ScaleOptions optional arguments for vips_scale +type ScaleOptions struct { + // Exp Exponent for log scale + Exp float64 + // Log Log scale + Log bool +} + +// DefaultScaleOptions creates default value for vips_scale optional arguments +func DefaultScaleOptions() *ScaleOptions { + return &ScaleOptions{ + Exp: 0.25, + } +} + +// Scale vips_scale scale an image to uchar +func (r *Image) Scale(options *ScaleOptions) (error) { + if options != nil { + out, err := vipsgenScaleWithOptions(r.image, options.Exp, options.Log) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenScale(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Scharr vips_scharr Scharr edge detector +func (r *Image) Scharr() (error) { + out, err := vipsgenScharr(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// SequentialOptions optional arguments for vips_sequential +type SequentialOptions struct { + // TileHeight Tile height in pixels + TileHeight int +} + +// DefaultSequentialOptions creates default value for vips_sequential optional arguments +func DefaultSequentialOptions() *SequentialOptions { + return &SequentialOptions{ + TileHeight: 1, + } +} + +// Sequential vips_sequential check sequential access +func (r *Image) Sequential(options *SequentialOptions) (*Image, error) { + if options != nil { + out, err := vipsgenSequentialWithOptions(r.image, options.TileHeight) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil + } + out, err := vipsgenSequential(r.image) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil +} + +// SharpenOptions optional arguments for vips_sharpen +type SharpenOptions struct { + // Sigma Sigma of Gaussian + Sigma float64 + // X1 Flat/jaggy threshold + X1 float64 + // Y2 Maximum brightening + Y2 float64 + // Y3 Maximum darkening + Y3 float64 + // M1 Slope for flat areas + M1 float64 + // M2 Slope for jaggy areas + M2 float64 +} + +// DefaultSharpenOptions creates default value for vips_sharpen optional arguments +func DefaultSharpenOptions() *SharpenOptions { + return &SharpenOptions{ + Sigma: 0.5, + X1: 2, + Y2: 10, + Y3: 20, + M2: 3, + } +} + +// Sharpen vips_sharpen unsharp masking for print +func (r *Image) Sharpen(options *SharpenOptions) (error) { + if options != nil { + out, err := vipsgenSharpenWithOptions(r.image, options.Sigma, options.X1, options.Y2, options.Y3, options.M1, options.M2) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenSharpen(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ShrinkOptions optional arguments for vips_shrink +type ShrinkOptions struct { + // Ceil Round-up output dimensions + Ceil bool +} + +// DefaultShrinkOptions creates default value for vips_shrink optional arguments +func DefaultShrinkOptions() *ShrinkOptions { + return &ShrinkOptions{ + } +} + +// Shrink vips_shrink shrink an image +// +// The hshrink specifies horizontal shrink factor. +// The vshrink specifies vertical shrink factor. +func (r *Image) Shrink(hshrink float64, vshrink float64, options *ShrinkOptions) (error) { + if options != nil { + out, err := vipsgenShrinkWithOptions(r.image, hshrink, vshrink, options.Ceil) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenShrink(r.image, hshrink, vshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ShrinkhOptions optional arguments for vips_shrinkh +type ShrinkhOptions struct { + // Ceil Round-up output dimensions + Ceil bool +} + +// DefaultShrinkhOptions creates default value for vips_shrinkh optional arguments +func DefaultShrinkhOptions() *ShrinkhOptions { + return &ShrinkhOptions{ + } +} + +// Shrinkh vips_shrinkh shrink an image horizontally +// +// The hshrink specifies horizontal shrink factor. +func (r *Image) Shrinkh(hshrink int, options *ShrinkhOptions) (error) { + if options != nil { + out, err := vipsgenShrinkhWithOptions(r.image, hshrink, options.Ceil) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenShrinkh(r.image, hshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ShrinkvOptions optional arguments for vips_shrinkv +type ShrinkvOptions struct { + // Ceil Round-up output dimensions + Ceil bool +} + +// DefaultShrinkvOptions creates default value for vips_shrinkv optional arguments +func DefaultShrinkvOptions() *ShrinkvOptions { + return &ShrinkvOptions{ + } +} + +// Shrinkv vips_shrinkv shrink an image vertically +// +// The vshrink specifies vertical shrink factor. +func (r *Image) Shrinkv(vshrink int, options *ShrinkvOptions) (error) { + if options != nil { + out, err := vipsgenShrinkvWithOptions(r.image, vshrink, options.Ceil) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenShrinkv(r.image, vshrink) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Sign vips_sign unit vector of pixel +func (r *Image) Sign() (error) { + out, err := vipsgenSign(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// SimilarityOptions optional arguments for vips_similarity +type SimilarityOptions struct { + // Scale Scale by this factor + Scale float64 + // Angle Rotate clockwise by this many degrees + Angle float64 + // Interpolate Interpolate pixels with this + Interpolate *Interpolate + // Background Background value + Background []float64 + // Odx Horizontal output displacement + Odx float64 + // Ody Vertical output displacement + Ody float64 + // Idx Horizontal input displacement + Idx float64 + // Idy Vertical input displacement + Idy float64 +} + +// DefaultSimilarityOptions creates default value for vips_similarity optional arguments +func DefaultSimilarityOptions() *SimilarityOptions { + return &SimilarityOptions{ + Scale: 1, + } +} + +// Similarity vips_similarity similarity transform of an image +func (r *Image) Similarity(options *SimilarityOptions) (error) { + if options != nil { + out, err := vipsgenSimilarityWithOptions(r.image, options.Scale, options.Angle, options.Interpolate, options.Background, options.Odx, options.Ody, options.Idx, options.Idy) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenSimilarity(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// SmartcropOptions optional arguments for vips_smartcrop +type SmartcropOptions struct { + // Interesting How to measure interestingness + Interesting Interesting + // Premultiplied Input image already has premultiplied alpha + Premultiplied bool +} + +// DefaultSmartcropOptions creates default value for vips_smartcrop optional arguments +func DefaultSmartcropOptions() *SmartcropOptions { + return &SmartcropOptions{ + Interesting: Interesting(3), + } +} + +// Smartcrop vips_smartcrop extract an area from an image +// +// The width specifies width of extract area. +// The height specifies height of extract area. +func (r *Image) Smartcrop(width int, height int, options *SmartcropOptions) (error) { + if options != nil { + out, err := vipsgenSmartcropWithOptions(r.image, width, height, options.Interesting, options.Premultiplied) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenSmartcrop(r.image, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Sobel vips_sobel Sobel edge detector +func (r *Image) Sobel() (error) { + out, err := vipsgenSobel(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Spcor vips_spcor spatial correlation +// +// The ref specifies input reference image. +func (r *Image) Spcor(ref *Image) (error) { + out, err := vipsgenSpcor(r.image, ref.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Spectrum vips_spectrum make displayable power spectrum +func (r *Image) Spectrum() (error) { + out, err := vipsgenSpectrum(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Stats vips_stats find many image stats +func (r *Image) Stats() (error) { + out, err := vipsgenStats(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// StdifOptions optional arguments for vips_stdif +type StdifOptions struct { + // S0 New deviation + S0 float64 + // B Weight of new deviation + B float64 + // M0 New mean + M0 float64 + // A Weight of new mean + A float64 +} + +// DefaultStdifOptions creates default value for vips_stdif optional arguments +func DefaultStdifOptions() *StdifOptions { + return &StdifOptions{ + S0: 50, + B: 0.5, + M0: 128, + A: 0.5, + } +} + +// Stdif vips_stdif statistical difference +// +// The width specifies window width in pixels. +// The height specifies window height in pixels. +func (r *Image) Stdif(width int, height int, options *StdifOptions) (error) { + if options != nil { + out, err := vipsgenStdifWithOptions(r.image, width, height, options.S0, options.B, options.M0, options.A) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenStdif(r.image, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// SubsampleOptions optional arguments for vips_subsample +type SubsampleOptions struct { + // Point Point sample + Point bool +} + +// DefaultSubsampleOptions creates default value for vips_subsample optional arguments +func DefaultSubsampleOptions() *SubsampleOptions { + return &SubsampleOptions{ + } +} + +// Subsample vips_subsample subsample an image +// +// The xfac specifies horizontal subsample factor. +// The yfac specifies vertical subsample factor. +func (r *Image) Subsample(xfac int, yfac int, options *SubsampleOptions) (error) { + if options != nil { + out, err := vipsgenSubsampleWithOptions(r.image, xfac, yfac, options.Point) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenSubsample(r.image, xfac, yfac) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Subtract vips_subtract subtract two images +// +// The right specifies right-hand image argument. +func (r *Image) Subtract(right *Image) (error) { + out, err := vipsgenSubtract(r.image, right.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ThumbnailImageOptions optional arguments for vips_thumbnail_image +type ThumbnailImageOptions struct { + // Height Size to this height + Height int + // Size Only upsize, only downsize, or both + Size Size + // NoRotate Don't use orientation tags to rotate image upright + NoRotate bool + // Crop Reduce to fill target rectangle, then crop + Crop Interesting + // Linear Reduce in linear light + Linear bool + // InputProfile Fallback input profile + InputProfile string + // OutputProfile Fallback output profile + OutputProfile string + // Intent Rendering intent + Intent Intent + // FailOn Error level to fail on + FailOn FailOn +} + +// DefaultThumbnailImageOptions creates default value for vips_thumbnail_image optional arguments +func DefaultThumbnailImageOptions() *ThumbnailImageOptions { + return &ThumbnailImageOptions{ + Height: 1, + Intent: Intent(1), + } +} + +// ThumbnailImage vips_thumbnail_image generate thumbnail from image +// +// The width specifies size to this width. +func (r *Image) ThumbnailImage(width int, options *ThumbnailImageOptions) (error) { + if options != nil { + out, err := vipsgenThumbnailImageWithOptions(r.image, width, options.Height, options.Size, options.NoRotate, options.Crop, options.Linear, options.InputProfile, options.OutputProfile, options.Intent, options.FailOn) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenThumbnailImage(r.image, width) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// TiffsaveOptions optional arguments for vips_tiffsave +type TiffsaveOptions struct { + // Compression Compression for this file + Compression TiffCompression + // Q Q factor + Q int + // Predictor Compression prediction + Predictor TiffPredictor + // Tile Write a tiled tiff + Tile bool + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Pyramid Write a pyramidal tiff + Pyramid bool + // Miniswhite Use 0 for white in 1-bit images + Miniswhite bool + // Bitdepth Write as a 1, 2, 4 or 8 bit image + Bitdepth int + // Resunit Resolution unit + Resunit TiffResunit + // Xres Horizontal resolution in pixels/mm + Xres float64 + // Yres Vertical resolution in pixels/mm + Yres float64 + // Bigtiff Write a bigtiff image + Bigtiff bool + // Properties Write a properties document to IMAGEDESCRIPTION + Properties bool + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // Level Deflate (1-9, default 6) or ZSTD (1-22, default 9) compression level + Level int + // Lossless Enable WEBP lossless mode + Lossless bool + // Depth Pyramid depth + Depth DzDepth + // Subifd Save pyr layers as sub-IFDs + Subifd bool + // Premultiply Save with premultiplied alpha + Premultiply bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultTiffsaveOptions creates default value for vips_tiffsave optional arguments +func DefaultTiffsaveOptions() *TiffsaveOptions { + return &TiffsaveOptions{ + Q: 75, + Predictor: TiffPredictor(2), + TileWidth: 128, + TileHeight: 128, + Xres: 1, + Yres: 1, + Depth: DzDepth(1), + } +} + +// Tiffsave vips_tiffsave save image to tiff file +// +// The filename specifies filename to save to. +func (r *Image) Tiffsave(filename string, options *TiffsaveOptions) (error) { + if options != nil { + err := vipsgenTiffsaveWithOptions(r.image, filename, options.Compression, options.Q, options.Predictor, options.Tile, options.TileWidth, options.TileHeight, options.Pyramid, options.Miniswhite, options.Bitdepth, options.Resunit, options.Xres, options.Yres, options.Bigtiff, options.Properties, options.RegionShrink, options.Level, options.Lossless, options.Depth, options.Subifd, options.Premultiply, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenTiffsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// TiffsaveBufferOptions optional arguments for vips_tiffsave_buffer +type TiffsaveBufferOptions struct { + // Compression Compression for this file + Compression TiffCompression + // Q Q factor + Q int + // Predictor Compression prediction + Predictor TiffPredictor + // Tile Write a tiled tiff + Tile bool + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Pyramid Write a pyramidal tiff + Pyramid bool + // Miniswhite Use 0 for white in 1-bit images + Miniswhite bool + // Bitdepth Write as a 1, 2, 4 or 8 bit image + Bitdepth int + // Resunit Resolution unit + Resunit TiffResunit + // Xres Horizontal resolution in pixels/mm + Xres float64 + // Yres Vertical resolution in pixels/mm + Yres float64 + // Bigtiff Write a bigtiff image + Bigtiff bool + // Properties Write a properties document to IMAGEDESCRIPTION + Properties bool + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // Level Deflate (1-9, default 6) or ZSTD (1-22, default 9) compression level + Level int + // Lossless Enable WEBP lossless mode + Lossless bool + // Depth Pyramid depth + Depth DzDepth + // Subifd Save pyr layers as sub-IFDs + Subifd bool + // Premultiply Save with premultiplied alpha + Premultiply bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultTiffsaveBufferOptions creates default value for vips_tiffsave_buffer optional arguments +func DefaultTiffsaveBufferOptions() *TiffsaveBufferOptions { + return &TiffsaveBufferOptions{ + Q: 75, + Predictor: TiffPredictor(2), + TileWidth: 128, + TileHeight: 128, + Xres: 1, + Yres: 1, + Depth: DzDepth(1), + } +} + +// TiffsaveBuffer vips_tiffsave_buffer save image to tiff buffer +func (r *Image) TiffsaveBuffer(options *TiffsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenTiffsaveBufferWithOptions(r.image, options.Compression, options.Q, options.Predictor, options.Tile, options.TileWidth, options.TileHeight, options.Pyramid, options.Miniswhite, options.Bitdepth, options.Resunit, options.Xres, options.Yres, options.Bigtiff, options.Properties, options.RegionShrink, options.Level, options.Lossless, options.Depth, options.Subifd, options.Premultiply, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenTiffsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// TiffsaveTargetOptions optional arguments for vips_tiffsave_target +type TiffsaveTargetOptions struct { + // Compression Compression for this file + Compression TiffCompression + // Q Q factor + Q int + // Predictor Compression prediction + Predictor TiffPredictor + // Tile Write a tiled tiff + Tile bool + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // Pyramid Write a pyramidal tiff + Pyramid bool + // Miniswhite Use 0 for white in 1-bit images + Miniswhite bool + // Bitdepth Write as a 1, 2, 4 or 8 bit image + Bitdepth int + // Resunit Resolution unit + Resunit TiffResunit + // Xres Horizontal resolution in pixels/mm + Xres float64 + // Yres Vertical resolution in pixels/mm + Yres float64 + // Bigtiff Write a bigtiff image + Bigtiff bool + // Properties Write a properties document to IMAGEDESCRIPTION + Properties bool + // RegionShrink Method to shrink regions + RegionShrink RegionShrink + // Level Deflate (1-9, default 6) or ZSTD (1-22, default 9) compression level + Level int + // Lossless Enable WEBP lossless mode + Lossless bool + // Depth Pyramid depth + Depth DzDepth + // Subifd Save pyr layers as sub-IFDs + Subifd bool + // Premultiply Save with premultiplied alpha + Premultiply bool + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultTiffsaveTargetOptions creates default value for vips_tiffsave_target optional arguments +func DefaultTiffsaveTargetOptions() *TiffsaveTargetOptions { + return &TiffsaveTargetOptions{ + Q: 75, + Predictor: TiffPredictor(2), + TileWidth: 128, + TileHeight: 128, + Xres: 1, + Yres: 1, + Depth: DzDepth(1), + } +} + +// TiffsaveTarget vips_tiffsave_target save image to tiff target +// +// The target specifies target to save to. +func (r *Image) TiffsaveTarget(target *Target, options *TiffsaveTargetOptions) (error) { + if options != nil { + err := vipsgenTiffsaveTargetWithOptions(r.image, target.target, options.Compression, options.Q, options.Predictor, options.Tile, options.TileWidth, options.TileHeight, options.Pyramid, options.Miniswhite, options.Bitdepth, options.Resunit, options.Xres, options.Yres, options.Bigtiff, options.Properties, options.RegionShrink, options.Level, options.Lossless, options.Depth, options.Subifd, options.Premultiply, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenTiffsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// TilecacheOptions optional arguments for vips_tilecache +type TilecacheOptions struct { + // TileWidth Tile width in pixels + TileWidth int + // TileHeight Tile height in pixels + TileHeight int + // MaxTiles Maximum number of tiles to cache + MaxTiles int + // Access Expected access pattern + Access Access + // Threaded Allow threaded access + Threaded bool + // Persistent Keep cache between evaluations + Persistent bool +} + +// DefaultTilecacheOptions creates default value for vips_tilecache optional arguments +func DefaultTilecacheOptions() *TilecacheOptions { + return &TilecacheOptions{ + TileWidth: 128, + TileHeight: 128, + MaxTiles: 1000, + } +} + +// Tilecache vips_tilecache cache an image as a set of tiles +func (r *Image) Tilecache(options *TilecacheOptions) (*Image, error) { + if options != nil { + out, err := vipsgenTilecacheWithOptions(r.image, options.TileWidth, options.TileHeight, options.MaxTiles, options.Access, options.Threaded, options.Persistent) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil + } + out, err := vipsgenTilecache(r.image) + if err != nil { + return nil, err + } + outImage := newImageRef(out, r.format, nil) + return outImage, nil +} + +// Transpose3dOptions optional arguments for vips_transpose3d +type Transpose3dOptions struct { + // PageHeight Height of each input page + PageHeight int +} + +// DefaultTranspose3dOptions creates default value for vips_transpose3d optional arguments +func DefaultTranspose3dOptions() *Transpose3dOptions { + return &Transpose3dOptions{ + } +} + +// Transpose3d vips_transpose3d transpose3d an image +func (r *Image) Transpose3d(options *Transpose3dOptions) (error) { + if options != nil { + out, err := vipsgenTranspose3dWithOptions(r.image, options.PageHeight) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenTranspose3d(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// UnpremultiplyOptions optional arguments for vips_unpremultiply +type UnpremultiplyOptions struct { + // MaxAlpha Maximum value of alpha channel + MaxAlpha float64 + // AlphaBand Unpremultiply with this alpha + AlphaBand int +} + +// DefaultUnpremultiplyOptions creates default value for vips_unpremultiply optional arguments +func DefaultUnpremultiplyOptions() *UnpremultiplyOptions { + return &UnpremultiplyOptions{ + MaxAlpha: 255, + AlphaBand: 3, + } +} + +// Unpremultiply vips_unpremultiply unpremultiply image alpha +func (r *Image) Unpremultiply(options *UnpremultiplyOptions) (error) { + if options != nil { + out, err := vipsgenUnpremultiplyWithOptions(r.image, options.MaxAlpha, options.AlphaBand) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenUnpremultiply(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// VipssaveOptions optional arguments for vips_vipssave +type VipssaveOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultVipssaveOptions creates default value for vips_vipssave optional arguments +func DefaultVipssaveOptions() *VipssaveOptions { + return &VipssaveOptions{ + } +} + +// Vipssave vips_vipssave save image to file in vips format +// +// The filename specifies filename to save to. +func (r *Image) Vipssave(filename string, options *VipssaveOptions) (error) { + if options != nil { + err := vipsgenVipssaveWithOptions(r.image, filename, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenVipssave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// VipssaveTargetOptions optional arguments for vips_vipssave_target +type VipssaveTargetOptions struct { + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultVipssaveTargetOptions creates default value for vips_vipssave_target optional arguments +func DefaultVipssaveTargetOptions() *VipssaveTargetOptions { + return &VipssaveTargetOptions{ + } +} + +// VipssaveTarget vips_vipssave_target save image to target in vips format +// +// The target specifies target to save to. +func (r *Image) VipssaveTarget(target *Target, options *VipssaveTargetOptions) (error) { + if options != nil { + err := vipsgenVipssaveTargetWithOptions(r.image, target.target, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenVipssaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// WebpsaveOptions optional arguments for vips_webpsave +type WebpsaveOptions struct { + // Q Q factor + Q int + // Lossless Enable lossless compression + Lossless bool + // Preset Preset for lossy compression + Preset WebpPreset + // SmartSubsample Enable high quality chroma subsampling + SmartSubsample bool + // NearLossless Enable preprocessing in lossless mode (uses Q) + NearLossless bool + // AlphaQ Change alpha plane fidelity for lossy compression + AlphaQ int + // MinSize Optimise for minimum size + MinSize bool + // Kmin Minimum number of frames between key frames + Kmin int + // Kmax Maximum number of frames between key frames + Kmax int + // Effort Level of CPU effort to reduce file size + Effort int + // TargetSize Desired target size in bytes + TargetSize int + // Mixed Allow mixed encoding (might reduce file size) + Mixed bool + // SmartDeblock Enable auto-adjusting of the deblocking filter + SmartDeblock bool + // Passes Number of entropy-analysis passes (in [1..10]) + Passes int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultWebpsaveOptions creates default value for vips_webpsave optional arguments +func DefaultWebpsaveOptions() *WebpsaveOptions { + return &WebpsaveOptions{ + Q: 75, + AlphaQ: 100, + Kmin: 2147483646, + Kmax: 2147483647, + Effort: 4, + Passes: 1, + } +} + +// Webpsave vips_webpsave save as WebP +// +// The filename specifies filename to save to. +func (r *Image) Webpsave(filename string, options *WebpsaveOptions) (error) { + if options != nil { + err := vipsgenWebpsaveWithOptions(r.image, filename, options.Q, options.Lossless, options.Preset, options.SmartSubsample, options.NearLossless, options.AlphaQ, options.MinSize, options.Kmin, options.Kmax, options.Effort, options.TargetSize, options.Mixed, options.SmartDeblock, options.Passes, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenWebpsave(r.image, filename) + if err != nil { + return err + } + return nil +} + +// WebpsaveBufferOptions optional arguments for vips_webpsave_buffer +type WebpsaveBufferOptions struct { + // Q Q factor + Q int + // Lossless Enable lossless compression + Lossless bool + // Preset Preset for lossy compression + Preset WebpPreset + // SmartSubsample Enable high quality chroma subsampling + SmartSubsample bool + // NearLossless Enable preprocessing in lossless mode (uses Q) + NearLossless bool + // AlphaQ Change alpha plane fidelity for lossy compression + AlphaQ int + // MinSize Optimise for minimum size + MinSize bool + // Kmin Minimum number of frames between key frames + Kmin int + // Kmax Maximum number of frames between key frames + Kmax int + // Effort Level of CPU effort to reduce file size + Effort int + // TargetSize Desired target size in bytes + TargetSize int + // Mixed Allow mixed encoding (might reduce file size) + Mixed bool + // SmartDeblock Enable auto-adjusting of the deblocking filter + SmartDeblock bool + // Passes Number of entropy-analysis passes (in [1..10]) + Passes int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultWebpsaveBufferOptions creates default value for vips_webpsave_buffer optional arguments +func DefaultWebpsaveBufferOptions() *WebpsaveBufferOptions { + return &WebpsaveBufferOptions{ + Q: 75, + AlphaQ: 100, + Kmin: 2147483646, + Kmax: 2147483647, + Effort: 4, + Passes: 1, + } +} + +// WebpsaveBuffer vips_webpsave_buffer save as WebP +func (r *Image) WebpsaveBuffer(options *WebpsaveBufferOptions) ([]byte, error) { + if options != nil { + buf, err := vipsgenWebpsaveBufferWithOptions(r.image, options.Q, options.Lossless, options.Preset, options.SmartSubsample, options.NearLossless, options.AlphaQ, options.MinSize, options.Kmin, options.Kmax, options.Effort, options.TargetSize, options.Mixed, options.SmartDeblock, options.Passes, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return nil, err + } + return buf, nil + } + buf, err := vipsgenWebpsaveBuffer(r.image) + if err != nil { + return nil, err + } + return buf, nil +} + +// WebpsaveTargetOptions optional arguments for vips_webpsave_target +type WebpsaveTargetOptions struct { + // Q Q factor + Q int + // Lossless Enable lossless compression + Lossless bool + // Preset Preset for lossy compression + Preset WebpPreset + // SmartSubsample Enable high quality chroma subsampling + SmartSubsample bool + // NearLossless Enable preprocessing in lossless mode (uses Q) + NearLossless bool + // AlphaQ Change alpha plane fidelity for lossy compression + AlphaQ int + // MinSize Optimise for minimum size + MinSize bool + // Kmin Minimum number of frames between key frames + Kmin int + // Kmax Maximum number of frames between key frames + Kmax int + // Effort Level of CPU effort to reduce file size + Effort int + // TargetSize Desired target size in bytes + TargetSize int + // Mixed Allow mixed encoding (might reduce file size) + Mixed bool + // SmartDeblock Enable auto-adjusting of the deblocking filter + SmartDeblock bool + // Passes Number of entropy-analysis passes (in [1..10]) + Passes int + // Keep Which metadata to retain + Keep Keep + // Background Background value + Background []float64 + // PageHeight Set page height for multipage save + PageHeight int + // Profile Filename of ICC profile to embed + Profile string +} + +// DefaultWebpsaveTargetOptions creates default value for vips_webpsave_target optional arguments +func DefaultWebpsaveTargetOptions() *WebpsaveTargetOptions { + return &WebpsaveTargetOptions{ + Q: 75, + AlphaQ: 100, + Kmin: 2147483646, + Kmax: 2147483647, + Effort: 4, + Passes: 1, + } +} + +// WebpsaveTarget vips_webpsave_target save as WebP +// +// The target specifies target to save to. +func (r *Image) WebpsaveTarget(target *Target, options *WebpsaveTargetOptions) (error) { + if options != nil { + err := vipsgenWebpsaveTargetWithOptions(r.image, target.target, options.Q, options.Lossless, options.Preset, options.SmartSubsample, options.NearLossless, options.AlphaQ, options.MinSize, options.Kmin, options.Kmax, options.Effort, options.TargetSize, options.Mixed, options.SmartDeblock, options.Passes, options.Keep, options.Background, options.PageHeight, options.Profile) + if err != nil { + return err + } + return nil + } + err := vipsgenWebpsaveTarget(r.image, target.target) + if err != nil { + return err + } + return nil +} + +// WrapOptions optional arguments for vips_wrap +type WrapOptions struct { + // X Left edge of input in output + X int + // Y Top edge of input in output + Y int +} + +// DefaultWrapOptions creates default value for vips_wrap optional arguments +func DefaultWrapOptions() *WrapOptions { + return &WrapOptions{ + } +} + +// Wrap vips_wrap wrap image origin +func (r *Image) Wrap(options *WrapOptions) (error) { + if options != nil { + out, err := vipsgenWrapWithOptions(r.image, options.X, options.Y) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenWrap(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + +// Zoom vips_zoom zoom an image +// +// The xfac specifies horizontal zoom factor. +// The yfac specifies vertical zoom factor. +func (r *Image) Zoom(xfac int, yfac int) (error) { + out, err := vipsgenZoom(r.image, xfac, yfac) + if err != nil { + return err + } + r.setImage(out) + return nil +} + + + +// ProfileLoad vips_profile_load load named ICC profile +// +// The name specifies profile name. +func ProfileLoad(name string) ([]byte, error) { + Startup(nil) + return vipsgenProfileLoad(name) +} + + +// LoadOptions are options for loading an image. Some are type-specific. +type LoadOptions struct { + // N Number of pages to load, -1 for all + N int + // Page First page to load + Page int + // Dpi Resolution in DPI + Dpi int + // Autorotate Rotate image using exif orientation + Autorotate bool + // FailOnError Fail on first error + FailOnError bool + // Shrink Shrink factor for jpeg load + Shrink int + // Thumbnail Load the thumbnail instead of main image (for HEIF) + Thumbnail bool + // Unlimited Allow without size restrictions + Unlimited bool + // Memory Force open via memory + Memory bool + // Access Required access pattern for this file + Access Access +} + +// DefaultLoadOptions creates default LoadOptions +func DefaultLoadOptions() *LoadOptions { + return &LoadOptions{ + FailOnError: true, + } +} + +// OptionString convert import params to option_string +func (i *LoadOptions) OptionString() string { + var values []string + if v := i.N; v != 0 { + values = append(values, "n="+strconv.Itoa(v)) + } + if v := i.Page; v != 0 { + values = append(values, "page="+strconv.Itoa(v)) + } + if v := i.Dpi; v != 0 { + values = append(values, "dpi="+strconv.Itoa(v)) + } + if v := i.FailOnError; v { + values = append(values, "fail="+boolToStr(v)) + } + if v := i.Shrink; v != 0 { + values = append(values, "shrink="+strconv.Itoa(v)) + } + if v := i.Autorotate; v { + values = append(values, "autorotate="+boolToStr(v)) + } + if v := i.Unlimited; v { + values = append(values, "unlimited="+boolToStr(v)) + } + if v := i.Thumbnail; v { + values = append(values, "thumbnail="+boolToStr(v)) + } + if v := i.Memory; v { + values = append(values, "memory="+boolToStr(v)) + } + if access := i.Access; access != 0 { + switch access { + case AccessSequential: + values = append(values, "access=sequential") + case AccessRandom: + values = append(values, "access=random") + case AccessSequentialUnbuffered: + values = append(values, "access=sequential-unbuffered") + } + } + return strings.Join(values, ",") +} + +// NewImageFromSource vips_image_new_from_source loads a Source and creates a new Image +func NewImageFromSource(s *Source, options *LoadOptions) (*Image, error) { + Startup(nil) + if options == nil { + options = DefaultLoadOptions() + } + vipsImage, err := vipsgenImageFromSource(s.src, options) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil +} + +// NewImageFromBuffer vips_image_new_from_buffer loads an image buffer and creates a new Image +func NewImageFromBuffer(buf []byte, options *LoadOptions) (*Image, error) { + Startup(nil) + if options == nil { + options = DefaultLoadOptions() + } + vipsImage, err := vipsgenImageFromBuffer(buf, options) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), buf), nil +} + +// NewImageFromFile vips_image_new_from_file loads an image from file and creates a new Image +func NewImageFromFile(file string, options *LoadOptions) (*Image, error) { + Startup(nil) + if options == nil { + options = DefaultLoadOptions() + } + vipsImage, err := vipsgenImageFromFile(file, options) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, vipsDetermineImageType(vipsImage), nil), nil +} + +// NewImageFromMemory vips_image_new_from_memory loads a raw RGB/RGBA image buffer and creates a new Image +func NewImageFromMemory(buf []byte, width, height, bands int) (*Image, error) { + Startup(nil) + vipsImage, err := vipsgenImageFromMemory(buf, width, height, bands) + if err != nil { + return nil, err + } + return newImageRef(vipsImage, ImageTypeUnknown, buf), nil +} + + +func newImageRef(vipsImage *C.VipsImage, format ImageType, buf []byte) *Image { + imageRef := &Image{ + image: vipsImage, + format: format, + buf: buf, + } + log("vipsgen", LogLevelDebug, fmt.Sprintf("created imageRef %p", imageRef)) + return imageRef +} + +// setImage resets the image for this image and frees the previous one +func (r *Image) setImage(image *C.VipsImage) { + r.lock.Lock() + defer r.lock.Unlock() + if r.image == image { + return + } + if r.image != nil { + clearImage(r.image) + } + r.image = image + r.pageHeight = 0 +} + +// Close closes the image and frees the memory +func (r *Image) Close() { + if r == nil { + return + } + r.lock.Lock() + if r.image != nil { + clearImage(r.image) + r.image = nil + log("vipsgen", LogLevelDebug, fmt.Sprintf("closing image %p", r)) + } + r.buf = nil + r.lock.Unlock() +} + +// Format returns the initial format of the vips image when loaded. +func (r *Image) Format() ImageType { + return r.format +} + +// Width returns the width of this image. +func (r *Image) Width() int { + return int(r.image.Xsize) +} + +// Height returns the height of this image. +func (r *Image) Height() int { + return int(r.image.Ysize) +} + +// Bands returns the number of bands for this image. +func (r *Image) Bands() int { + return int(r.image.Bands) +} + +// ResX returns the X resolution +func (r *Image) ResX() float64 { + return float64(r.image.Xres) +} + +// ResY returns the Y resolution +func (r *Image) ResY() float64 { + return float64(r.image.Yres) +} + +// OffsetX returns the X offset +func (r *Image) OffsetX() int { + return int(r.image.Xoffset) +} + +// OffsetY returns the Y offset +func (r *Image) OffsetY() int { + return int(r.image.Yoffset) +} + +// BandFormat returns the current band format +func (r *Image) BandFormat() BandFormat { + return BandFormat(int(r.image.BandFmt)) +} + +// Coding returns the image coding +func (r *Image) Coding() Coding { + return Coding(int(r.image.Coding)) +} + +// Interpretation returns the current interpretation of the color space of the image. +func (r *Image) Interpretation() Interpretation { + return Interpretation(int(r.image.Type)) +} + +// IsColorSpaceSupported returns a boolean whether the image's color space is supported by libvips. +func (r *Image) IsColorSpaceSupported() bool { + return vipsIsColorSpaceSupported(r.image) +} + +// HasAlpha returns if the image has an alpha layer. +func (r *Image) HasAlpha() bool { + return vipsHasAlpha(r.image) +} + +// HasICCProfile checks whether the image has an ICC profile embedded. +func (r *Image) HasICCProfile() bool { + return vipsHasICCProfile(r.image) +} + +// HasIPTC returns a boolean whether the image in question has IPTC data associated with it. +func (r *Image) HasIPTC() bool { + return vipsHasIPTC(r.image) +} + +// Orientation returns the orientation number as it appears in the Exif, if present +func (r *Image) Orientation() int { + return vipsGetMetaOrientation(r.image) +} + +// GetFields vips_image_get_fields returns a list of all metadata field names in the image +func (r *Image) GetFields() []string { + return vipsImageGetFields(r.image) +} + +// HasField vips_image_get_typeof checks if the image has a metadata field with the given name +func (r *Image) HasField(name string) bool { + return vipsImageHasField(r.image, name) +} + +// GetBlob vips_image_get_blob retrieves binary metadata from the image by field name +func (r *Image) GetBlob(name string) ([]byte, error) { + return vipsImageGetBlob(r.image, name) +} + +// SetDouble vips_image_set_double sets a double-precision floating point metadata value +func (r *Image) SetDouble(name string, f float64) { + vipsImageSetDouble(r.image, name, f) +} + +// GetDouble vips_image_get_double retrieves a double-precision floating point metadata value +func (r *Image) GetDouble(name string) (float64, error) { + return vipsImageGetDouble(r.image, name) +} + +// SetInt vips_image_set_int sets an integer metadata value +func (r *Image) SetInt(name string, i int) { + vipsImageSetInt(r.image, name, i) +} + +// GetInt vips_image_get_int retrieves an integer metadata value +func (r *Image) GetInt(name string) (int, error) { + return vipsImageGetInt(r.image, name) +} + +// SetString vips_image_set_string sets a string metadata value +func (r *Image) SetString(name string, str string) { + vipsImageSetString(r.image, name, str) +} + +// GetString vips_image_get_string retrieves a string metadata value +func (r *Image) GetString(name string) (string, error) { + return vipsImageGetString(r.image, name) +} + +// GetAsString vips_image_get_as_string retrieves any metadata value converted to string format +func (r *Image) GetAsString(name string) (string, error) { + return vipsImageGetAsString(r.image, name) +} + +// GetArrayDouble vips_image_get_array_double retrieves a double array metadata value +func (r *Image) GetArrayDouble(name string) ([]float64, error) { + return vipsImageGetArrayDouble(r.image, name) +} + +// GetArrayInt vips_image_get_array_int retrieves an integer array metadata value +func (r *Image) GetArrayInt(name string) ([]int, error) { + return vipsImageGetArrayInt(r.image, name) +} + +// Exif extracts all EXIF metadata from the image and returns it as a map of field names to string values +func (r *Image) Exif() map[string]string { + fields := vipsImageGetFields(r.image) + exifData := map[string]string{} + for _, field := range fields { + if strings.HasPrefix(field, "exif") { + if val, err := vipsImageGetString(r.image, field); err == nil { + exifData[field] = val + } + } + } + return exifData +} + +// SetOrientation sets the orientation in the EXIF header of the associated image. +func (r *Image) SetOrientation(orientation int) error { + out, err := vipsgenCopy(r.image) + if err != nil { + return err + } + vipsSetMetaOrientation(out, orientation) + r.setImage(out) + return nil +} + +// RemoveOrientation removes the EXIF orientation information of the image. +func (r *Image) RemoveOrientation() error { + out, err := vipsgenCopy(r.image) + if err != nil { + return err + } + vipsRemoveMetaOrientation(out) + r.setImage(out) + return nil +} + +// Pages returns the number of pages in the Image +// For animated images this corresponds to the number of frames +func (r *Image) Pages() int { + + // libvips uses the same attribute (n_pages) to represent the number of pyramid layers in JP2K + // as we interpret the attribute as frames and JP2K does not support animation we override this with 1 + if r.format == ImageTypeJp2k { + return 1 + } + + return vipsGetImageNPages(r.image) +} + + +// SetPages sets the number of pages in the Image +// For animated images this corresponds to the number of frames +func (r *Image) SetPages(pages int) error { + out, err := vipsgenCopy(r.image) + if err != nil { + return err + } + vipsSetImageNPages(out, pages) + r.setImage(out) + return nil +} + +// PageHeight return the height of a single page +func (r *Image) PageHeight() int { + if r.pageHeight == 0 { + r.pageHeight = vipsGetPageHeight(r.image) + } + return r.pageHeight +} + +// SetPageHeight set the height of a page +// For animated images this is used when "unrolling" back to frames +func (r *Image) SetPageHeight(height int) error { + vipsSetPageHeight(r.image, height) + r.pageHeight = height + return nil +} + +// Background get the background of image. +func (r *Image) Background() ([]float64, error) { + return vipsImageGetArrayDouble(r.image, "background") +} + +// PageDelay gets the page delay array for animation +func (r *Image) PageDelay() ([]int, error) { + return vipsImageGetArrayInt(r.image, "delay") +} + +// GetICCProfile retrieves the ICC profile data (if any) from the image. +func (r *Image) GetICCProfile() ([]byte, bool) { + return vipsGetICCProfile(r.image) +} + +// RemoveICCProfile removes the ICC Profile information from the image. +// Typically, browsers and other software assume images without profile to be in the sRGB color space. +func (r *Image) RemoveICCProfile() error { + out, err := vipsgenCopy(r.image) + if err != nil { + return err + } + vipsRemoveICCProfile(out) + r.setImage(out) + return nil +} + +// RemoveExif removes all metadata from the image (except ICC profile) +func (r *Image) RemoveExif() error { + out, err := vipsgenRemoveExif(r.image) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// Modulate the colors +func (r *Image) Modulate(brightness, saturation, hue float64) error { + var err error + var multiplications []float64 + var additions []float64 + colorspace := r.Interpretation() + if colorspace == InterpretationRgb { + colorspace = InterpretationSrgb + } + multiplications = []float64{brightness, saturation, 1} + additions = []float64{0, 0, hue} + if r.HasAlpha() { + multiplications = append(multiplications, 1) + additions = append(additions, 0) + } + err = r.Colourspace(InterpretationLch, nil) + if err != nil { + return err + } + err = r.Linear(multiplications, additions, nil) + if err != nil { + return err + } + err = r.Colourspace(colorspace, nil) + if err != nil { + return err + } + return nil +} + +// ModulateHSV modulates the image HSV values based on the supplier parameters. +func (r *Image) ModulateHSV(brightness, saturation float64, hue int) error { + var err error + var multiplications []float64 + var additions []float64 + colorspace := r.Interpretation() + if colorspace == InterpretationRgb { + colorspace = InterpretationSrgb + } + if r.HasAlpha() { + multiplications = []float64{1, saturation, brightness, 1} + additions = []float64{float64(hue), 0, 0, 0} + } else { + multiplications = []float64{1, saturation, brightness} + additions = []float64{float64(hue), 0, 0} + } + err = r.Colourspace(InterpretationHsv, nil) + if err != nil { + return err + } + err = r.Linear(multiplications, additions, nil) + if err != nil { + return err + } + err = r.Colourspace(colorspace, nil) + if err != nil { + return err + } + return nil +} + +// EmbedMultiPageOptions are options for EmbedMultiPage method +type EmbedMultiPageOptions struct { + // Extend determines how the image edges are extended + Extend Extend + // Background color components [0-255] + Background []float64 +} + +// DefaultEmbedMultiPageOptions creates default options for EmbedMultiPage +func DefaultEmbedMultiPageOptions() *EmbedMultiPageOptions { + return &EmbedMultiPageOptions{ + Extend: ExtendBlack, + Background: []float64{}, + } +} + +// EmbedMultiPage embeds the image in a larger image with the specified dimensions +// When the image has multiple pages (e.g. animated GIF), this embeds each frame +func (r *Image) EmbedMultiPage(left, top, width, height int, options *EmbedMultiPageOptions) error { + if options == nil { + options = DefaultEmbedMultiPageOptions() + } + + if r.Height() == r.PageHeight() { + out, err := vipsgenEmbedWithOptions(r.image, left, top, width, height, options.Extend, options.Background) + if err != nil { + return err + } + r.setImage(out) + return nil + } + + if options.Extend == ExtendBackground { + bg := []float64{0, 0, 0, 255} + if len(options.Background) > 0 { + for i := 0; i < len(options.Background) && i < 4; i++ { + bg[i] = options.Background[i] + } + } + out, err := vipsgenEmbedMultiPageBackground( + r.image, + left, top, width, height, + int(bg[0]), int(bg[1]), int(bg[2]), int(bg[3]), + ) + if err != nil { + return err + } + r.setImage(out) + return nil + } + out, err := vipsgenEmbedMultiPage(r.image, left, top, width, height, options.Extend) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// ExtractAreaMultiPage extracts a region from the image, working correctly with multi-page (animated) images +func (r *Image) ExtractAreaMultiPage(left, top, width, height int) error { + + if r.Height() == r.PageHeight() { + out, err := vipsgenExtractArea(r.image, left, top, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil + } + + out, err := vipsgenExtractAreaMultiPage(r.image, left, top, width, height) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// RotMultiPage rotates an image by a multiple of 90 degrees, working correctly with multi-page (animated) images +func (r *Image) RotMultiPage(angle Angle) error { + + if r.Height() == r.PageHeight() { + out, err := vipsgenRot(r.image, angle) + if err != nil { + return err + } + r.setImage(out) + return nil + } + + out, err := vipsgenRotMultiPage(r.image, angle) + if err != nil { + return err + } + r.setImage(out) + return nil +} + +// LabelOptions are options for Label method +type LabelOptions struct { + // Font name + Font string + // Text size + Size int + // Text alignment + Align Align + // Text color components [0-255] + Color []float64 + // Text opacity (0-1) + Opacity float64 +} + +// DefaultLabelOptions creates default options for Label +func DefaultLabelOptions() *LabelOptions { + return &LabelOptions{ + Font: "sans", + Size: 12, + Align: AlignLow, + Color: []float64{0, 0, 0}, + Opacity: 1.0, + } +} + +// Label adds text to the image +func (r *Image) Label(text string, x, y int, options *LabelOptions) error { + if options == nil { + options = DefaultLabelOptions() + } + color := []float64{0, 0, 0} + if options.Color != nil { + for i := 0; i < len(options.Color) && i < 3; i++ { + color[i] = options.Color[i] + } + } + out, err := vipsgenLabel(r.image, text, options.Font, + x, y, options.Size, options.Align, + int(color[0]), int(color[1]), int(color[2]), + options.Opacity, + ) + if err != nil { + return err + } + r.setImage(out) + return nil +} diff --git a/vendor/github.com/cshum/vipsgen/vips/types.go b/vendor/github.com/cshum/vipsgen/vips/types.go new file mode 100644 index 0000000000..53dc152848 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/types.go @@ -0,0 +1,818 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +package vips + +// #include +import "C" +import ( + "strings" + "unsafe" +) + +// ImageType represents an image type +type ImageType string + +// ImageType enum +const ( + ImageTypeUnknown ImageType = "unknown" + ImageTypeJpeg ImageType = "jpeg" + ImageTypeGif ImageType = "gif" + ImageTypePng ImageType = "png" + ImageTypeWebp ImageType = "webp" + ImageTypeHeif ImageType = "heif" + ImageTypeSvg ImageType = "svg" + ImageTypeTiff ImageType = "tiff" + ImageTypeJp2k ImageType = "jp2k" + ImageTypeAvif ImageType = "avif" + ImageTypePdf ImageType = "pdf" + ImageTypeBmp ImageType = "bmp" + ImageTypeMagick ImageType = "magick" + ImageTypeAnalyze ImageType = "analyze" + ImageTypeCsv ImageType = "csv" + ImageTypeDz ImageType = "dz" + ImageTypeFits ImageType = "fits" + ImageTypeJxl ImageType = "jxl" + ImageTypeMat ImageType = "mat" + ImageTypeMatrix ImageType = "matrix" + ImageTypeOpenexr ImageType = "openexr" + ImageTypeOpenslide ImageType = "openslide" + ImageTypePpm ImageType = "ppm" + ImageTypeRad ImageType = "rad" + ImageTypeRaw ImageType = "raw" + ImageTypeVips ImageType = "vips" +) + + +// Access represents VipsAccess type +type Access int + +// Access enum +const ( + AccessRandom Access = C.VIPS_ACCESS_RANDOM + AccessSequential Access = C.VIPS_ACCESS_SEQUENTIAL + AccessSequentialUnbuffered Access = C.VIPS_ACCESS_SEQUENTIAL_UNBUFFERED + AccessLast Access = C.VIPS_ACCESS_LAST +) + +// Align represents VipsAlign type +type Align int + +// Align enum +const ( + AlignLow Align = C.VIPS_ALIGN_LOW + AlignCentre Align = C.VIPS_ALIGN_CENTRE + AlignHigh Align = C.VIPS_ALIGN_HIGH + AlignLast Align = C.VIPS_ALIGN_LAST +) + +// Angle represents VipsAngle type +type Angle int + +// Angle enum +const ( + AngleD0 Angle = C.VIPS_ANGLE_D0 + AngleD90 Angle = C.VIPS_ANGLE_D90 + AngleD180 Angle = C.VIPS_ANGLE_D180 + AngleD270 Angle = C.VIPS_ANGLE_D270 + AngleLast Angle = C.VIPS_ANGLE_LAST +) + +// Angle45 represents VipsAngle45 type +type Angle45 int + +// Angle45 enum +const ( + Angle45D0 Angle45 = C.VIPS_ANGLE45_D0 + Angle45D45 Angle45 = C.VIPS_ANGLE45_D45 + Angle45D90 Angle45 = C.VIPS_ANGLE45_D90 + Angle45D135 Angle45 = C.VIPS_ANGLE45_D135 + Angle45D180 Angle45 = C.VIPS_ANGLE45_D180 + Angle45D225 Angle45 = C.VIPS_ANGLE45_D225 + Angle45D270 Angle45 = C.VIPS_ANGLE45_D270 + Angle45D315 Angle45 = C.VIPS_ANGLE45_D315 + Angle45Last Angle45 = C.VIPS_ANGLE45_LAST +) + +// BandFormat represents VipsBandFormat type +type BandFormat int + +// BandFormat enum +const ( + BandFormatNotset BandFormat = C.VIPS_FORMAT_NOTSET + BandFormatUchar BandFormat = C.VIPS_FORMAT_UCHAR + BandFormatChar BandFormat = C.VIPS_FORMAT_CHAR + BandFormatUshort BandFormat = C.VIPS_FORMAT_USHORT + BandFormatShort BandFormat = C.VIPS_FORMAT_SHORT + BandFormatUint BandFormat = C.VIPS_FORMAT_UINT + BandFormatInt BandFormat = C.VIPS_FORMAT_INT + BandFormatFloat BandFormat = C.VIPS_FORMAT_FLOAT + BandFormatComplex BandFormat = C.VIPS_FORMAT_COMPLEX + BandFormatDouble BandFormat = C.VIPS_FORMAT_DOUBLE + BandFormatDpcomplex BandFormat = C.VIPS_FORMAT_DPCOMPLEX + BandFormatLast BandFormat = C.VIPS_FORMAT_LAST +) + +// BlendMode represents VipsBlendMode type +type BlendMode int + +// BlendMode enum +const ( + BlendModeClear BlendMode = C.VIPS_BLEND_MODE_CLEAR + BlendModeSource BlendMode = C.VIPS_BLEND_MODE_SOURCE + BlendModeOver BlendMode = C.VIPS_BLEND_MODE_OVER + BlendModeIn BlendMode = C.VIPS_BLEND_MODE_IN + BlendModeOut BlendMode = C.VIPS_BLEND_MODE_OUT + BlendModeAtop BlendMode = C.VIPS_BLEND_MODE_ATOP + BlendModeDest BlendMode = C.VIPS_BLEND_MODE_DEST + BlendModeDestOver BlendMode = C.VIPS_BLEND_MODE_DEST_OVER + BlendModeDestIn BlendMode = C.VIPS_BLEND_MODE_DEST_IN + BlendModeDestOut BlendMode = C.VIPS_BLEND_MODE_DEST_OUT + BlendModeDestAtop BlendMode = C.VIPS_BLEND_MODE_DEST_ATOP + BlendModeXor BlendMode = C.VIPS_BLEND_MODE_XOR + BlendModeAdd BlendMode = C.VIPS_BLEND_MODE_ADD + BlendModeSaturate BlendMode = C.VIPS_BLEND_MODE_SATURATE + BlendModeMultiply BlendMode = C.VIPS_BLEND_MODE_MULTIPLY + BlendModeScreen BlendMode = C.VIPS_BLEND_MODE_SCREEN + BlendModeOverlay BlendMode = C.VIPS_BLEND_MODE_OVERLAY + BlendModeDarken BlendMode = C.VIPS_BLEND_MODE_DARKEN + BlendModeLighten BlendMode = C.VIPS_BLEND_MODE_LIGHTEN + BlendModeColourDodge BlendMode = C.VIPS_BLEND_MODE_COLOUR_DODGE + BlendModeColourBurn BlendMode = C.VIPS_BLEND_MODE_COLOUR_BURN + BlendModeHardLight BlendMode = C.VIPS_BLEND_MODE_HARD_LIGHT + BlendModeSoftLight BlendMode = C.VIPS_BLEND_MODE_SOFT_LIGHT + BlendModeDifference BlendMode = C.VIPS_BLEND_MODE_DIFFERENCE + BlendModeExclusion BlendMode = C.VIPS_BLEND_MODE_EXCLUSION + BlendModeLast BlendMode = C.VIPS_BLEND_MODE_LAST +) + +// Coding represents VipsCoding type +type Coding int + +// Coding enum +const ( + CodingError Coding = C.VIPS_CODING_ERROR + CodingNone Coding = C.VIPS_CODING_NONE + CodingLabq Coding = C.VIPS_CODING_LABQ + CodingRad Coding = C.VIPS_CODING_RAD + CodingLast Coding = C.VIPS_CODING_LAST +) + +// Combine represents VipsCombine type +type Combine int + +// Combine enum +const ( + CombineMax Combine = C.VIPS_COMBINE_MAX + CombineSum Combine = C.VIPS_COMBINE_SUM + CombineMin Combine = C.VIPS_COMBINE_MIN + CombineLast Combine = C.VIPS_COMBINE_LAST +) + +// CombineMode represents VipsCombineMode type +type CombineMode int + +// CombineMode enum +const ( + CombineModeSet CombineMode = C.VIPS_COMBINE_MODE_SET + CombineModeAdd CombineMode = C.VIPS_COMBINE_MODE_ADD + CombineModeLast CombineMode = C.VIPS_COMBINE_MODE_LAST +) + +// CompassDirection represents VipsCompassDirection type +type CompassDirection int + +// CompassDirection enum +const ( + CompassDirectionCentre CompassDirection = C.VIPS_COMPASS_DIRECTION_CENTRE + CompassDirectionNorth CompassDirection = C.VIPS_COMPASS_DIRECTION_NORTH + CompassDirectionEast CompassDirection = C.VIPS_COMPASS_DIRECTION_EAST + CompassDirectionSouth CompassDirection = C.VIPS_COMPASS_DIRECTION_SOUTH + CompassDirectionWest CompassDirection = C.VIPS_COMPASS_DIRECTION_WEST + CompassDirectionNorthEast CompassDirection = C.VIPS_COMPASS_DIRECTION_NORTH_EAST + CompassDirectionSouthEast CompassDirection = C.VIPS_COMPASS_DIRECTION_SOUTH_EAST + CompassDirectionSouthWest CompassDirection = C.VIPS_COMPASS_DIRECTION_SOUTH_WEST + CompassDirectionNorthWest CompassDirection = C.VIPS_COMPASS_DIRECTION_NORTH_WEST + CompassDirectionLast CompassDirection = C.VIPS_COMPASS_DIRECTION_LAST +) + +// Direction represents VipsDirection type +type Direction int + +// Direction enum +const ( + DirectionHorizontal Direction = C.VIPS_DIRECTION_HORIZONTAL + DirectionVertical Direction = C.VIPS_DIRECTION_VERTICAL + DirectionLast Direction = C.VIPS_DIRECTION_LAST +) + +// Extend represents VipsExtend type +type Extend int + +// Extend enum +const ( + ExtendBlack Extend = C.VIPS_EXTEND_BLACK + ExtendCopy Extend = C.VIPS_EXTEND_COPY + ExtendRepeat Extend = C.VIPS_EXTEND_REPEAT + ExtendMirror Extend = C.VIPS_EXTEND_MIRROR + ExtendWhite Extend = C.VIPS_EXTEND_WHITE + ExtendBackground Extend = C.VIPS_EXTEND_BACKGROUND + ExtendLast Extend = C.VIPS_EXTEND_LAST +) + +// FailOn represents VipsFailOn type +type FailOn int + +// FailOn enum +const ( + FailOnNone FailOn = C.VIPS_FAIL_ON_NONE + FailOnTruncated FailOn = C.VIPS_FAIL_ON_TRUNCATED + FailOnError FailOn = C.VIPS_FAIL_ON_ERROR + FailOnWarning FailOn = C.VIPS_FAIL_ON_WARNING + FailOnLast FailOn = C.VIPS_FAIL_ON_LAST +) + +// DzContainer represents VipsForeignDzContainer type +type DzContainer int + +// DzContainer enum +const ( + DzContainerFs DzContainer = C.VIPS_FOREIGN_DZ_CONTAINER_FS + DzContainerZip DzContainer = C.VIPS_FOREIGN_DZ_CONTAINER_ZIP + DzContainerSzi DzContainer = C.VIPS_FOREIGN_DZ_CONTAINER_SZI + DzContainerLast DzContainer = C.VIPS_FOREIGN_DZ_CONTAINER_LAST +) + +// DzDepth represents VipsForeignDzDepth type +type DzDepth int + +// DzDepth enum +const ( + DzDepthOnepixel DzDepth = C.VIPS_FOREIGN_DZ_DEPTH_ONEPIXEL + DzDepthOnetile DzDepth = C.VIPS_FOREIGN_DZ_DEPTH_ONETILE + DzDepthOne DzDepth = C.VIPS_FOREIGN_DZ_DEPTH_ONE + DzDepthLast DzDepth = C.VIPS_FOREIGN_DZ_DEPTH_LAST +) + +// DzLayout represents VipsForeignDzLayout type +type DzLayout int + +// DzLayout enum +const ( + DzLayoutDz DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_DZ + DzLayoutZoomify DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_ZOOMIFY + DzLayoutGoogle DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_GOOGLE + DzLayoutIiif DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_IIIF + DzLayoutIiif3 DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_IIIF3 + DzLayoutLast DzLayout = C.VIPS_FOREIGN_DZ_LAYOUT_LAST +) + +// Flags represents VipsForeignFlags type +type Flags int + +// Flags enum +const ( + FlagsNone Flags = C.VIPS_FOREIGN_NONE + FlagsPartial Flags = C.VIPS_FOREIGN_PARTIAL + FlagsBigendian Flags = C.VIPS_FOREIGN_BIGENDIAN + FlagsSequential Flags = C.VIPS_FOREIGN_SEQUENTIAL + FlagsAll Flags = C.VIPS_FOREIGN_ALL +) + +// HeifCompression represents VipsForeignHeifCompression type +type HeifCompression int + +// HeifCompression enum +const ( + HeifCompressionHevc HeifCompression = C.VIPS_FOREIGN_HEIF_COMPRESSION_HEVC + HeifCompressionAvc HeifCompression = C.VIPS_FOREIGN_HEIF_COMPRESSION_AVC + HeifCompressionJpeg HeifCompression = C.VIPS_FOREIGN_HEIF_COMPRESSION_JPEG + HeifCompressionAv1 HeifCompression = C.VIPS_FOREIGN_HEIF_COMPRESSION_AV1 + HeifCompressionLast HeifCompression = C.VIPS_FOREIGN_HEIF_COMPRESSION_LAST +) + +// HeifEncoder represents VipsForeignHeifEncoder type +type HeifEncoder int + +// HeifEncoder enum +const ( + HeifEncoderAuto HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_AUTO + HeifEncoderAom HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_AOM + HeifEncoderRav1e HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_RAV1E + HeifEncoderSvt HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_SVT + HeifEncoderX265 HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_X265 + HeifEncoderLast HeifEncoder = C.VIPS_FOREIGN_HEIF_ENCODER_LAST +) + +// Keep represents VipsForeignKeep type +type Keep int + +// Keep enum +const ( + KeepNone Keep = C.VIPS_FOREIGN_KEEP_NONE + KeepExif Keep = C.VIPS_FOREIGN_KEEP_EXIF + KeepXmp Keep = C.VIPS_FOREIGN_KEEP_XMP + KeepIptc Keep = C.VIPS_FOREIGN_KEEP_IPTC + KeepIcc Keep = C.VIPS_FOREIGN_KEEP_ICC + KeepOther Keep = C.VIPS_FOREIGN_KEEP_OTHER + KeepAll Keep = C.VIPS_FOREIGN_KEEP_ALL +) + +// PngFilter represents VipsForeignPngFilter type +type PngFilter int + +// PngFilter enum +const ( + PngFilterNone PngFilter = C.VIPS_FOREIGN_PNG_FILTER_NONE + PngFilterSub PngFilter = C.VIPS_FOREIGN_PNG_FILTER_SUB + PngFilterUp PngFilter = C.VIPS_FOREIGN_PNG_FILTER_UP + PngFilterAvg PngFilter = C.VIPS_FOREIGN_PNG_FILTER_AVG + PngFilterPaeth PngFilter = C.VIPS_FOREIGN_PNG_FILTER_PAETH + PngFilterAll PngFilter = C.VIPS_FOREIGN_PNG_FILTER_ALL +) + +// PpmFormat represents VipsForeignPpmFormat type +type PpmFormat int + +// PpmFormat enum +const ( + PpmFormatPbm PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_PBM + PpmFormatPgm PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_PGM + PpmFormatPpm PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_PPM + PpmFormatPfm PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_PFM + PpmFormatPnm PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_PNM + PpmFormatLast PpmFormat = C.VIPS_FOREIGN_PPM_FORMAT_LAST +) + +// Subsample represents VipsForeignSubsample type +type Subsample int + +// Subsample enum +const ( + SubsampleAuto Subsample = C.VIPS_FOREIGN_SUBSAMPLE_AUTO + SubsampleOn Subsample = C.VIPS_FOREIGN_SUBSAMPLE_ON + SubsampleOff Subsample = C.VIPS_FOREIGN_SUBSAMPLE_OFF + SubsampleLast Subsample = C.VIPS_FOREIGN_SUBSAMPLE_LAST +) + +// TiffCompression represents VipsForeignTiffCompression type +type TiffCompression int + +// TiffCompression enum +const ( + TiffCompressionNone TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_NONE + TiffCompressionJpeg TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_JPEG + TiffCompressionDeflate TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_DEFLATE + TiffCompressionPackbits TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_PACKBITS + TiffCompressionCcittfax4 TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_CCITTFAX4 + TiffCompressionLzw TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_LZW + TiffCompressionWebp TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_WEBP + TiffCompressionZstd TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_ZSTD + TiffCompressionJp2k TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_JP2K + TiffCompressionLast TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_LAST +) + +// TiffPredictor represents VipsForeignTiffPredictor type +type TiffPredictor int + +// TiffPredictor enum +const ( + TiffPredictorNone TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_NONE + TiffPredictorHorizontal TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_HORIZONTAL + TiffPredictorFloat TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_FLOAT + TiffPredictorLast TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_LAST +) + +// TiffResunit represents VipsForeignTiffResunit type +type TiffResunit int + +// TiffResunit enum +const ( + TiffResunitCm TiffResunit = C.VIPS_FOREIGN_TIFF_RESUNIT_CM + TiffResunitInch TiffResunit = C.VIPS_FOREIGN_TIFF_RESUNIT_INCH + TiffResunitLast TiffResunit = C.VIPS_FOREIGN_TIFF_RESUNIT_LAST +) + +// WebpPreset represents VipsForeignWebpPreset type +type WebpPreset int + +// WebpPreset enum +const ( + WebpPresetDefault WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_DEFAULT + WebpPresetPicture WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_PICTURE + WebpPresetPhoto WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_PHOTO + WebpPresetDrawing WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_DRAWING + WebpPresetIcon WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_ICON + WebpPresetText WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_TEXT + WebpPresetLast WebpPreset = C.VIPS_FOREIGN_WEBP_PRESET_LAST +) + +// Intent represents VipsIntent type +type Intent int + +// Intent enum +const ( + IntentPerceptual Intent = C.VIPS_INTENT_PERCEPTUAL + IntentRelative Intent = C.VIPS_INTENT_RELATIVE + IntentSaturation Intent = C.VIPS_INTENT_SATURATION + IntentAbsolute Intent = C.VIPS_INTENT_ABSOLUTE + IntentAuto Intent = C.VIPS_INTENT_AUTO + IntentLast Intent = C.VIPS_INTENT_LAST +) + +// Interesting represents VipsInteresting type +type Interesting int + +// Interesting enum +const ( + InterestingNone Interesting = C.VIPS_INTERESTING_NONE + InterestingCentre Interesting = C.VIPS_INTERESTING_CENTRE + InterestingEntropy Interesting = C.VIPS_INTERESTING_ENTROPY + InterestingAttention Interesting = C.VIPS_INTERESTING_ATTENTION + InterestingLow Interesting = C.VIPS_INTERESTING_LOW + InterestingHigh Interesting = C.VIPS_INTERESTING_HIGH + InterestingAll Interesting = C.VIPS_INTERESTING_ALL + InterestingLast Interesting = C.VIPS_INTERESTING_LAST +) + +// Interpretation represents VipsInterpretation type +type Interpretation int + +// Interpretation enum +const ( + InterpretationError Interpretation = C.VIPS_INTERPRETATION_ERROR + InterpretationMultiband Interpretation = C.VIPS_INTERPRETATION_MULTIBAND + InterpretationBW Interpretation = C.VIPS_INTERPRETATION_B_W + InterpretationHistogram Interpretation = C.VIPS_INTERPRETATION_HISTOGRAM + InterpretationXyz Interpretation = C.VIPS_INTERPRETATION_XYZ + InterpretationLab Interpretation = C.VIPS_INTERPRETATION_LAB + InterpretationCmyk Interpretation = C.VIPS_INTERPRETATION_CMYK + InterpretationLabq Interpretation = C.VIPS_INTERPRETATION_LABQ + InterpretationRgb Interpretation = C.VIPS_INTERPRETATION_RGB + InterpretationCmc Interpretation = C.VIPS_INTERPRETATION_CMC + InterpretationLch Interpretation = C.VIPS_INTERPRETATION_LCH + InterpretationLabs Interpretation = C.VIPS_INTERPRETATION_LABS + InterpretationSrgb Interpretation = C.VIPS_INTERPRETATION_sRGB + InterpretationYxy Interpretation = C.VIPS_INTERPRETATION_YXY + InterpretationFourier Interpretation = C.VIPS_INTERPRETATION_FOURIER + InterpretationRgb16 Interpretation = C.VIPS_INTERPRETATION_RGB16 + InterpretationGrey16 Interpretation = C.VIPS_INTERPRETATION_GREY16 + InterpretationMatrix Interpretation = C.VIPS_INTERPRETATION_MATRIX + InterpretationScrgb Interpretation = C.VIPS_INTERPRETATION_scRGB + InterpretationHsv Interpretation = C.VIPS_INTERPRETATION_HSV + InterpretationLast Interpretation = C.VIPS_INTERPRETATION_LAST +) + +// Kernel represents VipsKernel type +type Kernel int + +// Kernel enum +const ( + KernelNearest Kernel = C.VIPS_KERNEL_NEAREST + KernelLinear Kernel = C.VIPS_KERNEL_LINEAR + KernelCubic Kernel = C.VIPS_KERNEL_CUBIC + KernelMitchell Kernel = C.VIPS_KERNEL_MITCHELL + KernelLanczos2 Kernel = C.VIPS_KERNEL_LANCZOS2 + KernelLanczos3 Kernel = C.VIPS_KERNEL_LANCZOS3 + KernelMks2013 Kernel = C.VIPS_KERNEL_MKS2013 + KernelMks2021 Kernel = C.VIPS_KERNEL_MKS2021 + KernelLast Kernel = C.VIPS_KERNEL_LAST +) + +// OperationBoolean represents VipsOperationBoolean type +type OperationBoolean int + +// OperationBoolean enum +const ( + OperationBooleanAnd OperationBoolean = C.VIPS_OPERATION_BOOLEAN_AND + OperationBooleanOr OperationBoolean = C.VIPS_OPERATION_BOOLEAN_OR + OperationBooleanEor OperationBoolean = C.VIPS_OPERATION_BOOLEAN_EOR + OperationBooleanLshift OperationBoolean = C.VIPS_OPERATION_BOOLEAN_LSHIFT + OperationBooleanRshift OperationBoolean = C.VIPS_OPERATION_BOOLEAN_RSHIFT + OperationBooleanLast OperationBoolean = C.VIPS_OPERATION_BOOLEAN_LAST +) + +// OperationComplex represents VipsOperationComplex type +type OperationComplex int + +// OperationComplex enum +const ( + OperationComplexPolar OperationComplex = C.VIPS_OPERATION_COMPLEX_POLAR + OperationComplexRect OperationComplex = C.VIPS_OPERATION_COMPLEX_RECT + OperationComplexConj OperationComplex = C.VIPS_OPERATION_COMPLEX_CONJ + OperationComplexLast OperationComplex = C.VIPS_OPERATION_COMPLEX_LAST +) + +// OperationComplex2 represents VipsOperationComplex2 type +type OperationComplex2 int + +// OperationComplex2 enum +const ( + OperationComplex2CrossPhase OperationComplex2 = C.VIPS_OPERATION_COMPLEX2_CROSS_PHASE + OperationComplex2Last OperationComplex2 = C.VIPS_OPERATION_COMPLEX2_LAST +) + +// OperationComplexget represents VipsOperationComplexget type +type OperationComplexget int + +// OperationComplexget enum +const ( + OperationComplexgetReal OperationComplexget = C.VIPS_OPERATION_COMPLEXGET_REAL + OperationComplexgetImag OperationComplexget = C.VIPS_OPERATION_COMPLEXGET_IMAG + OperationComplexgetLast OperationComplexget = C.VIPS_OPERATION_COMPLEXGET_LAST +) + +// OperationMath represents VipsOperationMath type +type OperationMath int + +// OperationMath enum +const ( + OperationMathSin OperationMath = C.VIPS_OPERATION_MATH_SIN + OperationMathCos OperationMath = C.VIPS_OPERATION_MATH_COS + OperationMathTan OperationMath = C.VIPS_OPERATION_MATH_TAN + OperationMathAsin OperationMath = C.VIPS_OPERATION_MATH_ASIN + OperationMathAcos OperationMath = C.VIPS_OPERATION_MATH_ACOS + OperationMathAtan OperationMath = C.VIPS_OPERATION_MATH_ATAN + OperationMathLog OperationMath = C.VIPS_OPERATION_MATH_LOG + OperationMathLog10 OperationMath = C.VIPS_OPERATION_MATH_LOG10 + OperationMathExp OperationMath = C.VIPS_OPERATION_MATH_EXP + OperationMathExp10 OperationMath = C.VIPS_OPERATION_MATH_EXP10 + OperationMathSinh OperationMath = C.VIPS_OPERATION_MATH_SINH + OperationMathCosh OperationMath = C.VIPS_OPERATION_MATH_COSH + OperationMathTanh OperationMath = C.VIPS_OPERATION_MATH_TANH + OperationMathAsinh OperationMath = C.VIPS_OPERATION_MATH_ASINH + OperationMathAcosh OperationMath = C.VIPS_OPERATION_MATH_ACOSH + OperationMathAtanh OperationMath = C.VIPS_OPERATION_MATH_ATANH + OperationMathLast OperationMath = C.VIPS_OPERATION_MATH_LAST +) + +// OperationMath2 represents VipsOperationMath2 type +type OperationMath2 int + +// OperationMath2 enum +const ( + OperationMath2Pow OperationMath2 = C.VIPS_OPERATION_MATH2_POW + OperationMath2Wop OperationMath2 = C.VIPS_OPERATION_MATH2_WOP + OperationMath2Atan2 OperationMath2 = C.VIPS_OPERATION_MATH2_ATAN2 + OperationMath2Last OperationMath2 = C.VIPS_OPERATION_MATH2_LAST +) + +// OperationMorphology represents VipsOperationMorphology type +type OperationMorphology int + +// OperationMorphology enum +const ( + OperationMorphologyErode OperationMorphology = C.VIPS_OPERATION_MORPHOLOGY_ERODE + OperationMorphologyDilate OperationMorphology = C.VIPS_OPERATION_MORPHOLOGY_DILATE + OperationMorphologyLast OperationMorphology = C.VIPS_OPERATION_MORPHOLOGY_LAST +) + +// OperationRelational represents VipsOperationRelational type +type OperationRelational int + +// OperationRelational enum +const ( + OperationRelationalEqual OperationRelational = C.VIPS_OPERATION_RELATIONAL_EQUAL + OperationRelationalNoteq OperationRelational = C.VIPS_OPERATION_RELATIONAL_NOTEQ + OperationRelationalLess OperationRelational = C.VIPS_OPERATION_RELATIONAL_LESS + OperationRelationalLesseq OperationRelational = C.VIPS_OPERATION_RELATIONAL_LESSEQ + OperationRelationalMore OperationRelational = C.VIPS_OPERATION_RELATIONAL_MORE + OperationRelationalMoreeq OperationRelational = C.VIPS_OPERATION_RELATIONAL_MOREEQ + OperationRelationalLast OperationRelational = C.VIPS_OPERATION_RELATIONAL_LAST +) + +// OperationRound represents VipsOperationRound type +type OperationRound int + +// OperationRound enum +const ( + OperationRoundRint OperationRound = C.VIPS_OPERATION_ROUND_RINT + OperationRoundCeil OperationRound = C.VIPS_OPERATION_ROUND_CEIL + OperationRoundFloor OperationRound = C.VIPS_OPERATION_ROUND_FLOOR + OperationRoundLast OperationRound = C.VIPS_OPERATION_ROUND_LAST +) + +// PCS represents VipsPCS type +type PCS int + +// PCS enum +const ( + PcsLab PCS = C.VIPS_PCS_LAB + PcsXyz PCS = C.VIPS_PCS_XYZ + PcsLast PCS = C.VIPS_PCS_LAST +) + +// Precision represents VipsPrecision type +type Precision int + +// Precision enum +const ( + PrecisionInteger Precision = C.VIPS_PRECISION_INTEGER + PrecisionFloat Precision = C.VIPS_PRECISION_FLOAT + PrecisionApproximate Precision = C.VIPS_PRECISION_APPROXIMATE + PrecisionLast Precision = C.VIPS_PRECISION_LAST +) + +// RegionShrink represents VipsRegionShrink type +type RegionShrink int + +// RegionShrink enum +const ( + RegionShrinkMean RegionShrink = C.VIPS_REGION_SHRINK_MEAN + RegionShrinkMedian RegionShrink = C.VIPS_REGION_SHRINK_MEDIAN + RegionShrinkMode RegionShrink = C.VIPS_REGION_SHRINK_MODE + RegionShrinkMax RegionShrink = C.VIPS_REGION_SHRINK_MAX + RegionShrinkMin RegionShrink = C.VIPS_REGION_SHRINK_MIN + RegionShrinkNearest RegionShrink = C.VIPS_REGION_SHRINK_NEAREST + RegionShrinkLast RegionShrink = C.VIPS_REGION_SHRINK_LAST +) + +// SdfShape represents VipsSdfShape type +type SdfShape int + +// SdfShape enum +const ( + SdfShapeCircle SdfShape = C.VIPS_SDF_SHAPE_CIRCLE + SdfShapeBox SdfShape = C.VIPS_SDF_SHAPE_BOX + SdfShapeRoundedBox SdfShape = C.VIPS_SDF_SHAPE_ROUNDED_BOX + SdfShapeLine SdfShape = C.VIPS_SDF_SHAPE_LINE + SdfShapeLast SdfShape = C.VIPS_SDF_SHAPE_LAST +) + +// Size represents VipsSize type +type Size int + +// Size enum +const ( + SizeBoth Size = C.VIPS_SIZE_BOTH + SizeUp Size = C.VIPS_SIZE_UP + SizeDown Size = C.VIPS_SIZE_DOWN + SizeForce Size = C.VIPS_SIZE_FORCE + SizeLast Size = C.VIPS_SIZE_LAST +) + +// TextWrap represents VipsTextWrap type +type TextWrap int + +// TextWrap enum +const ( + TextWrapWord TextWrap = C.VIPS_TEXT_WRAP_WORD + TextWrapChar TextWrap = C.VIPS_TEXT_WRAP_CHAR + TextWrapWordChar TextWrap = C.VIPS_TEXT_WRAP_WORD_CHAR + TextWrapNone TextWrap = C.VIPS_TEXT_WRAP_NONE + TextWrapLast TextWrap = C.VIPS_TEXT_WRAP_LAST +) + + +// imageMimeTypes map the various image types to its mime type representation +var imageMimeTypes = map[ImageType]string{ + ImageTypeJpeg: "image/jpeg", + ImageTypeGif: "image/gif", + ImageTypePng: "image/png", + ImageTypeWebp: "image/webp", + ImageTypeHeif: "image/heif", + ImageTypeSvg: "image/svg+xml", + ImageTypeTiff: "image/tiff", + ImageTypeJp2k: "image/jp2", + ImageTypeAvif: "image/avif", + ImageTypePdf: "application/pdf", + ImageTypeBmp: "image/bmp", + ImageTypeAnalyze: "application/x-analyze", + ImageTypeCsv: "text/csv", + ImageTypeDz: "image/x-deepzoom", + ImageTypeFits: "image/fits", + ImageTypeJxl: "image/jxl", + ImageTypeMat: "application/x-matlab-data", + ImageTypeMatrix: "application/x-matrix", + ImageTypeOpenexr: "image/openexr", + ImageTypeOpenslide: "application/x-openslide", + ImageTypePpm: "image/x-portable-pixmap", + ImageTypeRad: "image/rad", + ImageTypeRaw: "image/raw", + ImageTypeVips: "image/vnd.libvips", +} + +// MimeType returns the MIME type for the image type. +func (imageType ImageType) MimeType() (mime string, ok bool) { + mime, ok = imageMimeTypes[imageType] + return +} + +// vipsDetermineImageType determine the image type from loader metadata +func vipsDetermineImageType(in *C.VipsImage) ImageType { + if in != nil { + if vipsLoader, ok := vipsImageGetMetaLoader(in); ok { + if strings.HasPrefix(vipsLoader, "jpeg") { + return ImageTypeJpeg + } + if strings.HasPrefix(vipsLoader, "gif") { + return ImageTypeGif + } + if strings.HasPrefix(vipsLoader, "png") { + return ImageTypePng + } + if strings.HasPrefix(vipsLoader, "webp") { + return ImageTypeWebp + } + if strings.HasPrefix(vipsLoader, "heif") { + return ImageTypeHeif + } + if strings.HasPrefix(vipsLoader, "svg") { + return ImageTypeSvg + } + if strings.HasPrefix(vipsLoader, "tiff") { + return ImageTypeTiff + } + if strings.HasPrefix(vipsLoader, "jp2k") { + return ImageTypeJp2k + } + if strings.HasPrefix(vipsLoader, "pdf") { + return ImageTypePdf + } + if strings.HasPrefix(vipsLoader, "analyze") { + return ImageTypeAnalyze + } + if strings.HasPrefix(vipsLoader, "csv") { + return ImageTypeCsv + } + if strings.HasPrefix(vipsLoader, "fits") { + return ImageTypeFits + } + if strings.HasPrefix(vipsLoader, "jxl") { + return ImageTypeJxl + } + if strings.HasPrefix(vipsLoader, "mat") { + return ImageTypeMat + } + if strings.HasPrefix(vipsLoader, "matrix") { + return ImageTypeMatrix + } + if strings.HasPrefix(vipsLoader, "openexr") { + return ImageTypeOpenexr + } + if strings.HasPrefix(vipsLoader, "openslide") { + return ImageTypeOpenslide + } + if strings.HasPrefix(vipsLoader, "ppm") { + return ImageTypePpm + } + if strings.HasPrefix(vipsLoader, "rad") { + return ImageTypeRad + } + if strings.HasPrefix(vipsLoader, "raw") { + return ImageTypeRaw + } + if strings.HasPrefix(vipsLoader, "vips") { + return ImageTypeVips + } + if strings.HasPrefix(vipsLoader, "magick") { + return ImageTypeMagick + } + + } + } + return ImageTypeUnknown +} + +// Interpolate represents VipsInterpolate type +type Interpolate struct { + interp *C.VipsInterpolate +} + +// InterpolateType represents the type of interpolation to use +type InterpolateType string + +// InterpolateType enum - these values match the predefined interpolators in libvips +const ( + InterpolateNearest InterpolateType = "nearest" + InterpolateBilinear InterpolateType = "bilinear" + InterpolateBicubic InterpolateType = "bicubic" + InterpolateLbb InterpolateType = "lbb" // Lanczos3 + InterpolateNohalo InterpolateType = "nohalo" + InterpolateVsqbs InterpolateType = "vsqbs" +) + +// NewInterpolate creates a new Interpolate with the given name +// Valid names include: "nearest", "bilinear", "bicubic", "lbb", "nohalo", "vsqbs" +func NewInterpolate(name InterpolateType) *Interpolate { + Startup(nil) + cName := C.CString(string(name)) + defer C.free(unsafe.Pointer(cName)) + + interp := C.vips_interpolate_new(cName) + if interp == nil { + // Default to bilinear if requested interpolator not found + C.vips_error_clear() + cDefault := C.CString("bilinear") + defer C.free(unsafe.Pointer(cDefault)) + interp = C.vips_interpolate_new(cDefault) + } + return &Interpolate{interp: interp} +} + +// Close frees the interpolator resources +func (i *Interpolate) Close() { + if i != nil && i.interp != nil { + C.g_object_unref(C.gpointer(i.interp)) + i.interp = nil + } +} diff --git a/vendor/github.com/cshum/vipsgen/vips/util.c b/vendor/github.com/cshum/vipsgen/vips/util.c new file mode 100644 index 0000000000..d6140df2c4 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/util.c @@ -0,0 +1,25 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +#include "util.h" + +static void logging_handler(const gchar *log_domain, + GLogLevelFlags log_level, + const gchar *message, gpointer user_data) { + goLoggingHandler((char *)log_domain, (int)log_level, (char *)message); +} + +static void null_logging_handler(const gchar *log_domain, + GLogLevelFlags log_level, const gchar *message, + gpointer user_data) {} + +void set_logging_handler(void) { + g_log_set_default_handler(logging_handler, NULL); +} + +void unset_logging_handler(void) { + g_log_set_default_handler(null_logging_handler, NULL); +} + +int is_gobject(void* obj) { + return G_IS_OBJECT(obj) ? 1 : 0; +} diff --git a/vendor/github.com/cshum/vipsgen/vips/util.go b/vendor/github.com/cshum/vipsgen/vips/util.go new file mode 100644 index 0000000000..3acfa2dfb6 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/util.go @@ -0,0 +1,466 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +package vips + +// #cgo pkg-config: vips +// #include "util.h" +import "C" +import ( + "fmt" + "runtime" + "sync" + "unsafe" +) + +// Version is the full libvips version string (x.y.z) +const Version = string(C.VIPS_VERSION) + +// MajorVersion is the libvips major component of the version string (x in x.y.z) +const MajorVersion = int(C.VIPS_MAJOR_VERSION) + +// MinorVersion is the libvips minor component of the version string (y in x.y.z) +const MinorVersion = int(C.VIPS_MINOR_VERSION) + +// MicroVersion is the libvips micro component of the version string (z in x.y.z) +// Also known as patch version +const MicroVersion = int(C.VIPS_MICRO_VERSION) + +var ( + lock sync.Mutex + once sync.Once + isStarted bool + isShutdown bool +) + +type Config struct { + ConcurrencyLevel int + MaxCacheFiles int + MaxCacheMem int + MaxCacheSize int + ReportLeaks bool + CacheTrace bool + VectorEnabled bool +} + +// LogLevel log level +type LogLevel int + +// LogLevel enum +const ( + LogLevelError LogLevel = C.G_LOG_LEVEL_ERROR + LogLevelCritical LogLevel = C.G_LOG_LEVEL_CRITICAL + LogLevelWarning LogLevel = C.G_LOG_LEVEL_WARNING + LogLevelMessage LogLevel = C.G_LOG_LEVEL_MESSAGE + LogLevelInfo LogLevel = C.G_LOG_LEVEL_INFO + LogLevelDebug LogLevel = C.G_LOG_LEVEL_DEBUG +) + +var ( + currentLoggingHandlerFunction = noopLoggingHandler + currentLoggingVerbosity LogLevel +) + +// LoggingHandlerFunction logging handler function +type LoggingHandlerFunction func(messageDomain string, messageLevel LogLevel, message string) + +// SetLogging set logging handler and verbosity +func SetLogging(handler LoggingHandlerFunction, verbosity LogLevel) { + if handler != nil { + currentLoggingHandlerFunction = handler + } + currentLoggingVerbosity = verbosity +} + +func noopLoggingHandler(_ string, _ LogLevel, _ string) { +} + +func log(domain string, level LogLevel, message string) { + if level <= currentLoggingVerbosity { + currentLoggingHandlerFunction(domain, level, message) + } +} + +func enableLogging() { + C.set_logging_handler() +} + +func disableLogging() { + C.unset_logging_handler() +} + +// Startup sets up libvips and ensures the versions are correct. Pass in nil for default config. +func Startup(config *Config) { + once.Do(func() { + startup(config) + }) +} + +func startup(config *Config) { + lock.Lock() + defer lock.Unlock() + + if isStarted || isShutdown { + return + } + + runtime.LockOSThread() + defer runtime.UnlockOSThread() + + if MajorVersion < 8 || (MajorVersion == 8 && MinorVersion < 10) { + panic("requires libvips version 8.10+") + } + + cName := C.CString("vips") + defer freeCString(cName) + + // Override default glib logging handler to intercept logging messages + enableLogging() + + err := C.vips_init(cName) + if err != 0 { + panic(fmt.Sprintf("Failed to start vips code=%v", err)) + } + + if config != nil { + C.vips_leak_set(toGboolean(config.ReportLeaks)) + } + + if config != nil && config.ConcurrencyLevel >= 0 { + C.vips_concurrency_set(C.int(config.ConcurrencyLevel)) + } else { + C.vips_concurrency_set(1) + } + + if config != nil && config.MaxCacheFiles >= 0 { + C.vips_cache_set_max_files(C.int(config.MaxCacheFiles)) + } else { + C.vips_cache_set_max_files(0) + } + + if config != nil && config.MaxCacheMem >= 0 { + C.vips_cache_set_max_mem(C.size_t(config.MaxCacheMem)) + } else { + C.vips_cache_set_max_mem(0) + } + + if config != nil && config.MaxCacheSize >= 0 { + C.vips_cache_set_max(C.int(config.MaxCacheSize)) + } else { + C.vips_cache_set_max(0) + } + + if config != nil && config.VectorEnabled { + C.vips_vector_set_enabled(1) + } else { + C.vips_vector_set_enabled(0) + } + + if config != nil && config.CacheTrace { + C.vips_cache_set_trace(toGboolean(true)) + } + + log("vipsgen", LogLevelInfo, fmt.Sprintf("vips %s started with concurrency=%d cache_max_files=%d cache_max_mem=%d cache_max=%d", + Version, + int(C.vips_concurrency_get()), + int(C.vips_cache_get_max_files()), + int(C.vips_cache_get_max_mem()), + int(C.vips_cache_get_max()))) + + isStarted = true +} + +// Shutdown libvips +func Shutdown() { + lock.Lock() + defer lock.Unlock() + + if !isStarted || isShutdown { + return + } + + runtime.LockOSThread() + defer runtime.UnlockOSThread() + + C.vips_shutdown() + disableLogging() + + isShutdown = true +} + +// MemoryStats is a data structure that houses various memory statistics from ReadVipsMemStats() +type MemoryStats struct { + Mem int64 + MemHigh int64 + Files int64 + Allocs int64 +} + +// ReadVipsMemStats returns various memory statistics such as allocated memory and open files. +func ReadVipsMemStats(stats *MemoryStats) { + stats.Mem = int64(C.vips_tracked_get_mem()) + stats.MemHigh = int64(C.vips_tracked_get_mem_highwater()) + stats.Allocs = int64(C.vips_tracked_get_allocs()) + stats.Files = int64(C.vips_tracked_get_files()) +} + +// HasOperation checks if a libvips operation exists +func HasOperation(name string) bool { + Startup(nil) + cName := C.CString(name) + defer freeCString(cName) + vop := C.vips_operation_new(cName) + if vop == nil { + C.vips_error_clear() + return false + } + if C.is_gobject(unsafe.Pointer(vop)) != 0 { + C.g_object_unref(C.gpointer(vop)) + } + return true +} + +func handleImageError(out *C.VipsImage) error { + if out != nil { + clearImage(out) + } + return handleVipsError() +} + +func handleVipsError() error { + s := C.GoString(C.vips_error_buffer()) + C.vips_error_clear() + + return fmt.Errorf("%v", s) +} + +func freeCString(s *C.char) { + C.free(unsafe.Pointer(s)) +} + +func gFreePointer(ref unsafe.Pointer) { + C.g_free(C.gpointer(ref)) +} + +func boolToInt(b bool) int { + if b { + return 1 + } + return 0 +} + +func boolToStr(v bool) string { + if v { + return "TRUE" + } + return "FALSE" +} + +func toGboolean(b bool) C.gboolean { + if b { + return C.gboolean(1) + } + return C.gboolean(0) +} + +func fromGboolean(b C.gboolean) bool { + return b != 0 +} + +var cStringsCache sync.Map + +func cachedCString(str string) *C.char { + if cstr, ok := cStringsCache.Load(str); ok { + return cstr.(*C.char) + } + cstr := C.CString(str) + cStringsCache.Store(str, cstr) + return cstr +} + +// bufferToBytes converts a C buffer to Go bytes and frees the original buffer. +// This function takes ownership of the buffer and will free it after conversion. +func bufferToBytes(buf unsafe.Pointer, length C.size_t) []byte { + if buf == nil { + return nil + } + bytes := C.GoBytes(buf, C.int(length)) + C.g_free(C.gpointer(buf)) + return bytes +} + +// convertImagesToVipsImages converts from Image slice to VipsImage slice +func convertImagesToVipsImages(images []*Image) []*C.VipsImage { + vipsImages := make([]*C.VipsImage, len(images)) + for i, img := range images { + vipsImages[i] = img.image + } + return vipsImages +} + +// convertVipsImagesToImages converts a slice of *C.VipsImage to []*Image +func convertVipsImagesToImages(vipsImages []*C.VipsImage) []*Image { + images := make([]*Image, len(vipsImages)) + for i, vipsImg := range vipsImages { + images[i] = newImageRef(vipsImg, ImageTypeUnknown, nil) + } + return images +} + +// vipsInterpolateToC converts a Go Interpolate to a C VipsInterpolate pointer +func vipsInterpolateToC(interp *Interpolate) *C.VipsInterpolate { + if interp == nil { + return nil + } + return interp.interp +} + +// vipsInterpolateFromC converts a C VipsInterpolate pointer to a Go Interpolate +func vipsInterpolateFromC(interp *C.VipsInterpolate) *Interpolate { + if interp == nil { + return nil + } + return &Interpolate{interp: interp} +} + +// convertToDoubleArray converts a Go float64 slice to a C double array and returns the length +func convertToDoubleArray(values []float64) (*C.double, C.int, error) { + if len(values) == 0 { + return nil, 0, nil + } + + // Allocate C memory + size := C.size_t(len(values)) * C.size_t(unsafe.Sizeof(C.double(0))) + cArray := (*C.double)(C.malloc(size)) + if cArray == nil { + return nil, 0, fmt.Errorf("failed to allocate memory for double array") + } + + // Copy values to C array + for i, v := range values { + ptr := unsafe.Pointer(uintptr(unsafe.Pointer(cArray)) + uintptr(i)*unsafe.Sizeof(C.double(0))) + *(*C.double)(ptr) = C.double(v) + } + + return cArray, C.int(len(values)), nil +} + +// freeDoubleArray frees memory allocated for a C double array +func freeDoubleArray(array *C.double) { + if array != nil { + C.free(unsafe.Pointer(array)) + } +} + +func fromCArrayDouble(out *C.double, n int) []float64 { + if out == nil || n <= 0 { + return nil + } + data := make([]float64, n) + for i := 0; i < n; i++ { + data[i] = float64(*(*C.double)(unsafe.Pointer(uintptr(unsafe.Pointer(out)) + uintptr(i)*unsafe.Sizeof(C.double(0))))) + } + return data +} + +func fromCArrayInt(out *C.int, n int) []int { + if out == nil || n <= 0 { + return nil + } + data := make([]int, n) + for i := 0; i < n; i++ { + data[i] = int(*(*C.int)(unsafe.Pointer(uintptr(unsafe.Pointer(out)) + uintptr(i)*unsafe.Sizeof(C.int(0))))) + } + return data +} + +// convertToIntArray converts a Go int slice to a C int array and returns the length +func convertToIntArray(values []int) (*C.int, C.int, error) { + if len(values) == 0 { + return nil, 0, nil + } + + // Allocate C memory + size := C.size_t(len(values)) * C.size_t(unsafe.Sizeof(C.int(0))) + cArray := (*C.int)(C.malloc(size)) + if cArray == nil { + return nil, 0, fmt.Errorf("failed to allocate memory for int array") + } + + // Copy values to C array + for i, v := range values { + ptr := unsafe.Pointer(uintptr(unsafe.Pointer(cArray)) + uintptr(i)*unsafe.Sizeof(C.int(0))) + *(*C.int)(ptr) = C.int(v) + } + + return cArray, C.int(len(values)), nil +} + +// freeIntArray frees memory allocated for a C int array +func freeIntArray(array *C.int) { + if array != nil { + C.free(unsafe.Pointer(array)) + } +} + +// convertToBlendModeArray converts a Go BlendMode slice to a C int array and returns the length +func convertToBlendModeArray(values []BlendMode) (*C.int, C.int, error) { + if len(values) == 0 { + return nil, 0, nil + } + + // Allocate C memory + size := C.size_t(len(values)) * C.size_t(unsafe.Sizeof(C.int(0))) + cArray := (*C.int)(C.malloc(size)) + if cArray == nil { + return nil, 0, fmt.Errorf("failed to allocate memory for BlendMode array") + } + + // Copy values to C array + for i, v := range values { + ptr := unsafe.Pointer(uintptr(unsafe.Pointer(cArray)) + uintptr(i)*unsafe.Sizeof(C.int(0))) + *(*C.int)(ptr) = C.int(v) + } + + return cArray, C.int(len(values)), nil +} + +// convertToImageArray converts a Go []*Image slice to a C VipsImage** array and returns the length +func convertToImageArray(images []*C.VipsImage) (**C.VipsImage, C.int, error) { + if len(images) == 0 { + return nil, 0, nil + } + + // Allocate C memory for array of VipsImage pointers + size := C.size_t(len(images)) * C.size_t(unsafe.Sizeof((*C.VipsImage)(nil))) + cArray := (**C.VipsImage)(C.malloc(size)) + if cArray == nil { + return nil, 0, fmt.Errorf("failed to allocate memory for image array") + } + + // Convert each Image to a C VipsImage pointer and store in array + for i, img := range images { + ptr := unsafe.Pointer(uintptr(unsafe.Pointer(cArray)) + uintptr(i)*unsafe.Sizeof((*C.VipsImage)(nil))) + *(**C.VipsImage)(ptr) = img + } + + return cArray, C.int(len(images)), nil +} + +// freeImageArray frees memory allocated for a C VipsImage** array +func freeImageArray(array **C.VipsImage) { + if array != nil { + C.free(unsafe.Pointer(array)) + } +} + +// vipsBlobToBytes converts a VipsBlob to a Go byte slice and unrefs the blob +func vipsBlobToBytes(blob *C.VipsBlob) []byte { + if blob == nil { + return nil + } + var size C.size_t + ptr := C.vips_blob_get(blob, &size) + data := C.GoBytes(ptr, C.int(size)) + C.vips_area_unref((*C.VipsArea)(unsafe.Pointer(blob))) + return data +} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/govips.h b/vendor/github.com/cshum/vipsgen/vips/util.h similarity index 55% rename from vendor/github.com/davidbyttow/govips/v2/vips/govips.h rename to vendor/github.com/cshum/vipsgen/vips/util.h index 31f42b04c6..fdb60f394f 100644 --- a/vendor/github.com/davidbyttow/govips/v2/vips/govips.h +++ b/vendor/github.com/cshum/vipsgen/vips/util.h @@ -1,9 +1,11 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. // clang-format off // include order matters #include #include #include +#include // clang-format on #if (VIPS_MAJOR_VERSION < 8) @@ -11,9 +13,9 @@ error_requires_version_8 #endif extern void - govipsLoggingHandler(char *log_domain, int log_level, char *message); + goLoggingHandler(char *log_domain, int log_level, char *message); -static void govips_logging_handler(const gchar *log_domain, +static void logging_handler(const gchar *log_domain, GLogLevelFlags log_level, const gchar *message, gpointer user_data); @@ -21,6 +23,11 @@ static void null_logging_handler(const gchar *log_domain, GLogLevelFlags log_level, const gchar *message, gpointer user_data); -void vips_set_logging_handler(void); -void vips_unset_logging_handler(void); -void vips_default_logging_handler(void); \ No newline at end of file +void set_logging_handler(void); +void unset_logging_handler(void); + +#ifndef G_IS_OBJECT +#define G_IS_OBJECT(obj) (G_TYPE_CHECK_INSTANCE_TYPE((obj), G_TYPE_OBJECT)) +#endif + +int is_gobject(void* obj); diff --git a/vendor/github.com/cshum/vipsgen/vips/vips.c b/vendor/github.com/cshum/vipsgen/vips/vips.c new file mode 100644 index 0000000000..21ba386dd7 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/vips.c @@ -0,0 +1,6091 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +#include "vips.h" +#include + +// Prerequisites to build, get outputs and cleanup a vips operation + +int vipsgen_operation_execute(VipsOperation *operation, ...) { + va_list ap; + if (vips_cache_operation_buildp(&operation)) { + vips_object_unref_outputs(VIPS_OBJECT(operation)); + g_object_unref(operation); + return 1; + } + va_start(ap, operation); + const char *name; + while ((name = va_arg(ap, const char *)) != NULL) { + void *value = va_arg(ap, void *); + if (value != NULL) { + g_object_get(VIPS_OBJECT(operation), name, value, NULL); + } + } + va_end(ap); + vips_object_unref_outputs(VIPS_OBJECT(operation)); + g_object_unref(operation); + return 0; +} + +int vipsgen_operation_save_buffer(VipsOperation *operation, void** buf, size_t* len) { + if (vips_cache_operation_buildp(&operation)) { + vips_object_unref_outputs(VIPS_OBJECT(operation)); + g_object_unref(operation); + return 1; + } + VipsBlob *blob; + g_object_get(VIPS_OBJECT(operation), "buffer", &blob, NULL); + VipsArea *area = VIPS_AREA(blob); + *buf = (char *)(area->data); + *len = area->length; + area->free_fn = NULL; + vips_area_unref(area); + vips_object_unref_outputs(VIPS_OBJECT(operation)); + g_object_unref(operation); + return 0; +} + +int vipsgen_set_int(VipsOperation *operation, const char *name, int value) { + if (value != 0) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_bool(VipsOperation *operation, const char *name, gboolean value) { + if (value) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_double(VipsOperation *operation, const char *name, double value) { + if (value != 0.0) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_guint64(VipsOperation *operation, const char *name, guint64 value) { + if (value != 0) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_string(VipsOperation *operation, const char *name, const char *value) { + if (value != NULL && strlen(value) > 0) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_image(VipsOperation *operation, const char *name, VipsImage *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_array_double(VipsOperation *operation, const char *name, VipsArrayDouble *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_array_int(VipsOperation *operation, const char *name, VipsArrayInt *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_array_image(VipsOperation *operation, const char *name, VipsArrayImage *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_interpolate(VipsOperation *operation, const char *name, VipsInterpolate *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_source(VipsOperation *operation, const char *name, VipsSource *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +int vipsgen_set_target(VipsOperation *operation, const char *name, VipsTarget *value) { + if (value != NULL) { return vips_object_set(VIPS_OBJECT(operation), name, value, NULL); } + return 0; +} + +// Generated operations + +int vipsgen_CMC2LCh(VipsImage* in, VipsImage** out) { + return vips_CMC2LCh(in, out, NULL); +} + +int vipsgen_CMYK2XYZ(VipsImage* in, VipsImage** out) { + return vips_CMYK2XYZ(in, out, NULL); +} + +int vipsgen_HSV2sRGB(VipsImage* in, VipsImage** out) { + return vips_HSV2sRGB(in, out, NULL); +} + +int vipsgen_LCh2CMC(VipsImage* in, VipsImage** out) { + return vips_LCh2CMC(in, out, NULL); +} + +int vipsgen_LCh2Lab(VipsImage* in, VipsImage** out) { + return vips_LCh2Lab(in, out, NULL); +} + +int vipsgen_Lab2LCh(VipsImage* in, VipsImage** out) { + return vips_Lab2LCh(in, out, NULL); +} + +int vipsgen_Lab2LabQ(VipsImage* in, VipsImage** out) { + return vips_Lab2LabQ(in, out, NULL); +} + +int vipsgen_Lab2LabS(VipsImage* in, VipsImage** out) { + return vips_Lab2LabS(in, out, NULL); +} + +int vipsgen_Lab2XYZ(VipsImage* in, VipsImage** out) { + return vips_Lab2XYZ(in, out, NULL); +} + +int vipsgen_Lab2XYZ_with_options(VipsImage* in, VipsImage** out, double* temp, int temp_n) { + VipsOperation *operation = vips_operation_new("Lab2XYZ"); + if (!operation) return 1; + VipsArrayDouble *temp_array = NULL; + if (temp != NULL && temp_n > 0) { temp_array = vips_array_double_new(temp, temp_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_array_double(operation, "temp", temp_array) + ) { + g_object_unref(operation); + if (temp_array != NULL) { vips_area_unref(VIPS_AREA(temp_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (temp_array != NULL) { vips_area_unref(VIPS_AREA(temp_array)); } + return result; +} + +int vipsgen_LabQ2Lab(VipsImage* in, VipsImage** out) { + return vips_LabQ2Lab(in, out, NULL); +} + +int vipsgen_LabQ2LabS(VipsImage* in, VipsImage** out) { + return vips_LabQ2LabS(in, out, NULL); +} + +int vipsgen_LabQ2sRGB(VipsImage* in, VipsImage** out) { + return vips_LabQ2sRGB(in, out, NULL); +} + +int vipsgen_LabS2Lab(VipsImage* in, VipsImage** out) { + return vips_LabS2Lab(in, out, NULL); +} + +int vipsgen_LabS2LabQ(VipsImage* in, VipsImage** out) { + return vips_LabS2LabQ(in, out, NULL); +} + +int vipsgen_XYZ2CMYK(VipsImage* in, VipsImage** out) { + return vips_XYZ2CMYK(in, out, NULL); +} + +int vipsgen_XYZ2Lab(VipsImage* in, VipsImage** out) { + return vips_XYZ2Lab(in, out, NULL); +} + +int vipsgen_XYZ2Lab_with_options(VipsImage* in, VipsImage** out, double* temp, int temp_n) { + VipsOperation *operation = vips_operation_new("XYZ2Lab"); + if (!operation) return 1; + VipsArrayDouble *temp_array = NULL; + if (temp != NULL && temp_n > 0) { temp_array = vips_array_double_new(temp, temp_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_array_double(operation, "temp", temp_array) + ) { + g_object_unref(operation); + if (temp_array != NULL) { vips_area_unref(VIPS_AREA(temp_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (temp_array != NULL) { vips_area_unref(VIPS_AREA(temp_array)); } + return result; +} + +int vipsgen_XYZ2Yxy(VipsImage* in, VipsImage** out) { + return vips_XYZ2Yxy(in, out, NULL); +} + +int vipsgen_XYZ2scRGB(VipsImage* in, VipsImage** out) { + return vips_XYZ2scRGB(in, out, NULL); +} + +int vipsgen_Yxy2XYZ(VipsImage* in, VipsImage** out) { + return vips_Yxy2XYZ(in, out, NULL); +} + +int vipsgen_abs(VipsImage* in, VipsImage** out) { + return vips_abs(in, out, NULL); +} + +int vipsgen_add(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_add(left, right, out, NULL); +} + +int vipsgen_addalpha(VipsImage* in, VipsImage** out) { + return vips_addalpha(in, out, NULL); +} + +int vipsgen_affine(VipsImage* in, VipsImage** out, double a, double b, double c, double d) { + return vips_affine(in, out, a, b, c, d, NULL); +} + +int vipsgen_affine_with_options(VipsImage* in, VipsImage** out, double a, double b, double c, double d, VipsInterpolate* interpolate, int* oarea, int oarea_n, double odx, double ody, double idx, double idy, double* background, int background_n, gboolean premultiplied, VipsExtend extend) { + VipsOperation *operation = vips_operation_new("affine"); + if (!operation) return 1; + VipsArrayInt *oarea_array = NULL; + if (oarea != NULL && oarea_n > 0) { oarea_array = vips_array_int_new(oarea, oarea_n); } + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "a", a, NULL) || + vips_object_set(VIPS_OBJECT(operation), "b", b, NULL) || + vips_object_set(VIPS_OBJECT(operation), "c", c, NULL) || + vips_object_set(VIPS_OBJECT(operation), "d", d, NULL) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) || + vipsgen_set_array_int(operation, "oarea", oarea_array) || + vipsgen_set_double(operation, "odx", odx) || + vipsgen_set_double(operation, "ody", ody) || + vipsgen_set_double(operation, "idx", idx) || + vipsgen_set_double(operation, "idy", idy) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_bool(operation, "premultiplied", premultiplied) || + vipsgen_set_int(operation, "extend", extend) + ) { + g_object_unref(operation); + if (oarea_array != NULL) { vips_area_unref(VIPS_AREA(oarea_array)); } + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (oarea_array != NULL) { vips_area_unref(VIPS_AREA(oarea_array)); } + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_analyzeload(const char* filename, VipsImage** out) { + return vips_analyzeload(filename, out, NULL); +} + +int vipsgen_analyzeload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("analyzeload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_arrayjoin(VipsImage** in, VipsImage** out, int n) { + return vips_arrayjoin(in, out, n, NULL); +} + +int vipsgen_arrayjoin_with_options(VipsImage** in, VipsImage** out, int n, int across, int shim, double* background, int background_n, VipsAlign halign, VipsAlign valign, int hspacing, int vspacing) { + VipsOperation *operation = vips_operation_new("arrayjoin"); + if (!operation) return 1; + VipsArrayImage *in_array = NULL; + if (in != NULL && n > 0) { in_array = vips_array_image_new(in, n); } + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in_array, NULL) || + vipsgen_set_int(operation, "across", across) || + vipsgen_set_int(operation, "shim", shim) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "halign", halign) || + vipsgen_set_int(operation, "valign", valign) || + vipsgen_set_int(operation, "hspacing", hspacing) || + vipsgen_set_int(operation, "vspacing", vspacing) + ) { + g_object_unref(operation); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_autorot(VipsImage* in, VipsImage** out) { + return vips_autorot(in, out, NULL); +} + +int vipsgen_avg(VipsImage* in, double* out) { + return vips_avg(in, out, NULL); +} + +int vipsgen_bandbool(VipsImage* in, VipsImage** out, VipsOperationBoolean boolean) { + return vips_bandbool(in, out, boolean, NULL); +} + +int vipsgen_bandfold(VipsImage* in, VipsImage** out) { + return vips_bandfold(in, out, NULL); +} + +int vipsgen_bandfold_with_options(VipsImage* in, VipsImage** out, int factor) { + VipsOperation *operation = vips_operation_new("bandfold"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "factor", factor) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_bandjoin(VipsImage** in, VipsImage** out, int n) { + return vips_bandjoin(in, out, n, NULL); +} + +int vipsgen_bandjoin_const(VipsImage* in, VipsImage** out, double* c, int n) { + return vips_bandjoin_const(in, out, c, n, NULL); +} + +int vipsgen_bandmean(VipsImage* in, VipsImage** out) { + return vips_bandmean(in, out, NULL); +} + +int vipsgen_bandrank(VipsImage** in, VipsImage** out, int n) { + return vips_bandrank(in, out, n, NULL); +} + +int vipsgen_bandrank_with_options(VipsImage** in, VipsImage** out, int n, int index) { + VipsOperation *operation = vips_operation_new("bandrank"); + if (!operation) return 1; + VipsArrayImage *in_array = NULL; + if (in != NULL && n > 0) { in_array = vips_array_image_new(in, n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in_array, NULL) || + vipsgen_set_int(operation, "index", index) + ) { + g_object_unref(operation); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + return result; +} + +int vipsgen_bandunfold(VipsImage* in, VipsImage** out) { + return vips_bandunfold(in, out, NULL); +} + +int vipsgen_bandunfold_with_options(VipsImage* in, VipsImage** out, int factor) { + VipsOperation *operation = vips_operation_new("bandunfold"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "factor", factor) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_black(VipsImage** out, int width, int height) { + return vips_black(out, width, height, NULL); +} + +int vipsgen_black_with_options(VipsImage** out, int width, int height, int bands) { + VipsOperation *operation = vips_operation_new("black"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "bands", bands) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_boolean(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationBoolean boolean) { + return vips_boolean(left, right, out, boolean, NULL); +} + +int vipsgen_boolean_const(VipsImage* in, VipsImage** out, VipsOperationBoolean boolean, double* c, int n) { + return vips_boolean_const(in, out, boolean, c, n, NULL); +} + +int vipsgen_buildlut(VipsImage* in, VipsImage** out) { + return vips_buildlut(in, out, NULL); +} + +int vipsgen_byteswap(VipsImage* in, VipsImage** out) { + return vips_byteswap(in, out, NULL); +} + +int vipsgen_canny(VipsImage* in, VipsImage** out) { + return vips_canny(in, out, NULL); +} + +int vipsgen_canny_with_options(VipsImage* in, VipsImage** out, double sigma, VipsPrecision precision) { + VipsOperation *operation = vips_operation_new("canny"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "sigma", sigma) || + vipsgen_set_int(operation, "precision", precision) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_case(VipsImage* index, VipsImage** cases, VipsImage** out, int n) { + return vips_case(index, cases, out, n, NULL); +} + +int vipsgen_cast(VipsImage* in, VipsImage** out, VipsBandFormat format) { + return vips_cast(in, out, format, NULL); +} + +int vipsgen_cast_with_options(VipsImage* in, VipsImage** out, VipsBandFormat format, gboolean shift) { + VipsOperation *operation = vips_operation_new("cast"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "format", format, NULL) || + vipsgen_set_bool(operation, "shift", shift) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_clamp(VipsImage* in, VipsImage** out) { + return vips_clamp(in, out, NULL); +} + +int vipsgen_clamp_with_options(VipsImage* in, VipsImage** out, double min, double max) { + VipsOperation *operation = vips_operation_new("clamp"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "min", min) || + vipsgen_set_double(operation, "max", max) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_colourspace(VipsImage* in, VipsImage** out, VipsInterpretation space) { + return vips_colourspace(in, out, space, NULL); +} + +int vipsgen_colourspace_with_options(VipsImage* in, VipsImage** out, VipsInterpretation space, VipsInterpretation source_space) { + VipsOperation *operation = vips_operation_new("colourspace"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "space", space, NULL) || + vipsgen_set_int(operation, "source_space", source_space) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_compass(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_compass(in, out, mask, NULL); +} + +int vipsgen_compass_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int times, VipsAngle45 angle, VipsCombine combine, VipsPrecision precision, int layers, int cluster) { + VipsOperation *operation = vips_operation_new("compass"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mask", mask, NULL) || + vipsgen_set_int(operation, "times", times) || + vipsgen_set_int(operation, "angle", angle) || + vipsgen_set_int(operation, "combine", combine) || + vipsgen_set_int(operation, "precision", precision) || + vipsgen_set_int(operation, "layers", layers) || + vipsgen_set_int(operation, "cluster", cluster) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_complex(VipsImage* in, VipsImage** out, VipsOperationComplex cmplx) { + return vips_complex(in, out, cmplx, NULL); +} + +int vipsgen_complex2(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationComplex2 cmplx) { + return vips_complex2(left, right, out, cmplx, NULL); +} + +int vipsgen_complexform(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_complexform(left, right, out, NULL); +} + +int vipsgen_complexget(VipsImage* in, VipsImage** out, VipsOperationComplexget get) { + return vips_complexget(in, out, get, NULL); +} + +int vipsgen_composite(VipsImage** in, VipsImage** out, int n, int* mode) { + return vips_composite(in, out, n, mode, NULL); +} + +int vipsgen_composite_with_options(VipsImage** in, VipsImage** out, int n, int* mode, int* x, int x_n, int* y, int y_n, VipsInterpretation compositing_space, gboolean premultiplied) { + VipsOperation *operation = vips_operation_new("composite"); + if (!operation) return 1; + VipsArrayImage *in_array = NULL; + if (in != NULL && n > 0) { in_array = vips_array_image_new(in, n); } + VipsArrayInt *mode_array = NULL; + if (mode != NULL && n > 1) { mode_array = vips_array_int_new(mode, n-1); } + VipsArrayInt *x_array = NULL; + if (x != NULL && x_n > 0) { x_array = vips_array_int_new(x, x_n); } + VipsArrayInt *y_array = NULL; + if (y != NULL && y_n > 0) { y_array = vips_array_int_new(y, y_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in_array, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mode", mode_array, NULL) || + vipsgen_set_array_int(operation, "x", x_array) || + vipsgen_set_array_int(operation, "y", y_array) || + vipsgen_set_int(operation, "compositing_space", compositing_space) || + vipsgen_set_bool(operation, "premultiplied", premultiplied) + ) { + g_object_unref(operation); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + if (mode_array != NULL) { vips_area_unref(VIPS_AREA(mode_array)); } + if (x_array != NULL) { vips_area_unref(VIPS_AREA(x_array)); } + if (y_array != NULL) { vips_area_unref(VIPS_AREA(y_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + if (mode_array != NULL) { vips_area_unref(VIPS_AREA(mode_array)); } + if (x_array != NULL) { vips_area_unref(VIPS_AREA(x_array)); } + if (y_array != NULL) { vips_area_unref(VIPS_AREA(y_array)); } + return result; +} + +int vipsgen_composite2(VipsImage* base, VipsImage* overlay, VipsImage** out, VipsBlendMode mode) { + return vips_composite2(base, overlay, out, mode, NULL); +} + +int vipsgen_composite2_with_options(VipsImage* base, VipsImage* overlay, VipsImage** out, VipsBlendMode mode, int x, int y, VipsInterpretation compositing_space, gboolean premultiplied) { + VipsOperation *operation = vips_operation_new("composite2"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "base", base, NULL) || + vips_object_set(VIPS_OBJECT(operation), "overlay", overlay, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mode", mode, NULL) || + vipsgen_set_int(operation, "x", x) || + vipsgen_set_int(operation, "y", y) || + vipsgen_set_int(operation, "compositing_space", compositing_space) || + vipsgen_set_bool(operation, "premultiplied", premultiplied) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_conv(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_conv(in, out, mask, NULL); +} + +int vipsgen_conv_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, VipsPrecision precision, int layers, int cluster) { + VipsOperation *operation = vips_operation_new("conv"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mask", mask, NULL) || + vipsgen_set_int(operation, "precision", precision) || + vipsgen_set_int(operation, "layers", layers) || + vipsgen_set_int(operation, "cluster", cluster) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_conva(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_conva(in, out, mask, NULL); +} + +int vipsgen_conva_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int layers, int cluster) { + VipsOperation *operation = vips_operation_new("conva"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mask", mask, NULL) || + vipsgen_set_int(operation, "layers", layers) || + vipsgen_set_int(operation, "cluster", cluster) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_convasep(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_convasep(in, out, mask, NULL); +} + +int vipsgen_convasep_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int layers) { + VipsOperation *operation = vips_operation_new("convasep"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mask", mask, NULL) || + vipsgen_set_int(operation, "layers", layers) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_convf(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_convf(in, out, mask, NULL); +} + +int vipsgen_convi(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_convi(in, out, mask, NULL); +} + +int vipsgen_convsep(VipsImage* in, VipsImage** out, VipsImage* mask) { + return vips_convsep(in, out, mask, NULL); +} + +int vipsgen_convsep_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, VipsPrecision precision, int layers, int cluster) { + VipsOperation *operation = vips_operation_new("convsep"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "mask", mask, NULL) || + vipsgen_set_int(operation, "precision", precision) || + vipsgen_set_int(operation, "layers", layers) || + vipsgen_set_int(operation, "cluster", cluster) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_copy(VipsImage* in, VipsImage** out) { + return vips_copy(in, out, NULL); +} + +int vipsgen_copy_with_options(VipsImage* in, VipsImage** out, int width, int height, int bands, VipsBandFormat format, VipsCoding coding, VipsInterpretation interpretation, double xres, double yres, int xoffset, int yoffset) { + VipsOperation *operation = vips_operation_new("copy"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "width", width) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "bands", bands) || + vipsgen_set_int(operation, "format", format) || + vipsgen_set_int(operation, "coding", coding) || + vipsgen_set_int(operation, "interpretation", interpretation) || + vipsgen_set_double(operation, "xres", xres) || + vipsgen_set_double(operation, "yres", yres) || + vipsgen_set_int(operation, "xoffset", xoffset) || + vipsgen_set_int(operation, "yoffset", yoffset) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_countlines(VipsImage* in, double* nolines, VipsDirection direction) { + return vips_countlines(in, nolines, direction, NULL); +} + +int vipsgen_csvload(const char* filename, VipsImage** out) { + return vips_csvload(filename, out, NULL); +} + +int vipsgen_csvload_with_options(const char* filename, VipsImage** out, int skip, int lines, const char* whitespace, const char* separator, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("csvload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "skip", skip) || + vipsgen_set_int(operation, "lines", lines) || + vipsgen_set_string(operation, "whitespace", whitespace) || + vipsgen_set_string(operation, "separator", separator) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_csvload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_csvload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_csvload_source_with_options(VipsSourceCustom* source, VipsImage** out, int skip, int lines, const char* whitespace, const char* separator, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("csvload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "skip", skip) || + vipsgen_set_int(operation, "lines", lines) || + vipsgen_set_string(operation, "whitespace", whitespace) || + vipsgen_set_string(operation, "separator", separator) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_csvsave(VipsImage* in, const char* filename) { + return vips_csvsave(in, filename, NULL); +} + +int vipsgen_csvsave_with_options(VipsImage* in, const char* filename, const char* separator, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("csvsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_string(operation, "separator", separator) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_csvsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_csvsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_csvsave_target_with_options(VipsImage* in, VipsTargetCustom* target, const char* separator, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("csvsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_string(operation, "separator", separator) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_dE00(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_dE00(left, right, out, NULL); +} + +int vipsgen_dE76(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_dE76(left, right, out, NULL); +} + +int vipsgen_dECMC(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_dECMC(left, right, out, NULL); +} + +int vipsgen_deviate(VipsImage* in, double* out) { + return vips_deviate(in, out, NULL); +} + +int vipsgen_divide(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_divide(left, right, out, NULL); +} + +int vipsgen_draw_circle(VipsImage* image, double* ink, int n, int cx, int cy, int radius) { + return vips_draw_circle(image, ink, n, cx, cy, radius, NULL); +} + +int vipsgen_draw_circle_with_options(VipsImage* image, double* ink, int n, int cx, int cy, int radius, gboolean fill) { + VipsOperation *operation = vips_operation_new("draw_circle"); + if (!operation) return 1; + VipsArrayDouble *ink_array = NULL; + if (ink != NULL && n > 0) { ink_array = vips_array_double_new(ink, n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "image", image, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ink", ink_array, NULL) || + vips_object_set(VIPS_OBJECT(operation), "cx", cx, NULL) || + vips_object_set(VIPS_OBJECT(operation), "cy", cy, NULL) || + vips_object_set(VIPS_OBJECT(operation), "radius", radius, NULL) || + vipsgen_set_bool(operation, "fill", fill) + ) { + g_object_unref(operation); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return result; +} + +int vipsgen_draw_flood(VipsImage* image, double* ink, int n, int x, int y) { + return vips_draw_flood(image, ink, n, x, y, NULL); +} + +int vipsgen_draw_flood_with_options(VipsImage* image, double* ink, int n, int x, int y, VipsImage* test, gboolean equal) { + VipsOperation *operation = vips_operation_new("draw_flood"); + if (!operation) return 1; + VipsArrayDouble *ink_array = NULL; + if (ink != NULL && n > 0) { ink_array = vips_array_double_new(ink, n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "image", image, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ink", ink_array, NULL) || + vips_object_set(VIPS_OBJECT(operation), "x", x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "y", y, NULL) || + vipsgen_set_image(operation, "test", test) || + vipsgen_set_bool(operation, "equal", equal) + ) { + g_object_unref(operation); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return result; +} + +int vipsgen_draw_image(VipsImage* image, VipsImage* sub, int x, int y) { + return vips_draw_image(image, sub, x, y, NULL); +} + +int vipsgen_draw_image_with_options(VipsImage* image, VipsImage* sub, int x, int y, VipsCombineMode mode) { + VipsOperation *operation = vips_operation_new("draw_image"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "image", image, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sub", sub, NULL) || + vips_object_set(VIPS_OBJECT(operation), "x", x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "y", y, NULL) || + vipsgen_set_int(operation, "mode", mode) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + return result; +} + +int vipsgen_draw_line(VipsImage* image, double* ink, int n, int x1, int y1, int x2, int y2) { + return vips_draw_line(image, ink, n, x1, y1, x2, y2, NULL); +} + +int vipsgen_draw_mask(VipsImage* image, double* ink, int n, VipsImage* mask, int x, int y) { + return vips_draw_mask(image, ink, n, mask, x, y, NULL); +} + +int vipsgen_draw_rect(VipsImage* image, double* ink, int n, int left, int top, int width, int height) { + return vips_draw_rect(image, ink, n, left, top, width, height, NULL); +} + +int vipsgen_draw_rect_with_options(VipsImage* image, double* ink, int n, int left, int top, int width, int height, gboolean fill) { + VipsOperation *operation = vips_operation_new("draw_rect"); + if (!operation) return 1; + VipsArrayDouble *ink_array = NULL; + if (ink != NULL && n > 0) { ink_array = vips_array_double_new(ink, n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "image", image, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ink", ink_array, NULL) || + vips_object_set(VIPS_OBJECT(operation), "left", left, NULL) || + vips_object_set(VIPS_OBJECT(operation), "top", top, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_bool(operation, "fill", fill) + ) { + g_object_unref(operation); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (ink_array != NULL) { vips_area_unref(VIPS_AREA(ink_array)); } + return result; +} + +int vipsgen_draw_smudge(VipsImage* image, int left, int top, int width, int height) { + return vips_draw_smudge(image, left, top, width, height, NULL); +} + +int vipsgen_dzsave(VipsImage* in, const char* filename) { + return vips_dzsave(in, filename, NULL); +} + +int vipsgen_dzsave_with_options(VipsImage* in, const char* filename, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("dzsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_string(operation, "imagename", imagename) || + vipsgen_set_int(operation, "layout", layout) || + vipsgen_set_string(operation, "suffix", suffix) || + vipsgen_set_int(operation, "overlap", overlap) || + vipsgen_set_int(operation, "tile_size", tile_size) || + vipsgen_set_bool(operation, "centre", centre) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_int(operation, "angle", angle) || + vipsgen_set_int(operation, "container", container) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "skip_blanks", skip_blanks) || + vipsgen_set_string(operation, "id", id) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_dzsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_dzsave_buffer(in, buf, len, NULL); +} + +int vipsgen_dzsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("dzsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_string(operation, "imagename", imagename) || + vipsgen_set_int(operation, "layout", layout) || + vipsgen_set_string(operation, "suffix", suffix) || + vipsgen_set_int(operation, "overlap", overlap) || + vipsgen_set_int(operation, "tile_size", tile_size) || + vipsgen_set_bool(operation, "centre", centre) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_int(operation, "angle", angle) || + vipsgen_set_int(operation, "container", container) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "skip_blanks", skip_blanks) || + vipsgen_set_string(operation, "id", id) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_dzsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_dzsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_dzsave_target_with_options(VipsImage* in, VipsTargetCustom* target, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("dzsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_string(operation, "imagename", imagename) || + vipsgen_set_int(operation, "layout", layout) || + vipsgen_set_string(operation, "suffix", suffix) || + vipsgen_set_int(operation, "overlap", overlap) || + vipsgen_set_int(operation, "tile_size", tile_size) || + vipsgen_set_bool(operation, "centre", centre) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_int(operation, "angle", angle) || + vipsgen_set_int(operation, "container", container) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "skip_blanks", skip_blanks) || + vipsgen_set_string(operation, "id", id) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_embed(VipsImage* in, VipsImage** out, int x, int y, int width, int height) { + return vips_embed(in, out, x, y, width, height, NULL); +} + +int vipsgen_embed_with_options(VipsImage* in, VipsImage** out, int x, int y, int width, int height, VipsExtend extend, double* background, int background_n) { + VipsOperation *operation = vips_operation_new("embed"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "x", x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "y", y, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "extend", extend) || + vipsgen_set_array_double(operation, "background", background_array) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_extract_area(VipsImage* input, VipsImage** out, int left, int top, int width, int height) { + return vips_extract_area(input, out, left, top, width, height, NULL); +} + +int vipsgen_extract_band(VipsImage* in, VipsImage** out, int band) { + return vips_extract_band(in, out, band, NULL); +} + +int vipsgen_extract_band_with_options(VipsImage* in, VipsImage** out, int band, int n) { + VipsOperation *operation = vips_operation_new("extract_band"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "band", band, NULL) || + vipsgen_set_int(operation, "n", n) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_eye(VipsImage** out, int width, int height) { + return vips_eye(out, width, height, NULL); +} + +int vipsgen_eye_with_options(VipsImage** out, int width, int height, gboolean uchar, double factor) { + VipsOperation *operation = vips_operation_new("eye"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_double(operation, "factor", factor) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_falsecolour(VipsImage* in, VipsImage** out) { + return vips_falsecolour(in, out, NULL); +} + +int vipsgen_fastcor(VipsImage* in, VipsImage* ref, VipsImage** out) { + return vips_fastcor(in, ref, out, NULL); +} + +int vipsgen_fill_nearest(VipsImage* in, VipsImage** out) { + return vips_fill_nearest(in, out, NULL); +} + +int vipsgen_find_trim(VipsImage* in, int* left, int* top, int* width, int* height) { + return vips_find_trim(in, left, top, width, height, NULL); +} + +int vipsgen_find_trim_with_options(VipsImage* in, int* left, int* top, int* width, int* height, double threshold, double* background, int background_n, gboolean line_art) { + VipsOperation *operation = vips_operation_new("find_trim"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "threshold", threshold) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_bool(operation, "line_art", line_art) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "left", left, "top", top, "width", width, "height", height, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_fitsload(const char* filename, VipsImage** out) { + return vips_fitsload(filename, out, NULL); +} + +int vipsgen_fitsload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("fitsload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_fitssave(VipsImage* in, const char* filename) { + return vips_fitssave(in, filename, NULL); +} + +int vipsgen_fitssave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("fitssave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_flatten(VipsImage* in, VipsImage** out) { + return vips_flatten(in, out, NULL); +} + +int vipsgen_flatten_with_options(VipsImage* in, VipsImage** out, double* background, int background_n, double max_alpha) { + VipsOperation *operation = vips_operation_new("flatten"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_double(operation, "max_alpha", max_alpha) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_flip(VipsImage* in, VipsImage** out, VipsDirection direction) { + return vips_flip(in, out, direction, NULL); +} + +int vipsgen_float2rad(VipsImage* in, VipsImage** out) { + return vips_float2rad(in, out, NULL); +} + +int vipsgen_fractsurf(VipsImage** out, int width, int height, double fractal_dimension) { + return vips_fractsurf(out, width, height, fractal_dimension, NULL); +} + +int vipsgen_freqmult(VipsImage* in, VipsImage* mask, VipsImage** out) { + return vips_freqmult(in, mask, out, NULL); +} + +int vipsgen_fwfft(VipsImage* in, VipsImage** out) { + return vips_fwfft(in, out, NULL); +} + +int vipsgen_gamma(VipsImage* in, VipsImage** out) { + return vips_gamma(in, out, NULL); +} + +int vipsgen_gamma_with_options(VipsImage* in, VipsImage** out, double exponent) { + VipsOperation *operation = vips_operation_new("gamma"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "exponent", exponent) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gaussblur(VipsImage* in, VipsImage** out, double sigma) { + return vips_gaussblur(in, out, sigma, NULL); +} + +int vipsgen_gaussblur_with_options(VipsImage* in, VipsImage** out, double sigma, double min_ampl, VipsPrecision precision) { + VipsOperation *operation = vips_operation_new("gaussblur"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sigma", sigma, NULL) || + vipsgen_set_double(operation, "min_ampl", min_ampl) || + vipsgen_set_int(operation, "precision", precision) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gaussmat(VipsImage** out, double sigma, double min_ampl) { + return vips_gaussmat(out, sigma, min_ampl, NULL); +} + +int vipsgen_gaussmat_with_options(VipsImage** out, double sigma, double min_ampl, gboolean separable, VipsPrecision precision) { + VipsOperation *operation = vips_operation_new("gaussmat"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "sigma", sigma, NULL) || + vips_object_set(VIPS_OBJECT(operation), "min_ampl", min_ampl, NULL) || + vipsgen_set_bool(operation, "separable", separable) || + vipsgen_set_int(operation, "precision", precision) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gaussnoise(VipsImage** out, int width, int height) { + return vips_gaussnoise(out, width, height, NULL); +} + +int vipsgen_gaussnoise_with_options(VipsImage** out, int width, int height, double sigma, double mean, int seed) { + VipsOperation *operation = vips_operation_new("gaussnoise"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_double(operation, "sigma", sigma) || + vipsgen_set_double(operation, "mean", mean) || + vipsgen_set_int(operation, "seed", seed) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_getpoint(VipsImage* in, double** out_array, int* n, int x, int y) { + return vips_getpoint(in, out_array, n, x, y, NULL); +} + +int vipsgen_getpoint_with_options(VipsImage* in, double** out_array, int* n, int x, int y, gboolean unpack_complex) { + VipsOperation *operation = vips_operation_new("getpoint"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "x", x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "y", y, NULL) || + vipsgen_set_bool(operation, "unpack_complex", unpack_complex) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out_array", out_array, "n", n, NULL); + return result; +} + +int vipsgen_gifload(const char* filename, VipsImage** out) { + return vips_gifload(filename, out, NULL); +} + +int vipsgen_gifload_with_options(const char* filename, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("gifload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gifload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_gifload_buffer(buf, len, out, NULL); +} + +int vipsgen_gifload_buffer_with_options(void* buf, size_t len, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("gifload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gifload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_gifload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_gifload_source_with_options(VipsSourceCustom* source, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("gifload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gifsave(VipsImage* in, const char* filename) { + return vips_gifsave(in, filename, NULL); +} + +int vipsgen_gifsave_with_options(VipsImage* in, const char* filename, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("gifsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_double(operation, "interframe_maxerror", interframe_maxerror) || + vipsgen_set_bool(operation, "reuse", reuse) || + vipsgen_set_double(operation, "interpalette_maxerror", interpalette_maxerror) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "keep_duplicate_frames", keep_duplicate_frames) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_gifsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_gifsave_buffer(in, buf, len, NULL); +} + +int vipsgen_gifsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("gifsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_double(operation, "interframe_maxerror", interframe_maxerror) || + vipsgen_set_bool(operation, "reuse", reuse) || + vipsgen_set_double(operation, "interpalette_maxerror", interpalette_maxerror) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "keep_duplicate_frames", keep_duplicate_frames) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_gifsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_gifsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_gifsave_target_with_options(VipsImage* in, VipsTargetCustom* target, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("gifsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_double(operation, "interframe_maxerror", interframe_maxerror) || + vipsgen_set_bool(operation, "reuse", reuse) || + vipsgen_set_double(operation, "interpalette_maxerror", interpalette_maxerror) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "keep_duplicate_frames", keep_duplicate_frames) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_globalbalance(VipsImage* in, VipsImage** out) { + return vips_globalbalance(in, out, NULL); +} + +int vipsgen_globalbalance_with_options(VipsImage* in, VipsImage** out, double gamma, gboolean int_output) { + VipsOperation *operation = vips_operation_new("globalbalance"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "gamma", gamma) || + vipsgen_set_bool(operation, "int_output", int_output) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_gravity(VipsImage* in, VipsImage** out, VipsCompassDirection direction, int width, int height) { + return vips_gravity(in, out, direction, width, height, NULL); +} + +int vipsgen_gravity_with_options(VipsImage* in, VipsImage** out, VipsCompassDirection direction, int width, int height, VipsExtend extend, double* background, int background_n) { + VipsOperation *operation = vips_operation_new("gravity"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "direction", direction, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "extend", extend) || + vipsgen_set_array_double(operation, "background", background_array) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_grey(VipsImage** out, int width, int height) { + return vips_grey(out, width, height, NULL); +} + +int vipsgen_grey_with_options(VipsImage** out, int width, int height, gboolean uchar) { + VipsOperation *operation = vips_operation_new("grey"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_grid(VipsImage* in, VipsImage** out, int tile_height, int across, int down) { + return vips_grid(in, out, tile_height, across, down, NULL); +} + +int vipsgen_heifload(const char* filename, VipsImage** out) { + return vips_heifload(filename, out, NULL); +} + +int vipsgen_heifload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("heifload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "thumbnail", thumbnail) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_heifload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_heifload_buffer(buf, len, out, NULL); +} + +int vipsgen_heifload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("heifload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "thumbnail", thumbnail) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_heifload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_heifload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_heifload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("heifload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "thumbnail", thumbnail) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_heifsave(VipsImage* in, const char* filename) { + return vips_heifsave(in, filename, NULL); +} + +int vipsgen_heifsave_with_options(VipsImage* in, const char* filename, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("heifsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "encoder", encoder) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_heifsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_heifsave_buffer(in, buf, len, NULL); +} + +int vipsgen_heifsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("heifsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "encoder", encoder) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_heifsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_heifsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_heifsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("heifsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "encoder", encoder) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_hist_cum(VipsImage* in, VipsImage** out) { + return vips_hist_cum(in, out, NULL); +} + +int vipsgen_hist_entropy(VipsImage* in, double* out) { + return vips_hist_entropy(in, out, NULL); +} + +int vipsgen_hist_equal(VipsImage* in, VipsImage** out) { + return vips_hist_equal(in, out, NULL); +} + +int vipsgen_hist_equal_with_options(VipsImage* in, VipsImage** out, int band) { + VipsOperation *operation = vips_operation_new("hist_equal"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "band", band) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hist_find(VipsImage* in, VipsImage** out) { + return vips_hist_find(in, out, NULL); +} + +int vipsgen_hist_find_with_options(VipsImage* in, VipsImage** out, int band) { + VipsOperation *operation = vips_operation_new("hist_find"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "band", band) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hist_find_indexed(VipsImage* in, VipsImage* index, VipsImage** out) { + return vips_hist_find_indexed(in, index, out, NULL); +} + +int vipsgen_hist_find_indexed_with_options(VipsImage* in, VipsImage* index, VipsImage** out, VipsCombine combine) { + VipsOperation *operation = vips_operation_new("hist_find_indexed"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "index", index, NULL) || + vipsgen_set_int(operation, "combine", combine) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hist_find_ndim(VipsImage* in, VipsImage** out) { + return vips_hist_find_ndim(in, out, NULL); +} + +int vipsgen_hist_find_ndim_with_options(VipsImage* in, VipsImage** out, int bins) { + VipsOperation *operation = vips_operation_new("hist_find_ndim"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "bins", bins) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hist_ismonotonic(VipsImage* in, gboolean* monotonic) { + return vips_hist_ismonotonic(in, monotonic, NULL); +} + +int vipsgen_hist_local(VipsImage* in, VipsImage** out, int width, int height) { + return vips_hist_local(in, out, width, height, NULL); +} + +int vipsgen_hist_local_with_options(VipsImage* in, VipsImage** out, int width, int height, int max_slope) { + VipsOperation *operation = vips_operation_new("hist_local"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "max_slope", max_slope) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hist_match(VipsImage* in, VipsImage* ref, VipsImage** out) { + return vips_hist_match(in, ref, out, NULL); +} + +int vipsgen_hist_norm(VipsImage* in, VipsImage** out) { + return vips_hist_norm(in, out, NULL); +} + +int vipsgen_hist_plot(VipsImage* in, VipsImage** out) { + return vips_hist_plot(in, out, NULL); +} + +int vipsgen_hough_circle(VipsImage* in, VipsImage** out) { + return vips_hough_circle(in, out, NULL); +} + +int vipsgen_hough_circle_with_options(VipsImage* in, VipsImage** out, int scale, int min_radius, int max_radius) { + VipsOperation *operation = vips_operation_new("hough_circle"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "scale", scale) || + vipsgen_set_int(operation, "min_radius", min_radius) || + vipsgen_set_int(operation, "max_radius", max_radius) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_hough_line(VipsImage* in, VipsImage** out) { + return vips_hough_line(in, out, NULL); +} + +int vipsgen_hough_line_with_options(VipsImage* in, VipsImage** out, int width, int height) { + VipsOperation *operation = vips_operation_new("hough_line"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "width", width) || + vipsgen_set_int(operation, "height", height) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_icc_export(VipsImage* in, VipsImage** out) { + return vips_icc_export(in, out, NULL); +} + +int vipsgen_icc_export_with_options(VipsImage* in, VipsImage** out, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, const char* output_profile, int depth) { + VipsOperation *operation = vips_operation_new("icc_export"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "pcs", pcs) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_bool(operation, "black_point_compensation", black_point_compensation) || + vipsgen_set_string(operation, "output_profile", output_profile) || + vipsgen_set_int(operation, "depth", depth) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_icc_import(VipsImage* in, VipsImage** out) { + return vips_icc_import(in, out, NULL); +} + +int vipsgen_icc_import_with_options(VipsImage* in, VipsImage** out, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, gboolean embedded, const char* input_profile) { + VipsOperation *operation = vips_operation_new("icc_import"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "pcs", pcs) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_bool(operation, "black_point_compensation", black_point_compensation) || + vipsgen_set_bool(operation, "embedded", embedded) || + vipsgen_set_string(operation, "input_profile", input_profile) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_icc_transform(VipsImage* in, VipsImage** out, const char* output_profile) { + return vips_icc_transform(in, out, output_profile, NULL); +} + +int vipsgen_icc_transform_with_options(VipsImage* in, VipsImage** out, const char* output_profile, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, gboolean embedded, const char* input_profile, int depth) { + VipsOperation *operation = vips_operation_new("icc_transform"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "output_profile", output_profile, NULL) || + vipsgen_set_int(operation, "pcs", pcs) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_bool(operation, "black_point_compensation", black_point_compensation) || + vipsgen_set_bool(operation, "embedded", embedded) || + vipsgen_set_string(operation, "input_profile", input_profile) || + vipsgen_set_int(operation, "depth", depth) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_identity(VipsImage** out) { + return vips_identity(out, NULL); +} + +int vipsgen_identity_with_options(VipsImage** out, int bands, gboolean ushort, int size) { + VipsOperation *operation = vips_operation_new("identity"); + if (!operation) return 1; + if ( + vipsgen_set_int(operation, "bands", bands) || + vipsgen_set_bool(operation, "ushort", ushort) || + vipsgen_set_int(operation, "size", size) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_ifthenelse(VipsImage* cond, VipsImage* in1, VipsImage* in2, VipsImage** out) { + return vips_ifthenelse(cond, in1, in2, out, NULL); +} + +int vipsgen_ifthenelse_with_options(VipsImage* cond, VipsImage* in1, VipsImage* in2, VipsImage** out, gboolean blend) { + VipsOperation *operation = vips_operation_new("ifthenelse"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "cond", cond, NULL) || + vips_object_set(VIPS_OBJECT(operation), "in1", in1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "in2", in2, NULL) || + vipsgen_set_bool(operation, "blend", blend) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_insert(VipsImage* main, VipsImage* sub, VipsImage** out, int x, int y) { + return vips_insert(main, sub, out, x, y, NULL); +} + +int vipsgen_insert_with_options(VipsImage* main, VipsImage* sub, VipsImage** out, int x, int y, gboolean expand, double* background, int background_n) { + VipsOperation *operation = vips_operation_new("insert"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "main", main, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sub", sub, NULL) || + vips_object_set(VIPS_OBJECT(operation), "x", x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "y", y, NULL) || + vipsgen_set_bool(operation, "expand", expand) || + vipsgen_set_array_double(operation, "background", background_array) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_invert(VipsImage* in, VipsImage** out) { + return vips_invert(in, out, NULL); +} + +int vipsgen_invertlut(VipsImage* in, VipsImage** out) { + return vips_invertlut(in, out, NULL); +} + +int vipsgen_invertlut_with_options(VipsImage* in, VipsImage** out, int size) { + VipsOperation *operation = vips_operation_new("invertlut"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "size", size) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_invfft(VipsImage* in, VipsImage** out) { + return vips_invfft(in, out, NULL); +} + +int vipsgen_invfft_with_options(VipsImage* in, VipsImage** out, gboolean real) { + VipsOperation *operation = vips_operation_new("invfft"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_bool(operation, "real", real) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_join(VipsImage* in1, VipsImage* in2, VipsImage** out, VipsDirection direction) { + return vips_join(in1, in2, out, direction, NULL); +} + +int vipsgen_join_with_options(VipsImage* in1, VipsImage* in2, VipsImage** out, VipsDirection direction, gboolean expand, int shim, double* background, int background_n, VipsAlign align) { + VipsOperation *operation = vips_operation_new("join"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in1", in1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "in2", in2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "direction", direction, NULL) || + vipsgen_set_bool(operation, "expand", expand) || + vipsgen_set_int(operation, "shim", shim) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "align", align) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jp2kload(const char* filename, VipsImage** out) { + return vips_jp2kload(filename, out, NULL); +} + +int vipsgen_jp2kload_with_options(const char* filename, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jp2kload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "oneshot", oneshot) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jp2kload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_jp2kload_buffer(buf, len, out, NULL); +} + +int vipsgen_jp2kload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jp2kload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "oneshot", oneshot) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jp2kload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_jp2kload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_jp2kload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jp2kload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_bool(operation, "oneshot", oneshot) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jp2ksave(VipsImage* in, const char* filename) { + return vips_jp2ksave(in, filename, NULL); +} + +int vipsgen_jp2ksave_with_options(VipsImage* in, const char* filename, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jp2ksave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jp2ksave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_jp2ksave_buffer(in, buf, len, NULL); +} + +int vipsgen_jp2ksave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jp2ksave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jp2ksave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_jp2ksave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_jp2ksave_target_with_options(VipsImage* in, VipsTargetCustom* target, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jp2ksave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jpegload(const char* filename, VipsImage** out) { + return vips_jpegload(filename, out, NULL); +} + +int vipsgen_jpegload_with_options(const char* filename, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jpegload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "shrink", shrink) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jpegload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_jpegload_buffer(buf, len, out, NULL); +} + +int vipsgen_jpegload_buffer_with_options(void* buf, size_t len, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jpegload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "shrink", shrink) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jpegload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_jpegload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_jpegload_source_with_options(VipsSourceCustom* source, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jpegload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "shrink", shrink) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jpegsave(VipsImage* in, const char* filename) { + return vips_jpegsave(in, filename, NULL); +} + +int vipsgen_jpegsave_with_options(VipsImage* in, const char* filename, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jpegsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "optimize_coding", optimize_coding) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "trellis_quant", trellis_quant) || + vipsgen_set_bool(operation, "overshoot_deringing", overshoot_deringing) || + vipsgen_set_bool(operation, "optimize_scans", optimize_scans) || + vipsgen_set_int(operation, "quant_table", quant_table) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "restart_interval", restart_interval) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jpegsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_jpegsave_buffer(in, buf, len, NULL); +} + +int vipsgen_jpegsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jpegsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "optimize_coding", optimize_coding) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "trellis_quant", trellis_quant) || + vipsgen_set_bool(operation, "overshoot_deringing", overshoot_deringing) || + vipsgen_set_bool(operation, "optimize_scans", optimize_scans) || + vipsgen_set_int(operation, "quant_table", quant_table) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "restart_interval", restart_interval) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jpegsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_jpegsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_jpegsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jpegsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "optimize_coding", optimize_coding) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_bool(operation, "trellis_quant", trellis_quant) || + vipsgen_set_bool(operation, "overshoot_deringing", overshoot_deringing) || + vipsgen_set_bool(operation, "optimize_scans", optimize_scans) || + vipsgen_set_int(operation, "quant_table", quant_table) || + vipsgen_set_int(operation, "subsample_mode", subsample_mode) || + vipsgen_set_int(operation, "restart_interval", restart_interval) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jxlload(const char* filename, VipsImage** out) { + return vips_jxlload(filename, out, NULL); +} + +int vipsgen_jxlload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jxlload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jxlload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_jxlload_buffer(buf, len, out, NULL); +} + +int vipsgen_jxlload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jxlload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jxlload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_jxlload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_jxlload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("jxlload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_jxlsave(VipsImage* in, const char* filename) { + return vips_jxlsave(in, filename, NULL); +} + +int vipsgen_jxlsave_with_options(VipsImage* in, const char* filename, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jxlsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "tier", tier) || + vipsgen_set_double(operation, "distance", distance) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jxlsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_jxlsave_buffer(in, buf, len, NULL); +} + +int vipsgen_jxlsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jxlsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "tier", tier) || + vipsgen_set_double(operation, "distance", distance) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_jxlsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_jxlsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_jxlsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("jxlsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "tier", tier) || + vipsgen_set_double(operation, "distance", distance) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_labelregions(VipsImage* in, VipsImage** mask) { + return vips_labelregions(in, mask, NULL); +} + +int vipsgen_linear(VipsImage* in, VipsImage** out, double* a, double* b, int n) { + return vips_linear(in, out, a, b, n, NULL); +} + +int vipsgen_linear_with_options(VipsImage* in, VipsImage** out, double* a, double* b, int n, gboolean uchar) { + VipsOperation *operation = vips_operation_new("linear"); + if (!operation) return 1; + VipsArrayDouble *a_array = NULL; + if (a != NULL && n > 0) { a_array = vips_array_double_new(a, n); } + VipsArrayDouble *b_array = NULL; + if (b != NULL && n > 0) { b_array = vips_array_double_new(b, n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "a", a_array, NULL) || + vips_object_set(VIPS_OBJECT(operation), "b", b_array, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) + ) { + g_object_unref(operation); + if (a_array != NULL) { vips_area_unref(VIPS_AREA(a_array)); } + if (b_array != NULL) { vips_area_unref(VIPS_AREA(b_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (a_array != NULL) { vips_area_unref(VIPS_AREA(a_array)); } + if (b_array != NULL) { vips_area_unref(VIPS_AREA(b_array)); } + return result; +} + +int vipsgen_linecache(VipsImage* in, VipsImage** out) { + return vips_linecache(in, out, NULL); +} + +int vipsgen_linecache_with_options(VipsImage* in, VipsImage** out, int tile_height, VipsAccess access, gboolean threaded, gboolean persistent) { + VipsOperation *operation = vips_operation_new("linecache"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_bool(operation, "threaded", threaded) || + vipsgen_set_bool(operation, "persistent", persistent) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_logmat(VipsImage** out, double sigma, double min_ampl) { + return vips_logmat(out, sigma, min_ampl, NULL); +} + +int vipsgen_logmat_with_options(VipsImage** out, double sigma, double min_ampl, gboolean separable, VipsPrecision precision) { + VipsOperation *operation = vips_operation_new("logmat"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "sigma", sigma, NULL) || + vips_object_set(VIPS_OBJECT(operation), "min_ampl", min_ampl, NULL) || + vipsgen_set_bool(operation, "separable", separable) || + vipsgen_set_int(operation, "precision", precision) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_magickload(const char* filename, VipsImage** out) { + return vips_magickload(filename, out, NULL); +} + +int vipsgen_magickload_with_options(const char* filename, VipsImage** out, const char* density, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("magickload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_string(operation, "density", density) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_magickload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_magickload_buffer(buf, len, out, NULL); +} + +int vipsgen_magickload_buffer_with_options(void* buf, size_t len, VipsImage** out, const char* density, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("magickload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_string(operation, "density", density) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_magicksave(VipsImage* in, const char* filename) { + return vips_magicksave(in, filename, NULL); +} + +int vipsgen_magicksave_with_options(VipsImage* in, const char* filename, const char* format, int quality, gboolean optimize_gif_frames, gboolean optimize_gif_transparency, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("magicksave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_string(operation, "format", format) || + vipsgen_set_int(operation, "quality", quality) || + vipsgen_set_bool(operation, "optimize_gif_frames", optimize_gif_frames) || + vipsgen_set_bool(operation, "optimize_gif_transparency", optimize_gif_transparency) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_magicksave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_magicksave_buffer(in, buf, len, NULL); +} + +int vipsgen_magicksave_buffer_with_options(VipsImage* in, void** buf, size_t* len, const char* format, int quality, gboolean optimize_gif_frames, gboolean optimize_gif_transparency, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("magicksave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_string(operation, "format", format) || + vipsgen_set_int(operation, "quality", quality) || + vipsgen_set_bool(operation, "optimize_gif_frames", optimize_gif_frames) || + vipsgen_set_bool(operation, "optimize_gif_transparency", optimize_gif_transparency) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_mapim(VipsImage* in, VipsImage** out, VipsImage* index) { + return vips_mapim(in, out, index, NULL); +} + +int vipsgen_mapim_with_options(VipsImage* in, VipsImage** out, VipsImage* index, VipsInterpolate* interpolate, double* background, int background_n, gboolean premultiplied, VipsExtend extend) { + VipsOperation *operation = vips_operation_new("mapim"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "index", index, NULL) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_bool(operation, "premultiplied", premultiplied) || + vipsgen_set_int(operation, "extend", extend) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_maplut(VipsImage* in, VipsImage** out, VipsImage* lut) { + return vips_maplut(in, out, lut, NULL); +} + +int vipsgen_maplut_with_options(VipsImage* in, VipsImage** out, VipsImage* lut, int band) { + VipsOperation *operation = vips_operation_new("maplut"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "lut", lut, NULL) || + vipsgen_set_int(operation, "band", band) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_butterworth(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff) { + return vips_mask_butterworth(out, width, height, order, frequency_cutoff, amplitude_cutoff, NULL); +} + +int vipsgen_mask_butterworth_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_butterworth"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "order", order, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_butterworth_band(VipsImage** out, int width, int height, double order, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff) { + return vips_mask_butterworth_band(out, width, height, order, frequency_cutoff_x, frequency_cutoff_y, radius, amplitude_cutoff, NULL); +} + +int vipsgen_mask_butterworth_band_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_butterworth_band"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "order", order, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_x", frequency_cutoff_x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_y", frequency_cutoff_y, NULL) || + vips_object_set(VIPS_OBJECT(operation), "radius", radius, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_butterworth_ring(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, double ringwidth) { + return vips_mask_butterworth_ring(out, width, height, order, frequency_cutoff, amplitude_cutoff, ringwidth, NULL); +} + +int vipsgen_mask_butterworth_ring_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_butterworth_ring"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "order", order, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ringwidth", ringwidth, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_fractal(VipsImage** out, int width, int height, double fractal_dimension) { + return vips_mask_fractal(out, width, height, fractal_dimension, NULL); +} + +int vipsgen_mask_fractal_with_options(VipsImage** out, int width, int height, double fractal_dimension, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_fractal"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "fractal_dimension", fractal_dimension, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_gaussian(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff) { + return vips_mask_gaussian(out, width, height, frequency_cutoff, amplitude_cutoff, NULL); +} + +int vipsgen_mask_gaussian_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_gaussian"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_gaussian_band(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff) { + return vips_mask_gaussian_band(out, width, height, frequency_cutoff_x, frequency_cutoff_y, radius, amplitude_cutoff, NULL); +} + +int vipsgen_mask_gaussian_band_with_options(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_gaussian_band"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_x", frequency_cutoff_x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_y", frequency_cutoff_y, NULL) || + vips_object_set(VIPS_OBJECT(operation), "radius", radius, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_gaussian_ring(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, double ringwidth) { + return vips_mask_gaussian_ring(out, width, height, frequency_cutoff, amplitude_cutoff, ringwidth, NULL); +} + +int vipsgen_mask_gaussian_ring_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_gaussian_ring"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "amplitude_cutoff", amplitude_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ringwidth", ringwidth, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_ideal(VipsImage** out, int width, int height, double frequency_cutoff) { + return vips_mask_ideal(out, width, height, frequency_cutoff, NULL); +} + +int vipsgen_mask_ideal_with_options(VipsImage** out, int width, int height, double frequency_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_ideal"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_ideal_band(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius) { + return vips_mask_ideal_band(out, width, height, frequency_cutoff_x, frequency_cutoff_y, radius, NULL); +} + +int vipsgen_mask_ideal_band_with_options(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_ideal_band"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_x", frequency_cutoff_x, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff_y", frequency_cutoff_y, NULL) || + vips_object_set(VIPS_OBJECT(operation), "radius", radius, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mask_ideal_ring(VipsImage** out, int width, int height, double frequency_cutoff, double ringwidth) { + return vips_mask_ideal_ring(out, width, height, frequency_cutoff, ringwidth, NULL); +} + +int vipsgen_mask_ideal_ring_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical) { + VipsOperation *operation = vips_operation_new("mask_ideal_ring"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "frequency_cutoff", frequency_cutoff, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ringwidth", ringwidth, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_bool(operation, "nodc", nodc) || + vipsgen_set_bool(operation, "reject", reject) || + vipsgen_set_bool(operation, "optical", optical) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_match(VipsImage* ref, VipsImage* sec, VipsImage** out, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2) { + return vips_match(ref, sec, out, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2, NULL); +} + +int vipsgen_match_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2, int hwindow, int harea, gboolean search, VipsInterpolate* interpolate) { + VipsOperation *operation = vips_operation_new("match"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "ref", ref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sec", sec, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xr1", xr1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yr1", yr1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xs1", xs1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ys1", ys1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xr2", xr2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yr2", yr2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xs2", xs2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ys2", ys2, NULL) || + vipsgen_set_int(operation, "hwindow", hwindow) || + vipsgen_set_int(operation, "harea", harea) || + vipsgen_set_bool(operation, "search", search) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_math(VipsImage* in, VipsImage** out, VipsOperationMath math) { + return vips_math(in, out, math, NULL); +} + +int vipsgen_math2(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationMath2 math2) { + return vips_math2(left, right, out, math2, NULL); +} + +int vipsgen_math2_const(VipsImage* in, VipsImage** out, VipsOperationMath2 math2, double* c, int n) { + return vips_math2_const(in, out, math2, c, n, NULL); +} + +int vipsgen_matload(const char* filename, VipsImage** out) { + return vips_matload(filename, out, NULL); +} + +int vipsgen_matload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("matload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_matrixinvert(VipsImage* in, VipsImage** out) { + return vips_matrixinvert(in, out, NULL); +} + +int vipsgen_matrixload(const char* filename, VipsImage** out) { + return vips_matrixload(filename, out, NULL); +} + +int vipsgen_matrixload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("matrixload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_matrixload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_matrixload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_matrixload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("matrixload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_matrixmultiply(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_matrixmultiply(left, right, out, NULL); +} + +int vipsgen_matrixprint(VipsImage* in) { + return vips_matrixprint(in, NULL); +} + +int vipsgen_matrixprint_with_options(VipsImage* in, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("matrixprint"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_matrixsave(VipsImage* in, const char* filename) { + return vips_matrixsave(in, filename, NULL); +} + +int vipsgen_matrixsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("matrixsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_matrixsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_matrixsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_matrixsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("matrixsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_max(VipsImage* in, double* out) { + return vips_max(in, out, NULL); +} + +int vipsgen_max_with_options(VipsImage* in, double* out, int size) { + VipsOperation *operation = vips_operation_new("max"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "size", size) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_maxpair(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_maxpair(left, right, out, NULL); +} + +int vipsgen_measure(VipsImage* in, VipsImage** out, int h, int v) { + return vips_measure(in, out, h, v, NULL); +} + +int vipsgen_measure_with_options(VipsImage* in, VipsImage** out, int h, int v, int left, int top, int width, int height) { + VipsOperation *operation = vips_operation_new("measure"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "h", h, NULL) || + vips_object_set(VIPS_OBJECT(operation), "v", v, NULL) || + vipsgen_set_int(operation, "left", left) || + vipsgen_set_int(operation, "top", top) || + vipsgen_set_int(operation, "width", width) || + vipsgen_set_int(operation, "height", height) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_merge(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int dx, int dy) { + return vips_merge(ref, sec, out, direction, dx, dy, NULL); +} + +int vipsgen_merge_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int dx, int dy, int mblend) { + VipsOperation *operation = vips_operation_new("merge"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "ref", ref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sec", sec, NULL) || + vips_object_set(VIPS_OBJECT(operation), "direction", direction, NULL) || + vips_object_set(VIPS_OBJECT(operation), "dx", dx, NULL) || + vips_object_set(VIPS_OBJECT(operation), "dy", dy, NULL) || + vipsgen_set_int(operation, "mblend", mblend) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_min(VipsImage* in, double* out) { + return vips_min(in, out, NULL); +} + +int vipsgen_min_with_options(VipsImage* in, double* out, int size) { + VipsOperation *operation = vips_operation_new("min"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "size", size) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_minpair(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_minpair(left, right, out, NULL); +} + +int vipsgen_morph(VipsImage* in, VipsImage** out, VipsImage* mask, VipsOperationMorphology morph) { + return vips_morph(in, out, mask, morph, NULL); +} + +int vipsgen_mosaic(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xref, int yref, int xsec, int ysec) { + return vips_mosaic(ref, sec, out, direction, xref, yref, xsec, ysec, NULL); +} + +int vipsgen_mosaic_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xref, int yref, int xsec, int ysec, int hwindow, int harea, int mblend, int bandno) { + VipsOperation *operation = vips_operation_new("mosaic"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "ref", ref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sec", sec, NULL) || + vips_object_set(VIPS_OBJECT(operation), "direction", direction, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xref", xref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yref", yref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xsec", xsec, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ysec", ysec, NULL) || + vipsgen_set_int(operation, "hwindow", hwindow) || + vipsgen_set_int(operation, "harea", harea) || + vipsgen_set_int(operation, "mblend", mblend) || + vipsgen_set_int(operation, "bandno", bandno) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_mosaic1(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2) { + return vips_mosaic1(ref, sec, out, direction, xr1, yr1, xs1, ys1, xr2, yr2, xs2, ys2, NULL); +} + +int vipsgen_mosaic1_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2, int hwindow, int harea, gboolean search, VipsInterpolate* interpolate, int mblend) { + VipsOperation *operation = vips_operation_new("mosaic1"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "ref", ref, NULL) || + vips_object_set(VIPS_OBJECT(operation), "sec", sec, NULL) || + vips_object_set(VIPS_OBJECT(operation), "direction", direction, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xr1", xr1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yr1", yr1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xs1", xs1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ys1", ys1, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xr2", xr2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yr2", yr2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xs2", xs2, NULL) || + vips_object_set(VIPS_OBJECT(operation), "ys2", ys2, NULL) || + vipsgen_set_int(operation, "hwindow", hwindow) || + vipsgen_set_int(operation, "harea", harea) || + vipsgen_set_bool(operation, "search", search) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) || + vipsgen_set_int(operation, "mblend", mblend) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_msb(VipsImage* in, VipsImage** out) { + return vips_msb(in, out, NULL); +} + +int vipsgen_msb_with_options(VipsImage* in, VipsImage** out, int band) { + VipsOperation *operation = vips_operation_new("msb"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "band", band) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_multiply(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_multiply(left, right, out, NULL); +} + +int vipsgen_niftiload(const char* filename, VipsImage** out) { + return vips_niftiload(filename, out, NULL); +} + +int vipsgen_niftiload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("niftiload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_niftiload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_niftiload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_niftiload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("niftiload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_niftisave(VipsImage* in, const char* filename) { + return vips_niftisave(in, filename, NULL); +} + +int vipsgen_niftisave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("niftisave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_openexrload(const char* filename, VipsImage** out) { + return vips_openexrload(filename, out, NULL); +} + +int vipsgen_openexrload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("openexrload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_openslideload(const char* filename, VipsImage** out) { + return vips_openslideload(filename, out, NULL); +} + +int vipsgen_openslideload_with_options(const char* filename, VipsImage** out, int level, gboolean autocrop, const char* associated, gboolean attach_associated, gboolean rgb, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("openslideload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "level", level) || + vipsgen_set_bool(operation, "autocrop", autocrop) || + vipsgen_set_string(operation, "associated", associated) || + vipsgen_set_bool(operation, "attach_associated", attach_associated) || + vipsgen_set_bool(operation, "rgb", rgb) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_openslideload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_openslideload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_openslideload_source_with_options(VipsSourceCustom* source, VipsImage** out, int level, gboolean autocrop, const char* associated, gboolean attach_associated, gboolean rgb, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("openslideload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "level", level) || + vipsgen_set_bool(operation, "autocrop", autocrop) || + vipsgen_set_string(operation, "associated", associated) || + vipsgen_set_bool(operation, "attach_associated", attach_associated) || + vipsgen_set_bool(operation, "rgb", rgb) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_pdfload(const char* filename, VipsImage** out) { + return vips_pdfload(filename, out, NULL); +} + +int vipsgen_pdfload_with_options(const char* filename, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pdfload"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_string(operation, "password", password) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_pdfload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_pdfload_buffer(buf, len, out, NULL); +} + +int vipsgen_pdfload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pdfload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_string(operation, "password", password) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_pdfload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_pdfload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_pdfload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pdfload_source"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_string(operation, "password", password) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_percent(VipsImage* in, double percent, int* threshold) { + return vips_percent(in, percent, threshold, NULL); +} + +int vipsgen_perlin(VipsImage** out, int width, int height) { + return vips_perlin(out, width, height, NULL); +} + +int vipsgen_perlin_with_options(VipsImage** out, int width, int height, int cell_size, gboolean uchar, int seed) { + VipsOperation *operation = vips_operation_new("perlin"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "cell_size", cell_size) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_int(operation, "seed", seed) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_phasecor(VipsImage* in, VipsImage* in2, VipsImage** out) { + return vips_phasecor(in, in2, out, NULL); +} + +int vipsgen_pngload(const char* filename, VipsImage** out) { + return vips_pngload(filename, out, NULL); +} + +int vipsgen_pngload_with_options(const char* filename, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pngload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_pngload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_pngload_buffer(buf, len, out, NULL); +} + +int vipsgen_pngload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pngload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_pngload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_pngload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_pngload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("pngload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_pngsave(VipsImage* in, const char* filename) { + return vips_pngsave(in, filename, NULL); +} + +int vipsgen_pngsave_with_options(VipsImage* in, const char* filename, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("pngsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_int(operation, "filter", filter) || + vipsgen_set_bool(operation, "palette", palette) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_pngsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_pngsave_buffer(in, buf, len, NULL); +} + +int vipsgen_pngsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("pngsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_int(operation, "filter", filter) || + vipsgen_set_bool(operation, "palette", palette) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_pngsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_pngsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_pngsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("pngsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_bool(operation, "interlace", interlace) || + vipsgen_set_int(operation, "filter", filter) || + vipsgen_set_bool(operation, "palette", palette) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_double(operation, "dither", dither) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_ppmload(const char* filename, VipsImage** out) { + return vips_ppmload(filename, out, NULL); +} + +int vipsgen_ppmload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("ppmload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_ppmload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_ppmload_buffer(buf, len, out, NULL); +} + +int vipsgen_ppmload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("ppmload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_ppmload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_ppmload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_ppmload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("ppmload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_ppmsave(VipsImage* in, const char* filename) { + return vips_ppmsave(in, filename, NULL); +} + +int vipsgen_ppmsave_with_options(VipsImage* in, const char* filename, VipsForeignPpmFormat format, gboolean ascii, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("ppmsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "format", format) || + vipsgen_set_bool(operation, "ascii", ascii) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_ppmsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_ppmsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_ppmsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignPpmFormat format, gboolean ascii, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("ppmsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "format", format) || + vipsgen_set_bool(operation, "ascii", ascii) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_premultiply(VipsImage* in, VipsImage** out) { + return vips_premultiply(in, out, NULL); +} + +int vipsgen_premultiply_with_options(VipsImage* in, VipsImage** out, double max_alpha) { + VipsOperation *operation = vips_operation_new("premultiply"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "max_alpha", max_alpha) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_prewitt(VipsImage* in, VipsImage** out) { + return vips_prewitt(in, out, NULL); +} + +int vipsgen_profile(VipsImage* in, VipsImage** columns, VipsImage** rows) { + return vips_profile(in, columns, rows, NULL); +} + +int vipsgen_profile_load(const char* name, VipsBlob** profile) { + return vips_profile_load(name, profile, NULL); +} + +int vipsgen_project(VipsImage* in, VipsImage** columns, VipsImage** rows) { + return vips_project(in, columns, rows, NULL); +} + +int vipsgen_quadratic(VipsImage* in, VipsImage** out, VipsImage* coeff) { + return vips_quadratic(in, out, coeff, NULL); +} + +int vipsgen_quadratic_with_options(VipsImage* in, VipsImage** out, VipsImage* coeff, VipsInterpolate* interpolate) { + VipsOperation *operation = vips_operation_new("quadratic"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "coeff", coeff, NULL) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_rad2float(VipsImage* in, VipsImage** out) { + return vips_rad2float(in, out, NULL); +} + +int vipsgen_radload(const char* filename, VipsImage** out) { + return vips_radload(filename, out, NULL); +} + +int vipsgen_radload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("radload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_radload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_radload_buffer(buf, len, out, NULL); +} + +int vipsgen_radload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("radload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_radload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_radload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_radload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("radload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_radsave(VipsImage* in, const char* filename) { + return vips_radsave(in, filename, NULL); +} + +int vipsgen_radsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("radsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_radsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_radsave_buffer(in, buf, len, NULL); +} + +int vipsgen_radsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("radsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_radsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_radsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_radsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("radsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_rank(VipsImage* in, VipsImage** out, int width, int height, int index) { + return vips_rank(in, out, width, height, index, NULL); +} + +int vipsgen_rawload(const char* filename, VipsImage** out, int width, int height, int bands) { + return vips_rawload(filename, out, width, height, bands, NULL); +} + +int vipsgen_rawload_with_options(const char* filename, VipsImage** out, int width, int height, int bands, guint64 offset, VipsBandFormat format, VipsInterpretation interpretation, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("rawload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "bands", bands, NULL) || + vipsgen_set_guint64(operation, "offset", offset) || + vipsgen_set_int(operation, "format", format) || + vipsgen_set_int(operation, "interpretation", interpretation) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_rawsave(VipsImage* in, const char* filename) { + return vips_rawsave(in, filename, NULL); +} + +int vipsgen_rawsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("rawsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_rawsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_rawsave_buffer(in, buf, len, NULL); +} + +int vipsgen_rawsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("rawsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_rawsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_rawsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_rawsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("rawsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_recomb(VipsImage* in, VipsImage** out, VipsImage* m) { + return vips_recomb(in, out, m, NULL); +} + +int vipsgen_reduce(VipsImage* in, VipsImage** out, double hshrink, double vshrink) { + return vips_reduce(in, out, hshrink, vshrink, NULL); +} + +int vipsgen_reduce_with_options(VipsImage* in, VipsImage** out, double hshrink, double vshrink, VipsKernel kernel, double gap) { + VipsOperation *operation = vips_operation_new("reduce"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "hshrink", hshrink, NULL) || + vips_object_set(VIPS_OBJECT(operation), "vshrink", vshrink, NULL) || + vipsgen_set_int(operation, "kernel", kernel) || + vipsgen_set_double(operation, "gap", gap) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_reduceh(VipsImage* in, VipsImage** out, double hshrink) { + return vips_reduceh(in, out, hshrink, NULL); +} + +int vipsgen_reduceh_with_options(VipsImage* in, VipsImage** out, double hshrink, VipsKernel kernel, double gap) { + VipsOperation *operation = vips_operation_new("reduceh"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "hshrink", hshrink, NULL) || + vipsgen_set_int(operation, "kernel", kernel) || + vipsgen_set_double(operation, "gap", gap) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_reducev(VipsImage* in, VipsImage** out, double vshrink) { + return vips_reducev(in, out, vshrink, NULL); +} + +int vipsgen_reducev_with_options(VipsImage* in, VipsImage** out, double vshrink, VipsKernel kernel, double gap) { + VipsOperation *operation = vips_operation_new("reducev"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "vshrink", vshrink, NULL) || + vipsgen_set_int(operation, "kernel", kernel) || + vipsgen_set_double(operation, "gap", gap) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_relational(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationRelational relational) { + return vips_relational(left, right, out, relational, NULL); +} + +int vipsgen_relational_const(VipsImage* in, VipsImage** out, VipsOperationRelational relational, double* c, int n) { + return vips_relational_const(in, out, relational, c, n, NULL); +} + +int vipsgen_remainder(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_remainder(left, right, out, NULL); +} + +int vipsgen_remainder_const(VipsImage* in, VipsImage** out, double* c, int n) { + return vips_remainder_const(in, out, c, n, NULL); +} + +int vipsgen_remosaic(VipsImage* in, VipsImage** out, const char* old_str, const char* new_str) { + return vips_remosaic(in, out, old_str, new_str, NULL); +} + +int vipsgen_replicate(VipsImage* in, VipsImage** out, int across, int down) { + return vips_replicate(in, out, across, down, NULL); +} + +int vipsgen_resize(VipsImage* in, VipsImage** out, double scale) { + return vips_resize(in, out, scale, NULL); +} + +int vipsgen_resize_with_options(VipsImage* in, VipsImage** out, double scale, VipsKernel kernel, double gap, double vscale) { + VipsOperation *operation = vips_operation_new("resize"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "scale", scale, NULL) || + vipsgen_set_int(operation, "kernel", kernel) || + vipsgen_set_double(operation, "gap", gap) || + vipsgen_set_double(operation, "vscale", vscale) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_rot(VipsImage* in, VipsImage** out, VipsAngle angle) { + return vips_rot(in, out, angle, NULL); +} + +int vipsgen_rot45(VipsImage* in, VipsImage** out) { + return vips_rot45(in, out, NULL); +} + +int vipsgen_rot45_with_options(VipsImage* in, VipsImage** out, VipsAngle45 angle) { + VipsOperation *operation = vips_operation_new("rot45"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "angle", angle) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_rotate(VipsImage* in, VipsImage** out, double angle) { + return vips_rotate(in, out, angle, NULL); +} + +int vipsgen_rotate_with_options(VipsImage* in, VipsImage** out, double angle, VipsInterpolate* interpolate, double* background, int background_n, double odx, double ody, double idx, double idy) { + VipsOperation *operation = vips_operation_new("rotate"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "angle", angle, NULL) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_double(operation, "odx", odx) || + vipsgen_set_double(operation, "ody", ody) || + vipsgen_set_double(operation, "idx", idx) || + vipsgen_set_double(operation, "idy", idy) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_round(VipsImage* in, VipsImage** out, VipsOperationRound round) { + return vips_round(in, out, round, NULL); +} + +int vipsgen_sRGB2HSV(VipsImage* in, VipsImage** out) { + return vips_sRGB2HSV(in, out, NULL); +} + +int vipsgen_sRGB2scRGB(VipsImage* in, VipsImage** out) { + return vips_sRGB2scRGB(in, out, NULL); +} + +int vipsgen_scRGB2BW(VipsImage* in, VipsImage** out) { + return vips_scRGB2BW(in, out, NULL); +} + +int vipsgen_scRGB2BW_with_options(VipsImage* in, VipsImage** out, int depth) { + VipsOperation *operation = vips_operation_new("scRGB2BW"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "depth", depth) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_scRGB2XYZ(VipsImage* in, VipsImage** out) { + return vips_scRGB2XYZ(in, out, NULL); +} + +int vipsgen_scRGB2sRGB(VipsImage* in, VipsImage** out) { + return vips_scRGB2sRGB(in, out, NULL); +} + +int vipsgen_scRGB2sRGB_with_options(VipsImage* in, VipsImage** out, int depth) { + VipsOperation *operation = vips_operation_new("scRGB2sRGB"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "depth", depth) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_scale(VipsImage* in, VipsImage** out) { + return vips_scale(in, out, NULL); +} + +int vipsgen_scale_with_options(VipsImage* in, VipsImage** out, double exp, gboolean log) { + VipsOperation *operation = vips_operation_new("scale"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "exp", exp) || + vipsgen_set_bool(operation, "log", log) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_scharr(VipsImage* in, VipsImage** out) { + return vips_scharr(in, out, NULL); +} + +int vipsgen_sdf(VipsImage** out, int width, int height, VipsSdfShape shape) { + return vips_sdf(out, width, height, shape, NULL); +} + +int vipsgen_sdf_with_options(VipsImage** out, int width, int height, VipsSdfShape shape, double r, double* a, int a_n, double* b, int b_n, double* corners, int corners_n) { + VipsOperation *operation = vips_operation_new("sdf"); + if (!operation) return 1; + VipsArrayDouble *a_array = NULL; + if (a != NULL && a_n > 0) { a_array = vips_array_double_new(a, a_n); } + VipsArrayDouble *b_array = NULL; + if (b != NULL && b_n > 0) { b_array = vips_array_double_new(b, b_n); } + VipsArrayDouble *corners_array = NULL; + if (corners != NULL && corners_n > 0) { corners_array = vips_array_double_new(corners, corners_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vips_object_set(VIPS_OBJECT(operation), "shape", shape, NULL) || + vipsgen_set_double(operation, "r", r) || + vipsgen_set_array_double(operation, "a", a_array) || + vipsgen_set_array_double(operation, "b", b_array) || + vipsgen_set_array_double(operation, "corners", corners_array) + ) { + g_object_unref(operation); + if (a_array != NULL) { vips_area_unref(VIPS_AREA(a_array)); } + if (b_array != NULL) { vips_area_unref(VIPS_AREA(b_array)); } + if (corners_array != NULL) { vips_area_unref(VIPS_AREA(corners_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (a_array != NULL) { vips_area_unref(VIPS_AREA(a_array)); } + if (b_array != NULL) { vips_area_unref(VIPS_AREA(b_array)); } + if (corners_array != NULL) { vips_area_unref(VIPS_AREA(corners_array)); } + return result; +} + +int vipsgen_sequential(VipsImage* in, VipsImage** out) { + return vips_sequential(in, out, NULL); +} + +int vipsgen_sequential_with_options(VipsImage* in, VipsImage** out, int tile_height) { + VipsOperation *operation = vips_operation_new("sequential"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "tile_height", tile_height) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_sharpen(VipsImage* in, VipsImage** out) { + return vips_sharpen(in, out, NULL); +} + +int vipsgen_sharpen_with_options(VipsImage* in, VipsImage** out, double sigma, double x1, double y2, double y3, double m1, double m2) { + VipsOperation *operation = vips_operation_new("sharpen"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "sigma", sigma) || + vipsgen_set_double(operation, "x1", x1) || + vipsgen_set_double(operation, "y2", y2) || + vipsgen_set_double(operation, "y3", y3) || + vipsgen_set_double(operation, "m1", m1) || + vipsgen_set_double(operation, "m2", m2) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_shrink(VipsImage* in, VipsImage** out, double hshrink, double vshrink) { + return vips_shrink(in, out, hshrink, vshrink, NULL); +} + +int vipsgen_shrink_with_options(VipsImage* in, VipsImage** out, double hshrink, double vshrink, gboolean ceil) { + VipsOperation *operation = vips_operation_new("shrink"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "hshrink", hshrink, NULL) || + vips_object_set(VIPS_OBJECT(operation), "vshrink", vshrink, NULL) || + vipsgen_set_bool(operation, "ceil", ceil) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_shrinkh(VipsImage* in, VipsImage** out, int hshrink) { + return vips_shrinkh(in, out, hshrink, NULL); +} + +int vipsgen_shrinkh_with_options(VipsImage* in, VipsImage** out, int hshrink, gboolean ceil) { + VipsOperation *operation = vips_operation_new("shrinkh"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "hshrink", hshrink, NULL) || + vipsgen_set_bool(operation, "ceil", ceil) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_shrinkv(VipsImage* in, VipsImage** out, int vshrink) { + return vips_shrinkv(in, out, vshrink, NULL); +} + +int vipsgen_shrinkv_with_options(VipsImage* in, VipsImage** out, int vshrink, gboolean ceil) { + VipsOperation *operation = vips_operation_new("shrinkv"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "vshrink", vshrink, NULL) || + vipsgen_set_bool(operation, "ceil", ceil) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_sign(VipsImage* in, VipsImage** out) { + return vips_sign(in, out, NULL); +} + +int vipsgen_similarity(VipsImage* in, VipsImage** out) { + return vips_similarity(in, out, NULL); +} + +int vipsgen_similarity_with_options(VipsImage* in, VipsImage** out, double scale, double angle, VipsInterpolate* interpolate, double* background, int background_n, double odx, double ody, double idx, double idy) { + VipsOperation *operation = vips_operation_new("similarity"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_double(operation, "angle", angle) || + vipsgen_set_interpolate(operation, "interpolate", interpolate) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_double(operation, "odx", odx) || + vipsgen_set_double(operation, "ody", ody) || + vipsgen_set_double(operation, "idx", idx) || + vipsgen_set_double(operation, "idy", idy) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_sines(VipsImage** out, int width, int height) { + return vips_sines(out, width, height, NULL); +} + +int vipsgen_sines_with_options(VipsImage** out, int width, int height, gboolean uchar, double hfreq, double vfreq) { + VipsOperation *operation = vips_operation_new("sines"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) || + vipsgen_set_double(operation, "hfreq", hfreq) || + vipsgen_set_double(operation, "vfreq", vfreq) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_smartcrop(VipsImage* input, VipsImage** out, int width, int height) { + return vips_smartcrop(input, out, width, height, NULL); +} + +int vipsgen_smartcrop_with_options(VipsImage* input, VipsImage** out, int width, int height, VipsInteresting interesting, gboolean premultiplied) { + VipsOperation *operation = vips_operation_new("smartcrop"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "input", input, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "interesting", interesting) || + vipsgen_set_bool(operation, "premultiplied", premultiplied) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_sobel(VipsImage* in, VipsImage** out) { + return vips_sobel(in, out, NULL); +} + +int vipsgen_spcor(VipsImage* in, VipsImage* ref, VipsImage** out) { + return vips_spcor(in, ref, out, NULL); +} + +int vipsgen_spectrum(VipsImage* in, VipsImage** out) { + return vips_spectrum(in, out, NULL); +} + +int vipsgen_stats(VipsImage* in, VipsImage** out) { + return vips_stats(in, out, NULL); +} + +int vipsgen_stdif(VipsImage* in, VipsImage** out, int width, int height) { + return vips_stdif(in, out, width, height, NULL); +} + +int vipsgen_stdif_with_options(VipsImage* in, VipsImage** out, int width, int height, double s0, double b, double m0, double a) { + VipsOperation *operation = vips_operation_new("stdif"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_double(operation, "s0", s0) || + vipsgen_set_double(operation, "b", b) || + vipsgen_set_double(operation, "m0", m0) || + vipsgen_set_double(operation, "a", a) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_subsample(VipsImage* input, VipsImage** out, int xfac, int yfac) { + return vips_subsample(input, out, xfac, yfac, NULL); +} + +int vipsgen_subsample_with_options(VipsImage* input, VipsImage** out, int xfac, int yfac, gboolean point) { + VipsOperation *operation = vips_operation_new("subsample"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "input", input, NULL) || + vips_object_set(VIPS_OBJECT(operation), "xfac", xfac, NULL) || + vips_object_set(VIPS_OBJECT(operation), "yfac", yfac, NULL) || + vipsgen_set_bool(operation, "point", point) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_subtract(VipsImage* left, VipsImage* right, VipsImage** out) { + return vips_subtract(left, right, out, NULL); +} + +int vipsgen_sum(VipsImage** in, VipsImage** out, int n) { + return vips_sum(in, out, n, NULL); +} + +int vipsgen_svgload(const char* filename, VipsImage** out) { + return vips_svgload(filename, out, NULL); +} + +int vipsgen_svgload_with_options(const char* filename, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("svgload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_string(operation, "stylesheet", stylesheet) || + vipsgen_set_bool(operation, "high_bitdepth", high_bitdepth) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_svgload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_svgload_buffer(buf, len, out, NULL); +} + +int vipsgen_svgload_buffer_with_options(void* buf, size_t len, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("svgload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_string(operation, "stylesheet", stylesheet) || + vipsgen_set_bool(operation, "high_bitdepth", high_bitdepth) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_svgload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_svgload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_svgload_source_with_options(VipsSourceCustom* source, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("svgload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_double(operation, "dpi", dpi) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_string(operation, "stylesheet", stylesheet) || + vipsgen_set_bool(operation, "high_bitdepth", high_bitdepth) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_switch(VipsImage** tests, VipsImage** out, int n) { + return vips_switch(tests, out, n, NULL); +} + +int vipsgen_system(const char* cmd_format) { + return vips_system(cmd_format, NULL); +} + +int vipsgen_system_with_options(const char* cmd_format, VipsImage** in, int in_n, const char* out_format, const char* in_format) { + VipsOperation *operation = vips_operation_new("system"); + if (!operation) return 1; + VipsArrayImage *in_array = NULL; + if (in != NULL && in_n > 0) { in_array = vips_array_image_new(in, in_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "cmd_format", cmd_format, NULL) || + vipsgen_set_array_image(operation, "in", in_array) || + vipsgen_set_string(operation, "out_format", out_format) || + vipsgen_set_string(operation, "in_format", in_format) + ) { + g_object_unref(operation); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (in_array != NULL) { vips_area_unref(VIPS_AREA(in_array)); } + return result; +} + +int vipsgen_text(VipsImage** out, const char* text) { + return vips_text(out, text, NULL); +} + +int vipsgen_text_with_options(VipsImage** out, const char* text, const char* font, int width, int height, VipsAlign align, gboolean justify, int dpi, int spacing, const char* fontfile, gboolean rgba, VipsTextWrap wrap) { + VipsOperation *operation = vips_operation_new("text"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "text", text, NULL) || + vipsgen_set_string(operation, "font", font) || + vipsgen_set_int(operation, "width", width) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "align", align) || + vipsgen_set_bool(operation, "justify", justify) || + vipsgen_set_int(operation, "dpi", dpi) || + vipsgen_set_int(operation, "spacing", spacing) || + vipsgen_set_string(operation, "fontfile", fontfile) || + vipsgen_set_bool(operation, "rgba", rgba) || + vipsgen_set_int(operation, "wrap", wrap) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_thumbnail(const char* filename, VipsImage** out, int width) { + return vips_thumbnail(filename, out, width, NULL); +} + +int vipsgen_thumbnail_with_options(const char* filename, VipsImage** out, int width, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on) { + VipsOperation *operation = vips_operation_new("thumbnail"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "size", size) || + vipsgen_set_bool(operation, "no_rotate", no_rotate) || + vipsgen_set_int(operation, "crop", crop) || + vipsgen_set_bool(operation, "linear", linear) || + vipsgen_set_string(operation, "input_profile", input_profile) || + vipsgen_set_string(operation, "output_profile", output_profile) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_int(operation, "fail_on", fail_on) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_thumbnail_buffer(void* buf, size_t len, VipsImage** out, int width) { + return vips_thumbnail_buffer(buf, len, out, width, NULL); +} + +int vipsgen_thumbnail_buffer_with_options(void* buf, size_t len, VipsImage** out, int width, const char* option_string, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on) { + VipsOperation *operation = vips_operation_new("thumbnail_buffer"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "buf", buf, NULL) || + vips_object_set(VIPS_OBJECT(operation), "len", len, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vipsgen_set_string(operation, "option_string", option_string) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "size", size) || + vipsgen_set_bool(operation, "no_rotate", no_rotate) || + vipsgen_set_int(operation, "crop", crop) || + vipsgen_set_bool(operation, "linear", linear) || + vipsgen_set_string(operation, "input_profile", input_profile) || + vipsgen_set_string(operation, "output_profile", output_profile) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_int(operation, "fail_on", fail_on) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_thumbnail_image(VipsImage* in, VipsImage** out, int width) { + return vips_thumbnail_image(in, out, width, NULL); +} + +int vipsgen_thumbnail_image_with_options(VipsImage* in, VipsImage** out, int width, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on) { + VipsOperation *operation = vips_operation_new("thumbnail_image"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "size", size) || + vipsgen_set_bool(operation, "no_rotate", no_rotate) || + vipsgen_set_int(operation, "crop", crop) || + vipsgen_set_bool(operation, "linear", linear) || + vipsgen_set_string(operation, "input_profile", input_profile) || + vipsgen_set_string(operation, "output_profile", output_profile) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_int(operation, "fail_on", fail_on) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_thumbnail_source(VipsSourceCustom* source, VipsImage** out, int width) { + return vips_thumbnail_source((VipsSource*) source, out, width, NULL); +} + +int vipsgen_thumbnail_source_with_options(VipsSourceCustom* source, VipsImage** out, int width, const char* option_string, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on) { + VipsOperation *operation = vips_operation_new("thumbnail_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vipsgen_set_string(operation, "option_string", option_string) || + vipsgen_set_int(operation, "height", height) || + vipsgen_set_int(operation, "size", size) || + vipsgen_set_bool(operation, "no_rotate", no_rotate) || + vipsgen_set_int(operation, "crop", crop) || + vipsgen_set_bool(operation, "linear", linear) || + vipsgen_set_string(operation, "input_profile", input_profile) || + vipsgen_set_string(operation, "output_profile", output_profile) || + vipsgen_set_int(operation, "intent", intent) || + vipsgen_set_int(operation, "fail_on", fail_on) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_tiffload(const char* filename, VipsImage** out) { + return vips_tiffload(filename, out, NULL); +} + +int vipsgen_tiffload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("tiffload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_int(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_tiffload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_tiffload_buffer(buf, len, out, NULL); +} + +int vipsgen_tiffload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("tiffload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_int(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_tiffload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_tiffload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_tiffload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("tiffload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_bool(operation, "autorotate", autorotate) || + vipsgen_set_int(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "unlimited", unlimited) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_tiffsave(VipsImage* in, const char* filename) { + return vips_tiffsave(in, filename, NULL); +} + +int vipsgen_tiffsave_with_options(VipsImage* in, const char* filename, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("tiffsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "predictor", predictor) || + vipsgen_set_bool(operation, "tile", tile) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "pyramid", pyramid) || + vipsgen_set_bool(operation, "miniswhite", miniswhite) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "resunit", resunit) || + vipsgen_set_double(operation, "xres", xres) || + vipsgen_set_double(operation, "yres", yres) || + vipsgen_set_bool(operation, "bigtiff", bigtiff) || + vipsgen_set_bool(operation, "properties", properties) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "level", level) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_bool(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "premultiply", premultiply) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_tiffsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_tiffsave_buffer(in, buf, len, NULL); +} + +int vipsgen_tiffsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("tiffsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "predictor", predictor) || + vipsgen_set_bool(operation, "tile", tile) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "pyramid", pyramid) || + vipsgen_set_bool(operation, "miniswhite", miniswhite) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "resunit", resunit) || + vipsgen_set_double(operation, "xres", xres) || + vipsgen_set_double(operation, "yres", yres) || + vipsgen_set_bool(operation, "bigtiff", bigtiff) || + vipsgen_set_bool(operation, "properties", properties) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "level", level) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_bool(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "premultiply", premultiply) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_tiffsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_tiffsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_tiffsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("tiffsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "compression", compression) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_int(operation, "predictor", predictor) || + vipsgen_set_bool(operation, "tile", tile) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_bool(operation, "pyramid", pyramid) || + vipsgen_set_bool(operation, "miniswhite", miniswhite) || + vipsgen_set_int(operation, "bitdepth", bitdepth) || + vipsgen_set_int(operation, "resunit", resunit) || + vipsgen_set_double(operation, "xres", xres) || + vipsgen_set_double(operation, "yres", yres) || + vipsgen_set_bool(operation, "bigtiff", bigtiff) || + vipsgen_set_bool(operation, "properties", properties) || + vipsgen_set_int(operation, "region_shrink", region_shrink) || + vipsgen_set_int(operation, "level", level) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "depth", depth) || + vipsgen_set_bool(operation, "subifd", subifd) || + vipsgen_set_bool(operation, "premultiply", premultiply) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_tilecache(VipsImage* in, VipsImage** out) { + return vips_tilecache(in, out, NULL); +} + +int vipsgen_tilecache_with_options(VipsImage* in, VipsImage** out, int tile_width, int tile_height, int max_tiles, VipsAccess access, gboolean threaded, gboolean persistent) { + VipsOperation *operation = vips_operation_new("tilecache"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "tile_width", tile_width) || + vipsgen_set_int(operation, "tile_height", tile_height) || + vipsgen_set_int(operation, "max_tiles", max_tiles) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_bool(operation, "threaded", threaded) || + vipsgen_set_bool(operation, "persistent", persistent) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_tonelut(VipsImage** out) { + return vips_tonelut(out, NULL); +} + +int vipsgen_tonelut_with_options(VipsImage** out, int in_max, int out_max, double Lb, double Lw, double Ps, double Pm, double Ph, double S, double M, double H) { + VipsOperation *operation = vips_operation_new("tonelut"); + if (!operation) return 1; + if ( + vipsgen_set_int(operation, "in_max", in_max) || + vipsgen_set_int(operation, "out_max", out_max) || + vipsgen_set_double(operation, "Lb", Lb) || + vipsgen_set_double(operation, "Lw", Lw) || + vipsgen_set_double(operation, "Ps", Ps) || + vipsgen_set_double(operation, "Pm", Pm) || + vipsgen_set_double(operation, "Ph", Ph) || + vipsgen_set_double(operation, "S", S) || + vipsgen_set_double(operation, "M", M) || + vipsgen_set_double(operation, "H", H) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_transpose3d(VipsImage* in, VipsImage** out) { + return vips_transpose3d(in, out, NULL); +} + +int vipsgen_transpose3d_with_options(VipsImage* in, VipsImage** out, int page_height) { + VipsOperation *operation = vips_operation_new("transpose3d"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "page_height", page_height) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_unpremultiply(VipsImage* in, VipsImage** out) { + return vips_unpremultiply(in, out, NULL); +} + +int vipsgen_unpremultiply_with_options(VipsImage* in, VipsImage** out, double max_alpha, int alpha_band) { + VipsOperation *operation = vips_operation_new("unpremultiply"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_double(operation, "max_alpha", max_alpha) || + vipsgen_set_int(operation, "alpha_band", alpha_band) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_vipsload(const char* filename, VipsImage** out) { + return vips_vipsload(filename, out, NULL); +} + +int vipsgen_vipsload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("vipsload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_vipsload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_vipsload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_vipsload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("vipsload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_vipssave(VipsImage* in, const char* filename) { + return vips_vipssave(in, filename, NULL); +} + +int vipsgen_vipssave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("vipssave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_vipssave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_vipssave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_vipssave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("vipssave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_webpload(const char* filename, VipsImage** out) { + return vips_webpload(filename, out, NULL); +} + +int vipsgen_webpload_with_options(const char* filename, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("webpload"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_webpload_buffer(void* buf, size_t len, VipsImage** out) { + return vips_webpload_buffer(buf, len, out, NULL); +} + +int vipsgen_webpload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("webpload_buffer"); + if (!operation) return 1; + VipsBlob *blob = vips_blob_new(NULL, buf, len); + if (!blob) { g_object_unref(operation); return 1; } + if ( + vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + vips_area_unref((VipsArea *)blob); + g_object_unref(operation); + return 1; + } + vips_area_unref((VipsArea *)blob); + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_webpload_source(VipsSourceCustom* source, VipsImage** out) { + return vips_webpload_source((VipsSource*) source, out, NULL); +} + +int vipsgen_webpload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate) { + VipsOperation *operation = vips_operation_new("webpload_source"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "source", (VipsSource*)source, NULL) || + vipsgen_set_int(operation, "page", page) || + vipsgen_set_int(operation, "n", n) || + vipsgen_set_double(operation, "scale", scale) || + vipsgen_set_bool(operation, "memory", memory) || + vipsgen_set_int(operation, "access", access) || + vipsgen_set_int(operation, "fail_on", fail_on) || + vipsgen_set_bool(operation, "revalidate", revalidate) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_webpsave(VipsImage* in, const char* filename) { + return vips_webpsave(in, filename, NULL); +} + +int vipsgen_webpsave_with_options(VipsImage* in, const char* filename, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("webpsave"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "filename", filename, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "preset", preset) || + vipsgen_set_bool(operation, "smart_subsample", smart_subsample) || + vipsgen_set_bool(operation, "near_lossless", near_lossless) || + vipsgen_set_int(operation, "alpha_q", alpha_q) || + vipsgen_set_bool(operation, "min_size", min_size) || + vipsgen_set_int(operation, "kmin", kmin) || + vipsgen_set_int(operation, "kmax", kmax) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "target_size", target_size) || + vipsgen_set_bool(operation, "mixed", mixed) || + vipsgen_set_bool(operation, "smart_deblock", smart_deblock) || + vipsgen_set_int(operation, "passes", passes) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_webpsave_buffer(VipsImage* in, void** buf, size_t* len) { + return vips_webpsave_buffer(in, buf, len, NULL); +} + +int vipsgen_webpsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("webpsave_buffer"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "preset", preset) || + vipsgen_set_bool(operation, "smart_subsample", smart_subsample) || + vipsgen_set_bool(operation, "near_lossless", near_lossless) || + vipsgen_set_int(operation, "alpha_q", alpha_q) || + vipsgen_set_bool(operation, "min_size", min_size) || + vipsgen_set_int(operation, "kmin", kmin) || + vipsgen_set_int(operation, "kmax", kmax) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "target_size", target_size) || + vipsgen_set_bool(operation, "mixed", mixed) || + vipsgen_set_bool(operation, "smart_deblock", smart_deblock) || + vipsgen_set_int(operation, "passes", passes) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_save_buffer(operation, buf, len); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_webpsave_target(VipsImage* in, VipsTargetCustom* target) { + return vips_webpsave_target(in, (VipsTarget*) target, NULL); +} + +int vipsgen_webpsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile) { + VipsOperation *operation = vips_operation_new("webpsave_target"); + if (!operation) return 1; + VipsArrayDouble *background_array = NULL; + if (background != NULL && background_n > 0) { background_array = vips_array_double_new(background, background_n); } + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vips_object_set(VIPS_OBJECT(operation), "target", (VipsTarget*)target, NULL) || + vipsgen_set_int(operation, "Q", Q) || + vipsgen_set_bool(operation, "lossless", lossless) || + vipsgen_set_int(operation, "preset", preset) || + vipsgen_set_bool(operation, "smart_subsample", smart_subsample) || + vipsgen_set_bool(operation, "near_lossless", near_lossless) || + vipsgen_set_int(operation, "alpha_q", alpha_q) || + vipsgen_set_bool(operation, "min_size", min_size) || + vipsgen_set_int(operation, "kmin", kmin) || + vipsgen_set_int(operation, "kmax", kmax) || + vipsgen_set_int(operation, "effort", effort) || + vipsgen_set_int(operation, "target_size", target_size) || + vipsgen_set_bool(operation, "mixed", mixed) || + vipsgen_set_bool(operation, "smart_deblock", smart_deblock) || + vipsgen_set_int(operation, "passes", passes) || + vipsgen_set_int(operation, "keep", keep) || + vipsgen_set_array_double(operation, "background", background_array) || + vipsgen_set_int(operation, "page_height", page_height) || + vipsgen_set_string(operation, "profile", profile) + ) { + g_object_unref(operation); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return 1; + } + int result = vipsgen_operation_execute(operation, NULL); + if (background_array != NULL) { vips_area_unref(VIPS_AREA(background_array)); } + return result; +} + +int vipsgen_worley(VipsImage** out, int width, int height) { + return vips_worley(out, width, height, NULL); +} + +int vipsgen_worley_with_options(VipsImage** out, int width, int height, int cell_size, int seed) { + VipsOperation *operation = vips_operation_new("worley"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "cell_size", cell_size) || + vipsgen_set_int(operation, "seed", seed) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_wrap(VipsImage* in, VipsImage** out) { + return vips_wrap(in, out, NULL); +} + +int vipsgen_wrap_with_options(VipsImage* in, VipsImage** out, int x, int y) { + VipsOperation *operation = vips_operation_new("wrap"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "in", in, NULL) || + vipsgen_set_int(operation, "x", x) || + vipsgen_set_int(operation, "y", y) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_xyz(VipsImage** out, int width, int height) { + return vips_xyz(out, width, height, NULL); +} + +int vipsgen_xyz_with_options(VipsImage** out, int width, int height, int csize, int dsize, int esize) { + VipsOperation *operation = vips_operation_new("xyz"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_int(operation, "csize", csize) || + vipsgen_set_int(operation, "dsize", dsize) || + vipsgen_set_int(operation, "esize", esize) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_zone(VipsImage** out, int width, int height) { + return vips_zone(out, width, height, NULL); +} + +int vipsgen_zone_with_options(VipsImage** out, int width, int height, gboolean uchar) { + VipsOperation *operation = vips_operation_new("zone"); + if (!operation) return 1; + if ( + vips_object_set(VIPS_OBJECT(operation), "width", width, NULL) || + vips_object_set(VIPS_OBJECT(operation), "height", height, NULL) || + vipsgen_set_bool(operation, "uchar", uchar) + ) { + g_object_unref(operation); + return 1; + } + int result = vipsgen_operation_execute(operation, "out", out, NULL); + return result; +} + +int vipsgen_zoom(VipsImage* input, VipsImage** out, int xfac, int yfac) { + return vips_zoom(input, out, xfac, yfac, NULL); +} + + +// Custom operations + +int vipsgen_image_new_from_source(VipsSourceCustom *source, VipsImage **out) { + *out = vips_image_new_from_source((VipsSource*) source, "", NULL); + if (!*out) return 1; + return 0; +} + +int vipsgen_image_new_from_source_with_option(VipsSourceCustom *source, VipsImage **out, const char *option_string) { + *out = vips_image_new_from_source((VipsSource*) source, option_string, NULL); + if (!*out) return 1; + return 0; +} + +int vipsgen_image_new_from_file(const char *name, VipsImage **out) { + *out = vips_image_new_from_file(name, NULL); + if (!*out) return 1; + return 0; +} + +int vipsgen_image_new_from_buffer(const void *buf, size_t len, VipsImage **out) { + *out = vips_image_new_from_buffer(buf, len, "", NULL); + if (!*out) return 1; + return 0; +} + +int vipsgen_image_new_from_memory(const void *buf, size_t len, int width, int height, int bands, VipsImage **out) { + *out = vips_image_new_from_memory(buf, len, width, height, bands, VIPS_FORMAT_UCHAR); + if (!*out) return 1; + return 0; +} + +int vipsgen_image_new_from_buffer_with_option(const void *buf, size_t len, VipsImage **out, const char *option_string) { + *out = vips_image_new_from_buffer(buf, len, option_string, NULL); + if (!*out) return 1; + return 0; +} + +void vipsgen_clear_image(VipsImage **image) { + // https://developer.gnome.org/gobject/stable/gobject-The-Base-Object-Type.html#g-clear-object + if (G_IS_OBJECT(*image)) g_clear_object(image); +} + +int vipsgen_remove_exif(VipsImage *in, VipsImage **out) { + static double default_resolution = 72.0 / 25.4; + + if (vips_copy( + in, out, + "xres", default_resolution, + "yres", default_resolution, + NULL + )) return 1; + + gchar **fields = vips_image_get_fields(in); + + for (int i = 0; fields[i] != NULL; i++) { + gchar *name = fields[i]; + if (strcmp(name, VIPS_META_ICC_NAME) == 0) continue; + if (strcmp(name, VIPS_META_ORIENTATION) == 0) continue; + if (strcmp(name, VIPS_META_N_PAGES) == 0) continue; + if (strcmp(name, VIPS_META_PAGE_HEIGHT) == 0) continue; + if (strcmp(name, "palette-bit-depth") == 0) continue; + vips_image_remove(*out, name); + } + g_strfreev(fields); + return 0; +} + +int vipsgen_embed_multi_page(VipsImage *in, VipsImage **out, int left, int top, int width, + int height, int extend) { + VipsObject *base = VIPS_OBJECT(vips_image_new()); + int page_height = vips_image_get_page_height(in); + int in_width = in->Xsize; + int n_pages = in->Ysize / page_height; + + VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **embedded_page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); + + // split image into cropped frames + for (int i = 0; i < n_pages; i++) { + if ( + vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || + vips_embed(page[i], &embedded_page[i], left, top, width, height, "extend", extend, NULL) + ) { + g_object_unref(base); + return -1; + } + } + // reassemble frames and set page height + // copy before modifying metadata + if( + vips_arrayjoin(embedded_page, ©[0], n_pages, "across", 1, NULL) || + vips_copy(copy[0], out, NULL) + ) { + g_object_unref(base); + return -1; + } + vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); + g_object_unref(base); + return 0; +} + +int vipsgen_embed_multi_page_background(VipsImage *in, VipsImage **out, int left, int top, int width, + int height, double r, double g, double b, double a) { + double background[3] = {r, g, b}; + double backgroundRGBA[4] = {r, g, b, a}; + + VipsArrayDouble *vipsBackground; + + if (in->Bands <= 3) { + vipsBackground = vips_array_double_new(background, 3); + } else { + vipsBackground = vips_array_double_new(backgroundRGBA, 4); + } + VipsObject *base = VIPS_OBJECT(vips_image_new()); + int page_height = vips_image_get_page_height(in); + int in_width = in->Xsize; + int n_pages = in->Ysize / page_height; + + VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **embedded_page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); + + // split image into cropped frames + for (int i = 0; i < n_pages; i++) { + if ( + vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || + vips_embed(page[i], &embedded_page[i], left, top, width, height, + "extend", VIPS_EXTEND_BACKGROUND, "background", vipsBackground, NULL) + ) { + vips_area_unref(VIPS_AREA(vipsBackground)); + g_object_unref(base); + return -1; + } + } + // reassemble frames and set page height + // copy before modifying metadata + if( + vips_arrayjoin(embedded_page, ©[0], n_pages, "across", 1, NULL) || + vips_copy(copy[0], out, NULL) + ) { + vips_area_unref(VIPS_AREA(vipsBackground)); + g_object_unref(base); + return -1; + } + vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); + vips_area_unref(VIPS_AREA(vipsBackground)); + g_object_unref(base); + return 0; +} + +int vipsgen_extract_area_multi_page(VipsImage *in, VipsImage **out, int left, int top, int width, int height) { + VipsObject *base = VIPS_OBJECT(vips_image_new()); + int page_height = vips_image_get_page_height(in); + int n_pages = in->Ysize / page_height; + + VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); + + // split image into cropped frames + for (int i = 0; i < n_pages; i++) { + if(vips_extract_area(in, &page[i], left, page_height * i + top, width, height, NULL)) { + g_object_unref(base); + return -1; + } + } + // reassemble frames and set page height + // copy before modifying metadata + if( + vips_arrayjoin(page, ©[0], n_pages, "across", 1, NULL) || + vips_copy(copy[0], out, NULL) + ) { + g_object_unref(base); + return -1; + } + vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); + g_object_unref(base); + return 0; +} + +int vipsgen_rot_multi_page(VipsImage *in, VipsImage **out, VipsAngle angle) { + VipsObject *base = VIPS_OBJECT(vips_image_new()); + int page_height = vips_image_get_page_height(in); + int in_width = in->Xsize; + int n_pages = in->Ysize / page_height; + + VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **rotated_page = (VipsImage **) vips_object_local_array(base, n_pages); + VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); + + // split image into cropped frames + for (int i = 0; i < n_pages; i++) { + if ( + vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || + vips_rot(page[i], &rotated_page[i], angle, NULL) + ) { + g_object_unref(base); + return -1; + } + } + // reassemble frames and set page height if rotate 90 or 270 + // copy before modifying metadata + if( + vips_arrayjoin(rotated_page, ©[0], n_pages, "across", 1, NULL) || + vips_copy(copy[0], out, NULL) + ) { + g_object_unref(base); + return -1; + } + if (angle == VIPS_ANGLE_D90 || angle == VIPS_ANGLE_D270) { + vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, in_width); + } + g_object_unref(base); + return 0; +} + +int vipsgen_label(VipsImage *in, VipsImage **out, + const char *text, const char *font, + int x, int y, int size, VipsAlign align, + double r, double g, double b, float opacity) { + double ones[3] = {1, 1, 1}; + double color[3] = {r, g, b}; + int page_height = vips_image_get_page_height(in); + int in_width = in->Xsize; + int n_pages = in->Ysize / page_height; + VipsImage *base = vips_image_new(); + VipsImage **t = (VipsImage **)vips_object_local_array(VIPS_OBJECT(base), 12); + if (vips_text(&t[0], text, "font", font, "width", 9999, "height", size, NULL) || + vips_linear1(t[0], &t[1], opacity, 0.0, NULL) || + vips_cast(t[1], &t[2], VIPS_FORMAT_UCHAR, NULL)) { + g_object_unref(base); + return 1; + } + int text_width = t[0]->Xsize; + if (align == VIPS_ALIGN_CENTRE) { + x = x-text_width/2; + } else if (align == VIPS_ALIGN_HIGH) { + x = x-text_width; + } + if (vips_embed(t[2], &t[3], x, y, in_width, page_height, NULL) || + vips_replicate(t[3], &t[10], 1, n_pages, NULL)) { + g_object_unref(base); + return 1; + } + if (vips_black(&t[4], 1, 1, NULL) || + vips_linear(t[4], &t[5], ones, color, 3, NULL) || + vips_cast(t[5], &t[6], VIPS_FORMAT_UCHAR, NULL) || + vips_copy(t[6], &t[7], "interpretation", in->Type, NULL) || + vips_embed(t[7], &t[8], 0, 0, in_width, page_height, + "extend", VIPS_EXTEND_COPY, NULL) || + vips_addalpha(t[8], &t[9], NULL) || + vips_replicate(t[9], &t[11], 1, n_pages, NULL)) { + g_object_unref(base); + return 1; + } + if (vips_ifthenelse(t[10], t[11], in, out, "blend", TRUE, NULL)) { + g_object_unref(base); + return 1; + } + g_object_unref(base); + return 0; +} diff --git a/vendor/github.com/cshum/vipsgen/vips/vips.go b/vendor/github.com/cshum/vipsgen/vips/vips.go new file mode 100644 index 0000000000..41a351f357 --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/vips.go @@ -0,0 +1,6260 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. +package vips + +// #include "vips.h" +import "C" +import ( + "runtime" + "unsafe" +) + + +// vipsgenCMC2LCh vips_CMC2LCh transform LCh to CMC +func vipsgenCMC2LCh(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_CMC2LCh(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCMYK2XYZ vips_CMYK2XYZ transform CMYK to XYZ +func vipsgenCMYK2XYZ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_CMYK2XYZ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHSV2sRGB vips_HSV2sRGB transform HSV to sRGB +func vipsgenHSV2sRGB(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_HSV2sRGB(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLCh2CMC vips_LCh2CMC transform LCh to CMC +func vipsgenLCh2CMC(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LCh2CMC(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLCh2Lab vips_LCh2Lab transform LCh to Lab +func vipsgenLCh2Lab(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LCh2Lab(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLab2LCh vips_Lab2LCh transform Lab to LCh +func vipsgenLab2LCh(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_Lab2LCh(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLab2LabQ vips_Lab2LabQ transform float Lab to LabQ coding +func vipsgenLab2LabQ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_Lab2LabQ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLab2LabS vips_Lab2LabS transform float Lab to signed short +func vipsgenLab2LabS(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_Lab2LabS(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLab2XYZ vips_Lab2XYZ transform CIELAB to XYZ +func vipsgenLab2XYZ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_Lab2XYZ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLab2XYZWithOptions vips_Lab2XYZ transform CIELAB to XYZ with optional arguments +func vipsgenLab2XYZWithOptions(in *C.VipsImage, temp []float64) (*C.VipsImage, error) { + var out *C.VipsImage + ctemp, ctempLength, err := convertToDoubleArray(temp) + if err != nil { + return nil, err + } + if ctemp != nil { + defer freeDoubleArray(ctemp) + } + if err := C.vipsgen_Lab2XYZ_with_options(in, &out, ctemp, ctempLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLabQ2Lab vips_LabQ2Lab unpack a LabQ image to float Lab +func vipsgenLabQ2Lab(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LabQ2Lab(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLabQ2LabS vips_LabQ2LabS unpack a LabQ image to short Lab +func vipsgenLabQ2LabS(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LabQ2LabS(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLabQ2sRGB vips_LabQ2sRGB convert a LabQ image to sRGB +func vipsgenLabQ2sRGB(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LabQ2sRGB(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLabS2Lab vips_LabS2Lab transform signed short Lab to float +func vipsgenLabS2Lab(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LabS2Lab(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLabS2LabQ vips_LabS2LabQ transform short Lab to LabQ coding +func vipsgenLabS2LabQ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_LabS2LabQ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXYZ2CMYK vips_XYZ2CMYK transform XYZ to CMYK +func vipsgenXYZ2CMYK(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_XYZ2CMYK(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXYZ2Lab vips_XYZ2Lab transform XYZ to Lab +func vipsgenXYZ2Lab(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_XYZ2Lab(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXYZ2LabWithOptions vips_XYZ2Lab transform XYZ to Lab with optional arguments +func vipsgenXYZ2LabWithOptions(in *C.VipsImage, temp []float64) (*C.VipsImage, error) { + var out *C.VipsImage + ctemp, ctempLength, err := convertToDoubleArray(temp) + if err != nil { + return nil, err + } + if ctemp != nil { + defer freeDoubleArray(ctemp) + } + if err := C.vipsgen_XYZ2Lab_with_options(in, &out, ctemp, ctempLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXYZ2Yxy vips_XYZ2Yxy transform XYZ to Yxy +func vipsgenXYZ2Yxy(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_XYZ2Yxy(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXYZ2scRGB vips_XYZ2scRGB transform XYZ to scRGB +func vipsgenXYZ2scRGB(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_XYZ2scRGB(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenYxy2XYZ vips_Yxy2XYZ transform Yxy to XYZ +func vipsgenYxy2XYZ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_Yxy2XYZ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAbs vips_abs absolute value of an image +func vipsgenAbs(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_abs(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAdd vips_add add two images +func vipsgenAdd(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_add(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAddalpha vips_addalpha append an alpha channel +func vipsgenAddalpha(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_addalpha(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAffine vips_affine affine transform of an image +func vipsgenAffine(in *C.VipsImage, a float64, b float64, c float64, d float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_affine(in, &out, C.double(a), C.double(b), C.double(c), C.double(d)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAffineWithOptions vips_affine affine transform of an image with optional arguments +func vipsgenAffineWithOptions(in *C.VipsImage, a float64, b float64, c float64, d float64, interpolate *Interpolate, oarea []int, odx float64, ody float64, idx float64, idy float64, background []float64, premultiplied bool, extend Extend) (*C.VipsImage, error) { + var out *C.VipsImage + coarea, coareaLength, err := convertToIntArray(oarea) + if err != nil { + return nil, err + } + if coarea != nil { + defer freeIntArray(coarea) + } + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_affine_with_options(in, &out, C.double(a), C.double(b), C.double(c), C.double(d), vipsInterpolateToC(interpolate), coarea, coareaLength, C.double(odx), C.double(ody), C.double(idx), C.double(idy), cbackground, cbackgroundLength, C.int(boolToInt(premultiplied)), C.VipsExtend(extend)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAnalyzeload vips_analyzeload load an Analyze6 image +func vipsgenAnalyzeload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_analyzeload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAnalyzeloadWithOptions vips_analyzeload load an Analyze6 image with optional arguments +func vipsgenAnalyzeloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_analyzeload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenArrayjoin vips_arrayjoin join an array of images +func vipsgenArrayjoin(in []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + if err := C.vipsgen_arrayjoin((**C.VipsImage)(cin), &out, C.int(len(in))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenArrayjoinWithOptions vips_arrayjoin join an array of images with optional arguments +func vipsgenArrayjoinWithOptions(in []*C.VipsImage, across int, shim int, background []float64, halign Align, valign Align, hspacing int, vspacing int) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_arrayjoin_with_options(cin, &out, C.int(len(in)), C.int(across), C.int(shim), cbackground, cbackgroundLength, C.VipsAlign(halign), C.VipsAlign(valign), C.int(hspacing), C.int(vspacing)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAutorot vips_autorot autorotate image by exif tag +func vipsgenAutorot(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_autorot(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenAvg vips_avg find image average +func vipsgenAvg(in *C.VipsImage) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_avg(in, cout); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenBandbool vips_bandbool boolean operation across image bands +func vipsgenBandbool(in *C.VipsImage, boolean OperationBoolean) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandbool(in, &out, C.VipsOperationBoolean(boolean)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandfold vips_bandfold fold up x axis into bands +func vipsgenBandfold(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandfold(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandfoldWithOptions vips_bandfold fold up x axis into bands with optional arguments +func vipsgenBandfoldWithOptions(in *C.VipsImage, factor int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandfold_with_options(in, &out, C.int(factor)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandjoin vips_bandjoin bandwise join a set of images +func vipsgenBandjoin(in []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + if err := C.vipsgen_bandjoin((**C.VipsImage)(cin), &out, C.int(len(in))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandjoinConst vips_bandjoin_const append a constant band to an image +func vipsgenBandjoinConst(in *C.VipsImage, c []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cc, _, err := convertToDoubleArray(c) + if err != nil { + return nil, err + } + if cc != nil { + defer freeDoubleArray(cc) + } + if err := C.vipsgen_bandjoin_const(in, &out, cc, C.int(len(c))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandmean vips_bandmean band-wise average +func vipsgenBandmean(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandmean(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandrank vips_bandrank band-wise rank of a set of images +func vipsgenBandrank(in []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + if err := C.vipsgen_bandrank((**C.VipsImage)(cin), &out, C.int(len(in))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandrankWithOptions vips_bandrank band-wise rank of a set of images with optional arguments +func vipsgenBandrankWithOptions(in []*C.VipsImage, index int) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + if err := C.vipsgen_bandrank_with_options(cin, &out, C.int(len(in)), C.int(index)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandunfold vips_bandunfold unfold image bands into x axis +func vipsgenBandunfold(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandunfold(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBandunfoldWithOptions vips_bandunfold unfold image bands into x axis with optional arguments +func vipsgenBandunfoldWithOptions(in *C.VipsImage, factor int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_bandunfold_with_options(in, &out, C.int(factor)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBlack vips_black make a black image +func vipsgenBlack(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_black(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBlackWithOptions vips_black make a black image with optional arguments +func vipsgenBlackWithOptions(width int, height int, bands int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_black_with_options(&out, C.int(width), C.int(height), C.int(bands)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBoolean vips_boolean boolean operation on two images +func vipsgenBoolean(left *C.VipsImage, right *C.VipsImage, boolean OperationBoolean) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_boolean(left, right, &out, C.VipsOperationBoolean(boolean)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBooleanConst vips_boolean_const boolean operations against a constant +func vipsgenBooleanConst(in *C.VipsImage, boolean OperationBoolean, c []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cc, _, err := convertToDoubleArray(c) + if err != nil { + return nil, err + } + if cc != nil { + defer freeDoubleArray(cc) + } + if err := C.vipsgen_boolean_const(in, &out, C.VipsOperationBoolean(boolean), cc, C.int(len(c))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenBuildlut vips_buildlut build a look-up table +func vipsgenBuildlut(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_buildlut(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenByteswap vips_byteswap byteswap an image +func vipsgenByteswap(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_byteswap(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCanny vips_canny Canny edge detector +func vipsgenCanny(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_canny(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCannyWithOptions vips_canny Canny edge detector with optional arguments +func vipsgenCannyWithOptions(in *C.VipsImage, sigma float64, precision Precision) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_canny_with_options(in, &out, C.double(sigma), C.VipsPrecision(precision)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCase vips_case use pixel values to pick cases from an array of images +func vipsgenCase(index *C.VipsImage, cases []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + ccases, _, err := convertToImageArray(cases) + if err != nil { + return nil, err + } + if ccases != nil { + defer freeImageArray(ccases) + } + if err := C.vipsgen_case(index, (**C.VipsImage)(ccases), &out, C.int(len(cases))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCast vips_cast cast an image +func vipsgenCast(in *C.VipsImage, format BandFormat) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_cast(in, &out, C.VipsBandFormat(format)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCastWithOptions vips_cast cast an image with optional arguments +func vipsgenCastWithOptions(in *C.VipsImage, format BandFormat, shift bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_cast_with_options(in, &out, C.VipsBandFormat(format), C.int(boolToInt(shift))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenClamp vips_clamp clamp values of an image +func vipsgenClamp(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_clamp(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenClampWithOptions vips_clamp clamp values of an image with optional arguments +func vipsgenClampWithOptions(in *C.VipsImage, min float64, max float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_clamp_with_options(in, &out, C.double(min), C.double(max)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenColourspace vips_colourspace convert to a new colorspace +func vipsgenColourspace(in *C.VipsImage, space Interpretation) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_colourspace(in, &out, C.VipsInterpretation(space)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenColourspaceWithOptions vips_colourspace convert to a new colorspace with optional arguments +func vipsgenColourspaceWithOptions(in *C.VipsImage, space Interpretation, sourceSpace Interpretation) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_colourspace_with_options(in, &out, C.VipsInterpretation(space), C.VipsInterpretation(sourceSpace)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCompass vips_compass convolve with rotating mask +func vipsgenCompass(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_compass(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCompassWithOptions vips_compass convolve with rotating mask with optional arguments +func vipsgenCompassWithOptions(in *C.VipsImage, mask *C.VipsImage, times int, angle Angle45, combine Combine, precision Precision, layers int, cluster int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_compass_with_options(in, &out, mask, C.int(times), C.VipsAngle45(angle), C.VipsCombine(combine), C.VipsPrecision(precision), C.int(layers), C.int(cluster)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComplex vips_complex perform a complex operation on an image +func vipsgenComplex(in *C.VipsImage, cmplx OperationComplex) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_complex(in, &out, C.VipsOperationComplex(cmplx)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComplex2 vips_complex2 complex binary operations on two images +func vipsgenComplex2(left *C.VipsImage, right *C.VipsImage, cmplx OperationComplex2) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_complex2(left, right, &out, C.VipsOperationComplex2(cmplx)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComplexform vips_complexform form a complex image from two real images +func vipsgenComplexform(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_complexform(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComplexget vips_complexget get a component from a complex image +func vipsgenComplexget(in *C.VipsImage, get OperationComplexget) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_complexget(in, &out, C.VipsOperationComplexget(get)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComposite vips_composite blend an array of images with an array of blend modes +func vipsgenComposite(in []*C.VipsImage, mode []BlendMode) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + cmode, _, err := convertToBlendModeArray(mode) + if err != nil { + return nil, err + } + if cmode != nil { + defer freeIntArray(cmode) + } + if err := C.vipsgen_composite((**C.VipsImage)(cin), &out, C.int(len(in)), cmode); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCompositeWithOptions vips_composite blend an array of images with an array of blend modes with optional arguments +func vipsgenCompositeWithOptions(in []*C.VipsImage, mode []BlendMode, x []int, y []int, compositingSpace Interpretation, premultiplied bool) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + cmode, _, err := convertToBlendModeArray(mode) + if err != nil { + return nil, err + } + if cmode != nil { + defer freeIntArray(cmode) + } + cx, cxLength, err := convertToIntArray(x) + if err != nil { + return nil, err + } + if cx != nil { + defer freeIntArray(cx) + } + cy, cyLength, err := convertToIntArray(y) + if err != nil { + return nil, err + } + if cy != nil { + defer freeIntArray(cy) + } + if err := C.vipsgen_composite_with_options(cin, &out, C.int(len(in)), cmode, cx, cxLength, cy, cyLength, C.VipsInterpretation(compositingSpace), C.int(boolToInt(premultiplied))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComposite2 vips_composite2 blend a pair of images with a blend mode +func vipsgenComposite2(base *C.VipsImage, overlay *C.VipsImage, mode BlendMode) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_composite2(base, overlay, &out, C.VipsBlendMode(mode)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenComposite2WithOptions vips_composite2 blend a pair of images with a blend mode with optional arguments +func vipsgenComposite2WithOptions(base *C.VipsImage, overlay *C.VipsImage, mode BlendMode, x int, y int, compositingSpace Interpretation, premultiplied bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_composite2_with_options(base, overlay, &out, C.VipsBlendMode(mode), C.int(x), C.int(y), C.VipsInterpretation(compositingSpace), C.int(boolToInt(premultiplied))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConv vips_conv convolution operation +func vipsgenConv(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_conv(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvWithOptions vips_conv convolution operation with optional arguments +func vipsgenConvWithOptions(in *C.VipsImage, mask *C.VipsImage, precision Precision, layers int, cluster int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_conv_with_options(in, &out, mask, C.VipsPrecision(precision), C.int(layers), C.int(cluster)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConva vips_conva approximate integer convolution +func vipsgenConva(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_conva(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvaWithOptions vips_conva approximate integer convolution with optional arguments +func vipsgenConvaWithOptions(in *C.VipsImage, mask *C.VipsImage, layers int, cluster int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_conva_with_options(in, &out, mask, C.int(layers), C.int(cluster)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvasep vips_convasep approximate separable integer convolution +func vipsgenConvasep(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convasep(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvasepWithOptions vips_convasep approximate separable integer convolution with optional arguments +func vipsgenConvasepWithOptions(in *C.VipsImage, mask *C.VipsImage, layers int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convasep_with_options(in, &out, mask, C.int(layers)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvf vips_convf float convolution operation +func vipsgenConvf(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convf(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvi vips_convi int convolution operation +func vipsgenConvi(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convi(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvsep vips_convsep separable convolution operation +func vipsgenConvsep(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convsep(in, &out, mask); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenConvsepWithOptions vips_convsep separable convolution operation with optional arguments +func vipsgenConvsepWithOptions(in *C.VipsImage, mask *C.VipsImage, precision Precision, layers int, cluster int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_convsep_with_options(in, &out, mask, C.VipsPrecision(precision), C.int(layers), C.int(cluster)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCopy vips_copy copy an image +func vipsgenCopy(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_copy(in, &out); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenCopyWithOptions vips_copy copy an image with optional arguments +func vipsgenCopyWithOptions(in *C.VipsImage, width int, height int, bands int, format BandFormat, coding Coding, interpretation Interpretation, xres float64, yres float64, xoffset int, yoffset int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_copy_with_options(in, &out, C.int(width), C.int(height), C.int(bands), C.VipsBandFormat(format), C.VipsCoding(coding), C.VipsInterpretation(interpretation), C.double(xres), C.double(yres), C.int(xoffset), C.int(yoffset)); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenCountlines vips_countlines count lines in an image +func vipsgenCountlines(in *C.VipsImage, direction Direction) (float64, error) { + var nolines float64 + cnolines := (*C.double)(unsafe.Pointer(&nolines)) + if err := C.vipsgen_countlines(in, cnolines, C.VipsDirection(direction)); err != 0 { + return 0, handleVipsError() + } + return nolines, nil +} + +// vipsgenCsvload vips_csvload load csv +func vipsgenCsvload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_csvload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCsvloadWithOptions vips_csvload load csv with optional arguments +func vipsgenCsvloadWithOptions(filename string, skip int, lines int, whitespace string, separator string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cwhitespace := C.CString(whitespace) + defer freeCString(cwhitespace) + cseparator := C.CString(separator) + defer freeCString(cseparator) + if err := C.vipsgen_csvload_with_options(cfilename, &out, C.int(skip), C.int(lines), cwhitespace, cseparator, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCsvloadSource vips_csvload_source load csv +func vipsgenCsvloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_csvload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCsvloadSourceWithOptions vips_csvload_source load csv with optional arguments +func vipsgenCsvloadSourceWithOptions(source *C.VipsSourceCustom, skip int, lines int, whitespace string, separator string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cwhitespace := C.CString(whitespace) + defer freeCString(cwhitespace) + cseparator := C.CString(separator) + defer freeCString(cseparator) + if err := C.vipsgen_csvload_source_with_options(source, &out, C.int(skip), C.int(lines), cwhitespace, cseparator, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenCsvsave vips_csvsave save image to csv +func vipsgenCsvsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_csvsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenCsvsaveWithOptions vips_csvsave save image to csv with optional arguments +func vipsgenCsvsaveWithOptions(in *C.VipsImage, filename string, separator string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cseparator := C.CString(separator) + defer freeCString(cseparator) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_csvsave_with_options(in, cfilename, cseparator, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenCsvsaveTarget vips_csvsave_target save image to csv +func vipsgenCsvsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_csvsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenCsvsaveTargetWithOptions vips_csvsave_target save image to csv with optional arguments +func vipsgenCsvsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, separator string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cseparator := C.CString(separator) + defer freeCString(cseparator) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_csvsave_target_with_options(in, target, cseparator, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDE00 vips_dE00 calculate dE00 +func vipsgenDE00(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_dE00(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenDE76 vips_dE76 calculate dE76 +func vipsgenDE76(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_dE76(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenDECMC vips_dECMC calculate dECMC +func vipsgenDECMC(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_dECMC(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenDeviate vips_deviate find image standard deviation +func vipsgenDeviate(in *C.VipsImage) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_deviate(in, cout); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenDivide vips_divide divide two images +func vipsgenDivide(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_divide(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenDrawCircle vips_draw_circle draw a circle on an image +func vipsgenDrawCircle(image *C.VipsImage, ink []float64, cx int, cy int, radius int) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_circle(image, cink, C.int(len(ink)), C.int(cx), C.int(cy), C.int(radius)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawCircleWithOptions vips_draw_circle draw a circle on an image with optional arguments +func vipsgenDrawCircleWithOptions(image *C.VipsImage, ink []float64, cx int, cy int, radius int, fill bool) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_circle_with_options(image, cink, C.int(len(ink)), C.int(cx), C.int(cy), C.int(radius), C.int(boolToInt(fill))); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawFlood vips_draw_flood flood-fill an area +func vipsgenDrawFlood(image *C.VipsImage, ink []float64, x int, y int) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_flood(image, cink, C.int(len(ink)), C.int(x), C.int(y)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawFloodWithOptions vips_draw_flood flood-fill an area with optional arguments +func vipsgenDrawFloodWithOptions(image *C.VipsImage, ink []float64, x int, y int, test *C.VipsImage, equal bool) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_flood_with_options(image, cink, C.int(len(ink)), C.int(x), C.int(y), test, C.int(boolToInt(equal))); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawImage vips_draw_image paint an image into another image +func vipsgenDrawImage(image *C.VipsImage, sub *C.VipsImage, x int, y int) (error) { + + if err := C.vipsgen_draw_image(image, sub, C.int(x), C.int(y)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawImageWithOptions vips_draw_image paint an image into another image with optional arguments +func vipsgenDrawImageWithOptions(image *C.VipsImage, sub *C.VipsImage, x int, y int, mode CombineMode) (error) { + + if err := C.vipsgen_draw_image_with_options(image, sub, C.int(x), C.int(y), C.VipsCombineMode(mode)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawLine vips_draw_line draw a line on an image +func vipsgenDrawLine(image *C.VipsImage, ink []float64, x1 int, y1 int, x2 int, y2 int) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_line(image, cink, C.int(len(ink)), C.int(x1), C.int(y1), C.int(x2), C.int(y2)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawMask vips_draw_mask draw a mask on an image +func vipsgenDrawMask(image *C.VipsImage, ink []float64, mask *C.VipsImage, x int, y int) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_mask(image, cink, C.int(len(ink)), mask, C.int(x), C.int(y)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawRect vips_draw_rect paint a rectangle on an image +func vipsgenDrawRect(image *C.VipsImage, ink []float64, left int, top int, width int, height int) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_rect(image, cink, C.int(len(ink)), C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawRectWithOptions vips_draw_rect paint a rectangle on an image with optional arguments +func vipsgenDrawRectWithOptions(image *C.VipsImage, ink []float64, left int, top int, width int, height int, fill bool) (error) { + cink, _, err := convertToDoubleArray(ink) + if err != nil { + return err + } + if cink != nil { + defer freeDoubleArray(cink) + } + if err := C.vipsgen_draw_rect_with_options(image, cink, C.int(len(ink)), C.int(left), C.int(top), C.int(width), C.int(height), C.int(boolToInt(fill))); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDrawSmudge vips_draw_smudge blur a rectangle on an image +func vipsgenDrawSmudge(image *C.VipsImage, left int, top int, width int, height int) (error) { + + if err := C.vipsgen_draw_smudge(image, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDzsave vips_dzsave save image to deepzoom file +func vipsgenDzsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_dzsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDzsaveWithOptions vips_dzsave save image to deepzoom file with optional arguments +func vipsgenDzsaveWithOptions(in *C.VipsImage, filename string, imagename string, layout DzLayout, suffix string, overlap int, tileSize int, centre bool, depth DzDepth, angle Angle, container DzContainer, compression int, regionShrink RegionShrink, skipBlanks int, id string, q int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cimagename := C.CString(imagename) + defer freeCString(cimagename) + csuffix := C.CString(suffix) + defer freeCString(csuffix) + cid := C.CString(id) + defer freeCString(cid) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_dzsave_with_options(in, cfilename, cimagename, C.VipsForeignDzLayout(layout), csuffix, C.int(overlap), C.int(tileSize), C.int(boolToInt(centre)), C.VipsForeignDzDepth(depth), C.VipsAngle(angle), C.VipsForeignDzContainer(container), C.int(compression), C.VipsRegionShrink(regionShrink), C.int(skipBlanks), cid, C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDzsaveBuffer vips_dzsave_buffer save image to dz buffer +func vipsgenDzsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_dzsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenDzsaveBufferWithOptions vips_dzsave_buffer save image to dz buffer with optional arguments +func vipsgenDzsaveBufferWithOptions(in *C.VipsImage, imagename string, layout DzLayout, suffix string, overlap int, tileSize int, centre bool, depth DzDepth, angle Angle, container DzContainer, compression int, regionShrink RegionShrink, skipBlanks int, id string, q int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cimagename := C.CString(imagename) + defer freeCString(cimagename) + csuffix := C.CString(suffix) + defer freeCString(csuffix) + cid := C.CString(id) + defer freeCString(cid) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_dzsave_buffer_with_options(in, &buf, &length, cimagename, C.VipsForeignDzLayout(layout), csuffix, C.int(overlap), C.int(tileSize), C.int(boolToInt(centre)), C.VipsForeignDzDepth(depth), C.VipsAngle(angle), C.VipsForeignDzContainer(container), C.int(compression), C.VipsRegionShrink(regionShrink), C.int(skipBlanks), cid, C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenDzsaveTarget vips_dzsave_target save image to deepzoom target +func vipsgenDzsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_dzsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenDzsaveTargetWithOptions vips_dzsave_target save image to deepzoom target with optional arguments +func vipsgenDzsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, imagename string, layout DzLayout, suffix string, overlap int, tileSize int, centre bool, depth DzDepth, angle Angle, container DzContainer, compression int, regionShrink RegionShrink, skipBlanks int, id string, q int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cimagename := C.CString(imagename) + defer freeCString(cimagename) + csuffix := C.CString(suffix) + defer freeCString(csuffix) + cid := C.CString(id) + defer freeCString(cid) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_dzsave_target_with_options(in, target, cimagename, C.VipsForeignDzLayout(layout), csuffix, C.int(overlap), C.int(tileSize), C.int(boolToInt(centre)), C.VipsForeignDzDepth(depth), C.VipsAngle(angle), C.VipsForeignDzContainer(container), C.int(compression), C.VipsRegionShrink(regionShrink), C.int(skipBlanks), cid, C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenEmbed vips_embed embed an image in a larger image +func vipsgenEmbed(in *C.VipsImage, x int, y int, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_embed(in, &out, C.int(x), C.int(y), C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenEmbedWithOptions vips_embed embed an image in a larger image with optional arguments +func vipsgenEmbedWithOptions(in *C.VipsImage, x int, y int, width int, height int, extend Extend, background []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_embed_with_options(in, &out, C.int(x), C.int(y), C.int(width), C.int(height), C.VipsExtend(extend), cbackground, cbackgroundLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenExtractArea vips_extract_area extract an area from an image +func vipsgenExtractArea(input *C.VipsImage, left int, top int, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_extract_area(input, &out, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenExtractBand vips_extract_band extract band from an image +func vipsgenExtractBand(in *C.VipsImage, band int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_extract_band(in, &out, C.int(band)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenExtractBandWithOptions vips_extract_band extract band from an image with optional arguments +func vipsgenExtractBandWithOptions(in *C.VipsImage, band int, n int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_extract_band_with_options(in, &out, C.int(band), C.int(n)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenEye vips_eye make an image showing the eye's spatial response +func vipsgenEye(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_eye(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenEyeWithOptions vips_eye make an image showing the eye's spatial response with optional arguments +func vipsgenEyeWithOptions(width int, height int, uchar bool, factor float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_eye_with_options(&out, C.int(width), C.int(height), C.int(boolToInt(uchar)), C.double(factor)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFalsecolour vips_falsecolour false-color an image +func vipsgenFalsecolour(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_falsecolour(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFastcor vips_fastcor fast correlation +func vipsgenFastcor(in *C.VipsImage, ref *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_fastcor(in, ref, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFillNearest vips_fill_nearest fill image zeros with nearest non-zero pixel +func vipsgenFillNearest(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_fill_nearest(in, &out); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenFindTrim vips_find_trim search an image for non-edge areas +func vipsgenFindTrim(in *C.VipsImage) (int, int, int, int, error) { + var left int + cleft := (*C.int)(unsafe.Pointer(&left)) + var top int + ctop := (*C.int)(unsafe.Pointer(&top)) + var width int + cwidth := (*C.int)(unsafe.Pointer(&width)) + var height int + cheight := (*C.int)(unsafe.Pointer(&height)) + if err := C.vipsgen_find_trim(in, cleft, ctop, cwidth, cheight); err != 0 { + return 0, 0, 0, 0, handleVipsError() + } + return left, top, width, height, nil +} + +// vipsgenFindTrimWithOptions vips_find_trim search an image for non-edge areas with optional arguments +func vipsgenFindTrimWithOptions(in *C.VipsImage, threshold float64, background []float64, lineArt bool) (int, int, int, int, error) { + var left int + cleft := (*C.int)(unsafe.Pointer(&left)) + var top int + ctop := (*C.int)(unsafe.Pointer(&top)) + var width int + cwidth := (*C.int)(unsafe.Pointer(&width)) + var height int + cheight := (*C.int)(unsafe.Pointer(&height)) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return 0, 0, 0, 0, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_find_trim_with_options(in, cleft, ctop, cwidth, cheight, C.double(threshold), cbackground, cbackgroundLength, C.int(boolToInt(lineArt))); err != 0 { + return 0, 0, 0, 0, handleVipsError() + } + return left, top, width, height, nil +} + +// vipsgenFitsload vips_fitsload load a FITS image +func vipsgenFitsload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_fitsload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFitsloadWithOptions vips_fitsload load a FITS image with optional arguments +func vipsgenFitsloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_fitsload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFitssave vips_fitssave save image to fits file +func vipsgenFitssave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_fitssave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenFitssaveWithOptions vips_fitssave save image to fits file with optional arguments +func vipsgenFitssaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_fitssave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenFlatten vips_flatten flatten alpha out of an image +func vipsgenFlatten(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_flatten(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFlattenWithOptions vips_flatten flatten alpha out of an image with optional arguments +func vipsgenFlattenWithOptions(in *C.VipsImage, background []float64, maxAlpha float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_flatten_with_options(in, &out, cbackground, cbackgroundLength, C.double(maxAlpha)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFlip vips_flip flip an image +func vipsgenFlip(in *C.VipsImage, direction Direction) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_flip(in, &out, C.VipsDirection(direction)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFloat2rad vips_float2rad transform float RGB to Radiance coding +func vipsgenFloat2rad(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_float2rad(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFractsurf vips_fractsurf make a fractal surface +func vipsgenFractsurf(width int, height int, fractalDimension float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_fractsurf(&out, C.int(width), C.int(height), C.double(fractalDimension)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFreqmult vips_freqmult frequency-domain filtering +func vipsgenFreqmult(in *C.VipsImage, mask *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_freqmult(in, mask, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenFwfft vips_fwfft forward FFT +func vipsgenFwfft(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_fwfft(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGamma vips_gamma gamma an image +func vipsgenGamma(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gamma(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGammaWithOptions vips_gamma gamma an image with optional arguments +func vipsgenGammaWithOptions(in *C.VipsImage, exponent float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gamma_with_options(in, &out, C.double(exponent)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussblur vips_gaussblur gaussian blur +func vipsgenGaussblur(in *C.VipsImage, sigma float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussblur(in, &out, C.double(sigma)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussblurWithOptions vips_gaussblur gaussian blur with optional arguments +func vipsgenGaussblurWithOptions(in *C.VipsImage, sigma float64, minAmpl float64, precision Precision) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussblur_with_options(in, &out, C.double(sigma), C.double(minAmpl), C.VipsPrecision(precision)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussmat vips_gaussmat make a gaussian image +func vipsgenGaussmat(sigma float64, minAmpl float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussmat(&out, C.double(sigma), C.double(minAmpl)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussmatWithOptions vips_gaussmat make a gaussian image with optional arguments +func vipsgenGaussmatWithOptions(sigma float64, minAmpl float64, separable bool, precision Precision) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussmat_with_options(&out, C.double(sigma), C.double(minAmpl), C.int(boolToInt(separable)), C.VipsPrecision(precision)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussnoise vips_gaussnoise make a gaussnoise image +func vipsgenGaussnoise(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussnoise(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGaussnoiseWithOptions vips_gaussnoise make a gaussnoise image with optional arguments +func vipsgenGaussnoiseWithOptions(width int, height int, sigma float64, mean float64, seed int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gaussnoise_with_options(&out, C.int(width), C.int(height), C.double(sigma), C.double(mean), C.int(seed)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGetpoint vips_getpoint read a point from an image +func vipsgenGetpoint(in *C.VipsImage, x int, y int) ([]float64, error) { + var out *C.double + defer gFreePointer(unsafe.Pointer(out)) + var n int + cn := (*C.int)(unsafe.Pointer(&n)) + if err := C.vipsgen_getpoint(in, &out, cn, C.int(x), C.int(y)); err != 0 { + return nil, handleVipsError() + } + return (*[1024]float64)(unsafe.Pointer(out))[:n:n], nil +} + +// vipsgenGetpointWithOptions vips_getpoint read a point from an image with optional arguments +func vipsgenGetpointWithOptions(in *C.VipsImage, x int, y int, unpackComplex bool) ([]float64, error) { + var out *C.double + defer gFreePointer(unsafe.Pointer(out)) + var n int + cn := (*C.int)(unsafe.Pointer(&n)) + if err := C.vipsgen_getpoint_with_options(in, &out, cn, C.int(x), C.int(y), C.int(boolToInt(unpackComplex))); err != 0 { + return nil, handleVipsError() + } + return (*[1024]float64)(unsafe.Pointer(out))[:n:n], nil +} + +// vipsgenGifload vips_gifload load GIF with libnsgif +func vipsgenGifload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_gifload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifloadWithOptions vips_gifload load GIF with libnsgif with optional arguments +func vipsgenGifloadWithOptions(filename string, n int, page int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_gifload_with_options(cfilename, &out, C.int(n), C.int(page), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifloadBuffer vips_gifload_buffer load GIF with libnsgif +func vipsgenGifloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_gifload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifloadBufferWithOptions vips_gifload_buffer load GIF with libnsgif with optional arguments +func vipsgenGifloadBufferWithOptions(buf []byte, n int, page int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_gifload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(n), C.int(page), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifloadSource vips_gifload_source load gif from source +func vipsgenGifloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gifload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifloadSourceWithOptions vips_gifload_source load gif from source with optional arguments +func vipsgenGifloadSourceWithOptions(source *C.VipsSourceCustom, n int, page int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gifload_source_with_options(source, &out, C.int(n), C.int(page), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGifsave vips_gifsave save as gif +func vipsgenGifsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_gifsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenGifsaveWithOptions vips_gifsave save as gif with optional arguments +func vipsgenGifsaveWithOptions(in *C.VipsImage, filename string, dither float64, effort int, bitdepth int, interframeMaxerror float64, reuse bool, interpaletteMaxerror float64, interlace bool, keepDuplicateFrames bool, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_gifsave_with_options(in, cfilename, C.double(dither), C.int(effort), C.int(bitdepth), C.double(interframeMaxerror), C.int(boolToInt(reuse)), C.double(interpaletteMaxerror), C.int(boolToInt(interlace)), C.int(boolToInt(keepDuplicateFrames)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenGifsaveBuffer vips_gifsave_buffer save as gif +func vipsgenGifsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_gifsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenGifsaveBufferWithOptions vips_gifsave_buffer save as gif with optional arguments +func vipsgenGifsaveBufferWithOptions(in *C.VipsImage, dither float64, effort int, bitdepth int, interframeMaxerror float64, reuse bool, interpaletteMaxerror float64, interlace bool, keepDuplicateFrames bool, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_gifsave_buffer_with_options(in, &buf, &length, C.double(dither), C.int(effort), C.int(bitdepth), C.double(interframeMaxerror), C.int(boolToInt(reuse)), C.double(interpaletteMaxerror), C.int(boolToInt(interlace)), C.int(boolToInt(keepDuplicateFrames)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenGifsaveTarget vips_gifsave_target save as gif +func vipsgenGifsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_gifsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenGifsaveTargetWithOptions vips_gifsave_target save as gif with optional arguments +func vipsgenGifsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, dither float64, effort int, bitdepth int, interframeMaxerror float64, reuse bool, interpaletteMaxerror float64, interlace bool, keepDuplicateFrames bool, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_gifsave_target_with_options(in, target, C.double(dither), C.int(effort), C.int(bitdepth), C.double(interframeMaxerror), C.int(boolToInt(reuse)), C.double(interpaletteMaxerror), C.int(boolToInt(interlace)), C.int(boolToInt(keepDuplicateFrames)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenGlobalbalance vips_globalbalance global balance an image mosaic +func vipsgenGlobalbalance(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_globalbalance(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGlobalbalanceWithOptions vips_globalbalance global balance an image mosaic with optional arguments +func vipsgenGlobalbalanceWithOptions(in *C.VipsImage, gamma float64, intOutput bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_globalbalance_with_options(in, &out, C.double(gamma), C.int(boolToInt(intOutput))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGravity vips_gravity place an image within a larger image with a certain gravity +func vipsgenGravity(in *C.VipsImage, direction CompassDirection, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_gravity(in, &out, C.VipsCompassDirection(direction), C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGravityWithOptions vips_gravity place an image within a larger image with a certain gravity with optional arguments +func vipsgenGravityWithOptions(in *C.VipsImage, direction CompassDirection, width int, height int, extend Extend, background []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_gravity_with_options(in, &out, C.VipsCompassDirection(direction), C.int(width), C.int(height), C.VipsExtend(extend), cbackground, cbackgroundLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGrey vips_grey make a grey ramp image +func vipsgenGrey(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_grey(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGreyWithOptions vips_grey make a grey ramp image with optional arguments +func vipsgenGreyWithOptions(width int, height int, uchar bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_grey_with_options(&out, C.int(width), C.int(height), C.int(boolToInt(uchar))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenGrid vips_grid grid an image +func vipsgenGrid(in *C.VipsImage, tileHeight int, across int, down int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_grid(in, &out, C.int(tileHeight), C.int(across), C.int(down)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifload vips_heifload load a HEIF image +func vipsgenHeifload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_heifload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifloadWithOptions vips_heifload load a HEIF image with optional arguments +func vipsgenHeifloadWithOptions(filename string, page int, n int, thumbnail bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_heifload_with_options(cfilename, &out, C.int(page), C.int(n), C.int(boolToInt(thumbnail)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifloadBuffer vips_heifload_buffer load a HEIF image +func vipsgenHeifloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_heifload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifloadBufferWithOptions vips_heifload_buffer load a HEIF image with optional arguments +func vipsgenHeifloadBufferWithOptions(buf []byte, page int, n int, thumbnail bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_heifload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(n), C.int(boolToInt(thumbnail)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifloadSource vips_heifload_source load a HEIF image +func vipsgenHeifloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_heifload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifloadSourceWithOptions vips_heifload_source load a HEIF image with optional arguments +func vipsgenHeifloadSourceWithOptions(source *C.VipsSourceCustom, page int, n int, thumbnail bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_heifload_source_with_options(source, &out, C.int(page), C.int(n), C.int(boolToInt(thumbnail)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHeifsave vips_heifsave save image in HEIF format +func vipsgenHeifsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_heifsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenHeifsaveWithOptions vips_heifsave save image in HEIF format with optional arguments +func vipsgenHeifsaveWithOptions(in *C.VipsImage, filename string, q int, bitdepth int, lossless bool, compression HeifCompression, effort int, subsampleMode Subsample, encoder HeifEncoder, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_heifsave_with_options(in, cfilename, C.int(q), C.int(bitdepth), C.int(boolToInt(lossless)), C.VipsForeignHeifCompression(compression), C.int(effort), C.VipsForeignSubsample(subsampleMode), C.VipsForeignHeifEncoder(encoder), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenHeifsaveBuffer vips_heifsave_buffer save image in HEIF format +func vipsgenHeifsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_heifsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenHeifsaveBufferWithOptions vips_heifsave_buffer save image in HEIF format with optional arguments +func vipsgenHeifsaveBufferWithOptions(in *C.VipsImage, q int, bitdepth int, lossless bool, compression HeifCompression, effort int, subsampleMode Subsample, encoder HeifEncoder, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_heifsave_buffer_with_options(in, &buf, &length, C.int(q), C.int(bitdepth), C.int(boolToInt(lossless)), C.VipsForeignHeifCompression(compression), C.int(effort), C.VipsForeignSubsample(subsampleMode), C.VipsForeignHeifEncoder(encoder), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenHeifsaveTarget vips_heifsave_target save image in HEIF format +func vipsgenHeifsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_heifsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenHeifsaveTargetWithOptions vips_heifsave_target save image in HEIF format with optional arguments +func vipsgenHeifsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, q int, bitdepth int, lossless bool, compression HeifCompression, effort int, subsampleMode Subsample, encoder HeifEncoder, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_heifsave_target_with_options(in, target, C.int(q), C.int(bitdepth), C.int(boolToInt(lossless)), C.VipsForeignHeifCompression(compression), C.int(effort), C.VipsForeignSubsample(subsampleMode), C.VipsForeignHeifEncoder(encoder), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenHistCum vips_hist_cum form cumulative histogram +func vipsgenHistCum(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_cum(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistEntropy vips_hist_entropy estimate image entropy +func vipsgenHistEntropy(in *C.VipsImage) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_hist_entropy(in, cout); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenHistEqual vips_hist_equal histogram equalisation +func vipsgenHistEqual(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_equal(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistEqualWithOptions vips_hist_equal histogram equalisation with optional arguments +func vipsgenHistEqualWithOptions(in *C.VipsImage, band int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_equal_with_options(in, &out, C.int(band)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFind vips_hist_find find image histogram +func vipsgenHistFind(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFindWithOptions vips_hist_find find image histogram with optional arguments +func vipsgenHistFindWithOptions(in *C.VipsImage, band int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find_with_options(in, &out, C.int(band)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFindIndexed vips_hist_find_indexed find indexed image histogram +func vipsgenHistFindIndexed(in *C.VipsImage, index *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find_indexed(in, index, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFindIndexedWithOptions vips_hist_find_indexed find indexed image histogram with optional arguments +func vipsgenHistFindIndexedWithOptions(in *C.VipsImage, index *C.VipsImage, combine Combine) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find_indexed_with_options(in, index, &out, C.VipsCombine(combine)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFindNdim vips_hist_find_ndim find n-dimensional image histogram +func vipsgenHistFindNdim(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find_ndim(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistFindNdimWithOptions vips_hist_find_ndim find n-dimensional image histogram with optional arguments +func vipsgenHistFindNdimWithOptions(in *C.VipsImage, bins int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_find_ndim_with_options(in, &out, C.int(bins)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistIsmonotonic vips_hist_ismonotonic test for monotonicity +func vipsgenHistIsmonotonic(in *C.VipsImage) (bool, error) { + var monotonic bool + cmonotonic := (*C.int)(unsafe.Pointer(&monotonic)) + if err := C.vipsgen_hist_ismonotonic(in, cmonotonic); err != 0 { + return false, handleVipsError() + } + return monotonic, nil +} + +// vipsgenHistLocal vips_hist_local local histogram equalisation +func vipsgenHistLocal(in *C.VipsImage, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_local(in, &out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistLocalWithOptions vips_hist_local local histogram equalisation with optional arguments +func vipsgenHistLocalWithOptions(in *C.VipsImage, width int, height int, maxSlope int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_local_with_options(in, &out, C.int(width), C.int(height), C.int(maxSlope)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistMatch vips_hist_match match two histograms +func vipsgenHistMatch(in *C.VipsImage, ref *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_match(in, ref, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistNorm vips_hist_norm normalise histogram +func vipsgenHistNorm(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_norm(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHistPlot vips_hist_plot plot histogram +func vipsgenHistPlot(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hist_plot(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHoughCircle vips_hough_circle find hough circle transform +func vipsgenHoughCircle(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hough_circle(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHoughCircleWithOptions vips_hough_circle find hough circle transform with optional arguments +func vipsgenHoughCircleWithOptions(in *C.VipsImage, scale int, minRadius int, maxRadius int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hough_circle_with_options(in, &out, C.int(scale), C.int(minRadius), C.int(maxRadius)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHoughLine vips_hough_line find hough line transform +func vipsgenHoughLine(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hough_line(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenHoughLineWithOptions vips_hough_line find hough line transform with optional arguments +func vipsgenHoughLineWithOptions(in *C.VipsImage, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_hough_line_with_options(in, &out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccExport vips_icc_export output to device with ICC profile +func vipsgenIccExport(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_icc_export(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccExportWithOptions vips_icc_export output to device with ICC profile with optional arguments +func vipsgenIccExportWithOptions(in *C.VipsImage, pcs PCS, intent Intent, blackPointCompensation bool, outputProfile string, depth int) (*C.VipsImage, error) { + var out *C.VipsImage + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_icc_export_with_options(in, &out, C.VipsPCS(pcs), C.VipsIntent(intent), C.int(boolToInt(blackPointCompensation)), coutputProfile, C.int(depth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccImport vips_icc_import import from device with ICC profile +func vipsgenIccImport(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_icc_import(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccImportWithOptions vips_icc_import import from device with ICC profile with optional arguments +func vipsgenIccImportWithOptions(in *C.VipsImage, pcs PCS, intent Intent, blackPointCompensation bool, embedded bool, inputProfile string) (*C.VipsImage, error) { + var out *C.VipsImage + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + if err := C.vipsgen_icc_import_with_options(in, &out, C.VipsPCS(pcs), C.VipsIntent(intent), C.int(boolToInt(blackPointCompensation)), C.int(boolToInt(embedded)), cinputProfile); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccTransform vips_icc_transform transform between devices with ICC profiles +func vipsgenIccTransform(in *C.VipsImage, outputProfile string) (*C.VipsImage, error) { + var out *C.VipsImage + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_icc_transform(in, &out, coutputProfile); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIccTransformWithOptions vips_icc_transform transform between devices with ICC profiles with optional arguments +func vipsgenIccTransformWithOptions(in *C.VipsImage, outputProfile string, pcs PCS, intent Intent, blackPointCompensation bool, embedded bool, inputProfile string, depth int) (*C.VipsImage, error) { + var out *C.VipsImage + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + if err := C.vipsgen_icc_transform_with_options(in, &out, coutputProfile, C.VipsPCS(pcs), C.VipsIntent(intent), C.int(boolToInt(blackPointCompensation)), C.int(boolToInt(embedded)), cinputProfile, C.int(depth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIdentity vips_identity make a 1D image where pixel values are indexes +func vipsgenIdentity() (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_identity(&out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIdentityWithOptions vips_identity make a 1D image where pixel values are indexes with optional arguments +func vipsgenIdentityWithOptions(bands int, ushort bool, size int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_identity_with_options(&out, C.int(bands), C.int(boolToInt(ushort)), C.int(size)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIfthenelse vips_ifthenelse ifthenelse an image +func vipsgenIfthenelse(cond *C.VipsImage, in1 *C.VipsImage, in2 *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_ifthenelse(cond, in1, in2, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenIfthenelseWithOptions vips_ifthenelse ifthenelse an image with optional arguments +func vipsgenIfthenelseWithOptions(cond *C.VipsImage, in1 *C.VipsImage, in2 *C.VipsImage, blend bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_ifthenelse_with_options(cond, in1, in2, &out, C.int(boolToInt(blend))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInsert vips_insert insert image @sub into @main at @x, @y +func vipsgenInsert(main *C.VipsImage, sub *C.VipsImage, x int, y int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_insert(main, sub, &out, C.int(x), C.int(y)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInsertWithOptions vips_insert insert image @sub into @main at @x, @y with optional arguments +func vipsgenInsertWithOptions(main *C.VipsImage, sub *C.VipsImage, x int, y int, expand bool, background []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_insert_with_options(main, sub, &out, C.int(x), C.int(y), C.int(boolToInt(expand)), cbackground, cbackgroundLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInvert vips_invert invert an image +func vipsgenInvert(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_invert(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInvertlut vips_invertlut build an inverted look-up table +func vipsgenInvertlut(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_invertlut(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInvertlutWithOptions vips_invertlut build an inverted look-up table with optional arguments +func vipsgenInvertlutWithOptions(in *C.VipsImage, size int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_invertlut_with_options(in, &out, C.int(size)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInvfft vips_invfft inverse FFT +func vipsgenInvfft(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_invfft(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenInvfftWithOptions vips_invfft inverse FFT with optional arguments +func vipsgenInvfftWithOptions(in *C.VipsImage, real bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_invfft_with_options(in, &out, C.int(boolToInt(real))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJoin vips_join join a pair of images +func vipsgenJoin(in1 *C.VipsImage, in2 *C.VipsImage, direction Direction) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_join(in1, in2, &out, C.VipsDirection(direction)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJoinWithOptions vips_join join a pair of images with optional arguments +func vipsgenJoinWithOptions(in1 *C.VipsImage, in2 *C.VipsImage, direction Direction, expand bool, shim int, background []float64, align Align) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_join_with_options(in1, in2, &out, C.VipsDirection(direction), C.int(boolToInt(expand)), C.int(shim), cbackground, cbackgroundLength, C.VipsAlign(align)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kload vips_jp2kload load JPEG2000 image +func vipsgenJp2kload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jp2kload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kloadWithOptions vips_jp2kload load JPEG2000 image with optional arguments +func vipsgenJp2kloadWithOptions(filename string, page int, oneshot bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jp2kload_with_options(cfilename, &out, C.int(page), C.int(boolToInt(oneshot)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kloadBuffer vips_jp2kload_buffer load JPEG2000 image +func vipsgenJp2kloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jp2kload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kloadBufferWithOptions vips_jp2kload_buffer load JPEG2000 image with optional arguments +func vipsgenJp2kloadBufferWithOptions(buf []byte, page int, oneshot bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jp2kload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(boolToInt(oneshot)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kloadSource vips_jp2kload_source load JPEG2000 image +func vipsgenJp2kloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jp2kload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2kloadSourceWithOptions vips_jp2kload_source load JPEG2000 image with optional arguments +func vipsgenJp2kloadSourceWithOptions(source *C.VipsSourceCustom, page int, oneshot bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jp2kload_source_with_options(source, &out, C.int(page), C.int(boolToInt(oneshot)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJp2ksave vips_jp2ksave save image in JPEG2000 format +func vipsgenJp2ksave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jp2ksave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJp2ksaveWithOptions vips_jp2ksave save image in JPEG2000 format with optional arguments +func vipsgenJp2ksaveWithOptions(in *C.VipsImage, filename string, tileWidth int, tileHeight int, lossless bool, q int, subsampleMode Subsample, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jp2ksave_with_options(in, cfilename, C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignSubsample(subsampleMode), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJp2ksaveBuffer vips_jp2ksave_buffer save image in JPEG2000 format +func vipsgenJp2ksaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_jp2ksave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJp2ksaveBufferWithOptions vips_jp2ksave_buffer save image in JPEG2000 format with optional arguments +func vipsgenJp2ksaveBufferWithOptions(in *C.VipsImage, tileWidth int, tileHeight int, lossless bool, q int, subsampleMode Subsample, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jp2ksave_buffer_with_options(in, &buf, &length, C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignSubsample(subsampleMode), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJp2ksaveTarget vips_jp2ksave_target save image in JPEG2000 format +func vipsgenJp2ksaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_jp2ksave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJp2ksaveTargetWithOptions vips_jp2ksave_target save image in JPEG2000 format with optional arguments +func vipsgenJp2ksaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, tileWidth int, tileHeight int, lossless bool, q int, subsampleMode Subsample, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jp2ksave_target_with_options(in, target, C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignSubsample(subsampleMode), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJpegload vips_jpegload load jpeg from file +func vipsgenJpegload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jpegload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegloadWithOptions vips_jpegload load jpeg from file with optional arguments +func vipsgenJpegloadWithOptions(filename string, shrink int, autorotate bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jpegload_with_options(cfilename, &out, C.int(shrink), C.int(boolToInt(autorotate)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegloadBuffer vips_jpegload_buffer load jpeg from buffer +func vipsgenJpegloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jpegload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegloadBufferWithOptions vips_jpegload_buffer load jpeg from buffer with optional arguments +func vipsgenJpegloadBufferWithOptions(buf []byte, shrink int, autorotate bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jpegload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(shrink), C.int(boolToInt(autorotate)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegloadSource vips_jpegload_source load image from jpeg source +func vipsgenJpegloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jpegload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegloadSourceWithOptions vips_jpegload_source load image from jpeg source with optional arguments +func vipsgenJpegloadSourceWithOptions(source *C.VipsSourceCustom, shrink int, autorotate bool, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jpegload_source_with_options(source, &out, C.int(shrink), C.int(boolToInt(autorotate)), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJpegsave vips_jpegsave save image to jpeg file +func vipsgenJpegsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jpegsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJpegsaveWithOptions vips_jpegsave save image to jpeg file with optional arguments +func vipsgenJpegsaveWithOptions(in *C.VipsImage, filename string, q int, optimizeCoding bool, interlace bool, trellisQuant bool, overshootDeringing bool, optimizeScans bool, quantTable int, subsampleMode Subsample, restartInterval int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jpegsave_with_options(in, cfilename, C.int(q), C.int(boolToInt(optimizeCoding)), C.int(boolToInt(interlace)), C.int(boolToInt(trellisQuant)), C.int(boolToInt(overshootDeringing)), C.int(boolToInt(optimizeScans)), C.int(quantTable), C.VipsForeignSubsample(subsampleMode), C.int(restartInterval), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJpegsaveBuffer vips_jpegsave_buffer save image to jpeg buffer +func vipsgenJpegsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_jpegsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJpegsaveBufferWithOptions vips_jpegsave_buffer save image to jpeg buffer with optional arguments +func vipsgenJpegsaveBufferWithOptions(in *C.VipsImage, q int, optimizeCoding bool, interlace bool, trellisQuant bool, overshootDeringing bool, optimizeScans bool, quantTable int, subsampleMode Subsample, restartInterval int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jpegsave_buffer_with_options(in, &buf, &length, C.int(q), C.int(boolToInt(optimizeCoding)), C.int(boolToInt(interlace)), C.int(boolToInt(trellisQuant)), C.int(boolToInt(overshootDeringing)), C.int(boolToInt(optimizeScans)), C.int(quantTable), C.VipsForeignSubsample(subsampleMode), C.int(restartInterval), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJpegsaveTarget vips_jpegsave_target save image to jpeg target +func vipsgenJpegsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_jpegsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJpegsaveTargetWithOptions vips_jpegsave_target save image to jpeg target with optional arguments +func vipsgenJpegsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, q int, optimizeCoding bool, interlace bool, trellisQuant bool, overshootDeringing bool, optimizeScans bool, quantTable int, subsampleMode Subsample, restartInterval int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jpegsave_target_with_options(in, target, C.int(q), C.int(boolToInt(optimizeCoding)), C.int(boolToInt(interlace)), C.int(boolToInt(trellisQuant)), C.int(boolToInt(overshootDeringing)), C.int(boolToInt(optimizeScans)), C.int(quantTable), C.VipsForeignSubsample(subsampleMode), C.int(restartInterval), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJxlload vips_jxlload load JPEG-XL image +func vipsgenJxlload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jxlload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlloadWithOptions vips_jxlload load JPEG-XL image with optional arguments +func vipsgenJxlloadWithOptions(filename string, page int, n int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jxlload_with_options(cfilename, &out, C.int(page), C.int(n), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlloadBuffer vips_jxlload_buffer load JPEG-XL image +func vipsgenJxlloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jxlload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlloadBufferWithOptions vips_jxlload_buffer load JPEG-XL image with optional arguments +func vipsgenJxlloadBufferWithOptions(buf []byte, page int, n int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_jxlload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(n), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlloadSource vips_jxlload_source load JPEG-XL image +func vipsgenJxlloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jxlload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlloadSourceWithOptions vips_jxlload_source load JPEG-XL image with optional arguments +func vipsgenJxlloadSourceWithOptions(source *C.VipsSourceCustom, page int, n int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_jxlload_source_with_options(source, &out, C.int(page), C.int(n), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenJxlsave vips_jxlsave save image in JPEG-XL format +func vipsgenJxlsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_jxlsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJxlsaveWithOptions vips_jxlsave save image in JPEG-XL format with optional arguments +func vipsgenJxlsaveWithOptions(in *C.VipsImage, filename string, tier int, distance float64, effort int, lossless bool, q int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jxlsave_with_options(in, cfilename, C.int(tier), C.double(distance), C.int(effort), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJxlsaveBuffer vips_jxlsave_buffer save image in JPEG-XL format +func vipsgenJxlsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_jxlsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJxlsaveBufferWithOptions vips_jxlsave_buffer save image in JPEG-XL format with optional arguments +func vipsgenJxlsaveBufferWithOptions(in *C.VipsImage, tier int, distance float64, effort int, lossless bool, q int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jxlsave_buffer_with_options(in, &buf, &length, C.int(tier), C.double(distance), C.int(effort), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenJxlsaveTarget vips_jxlsave_target save image in JPEG-XL format +func vipsgenJxlsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_jxlsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenJxlsaveTargetWithOptions vips_jxlsave_target save image in JPEG-XL format with optional arguments +func vipsgenJxlsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, tier int, distance float64, effort int, lossless bool, q int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_jxlsave_target_with_options(in, target, C.int(tier), C.double(distance), C.int(effort), C.int(boolToInt(lossless)), C.int(q), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenLabelregions vips_labelregions label regions in an image +func vipsgenLabelregions(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_labelregions(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLinear vips_linear calculate (a * in + b) +func vipsgenLinear(in *C.VipsImage, a []float64, b []float64) (*C.VipsImage, error) { + var out *C.VipsImage + ca, _, err := convertToDoubleArray(a) + if err != nil { + return nil, err + } + if ca != nil { + defer freeDoubleArray(ca) + } + cb, _, err := convertToDoubleArray(b) + if err != nil { + return nil, err + } + if cb != nil { + defer freeDoubleArray(cb) + } + if err := C.vipsgen_linear(in, &out, ca, cb, C.int(len(a))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLinearWithOptions vips_linear calculate (a * in + b) with optional arguments +func vipsgenLinearWithOptions(in *C.VipsImage, a []float64, b []float64, uchar bool) (*C.VipsImage, error) { + var out *C.VipsImage + ca, _, err := convertToDoubleArray(a) + if err != nil { + return nil, err + } + if ca != nil { + defer freeDoubleArray(ca) + } + cb, _, err := convertToDoubleArray(b) + if err != nil { + return nil, err + } + if cb != nil { + defer freeDoubleArray(cb) + } + if err := C.vipsgen_linear_with_options(in, &out, ca, cb, C.int(len(a)), C.int(boolToInt(uchar))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLinecache vips_linecache cache an image as a set of lines +func vipsgenLinecache(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_linecache(in, &out); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenLinecacheWithOptions vips_linecache cache an image as a set of lines with optional arguments +func vipsgenLinecacheWithOptions(in *C.VipsImage, tileHeight int, access Access, threaded bool, persistent bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_linecache_with_options(in, &out, C.int(tileHeight), C.VipsAccess(access), C.int(boolToInt(threaded)), C.int(boolToInt(persistent))); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenLogmat vips_logmat make a Laplacian of Gaussian image +func vipsgenLogmat(sigma float64, minAmpl float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_logmat(&out, C.double(sigma), C.double(minAmpl)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenLogmatWithOptions vips_logmat make a Laplacian of Gaussian image with optional arguments +func vipsgenLogmatWithOptions(sigma float64, minAmpl float64, separable bool, precision Precision) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_logmat_with_options(&out, C.double(sigma), C.double(minAmpl), C.int(boolToInt(separable)), C.VipsPrecision(precision)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMagickload vips_magickload load file with ImageMagick +func vipsgenMagickload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_magickload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMagickloadWithOptions vips_magickload load file with ImageMagick with optional arguments +func vipsgenMagickloadWithOptions(filename string, density string, page int, n int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cdensity := C.CString(density) + defer freeCString(cdensity) + if err := C.vipsgen_magickload_with_options(cfilename, &out, cdensity, C.int(page), C.int(n), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMagickloadBuffer vips_magickload_buffer load buffer with ImageMagick +func vipsgenMagickloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_magickload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMagickloadBufferWithOptions vips_magickload_buffer load buffer with ImageMagick with optional arguments +func vipsgenMagickloadBufferWithOptions(buf []byte, density string, page int, n int, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + cdensity := C.CString(density) + defer freeCString(cdensity) + if err := C.vipsgen_magickload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, cdensity, C.int(page), C.int(n), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMagicksave vips_magicksave save file with ImageMagick +func vipsgenMagicksave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_magicksave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMagicksaveWithOptions vips_magicksave save file with ImageMagick with optional arguments +func vipsgenMagicksaveWithOptions(in *C.VipsImage, filename string, format string, quality int, optimizeGifFrames bool, optimizeGifTransparency bool, bitdepth int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cformat := C.CString(format) + defer freeCString(cformat) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_magicksave_with_options(in, cfilename, cformat, C.int(quality), C.int(boolToInt(optimizeGifFrames)), C.int(boolToInt(optimizeGifTransparency)), C.int(bitdepth), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMagicksaveBuffer vips_magicksave_buffer save image to magick buffer +func vipsgenMagicksaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_magicksave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenMagicksaveBufferWithOptions vips_magicksave_buffer save image to magick buffer with optional arguments +func vipsgenMagicksaveBufferWithOptions(in *C.VipsImage, format string, quality int, optimizeGifFrames bool, optimizeGifTransparency bool, bitdepth int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cformat := C.CString(format) + defer freeCString(cformat) + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_magicksave_buffer_with_options(in, &buf, &length, cformat, C.int(quality), C.int(boolToInt(optimizeGifFrames)), C.int(boolToInt(optimizeGifTransparency)), C.int(bitdepth), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenMapim vips_mapim resample with a map image +func vipsgenMapim(in *C.VipsImage, index *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mapim(in, &out, index); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMapimWithOptions vips_mapim resample with a map image with optional arguments +func vipsgenMapimWithOptions(in *C.VipsImage, index *C.VipsImage, interpolate *Interpolate, background []float64, premultiplied bool, extend Extend) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_mapim_with_options(in, &out, index, vipsInterpolateToC(interpolate), cbackground, cbackgroundLength, C.int(boolToInt(premultiplied)), C.VipsExtend(extend)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaplut vips_maplut map an image though a lut +func vipsgenMaplut(in *C.VipsImage, lut *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_maplut(in, &out, lut); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaplutWithOptions vips_maplut map an image though a lut with optional arguments +func vipsgenMaplutWithOptions(in *C.VipsImage, lut *C.VipsImage, band int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_maplut_with_options(in, &out, lut, C.int(band)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworth vips_mask_butterworth make a butterworth filter +func vipsgenMaskButterworth(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoff), C.double(amplitudeCutoff)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworthWithOptions vips_mask_butterworth make a butterworth filter with optional arguments +func vipsgenMaskButterworthWithOptions(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth_with_options(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworthBand vips_mask_butterworth_band make a butterworth_band filter +func vipsgenMaskButterworthBand(width int, height int, order float64, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth_band(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius), C.double(amplitudeCutoff)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworthBandWithOptions vips_mask_butterworth_band make a butterworth_band filter with optional arguments +func vipsgenMaskButterworthBandWithOptions(width int, height int, order float64, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth_band_with_options(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius), C.double(amplitudeCutoff), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworthRing vips_mask_butterworth_ring make a butterworth ring filter +func vipsgenMaskButterworthRing(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth_ring(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.double(ringwidth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskButterworthRingWithOptions vips_mask_butterworth_ring make a butterworth ring filter with optional arguments +func vipsgenMaskButterworthRingWithOptions(width int, height int, order float64, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_butterworth_ring_with_options(&out, C.int(width), C.int(height), C.double(order), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.double(ringwidth), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskFractal vips_mask_fractal make fractal filter +func vipsgenMaskFractal(width int, height int, fractalDimension float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_fractal(&out, C.int(width), C.int(height), C.double(fractalDimension)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskFractalWithOptions vips_mask_fractal make fractal filter with optional arguments +func vipsgenMaskFractalWithOptions(width int, height int, fractalDimension float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_fractal_with_options(&out, C.int(width), C.int(height), C.double(fractalDimension), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussian vips_mask_gaussian make a gaussian filter +func vipsgenMaskGaussian(width int, height int, frequencyCutoff float64, amplitudeCutoff float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(amplitudeCutoff)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussianWithOptions vips_mask_gaussian make a gaussian filter with optional arguments +func vipsgenMaskGaussianWithOptions(width int, height int, frequencyCutoff float64, amplitudeCutoff float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussianBand vips_mask_gaussian_band make a gaussian filter +func vipsgenMaskGaussianBand(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian_band(&out, C.int(width), C.int(height), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius), C.double(amplitudeCutoff)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussianBandWithOptions vips_mask_gaussian_band make a gaussian filter with optional arguments +func vipsgenMaskGaussianBandWithOptions(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, amplitudeCutoff float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian_band_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius), C.double(amplitudeCutoff), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussianRing vips_mask_gaussian_ring make a gaussian ring filter +func vipsgenMaskGaussianRing(width int, height int, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian_ring(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.double(ringwidth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskGaussianRingWithOptions vips_mask_gaussian_ring make a gaussian ring filter with optional arguments +func vipsgenMaskGaussianRingWithOptions(width int, height int, frequencyCutoff float64, amplitudeCutoff float64, ringwidth float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_gaussian_ring_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(amplitudeCutoff), C.double(ringwidth), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdeal vips_mask_ideal make an ideal filter +func vipsgenMaskIdeal(width int, height int, frequencyCutoff float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal(&out, C.int(width), C.int(height), C.double(frequencyCutoff)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdealWithOptions vips_mask_ideal make an ideal filter with optional arguments +func vipsgenMaskIdealWithOptions(width int, height int, frequencyCutoff float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdealBand vips_mask_ideal_band make an ideal band filter +func vipsgenMaskIdealBand(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal_band(&out, C.int(width), C.int(height), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdealBandWithOptions vips_mask_ideal_band make an ideal band filter with optional arguments +func vipsgenMaskIdealBandWithOptions(width int, height int, frequencyCutoffX float64, frequencyCutoffY float64, radius float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal_band_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoffX), C.double(frequencyCutoffY), C.double(radius), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdealRing vips_mask_ideal_ring make an ideal ring filter +func vipsgenMaskIdealRing(width int, height int, frequencyCutoff float64, ringwidth float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal_ring(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(ringwidth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMaskIdealRingWithOptions vips_mask_ideal_ring make an ideal ring filter with optional arguments +func vipsgenMaskIdealRingWithOptions(width int, height int, frequencyCutoff float64, ringwidth float64, uchar bool, nodc bool, reject bool, optical bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mask_ideal_ring_with_options(&out, C.int(width), C.int(height), C.double(frequencyCutoff), C.double(ringwidth), C.int(boolToInt(uchar)), C.int(boolToInt(nodc)), C.int(boolToInt(reject)), C.int(boolToInt(optical))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatch vips_match first-order match of two images +func vipsgenMatch(ref *C.VipsImage, sec *C.VipsImage, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_match(ref, sec, &out, C.int(xr1), C.int(yr1), C.int(xs1), C.int(ys1), C.int(xr2), C.int(yr2), C.int(xs2), C.int(ys2)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatchWithOptions vips_match first-order match of two images with optional arguments +func vipsgenMatchWithOptions(ref *C.VipsImage, sec *C.VipsImage, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int, hwindow int, harea int, search bool, interpolate *Interpolate) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_match_with_options(ref, sec, &out, C.int(xr1), C.int(yr1), C.int(xs1), C.int(ys1), C.int(xr2), C.int(yr2), C.int(xs2), C.int(ys2), C.int(hwindow), C.int(harea), C.int(boolToInt(search)), vipsInterpolateToC(interpolate)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMath vips_math apply a math operation to an image +func vipsgenMath(in *C.VipsImage, math OperationMath) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_math(in, &out, C.VipsOperationMath(math)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMath2 vips_math2 binary math operations +func vipsgenMath2(left *C.VipsImage, right *C.VipsImage, math2 OperationMath2) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_math2(left, right, &out, C.VipsOperationMath2(math2)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMath2Const vips_math2_const binary math operations with a constant +func vipsgenMath2Const(in *C.VipsImage, math2 OperationMath2, c []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cc, _, err := convertToDoubleArray(c) + if err != nil { + return nil, err + } + if cc != nil { + defer freeDoubleArray(cc) + } + if err := C.vipsgen_math2_const(in, &out, C.VipsOperationMath2(math2), cc, C.int(len(c))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatload vips_matload load mat from file +func vipsgenMatload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_matload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatloadWithOptions vips_matload load mat from file with optional arguments +func vipsgenMatloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_matload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixinvert vips_matrixinvert invert a matrix +func vipsgenMatrixinvert(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_matrixinvert(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixload vips_matrixload load matrix +func vipsgenMatrixload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_matrixload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixloadWithOptions vips_matrixload load matrix with optional arguments +func vipsgenMatrixloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_matrixload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixloadSource vips_matrixload_source load matrix +func vipsgenMatrixloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_matrixload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixloadSourceWithOptions vips_matrixload_source load matrix with optional arguments +func vipsgenMatrixloadSourceWithOptions(source *C.VipsSourceCustom, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_matrixload_source_with_options(source, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixmultiply vips_matrixmultiply multiply two matrices +func vipsgenMatrixmultiply(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_matrixmultiply(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMatrixprint vips_matrixprint print matrix +func vipsgenMatrixprint(in *C.VipsImage) (error) { + + if err := C.vipsgen_matrixprint(in); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMatrixprintWithOptions vips_matrixprint print matrix with optional arguments +func vipsgenMatrixprintWithOptions(in *C.VipsImage, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_matrixprint_with_options(in, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMatrixsave vips_matrixsave save image to matrix +func vipsgenMatrixsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_matrixsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMatrixsaveWithOptions vips_matrixsave save image to matrix with optional arguments +func vipsgenMatrixsaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_matrixsave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMatrixsaveTarget vips_matrixsave_target save image to matrix +func vipsgenMatrixsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_matrixsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMatrixsaveTargetWithOptions vips_matrixsave_target save image to matrix with optional arguments +func vipsgenMatrixsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_matrixsave_target_with_options(in, target, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenMax vips_max find image maximum +func vipsgenMax(in *C.VipsImage) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_max(in, cout); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenMaxWithOptions vips_max find image maximum with optional arguments +func vipsgenMaxWithOptions(in *C.VipsImage, size int) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_max_with_options(in, cout, C.int(size)); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenMaxpair vips_maxpair maximum of a pair of images +func vipsgenMaxpair(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_maxpair(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMeasure vips_measure measure a set of patches on a color chart +func vipsgenMeasure(in *C.VipsImage, h int, v int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_measure(in, &out, C.int(h), C.int(v)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMeasureWithOptions vips_measure measure a set of patches on a color chart with optional arguments +func vipsgenMeasureWithOptions(in *C.VipsImage, h int, v int, left int, top int, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_measure_with_options(in, &out, C.int(h), C.int(v), C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMerge vips_merge merge two images +func vipsgenMerge(ref *C.VipsImage, sec *C.VipsImage, direction Direction, dx int, dy int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_merge(ref, sec, &out, C.VipsDirection(direction), C.int(dx), C.int(dy)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMergeWithOptions vips_merge merge two images with optional arguments +func vipsgenMergeWithOptions(ref *C.VipsImage, sec *C.VipsImage, direction Direction, dx int, dy int, mblend int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_merge_with_options(ref, sec, &out, C.VipsDirection(direction), C.int(dx), C.int(dy), C.int(mblend)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMin vips_min find image minimum +func vipsgenMin(in *C.VipsImage) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_min(in, cout); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenMinWithOptions vips_min find image minimum with optional arguments +func vipsgenMinWithOptions(in *C.VipsImage, size int) (float64, error) { + var out float64 + cout := (*C.double)(unsafe.Pointer(&out)) + if err := C.vipsgen_min_with_options(in, cout, C.int(size)); err != 0 { + return 0, handleVipsError() + } + return out, nil +} + +// vipsgenMinpair vips_minpair minimum of a pair of images +func vipsgenMinpair(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_minpair(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMorph vips_morph morphology operation +func vipsgenMorph(in *C.VipsImage, mask *C.VipsImage, morph OperationMorphology) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_morph(in, &out, mask, C.VipsOperationMorphology(morph)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMosaic vips_mosaic mosaic two images +func vipsgenMosaic(ref *C.VipsImage, sec *C.VipsImage, direction Direction, xref int, yref int, xsec int, ysec int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mosaic(ref, sec, &out, C.VipsDirection(direction), C.int(xref), C.int(yref), C.int(xsec), C.int(ysec)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMosaicWithOptions vips_mosaic mosaic two images with optional arguments +func vipsgenMosaicWithOptions(ref *C.VipsImage, sec *C.VipsImage, direction Direction, xref int, yref int, xsec int, ysec int, hwindow int, harea int, mblend int, bandno int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mosaic_with_options(ref, sec, &out, C.VipsDirection(direction), C.int(xref), C.int(yref), C.int(xsec), C.int(ysec), C.int(hwindow), C.int(harea), C.int(mblend), C.int(bandno)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMosaic1 vips_mosaic1 first-order mosaic of two images +func vipsgenMosaic1(ref *C.VipsImage, sec *C.VipsImage, direction Direction, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mosaic1(ref, sec, &out, C.VipsDirection(direction), C.int(xr1), C.int(yr1), C.int(xs1), C.int(ys1), C.int(xr2), C.int(yr2), C.int(xs2), C.int(ys2)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMosaic1WithOptions vips_mosaic1 first-order mosaic of two images with optional arguments +func vipsgenMosaic1WithOptions(ref *C.VipsImage, sec *C.VipsImage, direction Direction, xr1 int, yr1 int, xs1 int, ys1 int, xr2 int, yr2 int, xs2 int, ys2 int, hwindow int, harea int, search bool, interpolate *Interpolate, mblend int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_mosaic1_with_options(ref, sec, &out, C.VipsDirection(direction), C.int(xr1), C.int(yr1), C.int(xs1), C.int(ys1), C.int(xr2), C.int(yr2), C.int(xs2), C.int(ys2), C.int(hwindow), C.int(harea), C.int(boolToInt(search)), vipsInterpolateToC(interpolate), C.int(mblend)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMsb vips_msb pick most-significant byte from an image +func vipsgenMsb(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_msb(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMsbWithOptions vips_msb pick most-significant byte from an image with optional arguments +func vipsgenMsbWithOptions(in *C.VipsImage, band int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_msb_with_options(in, &out, C.int(band)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenMultiply vips_multiply multiply two images +func vipsgenMultiply(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_multiply(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenNiftiload vips_niftiload load NIfTI volume +func vipsgenNiftiload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_niftiload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenNiftiloadWithOptions vips_niftiload load NIfTI volume with optional arguments +func vipsgenNiftiloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_niftiload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenNiftiloadSource vips_niftiload_source load NIfTI volumes +func vipsgenNiftiloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_niftiload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenNiftiloadSourceWithOptions vips_niftiload_source load NIfTI volumes with optional arguments +func vipsgenNiftiloadSourceWithOptions(source *C.VipsSourceCustom, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_niftiload_source_with_options(source, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenNiftisave vips_niftisave save image to nifti file +func vipsgenNiftisave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_niftisave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenNiftisaveWithOptions vips_niftisave save image to nifti file with optional arguments +func vipsgenNiftisaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_niftisave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenOpenexrload vips_openexrload load an OpenEXR image +func vipsgenOpenexrload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_openexrload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenOpenexrloadWithOptions vips_openexrload load an OpenEXR image with optional arguments +func vipsgenOpenexrloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_openexrload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenOpenslideload vips_openslideload load file with OpenSlide +func vipsgenOpenslideload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_openslideload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenOpenslideloadWithOptions vips_openslideload load file with OpenSlide with optional arguments +func vipsgenOpenslideloadWithOptions(filename string, level int, autocrop bool, associated string, attachAssociated bool, rgb bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cassociated := C.CString(associated) + defer freeCString(cassociated) + if err := C.vipsgen_openslideload_with_options(cfilename, &out, C.int(level), C.int(boolToInt(autocrop)), cassociated, C.int(boolToInt(attachAssociated)), C.int(boolToInt(rgb)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenOpenslideloadSource vips_openslideload_source load source with OpenSlide +func vipsgenOpenslideloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_openslideload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenOpenslideloadSourceWithOptions vips_openslideload_source load source with OpenSlide with optional arguments +func vipsgenOpenslideloadSourceWithOptions(source *C.VipsSourceCustom, level int, autocrop bool, associated string, attachAssociated bool, rgb bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cassociated := C.CString(associated) + defer freeCString(cassociated) + if err := C.vipsgen_openslideload_source_with_options(source, &out, C.int(level), C.int(boolToInt(autocrop)), cassociated, C.int(boolToInt(attachAssociated)), C.int(boolToInt(rgb)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfload vips_pdfload load PDF from file +func vipsgenPdfload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_pdfload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfloadWithOptions vips_pdfload load PDF from file with optional arguments +func vipsgenPdfloadWithOptions(filename string, page int, n int, dpi float64, scale float64, background []float64, password string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cpassword := C.CString(password) + defer freeCString(cpassword) + if err := C.vipsgen_pdfload_with_options(cfilename, &out, C.int(page), C.int(n), C.double(dpi), C.double(scale), cbackground, cbackgroundLength, cpassword, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfloadBuffer vips_pdfload_buffer load PDF from buffer +func vipsgenPdfloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_pdfload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfloadBufferWithOptions vips_pdfload_buffer load PDF from buffer with optional arguments +func vipsgenPdfloadBufferWithOptions(buf []byte, page int, n int, dpi float64, scale float64, background []float64, password string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cpassword := C.CString(password) + defer freeCString(cpassword) + if err := C.vipsgen_pdfload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(n), C.double(dpi), C.double(scale), cbackground, cbackgroundLength, cpassword, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfloadSource vips_pdfload_source load PDF from source +func vipsgenPdfloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_pdfload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPdfloadSourceWithOptions vips_pdfload_source load PDF from source with optional arguments +func vipsgenPdfloadSourceWithOptions(source *C.VipsSourceCustom, page int, n int, dpi float64, scale float64, background []float64, password string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cpassword := C.CString(password) + defer freeCString(cpassword) + if err := C.vipsgen_pdfload_source_with_options(source, &out, C.int(page), C.int(n), C.double(dpi), C.double(scale), cbackground, cbackgroundLength, cpassword, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPercent vips_percent find threshold for percent of pixels +func vipsgenPercent(in *C.VipsImage, percent float64) (int, error) { + var threshold int + cthreshold := (*C.int)(unsafe.Pointer(&threshold)) + if err := C.vipsgen_percent(in, C.double(percent), cthreshold); err != 0 { + return 0, handleVipsError() + } + return threshold, nil +} + +// vipsgenPerlin vips_perlin make a perlin noise image +func vipsgenPerlin(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_perlin(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPerlinWithOptions vips_perlin make a perlin noise image with optional arguments +func vipsgenPerlinWithOptions(width int, height int, cellSize int, uchar bool, seed int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_perlin_with_options(&out, C.int(width), C.int(height), C.int(cellSize), C.int(boolToInt(uchar)), C.int(seed)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPhasecor vips_phasecor calculate phase correlation +func vipsgenPhasecor(in *C.VipsImage, in2 *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_phasecor(in, in2, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngload vips_pngload load png from file +func vipsgenPngload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_pngload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngloadWithOptions vips_pngload load png from file with optional arguments +func vipsgenPngloadWithOptions(filename string, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_pngload_with_options(cfilename, &out, C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngloadBuffer vips_pngload_buffer load png from buffer +func vipsgenPngloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_pngload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngloadBufferWithOptions vips_pngload_buffer load png from buffer with optional arguments +func vipsgenPngloadBufferWithOptions(buf []byte, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_pngload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngloadSource vips_pngload_source load png from source +func vipsgenPngloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_pngload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngloadSourceWithOptions vips_pngload_source load png from source with optional arguments +func vipsgenPngloadSourceWithOptions(source *C.VipsSourceCustom, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_pngload_source_with_options(source, &out, C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPngsave vips_pngsave save image to png file +func vipsgenPngsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_pngsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPngsaveWithOptions vips_pngsave save image to png file with optional arguments +func vipsgenPngsaveWithOptions(in *C.VipsImage, filename string, compression int, interlace bool, filter PngFilter, palette bool, q int, dither float64, bitdepth int, effort int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_pngsave_with_options(in, cfilename, C.int(compression), C.int(boolToInt(interlace)), C.VipsForeignPngFilter(filter), C.int(boolToInt(palette)), C.int(q), C.double(dither), C.int(bitdepth), C.int(effort), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPngsaveBuffer vips_pngsave_buffer save image to png buffer +func vipsgenPngsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_pngsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenPngsaveBufferWithOptions vips_pngsave_buffer save image to png buffer with optional arguments +func vipsgenPngsaveBufferWithOptions(in *C.VipsImage, compression int, interlace bool, filter PngFilter, palette bool, q int, dither float64, bitdepth int, effort int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_pngsave_buffer_with_options(in, &buf, &length, C.int(compression), C.int(boolToInt(interlace)), C.VipsForeignPngFilter(filter), C.int(boolToInt(palette)), C.int(q), C.double(dither), C.int(bitdepth), C.int(effort), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenPngsaveTarget vips_pngsave_target save image to target as PNG +func vipsgenPngsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_pngsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPngsaveTargetWithOptions vips_pngsave_target save image to target as PNG with optional arguments +func vipsgenPngsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, compression int, interlace bool, filter PngFilter, palette bool, q int, dither float64, bitdepth int, effort int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_pngsave_target_with_options(in, target, C.int(compression), C.int(boolToInt(interlace)), C.VipsForeignPngFilter(filter), C.int(boolToInt(palette)), C.int(q), C.double(dither), C.int(bitdepth), C.int(effort), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPpmload vips_ppmload load ppm from file +func vipsgenPpmload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_ppmload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmloadWithOptions vips_ppmload load ppm from file with optional arguments +func vipsgenPpmloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_ppmload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmloadBuffer vips_ppmload_buffer load ppm from buffer +func vipsgenPpmloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_ppmload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmloadBufferWithOptions vips_ppmload_buffer load ppm from buffer with optional arguments +func vipsgenPpmloadBufferWithOptions(buf []byte, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_ppmload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmloadSource vips_ppmload_source load ppm from source +func vipsgenPpmloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_ppmload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmloadSourceWithOptions vips_ppmload_source load ppm from source with optional arguments +func vipsgenPpmloadSourceWithOptions(source *C.VipsSourceCustom, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_ppmload_source_with_options(source, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPpmsave vips_ppmsave save image to ppm file +func vipsgenPpmsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_ppmsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPpmsaveWithOptions vips_ppmsave save image to ppm file with optional arguments +func vipsgenPpmsaveWithOptions(in *C.VipsImage, filename string, format PpmFormat, ascii bool, bitdepth int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_ppmsave_with_options(in, cfilename, C.VipsForeignPpmFormat(format), C.int(boolToInt(ascii)), C.int(bitdepth), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPpmsaveTarget vips_ppmsave_target save to ppm +func vipsgenPpmsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_ppmsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPpmsaveTargetWithOptions vips_ppmsave_target save to ppm with optional arguments +func vipsgenPpmsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, format PpmFormat, ascii bool, bitdepth int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_ppmsave_target_with_options(in, target, C.VipsForeignPpmFormat(format), C.int(boolToInt(ascii)), C.int(bitdepth), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenPremultiply vips_premultiply premultiply image alpha +func vipsgenPremultiply(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_premultiply(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPremultiplyWithOptions vips_premultiply premultiply image alpha with optional arguments +func vipsgenPremultiplyWithOptions(in *C.VipsImage, maxAlpha float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_premultiply_with_options(in, &out, C.double(maxAlpha)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenPrewitt vips_prewitt Prewitt edge detector +func vipsgenPrewitt(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_prewitt(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenProfile vips_profile find image profiles +func vipsgenProfile(in *C.VipsImage) (*C.VipsImage, *C.VipsImage, error) { + var columns *C.VipsImage + var rows *C.VipsImage + if err := C.vipsgen_profile(in, &columns, &rows); err != 0 { + return nil, nil, handleVipsError() + } + return columns, rows, nil +} + +// vipsgenProfileLoad vips_profile_load load named ICC profile +func vipsgenProfileLoad(name string) ([]byte, error) { + var profile *C.VipsBlob + cname := C.CString(name) + defer freeCString(cname) + if err := C.vipsgen_profile_load(cname, &profile); err != 0 { + return nil, handleVipsError() + } + return vipsBlobToBytes(profile), nil +} + +// vipsgenProject vips_project find image projections +func vipsgenProject(in *C.VipsImage) (*C.VipsImage, *C.VipsImage, error) { + var columns *C.VipsImage + var rows *C.VipsImage + if err := C.vipsgen_project(in, &columns, &rows); err != 0 { + return nil, nil, handleVipsError() + } + return columns, rows, nil +} + +// vipsgenQuadratic vips_quadratic resample an image with a quadratic transform +func vipsgenQuadratic(in *C.VipsImage, coeff *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_quadratic(in, &out, coeff); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenQuadraticWithOptions vips_quadratic resample an image with a quadratic transform with optional arguments +func vipsgenQuadraticWithOptions(in *C.VipsImage, coeff *C.VipsImage, interpolate *Interpolate) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_quadratic_with_options(in, &out, coeff, vipsInterpolateToC(interpolate)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRad2float vips_rad2float unpack Radiance coding to float RGB +func vipsgenRad2float(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rad2float(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadload vips_radload load a Radiance image from a file +func vipsgenRadload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_radload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadloadWithOptions vips_radload load a Radiance image from a file with optional arguments +func vipsgenRadloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_radload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadloadBuffer vips_radload_buffer load rad from buffer +func vipsgenRadloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_radload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadloadBufferWithOptions vips_radload_buffer load rad from buffer with optional arguments +func vipsgenRadloadBufferWithOptions(buf []byte, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_radload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadloadSource vips_radload_source load rad from source +func vipsgenRadloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_radload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadloadSourceWithOptions vips_radload_source load rad from source with optional arguments +func vipsgenRadloadSourceWithOptions(source *C.VipsSourceCustom, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_radload_source_with_options(source, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRadsave vips_radsave save image to Radiance file +func vipsgenRadsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_radsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRadsaveWithOptions vips_radsave save image to Radiance file with optional arguments +func vipsgenRadsaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_radsave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRadsaveBuffer vips_radsave_buffer save image to Radiance buffer +func vipsgenRadsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_radsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenRadsaveBufferWithOptions vips_radsave_buffer save image to Radiance buffer with optional arguments +func vipsgenRadsaveBufferWithOptions(in *C.VipsImage, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_radsave_buffer_with_options(in, &buf, &length, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenRadsaveTarget vips_radsave_target save image to Radiance target +func vipsgenRadsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_radsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRadsaveTargetWithOptions vips_radsave_target save image to Radiance target with optional arguments +func vipsgenRadsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_radsave_target_with_options(in, target, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRank vips_rank rank filter +func vipsgenRank(in *C.VipsImage, width int, height int, index int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rank(in, &out, C.int(width), C.int(height), C.int(index)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRawload vips_rawload load raw data from a file +func vipsgenRawload(filename string, width int, height int, bands int) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_rawload(cfilename, &out, C.int(width), C.int(height), C.int(bands)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRawloadWithOptions vips_rawload load raw data from a file with optional arguments +func vipsgenRawloadWithOptions(filename string, width int, height int, bands int, offset uint64, format BandFormat, interpretation Interpretation, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_rawload_with_options(cfilename, &out, C.int(width), C.int(height), C.int(bands), C.guint64(offset), C.VipsBandFormat(format), C.VipsInterpretation(interpretation), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRawsave vips_rawsave save image to raw file +func vipsgenRawsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_rawsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRawsaveWithOptions vips_rawsave save image to raw file with optional arguments +func vipsgenRawsaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_rawsave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRawsaveBuffer vips_rawsave_buffer write raw image to buffer +func vipsgenRawsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_rawsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenRawsaveBufferWithOptions vips_rawsave_buffer write raw image to buffer with optional arguments +func vipsgenRawsaveBufferWithOptions(in *C.VipsImage, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_rawsave_buffer_with_options(in, &buf, &length, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenRawsaveTarget vips_rawsave_target write raw image to target +func vipsgenRawsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_rawsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRawsaveTargetWithOptions vips_rawsave_target write raw image to target with optional arguments +func vipsgenRawsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_rawsave_target_with_options(in, target, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenRecomb vips_recomb linear recombination with matrix +func vipsgenRecomb(in *C.VipsImage, m *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_recomb(in, &out, m); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReduce vips_reduce reduce an image +func vipsgenReduce(in *C.VipsImage, hshrink float64, vshrink float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reduce(in, &out, C.double(hshrink), C.double(vshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReduceWithOptions vips_reduce reduce an image with optional arguments +func vipsgenReduceWithOptions(in *C.VipsImage, hshrink float64, vshrink float64, kernel Kernel, gap float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reduce_with_options(in, &out, C.double(hshrink), C.double(vshrink), C.VipsKernel(kernel), C.double(gap)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReduceh vips_reduceh shrink an image horizontally +func vipsgenReduceh(in *C.VipsImage, hshrink float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reduceh(in, &out, C.double(hshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReducehWithOptions vips_reduceh shrink an image horizontally with optional arguments +func vipsgenReducehWithOptions(in *C.VipsImage, hshrink float64, kernel Kernel, gap float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reduceh_with_options(in, &out, C.double(hshrink), C.VipsKernel(kernel), C.double(gap)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReducev vips_reducev shrink an image vertically +func vipsgenReducev(in *C.VipsImage, vshrink float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reducev(in, &out, C.double(vshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReducevWithOptions vips_reducev shrink an image vertically with optional arguments +func vipsgenReducevWithOptions(in *C.VipsImage, vshrink float64, kernel Kernel, gap float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_reducev_with_options(in, &out, C.double(vshrink), C.VipsKernel(kernel), C.double(gap)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRelational vips_relational relational operation on two images +func vipsgenRelational(left *C.VipsImage, right *C.VipsImage, relational OperationRelational) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_relational(left, right, &out, C.VipsOperationRelational(relational)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRelationalConst vips_relational_const relational operations against a constant +func vipsgenRelationalConst(in *C.VipsImage, relational OperationRelational, c []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cc, _, err := convertToDoubleArray(c) + if err != nil { + return nil, err + } + if cc != nil { + defer freeDoubleArray(cc) + } + if err := C.vipsgen_relational_const(in, &out, C.VipsOperationRelational(relational), cc, C.int(len(c))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRemainder vips_remainder remainder after integer division of two images +func vipsgenRemainder(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_remainder(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRemainderConst vips_remainder_const remainder after integer division of an image and a constant +func vipsgenRemainderConst(in *C.VipsImage, c []float64) (*C.VipsImage, error) { + var out *C.VipsImage + cc, _, err := convertToDoubleArray(c) + if err != nil { + return nil, err + } + if cc != nil { + defer freeDoubleArray(cc) + } + if err := C.vipsgen_remainder_const(in, &out, cc, C.int(len(c))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRemosaic vips_remosaic rebuild an mosaiced image +func vipsgenRemosaic(in *C.VipsImage, oldStr string, newStr string) (*C.VipsImage, error) { + var out *C.VipsImage + coldStr := C.CString(oldStr) + defer freeCString(coldStr) + cnewStr := C.CString(newStr) + defer freeCString(cnewStr) + if err := C.vipsgen_remosaic(in, &out, coldStr, cnewStr); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenReplicate vips_replicate replicate an image +func vipsgenReplicate(in *C.VipsImage, across int, down int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_replicate(in, &out, C.int(across), C.int(down)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenResize vips_resize resize an image +func vipsgenResize(in *C.VipsImage, scale float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_resize(in, &out, C.double(scale)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenResizeWithOptions vips_resize resize an image with optional arguments +func vipsgenResizeWithOptions(in *C.VipsImage, scale float64, kernel Kernel, gap float64, vscale float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_resize_with_options(in, &out, C.double(scale), C.VipsKernel(kernel), C.double(gap), C.double(vscale)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRot vips_rot rotate an image +func vipsgenRot(in *C.VipsImage, angle Angle) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rot(in, &out, C.VipsAngle(angle)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRot45 vips_rot45 rotate an image +func vipsgenRot45(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rot45(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRot45WithOptions vips_rot45 rotate an image with optional arguments +func vipsgenRot45WithOptions(in *C.VipsImage, angle Angle45) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rot45_with_options(in, &out, C.VipsAngle45(angle)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRotate vips_rotate rotate an image by a number of degrees +func vipsgenRotate(in *C.VipsImage, angle float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rotate(in, &out, C.double(angle)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRotateWithOptions vips_rotate rotate an image by a number of degrees with optional arguments +func vipsgenRotateWithOptions(in *C.VipsImage, angle float64, interpolate *Interpolate, background []float64, odx float64, ody float64, idx float64, idy float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_rotate_with_options(in, &out, C.double(angle), vipsInterpolateToC(interpolate), cbackground, cbackgroundLength, C.double(odx), C.double(ody), C.double(idx), C.double(idy)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenRound vips_round perform a round function on an image +func vipsgenRound(in *C.VipsImage, round OperationRound) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_round(in, &out, C.VipsOperationRound(round)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSRGB2HSV vips_sRGB2HSV transform sRGB to HSV +func vipsgenSRGB2HSV(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sRGB2HSV(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSRGB2scRGB vips_sRGB2scRGB convert an sRGB image to scRGB +func vipsgenSRGB2scRGB(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sRGB2scRGB(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScRGB2BW vips_scRGB2BW convert scRGB to BW +func vipsgenScRGB2BW(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scRGB2BW(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScRGB2BWWithOptions vips_scRGB2BW convert scRGB to BW with optional arguments +func vipsgenScRGB2BWWithOptions(in *C.VipsImage, depth int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scRGB2BW_with_options(in, &out, C.int(depth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScRGB2XYZ vips_scRGB2XYZ transform scRGB to XYZ +func vipsgenScRGB2XYZ(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scRGB2XYZ(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScRGB2sRGB vips_scRGB2sRGB convert scRGB to sRGB +func vipsgenScRGB2sRGB(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scRGB2sRGB(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScRGB2sRGBWithOptions vips_scRGB2sRGB convert scRGB to sRGB with optional arguments +func vipsgenScRGB2sRGBWithOptions(in *C.VipsImage, depth int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scRGB2sRGB_with_options(in, &out, C.int(depth)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScale vips_scale scale an image to uchar +func vipsgenScale(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scale(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScaleWithOptions vips_scale scale an image to uchar with optional arguments +func vipsgenScaleWithOptions(in *C.VipsImage, exp float64, log bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scale_with_options(in, &out, C.double(exp), C.int(boolToInt(log))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenScharr vips_scharr Scharr edge detector +func vipsgenScharr(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_scharr(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSdf vips_sdf create an SDF image +func vipsgenSdf(width int, height int, shape SdfShape) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sdf(&out, C.int(width), C.int(height), C.VipsSdfShape(shape)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSdfWithOptions vips_sdf create an SDF image with optional arguments +func vipsgenSdfWithOptions(width int, height int, shape SdfShape, r float64, a []float64, b []float64, corners []float64) (*C.VipsImage, error) { + var out *C.VipsImage + ca, caLength, err := convertToDoubleArray(a) + if err != nil { + return nil, err + } + if ca != nil { + defer freeDoubleArray(ca) + } + cb, cbLength, err := convertToDoubleArray(b) + if err != nil { + return nil, err + } + if cb != nil { + defer freeDoubleArray(cb) + } + ccorners, ccornersLength, err := convertToDoubleArray(corners) + if err != nil { + return nil, err + } + if ccorners != nil { + defer freeDoubleArray(ccorners) + } + if err := C.vipsgen_sdf_with_options(&out, C.int(width), C.int(height), C.VipsSdfShape(shape), C.double(r), ca, caLength, cb, cbLength, ccorners, ccornersLength); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSequential vips_sequential check sequential access +func vipsgenSequential(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sequential(in, &out); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenSequentialWithOptions vips_sequential check sequential access with optional arguments +func vipsgenSequentialWithOptions(in *C.VipsImage, tileHeight int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sequential_with_options(in, &out, C.int(tileHeight)); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenSharpen vips_sharpen unsharp masking for print +func vipsgenSharpen(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sharpen(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSharpenWithOptions vips_sharpen unsharp masking for print with optional arguments +func vipsgenSharpenWithOptions(in *C.VipsImage, sigma float64, x1 float64, y2 float64, y3 float64, m1 float64, m2 float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sharpen_with_options(in, &out, C.double(sigma), C.double(x1), C.double(y2), C.double(y3), C.double(m1), C.double(m2)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrink vips_shrink shrink an image +func vipsgenShrink(in *C.VipsImage, hshrink float64, vshrink float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrink(in, &out, C.double(hshrink), C.double(vshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrinkWithOptions vips_shrink shrink an image with optional arguments +func vipsgenShrinkWithOptions(in *C.VipsImage, hshrink float64, vshrink float64, ceil bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrink_with_options(in, &out, C.double(hshrink), C.double(vshrink), C.int(boolToInt(ceil))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrinkh vips_shrinkh shrink an image horizontally +func vipsgenShrinkh(in *C.VipsImage, hshrink int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrinkh(in, &out, C.int(hshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrinkhWithOptions vips_shrinkh shrink an image horizontally with optional arguments +func vipsgenShrinkhWithOptions(in *C.VipsImage, hshrink int, ceil bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrinkh_with_options(in, &out, C.int(hshrink), C.int(boolToInt(ceil))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrinkv vips_shrinkv shrink an image vertically +func vipsgenShrinkv(in *C.VipsImage, vshrink int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrinkv(in, &out, C.int(vshrink)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenShrinkvWithOptions vips_shrinkv shrink an image vertically with optional arguments +func vipsgenShrinkvWithOptions(in *C.VipsImage, vshrink int, ceil bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_shrinkv_with_options(in, &out, C.int(vshrink), C.int(boolToInt(ceil))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSign vips_sign unit vector of pixel +func vipsgenSign(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sign(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSimilarity vips_similarity similarity transform of an image +func vipsgenSimilarity(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_similarity(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSimilarityWithOptions vips_similarity similarity transform of an image with optional arguments +func vipsgenSimilarityWithOptions(in *C.VipsImage, scale float64, angle float64, interpolate *Interpolate, background []float64, odx float64, ody float64, idx float64, idy float64) (*C.VipsImage, error) { + var out *C.VipsImage + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + if err := C.vipsgen_similarity_with_options(in, &out, C.double(scale), C.double(angle), vipsInterpolateToC(interpolate), cbackground, cbackgroundLength, C.double(odx), C.double(ody), C.double(idx), C.double(idy)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSines vips_sines make a 2D sine wave +func vipsgenSines(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sines(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSinesWithOptions vips_sines make a 2D sine wave with optional arguments +func vipsgenSinesWithOptions(width int, height int, uchar bool, hfreq float64, vfreq float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sines_with_options(&out, C.int(width), C.int(height), C.int(boolToInt(uchar)), C.double(hfreq), C.double(vfreq)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSmartcrop vips_smartcrop extract an area from an image +func vipsgenSmartcrop(input *C.VipsImage, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_smartcrop(input, &out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSmartcropWithOptions vips_smartcrop extract an area from an image with optional arguments +func vipsgenSmartcropWithOptions(input *C.VipsImage, width int, height int, interesting Interesting, premultiplied bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_smartcrop_with_options(input, &out, C.int(width), C.int(height), C.VipsInteresting(interesting), C.int(boolToInt(premultiplied))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSobel vips_sobel Sobel edge detector +func vipsgenSobel(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_sobel(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSpcor vips_spcor spatial correlation +func vipsgenSpcor(in *C.VipsImage, ref *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_spcor(in, ref, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSpectrum vips_spectrum make displayable power spectrum +func vipsgenSpectrum(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_spectrum(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenStats vips_stats find many image stats +func vipsgenStats(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_stats(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenStdif vips_stdif statistical difference +func vipsgenStdif(in *C.VipsImage, width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_stdif(in, &out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenStdifWithOptions vips_stdif statistical difference with optional arguments +func vipsgenStdifWithOptions(in *C.VipsImage, width int, height int, s0 float64, b float64, m0 float64, a float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_stdif_with_options(in, &out, C.int(width), C.int(height), C.double(s0), C.double(b), C.double(m0), C.double(a)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSubsample vips_subsample subsample an image +func vipsgenSubsample(input *C.VipsImage, xfac int, yfac int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_subsample(input, &out, C.int(xfac), C.int(yfac)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSubsampleWithOptions vips_subsample subsample an image with optional arguments +func vipsgenSubsampleWithOptions(input *C.VipsImage, xfac int, yfac int, point bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_subsample_with_options(input, &out, C.int(xfac), C.int(yfac), C.int(boolToInt(point))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSubtract vips_subtract subtract two images +func vipsgenSubtract(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_subtract(left, right, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSum vips_sum sum an array of images +func vipsgenSum(in []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + cin, _, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + if err := C.vipsgen_sum((**C.VipsImage)(cin), &out, C.int(len(in))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgload vips_svgload load SVG with rsvg +func vipsgenSvgload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_svgload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgloadWithOptions vips_svgload load SVG with rsvg with optional arguments +func vipsgenSvgloadWithOptions(filename string, dpi float64, scale float64, unlimited bool, stylesheet string, highBitdepth bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cstylesheet := C.CString(stylesheet) + defer freeCString(cstylesheet) + if err := C.vipsgen_svgload_with_options(cfilename, &out, C.double(dpi), C.double(scale), C.int(boolToInt(unlimited)), cstylesheet, C.int(boolToInt(highBitdepth)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgloadBuffer vips_svgload_buffer load SVG with rsvg +func vipsgenSvgloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_svgload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgloadBufferWithOptions vips_svgload_buffer load SVG with rsvg with optional arguments +func vipsgenSvgloadBufferWithOptions(buf []byte, dpi float64, scale float64, unlimited bool, stylesheet string, highBitdepth bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + cstylesheet := C.CString(stylesheet) + defer freeCString(cstylesheet) + if err := C.vipsgen_svgload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.double(dpi), C.double(scale), C.int(boolToInt(unlimited)), cstylesheet, C.int(boolToInt(highBitdepth)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgloadSource vips_svgload_source load svg from source +func vipsgenSvgloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_svgload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSvgloadSourceWithOptions vips_svgload_source load svg from source with optional arguments +func vipsgenSvgloadSourceWithOptions(source *C.VipsSourceCustom, dpi float64, scale float64, unlimited bool, stylesheet string, highBitdepth bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cstylesheet := C.CString(stylesheet) + defer freeCString(cstylesheet) + if err := C.vipsgen_svgload_source_with_options(source, &out, C.double(dpi), C.double(scale), C.int(boolToInt(unlimited)), cstylesheet, C.int(boolToInt(highBitdepth)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSwitch vips_switch find the index of the first non-zero pixel in tests +func vipsgenSwitch(tests []*C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + ctests, _, err := convertToImageArray(tests) + if err != nil { + return nil, err + } + if ctests != nil { + defer freeImageArray(ctests) + } + if err := C.vipsgen_switch((**C.VipsImage)(ctests), &out, C.int(len(tests))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSystem vips_system run an external command +func vipsgenSystem(cmdFormat string) (*C.VipsImage, error) { + var out *C.VipsImage + ccmdFormat := C.CString(cmdFormat) + defer freeCString(ccmdFormat) + if err := C.vipsgen_system(ccmdFormat); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenSystemWithOptions vips_system run an external command with optional arguments +func vipsgenSystemWithOptions(cmdFormat string, in []*C.VipsImage, outFormat string, inFormat string) (*C.VipsImage, error) { + var out *C.VipsImage + ccmdFormat := C.CString(cmdFormat) + defer freeCString(ccmdFormat) + cin, cinLength, err := convertToImageArray(in) + if err != nil { + return nil, err + } + if cin != nil { + defer freeImageArray(cin) + } + coutFormat := C.CString(outFormat) + defer freeCString(coutFormat) + cinFormat := C.CString(inFormat) + defer freeCString(cinFormat) + if err := C.vipsgen_system_with_options(ccmdFormat, cin, cinLength, coutFormat, cinFormat); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenText vips_text make a text image +func vipsgenText(text string) (*C.VipsImage, error) { + var out *C.VipsImage + ctext := C.CString(text) + defer freeCString(ctext) + if err := C.vipsgen_text(&out, ctext); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTextWithOptions vips_text make a text image with optional arguments +func vipsgenTextWithOptions(text string, font string, width int, height int, align Align, justify bool, dpi int, spacing int, fontfile string, rgba bool, wrap TextWrap) (*C.VipsImage, error) { + var out *C.VipsImage + ctext := C.CString(text) + defer freeCString(ctext) + cfont := C.CString(font) + defer freeCString(cfont) + cfontfile := C.CString(fontfile) + defer freeCString(cfontfile) + if err := C.vipsgen_text_with_options(&out, ctext, cfont, C.int(width), C.int(height), C.VipsAlign(align), C.int(boolToInt(justify)), C.int(dpi), C.int(spacing), cfontfile, C.int(boolToInt(rgba)), C.VipsTextWrap(wrap)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnail vips_thumbnail generate thumbnail from file +func vipsgenThumbnail(filename string, width int) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_thumbnail(cfilename, &out, C.int(width)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailWithOptions vips_thumbnail generate thumbnail from file with optional arguments +func vipsgenThumbnailWithOptions(filename string, width int, height int, size Size, noRotate bool, crop Interesting, linear bool, inputProfile string, outputProfile string, intent Intent, failOn FailOn) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_thumbnail_with_options(cfilename, &out, C.int(width), C.int(height), C.VipsSize(size), C.int(boolToInt(noRotate)), C.VipsInteresting(crop), C.int(boolToInt(linear)), cinputProfile, coutputProfile, C.VipsIntent(intent), C.VipsFailOn(failOn)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailBuffer vips_thumbnail_buffer generate thumbnail from buffer +func vipsgenThumbnailBuffer(buf []byte, width int) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_thumbnail_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(width)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailBufferWithOptions vips_thumbnail_buffer generate thumbnail from buffer with optional arguments +func vipsgenThumbnailBufferWithOptions(buf []byte, width int, optionString string, height int, size Size, noRotate bool, crop Interesting, linear bool, inputProfile string, outputProfile string, intent Intent, failOn FailOn) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + coptionString := C.CString(optionString) + defer freeCString(coptionString) + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_thumbnail_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(width), coptionString, C.int(height), C.VipsSize(size), C.int(boolToInt(noRotate)), C.VipsInteresting(crop), C.int(boolToInt(linear)), cinputProfile, coutputProfile, C.VipsIntent(intent), C.VipsFailOn(failOn)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailImage vips_thumbnail_image generate thumbnail from image +func vipsgenThumbnailImage(in *C.VipsImage, width int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_thumbnail_image(in, &out, C.int(width)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailImageWithOptions vips_thumbnail_image generate thumbnail from image with optional arguments +func vipsgenThumbnailImageWithOptions(in *C.VipsImage, width int, height int, size Size, noRotate bool, crop Interesting, linear bool, inputProfile string, outputProfile string, intent Intent, failOn FailOn) (*C.VipsImage, error) { + var out *C.VipsImage + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_thumbnail_image_with_options(in, &out, C.int(width), C.int(height), C.VipsSize(size), C.int(boolToInt(noRotate)), C.VipsInteresting(crop), C.int(boolToInt(linear)), cinputProfile, coutputProfile, C.VipsIntent(intent), C.VipsFailOn(failOn)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailSource vips_thumbnail_source generate thumbnail from source +func vipsgenThumbnailSource(source *C.VipsSourceCustom, width int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_thumbnail_source(source, &out, C.int(width)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenThumbnailSourceWithOptions vips_thumbnail_source generate thumbnail from source with optional arguments +func vipsgenThumbnailSourceWithOptions(source *C.VipsSourceCustom, width int, optionString string, height int, size Size, noRotate bool, crop Interesting, linear bool, inputProfile string, outputProfile string, intent Intent, failOn FailOn) (*C.VipsImage, error) { + var out *C.VipsImage + coptionString := C.CString(optionString) + defer freeCString(coptionString) + cinputProfile := C.CString(inputProfile) + defer freeCString(cinputProfile) + coutputProfile := C.CString(outputProfile) + defer freeCString(coutputProfile) + if err := C.vipsgen_thumbnail_source_with_options(source, &out, C.int(width), coptionString, C.int(height), C.VipsSize(size), C.int(boolToInt(noRotate)), C.VipsInteresting(crop), C.int(boolToInt(linear)), cinputProfile, coutputProfile, C.VipsIntent(intent), C.VipsFailOn(failOn)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffload vips_tiffload load tiff from file +func vipsgenTiffload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_tiffload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffloadWithOptions vips_tiffload load tiff from file with optional arguments +func vipsgenTiffloadWithOptions(filename string, page int, n int, autorotate bool, subifd int, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_tiffload_with_options(cfilename, &out, C.int(page), C.int(n), C.int(boolToInt(autorotate)), C.int(subifd), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffloadBuffer vips_tiffload_buffer load tiff from buffer +func vipsgenTiffloadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_tiffload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffloadBufferWithOptions vips_tiffload_buffer load tiff from buffer with optional arguments +func vipsgenTiffloadBufferWithOptions(buf []byte, page int, n int, autorotate bool, subifd int, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_tiffload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(n), C.int(boolToInt(autorotate)), C.int(subifd), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffloadSource vips_tiffload_source load tiff from source +func vipsgenTiffloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tiffload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffloadSourceWithOptions vips_tiffload_source load tiff from source with optional arguments +func vipsgenTiffloadSourceWithOptions(source *C.VipsSourceCustom, page int, n int, autorotate bool, subifd int, unlimited bool, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tiffload_source_with_options(source, &out, C.int(page), C.int(n), C.int(boolToInt(autorotate)), C.int(subifd), C.int(boolToInt(unlimited)), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTiffsave vips_tiffsave save image to tiff file +func vipsgenTiffsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_tiffsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenTiffsaveWithOptions vips_tiffsave save image to tiff file with optional arguments +func vipsgenTiffsaveWithOptions(in *C.VipsImage, filename string, compression TiffCompression, q int, predictor TiffPredictor, tile bool, tileWidth int, tileHeight int, pyramid bool, miniswhite bool, bitdepth int, resunit TiffResunit, xres float64, yres float64, bigtiff bool, properties bool, regionShrink RegionShrink, level int, lossless bool, depth DzDepth, subifd bool, premultiply bool, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_tiffsave_with_options(in, cfilename, C.VipsForeignTiffCompression(compression), C.int(q), C.VipsForeignTiffPredictor(predictor), C.int(boolToInt(tile)), C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(pyramid)), C.int(boolToInt(miniswhite)), C.int(bitdepth), C.VipsForeignTiffResunit(resunit), C.double(xres), C.double(yres), C.int(boolToInt(bigtiff)), C.int(boolToInt(properties)), C.VipsRegionShrink(regionShrink), C.int(level), C.int(boolToInt(lossless)), C.VipsForeignDzDepth(depth), C.int(boolToInt(subifd)), C.int(boolToInt(premultiply)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenTiffsaveBuffer vips_tiffsave_buffer save image to tiff buffer +func vipsgenTiffsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_tiffsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenTiffsaveBufferWithOptions vips_tiffsave_buffer save image to tiff buffer with optional arguments +func vipsgenTiffsaveBufferWithOptions(in *C.VipsImage, compression TiffCompression, q int, predictor TiffPredictor, tile bool, tileWidth int, tileHeight int, pyramid bool, miniswhite bool, bitdepth int, resunit TiffResunit, xres float64, yres float64, bigtiff bool, properties bool, regionShrink RegionShrink, level int, lossless bool, depth DzDepth, subifd bool, premultiply bool, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_tiffsave_buffer_with_options(in, &buf, &length, C.VipsForeignTiffCompression(compression), C.int(q), C.VipsForeignTiffPredictor(predictor), C.int(boolToInt(tile)), C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(pyramid)), C.int(boolToInt(miniswhite)), C.int(bitdepth), C.VipsForeignTiffResunit(resunit), C.double(xres), C.double(yres), C.int(boolToInt(bigtiff)), C.int(boolToInt(properties)), C.VipsRegionShrink(regionShrink), C.int(level), C.int(boolToInt(lossless)), C.VipsForeignDzDepth(depth), C.int(boolToInt(subifd)), C.int(boolToInt(premultiply)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenTiffsaveTarget vips_tiffsave_target save image to tiff target +func vipsgenTiffsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_tiffsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenTiffsaveTargetWithOptions vips_tiffsave_target save image to tiff target with optional arguments +func vipsgenTiffsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, compression TiffCompression, q int, predictor TiffPredictor, tile bool, tileWidth int, tileHeight int, pyramid bool, miniswhite bool, bitdepth int, resunit TiffResunit, xres float64, yres float64, bigtiff bool, properties bool, regionShrink RegionShrink, level int, lossless bool, depth DzDepth, subifd bool, premultiply bool, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_tiffsave_target_with_options(in, target, C.VipsForeignTiffCompression(compression), C.int(q), C.VipsForeignTiffPredictor(predictor), C.int(boolToInt(tile)), C.int(tileWidth), C.int(tileHeight), C.int(boolToInt(pyramid)), C.int(boolToInt(miniswhite)), C.int(bitdepth), C.VipsForeignTiffResunit(resunit), C.double(xres), C.double(yres), C.int(boolToInt(bigtiff)), C.int(boolToInt(properties)), C.VipsRegionShrink(regionShrink), C.int(level), C.int(boolToInt(lossless)), C.VipsForeignDzDepth(depth), C.int(boolToInt(subifd)), C.int(boolToInt(premultiply)), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenTilecache vips_tilecache cache an image as a set of tiles +func vipsgenTilecache(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tilecache(in, &out); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenTilecacheWithOptions vips_tilecache cache an image as a set of tiles with optional arguments +func vipsgenTilecacheWithOptions(in *C.VipsImage, tileWidth int, tileHeight int, maxTiles int, access Access, threaded bool, persistent bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tilecache_with_options(in, &out, C.int(tileWidth), C.int(tileHeight), C.int(maxTiles), C.VipsAccess(access), C.int(boolToInt(threaded)), C.int(boolToInt(persistent))); err != 0 { + return nil, handleVipsError() + } + return out, nil +} + +// vipsgenTonelut vips_tonelut build a look-up table +func vipsgenTonelut() (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tonelut(&out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTonelutWithOptions vips_tonelut build a look-up table with optional arguments +func vipsgenTonelutWithOptions(inMax int, outMax int, lb float64, lw float64, ps float64, pm float64, ph float64, s float64, m float64, h float64) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_tonelut_with_options(&out, C.int(inMax), C.int(outMax), C.double(lb), C.double(lw), C.double(ps), C.double(pm), C.double(ph), C.double(s), C.double(m), C.double(h)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTranspose3d vips_transpose3d transpose3d an image +func vipsgenTranspose3d(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_transpose3d(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenTranspose3dWithOptions vips_transpose3d transpose3d an image with optional arguments +func vipsgenTranspose3dWithOptions(in *C.VipsImage, pageHeight int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_transpose3d_with_options(in, &out, C.int(pageHeight)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenUnpremultiply vips_unpremultiply unpremultiply image alpha +func vipsgenUnpremultiply(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_unpremultiply(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenUnpremultiplyWithOptions vips_unpremultiply unpremultiply image alpha with optional arguments +func vipsgenUnpremultiplyWithOptions(in *C.VipsImage, maxAlpha float64, alphaBand int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_unpremultiply_with_options(in, &out, C.double(maxAlpha), C.int(alphaBand)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenVipsload vips_vipsload load vips from file +func vipsgenVipsload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_vipsload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenVipsloadWithOptions vips_vipsload load vips from file with optional arguments +func vipsgenVipsloadWithOptions(filename string, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_vipsload_with_options(cfilename, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenVipsloadSource vips_vipsload_source load vips from source +func vipsgenVipsloadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_vipsload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenVipsloadSourceWithOptions vips_vipsload_source load vips from source with optional arguments +func vipsgenVipsloadSourceWithOptions(source *C.VipsSourceCustom, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_vipsload_source_with_options(source, &out, C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenVipssave vips_vipssave save image to file in vips format +func vipsgenVipssave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_vipssave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenVipssaveWithOptions vips_vipssave save image to file in vips format with optional arguments +func vipsgenVipssaveWithOptions(in *C.VipsImage, filename string, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_vipssave_with_options(in, cfilename, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenVipssaveTarget vips_vipssave_target save image to target in vips format +func vipsgenVipssaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_vipssave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenVipssaveTargetWithOptions vips_vipssave_target save image to target in vips format with optional arguments +func vipsgenVipssaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_vipssave_target_with_options(in, target, C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenWebpload vips_webpload load webp from file +func vipsgenWebpload(filename string) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_webpload(cfilename, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebploadWithOptions vips_webpload load webp from file with optional arguments +func vipsgenWebploadWithOptions(filename string, page int, n int, scale float64, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_webpload_with_options(cfilename, &out, C.int(page), C.int(n), C.double(scale), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebploadBuffer vips_webpload_buffer load webp from buffer +func vipsgenWebploadBuffer(buf []byte) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_webpload_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebploadBufferWithOptions vips_webpload_buffer load webp from buffer with optional arguments +func vipsgenWebploadBufferWithOptions(buf []byte, page int, n int, scale float64, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + var out *C.VipsImage + if err := C.vipsgen_webpload_buffer_with_options(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(page), C.int(n), C.double(scale), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebploadSource vips_webpload_source load webp from source +func vipsgenWebploadSource(source *C.VipsSourceCustom) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_webpload_source(source, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebploadSourceWithOptions vips_webpload_source load webp from source with optional arguments +func vipsgenWebploadSourceWithOptions(source *C.VipsSourceCustom, page int, n int, scale float64, memory bool, access Access, failOn FailOn, revalidate bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_webpload_source_with_options(source, &out, C.int(page), C.int(n), C.double(scale), C.int(boolToInt(memory)), C.VipsAccess(access), C.VipsFailOn(failOn), C.int(boolToInt(revalidate))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWebpsave vips_webpsave save as WebP +func vipsgenWebpsave(in *C.VipsImage, filename string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + if err := C.vipsgen_webpsave(in, cfilename); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenWebpsaveWithOptions vips_webpsave save as WebP with optional arguments +func vipsgenWebpsaveWithOptions(in *C.VipsImage, filename string, q int, lossless bool, preset WebpPreset, smartSubsample bool, nearLossless bool, alphaQ int, minSize bool, kmin int, kmax int, effort int, targetSize int, mixed bool, smartDeblock bool, passes int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cfilename := C.CString(filename) + defer freeCString(cfilename) + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_webpsave_with_options(in, cfilename, C.int(q), C.int(boolToInt(lossless)), C.VipsForeignWebpPreset(preset), C.int(boolToInt(smartSubsample)), C.int(boolToInt(nearLossless)), C.int(alphaQ), C.int(boolToInt(minSize)), C.int(kmin), C.int(kmax), C.int(effort), C.int(targetSize), C.int(boolToInt(mixed)), C.int(boolToInt(smartDeblock)), C.int(passes), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenWebpsaveBuffer vips_webpsave_buffer save as WebP +func vipsgenWebpsaveBuffer(in *C.VipsImage) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + if err := C.vipsgen_webpsave_buffer(in, &buf, &length); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenWebpsaveBufferWithOptions vips_webpsave_buffer save as WebP with optional arguments +func vipsgenWebpsaveBufferWithOptions(in *C.VipsImage, q int, lossless bool, preset WebpPreset, smartSubsample bool, nearLossless bool, alphaQ int, minSize bool, kmin int, kmax int, effort int, targetSize int, mixed bool, smartDeblock bool, passes int, keep Keep, background []float64, pageHeight int, profile string) ([]byte, error) { + var buf unsafe.Pointer + var length C.size_t + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return nil, err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_webpsave_buffer_with_options(in, &buf, &length, C.int(q), C.int(boolToInt(lossless)), C.VipsForeignWebpPreset(preset), C.int(boolToInt(smartSubsample)), C.int(boolToInt(nearLossless)), C.int(alphaQ), C.int(boolToInt(minSize)), C.int(kmin), C.int(kmax), C.int(effort), C.int(targetSize), C.int(boolToInt(mixed)), C.int(boolToInt(smartDeblock)), C.int(passes), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return nil, handleVipsError() + } + return bufferToBytes(buf, length), nil +} + +// vipsgenWebpsaveTarget vips_webpsave_target save as WebP +func vipsgenWebpsaveTarget(in *C.VipsImage, target *C.VipsTargetCustom) (error) { + + if err := C.vipsgen_webpsave_target(in, target); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenWebpsaveTargetWithOptions vips_webpsave_target save as WebP with optional arguments +func vipsgenWebpsaveTargetWithOptions(in *C.VipsImage, target *C.VipsTargetCustom, q int, lossless bool, preset WebpPreset, smartSubsample bool, nearLossless bool, alphaQ int, minSize bool, kmin int, kmax int, effort int, targetSize int, mixed bool, smartDeblock bool, passes int, keep Keep, background []float64, pageHeight int, profile string) (error) { + cbackground, cbackgroundLength, err := convertToDoubleArray(background) + if err != nil { + return err + } + if cbackground != nil { + defer freeDoubleArray(cbackground) + } + cprofile := C.CString(profile) + defer freeCString(cprofile) + if err := C.vipsgen_webpsave_target_with_options(in, target, C.int(q), C.int(boolToInt(lossless)), C.VipsForeignWebpPreset(preset), C.int(boolToInt(smartSubsample)), C.int(boolToInt(nearLossless)), C.int(alphaQ), C.int(boolToInt(minSize)), C.int(kmin), C.int(kmax), C.int(effort), C.int(targetSize), C.int(boolToInt(mixed)), C.int(boolToInt(smartDeblock)), C.int(passes), C.VipsForeignKeep(keep), cbackground, cbackgroundLength, C.int(pageHeight), cprofile); err != 0 { + return handleVipsError() + } + return nil +} + +// vipsgenWorley vips_worley make a worley noise image +func vipsgenWorley(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_worley(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWorleyWithOptions vips_worley make a worley noise image with optional arguments +func vipsgenWorleyWithOptions(width int, height int, cellSize int, seed int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_worley_with_options(&out, C.int(width), C.int(height), C.int(cellSize), C.int(seed)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWrap vips_wrap wrap image origin +func vipsgenWrap(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_wrap(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenWrapWithOptions vips_wrap wrap image origin with optional arguments +func vipsgenWrapWithOptions(in *C.VipsImage, x int, y int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_wrap_with_options(in, &out, C.int(x), C.int(y)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXyz vips_xyz make an image where pixel values are coordinates +func vipsgenXyz(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_xyz(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenXyzWithOptions vips_xyz make an image where pixel values are coordinates with optional arguments +func vipsgenXyzWithOptions(width int, height int, csize int, dsize int, esize int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_xyz_with_options(&out, C.int(width), C.int(height), C.int(csize), C.int(dsize), C.int(esize)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenZone vips_zone make a zone plate +func vipsgenZone(width int, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_zone(&out, C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenZoneWithOptions vips_zone make a zone plate with optional arguments +func vipsgenZoneWithOptions(width int, height int, uchar bool) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_zone_with_options(&out, C.int(width), C.int(height), C.int(boolToInt(uchar))); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenZoom vips_zoom zoom an image +func vipsgenZoom(input *C.VipsImage, xfac int, yfac int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_zoom(input, &out, C.int(xfac), C.int(yfac)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + + +// clearImage frees the VipsImage +func clearImage(img *C.VipsImage) { + C.vipsgen_clear_image(&img) +} + +// vipsgenImageFromSource vips_image_new_from_source +func vipsgenImageFromSource(src *C.VipsSourceCustom, params *LoadOptions) (*C.VipsImage, error) { + var out *C.VipsImage + var code C.int + var optionString string + + if params != nil { + optionString = params.OptionString() + } + if optionString == "" { + code = C.vipsgen_image_new_from_source(src, &out) + } else { + cOptionString := C.CString(optionString) + defer freeCString(cOptionString) + + code = C.vipsgen_image_new_from_source_with_option(src, &out, cOptionString) + } + if code != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenImageFromBuffer vips_image_new_from_buffer +func vipsgenImageFromBuffer(buf []byte, params *LoadOptions) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + + var out *C.VipsImage + var code C.int + var optionString string + if params != nil { + optionString = params.OptionString() + } + if optionString == "" { + code = C.vipsgen_image_new_from_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out) + } else { + cOptionString := C.CString(optionString) + defer freeCString(cOptionString) + + code = C.vipsgen_image_new_from_buffer_with_option(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, cOptionString) + } + if code != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenImageFromFile vips_image_new_from_file +func vipsgenImageFromFile(path string, params *LoadOptions) (*C.VipsImage, error) { + // Append options to the filename if needed + filenameOption := path + if params != nil && params.OptionString() != "" { + filenameOption += "[" + params.OptionString() + "]" + } + + cPath := C.CString(filenameOption) + defer freeCString(cPath) + + var out *C.VipsImage + code := C.vipsgen_image_new_from_file(cPath, &out) + + if code != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +// vipsgenImageFromMemory vips_image_new_memory +func vipsgenImageFromMemory(buf []byte, width, height, bands int) (*C.VipsImage, error) { + src := buf + // Reference src here so it's not garbage collected during image initialization. + defer runtime.KeepAlive(src) + + var out *C.VipsImage + var code C.int + code = C.vipsgen_image_new_from_memory(unsafe.Pointer(&src[0]), C.size_t(len(src)), C.int(width), C.int(height), C.int(bands), &out) + if code != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +func vipsHasAlpha(in *C.VipsImage) bool { + return int(C.vips_image_hasalpha(in)) > 0 +} + +func vipsIsColorSpaceSupported(in *C.VipsImage) bool { + return int(C.vips_colourspace_issupported(in)) != 0 +} + +func vipsImageGetFields(in *C.VipsImage) (fields []string) { + const maxFields = 1024 + rawFields := C.vips_image_get_fields(in) + defer C.g_strfreev(rawFields) + cFields := (*[maxFields]*C.char)(unsafe.Pointer(rawFields))[:maxFields:maxFields] + for _, field := range cFields { + if field == nil { + break + } + fields = append(fields, C.GoString(field)) + } + return +} + +func vipsImageHasField(in *C.VipsImage, name string) bool { + cName := C.CString(name) + defer freeCString(cName) + return int(C.vips_image_get_typeof(in, cName)) != 0 +} + +func vipsImageRemoveField(in *C.VipsImage, name string) { + cName := C.CString(name) + defer freeCString(cName) + C.vips_image_remove(in, cName) +} + +func vipsImageGetArrayInt(in *C.VipsImage, name string) ([]int, error) { + var out *C.int + var n C.int + cName := C.CString(name) + defer freeCString(cName) + if err := C.vips_image_get_array_int(in, cName, &out, &n); err != 0 { + return nil, handleVipsError() + } + result := fromCArrayInt(out, int(n)) + gFreePointer(unsafe.Pointer(out)) + return result, nil +} + +func vipsImageGetArrayDouble(in *C.VipsImage, name string) ([]float64, error) { + var out *C.double + var n C.int + cName := C.CString(name) + defer freeCString(cName) + if err := C.vips_image_get_array_double(in, cName, &out, &n); err != 0 { + return nil, handleVipsError() + } + result := fromCArrayDouble(out, int(n)) + gFreePointer(unsafe.Pointer(out)) + return result, nil +} + +func vipsImageSetBlob(in *C.VipsImage, name string, data []byte) { + cData := unsafe.Pointer(&data[0]) + cDataLength := C.size_t(len(data)) + cField := C.CString(name) + defer freeCString(cField) + C.vips_image_set_blob_copy(in, cField, cData, cDataLength) +} + +func vipsImageGetBlob(in *C.VipsImage, name string) ([]byte, error) { + var bufPtr unsafe.Pointer + var dataLength C.size_t + cField := C.CString(name) + defer freeCString(cField) + if int(C.vips_image_get_blob(in, cField, &bufPtr, &dataLength)) != 0 { + return nil, handleVipsError() + } + return bufferToBytes(bufPtr, dataLength), nil +} + +func vipsHasICCProfile(in *C.VipsImage) bool { + return int(C.vips_image_get_typeof(in, cachedCString(C.VIPS_META_ICC_NAME))) != 0 +} + +func vipsGetICCProfile(in *C.VipsImage) ([]byte, bool) { + if !vipsHasICCProfile(in) { + return nil, false + } + var bufPtr unsafe.Pointer + var dataLength C.size_t + if int(C.vips_image_get_blob(in, cachedCString(C.VIPS_META_ICC_NAME), &bufPtr, &dataLength)) != 0 { + return nil, false + } + buf := C.GoBytes(bufPtr, C.int(dataLength)) + return buf, buf != nil +} + +func vipsRemoveICCProfile(in *C.VipsImage) bool { + if vipsHasICCProfile(in) { + C.vips_image_remove(in, cachedCString(C.VIPS_META_ICC_NAME)) + return true + } + return false +} + +func vipsHasIPTC(in *C.VipsImage) bool { + return int(C.vips_image_get_typeof(in, cachedCString(C.VIPS_META_IPTC_NAME))) != 0 +} + +func vipsGetMetaOrientation(in *C.VipsImage) int { + orientationFieldName := cachedCString(C.VIPS_META_ORIENTATION) + if int(C.vips_image_get_typeof(in, orientationFieldName)) == 0 { + return 0 + } + var orientation C.int + if C.vips_image_get_int(in, orientationFieldName, &orientation) == 0 { + return int(orientation) + } + return 0 +} + +func vipsSetMetaOrientation(in *C.VipsImage, orientation int) { + C.vips_image_set_int(in, cachedCString(C.VIPS_META_ORIENTATION), C.int(orientation)) +} + +func vipsRemoveMetaOrientation(in *C.VipsImage) { + C.vips_image_remove(in, cachedCString(C.VIPS_META_ORIENTATION)) +} + +func vipsGetImageNPages(in *C.VipsImage) int { + return int(C.vips_image_get_n_pages(in)) +} + +func vipsSetImageNPages(in *C.VipsImage, pages int) { + C.vips_image_set_int(in, cachedCString(C.VIPS_META_N_PAGES), C.int(pages)) +} + +func vipsGetPageHeight(in *C.VipsImage) int { + return int(C.vips_image_get_page_height(in)) +} + +func vipsSetPageHeight(in *C.VipsImage, height int) { + C.vips_image_set_int(in, cachedCString(C.VIPS_META_PAGE_HEIGHT), C.int(height)) +} + +func vipsImageSetString(in *C.VipsImage, name string, str string) { + cField := C.CString(name) + defer freeCString(cField) + cStr := C.CString(str) + defer freeCString(cStr) + C.vips_image_set_string(in, cField, cStr) +} + +func vipsImageGetString(in *C.VipsImage, name string) (string, error) { + cField := C.CString(name) + defer freeCString(cField) + var cFieldValue *C.char + defer freeCString(cFieldValue) + if int(C.vips_image_get_string(in, cField, &cFieldValue)) == 0 { + return C.GoString(cFieldValue), nil + } + return "", handleVipsError() +} + +func vipsImageGetAsString(in *C.VipsImage, name string) (string, error) { + cField := C.CString(name) + defer freeCString(cField) + var cFieldValue *C.char + defer freeCString(cFieldValue) + if int(C.vips_image_get_as_string(in, cField, &cFieldValue)) == 0 { + return C.GoString(cFieldValue), nil + } + return "", handleVipsError() +} + +func vipsImageSetDouble(in *C.VipsImage, name string, f float64) { + cField := C.CString(name) + defer freeCString(cField) + cDouble := C.double(f) + C.vips_image_set_double(in, cField, cDouble) +} + +func vipsImageGetDouble(in *C.VipsImage, name string) (float64, error) { + cField := C.CString(name) + defer freeCString(cField) + var cDouble C.double + if int(C.vips_image_get_double(in, cField, &cDouble)) == 0 { + return float64(cDouble), nil + } + return 0, handleVipsError() +} + +func vipsImageSetInt(in *C.VipsImage, name string, i int) { + cField := C.CString(name) + defer freeCString(cField) + cInt := C.int(i) + C.vips_image_set_int(in, cField, cInt) +} + +func vipsImageGetInt(in *C.VipsImage, name string) (int, error) { + cField := C.CString(name) + defer freeCString(cField) + var cInt C.int + if int(C.vips_image_get_int(in, cField, &cInt)) == 0 { + return int(cInt), nil + } + return 0, handleVipsError() +} + +func vipsImageGetMetaLoader(in *C.VipsImage) (string, bool) { + loaderFieldName := cachedCString(C.VIPS_META_LOADER) + if int(C.vips_image_get_typeof(in, loaderFieldName)) == 0 { + return "", false + } + var cFieldValue *C.char + if int(C.vips_image_get_string(in, loaderFieldName, &cFieldValue)) == 0 { + return C.GoString(cFieldValue), true + } + return "", false +} + +func vipsgenEmbedMultiPage(in *C.VipsImage, left, top, width, height int, extend Extend) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_embed_multi_page(in, &out, C.int(left), C.int(top), C.int(width), C.int(height), C.int(extend)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +func vipsgenEmbedMultiPageBackground(in *C.VipsImage, left, top, width, height, + backgroundColorR, backgroundColorG, backgroundColorB, backgroundColorA int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_embed_multi_page_background(in, &out, C.int(left), C.int(top), C.int(width), + C.int(height), C.double(backgroundColorR), + C.double(backgroundColorG), C.double(backgroundColorB), C.double(backgroundColorA)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +func vipsgenExtractAreaMultiPage(in *C.VipsImage, left, top, width, height int) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_extract_area_multi_page(in, &out, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +func vipsgenRotMultiPage(in *C.VipsImage, angle Angle) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_rot_multi_page(in, &out, C.VipsAngle(angle)); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} + +func vipsgenLabel( + in *C.VipsImage, + text, font string, + x, y, size int, align Align, + colorR, colorG, colorB int, opacity float64, +) (*C.VipsImage, error) { + var out *C.VipsImage + cText := C.CString(text) + defer freeCString(cText) + cFont := C.CString(font) + defer freeCString(cFont) + + err := C.vipsgen_label(in, &out, cText, cFont, + C.int(x), C.int(y), C.int(size), C.VipsAlign(align), + C.double(colorR), C.double(colorG), C.double(colorB), C.float(float32(opacity))) + if int(err) != 0 { + return nil, handleImageError(out) + } + + return out, nil +} + +func vipsgenRemoveExif(in *C.VipsImage) (*C.VipsImage, error) { + var out *C.VipsImage + if err := C.vipsgen_remove_exif(in, &out); err != 0 { + return nil, handleImageError(out) + } + return out, nil +} diff --git a/vendor/github.com/cshum/vipsgen/vips/vips.h b/vendor/github.com/cshum/vipsgen/vips/vips.h new file mode 100644 index 0000000000..0be1bef27f --- /dev/null +++ b/vendor/github.com/cshum/vipsgen/vips/vips.h @@ -0,0 +1,884 @@ +// Code generated by github.com/cshum/vipsgen from libvips 8.17.0; DO NOT EDIT. + +#include +#include +#include + +// Prerequisites to build, get outputs and cleanup a vips operation + +int vipsgen_operation_execute(VipsOperation *operation, ...); +int vipsgen_operation_save_buffer(VipsOperation *operation, void** buf, size_t* len); +int vipsgen_set_source(VipsOperation *operation, const char *name, VipsSource *value); +int vipsgen_set_target(VipsOperation *operation, const char *name, VipsTarget *value); +int vipsgen_set_int(VipsOperation *operation, const char *name, int value); +int vipsgen_set_bool(VipsOperation *operation, const char *name, gboolean value); +int vipsgen_set_double(VipsOperation *operation, const char *name, double value); +int vipsgen_set_guint64(VipsOperation *operation, const char *name, guint64 value); +int vipsgen_set_string(VipsOperation *operation, const char *name, const char *value); +int vipsgen_set_image(VipsOperation *operation, const char *name, VipsImage *value); +int vipsgen_set_array_double(VipsOperation *operation, const char *name, VipsArrayDouble *value); +int vipsgen_set_array_int(VipsOperation *operation, const char *name, VipsArrayInt *value); +int vipsgen_set_array_image(VipsOperation *operation, const char *name, VipsArrayImage *value); +int vipsgen_set_interpolate(VipsOperation *operation, const char *name, VipsInterpolate *value); + +// Generated operations + +int vipsgen_CMC2LCh(VipsImage* in, VipsImage** out); + +int vipsgen_CMYK2XYZ(VipsImage* in, VipsImage** out); + +int vipsgen_HSV2sRGB(VipsImage* in, VipsImage** out); + +int vipsgen_LCh2CMC(VipsImage* in, VipsImage** out); + +int vipsgen_LCh2Lab(VipsImage* in, VipsImage** out); + +int vipsgen_Lab2LCh(VipsImage* in, VipsImage** out); + +int vipsgen_Lab2LabQ(VipsImage* in, VipsImage** out); + +int vipsgen_Lab2LabS(VipsImage* in, VipsImage** out); + +int vipsgen_Lab2XYZ(VipsImage* in, VipsImage** out); +int vipsgen_Lab2XYZ_with_options(VipsImage* in, VipsImage** out, double* temp, int temp_n); + +int vipsgen_LabQ2Lab(VipsImage* in, VipsImage** out); + +int vipsgen_LabQ2LabS(VipsImage* in, VipsImage** out); + +int vipsgen_LabQ2sRGB(VipsImage* in, VipsImage** out); + +int vipsgen_LabS2Lab(VipsImage* in, VipsImage** out); + +int vipsgen_LabS2LabQ(VipsImage* in, VipsImage** out); + +int vipsgen_XYZ2CMYK(VipsImage* in, VipsImage** out); + +int vipsgen_XYZ2Lab(VipsImage* in, VipsImage** out); +int vipsgen_XYZ2Lab_with_options(VipsImage* in, VipsImage** out, double* temp, int temp_n); + +int vipsgen_XYZ2Yxy(VipsImage* in, VipsImage** out); + +int vipsgen_XYZ2scRGB(VipsImage* in, VipsImage** out); + +int vipsgen_Yxy2XYZ(VipsImage* in, VipsImage** out); + +int vipsgen_abs(VipsImage* in, VipsImage** out); + +int vipsgen_add(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_addalpha(VipsImage* in, VipsImage** out); + +int vipsgen_affine(VipsImage* in, VipsImage** out, double a, double b, double c, double d); +int vipsgen_affine_with_options(VipsImage* in, VipsImage** out, double a, double b, double c, double d, VipsInterpolate* interpolate, int* oarea, int oarea_n, double odx, double ody, double idx, double idy, double* background, int background_n, gboolean premultiplied, VipsExtend extend); + +int vipsgen_analyzeload(const char* filename, VipsImage** out); +int vipsgen_analyzeload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_arrayjoin(VipsImage** in, VipsImage** out, int n); +int vipsgen_arrayjoin_with_options(VipsImage** in, VipsImage** out, int n, int across, int shim, double* background, int background_n, VipsAlign halign, VipsAlign valign, int hspacing, int vspacing); + +int vipsgen_autorot(VipsImage* in, VipsImage** out); + +int vipsgen_avg(VipsImage* in, double* out); + +int vipsgen_bandbool(VipsImage* in, VipsImage** out, VipsOperationBoolean boolean); + +int vipsgen_bandfold(VipsImage* in, VipsImage** out); +int vipsgen_bandfold_with_options(VipsImage* in, VipsImage** out, int factor); + +int vipsgen_bandjoin(VipsImage** in, VipsImage** out, int n); + +int vipsgen_bandjoin_const(VipsImage* in, VipsImage** out, double* c, int n); + +int vipsgen_bandmean(VipsImage* in, VipsImage** out); + +int vipsgen_bandrank(VipsImage** in, VipsImage** out, int n); +int vipsgen_bandrank_with_options(VipsImage** in, VipsImage** out, int n, int index); + +int vipsgen_bandunfold(VipsImage* in, VipsImage** out); +int vipsgen_bandunfold_with_options(VipsImage* in, VipsImage** out, int factor); + +int vipsgen_black(VipsImage** out, int width, int height); +int vipsgen_black_with_options(VipsImage** out, int width, int height, int bands); + +int vipsgen_boolean(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationBoolean boolean); + +int vipsgen_boolean_const(VipsImage* in, VipsImage** out, VipsOperationBoolean boolean, double* c, int n); + +int vipsgen_buildlut(VipsImage* in, VipsImage** out); + +int vipsgen_byteswap(VipsImage* in, VipsImage** out); + +int vipsgen_canny(VipsImage* in, VipsImage** out); +int vipsgen_canny_with_options(VipsImage* in, VipsImage** out, double sigma, VipsPrecision precision); + +int vipsgen_case(VipsImage* index, VipsImage** cases, VipsImage** out, int n); + +int vipsgen_cast(VipsImage* in, VipsImage** out, VipsBandFormat format); +int vipsgen_cast_with_options(VipsImage* in, VipsImage** out, VipsBandFormat format, gboolean shift); + +int vipsgen_clamp(VipsImage* in, VipsImage** out); +int vipsgen_clamp_with_options(VipsImage* in, VipsImage** out, double min, double max); + +int vipsgen_colourspace(VipsImage* in, VipsImage** out, VipsInterpretation space); +int vipsgen_colourspace_with_options(VipsImage* in, VipsImage** out, VipsInterpretation space, VipsInterpretation source_space); + +int vipsgen_compass(VipsImage* in, VipsImage** out, VipsImage* mask); +int vipsgen_compass_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int times, VipsAngle45 angle, VipsCombine combine, VipsPrecision precision, int layers, int cluster); + +int vipsgen_complex(VipsImage* in, VipsImage** out, VipsOperationComplex cmplx); + +int vipsgen_complex2(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationComplex2 cmplx); + +int vipsgen_complexform(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_complexget(VipsImage* in, VipsImage** out, VipsOperationComplexget get); + +int vipsgen_composite(VipsImage** in, VipsImage** out, int n, int* mode); +int vipsgen_composite_with_options(VipsImage** in, VipsImage** out, int n, int* mode, int* x, int x_n, int* y, int y_n, VipsInterpretation compositing_space, gboolean premultiplied); + +int vipsgen_composite2(VipsImage* base, VipsImage* overlay, VipsImage** out, VipsBlendMode mode); +int vipsgen_composite2_with_options(VipsImage* base, VipsImage* overlay, VipsImage** out, VipsBlendMode mode, int x, int y, VipsInterpretation compositing_space, gboolean premultiplied); + +int vipsgen_conv(VipsImage* in, VipsImage** out, VipsImage* mask); +int vipsgen_conv_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, VipsPrecision precision, int layers, int cluster); + +int vipsgen_conva(VipsImage* in, VipsImage** out, VipsImage* mask); +int vipsgen_conva_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int layers, int cluster); + +int vipsgen_convasep(VipsImage* in, VipsImage** out, VipsImage* mask); +int vipsgen_convasep_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, int layers); + +int vipsgen_convf(VipsImage* in, VipsImage** out, VipsImage* mask); + +int vipsgen_convi(VipsImage* in, VipsImage** out, VipsImage* mask); + +int vipsgen_convsep(VipsImage* in, VipsImage** out, VipsImage* mask); +int vipsgen_convsep_with_options(VipsImage* in, VipsImage** out, VipsImage* mask, VipsPrecision precision, int layers, int cluster); + +int vipsgen_copy(VipsImage* in, VipsImage** out); +int vipsgen_copy_with_options(VipsImage* in, VipsImage** out, int width, int height, int bands, VipsBandFormat format, VipsCoding coding, VipsInterpretation interpretation, double xres, double yres, int xoffset, int yoffset); + +int vipsgen_countlines(VipsImage* in, double* nolines, VipsDirection direction); + +int vipsgen_csvload(const char* filename, VipsImage** out); +int vipsgen_csvload_with_options(const char* filename, VipsImage** out, int skip, int lines, const char* whitespace, const char* separator, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_csvload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_csvload_source_with_options(VipsSourceCustom* source, VipsImage** out, int skip, int lines, const char* whitespace, const char* separator, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_csvsave(VipsImage* in, const char* filename); +int vipsgen_csvsave_with_options(VipsImage* in, const char* filename, const char* separator, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_csvsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_csvsave_target_with_options(VipsImage* in, VipsTargetCustom* target, const char* separator, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_dE00(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_dE76(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_dECMC(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_deviate(VipsImage* in, double* out); + +int vipsgen_divide(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_draw_circle(VipsImage* image, double* ink, int n, int cx, int cy, int radius); +int vipsgen_draw_circle_with_options(VipsImage* image, double* ink, int n, int cx, int cy, int radius, gboolean fill); + +int vipsgen_draw_flood(VipsImage* image, double* ink, int n, int x, int y); +int vipsgen_draw_flood_with_options(VipsImage* image, double* ink, int n, int x, int y, VipsImage* test, gboolean equal); + +int vipsgen_draw_image(VipsImage* image, VipsImage* sub, int x, int y); +int vipsgen_draw_image_with_options(VipsImage* image, VipsImage* sub, int x, int y, VipsCombineMode mode); + +int vipsgen_draw_line(VipsImage* image, double* ink, int n, int x1, int y1, int x2, int y2); + +int vipsgen_draw_mask(VipsImage* image, double* ink, int n, VipsImage* mask, int x, int y); + +int vipsgen_draw_rect(VipsImage* image, double* ink, int n, int left, int top, int width, int height); +int vipsgen_draw_rect_with_options(VipsImage* image, double* ink, int n, int left, int top, int width, int height, gboolean fill); + +int vipsgen_draw_smudge(VipsImage* image, int left, int top, int width, int height); + +int vipsgen_dzsave(VipsImage* in, const char* filename); +int vipsgen_dzsave_with_options(VipsImage* in, const char* filename, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_dzsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_dzsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_dzsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_dzsave_target_with_options(VipsImage* in, VipsTargetCustom* target, const char* imagename, VipsForeignDzLayout layout, const char* suffix, int overlap, int tile_size, gboolean centre, VipsForeignDzDepth depth, VipsAngle angle, VipsForeignDzContainer container, int compression, VipsRegionShrink region_shrink, int skip_blanks, const char* id, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_embed(VipsImage* in, VipsImage** out, int x, int y, int width, int height); +int vipsgen_embed_with_options(VipsImage* in, VipsImage** out, int x, int y, int width, int height, VipsExtend extend, double* background, int background_n); + +int vipsgen_extract_area(VipsImage* input, VipsImage** out, int left, int top, int width, int height); + +int vipsgen_extract_band(VipsImage* in, VipsImage** out, int band); +int vipsgen_extract_band_with_options(VipsImage* in, VipsImage** out, int band, int n); + +int vipsgen_eye(VipsImage** out, int width, int height); +int vipsgen_eye_with_options(VipsImage** out, int width, int height, gboolean uchar, double factor); + +int vipsgen_falsecolour(VipsImage* in, VipsImage** out); + +int vipsgen_fastcor(VipsImage* in, VipsImage* ref, VipsImage** out); + +int vipsgen_fill_nearest(VipsImage* in, VipsImage** out); + +int vipsgen_find_trim(VipsImage* in, int* left, int* top, int* width, int* height); +int vipsgen_find_trim_with_options(VipsImage* in, int* left, int* top, int* width, int* height, double threshold, double* background, int background_n, gboolean line_art); + +int vipsgen_fitsload(const char* filename, VipsImage** out); +int vipsgen_fitsload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_fitssave(VipsImage* in, const char* filename); +int vipsgen_fitssave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_flatten(VipsImage* in, VipsImage** out); +int vipsgen_flatten_with_options(VipsImage* in, VipsImage** out, double* background, int background_n, double max_alpha); + +int vipsgen_flip(VipsImage* in, VipsImage** out, VipsDirection direction); + +int vipsgen_float2rad(VipsImage* in, VipsImage** out); + +int vipsgen_fractsurf(VipsImage** out, int width, int height, double fractal_dimension); + +int vipsgen_freqmult(VipsImage* in, VipsImage* mask, VipsImage** out); + +int vipsgen_fwfft(VipsImage* in, VipsImage** out); + +int vipsgen_gamma(VipsImage* in, VipsImage** out); +int vipsgen_gamma_with_options(VipsImage* in, VipsImage** out, double exponent); + +int vipsgen_gaussblur(VipsImage* in, VipsImage** out, double sigma); +int vipsgen_gaussblur_with_options(VipsImage* in, VipsImage** out, double sigma, double min_ampl, VipsPrecision precision); + +int vipsgen_gaussmat(VipsImage** out, double sigma, double min_ampl); +int vipsgen_gaussmat_with_options(VipsImage** out, double sigma, double min_ampl, gboolean separable, VipsPrecision precision); + +int vipsgen_gaussnoise(VipsImage** out, int width, int height); +int vipsgen_gaussnoise_with_options(VipsImage** out, int width, int height, double sigma, double mean, int seed); + +int vipsgen_getpoint(VipsImage* in, double** out_array, int* n, int x, int y); +int vipsgen_getpoint_with_options(VipsImage* in, double** out_array, int* n, int x, int y, gboolean unpack_complex); + +int vipsgen_gifload(const char* filename, VipsImage** out); +int vipsgen_gifload_with_options(const char* filename, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_gifload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_gifload_buffer_with_options(void* buf, size_t len, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_gifload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_gifload_source_with_options(VipsSourceCustom* source, VipsImage** out, int n, int page, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_gifsave(VipsImage* in, const char* filename); +int vipsgen_gifsave_with_options(VipsImage* in, const char* filename, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_gifsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_gifsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_gifsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_gifsave_target_with_options(VipsImage* in, VipsTargetCustom* target, double dither, int effort, int bitdepth, double interframe_maxerror, gboolean reuse, double interpalette_maxerror, gboolean interlace, gboolean keep_duplicate_frames, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_globalbalance(VipsImage* in, VipsImage** out); +int vipsgen_globalbalance_with_options(VipsImage* in, VipsImage** out, double gamma, gboolean int_output); + +int vipsgen_gravity(VipsImage* in, VipsImage** out, VipsCompassDirection direction, int width, int height); +int vipsgen_gravity_with_options(VipsImage* in, VipsImage** out, VipsCompassDirection direction, int width, int height, VipsExtend extend, double* background, int background_n); + +int vipsgen_grey(VipsImage** out, int width, int height); +int vipsgen_grey_with_options(VipsImage** out, int width, int height, gboolean uchar); + +int vipsgen_grid(VipsImage* in, VipsImage** out, int tile_height, int across, int down); + +int vipsgen_heifload(const char* filename, VipsImage** out); +int vipsgen_heifload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_heifload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_heifload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_heifload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_heifload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean thumbnail, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_heifsave(VipsImage* in, const char* filename); +int vipsgen_heifsave_with_options(VipsImage* in, const char* filename, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_heifsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_heifsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_heifsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_heifsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, int bitdepth, gboolean lossless, VipsForeignHeifCompression compression, int effort, VipsForeignSubsample subsample_mode, VipsForeignHeifEncoder encoder, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_hist_cum(VipsImage* in, VipsImage** out); + +int vipsgen_hist_entropy(VipsImage* in, double* out); + +int vipsgen_hist_equal(VipsImage* in, VipsImage** out); +int vipsgen_hist_equal_with_options(VipsImage* in, VipsImage** out, int band); + +int vipsgen_hist_find(VipsImage* in, VipsImage** out); +int vipsgen_hist_find_with_options(VipsImage* in, VipsImage** out, int band); + +int vipsgen_hist_find_indexed(VipsImage* in, VipsImage* index, VipsImage** out); +int vipsgen_hist_find_indexed_with_options(VipsImage* in, VipsImage* index, VipsImage** out, VipsCombine combine); + +int vipsgen_hist_find_ndim(VipsImage* in, VipsImage** out); +int vipsgen_hist_find_ndim_with_options(VipsImage* in, VipsImage** out, int bins); + +int vipsgen_hist_ismonotonic(VipsImage* in, gboolean* monotonic); + +int vipsgen_hist_local(VipsImage* in, VipsImage** out, int width, int height); +int vipsgen_hist_local_with_options(VipsImage* in, VipsImage** out, int width, int height, int max_slope); + +int vipsgen_hist_match(VipsImage* in, VipsImage* ref, VipsImage** out); + +int vipsgen_hist_norm(VipsImage* in, VipsImage** out); + +int vipsgen_hist_plot(VipsImage* in, VipsImage** out); + +int vipsgen_hough_circle(VipsImage* in, VipsImage** out); +int vipsgen_hough_circle_with_options(VipsImage* in, VipsImage** out, int scale, int min_radius, int max_radius); + +int vipsgen_hough_line(VipsImage* in, VipsImage** out); +int vipsgen_hough_line_with_options(VipsImage* in, VipsImage** out, int width, int height); + +int vipsgen_icc_export(VipsImage* in, VipsImage** out); +int vipsgen_icc_export_with_options(VipsImage* in, VipsImage** out, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, const char* output_profile, int depth); + +int vipsgen_icc_import(VipsImage* in, VipsImage** out); +int vipsgen_icc_import_with_options(VipsImage* in, VipsImage** out, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, gboolean embedded, const char* input_profile); + +int vipsgen_icc_transform(VipsImage* in, VipsImage** out, const char* output_profile); +int vipsgen_icc_transform_with_options(VipsImage* in, VipsImage** out, const char* output_profile, VipsPCS pcs, VipsIntent intent, gboolean black_point_compensation, gboolean embedded, const char* input_profile, int depth); + +int vipsgen_identity(VipsImage** out); +int vipsgen_identity_with_options(VipsImage** out, int bands, gboolean ushort, int size); + +int vipsgen_ifthenelse(VipsImage* cond, VipsImage* in1, VipsImage* in2, VipsImage** out); +int vipsgen_ifthenelse_with_options(VipsImage* cond, VipsImage* in1, VipsImage* in2, VipsImage** out, gboolean blend); + +int vipsgen_insert(VipsImage* main, VipsImage* sub, VipsImage** out, int x, int y); +int vipsgen_insert_with_options(VipsImage* main, VipsImage* sub, VipsImage** out, int x, int y, gboolean expand, double* background, int background_n); + +int vipsgen_invert(VipsImage* in, VipsImage** out); + +int vipsgen_invertlut(VipsImage* in, VipsImage** out); +int vipsgen_invertlut_with_options(VipsImage* in, VipsImage** out, int size); + +int vipsgen_invfft(VipsImage* in, VipsImage** out); +int vipsgen_invfft_with_options(VipsImage* in, VipsImage** out, gboolean real); + +int vipsgen_join(VipsImage* in1, VipsImage* in2, VipsImage** out, VipsDirection direction); +int vipsgen_join_with_options(VipsImage* in1, VipsImage* in2, VipsImage** out, VipsDirection direction, gboolean expand, int shim, double* background, int background_n, VipsAlign align); + +int vipsgen_jp2kload(const char* filename, VipsImage** out); +int vipsgen_jp2kload_with_options(const char* filename, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jp2kload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_jp2kload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jp2kload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_jp2kload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, gboolean oneshot, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jp2ksave(VipsImage* in, const char* filename); +int vipsgen_jp2ksave_with_options(VipsImage* in, const char* filename, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jp2ksave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_jp2ksave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jp2ksave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_jp2ksave_target_with_options(VipsImage* in, VipsTargetCustom* target, int tile_width, int tile_height, gboolean lossless, int Q, VipsForeignSubsample subsample_mode, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jpegload(const char* filename, VipsImage** out); +int vipsgen_jpegload_with_options(const char* filename, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jpegload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_jpegload_buffer_with_options(void* buf, size_t len, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jpegload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_jpegload_source_with_options(VipsSourceCustom* source, VipsImage** out, int shrink, gboolean autorotate, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jpegsave(VipsImage* in, const char* filename); +int vipsgen_jpegsave_with_options(VipsImage* in, const char* filename, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jpegsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_jpegsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jpegsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_jpegsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, gboolean optimize_coding, gboolean interlace, gboolean trellis_quant, gboolean overshoot_deringing, gboolean optimize_scans, int quant_table, VipsForeignSubsample subsample_mode, int restart_interval, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jxlload(const char* filename, VipsImage** out); +int vipsgen_jxlload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jxlload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_jxlload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jxlload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_jxlload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_jxlsave(VipsImage* in, const char* filename); +int vipsgen_jxlsave_with_options(VipsImage* in, const char* filename, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jxlsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_jxlsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_jxlsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_jxlsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int tier, double distance, int effort, gboolean lossless, int Q, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_labelregions(VipsImage* in, VipsImage** mask); + +int vipsgen_linear(VipsImage* in, VipsImage** out, double* a, double* b, int n); +int vipsgen_linear_with_options(VipsImage* in, VipsImage** out, double* a, double* b, int n, gboolean uchar); + +int vipsgen_linecache(VipsImage* in, VipsImage** out); +int vipsgen_linecache_with_options(VipsImage* in, VipsImage** out, int tile_height, VipsAccess access, gboolean threaded, gboolean persistent); + +int vipsgen_logmat(VipsImage** out, double sigma, double min_ampl); +int vipsgen_logmat_with_options(VipsImage** out, double sigma, double min_ampl, gboolean separable, VipsPrecision precision); + +int vipsgen_magickload(const char* filename, VipsImage** out); +int vipsgen_magickload_with_options(const char* filename, VipsImage** out, const char* density, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_magickload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_magickload_buffer_with_options(void* buf, size_t len, VipsImage** out, const char* density, int page, int n, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_magicksave(VipsImage* in, const char* filename); +int vipsgen_magicksave_with_options(VipsImage* in, const char* filename, const char* format, int quality, gboolean optimize_gif_frames, gboolean optimize_gif_transparency, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_magicksave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_magicksave_buffer_with_options(VipsImage* in, void** buf, size_t* len, const char* format, int quality, gboolean optimize_gif_frames, gboolean optimize_gif_transparency, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_mapim(VipsImage* in, VipsImage** out, VipsImage* index); +int vipsgen_mapim_with_options(VipsImage* in, VipsImage** out, VipsImage* index, VipsInterpolate* interpolate, double* background, int background_n, gboolean premultiplied, VipsExtend extend); + +int vipsgen_maplut(VipsImage* in, VipsImage** out, VipsImage* lut); +int vipsgen_maplut_with_options(VipsImage* in, VipsImage** out, VipsImage* lut, int band); + +int vipsgen_mask_butterworth(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff); +int vipsgen_mask_butterworth_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_butterworth_band(VipsImage** out, int width, int height, double order, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff); +int vipsgen_mask_butterworth_band_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_butterworth_ring(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, double ringwidth); +int vipsgen_mask_butterworth_ring_with_options(VipsImage** out, int width, int height, double order, double frequency_cutoff, double amplitude_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_fractal(VipsImage** out, int width, int height, double fractal_dimension); +int vipsgen_mask_fractal_with_options(VipsImage** out, int width, int height, double fractal_dimension, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_gaussian(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff); +int vipsgen_mask_gaussian_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_gaussian_band(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff); +int vipsgen_mask_gaussian_band_with_options(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, double amplitude_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_gaussian_ring(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, double ringwidth); +int vipsgen_mask_gaussian_ring_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double amplitude_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_ideal(VipsImage** out, int width, int height, double frequency_cutoff); +int vipsgen_mask_ideal_with_options(VipsImage** out, int width, int height, double frequency_cutoff, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_ideal_band(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius); +int vipsgen_mask_ideal_band_with_options(VipsImage** out, int width, int height, double frequency_cutoff_x, double frequency_cutoff_y, double radius, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_mask_ideal_ring(VipsImage** out, int width, int height, double frequency_cutoff, double ringwidth); +int vipsgen_mask_ideal_ring_with_options(VipsImage** out, int width, int height, double frequency_cutoff, double ringwidth, gboolean uchar, gboolean nodc, gboolean reject, gboolean optical); + +int vipsgen_match(VipsImage* ref, VipsImage* sec, VipsImage** out, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2); +int vipsgen_match_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2, int hwindow, int harea, gboolean search, VipsInterpolate* interpolate); + +int vipsgen_math(VipsImage* in, VipsImage** out, VipsOperationMath math); + +int vipsgen_math2(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationMath2 math2); + +int vipsgen_math2_const(VipsImage* in, VipsImage** out, VipsOperationMath2 math2, double* c, int n); + +int vipsgen_matload(const char* filename, VipsImage** out); +int vipsgen_matload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_matrixinvert(VipsImage* in, VipsImage** out); + +int vipsgen_matrixload(const char* filename, VipsImage** out); +int vipsgen_matrixload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_matrixload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_matrixload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_matrixmultiply(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_matrixprint(VipsImage* in); +int vipsgen_matrixprint_with_options(VipsImage* in, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_matrixsave(VipsImage* in, const char* filename); +int vipsgen_matrixsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_matrixsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_matrixsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_max(VipsImage* in, double* out); +int vipsgen_max_with_options(VipsImage* in, double* out, int size); + +int vipsgen_maxpair(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_measure(VipsImage* in, VipsImage** out, int h, int v); +int vipsgen_measure_with_options(VipsImage* in, VipsImage** out, int h, int v, int left, int top, int width, int height); + +int vipsgen_merge(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int dx, int dy); +int vipsgen_merge_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int dx, int dy, int mblend); + +int vipsgen_min(VipsImage* in, double* out); +int vipsgen_min_with_options(VipsImage* in, double* out, int size); + +int vipsgen_minpair(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_morph(VipsImage* in, VipsImage** out, VipsImage* mask, VipsOperationMorphology morph); + +int vipsgen_mosaic(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xref, int yref, int xsec, int ysec); +int vipsgen_mosaic_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xref, int yref, int xsec, int ysec, int hwindow, int harea, int mblend, int bandno); + +int vipsgen_mosaic1(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2); +int vipsgen_mosaic1_with_options(VipsImage* ref, VipsImage* sec, VipsImage** out, VipsDirection direction, int xr1, int yr1, int xs1, int ys1, int xr2, int yr2, int xs2, int ys2, int hwindow, int harea, gboolean search, VipsInterpolate* interpolate, int mblend); + +int vipsgen_msb(VipsImage* in, VipsImage** out); +int vipsgen_msb_with_options(VipsImage* in, VipsImage** out, int band); + +int vipsgen_multiply(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_niftiload(const char* filename, VipsImage** out); +int vipsgen_niftiload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_niftiload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_niftiload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_niftisave(VipsImage* in, const char* filename); +int vipsgen_niftisave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_openexrload(const char* filename, VipsImage** out); +int vipsgen_openexrload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_openslideload(const char* filename, VipsImage** out); +int vipsgen_openslideload_with_options(const char* filename, VipsImage** out, int level, gboolean autocrop, const char* associated, gboolean attach_associated, gboolean rgb, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_openslideload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_openslideload_source_with_options(VipsSourceCustom* source, VipsImage** out, int level, gboolean autocrop, const char* associated, gboolean attach_associated, gboolean rgb, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pdfload(const char* filename, VipsImage** out); +int vipsgen_pdfload_with_options(const char* filename, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pdfload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_pdfload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pdfload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_pdfload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, double dpi, double scale, double* background, int background_n, const char* password, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_percent(VipsImage* in, double percent, int* threshold); + +int vipsgen_perlin(VipsImage** out, int width, int height); +int vipsgen_perlin_with_options(VipsImage** out, int width, int height, int cell_size, gboolean uchar, int seed); + +int vipsgen_phasecor(VipsImage* in, VipsImage* in2, VipsImage** out); + +int vipsgen_pngload(const char* filename, VipsImage** out); +int vipsgen_pngload_with_options(const char* filename, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pngload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_pngload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pngload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_pngload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_pngsave(VipsImage* in, const char* filename); +int vipsgen_pngsave_with_options(VipsImage* in, const char* filename, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_pngsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_pngsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_pngsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_pngsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int compression, gboolean interlace, VipsForeignPngFilter filter, gboolean palette, int Q, double dither, int bitdepth, int effort, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_ppmload(const char* filename, VipsImage** out); +int vipsgen_ppmload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_ppmload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_ppmload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_ppmload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_ppmload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_ppmsave(VipsImage* in, const char* filename); +int vipsgen_ppmsave_with_options(VipsImage* in, const char* filename, VipsForeignPpmFormat format, gboolean ascii, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_ppmsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_ppmsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignPpmFormat format, gboolean ascii, int bitdepth, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_premultiply(VipsImage* in, VipsImage** out); +int vipsgen_premultiply_with_options(VipsImage* in, VipsImage** out, double max_alpha); + +int vipsgen_prewitt(VipsImage* in, VipsImage** out); + +int vipsgen_profile(VipsImage* in, VipsImage** columns, VipsImage** rows); + +int vipsgen_profile_load(const char* name, VipsBlob** profile); + +int vipsgen_project(VipsImage* in, VipsImage** columns, VipsImage** rows); + +int vipsgen_quadratic(VipsImage* in, VipsImage** out, VipsImage* coeff); +int vipsgen_quadratic_with_options(VipsImage* in, VipsImage** out, VipsImage* coeff, VipsInterpolate* interpolate); + +int vipsgen_rad2float(VipsImage* in, VipsImage** out); + +int vipsgen_radload(const char* filename, VipsImage** out); +int vipsgen_radload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_radload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_radload_buffer_with_options(void* buf, size_t len, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_radload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_radload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_radsave(VipsImage* in, const char* filename); +int vipsgen_radsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_radsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_radsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_radsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_radsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_rank(VipsImage* in, VipsImage** out, int width, int height, int index); + +int vipsgen_rawload(const char* filename, VipsImage** out, int width, int height, int bands); +int vipsgen_rawload_with_options(const char* filename, VipsImage** out, int width, int height, int bands, guint64 offset, VipsBandFormat format, VipsInterpretation interpretation, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_rawsave(VipsImage* in, const char* filename); +int vipsgen_rawsave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_rawsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_rawsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_rawsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_rawsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_recomb(VipsImage* in, VipsImage** out, VipsImage* m); + +int vipsgen_reduce(VipsImage* in, VipsImage** out, double hshrink, double vshrink); +int vipsgen_reduce_with_options(VipsImage* in, VipsImage** out, double hshrink, double vshrink, VipsKernel kernel, double gap); + +int vipsgen_reduceh(VipsImage* in, VipsImage** out, double hshrink); +int vipsgen_reduceh_with_options(VipsImage* in, VipsImage** out, double hshrink, VipsKernel kernel, double gap); + +int vipsgen_reducev(VipsImage* in, VipsImage** out, double vshrink); +int vipsgen_reducev_with_options(VipsImage* in, VipsImage** out, double vshrink, VipsKernel kernel, double gap); + +int vipsgen_relational(VipsImage* left, VipsImage* right, VipsImage** out, VipsOperationRelational relational); + +int vipsgen_relational_const(VipsImage* in, VipsImage** out, VipsOperationRelational relational, double* c, int n); + +int vipsgen_remainder(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_remainder_const(VipsImage* in, VipsImage** out, double* c, int n); + +int vipsgen_remosaic(VipsImage* in, VipsImage** out, const char* old_str, const char* new_str); + +int vipsgen_replicate(VipsImage* in, VipsImage** out, int across, int down); + +int vipsgen_resize(VipsImage* in, VipsImage** out, double scale); +int vipsgen_resize_with_options(VipsImage* in, VipsImage** out, double scale, VipsKernel kernel, double gap, double vscale); + +int vipsgen_rot(VipsImage* in, VipsImage** out, VipsAngle angle); + +int vipsgen_rot45(VipsImage* in, VipsImage** out); +int vipsgen_rot45_with_options(VipsImage* in, VipsImage** out, VipsAngle45 angle); + +int vipsgen_rotate(VipsImage* in, VipsImage** out, double angle); +int vipsgen_rotate_with_options(VipsImage* in, VipsImage** out, double angle, VipsInterpolate* interpolate, double* background, int background_n, double odx, double ody, double idx, double idy); + +int vipsgen_round(VipsImage* in, VipsImage** out, VipsOperationRound round); + +int vipsgen_sRGB2HSV(VipsImage* in, VipsImage** out); + +int vipsgen_sRGB2scRGB(VipsImage* in, VipsImage** out); + +int vipsgen_scRGB2BW(VipsImage* in, VipsImage** out); +int vipsgen_scRGB2BW_with_options(VipsImage* in, VipsImage** out, int depth); + +int vipsgen_scRGB2XYZ(VipsImage* in, VipsImage** out); + +int vipsgen_scRGB2sRGB(VipsImage* in, VipsImage** out); +int vipsgen_scRGB2sRGB_with_options(VipsImage* in, VipsImage** out, int depth); + +int vipsgen_scale(VipsImage* in, VipsImage** out); +int vipsgen_scale_with_options(VipsImage* in, VipsImage** out, double exp, gboolean log); + +int vipsgen_scharr(VipsImage* in, VipsImage** out); + +int vipsgen_sdf(VipsImage** out, int width, int height, VipsSdfShape shape); +int vipsgen_sdf_with_options(VipsImage** out, int width, int height, VipsSdfShape shape, double r, double* a, int a_n, double* b, int b_n, double* corners, int corners_n); + +int vipsgen_sequential(VipsImage* in, VipsImage** out); +int vipsgen_sequential_with_options(VipsImage* in, VipsImage** out, int tile_height); + +int vipsgen_sharpen(VipsImage* in, VipsImage** out); +int vipsgen_sharpen_with_options(VipsImage* in, VipsImage** out, double sigma, double x1, double y2, double y3, double m1, double m2); + +int vipsgen_shrink(VipsImage* in, VipsImage** out, double hshrink, double vshrink); +int vipsgen_shrink_with_options(VipsImage* in, VipsImage** out, double hshrink, double vshrink, gboolean ceil); + +int vipsgen_shrinkh(VipsImage* in, VipsImage** out, int hshrink); +int vipsgen_shrinkh_with_options(VipsImage* in, VipsImage** out, int hshrink, gboolean ceil); + +int vipsgen_shrinkv(VipsImage* in, VipsImage** out, int vshrink); +int vipsgen_shrinkv_with_options(VipsImage* in, VipsImage** out, int vshrink, gboolean ceil); + +int vipsgen_sign(VipsImage* in, VipsImage** out); + +int vipsgen_similarity(VipsImage* in, VipsImage** out); +int vipsgen_similarity_with_options(VipsImage* in, VipsImage** out, double scale, double angle, VipsInterpolate* interpolate, double* background, int background_n, double odx, double ody, double idx, double idy); + +int vipsgen_sines(VipsImage** out, int width, int height); +int vipsgen_sines_with_options(VipsImage** out, int width, int height, gboolean uchar, double hfreq, double vfreq); + +int vipsgen_smartcrop(VipsImage* input, VipsImage** out, int width, int height); +int vipsgen_smartcrop_with_options(VipsImage* input, VipsImage** out, int width, int height, VipsInteresting interesting, gboolean premultiplied); + +int vipsgen_sobel(VipsImage* in, VipsImage** out); + +int vipsgen_spcor(VipsImage* in, VipsImage* ref, VipsImage** out); + +int vipsgen_spectrum(VipsImage* in, VipsImage** out); + +int vipsgen_stats(VipsImage* in, VipsImage** out); + +int vipsgen_stdif(VipsImage* in, VipsImage** out, int width, int height); +int vipsgen_stdif_with_options(VipsImage* in, VipsImage** out, int width, int height, double s0, double b, double m0, double a); + +int vipsgen_subsample(VipsImage* input, VipsImage** out, int xfac, int yfac); +int vipsgen_subsample_with_options(VipsImage* input, VipsImage** out, int xfac, int yfac, gboolean point); + +int vipsgen_subtract(VipsImage* left, VipsImage* right, VipsImage** out); + +int vipsgen_sum(VipsImage** in, VipsImage** out, int n); + +int vipsgen_svgload(const char* filename, VipsImage** out); +int vipsgen_svgload_with_options(const char* filename, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_svgload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_svgload_buffer_with_options(void* buf, size_t len, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_svgload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_svgload_source_with_options(VipsSourceCustom* source, VipsImage** out, double dpi, double scale, gboolean unlimited, const char* stylesheet, gboolean high_bitdepth, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_switch(VipsImage** tests, VipsImage** out, int n); + +int vipsgen_system(const char* cmd_format); +int vipsgen_system_with_options(const char* cmd_format, VipsImage** in, int in_n, const char* out_format, const char* in_format); + +int vipsgen_text(VipsImage** out, const char* text); +int vipsgen_text_with_options(VipsImage** out, const char* text, const char* font, int width, int height, VipsAlign align, gboolean justify, int dpi, int spacing, const char* fontfile, gboolean rgba, VipsTextWrap wrap); + +int vipsgen_thumbnail(const char* filename, VipsImage** out, int width); +int vipsgen_thumbnail_with_options(const char* filename, VipsImage** out, int width, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on); + +int vipsgen_thumbnail_buffer(void* buf, size_t len, VipsImage** out, int width); +int vipsgen_thumbnail_buffer_with_options(void* buf, size_t len, VipsImage** out, int width, const char* option_string, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on); + +int vipsgen_thumbnail_image(VipsImage* in, VipsImage** out, int width); +int vipsgen_thumbnail_image_with_options(VipsImage* in, VipsImage** out, int width, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on); + +int vipsgen_thumbnail_source(VipsSourceCustom* source, VipsImage** out, int width); +int vipsgen_thumbnail_source_with_options(VipsSourceCustom* source, VipsImage** out, int width, const char* option_string, int height, VipsSize size, gboolean no_rotate, VipsInteresting crop, gboolean linear, const char* input_profile, const char* output_profile, VipsIntent intent, VipsFailOn fail_on); + +int vipsgen_tiffload(const char* filename, VipsImage** out); +int vipsgen_tiffload_with_options(const char* filename, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_tiffload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_tiffload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_tiffload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_tiffload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, gboolean autorotate, int subifd, gboolean unlimited, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_tiffsave(VipsImage* in, const char* filename); +int vipsgen_tiffsave_with_options(VipsImage* in, const char* filename, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_tiffsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_tiffsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_tiffsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_tiffsave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignTiffCompression compression, int Q, VipsForeignTiffPredictor predictor, gboolean tile, int tile_width, int tile_height, gboolean pyramid, gboolean miniswhite, int bitdepth, VipsForeignTiffResunit resunit, double xres, double yres, gboolean bigtiff, gboolean properties, VipsRegionShrink region_shrink, int level, gboolean lossless, VipsForeignDzDepth depth, gboolean subifd, gboolean premultiply, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_tilecache(VipsImage* in, VipsImage** out); +int vipsgen_tilecache_with_options(VipsImage* in, VipsImage** out, int tile_width, int tile_height, int max_tiles, VipsAccess access, gboolean threaded, gboolean persistent); + +int vipsgen_tonelut(VipsImage** out); +int vipsgen_tonelut_with_options(VipsImage** out, int in_max, int out_max, double Lb, double Lw, double Ps, double Pm, double Ph, double S, double M, double H); + +int vipsgen_transpose3d(VipsImage* in, VipsImage** out); +int vipsgen_transpose3d_with_options(VipsImage* in, VipsImage** out, int page_height); + +int vipsgen_unpremultiply(VipsImage* in, VipsImage** out); +int vipsgen_unpremultiply_with_options(VipsImage* in, VipsImage** out, double max_alpha, int alpha_band); + +int vipsgen_vipsload(const char* filename, VipsImage** out); +int vipsgen_vipsload_with_options(const char* filename, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_vipsload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_vipsload_source_with_options(VipsSourceCustom* source, VipsImage** out, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_vipssave(VipsImage* in, const char* filename); +int vipsgen_vipssave_with_options(VipsImage* in, const char* filename, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_vipssave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_vipssave_target_with_options(VipsImage* in, VipsTargetCustom* target, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_webpload(const char* filename, VipsImage** out); +int vipsgen_webpload_with_options(const char* filename, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_webpload_buffer(void* buf, size_t len, VipsImage** out); +int vipsgen_webpload_buffer_with_options(void* buf, size_t len, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_webpload_source(VipsSourceCustom* source, VipsImage** out); +int vipsgen_webpload_source_with_options(VipsSourceCustom* source, VipsImage** out, int page, int n, double scale, gboolean memory, VipsAccess access, VipsFailOn fail_on, gboolean revalidate); + +int vipsgen_webpsave(VipsImage* in, const char* filename); +int vipsgen_webpsave_with_options(VipsImage* in, const char* filename, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_webpsave_buffer(VipsImage* in, void** buf, size_t* len); +int vipsgen_webpsave_buffer_with_options(VipsImage* in, void** buf, size_t* len, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_webpsave_target(VipsImage* in, VipsTargetCustom* target); +int vipsgen_webpsave_target_with_options(VipsImage* in, VipsTargetCustom* target, int Q, gboolean lossless, VipsForeignWebpPreset preset, gboolean smart_subsample, gboolean near_lossless, int alpha_q, gboolean min_size, int kmin, int kmax, int effort, int target_size, gboolean mixed, gboolean smart_deblock, int passes, VipsForeignKeep keep, double* background, int background_n, int page_height, const char* profile); + +int vipsgen_worley(VipsImage** out, int width, int height); +int vipsgen_worley_with_options(VipsImage** out, int width, int height, int cell_size, int seed); + +int vipsgen_wrap(VipsImage* in, VipsImage** out); +int vipsgen_wrap_with_options(VipsImage* in, VipsImage** out, int x, int y); + +int vipsgen_xyz(VipsImage** out, int width, int height); +int vipsgen_xyz_with_options(VipsImage** out, int width, int height, int csize, int dsize, int esize); + +int vipsgen_zone(VipsImage** out, int width, int height); +int vipsgen_zone_with_options(VipsImage** out, int width, int height, gboolean uchar); + +int vipsgen_zoom(VipsImage* input, VipsImage** out, int xfac, int yfac); + + +// Custom operations + +int vipsgen_image_new_from_source(VipsSourceCustom *source, VipsImage **out); +int vipsgen_image_new_from_source_with_option(VipsSourceCustom *source, VipsImage **out, const char *option_string); +int vipsgen_image_new_from_file(const char *name, VipsImage **out); +int vipsgen_image_new_from_buffer(const void *buf, size_t len, VipsImage **out); +int vipsgen_image_new_from_buffer_with_option(const void *buf, size_t len, VipsImage **out, const char *option_string); +int vipsgen_image_new_from_memory(const void *buf, size_t len, int width, int height, int bands, VipsImage **out); +void vipsgen_clear_image(VipsImage **image); + +int vipsgen_remove_exif(VipsImage *in, VipsImage **out); +int vipsgen_embed_multi_page(VipsImage *in, VipsImage **out, int left, int top, int width, int height, int extend); +int vipsgen_embed_multi_page_background(VipsImage *in, VipsImage **out, int left, int top, int width, int height, double r, double g, double b, double a); +int vipsgen_extract_area_multi_page(VipsImage *in, VipsImage **out, int left, int top, int width, int height); +int vipsgen_rot_multi_page(VipsImage *in, VipsImage **out, VipsAngle angle); +int vipsgen_label(VipsImage *in, VipsImage **out, const char *text, const char *font, int x, int y, int size, VipsAlign align, double r, double g, double b, float opacity); diff --git a/vendor/github.com/davidbyttow/govips/v2/LICENSE b/vendor/github.com/davidbyttow/govips/v2/LICENSE deleted file mode 100644 index 8d0891d788..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/LICENSE +++ /dev/null @@ -1,24 +0,0 @@ -The MIT License - -Copyright (c) Simple Things LLC and contributors - -Permission is hereby granted, free of charge, to any person -obtaining a copy of this software and associated documentation -files (the "Software"), to deal in the Software without -restriction, including without limitation the rights to use, -copy, modify, merge, publish, distribute, sublicense, and/or sell -copies of the Software, and to permit persons to whom the -Software is furnished to do so, subject to the following -conditions: - -The above copyright notice and this permission notice shall be -included in all copies or substantial portions of the Software. - -THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, -EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES -OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND -NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT -HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, -WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING -FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR -OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.c b/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.c deleted file mode 100644 index 557f613cbd..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.c +++ /dev/null @@ -1,71 +0,0 @@ -#include "arithmetic.h" - -int add(VipsImage *left, VipsImage *right, VipsImage **out) { - return vips_add(left, right, out, NULL); -} - -int multiply(VipsImage *left, VipsImage *right, VipsImage **out) { - return vips_multiply(left, right, out, NULL); -} - -int divide(VipsImage *left, VipsImage *right, VipsImage **out) { - return vips_divide(left, right, out, NULL); -} - -int linear(VipsImage *in, VipsImage **out, double *a, double *b, int n) { - return vips_linear(in, out, a, b, n, NULL); -} - -int linear1(VipsImage *in, VipsImage **out, double a, double b) { - return vips_linear1(in, out, a, b, NULL); -} - -int invert_image(VipsImage *in, VipsImage **out) { - return vips_invert(in, out, NULL); -} - -int average(VipsImage *in, double *out) { - return vips_avg(in, out, NULL); -} - -int find_trim(VipsImage *in, int *left, int *top, int *width, int *height, - double threshold, double r, double g, double b) { - - if (in->Type == VIPS_INTERPRETATION_RGB16 || in->Type == VIPS_INTERPRETATION_GREY16) { - r = 65535 * r / 255; - g = 65535 * g / 255; - b = 65535 * b / 255; - } - - double background[3] = {r, g, b}; - VipsArrayDouble *vipsBackground = vips_array_double_new(background, 3); - - int code = vips_find_trim(in, left, top, width, height, "threshold", threshold, "background", vipsBackground, NULL); - - vips_area_unref(VIPS_AREA(vipsBackground)); - return code; -} - -int getpoint(VipsImage *in, double **vector, int n, int x, int y) { - return vips_getpoint(in, vector, &n, x, y, NULL); -} - -int stats(VipsImage *in, VipsImage **out) { - return vips_stats(in, out, NULL); -} - -int hist_find(VipsImage *in, VipsImage **out) { - return vips_hist_find(in, out, NULL); -} - -int hist_cum(VipsImage *in, VipsImage **out) { - return vips_hist_cum(in, out, NULL); -} - -int hist_norm(VipsImage *in, VipsImage **out) { - return vips_hist_norm(in, out, NULL); -} - -int hist_entropy(VipsImage *in, double *out) { - return vips_hist_entropy(in, out, NULL); -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.go b/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.go deleted file mode 100644 index 3bdf5baa1d..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.go +++ /dev/null @@ -1,176 +0,0 @@ -package vips - -// #include "arithmetic.h" -import "C" -import "unsafe" - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-add -func vipsAdd(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("add") - var out *C.VipsImage - - if err := C.add(left, right, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-multiply -func vipsMultiply(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("multiply") - var out *C.VipsImage - - if err := C.multiply(left, right, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-divide -func vipsDivide(left *C.VipsImage, right *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("divide") - var out *C.VipsImage - - if err := C.divide(left, right, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-linear -func vipsLinear(in *C.VipsImage, a, b []float64, n int) (*C.VipsImage, error) { - incOpCounter("linear") - var out *C.VipsImage - - if err := C.linear(in, &out, (*C.double)(&a[0]), (*C.double)(&b[0]), C.int(n)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-linear1 -func vipsLinear1(in *C.VipsImage, a, b float64) (*C.VipsImage, error) { - incOpCounter("linear1") - var out *C.VipsImage - - if err := C.linear1(in, &out, C.double(a), C.double(b)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-invert -func vipsInvert(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("invert") - var out *C.VipsImage - - if err := C.invert_image(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-avg -func vipsAverage(in *C.VipsImage) (float64, error) { - incOpCounter("average") - var out C.double - - if err := C.average(in, &out); err != 0 { - return 0, handleVipsError() - } - - return float64(out), nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-find-trim -func vipsFindTrim(in *C.VipsImage, threshold float64, backgroundColor *Color) (int, int, int, int, error) { - incOpCounter("findTrim") - var left, top, width, height C.int - - if err := C.find_trim(in, &left, &top, &width, &height, C.double(threshold), C.double(backgroundColor.R), - C.double(backgroundColor.G), C.double(backgroundColor.B)); err != 0 { - return -1, -1, -1, -1, handleVipsError() - } - - return int(left), int(top), int(width), int(height), nil -} - -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-getpoint -func vipsGetPoint(in *C.VipsImage, n int, x int, y int) ([]float64, error) { - incOpCounter("getpoint") - var out *C.double - defer gFreePointer(unsafe.Pointer(out)) - - if err := C.getpoint(in, &out, C.int(n), C.int(x), C.int(y)); err != 0 { - return nil, handleVipsError() - } - - // maximum n is 4 - return (*[4]float64)(unsafe.Pointer(out))[:n:n], nil -} - -// https://www.libvips.org/API/current/libvips-arithmetic.html#vips-stats -func vipsStats(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("stats") - var out *C.VipsImage - - if err := C.stats(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://www.libvips.org/API/current/libvips-arithmetic.html#vips-hist-find -func vipsHistFind(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("histFind") - var out *C.VipsImage - - if err := C.hist_find(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://www.libvips.org/API/current/libvips-histogram.html#vips-hist-norm -func vipsHistNorm(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("histNorm") - var out *C.VipsImage - - if err := C.hist_norm(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://www.libvips.org/API/current/libvips-histogram.html#vips-hist-cum -func vipsHistCum(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("histCum") - var out *C.VipsImage - - if err := C.hist_cum(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://www.libvips.org/API/current/libvips-histogram.html#vips-hist-entropy -func vipsHistEntropy(in *C.VipsImage) (float64, error) { - incOpCounter("histEntropy") - var out C.double - - if err := C.hist_entropy(in, &out); err != 0 { - return 0, handleVipsError() - } - - return float64(out), nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.h b/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.h deleted file mode 100644 index 693b4fdde8..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/arithmetic.h +++ /dev/null @@ -1,20 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-arithmetic.html - -#include -#include - -int add(VipsImage *left, VipsImage *right, VipsImage **out); -int multiply(VipsImage *left, VipsImage *right, VipsImage **out); -int divide(VipsImage *left, VipsImage *right, VipsImage **out); -int linear(VipsImage *in, VipsImage **out, double *a, double *b, int n); -int linear1(VipsImage *in, VipsImage **out, double a, double b); -int invert_image(VipsImage *in, VipsImage **out); -int average(VipsImage *in, double *out); -int find_trim(VipsImage *in, int *left, int *top, int *width, int *height, - double threshold, double r, double g, double b); -int getpoint(VipsImage *in, double **vector, int n, int x, int y); -int stats(VipsImage *in, VipsImage **out); -int hist_find(VipsImage *in, VipsImage **out); -int hist_cum(VipsImage *in, VipsImage **out); -int hist_norm(VipsImage *in, VipsImage **out); -int hist_entropy(VipsImage *in, double *out); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/color.c b/vendor/github.com/davidbyttow/govips/v2/vips/color.c deleted file mode 100644 index 202440ee1b..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/color.c +++ /dev/null @@ -1,22 +0,0 @@ -#include "color.h" -#include - -int is_colorspace_supported(VipsImage *in) { - return vips_colourspace_issupported(in) ? 1 : 0; -} - -int to_colorspace(VipsImage *in, VipsImage **out, VipsInterpretation space) { - return vips_colourspace(in, out, space, NULL); -} - -// https://libvips.github.io/libvips/API/8.6/libvips-colour.html#vips-icc-transform -int icc_transform(VipsImage *in, VipsImage **out, const char *output_profile, const char *input_profile, VipsIntent intent, - int depth, gboolean embedded) { - return vips_icc_transform( - in, out, output_profile, - "input_profile", input_profile ? input_profile : "none", - "intent", intent, - "depth", depth ? depth : 8, - "embedded", embedded, - NULL); -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/color.go b/vendor/github.com/davidbyttow/govips/v2/vips/color.go deleted file mode 100644 index df5aed529a..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/color.go +++ /dev/null @@ -1,96 +0,0 @@ -package vips - -// #include "color.h" -import "C" - -// Color represents an RGB -type Color struct { - R, G, B uint8 -} - -// ColorRGBA represents an RGB with alpha channel (A) -type ColorRGBA struct { - R, G, B, A uint8 -} - -// Interpretation represents VIPS_INTERPRETATION type -type Interpretation int - -// Interpretation enum -const ( - InterpretationError Interpretation = C.VIPS_INTERPRETATION_ERROR - InterpretationMultiband Interpretation = C.VIPS_INTERPRETATION_MULTIBAND - InterpretationBW Interpretation = C.VIPS_INTERPRETATION_B_W - InterpretationHistogram Interpretation = C.VIPS_INTERPRETATION_HISTOGRAM - InterpretationXYZ Interpretation = C.VIPS_INTERPRETATION_XYZ - InterpretationLAB Interpretation = C.VIPS_INTERPRETATION_LAB - InterpretationCMYK Interpretation = C.VIPS_INTERPRETATION_CMYK - InterpretationLABQ Interpretation = C.VIPS_INTERPRETATION_LABQ - InterpretationRGB Interpretation = C.VIPS_INTERPRETATION_RGB - InterpretationRGB16 Interpretation = C.VIPS_INTERPRETATION_RGB16 - InterpretationCMC Interpretation = C.VIPS_INTERPRETATION_CMC - InterpretationLCH Interpretation = C.VIPS_INTERPRETATION_LCH - InterpretationLABS Interpretation = C.VIPS_INTERPRETATION_LABS - InterpretationSRGB Interpretation = C.VIPS_INTERPRETATION_sRGB - InterpretationYXY Interpretation = C.VIPS_INTERPRETATION_YXY - InterpretationFourier Interpretation = C.VIPS_INTERPRETATION_FOURIER - InterpretationGrey16 Interpretation = C.VIPS_INTERPRETATION_GREY16 - InterpretationMatrix Interpretation = C.VIPS_INTERPRETATION_MATRIX - InterpretationScRGB Interpretation = C.VIPS_INTERPRETATION_scRGB - InterpretationHSV Interpretation = C.VIPS_INTERPRETATION_HSV -) - -// Intent represents VIPS_INTENT type -type Intent int - -// Intent enum -const ( - IntentPerceptual Intent = C.VIPS_INTENT_PERCEPTUAL - IntentRelative Intent = C.VIPS_INTENT_RELATIVE - IntentSaturation Intent = C.VIPS_INTENT_SATURATION - IntentAbsolute Intent = C.VIPS_INTENT_ABSOLUTE - IntentLast Intent = C.VIPS_INTENT_LAST -) - -func vipsIsColorSpaceSupported(in *C.VipsImage) bool { - return C.is_colorspace_supported(in) == 1 -} - -// https://libvips.github.io/libvips/API/current/libvips-colour.html#vips-colourspace -func vipsToColorSpace(in *C.VipsImage, interpretation Interpretation) (*C.VipsImage, error) { - incOpCounter("to_colorspace") - var out *C.VipsImage - - inter := C.VipsInterpretation(interpretation) - - if err := C.to_colorspace(in, &out, inter); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsICCTransform(in *C.VipsImage, outputProfile string, inputProfile string, intent Intent, depth int, - embedded bool) (*C.VipsImage, error) { - var out *C.VipsImage - var cInputProfile *C.char - var cEmbedded C.gboolean - - cOutputProfile := C.CString(outputProfile) - defer freeCString(cOutputProfile) - - if inputProfile != "" { - cInputProfile = C.CString(inputProfile) - defer freeCString(cInputProfile) - } - - if embedded { - cEmbedded = C.TRUE - } - - if res := C.icc_transform(in, &out, cOutputProfile, cInputProfile, C.VipsIntent(intent), C.int(depth), cEmbedded); res != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/color.h b/vendor/github.com/davidbyttow/govips/v2/vips/color.h deleted file mode 100644 index 0f68796a6b..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/color.h +++ /dev/null @@ -1,10 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-colour.html - -#include -#include - -int is_colorspace_supported(VipsImage *in); -int to_colorspace(VipsImage *in, VipsImage **out, VipsInterpretation space); - -int icc_transform(VipsImage *in, VipsImage **out, const char *output_profile, const char *input_profile, VipsIntent intent, - int depth, gboolean embedded); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/composite.go b/vendor/github.com/davidbyttow/govips/v2/vips/composite.go deleted file mode 100644 index 209870928c..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/composite.go +++ /dev/null @@ -1,27 +0,0 @@ -package vips - -// #include -import "C" - -// ImageComposite image to composite param -type ImageComposite struct { - Image *ImageRef - BlendMode BlendMode - X, Y int -} - -func toVipsCompositeStructs(r *ImageRef, datas []*ImageComposite) ([]*C.VipsImage, []C.int, []C.int, []C.int) { - ins := []*C.VipsImage{r.image} - modes := []C.int{} - xs := []C.int{} - ys := []C.int{} - - for _, image := range datas { - ins = append(ins, image.Image.image) - modes = append(modes, C.int(image.BlendMode)) - xs = append(xs, C.int(image.X)) - ys = append(ys, C.int(image.Y)) - } - - return ins, modes, xs, ys -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.c b/vendor/github.com/davidbyttow/govips/v2/vips/conversion.c deleted file mode 100644 index 878e80818c..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.c +++ /dev/null @@ -1,380 +0,0 @@ -#include "conversion.h" - -int copy_image_changing_interpretation(VipsImage *in, VipsImage **out, - VipsInterpretation interpretation) { - return vips_copy(in, out, "interpretation", interpretation, NULL); -} - -int copy_image_changing_resolution(VipsImage *in, VipsImage **out, double xres, - double yres) { - return vips_copy(in, out, "xres", xres, "yres", yres, NULL); -} - -int copy_image(VipsImage *in, VipsImage **out) { - return vips_copy(in, out, NULL); -} - -int embed_image(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, int extend) { - return vips_embed(in, out, left, top, width, height, "extend", extend, NULL); -} - -int embed_image_background(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, double r, double g, double b, double a) { - - double background[3] = {r, g, b}; - double backgroundRGBA[4] = {r, g, b, a}; - - VipsArrayDouble *vipsBackground; - - if (in->Bands <= 3) { - vipsBackground = vips_array_double_new(background, 3); - } else { - vipsBackground = vips_array_double_new(backgroundRGBA, 4); - } - - int code = vips_embed(in, out, left, top, width, height, - "extend", VIPS_EXTEND_BACKGROUND, "background", vipsBackground, NULL); - - vips_area_unref(VIPS_AREA(vipsBackground)); - return code; -} - -int embed_multi_page_image(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, int extend) { - VipsObject *base = VIPS_OBJECT(vips_image_new()); - int page_height = vips_image_get_page_height(in); - int in_width = in->Xsize; - int n_pages = in->Ysize / page_height; - - VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); - VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); - - // split image into cropped frames - for (int i = 0; i < n_pages; i++) { - if ( - vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || - vips_embed(page[i], &page[i], left, top, width, height, "extend", extend, NULL) - ) { - g_object_unref(base); - return -1; - } - } - // reassemble frames and set page height - // copy before modifying metadata - if( - vips_arrayjoin(page, ©[0], n_pages, "across", 1, NULL) || - vips_copy(copy[0], out, NULL) - ) { - g_object_unref(base); - return -1; - } - vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); - g_object_unref(base); - return 0; -} - -int embed_multi_page_image_background(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, double r, double g, double b, double a) { - double background[3] = {r, g, b}; - double backgroundRGBA[4] = {r, g, b, a}; - - VipsArrayDouble *vipsBackground; - - if (in->Bands <= 3) { - vipsBackground = vips_array_double_new(background, 3); - } else { - vipsBackground = vips_array_double_new(backgroundRGBA, 4); - } - VipsObject *base = VIPS_OBJECT(vips_image_new()); - int page_height = vips_image_get_page_height(in); - int in_width = in->Xsize; - int n_pages = in->Ysize / page_height; - - VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); - VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); - - // split image into cropped frames - for (int i = 0; i < n_pages; i++) { - if ( - vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || - vips_embed(page[i], &page[i], left, top, width, height, - "extend", VIPS_EXTEND_BACKGROUND, "background", vipsBackground, NULL) - ) { - vips_area_unref(VIPS_AREA(vipsBackground)); - g_object_unref(base); - return -1; - } - } - // reassemble frames and set page height - // copy before modifying metadata - if( - vips_arrayjoin(page, ©[0], n_pages, "across", 1, NULL) || - vips_copy(copy[0], out, NULL) - ) { - vips_area_unref(VIPS_AREA(vipsBackground)); - g_object_unref(base); - return -1; - } - vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); - vips_area_unref(VIPS_AREA(vipsBackground)); - g_object_unref(base); - return 0; -} - -int flip_image(VipsImage *in, VipsImage **out, int direction) { - return vips_flip(in, out, direction, NULL); -} - -int recomb_image(VipsImage *in, VipsImage **out, VipsImage *m) { - return vips_recomb(in, out, m, NULL); -} - -int extract_image_area(VipsImage *in, VipsImage **out, int left, int top, - int width, int height) { - return vips_extract_area(in, out, left, top, width, height, NULL); -} - -int extract_area_multi_page(VipsImage *in, VipsImage **out, int left, int top, int width, int height) { - VipsObject *base = VIPS_OBJECT(vips_image_new()); - int page_height = vips_image_get_page_height(in); - int n_pages = in->Ysize / page_height; - - VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); - VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); - - // split image into cropped frames - for (int i = 0; i < n_pages; i++) { - if(vips_extract_area(in, &page[i], left, page_height * i + top, width, height, NULL)) { - g_object_unref(base); - return -1; - } - } - // reassemble frames and set page height - // copy before modifying metadata - if( - vips_arrayjoin(page, ©[0], n_pages, "across", 1, NULL) || - vips_copy(copy[0], out, NULL) - ) { - g_object_unref(base); - return -1; - } - vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); - g_object_unref(base); - return 0; -} - -int extract_band(VipsImage *in, VipsImage **out, int band, int num) { - if (num > 0) { - return vips_extract_band(in, out, band, "n", num, NULL); - } - return vips_extract_band(in, out, band, NULL); -} - -int rot_image(VipsImage *in, VipsImage **out, VipsAngle angle) { - return vips_rot(in, out, angle, NULL); -} - -int autorot_image(VipsImage *in, VipsImage **out) { - return vips_autorot(in, out, NULL); -} - -int zoom_image(VipsImage *in, VipsImage **out, int xfac, int yfac) { - return vips_zoom(in, out, xfac, yfac, NULL); -} - -int bandjoin(VipsImage **in, VipsImage **out, int n) { - return vips_bandjoin(in, out, n, NULL); -} - -int bandjoin_const(VipsImage *in, VipsImage **out, double constants[], int n) { - return vips_bandjoin_const(in, out, constants, n, NULL); -} - -int similarity(VipsImage *in, VipsImage **out, double scale, double angle, - double r, double g, double b, double a, double idx, double idy, - double odx, double ody) { - if (is_16bit(in->Type)) { - r = 65535 * r / 255; - g = 65535 * g / 255; - b = 65535 * b / 255; - a = 65535 * a / 255; - } - - double background[3] = {r, g, b}; - double backgroundRGBA[4] = {r, g, b, a}; - - VipsArrayDouble *vipsBackground; - - // Ignore the alpha channel if the image doesn't have one - if (in->Bands <= 3) { - vipsBackground = vips_array_double_new(background, 3); - } else { - vipsBackground = vips_array_double_new(backgroundRGBA, 4); - } - - int code = vips_similarity(in, out, "scale", scale, "angle", angle, - "background", vipsBackground, "idx", idx, "idy", - idy, "odx", odx, "ody", ody, NULL); - - vips_area_unref(VIPS_AREA(vipsBackground)); - return code; -} - -int smartcrop(VipsImage *in, VipsImage **out, int width, int height, - int interesting) { - return vips_smartcrop(in, out, width, height, "interesting", interesting, - NULL); -} - -int crop(VipsImage *in, VipsImage **out, int left, int top, - int width, int height) { - // resolve image pages - int page_height = vips_image_get_page_height(in); - int n_pages = in->Ysize / page_height; - if (n_pages <= 1) { - return vips_crop(in, out, left, top, width, height, NULL); - } - - int in_width = in->Xsize; - VipsObject *base = VIPS_OBJECT(vips_image_new()); - VipsImage **page = (VipsImage **) vips_object_local_array(base, n_pages); - VipsImage **copy = (VipsImage **) vips_object_local_array(base, 1); - // split image into cropped frames - for (int i = 0; i < n_pages; i++) { - if ( - vips_extract_area(in, &page[i], 0, page_height * i, in_width, page_height, NULL) || - vips_crop(page[i], &page[i], left, top, width, height, NULL) - ) { - g_object_unref(base); - return -1; - } - } - - // reassemble frames and set page height - // copy before modifying metadata - if( - vips_arrayjoin(page, ©[0], n_pages, "across", 1, NULL) || - vips_copy(copy[0], out, NULL) - ) { - g_object_unref(base); - return -1; - } - vips_image_set_int(*out, VIPS_META_PAGE_HEIGHT, height); - g_object_unref(base); - return 0; -} - -int flatten_image(VipsImage *in, VipsImage **out, double r, double g, - double b) { - if (is_16bit(in->Type)) { - r = 65535 * r / 255; - g = 65535 * g / 255; - b = 65535 * b / 255; - } - - double background[3] = {r, g, b}; - VipsArrayDouble *vipsBackground = vips_array_double_new(background, 3); - - int code = vips_flatten(in, out, "background", vipsBackground, "max_alpha", - is_16bit(in->Type) ? 65535.0 : 255.0, NULL); - - vips_area_unref(VIPS_AREA(vipsBackground)); - return code; -} - -int is_16bit(VipsInterpretation interpretation) { - return interpretation == VIPS_INTERPRETATION_RGB16 || - interpretation == VIPS_INTERPRETATION_GREY16; -} - -int add_alpha(VipsImage *in, VipsImage **out) { - return vips_addalpha(in, out, NULL); -} - -int premultiply_alpha(VipsImage *in, VipsImage **out) { - return vips_premultiply(in, out, "max_alpha", max_alpha(in), NULL); -} - -int unpremultiply_alpha(VipsImage *in, VipsImage **out) { - return vips_unpremultiply(in, out, NULL); -} - -int cast(VipsImage *in, VipsImage **out, int bandFormat) { - return vips_cast(in, out, bandFormat, NULL); -} - -double max_alpha(VipsImage *in) { - switch (in->BandFmt) { - case VIPS_FORMAT_USHORT: - return 65535; - case VIPS_FORMAT_FLOAT: - case VIPS_FORMAT_DOUBLE: - return 1.0; - default: - return 255; - } -} - -int composite_image(VipsImage **in, VipsImage **out, int n, int *mode, int *x, - int *y) { - VipsArrayInt *xs = vips_array_int_new(x, n - 1); - VipsArrayInt *ys = vips_array_int_new(y, n - 1); - - int code = vips_composite(in, out, n, mode, "x", xs, "y", ys, NULL); - - vips_area_unref(VIPS_AREA(xs)); - vips_area_unref(VIPS_AREA(ys)); - return code; -} - -int composite2_image(VipsImage *base, VipsImage *overlay, VipsImage **out, - int mode, gint x, gint y) { - return vips_composite2(base, overlay, out, mode, "x", x, "y", y, NULL); -} - -int insert_image(VipsImage *main, VipsImage *sub, VipsImage **out, int x, int y, int expand, double r, double g, double b, double a) { - if (is_16bit(main->Type)) { - r = 65535 * r / 255; - g = 65535 * g / 255; - b = 65535 * b / 255; - a = 65535 * a / 255; - } - - double background[3] = {r, g, b}; - double backgroundRGBA[4] = {r, g, b, a}; - - VipsArrayDouble *vipsBackground; - - // Ignore the alpha channel if the image doesn't have one - if (main->Bands <= 3) { - vipsBackground = vips_array_double_new(background, 3); - } else { - vipsBackground = vips_array_double_new(backgroundRGBA, 4); - } - int code = vips_insert(main, sub, out, x, y, "expand", expand, "background", vipsBackground, NULL); - - vips_area_unref(VIPS_AREA(vipsBackground)); - - return code; -} - -int join(VipsImage *in1, VipsImage *in2, VipsImage **out, int direction) { - return vips_join(in1, in2, out, direction, NULL); -} - -int arrayjoin(VipsImage **in, VipsImage **out, int n, int across) { - return vips_arrayjoin(in, out, n, "across", across, NULL); -} - -int replicate(VipsImage *in, VipsImage **out, int across, int down) { - return vips_replicate(in, out, across, down, NULL); -} - -int grid(VipsImage *in, VipsImage **out, int tileHeight, int across, int down){ - return vips_grid(in, out, tileHeight, across, down, NULL); -} - -int adjust_gamma(VipsImage *in, VipsImage **out, double g) { - return vips_gamma(in, out, "exponent", g, NULL); -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.go b/vendor/github.com/davidbyttow/govips/v2/vips/conversion.go deleted file mode 100644 index 0738727d9c..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.go +++ /dev/null @@ -1,520 +0,0 @@ -package vips - -// #cgo CFLAGS: -std=c99 -// #include "conversion.h" -import "C" - -// BandFormat represents VIPS_FORMAT type -type BandFormat int - -// BandFormat enum -const ( - BandFormatNotSet BandFormat = C.VIPS_FORMAT_NOTSET - BandFormatUchar BandFormat = C.VIPS_FORMAT_UCHAR - BandFormatChar BandFormat = C.VIPS_FORMAT_CHAR - BandFormatUshort BandFormat = C.VIPS_FORMAT_USHORT - BandFormatShort BandFormat = C.VIPS_FORMAT_SHORT - BandFormatUint BandFormat = C.VIPS_FORMAT_UINT - BandFormatInt BandFormat = C.VIPS_FORMAT_INT - BandFormatFloat BandFormat = C.VIPS_FORMAT_FLOAT - BandFormatComplex BandFormat = C.VIPS_FORMAT_COMPLEX - BandFormatDouble BandFormat = C.VIPS_FORMAT_DOUBLE - BandFormatDpComplex BandFormat = C.VIPS_FORMAT_DPCOMPLEX -) - -// BlendMode gives the various Porter-Duff and PDF blend modes. -// See https://libvips.github.io/libvips/API/current/libvips-conversion.html#VipsBlendMode -type BlendMode int - -// Constants define the various Porter-Duff and PDF blend modes. -// See https://libvips.github.io/libvips/API/current/libvips-conversion.html#VipsBlendMode -const ( - BlendModeClear BlendMode = C.VIPS_BLEND_MODE_CLEAR - BlendModeSource BlendMode = C.VIPS_BLEND_MODE_SOURCE - BlendModeOver BlendMode = C.VIPS_BLEND_MODE_OVER - BlendModeIn BlendMode = C.VIPS_BLEND_MODE_IN - BlendModeOut BlendMode = C.VIPS_BLEND_MODE_OUT - BlendModeAtop BlendMode = C.VIPS_BLEND_MODE_ATOP - BlendModeDest BlendMode = C.VIPS_BLEND_MODE_DEST - BlendModeDestOver BlendMode = C.VIPS_BLEND_MODE_DEST_OVER - BlendModeDestIn BlendMode = C.VIPS_BLEND_MODE_DEST_IN - BlendModeDestOut BlendMode = C.VIPS_BLEND_MODE_DEST_OUT - BlendModeDestAtop BlendMode = C.VIPS_BLEND_MODE_DEST_ATOP - BlendModeXOR BlendMode = C.VIPS_BLEND_MODE_XOR - BlendModeAdd BlendMode = C.VIPS_BLEND_MODE_ADD - BlendModeSaturate BlendMode = C.VIPS_BLEND_MODE_SATURATE - BlendModeMultiply BlendMode = C.VIPS_BLEND_MODE_MULTIPLY - BlendModeScreen BlendMode = C.VIPS_BLEND_MODE_SCREEN - BlendModeOverlay BlendMode = C.VIPS_BLEND_MODE_OVERLAY - BlendModeDarken BlendMode = C.VIPS_BLEND_MODE_DARKEN - BlendModeLighten BlendMode = C.VIPS_BLEND_MODE_LIGHTEN - BlendModeColorDodge BlendMode = C.VIPS_BLEND_MODE_COLOUR_DODGE - BlendModeColorBurn BlendMode = C.VIPS_BLEND_MODE_COLOUR_BURN - BlendModeHardLight BlendMode = C.VIPS_BLEND_MODE_HARD_LIGHT - BlendModeSoftLight BlendMode = C.VIPS_BLEND_MODE_SOFT_LIGHT - BlendModeDifference BlendMode = C.VIPS_BLEND_MODE_DIFFERENCE - BlendModeExclusion BlendMode = C.VIPS_BLEND_MODE_EXCLUSION -) - -// Direction represents VIPS_DIRECTION type -type Direction int - -// Direction enum -const ( - DirectionHorizontal Direction = C.VIPS_DIRECTION_HORIZONTAL - DirectionVertical Direction = C.VIPS_DIRECTION_VERTICAL -) - -// Angle represents VIPS_ANGLE type -type Angle int - -// Angle enum -const ( - Angle0 Angle = C.VIPS_ANGLE_D0 - Angle90 Angle = C.VIPS_ANGLE_D90 - Angle180 Angle = C.VIPS_ANGLE_D180 - Angle270 Angle = C.VIPS_ANGLE_D270 -) - -// Angle45 represents VIPS_ANGLE45 type -type Angle45 int - -// Angle45 enum -const ( - Angle45_0 Angle45 = C.VIPS_ANGLE45_D0 - Angle45_45 Angle45 = C.VIPS_ANGLE45_D45 - Angle45_90 Angle45 = C.VIPS_ANGLE45_D90 - Angle45_135 Angle45 = C.VIPS_ANGLE45_D135 - Angle45_180 Angle45 = C.VIPS_ANGLE45_D180 - Angle45_225 Angle45 = C.VIPS_ANGLE45_D225 - Angle45_270 Angle45 = C.VIPS_ANGLE45_D270 - Angle45_315 Angle45 = C.VIPS_ANGLE45_D315 -) - -// ExtendStrategy represents VIPS_EXTEND type -type ExtendStrategy int - -// ExtendStrategy enum -const ( - ExtendBlack ExtendStrategy = C.VIPS_EXTEND_BLACK - ExtendCopy ExtendStrategy = C.VIPS_EXTEND_COPY - ExtendRepeat ExtendStrategy = C.VIPS_EXTEND_REPEAT - ExtendMirror ExtendStrategy = C.VIPS_EXTEND_MIRROR - ExtendWhite ExtendStrategy = C.VIPS_EXTEND_WHITE - ExtendBackground ExtendStrategy = C.VIPS_EXTEND_BACKGROUND -) - -// Interesting represents VIPS_INTERESTING type -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#VipsInteresting -type Interesting int - -// Interesting constants represent areas of interest which smart cropping will crop based on. -const ( - InterestingNone Interesting = C.VIPS_INTERESTING_NONE - InterestingCentre Interesting = C.VIPS_INTERESTING_CENTRE - InterestingEntropy Interesting = C.VIPS_INTERESTING_ENTROPY - InterestingAttention Interesting = C.VIPS_INTERESTING_ATTENTION - InterestingLow Interesting = C.VIPS_INTERESTING_LOW - InterestingHigh Interesting = C.VIPS_INTERESTING_HIGH - InterestingAll Interesting = C.VIPS_INTERESTING_ALL - InterestingLast Interesting = C.VIPS_INTERESTING_LAST -) - -func vipsCopyImageChangingInterpretation(in *C.VipsImage, interpretation Interpretation) (*C.VipsImage, error) { - var out *C.VipsImage - - if err := C.copy_image_changing_interpretation(in, &out, C.VipsInterpretation(interpretation)); int(err) != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsCopyImageChangingResolution(in *C.VipsImage, xres float64, yres float64) (*C.VipsImage, error) { - var out *C.VipsImage - - if err := C.copy_image_changing_resolution(in, &out, C.double(xres), C.double(yres)); int(err) != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-copy -func vipsCopyImage(in *C.VipsImage) (*C.VipsImage, error) { - var out *C.VipsImage - - if err := C.copy_image(in, &out); int(err) != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-embed -func vipsEmbed(in *C.VipsImage, left, top, width, height int, extend ExtendStrategy) (*C.VipsImage, error) { - incOpCounter("embed") - var out *C.VipsImage - - if err := C.embed_image(in, &out, C.int(left), C.int(top), C.int(width), C.int(height), C.int(extend)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-embed -func vipsEmbedBackground(in *C.VipsImage, left, top, width, height int, backgroundColor *ColorRGBA) (*C.VipsImage, error) { - incOpCounter("embed") - var out *C.VipsImage - - if err := C.embed_image_background(in, &out, C.int(left), C.int(top), C.int(width), - C.int(height), C.double(backgroundColor.R), - C.double(backgroundColor.G), C.double(backgroundColor.B), C.double(backgroundColor.A)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsEmbedMultiPage(in *C.VipsImage, left, top, width, height int, extend ExtendStrategy) (*C.VipsImage, error) { - incOpCounter("embedMultiPage") - var out *C.VipsImage - - if err := C.embed_multi_page_image(in, &out, C.int(left), C.int(top), C.int(width), C.int(height), C.int(extend)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsEmbedMultiPageBackground(in *C.VipsImage, left, top, width, height int, backgroundColor *ColorRGBA) (*C.VipsImage, error) { - incOpCounter("embedMultiPageBackground") - var out *C.VipsImage - - if err := C.embed_multi_page_image_background(in, &out, C.int(left), C.int(top), C.int(width), - C.int(height), C.double(backgroundColor.R), - C.double(backgroundColor.G), C.double(backgroundColor.B), C.double(backgroundColor.A)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-flip -func vipsFlip(in *C.VipsImage, direction Direction) (*C.VipsImage, error) { - incOpCounter("flip") - var out *C.VipsImage - - if err := C.flip_image(in, &out, C.int(direction)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-recomb -func vipsRecomb(in *C.VipsImage, m *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("recomb") - var out *C.VipsImage - - if err := C.recomb_image(in, &out, m); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-extract-area -func vipsExtractArea(in *C.VipsImage, left, top, width, height int) (*C.VipsImage, error) { - incOpCounter("extractArea") - var out *C.VipsImage - - if err := C.extract_image_area(in, &out, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsExtractAreaMultiPage(in *C.VipsImage, left, top, width, height int) (*C.VipsImage, error) { - incOpCounter("extractAreaMultiPage") - var out *C.VipsImage - - if err := C.extract_area_multi_page(in, &out, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-extract-band -func vipsExtractBand(in *C.VipsImage, band, num int) (*C.VipsImage, error) { - incOpCounter("extractBand") - var out *C.VipsImage - - if err := C.extract_band(in, &out, C.int(band), C.int(num)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// http://libvips.github.io/libvips/API/current/libvips-resample.html#vips-similarity -func vipsSimilarity(in *C.VipsImage, scale float64, angle float64, color *ColorRGBA, - idx float64, idy float64, odx float64, ody float64) (*C.VipsImage, error) { - incOpCounter("similarity") - var out *C.VipsImage - - if err := C.similarity(in, &out, C.double(scale), C.double(angle), - C.double(color.R), C.double(color.G), C.double(color.B), C.double(color.A), - C.double(idx), C.double(idy), C.double(odx), C.double(ody)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// http://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-smartcrop -func vipsSmartCrop(in *C.VipsImage, width int, height int, interesting Interesting) (*C.VipsImage, error) { - incOpCounter("smartcrop") - var out *C.VipsImage - - if err := C.smartcrop(in, &out, C.int(width), C.int(height), C.int(interesting)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// http://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-crop -func vipsCrop(in *C.VipsImage, left int, top int, width int, height int) (*C.VipsImage, error) { - incOpCounter("crop") - var out *C.VipsImage - - if err := C.crop(in, &out, C.int(left), C.int(top), C.int(width), C.int(height)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-rot -func vipsRotate(in *C.VipsImage, angle Angle) (*C.VipsImage, error) { - incOpCounter("rot") - var out *C.VipsImage - - if err := C.rot_image(in, &out, C.VipsAngle(angle)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-autorot -func vipsAutoRotate(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("autorot") - var out *C.VipsImage - - if err := C.autorot_image(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-zoom -func vipsZoom(in *C.VipsImage, xFactor, yFactor int) (*C.VipsImage, error) { - incOpCounter("zoom") - var out *C.VipsImage - - if err := C.zoom_image(in, &out, C.int(xFactor), C.int(yFactor)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-bandjoin -func vipsBandJoin(ins []*C.VipsImage) (*C.VipsImage, error) { - incOpCounter("bandjoin") - var out *C.VipsImage - - if err := C.bandjoin(&ins[0], &out, C.int(len(ins))); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// http://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-bandjoin-const -func vipsBandJoinConst(in *C.VipsImage, constants []float64) (*C.VipsImage, error) { - incOpCounter("bandjoin_const") - var out *C.VipsImage - - if err := C.bandjoin_const(in, &out, (*C.double)(&constants[0]), C.int(len(constants))); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-flatten -func vipsFlatten(in *C.VipsImage, color *Color) (*C.VipsImage, error) { - incOpCounter("flatten") - var out *C.VipsImage - - err := C.flatten_image(in, &out, C.double(color.R), C.double(color.G), C.double(color.B)) - if int(err) != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsAddAlpha(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("addAlpha") - var out *C.VipsImage - - if err := C.add_alpha(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-premultiply -func vipsPremultiplyAlpha(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("premultiplyAlpha") - var out *C.VipsImage - - if err := C.premultiply_alpha(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-unpremultiply -func vipsUnpremultiplyAlpha(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("unpremultiplyAlpha") - var out *C.VipsImage - - if err := C.unpremultiply_alpha(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsCast(in *C.VipsImage, bandFormat BandFormat) (*C.VipsImage, error) { - incOpCounter("cast") - var out *C.VipsImage - - if err := C.cast(in, &out, C.int(bandFormat)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-composite -func vipsComposite(ins []*C.VipsImage, modes []C.int, xs, ys []C.int) (*C.VipsImage, error) { - incOpCounter("composite_multi") - var out *C.VipsImage - - if err := C.composite_image(&ins[0], &out, C.int(len(ins)), &modes[0], &xs[0], &ys[0]); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-composite2 -func vipsComposite2(base *C.VipsImage, overlay *C.VipsImage, mode BlendMode, x, y int) (*C.VipsImage, error) { - incOpCounter("composite") - var out *C.VipsImage - - if err := C.composite2_image(base, overlay, &out, C.int(mode), C.gint(x), C.gint(y)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsInsert(main *C.VipsImage, sub *C.VipsImage, x, y int, expand bool, background *ColorRGBA) (*C.VipsImage, error) { - incOpCounter("insert") - var out *C.VipsImage - - if background == nil { - background = &ColorRGBA{R: 0.0, G: 0.0, B: 0.0, A: 255.0} - } - - expandInt := 0 - if expand { - expandInt = 1 - } - - if err := C.insert_image(main, sub, &out, C.int(x), C.int(y), C.int(expandInt), C.double(background.R), C.double(background.G), C.double(background.B), C.double(background.A)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-join -func vipsJoin(input1 *C.VipsImage, input2 *C.VipsImage, dir Direction) (*C.VipsImage, error) { - incOpCounter("join") - var out *C.VipsImage - - defer C.g_object_unref(C.gpointer(input1)) - defer C.g_object_unref(C.gpointer(input2)) - if err := C.join(input1, input2, &out, C.int(dir)); err != 0 { - return nil, handleVipsError() - } - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-arrayjoin -func vipsArrayJoin(inputs []*C.VipsImage, across int) (*C.VipsImage, error) { - incOpCounter("arrayjoin") - var out *C.VipsImage - - if err := C.arrayjoin(&inputs[0], &out, C.int(len(inputs)), C.int(across)); err != 0 { - return nil, handleVipsError() - } - return out, nil -} - -// https://www.libvips.org/API/current/libvips-conversion.html#vips-replicate -func vipsReplicate(in *C.VipsImage, across int, down int) (*C.VipsImage, error) { - incOpCounter("replicate") - var out *C.VipsImage - - if err := C.replicate(in, &out, C.int(across), C.int(down)); err != 0 { - return nil, handleImageError(out) - } - return out, nil -} - -// https://www.libvips.org/API/current/libvips-conversion.html#vips-grid -func vipsGrid(in *C.VipsImage, tileHeight, across, down int) (*C.VipsImage, error) { - incOpCounter("grid") - var out *C.VipsImage - - if err := C.grid(in, &out, C.int(tileHeight), C.int(across), C.int(down)); err != 0 { - return nil, handleImageError(out) - } - return out, nil -} - -func vipsGamma(image *C.VipsImage, gamma float64) (*C.VipsImage, error) { - incOpCounter("gamma") - var out *C.VipsImage - - if err := C.adjust_gamma(image, &out, C.double(gamma)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.h b/vendor/github.com/davidbyttow/govips/v2/vips/conversion.h deleted file mode 100644 index ac92c5965c..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/conversion.h +++ /dev/null @@ -1,70 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-conversion.html - -#include -#include - -int copy_image_changing_interpretation(VipsImage *in, VipsImage **out, - VipsInterpretation interpretation); -int copy_image_changing_resolution(VipsImage *in, VipsImage **out, double xres, - double yres); -int copy_image(VipsImage *in, VipsImage **out); - -int embed_image(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, int extend); -int embed_image_background(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, double r, double g, double b, double a); -int embed_multi_page_image(VipsImage *in, VipsImage **out, int left, int top, int width, - int height, int extend); -int embed_multi_page_image_background(VipsImage *in, VipsImage **out, int left, int top, - int width, int height, double r, double g, double b, double a); - -int flip_image(VipsImage *in, VipsImage **out, int direction); - -int recomb_image(VipsImage *in, VipsImage **out, VipsImage *m); - -int extract_image_area(VipsImage *in, VipsImage **out, int left, int top, - int width, int height); -int extract_area_multi_page(VipsImage *in, VipsImage **out, int left, int top, - int width, int height); - -int extract_band(VipsImage *in, VipsImage **out, int band, int num); - -int rot_image(VipsImage *in, VipsImage **out, VipsAngle angle); -int autorot_image(VipsImage *in, VipsImage **out); - -int zoom_image(VipsImage *in, VipsImage **out, int xfac, int yfac); -int smartcrop(VipsImage *in, VipsImage **out, int width, int height, - int interesting); -int crop(VipsImage *in, VipsImage **out, int left, int top, - int width, int height); - -int bandjoin(VipsImage **in, VipsImage **out, int n); -int bandjoin_const(VipsImage *in, VipsImage **out, double constants[], int n); -int similarity(VipsImage *in, VipsImage **out, double scale, double angle, - double r, double g, double b, double a, double idx, double idy, - double odx, double ody); -int flatten_image(VipsImage *in, VipsImage **out, double r, double g, double b); -int add_alpha(VipsImage *in, VipsImage **out); -int premultiply_alpha(VipsImage *in, VipsImage **out); -int unpremultiply_alpha(VipsImage *in, VipsImage **out); -int cast(VipsImage *in, VipsImage **out, int bandFormat); -double max_alpha(VipsImage *in); - -int composite_image(VipsImage **in, VipsImage **out, int n, int *mode, int *x, - int *y); -int composite2_image(VipsImage *base, VipsImage *overlay, VipsImage **out, - int mode, gint x, gint y); - -int insert_image(VipsImage *main, VipsImage *sub, VipsImage **out, int x, int y, - int expand, double r, double g, double b, double a); - -int join(VipsImage *in1, VipsImage *in2, VipsImage **out, int direction); -int arrayjoin(VipsImage **in, VipsImage **out, int n, int across); - -int is_16bit(VipsInterpretation interpretation); - -int replicate(VipsImage *in, VipsImage **out, int across, int down); - -int grid(VipsImage *in, VipsImage **out, int tileHeight, int across, int down); - -int adjust_gamma(VipsImage *in, VipsImage **out, double g); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.c b/vendor/github.com/davidbyttow/govips/v2/vips/convolution.c deleted file mode 100644 index 48a9472bb7..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.c +++ /dev/null @@ -1,14 +0,0 @@ -#include "convolution.h" - -int gaussian_blur_image(VipsImage *in, VipsImage **out, double sigma, double min_ampl) { - return vips_gaussblur(in, out, sigma, "min_ampl", min_ampl, NULL); -} - -int sharpen_image(VipsImage *in, VipsImage **out, double sigma, double x1, - double m2) { - return vips_sharpen(in, out, "sigma", sigma, "x1", x1, "m2", m2, NULL); -} - -int sobel_image(VipsImage *in, VipsImage **out) { - return vips_sobel(in, out, NULL); -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.go b/vendor/github.com/davidbyttow/govips/v2/vips/convolution.go deleted file mode 100644 index 23622767fc..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.go +++ /dev/null @@ -1,40 +0,0 @@ -package vips - -// #include "convolution.h" -import "C" - -// https://libvips.github.io/libvips/API/current/libvips-convolution.html#vips-gaussblur -func vipsGaussianBlur(in *C.VipsImage, sigma, minAmpl float64) (*C.VipsImage, error) { - incOpCounter("gaussblur") - var out *C.VipsImage - - if err := C.gaussian_blur_image(in, &out, C.double(sigma), C.double(minAmpl)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-convolution.html#vips-sharpen -func vipsSharpen(in *C.VipsImage, sigma float64, x1 float64, m2 float64) (*C.VipsImage, error) { - incOpCounter("sharpen") - var out *C.VipsImage - - if err := C.sharpen_image(in, &out, C.double(sigma), C.double(x1), C.double(m2)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-convolution.html#vips-sobel -func vipsSobel(in *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("sobel") - var out *C.VipsImage - - if err := C.sobel_image(in, &out); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.h b/vendor/github.com/davidbyttow/govips/v2/vips/convolution.h deleted file mode 100644 index 30a525ee82..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/convolution.h +++ /dev/null @@ -1,9 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-convolution.html - -#include -#include - -int gaussian_blur_image(VipsImage *in, VipsImage **out, double sigma, double min_ampl); -int sharpen_image(VipsImage *in, VipsImage **out, double sigma, double x1, - double m2); -int sobel_image(VipsImage *in, VipsImage **out); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/create.c b/vendor/github.com/davidbyttow/govips/v2/vips/create.c deleted file mode 100644 index 1ffb7a34c1..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/create.c +++ /dev/null @@ -1,24 +0,0 @@ -// clang-format off -// include order matters -#include "lang.h" -#include "create.h" -// clang-format on - -// https://libvips.github.io/libvips/API/current/libvips-create.html#vips-xyz -int xyz(VipsImage **out, int width, int height) { - return vips_xyz(out, width, height, NULL); -} - -// http://libvips.github.io/libvips/API/current/libvips-create.html#vips-black -int black(VipsImage **out, int width, int height) { - return vips_black(out, width, height, NULL); -} - -// https://libvips.github.io/libvips/API/current/libvips-create.html#vips-identity -int identity(VipsImage **out, int ushort) { - if (ushort > 0) { - return vips_identity(out, "ushort", TRUE, NULL); - } else { - return vips_identity(out, NULL); - } -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/create.go b/vendor/github.com/davidbyttow/govips/v2/vips/create.go deleted file mode 100644 index 3532cf535e..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/create.go +++ /dev/null @@ -1,37 +0,0 @@ -package vips - -// #include "create.h" -import "C" - -// https://libvips.github.io/libvips/API/current/libvips-create.html#vips-xyz -func vipsXYZ(width int, height int) (*C.VipsImage, error) { - var out *C.VipsImage - - if err := C.xyz(&out, C.int(width), C.int(height)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// http://libvips.github.io/libvips/API/current/libvips-create.html#vips-black -func vipsBlack(width int, height int) (*C.VipsImage, error) { - var out *C.VipsImage - - if err := C.black(&out, C.int(width), C.int(height)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-create.html#vips-identity -func vipsIdentity(ushort bool) (*C.VipsImage, error) { - var out *C.VipsImage - ushortInt := C.int(boolToInt(ushort)) - if err := C.identity(&out, ushortInt); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/create.h b/vendor/github.com/davidbyttow/govips/v2/vips/create.h deleted file mode 100644 index 245d11fbaf..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/create.h +++ /dev/null @@ -1,12 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-create.html - -// clang-format off -// include order matters -#include -#include -#include -// clang-format on - -int xyz(VipsImage **out, int width, int height); -int black(VipsImage **out, int width, int height); -int identity(VipsImage **out, int ushort); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/draw.c b/vendor/github.com/davidbyttow/govips/v2/vips/draw.c deleted file mode 100644 index 024e18c1c0..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/draw.c +++ /dev/null @@ -1,24 +0,0 @@ -#include "draw.h" - -#include "conversion.h" - -int draw_rect(VipsImage *in, double r, double g, double b, double a, int left, - int top, int width, int height, int fill) { - if (is_16bit(in->Type)) { - r = 65535 * r / 255; - g = 65535 * g / 255; - b = 65535 * b / 255; - a = 65535 * a / 255; - } - - double background[3] = {r, g, b}; - double backgroundRGBA[4] = {r, g, b, a}; - - if (in->Bands <= 3) { - return vips_draw_rect(in, background, 3, left, top, width, height, "fill", - fill, NULL); - } else { - return vips_draw_rect(in, backgroundRGBA, 4, left, top, width, height, - "fill", fill, NULL); - } -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/draw.go b/vendor/github.com/davidbyttow/govips/v2/vips/draw.go deleted file mode 100644 index d2ab2ad9ee..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/draw.go +++ /dev/null @@ -1,21 +0,0 @@ -package vips - -// #include "draw.h" -import "C" - -// https://libvips.github.io/libvips/API/current/libvips-draw.html#vips-draw-rect -func vipsDrawRect(in *C.VipsImage, color ColorRGBA, left int, top int, width int, height int, fill bool) error { - incOpCounter("draw_rect") - - fillBit := 0 - if fill { - fillBit = 1 - } - - if err := C.draw_rect(in, C.double(color.R), C.double(color.G), C.double(color.B), C.double(color.A), - C.int(left), C.int(top), C.int(width), C.int(height), C.int(fillBit)); err != 0 { - return handleImageError(in) - } - - return nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/draw.h b/vendor/github.com/davidbyttow/govips/v2/vips/draw.h deleted file mode 100644 index a1c5b6f964..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/draw.h +++ /dev/null @@ -1,7 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-draw.html - -#include -#include - -int draw_rect(VipsImage *in, double r, double g, double b, double a, int left, - int top, int width, int height, int fill); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/error.go b/vendor/github.com/davidbyttow/govips/v2/vips/error.go deleted file mode 100644 index 08eb41e78f..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/error.go +++ /dev/null @@ -1,39 +0,0 @@ -package vips - -// #include -import "C" - -import ( - "errors" - "fmt" - dbg "runtime/debug" - "unsafe" -) - -var ( - // ErrUnsupportedImageFormat when image type is unsupported - ErrUnsupportedImageFormat = errors.New("unsupported image format") -) - -func handleImageError(out *C.VipsImage) error { - if out != nil { - clearImage(out) - } - - return handleVipsError() -} - -func handleSaveBufferError(out unsafe.Pointer) error { - if out != nil { - gFreePointer(out) - } - - return handleVipsError() -} - -func handleVipsError() error { - s := C.GoString(C.vips_error_buffer()) - C.vips_error_clear() - - return fmt.Errorf("%v\nStack:\n%s", s, dbg.Stack()) -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/foreign.c b/vendor/github.com/davidbyttow/govips/v2/vips/foreign.c deleted file mode 100644 index 10b6b883af..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/foreign.c +++ /dev/null @@ -1,578 +0,0 @@ -#include "foreign.h" - -#include "lang.h" - -void set_bool_param(Param *p, gboolean b) { - p->type = PARAM_TYPE_BOOL; - p->value.b = b; - p->is_set = TRUE; -} - -void set_int_param(Param *p, gint i) { - p->type = PARAM_TYPE_INT; - p->value.i = i; - p->is_set = TRUE; -} - -void set_double_param(Param *p, gdouble d) { - p->type = PARAM_TYPE_DOUBLE; - p->value.d = d; - p->is_set = TRUE; -} - -int load_image_buffer(LoadParams *params, void *buf, size_t len, - VipsImage **out) { - int code = 1; - ImageType imageType = params->inputFormat; - - if (imageType == JPEG) { - // shrink: int, fail: bool, autorotate: bool - code = vips_jpegload_buffer(buf, len, out, "fail", params->fail, - "autorotate", params->autorotate, "shrink", - params->jpegShrink, NULL); - } else if (imageType == PNG) { - code = vips_pngload_buffer(buf, len, out, NULL); - } else if (imageType == WEBP) { - // page: int, n: int, scale: double - code = vips_webpload_buffer(buf, len, out, "page", params->page, "n", - params->n, NULL); - } else if (imageType == TIFF) { - // page: int, n: int, autorotate: bool, subifd: int - code = - vips_tiffload_buffer(buf, len, out, "page", params->page, "n", - params->n, "autorotate", params->autorotate, NULL); - } else if (imageType == GIF) { - // page: int, n: int, scale: double - code = vips_gifload_buffer(buf, len, out, "page", params->page, "n", - params->n, NULL); - } else if (imageType == PDF) { - // page: int, n: int, dpi: double, scale: double, background: color - code = vips_pdfload_buffer(buf, len, out, "page", params->page, "n", - params->n, "dpi", params->dpi, NULL); - } else if (imageType == SVG) { - // dpi: double, scale: double, unlimited: bool - code = vips_svgload_buffer(buf, len, out, "dpi", params->dpi, "unlimited", - params->svgUnlimited, NULL); - } else if (imageType == HEIF) { - // added autorotate on load as currently it addresses orientation issues - // https://github.com/libvips/libvips/pull/1680 - // page: int, n: int, thumbnail: bool - code = vips_heifload_buffer(buf, len, out, "page", params->page, "n", - params->n, "thumbnail", params->heifThumbnail, - "autorotate", TRUE, NULL); - } else if (imageType == MAGICK) { - // page: int, n: int, density: string - code = vips_magickload_buffer(buf, len, out, "page", params->page, "n", - params->n, NULL); - } else if (imageType == AVIF) { - code = vips_heifload_buffer(buf, len, out, "page", params->page, "n", - params->n, "thumbnail", params->heifThumbnail, - "autorotate", params->autorotate, NULL); - - } - #if (VIPS_MAJOR_VERSION >= 8) && (VIPS_MINOR_VERSION >= 11) - else if (imageType == JP2K) { - code = vips_jp2kload_buffer(buf, len, out, "page", params->page, NULL); - } - #endif - - return code; -} - -#define MAYBE_SET_BOOL(OP, PARAM, NAME) \ - if (PARAM.is_set) { \ - vips_object_set(VIPS_OBJECT(OP), NAME, PARAM.value.b, NULL); \ - } - -#define MAYBE_SET_INT(OP, PARAM, NAME) \ - if (PARAM.is_set) { \ - vips_object_set(VIPS_OBJECT(OP), NAME, PARAM.value.i, NULL); \ - } - -#define MAYBE_SET_DOUBLE(OP, PARAM, NAME) \ - if (PARAM.is_set) { \ - vips_object_set(VIPS_OBJECT(OP), NAME, PARAM.value.d, NULL); \ - } - -typedef int (*SetLoadOptionsFn)(VipsOperation *operation, LoadParams *params); - -int set_jpegload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_BOOL(operation, params->autorotate, "autorotate"); - MAYBE_SET_BOOL(operation, params->fail, "fail"); - MAYBE_SET_INT(operation, params->jpegShrink, "shrink"); - return 0; -} - -int set_pngload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_BOOL(operation, params->fail, "fail"); - return 0; -} - -int set_webpload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - return 0; -} - -int set_tiffload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_BOOL(operation, params->autorotate, "autorotate"); - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - return 0; -} - -int set_gifload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - return 0; -} - -int set_pdfload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - MAYBE_SET_DOUBLE(operation, params->dpi, "dpi"); - return 0; -} - -int set_svgload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_BOOL(operation, params->svgUnlimited, "unlimited"); - MAYBE_SET_DOUBLE(operation, params->dpi, "dpi"); - return 0; -} - -int set_heifload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_BOOL(operation, params->autorotate, "autorotate"); - MAYBE_SET_BOOL(operation, params->heifThumbnail, "thumbnail"); - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - return 0; -} - -int set_jp2kload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_INT(operation, params->page, "page"); - return 0; -} - -int set_jxlload_options(VipsOperation *operation, LoadParams *params) { - // nothing need to do - return 0; -} - -int set_magickload_options(VipsOperation *operation, LoadParams *params) { - MAYBE_SET_INT(operation, params->page, "page"); - MAYBE_SET_INT(operation, params->n, "n"); - return 0; -} - -int load_buffer(const char *operationName, void *buf, size_t len, - LoadParams *params, SetLoadOptionsFn setLoadOptions) { - VipsBlob *blob = vips_blob_new(NULL, buf, len); - - VipsOperation *operation = vips_operation_new(operationName); - if (!operation) { - return 1; - } - - if (vips_object_set(VIPS_OBJECT(operation), "buffer", blob, NULL)) { - vips_area_unref(VIPS_AREA(blob)); - return 1; - } - - vips_area_unref(VIPS_AREA(blob)); - - if (setLoadOptions(operation, params)) { - vips_object_unref_outputs(VIPS_OBJECT(operation)); - g_object_unref(operation); - return 1; - } - - if (vips_cache_operation_buildp(&operation)) { - vips_object_unref_outputs(VIPS_OBJECT(operation)); - g_object_unref(operation); - return 1; - } - - g_object_get(VIPS_OBJECT(operation), "out", ¶ms->outputImage, NULL); - - vips_object_unref_outputs(VIPS_OBJECT(operation)); - g_object_unref(operation); - - return 0; -} - -typedef int (*SetSaveOptionsFn)(VipsOperation *operation, SaveParams *params); - -int save_buffer(const char *operationName, SaveParams *params, - SetSaveOptionsFn setSaveOptions) { - VipsBlob *blob; - VipsOperation *operation = vips_operation_new(operationName); - if (!operation) { - return 1; - } - - if (vips_object_set(VIPS_OBJECT(operation), "in", params->inputImage, NULL)) { - return 1; - } - - if (setSaveOptions(operation, params)) { - g_object_unref(operation); - return 1; - } - - if (vips_cache_operation_buildp(&operation)) { - vips_object_unref_outputs(VIPS_OBJECT(operation)); - g_object_unref(operation); - return 1; - } - - g_object_get(VIPS_OBJECT(operation), "buffer", &blob, NULL); - g_object_unref(operation); - - VipsArea *area = VIPS_AREA(blob); - - params->outputBuffer = (char *)(area->data); - params->outputLen = area->length; - area->free_fn = NULL; - vips_area_unref(area); - - return 0; -} - -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-jpegsave-buffer -int set_jpegsave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set( - VIPS_OBJECT(operation), "strip", params->stripMetadata, "optimize_coding", - params->jpegOptimizeCoding, "interlace", params->interlace, - "subsample_mode", params->jpegSubsample, "trellis_quant", - params->jpegTrellisQuant, "overshoot_deringing", - params->jpegOvershootDeringing, "optimize_scans", - params->jpegOptimizeScans, "quant_table", params->jpegQuantTable, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-pngsave-buffer -int set_pngsave_options(VipsOperation *operation, SaveParams *params) { - int ret = - vips_object_set(VIPS_OBJECT(operation), "strip", params->stripMetadata, - "compression", params->pngCompression, "interlace", - params->interlace, "filter", params->pngFilter, "palette", - params->pngPalette, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - if (!ret && params->pngDither) { - ret = vips_object_set(VIPS_OBJECT(operation), "dither", params->pngDither, NULL); - } - - if (!ret && params->pngBitdepth) { - ret = vips_object_set(VIPS_OBJECT(operation), "bitdepth", params->pngBitdepth, NULL); - } - - // TODO: Handle `profile` param. - - return ret; -} - -// https://github.com/libvips/libvips/blob/master/libvips/foreign/webpsave.c#L524 -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-webpsave-buffer -int set_webpsave_options(VipsOperation *operation, SaveParams *params) { - int ret = - vips_object_set(VIPS_OBJECT(operation), - "strip", params->stripMetadata, - "lossless", params->webpLossless, - "near_lossless", params->webpNearLossless, - "reduction_effort", params->webpReductionEffort, - "profile", params->webpIccProfile ? params->webpIccProfile : "none", - "min_size", params->webpMinSize, - "kmin", params->webpKMin, - "kmax", params->webpKMax, - NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-tiffsave-buffer -int set_tiffsave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set( - VIPS_OBJECT(operation), "strip", params->stripMetadata, "compression", - params->tiffCompression, "predictor", params->tiffPredictor, "pyramid", - params->tiffPyramid, "tile_height", params->tiffTileHeight, "tile_width", - params->tiffTileWidth, "tile", params->tiffTile, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-magicksave-buffer -int set_magicksave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set(VIPS_OBJECT(operation), "format", "GIF", "bitdepth", params->gifBitdepth, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "quality", params->quality, - NULL); - } - return ret; -} - -// https://libvips.github.io/libvips/API/current/VipsForeignSave.html#vips-gifsave-buffer -int set_gifsave_options(VipsOperation *operation, SaveParams *params) { - int ret = 0; - // See for argument values: https://www.libvips.org/API/current/VipsForeignSave.html#vips-gifsave - if (params->gifDither > 0.0 && params->gifDither <= 10) { - ret = vips_object_set(VIPS_OBJECT(operation), "dither", params->gifDither, NULL); - } - if (params->gifEffort >= 1 && params->gifEffort <= 10) { - ret = vips_object_set(VIPS_OBJECT(operation), "effort", params->gifEffort, NULL); - } - if (params->gifBitdepth >= 1 && params->gifBitdepth <= 8) { - ret = vips_object_set(VIPS_OBJECT(operation), "bitdepth", params->gifBitdepth, NULL); - } - return ret; -} - -// https://github.com/libvips/libvips/blob/master/libvips/foreign/heifsave.c#L653 -int set_heifsave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set(VIPS_OBJECT(operation), "lossless", - params->heifLossless, NULL); - -#if (VIPS_MAJOR_VERSION >= 8) && (VIPS_MINOR_VERSION >= 13) - if (!ret && params->heifBitdepth && params->heifEffort) { - ret = vips_object_set(VIPS_OBJECT(operation), "bitdepth", - params->heifBitdepth, "effort", params->heifEffort, - NULL); - } -#else - if (!ret && params->heifEffort) { - ret = vips_object_set(VIPS_OBJECT(operation), "speed", params->heifEffort, - NULL); - } -#endif - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -// https://github.com/libvips/libvips/blob/master/libvips/foreign/heifsave.c#L653 -int set_avifsave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set(VIPS_OBJECT(operation), "strip", params->stripMetadata, "compression", - VIPS_FOREIGN_HEIF_COMPRESSION_AV1, "lossless", - params->heifLossless, NULL); - -#if (VIPS_MAJOR_VERSION >= 8) && (VIPS_MINOR_VERSION >= 13) - if (!ret && params->heifBitdepth && params->heifEffort) { - ret = vips_object_set(VIPS_OBJECT(operation), "bitdepth", - params->heifBitdepth, "effort", params->heifEffort, - NULL); - } -#else - if (!ret && params->heifEffort) { - ret = vips_object_set(VIPS_OBJECT(operation), "speed", params->heifEffort, - NULL); - } -#endif - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -int set_jp2ksave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set( - VIPS_OBJECT(operation), "subsample_mode", params->jpegSubsample, - "tile_height", params->jp2kTileHeight, "tile_width", params->jp2kTileWidth, - "lossless", params->jp2kLossless, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -int set_jxlsave_options(VipsOperation *operation, SaveParams *params) { - int ret = vips_object_set( - VIPS_OBJECT(operation), "tier", params->jxlTier, - "distance", params->jxlDistance, "effort", params->jxlEffort, - "lossless", params->jxlLossless, NULL); - - if (!ret && params->quality) { - ret = vips_object_set(VIPS_OBJECT(operation), "Q", params->quality, NULL); - } - - return ret; -} - -int load_from_buffer(LoadParams *params, void *buf, size_t len) { - switch (params->inputFormat) { - case JPEG: - return load_buffer("jpegload_buffer", buf, len, params, - set_jpegload_options); - case PNG: - return load_buffer("pngload_buffer", buf, len, params, - set_pngload_options); - case WEBP: - return load_buffer("webpload_buffer", buf, len, params, - set_webpload_options); - case HEIF: - return load_buffer("heifload_buffer", buf, len, params, - set_heifload_options); - case TIFF: - return load_buffer("tiffload_buffer", buf, len, params, - set_tiffload_options); - case SVG: - return load_buffer("svgload_buffer", buf, len, params, - set_svgload_options); - case GIF: - return load_buffer("gifload_buffer", buf, len, params, - set_gifload_options); - case PDF: - return load_buffer("pdfload_buffer", buf, len, params, - set_pdfload_options); - case MAGICK: - return load_buffer("magickload_buffer", buf, len, params, - set_magickload_options); - case AVIF: - return load_buffer("heifload_buffer", buf, len, params, - set_heifload_options); - case JP2K: - return load_buffer("jp2kload_buffer", buf, len, params, - set_jp2kload_options); - case JXL: - return load_buffer("jxlload_buffer", buf, len, params, - set_jxlload_options); - default: - g_warning("Unsupported input type given: %d", params->inputFormat); - } - return 1; -} - -int save_to_buffer(SaveParams *params) { - switch (params->outputFormat) { - case JPEG: - return save_buffer("jpegsave_buffer", params, set_jpegsave_options); - case PNG: - return save_buffer("pngsave_buffer", params, set_pngsave_options); - case WEBP: - return save_buffer("webpsave_buffer", params, set_webpsave_options); - case HEIF: - return save_buffer("heifsave_buffer", params, set_heifsave_options); - case TIFF: - return save_buffer("tiffsave_buffer", params, set_tiffsave_options); - case GIF: -#if (VIPS_MAJOR_VERSION >= 8) && (VIPS_MINOR_VERSION >= 12) - return save_buffer("gifsave_buffer", params, set_gifsave_options); -#else - return save_buffer("magicksave_buffer", params, set_magicksave_options); -#endif - case AVIF: - return save_buffer("heifsave_buffer", params, set_avifsave_options); - case JP2K: - return save_buffer("jp2ksave_buffer", params, set_jp2ksave_options); - case JXL: - return save_buffer("jxlsave_buffer", params, set_jxlsave_options); - default: - g_warning("Unsupported output type given: %d", params->outputFormat); - } - return 1; -} - -LoadParams create_load_params(ImageType inputFormat) { - Param defaultParam = {}; - LoadParams p = { - .inputFormat = inputFormat, - .inputBlob = NULL, - .outputImage = NULL, - .autorotate = defaultParam, - .fail = defaultParam, - .page = defaultParam, - .n = defaultParam, - .dpi = defaultParam, - .jpegShrink = defaultParam, - .heifThumbnail = defaultParam, - .svgUnlimited = defaultParam, - }; - return p; -} - -// TODO: Change to same pattern as ImportParams - -static SaveParams defaultSaveParams = { - .inputImage = NULL, - .outputBuffer = NULL, - .outputFormat = JPEG, - .outputLen = 0, - - .interlace = FALSE, - .quality = 0, - .stripMetadata = FALSE, - - .jpegOptimizeCoding = FALSE, - .jpegSubsample = VIPS_FOREIGN_SUBSAMPLE_ON, - .jpegTrellisQuant = FALSE, - .jpegOvershootDeringing = FALSE, - .jpegOptimizeScans = FALSE, - .jpegQuantTable = 0, - - .pngCompression = 6, - .pngPalette = FALSE, - .pngBitdepth = 0, - .pngDither = 0, - .pngFilter = VIPS_FOREIGN_PNG_FILTER_NONE, - - .gifDither = 0.0, - .gifEffort = 0, - .gifBitdepth = 0, - - .webpLossless = FALSE, - .webpNearLossless = FALSE, - .webpReductionEffort = 4, - .webpIccProfile = NULL, - .webpKMax = 0, - .webpKMin = 0, - .webpMinSize = FALSE, - - .heifBitdepth = 8, - .heifLossless = FALSE, - .heifEffort = 5, - - .tiffCompression = VIPS_FOREIGN_TIFF_COMPRESSION_LZW, - .tiffPredictor = VIPS_FOREIGN_TIFF_PREDICTOR_HORIZONTAL, - .tiffPyramid = FALSE, - .tiffTile = FALSE, - .tiffTileHeight = 256, - .tiffTileWidth = 256, - - .jp2kLossless = FALSE, - .jp2kTileHeight = 512, - .jp2kTileWidth = 512, - - .jxlTier = 0, - .jxlDistance = 1.0, - .jxlEffort = 7, - .jxlLossless = FALSE, - }; - -SaveParams create_save_params(ImageType outputFormat) { - SaveParams params = defaultSaveParams; - params.outputFormat = outputFormat; - return params; -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/foreign.go b/vendor/github.com/davidbyttow/govips/v2/vips/foreign.go deleted file mode 100644 index cfa4ddddeb..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/foreign.go +++ /dev/null @@ -1,512 +0,0 @@ -package vips - -// #include "foreign.h" -import "C" -import ( - "bytes" - "encoding/xml" - "fmt" - "golang.org/x/image/bmp" - "golang.org/x/net/html/charset" - "image/png" - "math" - "runtime" - "unsafe" -) - -// SubsampleMode correlates to a libvips subsample mode -type SubsampleMode int - -// SubsampleMode enum correlating to libvips subsample modes -const ( - VipsForeignSubsampleAuto SubsampleMode = C.VIPS_FOREIGN_SUBSAMPLE_AUTO - VipsForeignSubsampleOn SubsampleMode = C.VIPS_FOREIGN_SUBSAMPLE_ON - VipsForeignSubsampleOff SubsampleMode = C.VIPS_FOREIGN_SUBSAMPLE_OFF - VipsForeignSubsampleLast SubsampleMode = C.VIPS_FOREIGN_SUBSAMPLE_LAST -) - -// ImageType represents an image type -type ImageType int - -// ImageType enum -const ( - ImageTypeUnknown ImageType = C.UNKNOWN - ImageTypeGIF ImageType = C.GIF - ImageTypeJPEG ImageType = C.JPEG - ImageTypeMagick ImageType = C.MAGICK - ImageTypePDF ImageType = C.PDF - ImageTypePNG ImageType = C.PNG - ImageTypeSVG ImageType = C.SVG - ImageTypeTIFF ImageType = C.TIFF - ImageTypeWEBP ImageType = C.WEBP - ImageTypeHEIF ImageType = C.HEIF - ImageTypeBMP ImageType = C.BMP - ImageTypeAVIF ImageType = C.AVIF - ImageTypeJP2K ImageType = C.JP2K - ImageTypeJXL ImageType = C.JXL -) - -var imageTypeExtensionMap = map[ImageType]string{ - ImageTypeGIF: ".gif", - ImageTypeJPEG: ".jpeg", - ImageTypeMagick: ".magick", - ImageTypePDF: ".pdf", - ImageTypePNG: ".png", - ImageTypeSVG: ".svg", - ImageTypeTIFF: ".tiff", - ImageTypeWEBP: ".webp", - ImageTypeHEIF: ".heic", - ImageTypeBMP: ".bmp", - ImageTypeAVIF: ".avif", - ImageTypeJP2K: ".jp2", - ImageTypeJXL: ".jxl", -} - -// ImageTypes defines the various image types supported by govips -var ImageTypes = map[ImageType]string{ - ImageTypeGIF: "gif", - ImageTypeJPEG: "jpeg", - ImageTypeMagick: "magick", - ImageTypePDF: "pdf", - ImageTypePNG: "png", - ImageTypeSVG: "svg", - ImageTypeTIFF: "tiff", - ImageTypeWEBP: "webp", - ImageTypeHEIF: "heif", - ImageTypeBMP: "bmp", - ImageTypeAVIF: "heif", - ImageTypeJP2K: "jp2k", - ImageTypeJXL: "jxl", -} - -// TiffCompression represents method for compressing a tiff at export -type TiffCompression int - -// TiffCompression enum -const ( - TiffCompressionNone TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_NONE - TiffCompressionJpeg TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_JPEG - TiffCompressionDeflate TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_DEFLATE - TiffCompressionPackbits TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_PACKBITS - TiffCompressionFax4 TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_CCITTFAX4 - TiffCompressionLzw TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_LZW - TiffCompressionWebp TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_WEBP - TiffCompressionZstd TiffCompression = C.VIPS_FOREIGN_TIFF_COMPRESSION_ZSTD -) - -// TiffPredictor represents method for compressing a tiff at export -type TiffPredictor int - -// TiffPredictor enum -const ( - TiffPredictorNone TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_NONE - TiffPredictorHorizontal TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_HORIZONTAL - TiffPredictorFloat TiffPredictor = C.VIPS_FOREIGN_TIFF_PREDICTOR_FLOAT -) - -// PngFilter represents filter algorithms that can be applied before compression. -// See https://www.w3.org/TR/PNG-Filters.html -type PngFilter int - -// PngFilter enum -const ( - PngFilterNone PngFilter = C.VIPS_FOREIGN_PNG_FILTER_NONE - PngFilterSub PngFilter = C.VIPS_FOREIGN_PNG_FILTER_SUB - PngFilterUo PngFilter = C.VIPS_FOREIGN_PNG_FILTER_UP - PngFilterAvg PngFilter = C.VIPS_FOREIGN_PNG_FILTER_AVG - PngFilterPaeth PngFilter = C.VIPS_FOREIGN_PNG_FILTER_PAETH - PngFilterAll PngFilter = C.VIPS_FOREIGN_PNG_FILTER_ALL -) - -// FileExt returns the canonical extension for the ImageType -func (i ImageType) FileExt() string { - if ext, ok := imageTypeExtensionMap[i]; ok { - return ext - } - return "" -} - -// IsTypeSupported checks whether given image type is supported by govips -func IsTypeSupported(imageType ImageType) bool { - startupIfNeeded() - - return supportedImageTypes[imageType] -} - -// DetermineImageType attempts to determine the image type of the given buffer -func DetermineImageType(buf []byte) ImageType { - if len(buf) < 12 { - return ImageTypeUnknown - } else if isJPEG(buf) { - return ImageTypeJPEG - } else if isPNG(buf) { - return ImageTypePNG - } else if isGIF(buf) { - return ImageTypeGIF - } else if isTIFF(buf) { - return ImageTypeTIFF - } else if isWEBP(buf) { - return ImageTypeWEBP - } else if isAVIF(buf) { - return ImageTypeAVIF - } else if isHEIF(buf) { - return ImageTypeHEIF - } else if isSVG(buf) { - return ImageTypeSVG - } else if isBMP(buf) { - return ImageTypeBMP - } else if isJP2K(buf) { - return ImageTypeJP2K - } else if isJXL(buf) { - return ImageTypeJXL - } else if isPDF(buf) { - return ImageTypePDF - } else { - return ImageTypeUnknown - } -} - -var jpeg = []byte("\xFF\xD8\xFF") - -func isJPEG(buf []byte) bool { - return bytes.HasPrefix(buf, jpeg) -} - -var gifHeader = []byte("\x47\x49\x46") - -func isGIF(buf []byte) bool { - return bytes.HasPrefix(buf, gifHeader) -} - -var pngHeader = []byte("\x89\x50\x4E\x47") - -func isPNG(buf []byte) bool { - return bytes.HasPrefix(buf, pngHeader) -} - -var tifII = []byte("\x49\x49\x2A\x00") -var tifMM = []byte("\x4D\x4D\x00\x2A") - -func isTIFF(buf []byte) bool { - return bytes.HasPrefix(buf, tifII) || bytes.HasPrefix(buf, tifMM) -} - -var webpHeader = []byte("\x57\x45\x42\x50") - -func isWEBP(buf []byte) bool { - return bytes.Equal(buf[8:12], webpHeader) -} - -// https://github.com/strukturag/libheif/blob/master/libheif/heif.cc -var ftyp = []byte("ftyp") -var heic = []byte("heic") -var mif1 = []byte("mif1") -var msf1 = []byte("msf1") -var avif = []byte("avif") - -func isHEIF(buf []byte) bool { - return bytes.Equal(buf[4:8], ftyp) && (bytes.Equal(buf[8:12], heic) || - bytes.Equal(buf[8:12], mif1) || - bytes.Equal(buf[8:12], msf1)) || - isAVIF(buf) -} - -func isAVIF(buf []byte) bool { - return bytes.Equal(buf[4:8], ftyp) && bytes.Equal(buf[8:12], avif) -} - -var svg = []byte(" - -#include -#include -// clang-format n - -#ifndef BOOL -#define BOOL int -#endif - -typedef enum types { - UNKNOWN = 0, - JPEG, - WEBP, - PNG, - TIFF, - GIF, - PDF, - SVG, - MAGICK, - HEIF, - BMP, - AVIF, - JP2K, - JXL -} ImageType; - -typedef enum ParamType { - PARAM_TYPE_NULL, - PARAM_TYPE_BOOL, - PARAM_TYPE_INT, - PARAM_TYPE_DOUBLE, -} ParamType; - -typedef struct Param { - ParamType type; - - union Value { - gboolean b; - gint i; - gdouble d; - } value; - - gboolean is_set; - -} Param; - -void set_bool_param(Param *p, gboolean b); -void set_int_param(Param *p, gint i); -void set_double_param(Param *p, gdouble d); - -typedef struct LoadParams { - ImageType inputFormat; - VipsBlob *inputBlob; - VipsImage *outputImage; - - Param autorotate; - Param fail; - Param page; - Param n; - Param dpi; - Param jpegShrink; - Param heifThumbnail; - Param svgUnlimited; - -} LoadParams; - -LoadParams create_load_params(ImageType inputFormat); -int load_from_buffer(LoadParams *params, void *buf, size_t len); - -typedef struct SaveParams { - VipsImage *inputImage; - void *outputBuffer; - ImageType outputFormat; - size_t outputLen; - - BOOL stripMetadata; - int quality; - BOOL interlace; - - // JPEG - BOOL jpegOptimizeCoding; - VipsForeignSubsample jpegSubsample; - BOOL jpegTrellisQuant; - BOOL jpegOvershootDeringing; - BOOL jpegOptimizeScans; - int jpegQuantTable; - - // PNG - int pngCompression; - VipsForeignPngFilter pngFilter; - BOOL pngPalette; - double pngDither; - int pngBitdepth; - - // GIF (with CGIF) - double gifDither; - int gifEffort; - int gifBitdepth; - - // WEBP - BOOL webpLossless; - BOOL webpNearLossless; - int webpReductionEffort; - char *webpIccProfile; - BOOL webpMinSize; - int webpKMin; - int webpKMax; - - // HEIF - https://github.com/libvips/libvips/blob/master/libvips/foreign/heifsave.c#L71 - int heifBitdepth; // Bitdepth to save at for >8 bit images - BOOL heifLossless; // Lossless compression - int heifEffort; // CPU effort (0 - 9) - - // TIFF - VipsForeignTiffCompression tiffCompression; - VipsForeignTiffPredictor tiffPredictor; - BOOL tiffPyramid; - BOOL tiffTile; - int tiffTileHeight; - int tiffTileWidth; - - // JPEG2000 - BOOL jp2kLossless; - int jp2kTileWidth; - int jp2kTileHeight; - - // JXL - int jxlTier; - double jxlDistance; - int jxlEffort; - BOOL jxlLossless; -} SaveParams; - -SaveParams create_save_params(ImageType outputFormat); -int save_to_buffer(SaveParams *params); - diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/govips.c b/vendor/github.com/davidbyttow/govips/v2/vips/govips.c deleted file mode 100644 index 0b220b9ece..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/govips.c +++ /dev/null @@ -1,27 +0,0 @@ -#include "govips.h" - -static void govips_logging_handler(const gchar *log_domain, - GLogLevelFlags log_level, - const gchar *message, gpointer user_data) { - govipsLoggingHandler((char *)log_domain, (int)log_level, (char *)message); -} - -static void null_logging_handler(const gchar *log_domain, - GLogLevelFlags log_level, const gchar *message, - gpointer user_data) {} - -void vips_set_logging_handler(void) { - g_log_set_default_handler(govips_logging_handler, NULL); -} - -void vips_unset_logging_handler(void) { - g_log_set_default_handler(null_logging_handler, NULL); -} - -/* This function skips the Govips logging handler and logs - directly to stdout. To be used only for testing and debugging. - Needed for CI because of a Go macOS bug which doesn't clean cgo callbacks on - exit. */ -void vips_default_logging_handler(void) { - g_log_set_default_handler(g_log_default_handler, NULL); -} \ No newline at end of file diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/govips.go b/vendor/github.com/davidbyttow/govips/v2/vips/govips.go deleted file mode 100644 index 2036ebbe01..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/govips.go +++ /dev/null @@ -1,265 +0,0 @@ -// Package vips provides go bindings for libvips, a fast image processing library. -package vips - -// #cgo pkg-config: vips -// #include -// #include "govips.h" -import "C" -import ( - "fmt" - "os" - "runtime" - "strings" - "sync" -) - -const ( - defaultConcurrencyLevel = 1 - defaultMaxCacheMem = 50 * 1024 * 1024 - defaultMaxCacheSize = 100 - defaultMaxCacheFiles = 0 -) - -var ( - // Version is the full libvips version string (x.y.z) - Version = C.GoString(C.vips_version_string()) - - // MajorVersion is the libvips major component of the version string (x in x.y.z) - MajorVersion = int(C.vips_version(0)) - - // MinorVersion is the libvips minor component of the version string (y in x.y.z) - MinorVersion = int(C.vips_version(1)) - - // MicroVersion is the libvips micro component of the version string (z in x.y.z) - // Also known as patch version - MicroVersion = int(C.vips_version(2)) - - running = false - hasShutdown = false - initLock sync.Mutex - statCollectorDone chan struct{} - once sync.Once - typeLoaders = make(map[string]ImageType) - supportedImageTypes = make(map[ImageType]bool) -) - -// Config allows fine-tuning of libvips library -type Config struct { - ConcurrencyLevel int - MaxCacheFiles int - MaxCacheMem int - MaxCacheSize int - ReportLeaks bool - CacheTrace bool - CollectStats bool -} - -// Startup sets up the libvips support and ensures the versions are correct. Pass in nil for -// default configuration. -func Startup(config *Config) { - if hasShutdown { - panic("govips cannot be stopped and restarted") - } - - initLock.Lock() - defer initLock.Unlock() - - runtime.LockOSThread() - defer runtime.UnlockOSThread() - - if running { - govipsLog("govips", LogLevelInfo, "warning libvips already started") - return - } - - if MajorVersion < 8 { - panic("govips requires libvips version 8.10+") - } - - if MajorVersion == 8 && MinorVersion < 10 { - panic("govips requires libvips version 8.10+") - } - - cName := C.CString("govips") - defer freeCString(cName) - - // Initialize govips logging handler and verbosity filter to historical default - if !currentLoggingOverridden { - govipsLoggingSettings(nil, LogLevelInfo) - } - - // Override default glib logging handler to intercept logging messages - enableLogging() - - err := C.vips_init(cName) - if err != 0 { - panic(fmt.Sprintf("Failed to start vips code=%v", err)) - } - - running = true - - if config != nil { - if config.CollectStats { - statCollectorDone = collectStats() - } - - C.vips_leak_set(toGboolean(config.ReportLeaks)) - - if config.ConcurrencyLevel >= 0 { - C.vips_concurrency_set(C.int(config.ConcurrencyLevel)) - } else { - C.vips_concurrency_set(defaultConcurrencyLevel) - } - - if config.MaxCacheFiles >= 0 { - C.vips_cache_set_max_files(C.int(config.MaxCacheFiles)) - } else { - C.vips_cache_set_max_files(defaultMaxCacheFiles) - } - - if config.MaxCacheMem >= 0 { - C.vips_cache_set_max_mem(C.size_t(config.MaxCacheMem)) - } else { - C.vips_cache_set_max_mem(defaultMaxCacheMem) - } - - if config.MaxCacheSize >= 0 { - C.vips_cache_set_max(C.int(config.MaxCacheSize)) - } else { - C.vips_cache_set_max(defaultMaxCacheSize) - } - - if config.CacheTrace { - C.vips_cache_set_trace(toGboolean(true)) - } - } else { - C.vips_concurrency_set(defaultConcurrencyLevel) - C.vips_cache_set_max(defaultMaxCacheSize) - C.vips_cache_set_max_mem(defaultMaxCacheMem) - C.vips_cache_set_max_files(defaultMaxCacheFiles) - } - - govipsLog("govips", LogLevelInfo, fmt.Sprintf("vips %s started with concurrency=%d cache_max_files=%d cache_max_mem=%d cache_max=%d", - Version, - int(C.vips_concurrency_get()), - int(C.vips_cache_get_max_files()), - int(C.vips_cache_get_max_mem()), - int(C.vips_cache_get_max()))) - - initTypes() -} - -func enableLogging() { - C.vips_set_logging_handler() -} - -func disableLogging() { - C.vips_unset_logging_handler() -} - -// consoleLogging overrides the Govips logging handler and makes glib -// use its default logging handler which outputs everything to console. -// Needed for CI unit testing due to a macOS bug in Go (doesn't clean cgo callbacks on exit) -func consoleLogging() { - C.vips_default_logging_handler() -} - -// Shutdown libvips -func Shutdown() { - hasShutdown = true - - if statCollectorDone != nil { - statCollectorDone <- struct{}{} - } - - initLock.Lock() - defer initLock.Unlock() - - runtime.LockOSThread() - defer runtime.UnlockOSThread() - - if !running { - govipsLog("govips", LogLevelInfo, "warning libvips not started") - return - } - - if temporaryDirectory != "" { - os.RemoveAll(temporaryDirectory) - } - - C.vips_shutdown() - disableLogging() - running = false -} - -// ShutdownThread clears the cache for for the given thread. This needs to be -// called when a thread using vips exits. -func ShutdownThread() { - C.vips_thread_shutdown() -} - -// ClearCache drops the whole operation cache, handy for leak tracking. -func ClearCache() { - C.vips_cache_drop_all() -} - -// PrintCache prints the whole operation cache to stdout for debugging purposes. -func PrintCache() { - C.vips_cache_print() -} - -// PrintObjectReport outputs all of the current internal objects in libvips -func PrintObjectReport(label string) { - govipsLog("govips", LogLevelInfo, fmt.Sprintf("\n=======================================\nvips live objects: %s...\n", label)) - C.vips_object_print_all() - govipsLog("govips", LogLevelInfo, "=======================================\n\n") -} - -// MemoryStats is a data structure that houses various memory statistics from ReadVipsMemStats() -type MemoryStats struct { - Mem int64 - MemHigh int64 - Files int64 - Allocs int64 -} - -// ReadVipsMemStats returns various memory statistics such as allocated memory and open files. -func ReadVipsMemStats(stats *MemoryStats) { - stats.Mem = int64(C.vips_tracked_get_mem()) - stats.MemHigh = int64(C.vips_tracked_get_mem_highwater()) - stats.Allocs = int64(C.vips_tracked_get_allocs()) - stats.Files = int64(C.vips_tracked_get_files()) -} - -func startupIfNeeded() { - if !running { - govipsLog("govips", LogLevelInfo, "libvips was forcibly started automatically, consider calling Startup/Shutdown yourself") - Startup(nil) - } -} - -// InitTypes initializes caches and figures out which image types are supported -func initTypes() { - once.Do(func() { - cType := C.CString("VipsOperation") - defer freeCString(cType) - - for k, v := range ImageTypes { - name := strings.ToLower("VipsForeignLoad" + v) - typeLoaders[name] = k - typeLoaders[name+"buffer"] = k - - cFunc := C.CString(v + "load") - //noinspection GoDeferInLoop - defer freeCString(cFunc) - - ret := C.vips_type_find(cType, cFunc) - - supportedImageTypes[k] = int(ret) != 0 - - if supportedImageTypes[k] { - govipsLog("govips", LogLevelInfo, fmt.Sprintf("registered image type loader type=%s", v)) - } - } - }) -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/header.c b/vendor/github.com/davidbyttow/govips/v2/vips/header.c deleted file mode 100644 index 6744c840d7..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/header.c +++ /dev/null @@ -1,122 +0,0 @@ -#include "header.h" - -#include - -unsigned long has_icc_profile(VipsImage *in) { - return vips_image_get_typeof(in, VIPS_META_ICC_NAME); -} - -unsigned long get_icc_profile(VipsImage *in, const void **data, - size_t *dataLength) { - return image_get_blob(in, VIPS_META_ICC_NAME, data, dataLength); -} - -gboolean remove_icc_profile(VipsImage *in) { - return vips_image_remove(in, VIPS_META_ICC_NAME); -} - -unsigned long has_iptc(VipsImage *in) { - return vips_image_get_typeof(in, VIPS_META_IPTC_NAME); -} - -char **image_get_fields(VipsImage *in) { return vips_image_get_fields(in); } - -void image_set_string(VipsImage *in, const char *name, const char *str) { - vips_image_set_string(in, name, str); -} - -unsigned long image_get_string(VipsImage *in, const char *name, - const char **out) { - return vips_image_get_string(in, name, out); -} - -unsigned long image_get_as_string(VipsImage *in, const char *name, char **out) { - return vips_image_get_as_string(in, name, out); -} - -void remove_field(VipsImage *in, char *field) { vips_image_remove(in, field); } - -int get_meta_orientation(VipsImage *in) { - int orientation = 0; - if (vips_image_get_typeof(in, VIPS_META_ORIENTATION) != 0) { - vips_image_get_int(in, VIPS_META_ORIENTATION, &orientation); - } - - return orientation; -} - -void remove_meta_orientation(VipsImage *in) { - vips_image_remove(in, VIPS_META_ORIENTATION); -} - -void set_meta_orientation(VipsImage *in, int orientation) { - vips_image_set_int(in, VIPS_META_ORIENTATION, orientation); -} - -// https://libvips.github.io/libvips/API/current/libvips-header.html#vips-image-get-n-pages -int get_image_n_pages(VipsImage *in) { - int n_pages = 0; - n_pages = vips_image_get_n_pages(in); - return n_pages; -} - -void set_image_n_pages(VipsImage *in, int n_pages) { - vips_image_set_int(in, VIPS_META_N_PAGES, n_pages); -} - -// https://www.libvips.org/API/current/libvips-header.html#vips-image-get-page-height -int get_page_height(VipsImage *in) { - int page_height = 0; - page_height = vips_image_get_page_height(in); - return page_height; -} - -void set_page_height(VipsImage *in, int height) { - vips_image_set_int(in, VIPS_META_PAGE_HEIGHT, height); -} - -int get_meta_loader(const VipsImage *in, const char **out) { - return vips_image_get_string(in, VIPS_META_LOADER, out); -} - -int get_image_delay(VipsImage *in, int **out) { - return vips_image_get_array_int(in, "delay", out, NULL); -} - -void set_image_delay(VipsImage *in, const int *array, int n) { - return vips_image_set_array_int(in, "delay", array, n); -} - -void image_set_double(VipsImage *in, const char *name, double i) { - vips_image_set_double(in, name, i); -} - -unsigned long image_get_double(VipsImage *in, const char *name, double *out) { - return vips_image_get_double(in, name, out); -} - -void image_set_int(VipsImage *in, const char *name, int i) { - vips_image_set_int(in, name, i); -} - -unsigned long image_get_int(VipsImage *in, const char *name, int *out) { - return vips_image_get_int(in, name, out); -} - -void image_set_blob(VipsImage *in, const char *name, const void *data, - size_t dataLength) { - vips_image_set_blob_copy(in, name, data, dataLength); -} - -unsigned long image_get_blob(VipsImage *in, const char *name, const void **data, - size_t *dataLength) { - if (vips_image_get_typeof(in, name) == 0) { - return 0; - } - - if (vips_image_get_blob(in, name, data, dataLength)) { - return -1; - } - - return 0; -} \ No newline at end of file diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/header.go b/vendor/github.com/davidbyttow/govips/v2/vips/header.go deleted file mode 100644 index a85e47c516..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/header.go +++ /dev/null @@ -1,289 +0,0 @@ -package vips - -// #include "header.h" -import "C" -import ( - "strings" - "unsafe" -) - -func vipsHasICCProfile(in *C.VipsImage) bool { - return int(C.has_icc_profile(in)) != 0 -} - -func vipsGetICCProfile(in *C.VipsImage) ([]byte, bool) { - var bufPtr unsafe.Pointer - var dataLength C.size_t - - if int(C.get_icc_profile(in, &bufPtr, &dataLength)) != 0 { - return nil, false - } - - buf := C.GoBytes(bufPtr, C.int(dataLength)) - return buf, true -} - -func vipsRemoveICCProfile(in *C.VipsImage) bool { - return fromGboolean(C.remove_icc_profile(in)) -} - -func vipsHasIPTC(in *C.VipsImage) bool { - return int(C.has_iptc(in)) != 0 -} - -func vipsImageGetFields(in *C.VipsImage) (fields []string) { - const maxFields = 256 - - rawFields := C.image_get_fields(in) - defer C.g_strfreev(rawFields) - - cFields := (*[maxFields]*C.char)(unsafe.Pointer(rawFields))[:maxFields:maxFields] - - for _, field := range cFields { - if field == nil { - break - } - fields = append(fields, C.GoString(field)) - } - return -} - -func vipsImageGetExifData(in *C.VipsImage) map[string]string { - fields := vipsImageGetFields(in) - - exifData := map[string]string{} - for _, field := range fields { - if strings.HasPrefix(field, "exif") { - exifData[field] = vipsImageGetString(in, field) - } - } - - return exifData -} - -func vipsRemoveMetadata(in *C.VipsImage, keep ...string) { - fields := vipsImageGetFields(in) - - retain := append(keep, technicalMetadata...) - - for _, field := range fields { - if contains(retain, field) { - continue - } - - cField := C.CString(field) - - C.remove_field(in, cField) - - C.free(unsafe.Pointer(cField)) - } -} - -var technicalMetadata = []string{ - C.VIPS_META_ICC_NAME, - C.VIPS_META_ORIENTATION, - C.VIPS_META_N_PAGES, - C.VIPS_META_PAGE_HEIGHT, -} - -func contains(a []string, x string) bool { - for _, n := range a { - if x == n { - return true - } - } - return false -} - -func vipsGetMetaOrientation(in *C.VipsImage) int { - return int(C.get_meta_orientation(in)) -} - -func vipsRemoveMetaOrientation(in *C.VipsImage) { - C.remove_meta_orientation(in) -} - -func vipsSetMetaOrientation(in *C.VipsImage, orientation int) { - C.set_meta_orientation(in, C.int(orientation)) -} - -func vipsGetImageNPages(in *C.VipsImage) int { - return int(C.get_image_n_pages(in)) -} - -func vipsSetImageNPages(in *C.VipsImage, pages int) { - C.set_image_n_pages(in, C.int(pages)) -} - -func vipsGetPageHeight(in *C.VipsImage) int { - return int(C.get_page_height(in)) -} - -func vipsSetPageHeight(in *C.VipsImage, height int) { - C.set_page_height(in, C.int(height)) -} - -func vipsImageGetMetaLoader(in *C.VipsImage) (string, bool) { - var out *C.char - defer freeCString(out) - code := int(C.get_meta_loader(in, &out)) - return C.GoString(out), code == 0 -} - -func vipsImageGetDelay(in *C.VipsImage, n int) ([]int, error) { - incOpCounter("imageGetDelay") - var out *C.int - defer gFreePointer(unsafe.Pointer(out)) - - if err := C.get_image_delay(in, &out); err != 0 { - return nil, handleVipsError() - } - return fromCArrayInt(out, n), nil -} - -func vipsImageSetDelay(in *C.VipsImage, data []C.int) error { - incOpCounter("imageSetDelay") - if n := len(data); n > 0 { - C.set_image_delay(in, &data[0], C.int(n)) - } - return nil -} - -// vipsDetermineImageTypeFromMetaLoader determine the image type from vips-loader metadata -func vipsDetermineImageTypeFromMetaLoader(in *C.VipsImage) ImageType { - vipsLoader, ok := vipsImageGetMetaLoader(in) - if vipsLoader == "" || !ok { - return ImageTypeUnknown - } - if strings.HasPrefix(vipsLoader, "jpeg") { - return ImageTypeJPEG - } - if strings.HasPrefix(vipsLoader, "png") { - return ImageTypePNG - } - if strings.HasPrefix(vipsLoader, "gif") { - return ImageTypeGIF - } - if strings.HasPrefix(vipsLoader, "svg") { - return ImageTypeSVG - } - if strings.HasPrefix(vipsLoader, "webp") { - return ImageTypeWEBP - } - if strings.HasPrefix(vipsLoader, "jp2k") { - return ImageTypeJP2K - } - if strings.HasPrefix(vipsLoader, "jxl") { - return ImageTypeJXL - } - if strings.HasPrefix(vipsLoader, "magick") { - return ImageTypeMagick - } - if strings.HasPrefix(vipsLoader, "tiff") { - return ImageTypeTIFF - } - if strings.HasPrefix(vipsLoader, "heif") { - return ImageTypeHEIF - } - if strings.HasPrefix(vipsLoader, "pdf") { - return ImageTypePDF - } - return ImageTypeUnknown -} - -func vipsImageSetBlob(in *C.VipsImage, name string, data []byte) { - cData := unsafe.Pointer(&data) - cDataLength := C.size_t(len(data)) - - cField := C.CString(name) - defer freeCString(cField) - C.image_set_blob(in, cField, cData, cDataLength) -} - -func vipsImageGetBlob(in *C.VipsImage, name string) []byte { - var bufPtr unsafe.Pointer - var dataLength C.size_t - - cField := C.CString(name) - defer freeCString(cField) - if int(C.image_get_blob(in, cField, &bufPtr, &dataLength)) != 0 { - return nil - } - - buf := C.GoBytes(bufPtr, C.int(dataLength)) - return buf -} - -func vipsImageSetDouble(in *C.VipsImage, name string, f float64) { - cField := C.CString(name) - defer freeCString(cField) - - cDouble := C.double(f) - C.image_set_double(in, cField, cDouble) -} - -func vipsImageGetDouble(in *C.VipsImage, name string) float64 { - cField := C.CString(name) - defer freeCString(cField) - - var cDouble C.double - if int(C.image_get_double(in, cField, &cDouble)) == 0 { - return float64(cDouble) - } - - return 0 -} - -func vipsImageSetInt(in *C.VipsImage, name string, i int) { - cField := C.CString(name) - defer freeCString(cField) - - cInt := C.int(i) - C.image_set_int(in, cField, cInt) -} - -func vipsImageGetInt(in *C.VipsImage, name string) int { - cField := C.CString(name) - defer freeCString(cField) - - var cInt C.int - if int(C.image_get_int(in, cField, &cInt)) == 0 { - return int(cInt) - } - - return 0 -} - -func vipsImageSetString(in *C.VipsImage, name string, str string) { - cField := C.CString(name) - defer freeCString(cField) - - cStr := C.CString(str) - defer freeCString(cStr) - - C.image_set_string(in, cField, cStr) -} - -func vipsImageGetString(in *C.VipsImage, name string) string { - cField := C.CString(name) - defer freeCString(cField) - var cFieldValue *C.char - defer freeCString(cFieldValue) - if int(C.image_get_string(in, cField, &cFieldValue)) == 0 { - return C.GoString(cFieldValue) - } - - return "" -} - -func vipsImageGetAsString(in *C.VipsImage, name string) string { - cField := C.CString(name) - defer freeCString(cField) - var cFieldValue *C.char - defer freeCString(cFieldValue) - if int(C.image_get_as_string(in, cField, &cFieldValue)) == 0 { - return C.GoString(cFieldValue) - } - - return "" -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/header.h b/vendor/github.com/davidbyttow/govips/v2/vips/header.h deleted file mode 100644 index 9a4983e2e4..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/header.h +++ /dev/null @@ -1,41 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-header.html - -#include -#include - -unsigned long has_icc_profile(VipsImage *in); -unsigned long get_icc_profile(VipsImage *in, const void **data, - size_t *dataLength); -int remove_icc_profile(VipsImage *in); - -unsigned long has_iptc(VipsImage *in); -char **image_get_fields(VipsImage *in); - -void image_set_string(VipsImage *in, const char *name, const char *str); -unsigned long image_get_string(VipsImage *in, const char *name, - const char **out); -unsigned long image_get_as_string(VipsImage *in, const char *name, char **out); - -void remove_field(VipsImage *in, char *field); - -int get_meta_orientation(VipsImage *in); -void remove_meta_orientation(VipsImage *in); -void set_meta_orientation(VipsImage *in, int orientation); -int get_image_n_pages(VipsImage *in); -void set_image_n_pages(VipsImage *in, int n_pages); -int get_page_height(VipsImage *in); -void set_page_height(VipsImage *in, int height); -int get_meta_loader(const VipsImage *in, const char **out); -int get_image_delay(VipsImage *in, int **out); -void set_image_delay(VipsImage *in, const int *array, int n); - -void image_set_blob(VipsImage *in, const char *name, const void *data, - size_t dataLength); -unsigned long image_get_blob(VipsImage *in, const char *name, const void **data, - size_t *dataLength); - -void image_set_double(VipsImage *in, const char *name, double i); -unsigned long image_get_double(VipsImage *in, const char *name, double *out); - -void image_set_int(VipsImage *in, const char *name, int i); -unsigned long image_get_int(VipsImage *in, const char *name, int *out); \ No newline at end of file diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/icc_profiles.go b/vendor/github.com/davidbyttow/govips/v2/vips/icc_profiles.go deleted file mode 100644 index 94f467bb4b..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/icc_profiles.go +++ /dev/null @@ -1,726 +0,0 @@ -package vips - -import ( - "os" - "path/filepath" - "sync" -) - -var ( - // ATTRIBUTION: - // The following micro icc profile taken from: https://github.com/saucecontrol/Compact-ICC-Profiles. - // Read more (very interesting): https://photosauce.net/blog/post/making-a-minimal-srgb-icc-profile-part-1-trim-the-fat-abuse-the-spec - sRGBV2MicroICCProfile = []byte{ - 0x00, 0x00, 0x01, 0xc8, 0x6c, 0x63, 0x6d, 0x73, 0x02, 0x10, 0x00, 0x00, - 0x6d, 0x6e, 0x74, 0x72, 0x52, 0x47, 0x42, 0x20, 0x58, 0x59, 0x5a, 0x20, - 0x07, 0xe2, 0x00, 0x03, 0x00, 0x14, 0x00, 0x09, 0x00, 0x0e, 0x00, 0x1d, - 0x61, 0x63, 0x73, 0x70, 0x4d, 0x53, 0x46, 0x54, 0x00, 0x00, 0x00, 0x00, - 0x73, 0x61, 0x77, 0x73, 0x63, 0x74, 0x72, 0x6c, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xd6, - 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0xd3, 0x2d, 0x68, 0x61, 0x6e, 0x64, - 0x9d, 0x91, 0x00, 0x3d, 0x40, 0x80, 0xb0, 0x3d, 0x40, 0x74, 0x2c, 0x81, - 0x9e, 0xa5, 0x22, 0x8e, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x09, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x5f, - 0x63, 0x70, 0x72, 0x74, 0x00, 0x00, 0x01, 0x0c, 0x00, 0x00, 0x00, 0x0c, - 0x77, 0x74, 0x70, 0x74, 0x00, 0x00, 0x01, 0x18, 0x00, 0x00, 0x00, 0x14, - 0x72, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x01, 0x2c, 0x00, 0x00, 0x00, 0x14, - 0x67, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x01, 0x40, 0x00, 0x00, 0x00, 0x14, - 0x62, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x01, 0x54, 0x00, 0x00, 0x00, 0x14, - 0x72, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0x68, 0x00, 0x00, 0x00, 0x60, - 0x67, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0x68, 0x00, 0x00, 0x00, 0x60, - 0x62, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0x68, 0x00, 0x00, 0x00, 0x60, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, - 0x75, 0x52, 0x47, 0x42, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x74, 0x65, 0x78, 0x74, 0x00, 0x00, 0x00, 0x00, - 0x43, 0x43, 0x30, 0x00, 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0xf3, 0x54, 0x00, 0x01, 0x00, 0x00, 0x00, 0x01, 0x16, 0xc9, - 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6f, 0xa0, - 0x00, 0x00, 0x38, 0xf2, 0x00, 0x00, 0x03, 0x8f, 0x58, 0x59, 0x5a, 0x20, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x62, 0x96, 0x00, 0x00, 0xb7, 0x89, - 0x00, 0x00, 0x18, 0xda, 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x24, 0xa0, 0x00, 0x00, 0x0f, 0x85, 0x00, 0x00, 0xb6, 0xc4, - 0x63, 0x75, 0x72, 0x76, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2a, - 0x00, 0x00, 0x00, 0x7c, 0x00, 0xf8, 0x01, 0x9c, 0x02, 0x75, 0x03, 0x83, - 0x04, 0xc9, 0x06, 0x4e, 0x08, 0x12, 0x0a, 0x18, 0x0c, 0x62, 0x0e, 0xf4, - 0x11, 0xcf, 0x14, 0xf6, 0x18, 0x6a, 0x1c, 0x2e, 0x20, 0x43, 0x24, 0xac, - 0x29, 0x6a, 0x2e, 0x7e, 0x33, 0xeb, 0x39, 0xb3, 0x3f, 0xd6, 0x46, 0x57, - 0x4d, 0x36, 0x54, 0x76, 0x5c, 0x17, 0x64, 0x1d, 0x6c, 0x86, 0x75, 0x56, - 0x7e, 0x8d, 0x88, 0x2c, 0x92, 0x36, 0x9c, 0xab, 0xa7, 0x8c, 0xb2, 0xdb, - 0xbe, 0x99, 0xca, 0xc7, 0xd7, 0x65, 0xe4, 0x77, 0xf1, 0xf9, 0xff, 0xff, - } - - // ATTRIBUTION: - // The following micro icc profile taken from: https://github.com/saucecontrol/Compact-ICC-Profiles. - // Read more (very interesting): https://photosauce.net/blog/post/making-a-minimal-srgb-icc-profile-part-1-trim-the-fat-abuse-the-spec - sGrayV2MicroICCProfile = []byte{ - 0x00, 0x00, 0x01, 0x50, 0x6c, 0x63, 0x6d, 0x73, 0x02, 0x10, 0x00, 0x00, - 0x6d, 0x6e, 0x74, 0x72, 0x47, 0x52, 0x41, 0x59, 0x58, 0x59, 0x5a, 0x20, - 0x07, 0xe2, 0x00, 0x03, 0x00, 0x14, 0x00, 0x09, 0x00, 0x0e, 0x00, 0x1d, - 0x61, 0x63, 0x73, 0x70, 0x4d, 0x53, 0x46, 0x54, 0x00, 0x00, 0x00, 0x00, - 0x73, 0x61, 0x77, 0x73, 0x63, 0x74, 0x72, 0x6c, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xd6, - 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0xd3, 0x2d, 0x68, 0x61, 0x6e, 0x64, - 0x05, 0xd2, 0x02, 0xa7, 0xf9, 0xdd, 0x47, 0x94, 0xc7, 0x4f, 0x4c, 0x5f, - 0x26, 0x82, 0x3a, 0x09, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0xb4, 0x00, 0x00, 0x00, 0x5f, - 0x63, 0x70, 0x72, 0x74, 0x00, 0x00, 0x00, 0xd0, 0x00, 0x00, 0x00, 0x0c, - 0x77, 0x74, 0x70, 0x74, 0x00, 0x00, 0x00, 0xdc, 0x00, 0x00, 0x00, 0x14, - 0x6b, 0x54, 0x52, 0x43, 0x00, 0x00, 0x00, 0xf0, 0x00, 0x00, 0x00, 0x60, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, - 0x75, 0x47, 0x72, 0x79, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x74, 0x65, 0x78, 0x74, 0x00, 0x00, 0x00, 0x00, - 0x43, 0x43, 0x30, 0x00, 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0xf3, 0x54, 0x00, 0x01, 0x00, 0x00, 0x00, 0x01, 0x16, 0xc9, - 0x63, 0x75, 0x72, 0x76, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2a, - 0x00, 0x00, 0x00, 0x7c, 0x00, 0xf8, 0x01, 0x9c, 0x02, 0x75, 0x03, 0x83, - 0x04, 0xc9, 0x06, 0x4e, 0x08, 0x12, 0x0a, 0x18, 0x0c, 0x62, 0x0e, 0xf4, - 0x11, 0xcf, 0x14, 0xf6, 0x18, 0x6a, 0x1c, 0x2e, 0x20, 0x43, 0x24, 0xac, - 0x29, 0x6a, 0x2e, 0x7e, 0x33, 0xeb, 0x39, 0xb3, 0x3f, 0xd6, 0x46, 0x57, - 0x4d, 0x36, 0x54, 0x76, 0x5c, 0x17, 0x64, 0x1d, 0x6c, 0x86, 0x75, 0x56, - 0x7e, 0x8d, 0x88, 0x2c, 0x92, 0x36, 0x9c, 0xab, 0xa7, 0x8c, 0xb2, 0xdb, - 0xbe, 0x99, 0xca, 0xc7, 0xd7, 0x65, 0xe4, 0x77, 0xf1, 0xf9, 0xff, 0xff, - } - - sRGBIEC6196621ICCProfile = []byte{ - 0x00, 0x00, 0x0b, 0xe8, 0x00, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, - 0x6d, 0x6e, 0x74, 0x72, 0x52, 0x47, 0x42, 0x20, 0x58, 0x59, 0x5a, 0x20, - 0x07, 0xd9, 0x00, 0x03, 0x00, 0x1b, 0x00, 0x15, 0x00, 0x24, 0x00, 0x1f, - 0x61, 0x63, 0x73, 0x70, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x01, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xd6, - 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0xd3, 0x2d, 0x00, 0x00, 0x00, 0x00, - 0x29, 0xf8, 0x3d, 0xde, 0xaf, 0xf2, 0x55, 0xae, 0x78, 0x42, 0xfa, 0xe4, - 0xca, 0x83, 0x39, 0x0d, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x10, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x01, 0x44, 0x00, 0x00, 0x00, 0x79, - 0x62, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x01, 0xc0, 0x00, 0x00, 0x00, 0x14, - 0x62, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0xd4, 0x00, 0x00, 0x08, 0x0c, - 0x64, 0x6d, 0x64, 0x64, 0x00, 0x00, 0x09, 0xe0, 0x00, 0x00, 0x00, 0x88, - 0x67, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x0a, 0x68, 0x00, 0x00, 0x00, 0x14, - 0x67, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0xd4, 0x00, 0x00, 0x08, 0x0c, - 0x6c, 0x75, 0x6d, 0x69, 0x00, 0x00, 0x0a, 0x7c, 0x00, 0x00, 0x00, 0x14, - 0x6d, 0x65, 0x61, 0x73, 0x00, 0x00, 0x0a, 0x90, 0x00, 0x00, 0x00, 0x24, - 0x62, 0x6b, 0x70, 0x74, 0x00, 0x00, 0x0a, 0xb4, 0x00, 0x00, 0x00, 0x14, - 0x72, 0x58, 0x59, 0x5a, 0x00, 0x00, 0x0a, 0xc8, 0x00, 0x00, 0x00, 0x14, - 0x72, 0x54, 0x52, 0x43, 0x00, 0x00, 0x01, 0xd4, 0x00, 0x00, 0x08, 0x0c, - 0x74, 0x65, 0x63, 0x68, 0x00, 0x00, 0x0a, 0xdc, 0x00, 0x00, 0x00, 0x0c, - 0x76, 0x75, 0x65, 0x64, 0x00, 0x00, 0x0a, 0xe8, 0x00, 0x00, 0x00, 0x87, - 0x77, 0x74, 0x70, 0x74, 0x00, 0x00, 0x0b, 0x70, 0x00, 0x00, 0x00, 0x14, - 0x63, 0x70, 0x72, 0x74, 0x00, 0x00, 0x0b, 0x84, 0x00, 0x00, 0x00, 0x37, - 0x63, 0x68, 0x61, 0x64, 0x00, 0x00, 0x0b, 0xbc, 0x00, 0x00, 0x00, 0x2c, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x1f, - 0x73, 0x52, 0x47, 0x42, 0x20, 0x49, 0x45, 0x43, 0x36, 0x31, 0x39, 0x36, - 0x36, 0x2d, 0x32, 0x2d, 0x31, 0x20, 0x62, 0x6c, 0x61, 0x63, 0x6b, 0x20, - 0x73, 0x63, 0x61, 0x6c, 0x65, 0x64, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x24, 0xa0, 0x00, 0x00, 0x0f, 0x84, 0x00, 0x00, 0xb6, 0xcf, - 0x63, 0x75, 0x72, 0x76, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, - 0x00, 0x00, 0x00, 0x05, 0x00, 0x0a, 0x00, 0x0f, 0x00, 0x14, 0x00, 0x19, - 0x00, 0x1e, 0x00, 0x23, 0x00, 0x28, 0x00, 0x2d, 0x00, 0x32, 0x00, 0x37, - 0x00, 0x3b, 0x00, 0x40, 0x00, 0x45, 0x00, 0x4a, 0x00, 0x4f, 0x00, 0x54, - 0x00, 0x59, 0x00, 0x5e, 0x00, 0x63, 0x00, 0x68, 0x00, 0x6d, 0x00, 0x72, - 0x00, 0x77, 0x00, 0x7c, 0x00, 0x81, 0x00, 0x86, 0x00, 0x8b, 0x00, 0x90, - 0x00, 0x95, 0x00, 0x9a, 0x00, 0x9f, 0x00, 0xa4, 0x00, 0xa9, 0x00, 0xae, - 0x00, 0xb2, 0x00, 0xb7, 0x00, 0xbc, 0x00, 0xc1, 0x00, 0xc6, 0x00, 0xcb, - 0x00, 0xd0, 0x00, 0xd5, 0x00, 0xdb, 0x00, 0xe0, 0x00, 0xe5, 0x00, 0xeb, - 0x00, 0xf0, 0x00, 0xf6, 0x00, 0xfb, 0x01, 0x01, 0x01, 0x07, 0x01, 0x0d, - 0x01, 0x13, 0x01, 0x19, 0x01, 0x1f, 0x01, 0x25, 0x01, 0x2b, 0x01, 0x32, - 0x01, 0x38, 0x01, 0x3e, 0x01, 0x45, 0x01, 0x4c, 0x01, 0x52, 0x01, 0x59, - 0x01, 0x60, 0x01, 0x67, 0x01, 0x6e, 0x01, 0x75, 0x01, 0x7c, 0x01, 0x83, - 0x01, 0x8b, 0x01, 0x92, 0x01, 0x9a, 0x01, 0xa1, 0x01, 0xa9, 0x01, 0xb1, - 0x01, 0xb9, 0x01, 0xc1, 0x01, 0xc9, 0x01, 0xd1, 0x01, 0xd9, 0x01, 0xe1, - 0x01, 0xe9, 0x01, 0xf2, 0x01, 0xfa, 0x02, 0x03, 0x02, 0x0c, 0x02, 0x14, - 0x02, 0x1d, 0x02, 0x26, 0x02, 0x2f, 0x02, 0x38, 0x02, 0x41, 0x02, 0x4b, - 0x02, 0x54, 0x02, 0x5d, 0x02, 0x67, 0x02, 0x71, 0x02, 0x7a, 0x02, 0x84, - 0x02, 0x8e, 0x02, 0x98, 0x02, 0xa2, 0x02, 0xac, 0x02, 0xb6, 0x02, 0xc1, - 0x02, 0xcb, 0x02, 0xd5, 0x02, 0xe0, 0x02, 0xeb, 0x02, 0xf5, 0x03, 0x00, - 0x03, 0x0b, 0x03, 0x16, 0x03, 0x21, 0x03, 0x2d, 0x03, 0x38, 0x03, 0x43, - 0x03, 0x4f, 0x03, 0x5a, 0x03, 0x66, 0x03, 0x72, 0x03, 0x7e, 0x03, 0x8a, - 0x03, 0x96, 0x03, 0xa2, 0x03, 0xae, 0x03, 0xba, 0x03, 0xc7, 0x03, 0xd3, - 0x03, 0xe0, 0x03, 0xec, 0x03, 0xf9, 0x04, 0x06, 0x04, 0x13, 0x04, 0x20, - 0x04, 0x2d, 0x04, 0x3b, 0x04, 0x48, 0x04, 0x55, 0x04, 0x63, 0x04, 0x71, - 0x04, 0x7e, 0x04, 0x8c, 0x04, 0x9a, 0x04, 0xa8, 0x04, 0xb6, 0x04, 0xc4, - 0x04, 0xd3, 0x04, 0xe1, 0x04, 0xf0, 0x04, 0xfe, 0x05, 0x0d, 0x05, 0x1c, - 0x05, 0x2b, 0x05, 0x3a, 0x05, 0x49, 0x05, 0x58, 0x05, 0x67, 0x05, 0x77, - 0x05, 0x86, 0x05, 0x96, 0x05, 0xa6, 0x05, 0xb5, 0x05, 0xc5, 0x05, 0xd5, - 0x05, 0xe5, 0x05, 0xf6, 0x06, 0x06, 0x06, 0x16, 0x06, 0x27, 0x06, 0x37, - 0x06, 0x48, 0x06, 0x59, 0x06, 0x6a, 0x06, 0x7b, 0x06, 0x8c, 0x06, 0x9d, - 0x06, 0xaf, 0x06, 0xc0, 0x06, 0xd1, 0x06, 0xe3, 0x06, 0xf5, 0x07, 0x07, - 0x07, 0x19, 0x07, 0x2b, 0x07, 0x3d, 0x07, 0x4f, 0x07, 0x61, 0x07, 0x74, - 0x07, 0x86, 0x07, 0x99, 0x07, 0xac, 0x07, 0xbf, 0x07, 0xd2, 0x07, 0xe5, - 0x07, 0xf8, 0x08, 0x0b, 0x08, 0x1f, 0x08, 0x32, 0x08, 0x46, 0x08, 0x5a, - 0x08, 0x6e, 0x08, 0x82, 0x08, 0x96, 0x08, 0xaa, 0x08, 0xbe, 0x08, 0xd2, - 0x08, 0xe7, 0x08, 0xfb, 0x09, 0x10, 0x09, 0x25, 0x09, 0x3a, 0x09, 0x4f, - 0x09, 0x64, 0x09, 0x79, 0x09, 0x8f, 0x09, 0xa4, 0x09, 0xba, 0x09, 0xcf, - 0x09, 0xe5, 0x09, 0xfb, 0x0a, 0x11, 0x0a, 0x27, 0x0a, 0x3d, 0x0a, 0x54, - 0x0a, 0x6a, 0x0a, 0x81, 0x0a, 0x98, 0x0a, 0xae, 0x0a, 0xc5, 0x0a, 0xdc, - 0x0a, 0xf3, 0x0b, 0x0b, 0x0b, 0x22, 0x0b, 0x39, 0x0b, 0x51, 0x0b, 0x69, - 0x0b, 0x80, 0x0b, 0x98, 0x0b, 0xb0, 0x0b, 0xc8, 0x0b, 0xe1, 0x0b, 0xf9, - 0x0c, 0x12, 0x0c, 0x2a, 0x0c, 0x43, 0x0c, 0x5c, 0x0c, 0x75, 0x0c, 0x8e, - 0x0c, 0xa7, 0x0c, 0xc0, 0x0c, 0xd9, 0x0c, 0xf3, 0x0d, 0x0d, 0x0d, 0x26, - 0x0d, 0x40, 0x0d, 0x5a, 0x0d, 0x74, 0x0d, 0x8e, 0x0d, 0xa9, 0x0d, 0xc3, - 0x0d, 0xde, 0x0d, 0xf8, 0x0e, 0x13, 0x0e, 0x2e, 0x0e, 0x49, 0x0e, 0x64, - 0x0e, 0x7f, 0x0e, 0x9b, 0x0e, 0xb6, 0x0e, 0xd2, 0x0e, 0xee, 0x0f, 0x09, - 0x0f, 0x25, 0x0f, 0x41, 0x0f, 0x5e, 0x0f, 0x7a, 0x0f, 0x96, 0x0f, 0xb3, - 0x0f, 0xcf, 0x0f, 0xec, 0x10, 0x09, 0x10, 0x26, 0x10, 0x43, 0x10, 0x61, - 0x10, 0x7e, 0x10, 0x9b, 0x10, 0xb9, 0x10, 0xd7, 0x10, 0xf5, 0x11, 0x13, - 0x11, 0x31, 0x11, 0x4f, 0x11, 0x6d, 0x11, 0x8c, 0x11, 0xaa, 0x11, 0xc9, - 0x11, 0xe8, 0x12, 0x07, 0x12, 0x26, 0x12, 0x45, 0x12, 0x64, 0x12, 0x84, - 0x12, 0xa3, 0x12, 0xc3, 0x12, 0xe3, 0x13, 0x03, 0x13, 0x23, 0x13, 0x43, - 0x13, 0x63, 0x13, 0x83, 0x13, 0xa4, 0x13, 0xc5, 0x13, 0xe5, 0x14, 0x06, - 0x14, 0x27, 0x14, 0x49, 0x14, 0x6a, 0x14, 0x8b, 0x14, 0xad, 0x14, 0xce, - 0x14, 0xf0, 0x15, 0x12, 0x15, 0x34, 0x15, 0x56, 0x15, 0x78, 0x15, 0x9b, - 0x15, 0xbd, 0x15, 0xe0, 0x16, 0x03, 0x16, 0x26, 0x16, 0x49, 0x16, 0x6c, - 0x16, 0x8f, 0x16, 0xb2, 0x16, 0xd6, 0x16, 0xfa, 0x17, 0x1d, 0x17, 0x41, - 0x17, 0x65, 0x17, 0x89, 0x17, 0xae, 0x17, 0xd2, 0x17, 0xf7, 0x18, 0x1b, - 0x18, 0x40, 0x18, 0x65, 0x18, 0x8a, 0x18, 0xaf, 0x18, 0xd5, 0x18, 0xfa, - 0x19, 0x20, 0x19, 0x45, 0x19, 0x6b, 0x19, 0x91, 0x19, 0xb7, 0x19, 0xdd, - 0x1a, 0x04, 0x1a, 0x2a, 0x1a, 0x51, 0x1a, 0x77, 0x1a, 0x9e, 0x1a, 0xc5, - 0x1a, 0xec, 0x1b, 0x14, 0x1b, 0x3b, 0x1b, 0x63, 0x1b, 0x8a, 0x1b, 0xb2, - 0x1b, 0xda, 0x1c, 0x02, 0x1c, 0x2a, 0x1c, 0x52, 0x1c, 0x7b, 0x1c, 0xa3, - 0x1c, 0xcc, 0x1c, 0xf5, 0x1d, 0x1e, 0x1d, 0x47, 0x1d, 0x70, 0x1d, 0x99, - 0x1d, 0xc3, 0x1d, 0xec, 0x1e, 0x16, 0x1e, 0x40, 0x1e, 0x6a, 0x1e, 0x94, - 0x1e, 0xbe, 0x1e, 0xe9, 0x1f, 0x13, 0x1f, 0x3e, 0x1f, 0x69, 0x1f, 0x94, - 0x1f, 0xbf, 0x1f, 0xea, 0x20, 0x15, 0x20, 0x41, 0x20, 0x6c, 0x20, 0x98, - 0x20, 0xc4, 0x20, 0xf0, 0x21, 0x1c, 0x21, 0x48, 0x21, 0x75, 0x21, 0xa1, - 0x21, 0xce, 0x21, 0xfb, 0x22, 0x27, 0x22, 0x55, 0x22, 0x82, 0x22, 0xaf, - 0x22, 0xdd, 0x23, 0x0a, 0x23, 0x38, 0x23, 0x66, 0x23, 0x94, 0x23, 0xc2, - 0x23, 0xf0, 0x24, 0x1f, 0x24, 0x4d, 0x24, 0x7c, 0x24, 0xab, 0x24, 0xda, - 0x25, 0x09, 0x25, 0x38, 0x25, 0x68, 0x25, 0x97, 0x25, 0xc7, 0x25, 0xf7, - 0x26, 0x27, 0x26, 0x57, 0x26, 0x87, 0x26, 0xb7, 0x26, 0xe8, 0x27, 0x18, - 0x27, 0x49, 0x27, 0x7a, 0x27, 0xab, 0x27, 0xdc, 0x28, 0x0d, 0x28, 0x3f, - 0x28, 0x71, 0x28, 0xa2, 0x28, 0xd4, 0x29, 0x06, 0x29, 0x38, 0x29, 0x6b, - 0x29, 0x9d, 0x29, 0xd0, 0x2a, 0x02, 0x2a, 0x35, 0x2a, 0x68, 0x2a, 0x9b, - 0x2a, 0xcf, 0x2b, 0x02, 0x2b, 0x36, 0x2b, 0x69, 0x2b, 0x9d, 0x2b, 0xd1, - 0x2c, 0x05, 0x2c, 0x39, 0x2c, 0x6e, 0x2c, 0xa2, 0x2c, 0xd7, 0x2d, 0x0c, - 0x2d, 0x41, 0x2d, 0x76, 0x2d, 0xab, 0x2d, 0xe1, 0x2e, 0x16, 0x2e, 0x4c, - 0x2e, 0x82, 0x2e, 0xb7, 0x2e, 0xee, 0x2f, 0x24, 0x2f, 0x5a, 0x2f, 0x91, - 0x2f, 0xc7, 0x2f, 0xfe, 0x30, 0x35, 0x30, 0x6c, 0x30, 0xa4, 0x30, 0xdb, - 0x31, 0x12, 0x31, 0x4a, 0x31, 0x82, 0x31, 0xba, 0x31, 0xf2, 0x32, 0x2a, - 0x32, 0x63, 0x32, 0x9b, 0x32, 0xd4, 0x33, 0x0d, 0x33, 0x46, 0x33, 0x7f, - 0x33, 0xb8, 0x33, 0xf1, 0x34, 0x2b, 0x34, 0x65, 0x34, 0x9e, 0x34, 0xd8, - 0x35, 0x13, 0x35, 0x4d, 0x35, 0x87, 0x35, 0xc2, 0x35, 0xfd, 0x36, 0x37, - 0x36, 0x72, 0x36, 0xae, 0x36, 0xe9, 0x37, 0x24, 0x37, 0x60, 0x37, 0x9c, - 0x37, 0xd7, 0x38, 0x14, 0x38, 0x50, 0x38, 0x8c, 0x38, 0xc8, 0x39, 0x05, - 0x39, 0x42, 0x39, 0x7f, 0x39, 0xbc, 0x39, 0xf9, 0x3a, 0x36, 0x3a, 0x74, - 0x3a, 0xb2, 0x3a, 0xef, 0x3b, 0x2d, 0x3b, 0x6b, 0x3b, 0xaa, 0x3b, 0xe8, - 0x3c, 0x27, 0x3c, 0x65, 0x3c, 0xa4, 0x3c, 0xe3, 0x3d, 0x22, 0x3d, 0x61, - 0x3d, 0xa1, 0x3d, 0xe0, 0x3e, 0x20, 0x3e, 0x60, 0x3e, 0xa0, 0x3e, 0xe0, - 0x3f, 0x21, 0x3f, 0x61, 0x3f, 0xa2, 0x3f, 0xe2, 0x40, 0x23, 0x40, 0x64, - 0x40, 0xa6, 0x40, 0xe7, 0x41, 0x29, 0x41, 0x6a, 0x41, 0xac, 0x41, 0xee, - 0x42, 0x30, 0x42, 0x72, 0x42, 0xb5, 0x42, 0xf7, 0x43, 0x3a, 0x43, 0x7d, - 0x43, 0xc0, 0x44, 0x03, 0x44, 0x47, 0x44, 0x8a, 0x44, 0xce, 0x45, 0x12, - 0x45, 0x55, 0x45, 0x9a, 0x45, 0xde, 0x46, 0x22, 0x46, 0x67, 0x46, 0xab, - 0x46, 0xf0, 0x47, 0x35, 0x47, 0x7b, 0x47, 0xc0, 0x48, 0x05, 0x48, 0x4b, - 0x48, 0x91, 0x48, 0xd7, 0x49, 0x1d, 0x49, 0x63, 0x49, 0xa9, 0x49, 0xf0, - 0x4a, 0x37, 0x4a, 0x7d, 0x4a, 0xc4, 0x4b, 0x0c, 0x4b, 0x53, 0x4b, 0x9a, - 0x4b, 0xe2, 0x4c, 0x2a, 0x4c, 0x72, 0x4c, 0xba, 0x4d, 0x02, 0x4d, 0x4a, - 0x4d, 0x93, 0x4d, 0xdc, 0x4e, 0x25, 0x4e, 0x6e, 0x4e, 0xb7, 0x4f, 0x00, - 0x4f, 0x49, 0x4f, 0x93, 0x4f, 0xdd, 0x50, 0x27, 0x50, 0x71, 0x50, 0xbb, - 0x51, 0x06, 0x51, 0x50, 0x51, 0x9b, 0x51, 0xe6, 0x52, 0x31, 0x52, 0x7c, - 0x52, 0xc7, 0x53, 0x13, 0x53, 0x5f, 0x53, 0xaa, 0x53, 0xf6, 0x54, 0x42, - 0x54, 0x8f, 0x54, 0xdb, 0x55, 0x28, 0x55, 0x75, 0x55, 0xc2, 0x56, 0x0f, - 0x56, 0x5c, 0x56, 0xa9, 0x56, 0xf7, 0x57, 0x44, 0x57, 0x92, 0x57, 0xe0, - 0x58, 0x2f, 0x58, 0x7d, 0x58, 0xcb, 0x59, 0x1a, 0x59, 0x69, 0x59, 0xb8, - 0x5a, 0x07, 0x5a, 0x56, 0x5a, 0xa6, 0x5a, 0xf5, 0x5b, 0x45, 0x5b, 0x95, - 0x5b, 0xe5, 0x5c, 0x35, 0x5c, 0x86, 0x5c, 0xd6, 0x5d, 0x27, 0x5d, 0x78, - 0x5d, 0xc9, 0x5e, 0x1a, 0x5e, 0x6c, 0x5e, 0xbd, 0x5f, 0x0f, 0x5f, 0x61, - 0x5f, 0xb3, 0x60, 0x05, 0x60, 0x57, 0x60, 0xaa, 0x60, 0xfc, 0x61, 0x4f, - 0x61, 0xa2, 0x61, 0xf5, 0x62, 0x49, 0x62, 0x9c, 0x62, 0xf0, 0x63, 0x43, - 0x63, 0x97, 0x63, 0xeb, 0x64, 0x40, 0x64, 0x94, 0x64, 0xe9, 0x65, 0x3d, - 0x65, 0x92, 0x65, 0xe7, 0x66, 0x3d, 0x66, 0x92, 0x66, 0xe8, 0x67, 0x3d, - 0x67, 0x93, 0x67, 0xe9, 0x68, 0x3f, 0x68, 0x96, 0x68, 0xec, 0x69, 0x43, - 0x69, 0x9a, 0x69, 0xf1, 0x6a, 0x48, 0x6a, 0x9f, 0x6a, 0xf7, 0x6b, 0x4f, - 0x6b, 0xa7, 0x6b, 0xff, 0x6c, 0x57, 0x6c, 0xaf, 0x6d, 0x08, 0x6d, 0x60, - 0x6d, 0xb9, 0x6e, 0x12, 0x6e, 0x6b, 0x6e, 0xc4, 0x6f, 0x1e, 0x6f, 0x78, - 0x6f, 0xd1, 0x70, 0x2b, 0x70, 0x86, 0x70, 0xe0, 0x71, 0x3a, 0x71, 0x95, - 0x71, 0xf0, 0x72, 0x4b, 0x72, 0xa6, 0x73, 0x01, 0x73, 0x5d, 0x73, 0xb8, - 0x74, 0x14, 0x74, 0x70, 0x74, 0xcc, 0x75, 0x28, 0x75, 0x85, 0x75, 0xe1, - 0x76, 0x3e, 0x76, 0x9b, 0x76, 0xf8, 0x77, 0x56, 0x77, 0xb3, 0x78, 0x11, - 0x78, 0x6e, 0x78, 0xcc, 0x79, 0x2a, 0x79, 0x89, 0x79, 0xe7, 0x7a, 0x46, - 0x7a, 0xa5, 0x7b, 0x04, 0x7b, 0x63, 0x7b, 0xc2, 0x7c, 0x21, 0x7c, 0x81, - 0x7c, 0xe1, 0x7d, 0x41, 0x7d, 0xa1, 0x7e, 0x01, 0x7e, 0x62, 0x7e, 0xc2, - 0x7f, 0x23, 0x7f, 0x84, 0x7f, 0xe5, 0x80, 0x47, 0x80, 0xa8, 0x81, 0x0a, - 0x81, 0x6b, 0x81, 0xcd, 0x82, 0x30, 0x82, 0x92, 0x82, 0xf4, 0x83, 0x57, - 0x83, 0xba, 0x84, 0x1d, 0x84, 0x80, 0x84, 0xe3, 0x85, 0x47, 0x85, 0xab, - 0x86, 0x0e, 0x86, 0x72, 0x86, 0xd7, 0x87, 0x3b, 0x87, 0x9f, 0x88, 0x04, - 0x88, 0x69, 0x88, 0xce, 0x89, 0x33, 0x89, 0x99, 0x89, 0xfe, 0x8a, 0x64, - 0x8a, 0xca, 0x8b, 0x30, 0x8b, 0x96, 0x8b, 0xfc, 0x8c, 0x63, 0x8c, 0xca, - 0x8d, 0x31, 0x8d, 0x98, 0x8d, 0xff, 0x8e, 0x66, 0x8e, 0xce, 0x8f, 0x36, - 0x8f, 0x9e, 0x90, 0x06, 0x90, 0x6e, 0x90, 0xd6, 0x91, 0x3f, 0x91, 0xa8, - 0x92, 0x11, 0x92, 0x7a, 0x92, 0xe3, 0x93, 0x4d, 0x93, 0xb6, 0x94, 0x20, - 0x94, 0x8a, 0x94, 0xf4, 0x95, 0x5f, 0x95, 0xc9, 0x96, 0x34, 0x96, 0x9f, - 0x97, 0x0a, 0x97, 0x75, 0x97, 0xe0, 0x98, 0x4c, 0x98, 0xb8, 0x99, 0x24, - 0x99, 0x90, 0x99, 0xfc, 0x9a, 0x68, 0x9a, 0xd5, 0x9b, 0x42, 0x9b, 0xaf, - 0x9c, 0x1c, 0x9c, 0x89, 0x9c, 0xf7, 0x9d, 0x64, 0x9d, 0xd2, 0x9e, 0x40, - 0x9e, 0xae, 0x9f, 0x1d, 0x9f, 0x8b, 0x9f, 0xfa, 0xa0, 0x69, 0xa0, 0xd8, - 0xa1, 0x47, 0xa1, 0xb6, 0xa2, 0x26, 0xa2, 0x96, 0xa3, 0x06, 0xa3, 0x76, - 0xa3, 0xe6, 0xa4, 0x56, 0xa4, 0xc7, 0xa5, 0x38, 0xa5, 0xa9, 0xa6, 0x1a, - 0xa6, 0x8b, 0xa6, 0xfd, 0xa7, 0x6e, 0xa7, 0xe0, 0xa8, 0x52, 0xa8, 0xc4, - 0xa9, 0x37, 0xa9, 0xa9, 0xaa, 0x1c, 0xaa, 0x8f, 0xab, 0x02, 0xab, 0x75, - 0xab, 0xe9, 0xac, 0x5c, 0xac, 0xd0, 0xad, 0x44, 0xad, 0xb8, 0xae, 0x2d, - 0xae, 0xa1, 0xaf, 0x16, 0xaf, 0x8b, 0xb0, 0x00, 0xb0, 0x75, 0xb0, 0xea, - 0xb1, 0x60, 0xb1, 0xd6, 0xb2, 0x4b, 0xb2, 0xc2, 0xb3, 0x38, 0xb3, 0xae, - 0xb4, 0x25, 0xb4, 0x9c, 0xb5, 0x13, 0xb5, 0x8a, 0xb6, 0x01, 0xb6, 0x79, - 0xb6, 0xf0, 0xb7, 0x68, 0xb7, 0xe0, 0xb8, 0x59, 0xb8, 0xd1, 0xb9, 0x4a, - 0xb9, 0xc2, 0xba, 0x3b, 0xba, 0xb5, 0xbb, 0x2e, 0xbb, 0xa7, 0xbc, 0x21, - 0xbc, 0x9b, 0xbd, 0x15, 0xbd, 0x8f, 0xbe, 0x0a, 0xbe, 0x84, 0xbe, 0xff, - 0xbf, 0x7a, 0xbf, 0xf5, 0xc0, 0x70, 0xc0, 0xec, 0xc1, 0x67, 0xc1, 0xe3, - 0xc2, 0x5f, 0xc2, 0xdb, 0xc3, 0x58, 0xc3, 0xd4, 0xc4, 0x51, 0xc4, 0xce, - 0xc5, 0x4b, 0xc5, 0xc8, 0xc6, 0x46, 0xc6, 0xc3, 0xc7, 0x41, 0xc7, 0xbf, - 0xc8, 0x3d, 0xc8, 0xbc, 0xc9, 0x3a, 0xc9, 0xb9, 0xca, 0x38, 0xca, 0xb7, - 0xcb, 0x36, 0xcb, 0xb6, 0xcc, 0x35, 0xcc, 0xb5, 0xcd, 0x35, 0xcd, 0xb5, - 0xce, 0x36, 0xce, 0xb6, 0xcf, 0x37, 0xcf, 0xb8, 0xd0, 0x39, 0xd0, 0xba, - 0xd1, 0x3c, 0xd1, 0xbe, 0xd2, 0x3f, 0xd2, 0xc1, 0xd3, 0x44, 0xd3, 0xc6, - 0xd4, 0x49, 0xd4, 0xcb, 0xd5, 0x4e, 0xd5, 0xd1, 0xd6, 0x55, 0xd6, 0xd8, - 0xd7, 0x5c, 0xd7, 0xe0, 0xd8, 0x64, 0xd8, 0xe8, 0xd9, 0x6c, 0xd9, 0xf1, - 0xda, 0x76, 0xda, 0xfb, 0xdb, 0x80, 0xdc, 0x05, 0xdc, 0x8a, 0xdd, 0x10, - 0xdd, 0x96, 0xde, 0x1c, 0xde, 0xa2, 0xdf, 0x29, 0xdf, 0xaf, 0xe0, 0x36, - 0xe0, 0xbd, 0xe1, 0x44, 0xe1, 0xcc, 0xe2, 0x53, 0xe2, 0xdb, 0xe3, 0x63, - 0xe3, 0xeb, 0xe4, 0x73, 0xe4, 0xfc, 0xe5, 0x84, 0xe6, 0x0d, 0xe6, 0x96, - 0xe7, 0x1f, 0xe7, 0xa9, 0xe8, 0x32, 0xe8, 0xbc, 0xe9, 0x46, 0xe9, 0xd0, - 0xea, 0x5b, 0xea, 0xe5, 0xeb, 0x70, 0xeb, 0xfb, 0xec, 0x86, 0xed, 0x11, - 0xed, 0x9c, 0xee, 0x28, 0xee, 0xb4, 0xef, 0x40, 0xef, 0xcc, 0xf0, 0x58, - 0xf0, 0xe5, 0xf1, 0x72, 0xf1, 0xff, 0xf2, 0x8c, 0xf3, 0x19, 0xf3, 0xa7, - 0xf4, 0x34, 0xf4, 0xc2, 0xf5, 0x50, 0xf5, 0xde, 0xf6, 0x6d, 0xf6, 0xfb, - 0xf7, 0x8a, 0xf8, 0x19, 0xf8, 0xa8, 0xf9, 0x38, 0xf9, 0xc7, 0xfa, 0x57, - 0xfa, 0xe7, 0xfb, 0x77, 0xfc, 0x07, 0xfc, 0x98, 0xfd, 0x29, 0xfd, 0xba, - 0xfe, 0x4b, 0xfe, 0xdc, 0xff, 0x6d, 0xff, 0xff, 0x64, 0x65, 0x73, 0x63, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2e, 0x49, 0x45, 0x43, 0x20, - 0x36, 0x31, 0x39, 0x36, 0x36, 0x2d, 0x32, 0x2d, 0x31, 0x20, 0x44, 0x65, - 0x66, 0x61, 0x75, 0x6c, 0x74, 0x20, 0x52, 0x47, 0x42, 0x20, 0x43, 0x6f, - 0x6c, 0x6f, 0x75, 0x72, 0x20, 0x53, 0x70, 0x61, 0x63, 0x65, 0x20, 0x2d, - 0x20, 0x73, 0x52, 0x47, 0x42, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x62, 0x99, - 0x00, 0x00, 0xb7, 0x85, 0x00, 0x00, 0x18, 0xda, 0x58, 0x59, 0x5a, 0x20, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x50, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x6d, 0x65, 0x61, 0x73, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x02, 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x03, 0x16, 0x00, 0x00, 0x03, 0x33, 0x00, 0x00, 0x02, 0xa4, - 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6f, 0xa2, - 0x00, 0x00, 0x38, 0xf5, 0x00, 0x00, 0x03, 0x90, 0x73, 0x69, 0x67, 0x20, - 0x00, 0x00, 0x00, 0x00, 0x43, 0x52, 0x54, 0x20, 0x64, 0x65, 0x73, 0x63, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x2d, 0x52, 0x65, 0x66, 0x65, - 0x72, 0x65, 0x6e, 0x63, 0x65, 0x20, 0x56, 0x69, 0x65, 0x77, 0x69, 0x6e, - 0x67, 0x20, 0x43, 0x6f, 0x6e, 0x64, 0x69, 0x74, 0x69, 0x6f, 0x6e, 0x20, - 0x69, 0x6e, 0x20, 0x49, 0x45, 0x43, 0x20, 0x36, 0x31, 0x39, 0x36, 0x36, - 0x2d, 0x32, 0x2d, 0x31, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x58, 0x59, 0x5a, 0x20, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xd6, - 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0xd3, 0x2d, 0x74, 0x65, 0x78, 0x74, - 0x00, 0x00, 0x00, 0x00, 0x43, 0x6f, 0x70, 0x79, 0x72, 0x69, 0x67, 0x68, - 0x74, 0x20, 0x49, 0x6e, 0x74, 0x65, 0x72, 0x6e, 0x61, 0x74, 0x69, 0x6f, - 0x6e, 0x61, 0x6c, 0x20, 0x43, 0x6f, 0x6c, 0x6f, 0x72, 0x20, 0x43, 0x6f, - 0x6e, 0x73, 0x6f, 0x72, 0x74, 0x69, 0x75, 0x6d, 0x2c, 0x20, 0x32, 0x30, - 0x30, 0x39, 0x00, 0x00, 0x73, 0x66, 0x33, 0x32, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x01, 0x0c, 0x44, 0x00, 0x00, 0x05, 0xdf, 0xff, 0xff, 0xf3, 0x26, - 0x00, 0x00, 0x07, 0x94, 0x00, 0x00, 0xfd, 0x8f, 0xff, 0xff, 0xfb, 0xa1, - 0xff, 0xff, 0xfd, 0xa2, 0x00, 0x00, 0x03, 0xdb, 0x00, 0x00, 0xc0, 0x75, - } - - genericGrayGamma22ICCProfile = []byte{ - 0x00, 0x00, 0x0e, 0x04, 0x61, 0x70, 0x70, 0x6c, 0x02, 0x00, 0x00, 0x00, - 0x6d, 0x6e, 0x74, 0x72, 0x47, 0x52, 0x41, 0x59, 0x58, 0x59, 0x5a, 0x20, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x61, 0x63, 0x73, 0x70, 0x41, 0x50, 0x50, 0x4c, 0x00, 0x00, 0x00, 0x00, - 0x6e, 0x6f, 0x6e, 0x65, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf6, 0xd6, - 0x00, 0x01, 0x00, 0x00, 0x00, 0x00, 0xd3, 0x2d, 0x61, 0x70, 0x70, 0x6c, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x05, - 0x6b, 0x54, 0x52, 0x43, 0x00, 0x00, 0x00, 0xc0, 0x00, 0x00, 0x08, 0x0c, - 0x77, 0x74, 0x70, 0x74, 0x00, 0x00, 0x08, 0xcc, 0x00, 0x00, 0x00, 0x14, - 0x63, 0x70, 0x72, 0x74, 0x00, 0x00, 0x08, 0xe0, 0x00, 0x00, 0x00, 0x23, - 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x09, 0x04, 0x00, 0x00, 0x00, 0x79, - 0x64, 0x73, 0x63, 0x6d, 0x00, 0x00, 0x09, 0x80, 0x00, 0x00, 0x04, 0x82, - 0x63, 0x75, 0x72, 0x76, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x04, 0x00, - 0x00, 0x00, 0x00, 0x05, 0x00, 0x0a, 0x00, 0x0f, 0x00, 0x14, 0x00, 0x19, - 0x00, 0x1e, 0x00, 0x23, 0x00, 0x28, 0x00, 0x2d, 0x00, 0x32, 0x00, 0x37, - 0x00, 0x3b, 0x00, 0x40, 0x00, 0x45, 0x00, 0x4a, 0x00, 0x4f, 0x00, 0x54, - 0x00, 0x59, 0x00, 0x5e, 0x00, 0x63, 0x00, 0x68, 0x00, 0x6d, 0x00, 0x72, - 0x00, 0x77, 0x00, 0x7c, 0x00, 0x81, 0x00, 0x86, 0x00, 0x8b, 0x00, 0x90, - 0x00, 0x95, 0x00, 0x9a, 0x00, 0x9f, 0x00, 0xa4, 0x00, 0xa9, 0x00, 0xae, - 0x00, 0xb2, 0x00, 0xb7, 0x00, 0xbc, 0x00, 0xc1, 0x00, 0xc6, 0x00, 0xcb, - 0x00, 0xd0, 0x00, 0xd5, 0x00, 0xdb, 0x00, 0xe0, 0x00, 0xe5, 0x00, 0xeb, - 0x00, 0xf0, 0x00, 0xf6, 0x00, 0xfb, 0x01, 0x01, 0x01, 0x07, 0x01, 0x0d, - 0x01, 0x13, 0x01, 0x19, 0x01, 0x1f, 0x01, 0x25, 0x01, 0x2b, 0x01, 0x32, - 0x01, 0x38, 0x01, 0x3e, 0x01, 0x45, 0x01, 0x4c, 0x01, 0x52, 0x01, 0x59, - 0x01, 0x60, 0x01, 0x67, 0x01, 0x6e, 0x01, 0x75, 0x01, 0x7c, 0x01, 0x83, - 0x01, 0x8b, 0x01, 0x92, 0x01, 0x9a, 0x01, 0xa1, 0x01, 0xa9, 0x01, 0xb1, - 0x01, 0xb9, 0x01, 0xc1, 0x01, 0xc9, 0x01, 0xd1, 0x01, 0xd9, 0x01, 0xe1, - 0x01, 0xe9, 0x01, 0xf2, 0x01, 0xfa, 0x02, 0x03, 0x02, 0x0c, 0x02, 0x14, - 0x02, 0x1d, 0x02, 0x26, 0x02, 0x2f, 0x02, 0x38, 0x02, 0x41, 0x02, 0x4b, - 0x02, 0x54, 0x02, 0x5d, 0x02, 0x67, 0x02, 0x71, 0x02, 0x7a, 0x02, 0x84, - 0x02, 0x8e, 0x02, 0x98, 0x02, 0xa2, 0x02, 0xac, 0x02, 0xb6, 0x02, 0xc1, - 0x02, 0xcb, 0x02, 0xd5, 0x02, 0xe0, 0x02, 0xeb, 0x02, 0xf5, 0x03, 0x00, - 0x03, 0x0b, 0x03, 0x16, 0x03, 0x21, 0x03, 0x2d, 0x03, 0x38, 0x03, 0x43, - 0x03, 0x4f, 0x03, 0x5a, 0x03, 0x66, 0x03, 0x72, 0x03, 0x7e, 0x03, 0x8a, - 0x03, 0x96, 0x03, 0xa2, 0x03, 0xae, 0x03, 0xba, 0x03, 0xc7, 0x03, 0xd3, - 0x03, 0xe0, 0x03, 0xec, 0x03, 0xf9, 0x04, 0x06, 0x04, 0x13, 0x04, 0x20, - 0x04, 0x2d, 0x04, 0x3b, 0x04, 0x48, 0x04, 0x55, 0x04, 0x63, 0x04, 0x71, - 0x04, 0x7e, 0x04, 0x8c, 0x04, 0x9a, 0x04, 0xa8, 0x04, 0xb6, 0x04, 0xc4, - 0x04, 0xd3, 0x04, 0xe1, 0x04, 0xf0, 0x04, 0xfe, 0x05, 0x0d, 0x05, 0x1c, - 0x05, 0x2b, 0x05, 0x3a, 0x05, 0x49, 0x05, 0x58, 0x05, 0x67, 0x05, 0x77, - 0x05, 0x86, 0x05, 0x96, 0x05, 0xa6, 0x05, 0xb5, 0x05, 0xc5, 0x05, 0xd5, - 0x05, 0xe5, 0x05, 0xf6, 0x06, 0x06, 0x06, 0x16, 0x06, 0x27, 0x06, 0x37, - 0x06, 0x48, 0x06, 0x59, 0x06, 0x6a, 0x06, 0x7b, 0x06, 0x8c, 0x06, 0x9d, - 0x06, 0xaf, 0x06, 0xc0, 0x06, 0xd1, 0x06, 0xe3, 0x06, 0xf5, 0x07, 0x07, - 0x07, 0x19, 0x07, 0x2b, 0x07, 0x3d, 0x07, 0x4f, 0x07, 0x61, 0x07, 0x74, - 0x07, 0x86, 0x07, 0x99, 0x07, 0xac, 0x07, 0xbf, 0x07, 0xd2, 0x07, 0xe5, - 0x07, 0xf8, 0x08, 0x0b, 0x08, 0x1f, 0x08, 0x32, 0x08, 0x46, 0x08, 0x5a, - 0x08, 0x6e, 0x08, 0x82, 0x08, 0x96, 0x08, 0xaa, 0x08, 0xbe, 0x08, 0xd2, - 0x08, 0xe7, 0x08, 0xfb, 0x09, 0x10, 0x09, 0x25, 0x09, 0x3a, 0x09, 0x4f, - 0x09, 0x64, 0x09, 0x79, 0x09, 0x8f, 0x09, 0xa4, 0x09, 0xba, 0x09, 0xcf, - 0x09, 0xe5, 0x09, 0xfb, 0x0a, 0x11, 0x0a, 0x27, 0x0a, 0x3d, 0x0a, 0x54, - 0x0a, 0x6a, 0x0a, 0x81, 0x0a, 0x98, 0x0a, 0xae, 0x0a, 0xc5, 0x0a, 0xdc, - 0x0a, 0xf3, 0x0b, 0x0b, 0x0b, 0x22, 0x0b, 0x39, 0x0b, 0x51, 0x0b, 0x69, - 0x0b, 0x80, 0x0b, 0x98, 0x0b, 0xb0, 0x0b, 0xc8, 0x0b, 0xe1, 0x0b, 0xf9, - 0x0c, 0x12, 0x0c, 0x2a, 0x0c, 0x43, 0x0c, 0x5c, 0x0c, 0x75, 0x0c, 0x8e, - 0x0c, 0xa7, 0x0c, 0xc0, 0x0c, 0xd9, 0x0c, 0xf3, 0x0d, 0x0d, 0x0d, 0x26, - 0x0d, 0x40, 0x0d, 0x5a, 0x0d, 0x74, 0x0d, 0x8e, 0x0d, 0xa9, 0x0d, 0xc3, - 0x0d, 0xde, 0x0d, 0xf8, 0x0e, 0x13, 0x0e, 0x2e, 0x0e, 0x49, 0x0e, 0x64, - 0x0e, 0x7f, 0x0e, 0x9b, 0x0e, 0xb6, 0x0e, 0xd2, 0x0e, 0xee, 0x0f, 0x09, - 0x0f, 0x25, 0x0f, 0x41, 0x0f, 0x5e, 0x0f, 0x7a, 0x0f, 0x96, 0x0f, 0xb3, - 0x0f, 0xcf, 0x0f, 0xec, 0x10, 0x09, 0x10, 0x26, 0x10, 0x43, 0x10, 0x61, - 0x10, 0x7e, 0x10, 0x9b, 0x10, 0xb9, 0x10, 0xd7, 0x10, 0xf5, 0x11, 0x13, - 0x11, 0x31, 0x11, 0x4f, 0x11, 0x6d, 0x11, 0x8c, 0x11, 0xaa, 0x11, 0xc9, - 0x11, 0xe8, 0x12, 0x07, 0x12, 0x26, 0x12, 0x45, 0x12, 0x64, 0x12, 0x84, - 0x12, 0xa3, 0x12, 0xc3, 0x12, 0xe3, 0x13, 0x03, 0x13, 0x23, 0x13, 0x43, - 0x13, 0x63, 0x13, 0x83, 0x13, 0xa4, 0x13, 0xc5, 0x13, 0xe5, 0x14, 0x06, - 0x14, 0x27, 0x14, 0x49, 0x14, 0x6a, 0x14, 0x8b, 0x14, 0xad, 0x14, 0xce, - 0x14, 0xf0, 0x15, 0x12, 0x15, 0x34, 0x15, 0x56, 0x15, 0x78, 0x15, 0x9b, - 0x15, 0xbd, 0x15, 0xe0, 0x16, 0x03, 0x16, 0x26, 0x16, 0x49, 0x16, 0x6c, - 0x16, 0x8f, 0x16, 0xb2, 0x16, 0xd6, 0x16, 0xfa, 0x17, 0x1d, 0x17, 0x41, - 0x17, 0x65, 0x17, 0x89, 0x17, 0xae, 0x17, 0xd2, 0x17, 0xf7, 0x18, 0x1b, - 0x18, 0x40, 0x18, 0x65, 0x18, 0x8a, 0x18, 0xaf, 0x18, 0xd5, 0x18, 0xfa, - 0x19, 0x20, 0x19, 0x45, 0x19, 0x6b, 0x19, 0x91, 0x19, 0xb7, 0x19, 0xdd, - 0x1a, 0x04, 0x1a, 0x2a, 0x1a, 0x51, 0x1a, 0x77, 0x1a, 0x9e, 0x1a, 0xc5, - 0x1a, 0xec, 0x1b, 0x14, 0x1b, 0x3b, 0x1b, 0x63, 0x1b, 0x8a, 0x1b, 0xb2, - 0x1b, 0xda, 0x1c, 0x02, 0x1c, 0x2a, 0x1c, 0x52, 0x1c, 0x7b, 0x1c, 0xa3, - 0x1c, 0xcc, 0x1c, 0xf5, 0x1d, 0x1e, 0x1d, 0x47, 0x1d, 0x70, 0x1d, 0x99, - 0x1d, 0xc3, 0x1d, 0xec, 0x1e, 0x16, 0x1e, 0x40, 0x1e, 0x6a, 0x1e, 0x94, - 0x1e, 0xbe, 0x1e, 0xe9, 0x1f, 0x13, 0x1f, 0x3e, 0x1f, 0x69, 0x1f, 0x94, - 0x1f, 0xbf, 0x1f, 0xea, 0x20, 0x15, 0x20, 0x41, 0x20, 0x6c, 0x20, 0x98, - 0x20, 0xc4, 0x20, 0xf0, 0x21, 0x1c, 0x21, 0x48, 0x21, 0x75, 0x21, 0xa1, - 0x21, 0xce, 0x21, 0xfb, 0x22, 0x27, 0x22, 0x55, 0x22, 0x82, 0x22, 0xaf, - 0x22, 0xdd, 0x23, 0x0a, 0x23, 0x38, 0x23, 0x66, 0x23, 0x94, 0x23, 0xc2, - 0x23, 0xf0, 0x24, 0x1f, 0x24, 0x4d, 0x24, 0x7c, 0x24, 0xab, 0x24, 0xda, - 0x25, 0x09, 0x25, 0x38, 0x25, 0x68, 0x25, 0x97, 0x25, 0xc7, 0x25, 0xf7, - 0x26, 0x27, 0x26, 0x57, 0x26, 0x87, 0x26, 0xb7, 0x26, 0xe8, 0x27, 0x18, - 0x27, 0x49, 0x27, 0x7a, 0x27, 0xab, 0x27, 0xdc, 0x28, 0x0d, 0x28, 0x3f, - 0x28, 0x71, 0x28, 0xa2, 0x28, 0xd4, 0x29, 0x06, 0x29, 0x38, 0x29, 0x6b, - 0x29, 0x9d, 0x29, 0xd0, 0x2a, 0x02, 0x2a, 0x35, 0x2a, 0x68, 0x2a, 0x9b, - 0x2a, 0xcf, 0x2b, 0x02, 0x2b, 0x36, 0x2b, 0x69, 0x2b, 0x9d, 0x2b, 0xd1, - 0x2c, 0x05, 0x2c, 0x39, 0x2c, 0x6e, 0x2c, 0xa2, 0x2c, 0xd7, 0x2d, 0x0c, - 0x2d, 0x41, 0x2d, 0x76, 0x2d, 0xab, 0x2d, 0xe1, 0x2e, 0x16, 0x2e, 0x4c, - 0x2e, 0x82, 0x2e, 0xb7, 0x2e, 0xee, 0x2f, 0x24, 0x2f, 0x5a, 0x2f, 0x91, - 0x2f, 0xc7, 0x2f, 0xfe, 0x30, 0x35, 0x30, 0x6c, 0x30, 0xa4, 0x30, 0xdb, - 0x31, 0x12, 0x31, 0x4a, 0x31, 0x82, 0x31, 0xba, 0x31, 0xf2, 0x32, 0x2a, - 0x32, 0x63, 0x32, 0x9b, 0x32, 0xd4, 0x33, 0x0d, 0x33, 0x46, 0x33, 0x7f, - 0x33, 0xb8, 0x33, 0xf1, 0x34, 0x2b, 0x34, 0x65, 0x34, 0x9e, 0x34, 0xd8, - 0x35, 0x13, 0x35, 0x4d, 0x35, 0x87, 0x35, 0xc2, 0x35, 0xfd, 0x36, 0x37, - 0x36, 0x72, 0x36, 0xae, 0x36, 0xe9, 0x37, 0x24, 0x37, 0x60, 0x37, 0x9c, - 0x37, 0xd7, 0x38, 0x14, 0x38, 0x50, 0x38, 0x8c, 0x38, 0xc8, 0x39, 0x05, - 0x39, 0x42, 0x39, 0x7f, 0x39, 0xbc, 0x39, 0xf9, 0x3a, 0x36, 0x3a, 0x74, - 0x3a, 0xb2, 0x3a, 0xef, 0x3b, 0x2d, 0x3b, 0x6b, 0x3b, 0xaa, 0x3b, 0xe8, - 0x3c, 0x27, 0x3c, 0x65, 0x3c, 0xa4, 0x3c, 0xe3, 0x3d, 0x22, 0x3d, 0x61, - 0x3d, 0xa1, 0x3d, 0xe0, 0x3e, 0x20, 0x3e, 0x60, 0x3e, 0xa0, 0x3e, 0xe0, - 0x3f, 0x21, 0x3f, 0x61, 0x3f, 0xa2, 0x3f, 0xe2, 0x40, 0x23, 0x40, 0x64, - 0x40, 0xa6, 0x40, 0xe7, 0x41, 0x29, 0x41, 0x6a, 0x41, 0xac, 0x41, 0xee, - 0x42, 0x30, 0x42, 0x72, 0x42, 0xb5, 0x42, 0xf7, 0x43, 0x3a, 0x43, 0x7d, - 0x43, 0xc0, 0x44, 0x03, 0x44, 0x47, 0x44, 0x8a, 0x44, 0xce, 0x45, 0x12, - 0x45, 0x55, 0x45, 0x9a, 0x45, 0xde, 0x46, 0x22, 0x46, 0x67, 0x46, 0xab, - 0x46, 0xf0, 0x47, 0x35, 0x47, 0x7b, 0x47, 0xc0, 0x48, 0x05, 0x48, 0x4b, - 0x48, 0x91, 0x48, 0xd7, 0x49, 0x1d, 0x49, 0x63, 0x49, 0xa9, 0x49, 0xf0, - 0x4a, 0x37, 0x4a, 0x7d, 0x4a, 0xc4, 0x4b, 0x0c, 0x4b, 0x53, 0x4b, 0x9a, - 0x4b, 0xe2, 0x4c, 0x2a, 0x4c, 0x72, 0x4c, 0xba, 0x4d, 0x02, 0x4d, 0x4a, - 0x4d, 0x93, 0x4d, 0xdc, 0x4e, 0x25, 0x4e, 0x6e, 0x4e, 0xb7, 0x4f, 0x00, - 0x4f, 0x49, 0x4f, 0x93, 0x4f, 0xdd, 0x50, 0x27, 0x50, 0x71, 0x50, 0xbb, - 0x51, 0x06, 0x51, 0x50, 0x51, 0x9b, 0x51, 0xe6, 0x52, 0x31, 0x52, 0x7c, - 0x52, 0xc7, 0x53, 0x13, 0x53, 0x5f, 0x53, 0xaa, 0x53, 0xf6, 0x54, 0x42, - 0x54, 0x8f, 0x54, 0xdb, 0x55, 0x28, 0x55, 0x75, 0x55, 0xc2, 0x56, 0x0f, - 0x56, 0x5c, 0x56, 0xa9, 0x56, 0xf7, 0x57, 0x44, 0x57, 0x92, 0x57, 0xe0, - 0x58, 0x2f, 0x58, 0x7d, 0x58, 0xcb, 0x59, 0x1a, 0x59, 0x69, 0x59, 0xb8, - 0x5a, 0x07, 0x5a, 0x56, 0x5a, 0xa6, 0x5a, 0xf5, 0x5b, 0x45, 0x5b, 0x95, - 0x5b, 0xe5, 0x5c, 0x35, 0x5c, 0x86, 0x5c, 0xd6, 0x5d, 0x27, 0x5d, 0x78, - 0x5d, 0xc9, 0x5e, 0x1a, 0x5e, 0x6c, 0x5e, 0xbd, 0x5f, 0x0f, 0x5f, 0x61, - 0x5f, 0xb3, 0x60, 0x05, 0x60, 0x57, 0x60, 0xaa, 0x60, 0xfc, 0x61, 0x4f, - 0x61, 0xa2, 0x61, 0xf5, 0x62, 0x49, 0x62, 0x9c, 0x62, 0xf0, 0x63, 0x43, - 0x63, 0x97, 0x63, 0xeb, 0x64, 0x40, 0x64, 0x94, 0x64, 0xe9, 0x65, 0x3d, - 0x65, 0x92, 0x65, 0xe7, 0x66, 0x3d, 0x66, 0x92, 0x66, 0xe8, 0x67, 0x3d, - 0x67, 0x93, 0x67, 0xe9, 0x68, 0x3f, 0x68, 0x96, 0x68, 0xec, 0x69, 0x43, - 0x69, 0x9a, 0x69, 0xf1, 0x6a, 0x48, 0x6a, 0x9f, 0x6a, 0xf7, 0x6b, 0x4f, - 0x6b, 0xa7, 0x6b, 0xff, 0x6c, 0x57, 0x6c, 0xaf, 0x6d, 0x08, 0x6d, 0x60, - 0x6d, 0xb9, 0x6e, 0x12, 0x6e, 0x6b, 0x6e, 0xc4, 0x6f, 0x1e, 0x6f, 0x78, - 0x6f, 0xd1, 0x70, 0x2b, 0x70, 0x86, 0x70, 0xe0, 0x71, 0x3a, 0x71, 0x95, - 0x71, 0xf0, 0x72, 0x4b, 0x72, 0xa6, 0x73, 0x01, 0x73, 0x5d, 0x73, 0xb8, - 0x74, 0x14, 0x74, 0x70, 0x74, 0xcc, 0x75, 0x28, 0x75, 0x85, 0x75, 0xe1, - 0x76, 0x3e, 0x76, 0x9b, 0x76, 0xf8, 0x77, 0x56, 0x77, 0xb3, 0x78, 0x11, - 0x78, 0x6e, 0x78, 0xcc, 0x79, 0x2a, 0x79, 0x89, 0x79, 0xe7, 0x7a, 0x46, - 0x7a, 0xa5, 0x7b, 0x04, 0x7b, 0x63, 0x7b, 0xc2, 0x7c, 0x21, 0x7c, 0x81, - 0x7c, 0xe1, 0x7d, 0x41, 0x7d, 0xa1, 0x7e, 0x01, 0x7e, 0x62, 0x7e, 0xc2, - 0x7f, 0x23, 0x7f, 0x84, 0x7f, 0xe5, 0x80, 0x47, 0x80, 0xa8, 0x81, 0x0a, - 0x81, 0x6b, 0x81, 0xcd, 0x82, 0x30, 0x82, 0x92, 0x82, 0xf4, 0x83, 0x57, - 0x83, 0xba, 0x84, 0x1d, 0x84, 0x80, 0x84, 0xe3, 0x85, 0x47, 0x85, 0xab, - 0x86, 0x0e, 0x86, 0x72, 0x86, 0xd7, 0x87, 0x3b, 0x87, 0x9f, 0x88, 0x04, - 0x88, 0x69, 0x88, 0xce, 0x89, 0x33, 0x89, 0x99, 0x89, 0xfe, 0x8a, 0x64, - 0x8a, 0xca, 0x8b, 0x30, 0x8b, 0x96, 0x8b, 0xfc, 0x8c, 0x63, 0x8c, 0xca, - 0x8d, 0x31, 0x8d, 0x98, 0x8d, 0xff, 0x8e, 0x66, 0x8e, 0xce, 0x8f, 0x36, - 0x8f, 0x9e, 0x90, 0x06, 0x90, 0x6e, 0x90, 0xd6, 0x91, 0x3f, 0x91, 0xa8, - 0x92, 0x11, 0x92, 0x7a, 0x92, 0xe3, 0x93, 0x4d, 0x93, 0xb6, 0x94, 0x20, - 0x94, 0x8a, 0x94, 0xf4, 0x95, 0x5f, 0x95, 0xc9, 0x96, 0x34, 0x96, 0x9f, - 0x97, 0x0a, 0x97, 0x75, 0x97, 0xe0, 0x98, 0x4c, 0x98, 0xb8, 0x99, 0x24, - 0x99, 0x90, 0x99, 0xfc, 0x9a, 0x68, 0x9a, 0xd5, 0x9b, 0x42, 0x9b, 0xaf, - 0x9c, 0x1c, 0x9c, 0x89, 0x9c, 0xf7, 0x9d, 0x64, 0x9d, 0xd2, 0x9e, 0x40, - 0x9e, 0xae, 0x9f, 0x1d, 0x9f, 0x8b, 0x9f, 0xfa, 0xa0, 0x69, 0xa0, 0xd8, - 0xa1, 0x47, 0xa1, 0xb6, 0xa2, 0x26, 0xa2, 0x96, 0xa3, 0x06, 0xa3, 0x76, - 0xa3, 0xe6, 0xa4, 0x56, 0xa4, 0xc7, 0xa5, 0x38, 0xa5, 0xa9, 0xa6, 0x1a, - 0xa6, 0x8b, 0xa6, 0xfd, 0xa7, 0x6e, 0xa7, 0xe0, 0xa8, 0x52, 0xa8, 0xc4, - 0xa9, 0x37, 0xa9, 0xa9, 0xaa, 0x1c, 0xaa, 0x8f, 0xab, 0x02, 0xab, 0x75, - 0xab, 0xe9, 0xac, 0x5c, 0xac, 0xd0, 0xad, 0x44, 0xad, 0xb8, 0xae, 0x2d, - 0xae, 0xa1, 0xaf, 0x16, 0xaf, 0x8b, 0xb0, 0x00, 0xb0, 0x75, 0xb0, 0xea, - 0xb1, 0x60, 0xb1, 0xd6, 0xb2, 0x4b, 0xb2, 0xc2, 0xb3, 0x38, 0xb3, 0xae, - 0xb4, 0x25, 0xb4, 0x9c, 0xb5, 0x13, 0xb5, 0x8a, 0xb6, 0x01, 0xb6, 0x79, - 0xb6, 0xf0, 0xb7, 0x68, 0xb7, 0xe0, 0xb8, 0x59, 0xb8, 0xd1, 0xb9, 0x4a, - 0xb9, 0xc2, 0xba, 0x3b, 0xba, 0xb5, 0xbb, 0x2e, 0xbb, 0xa7, 0xbc, 0x21, - 0xbc, 0x9b, 0xbd, 0x15, 0xbd, 0x8f, 0xbe, 0x0a, 0xbe, 0x84, 0xbe, 0xff, - 0xbf, 0x7a, 0xbf, 0xf5, 0xc0, 0x70, 0xc0, 0xec, 0xc1, 0x67, 0xc1, 0xe3, - 0xc2, 0x5f, 0xc2, 0xdb, 0xc3, 0x58, 0xc3, 0xd4, 0xc4, 0x51, 0xc4, 0xce, - 0xc5, 0x4b, 0xc5, 0xc8, 0xc6, 0x46, 0xc6, 0xc3, 0xc7, 0x41, 0xc7, 0xbf, - 0xc8, 0x3d, 0xc8, 0xbc, 0xc9, 0x3a, 0xc9, 0xb9, 0xca, 0x38, 0xca, 0xb7, - 0xcb, 0x36, 0xcb, 0xb6, 0xcc, 0x35, 0xcc, 0xb5, 0xcd, 0x35, 0xcd, 0xb5, - 0xce, 0x36, 0xce, 0xb6, 0xcf, 0x37, 0xcf, 0xb8, 0xd0, 0x39, 0xd0, 0xba, - 0xd1, 0x3c, 0xd1, 0xbe, 0xd2, 0x3f, 0xd2, 0xc1, 0xd3, 0x44, 0xd3, 0xc6, - 0xd4, 0x49, 0xd4, 0xcb, 0xd5, 0x4e, 0xd5, 0xd1, 0xd6, 0x55, 0xd6, 0xd8, - 0xd7, 0x5c, 0xd7, 0xe0, 0xd8, 0x64, 0xd8, 0xe8, 0xd9, 0x6c, 0xd9, 0xf1, - 0xda, 0x76, 0xda, 0xfb, 0xdb, 0x80, 0xdc, 0x05, 0xdc, 0x8a, 0xdd, 0x10, - 0xdd, 0x96, 0xde, 0x1c, 0xde, 0xa2, 0xdf, 0x29, 0xdf, 0xaf, 0xe0, 0x36, - 0xe0, 0xbd, 0xe1, 0x44, 0xe1, 0xcc, 0xe2, 0x53, 0xe2, 0xdb, 0xe3, 0x63, - 0xe3, 0xeb, 0xe4, 0x73, 0xe4, 0xfc, 0xe5, 0x84, 0xe6, 0x0d, 0xe6, 0x96, - 0xe7, 0x1f, 0xe7, 0xa9, 0xe8, 0x32, 0xe8, 0xbc, 0xe9, 0x46, 0xe9, 0xd0, - 0xea, 0x5b, 0xea, 0xe5, 0xeb, 0x70, 0xeb, 0xfb, 0xec, 0x86, 0xed, 0x11, - 0xed, 0x9c, 0xee, 0x28, 0xee, 0xb4, 0xef, 0x40, 0xef, 0xcc, 0xf0, 0x58, - 0xf0, 0xe5, 0xf1, 0x72, 0xf1, 0xff, 0xf2, 0x8c, 0xf3, 0x19, 0xf3, 0xa7, - 0xf4, 0x34, 0xf4, 0xc2, 0xf5, 0x50, 0xf5, 0xde, 0xf6, 0x6d, 0xf6, 0xfb, - 0xf7, 0x8a, 0xf8, 0x19, 0xf8, 0xa8, 0xf9, 0x38, 0xf9, 0xc7, 0xfa, 0x57, - 0xfa, 0xe7, 0xfb, 0x77, 0xfc, 0x07, 0xfc, 0x98, 0xfd, 0x29, 0xfd, 0xba, - 0xfe, 0x4b, 0xfe, 0xdc, 0xff, 0x6d, 0xff, 0xff, 0x58, 0x59, 0x5a, 0x20, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0xf3, 0x51, 0x00, 0x01, 0x00, 0x00, - 0x00, 0x01, 0x16, 0xcc, 0x74, 0x65, 0x78, 0x74, 0x00, 0x00, 0x00, 0x00, - 0x43, 0x6f, 0x70, 0x79, 0x72, 0x69, 0x67, 0x68, 0x74, 0x20, 0x41, 0x70, - 0x70, 0x6c, 0x65, 0x20, 0x49, 0x6e, 0x63, 0x2e, 0x2c, 0x20, 0x32, 0x30, - 0x30, 0x38, 0x00, 0x00, 0x64, 0x65, 0x73, 0x63, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x1f, 0x47, 0x65, 0x6e, 0x65, 0x72, 0x69, 0x63, 0x20, - 0x47, 0x72, 0x61, 0x79, 0x20, 0x47, 0x61, 0x6d, 0x6d, 0x61, 0x20, 0x32, - 0x2e, 0x32, 0x20, 0x50, 0x72, 0x6f, 0x66, 0x69, 0x6c, 0x65, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x6d, 0x6c, 0x75, 0x63, - 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x11, 0x00, 0x00, 0x00, 0x0c, - 0x65, 0x6e, 0x55, 0x53, 0x00, 0x00, 0x00, 0x3c, 0x00, 0x00, 0x00, 0xdc, - 0x65, 0x73, 0x45, 0x53, 0x00, 0x00, 0x00, 0x4c, 0x00, 0x00, 0x01, 0x18, - 0x64, 0x61, 0x44, 0x4b, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x02, 0x2a, - 0x64, 0x65, 0x44, 0x45, 0x00, 0x00, 0x00, 0x4c, 0x00, 0x00, 0x01, 0xde, - 0x66, 0x69, 0x46, 0x49, 0x00, 0x00, 0x00, 0x46, 0x00, 0x00, 0x02, 0xa0, - 0x66, 0x72, 0x46, 0x55, 0x00, 0x00, 0x00, 0x3e, 0x00, 0x00, 0x02, 0x62, - 0x69, 0x74, 0x49, 0x54, 0x00, 0x00, 0x00, 0x54, 0x00, 0x00, 0x03, 0x70, - 0x6e, 0x6c, 0x4e, 0x4c, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x01, 0x64, - 0x6e, 0x62, 0x4e, 0x4f, 0x00, 0x00, 0x00, 0x3a, 0x00, 0x00, 0x03, 0xc4, - 0x70, 0x74, 0x42, 0x52, 0x00, 0x00, 0x00, 0x4a, 0x00, 0x00, 0x03, 0x26, - 0x73, 0x76, 0x53, 0x45, 0x00, 0x00, 0x00, 0x38, 0x00, 0x00, 0x02, 0x2a, - 0x6a, 0x61, 0x4a, 0x50, 0x00, 0x00, 0x00, 0x26, 0x00, 0x00, 0x03, 0xfe, - 0x6b, 0x6f, 0x4b, 0x52, 0x00, 0x00, 0x00, 0x22, 0x00, 0x00, 0x04, 0x24, - 0x7a, 0x68, 0x54, 0x57, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x00, 0x04, 0x46, - 0x7a, 0x68, 0x43, 0x4e, 0x00, 0x00, 0x00, 0x1e, 0x00, 0x00, 0x04, 0x64, - 0x72, 0x75, 0x52, 0x55, 0x00, 0x00, 0x00, 0x3a, 0x00, 0x00, 0x01, 0xa4, - 0x70, 0x6c, 0x50, 0x4c, 0x00, 0x00, 0x00, 0x40, 0x00, 0x00, 0x02, 0xe6, - 0x00, 0x47, 0x00, 0x65, 0x00, 0x6e, 0x00, 0x65, 0x00, 0x72, 0x00, 0x69, - 0x00, 0x63, 0x00, 0x20, 0x00, 0x47, 0x00, 0x72, 0x00, 0x61, 0x00, 0x79, - 0x00, 0x20, 0x00, 0x47, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, - 0x00, 0x20, 0x00, 0x32, 0x00, 0x2e, 0x00, 0x32, 0x00, 0x20, 0x00, 0x50, - 0x00, 0x72, 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x00, 0x65, - 0x00, 0x50, 0x00, 0x65, 0x00, 0x72, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, - 0x00, 0x20, 0x00, 0x67, 0x00, 0x65, 0x00, 0x6e, 0x00, 0xe9, 0x00, 0x72, - 0x00, 0x69, 0x00, 0x63, 0x00, 0x6f, 0x00, 0x20, 0x00, 0x64, 0x00, 0x65, - 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, - 0x00, 0x20, 0x00, 0x64, 0x00, 0x65, 0x00, 0x20, 0x00, 0x67, 0x00, 0x72, - 0x00, 0x69, 0x00, 0x73, 0x00, 0x65, 0x00, 0x73, 0x00, 0x20, 0x00, 0x32, - 0x00, 0x2c, 0x00, 0x32, 0x00, 0x41, 0x00, 0x6c, 0x00, 0x67, 0x00, 0x65, - 0x00, 0x6d, 0x00, 0x65, 0x00, 0x65, 0x00, 0x6e, 0x00, 0x20, 0x00, 0x67, - 0x00, 0x72, 0x00, 0x69, 0x00, 0x6a, 0x00, 0x73, 0x00, 0x20, 0x00, 0x67, - 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, 0x00, 0x20, 0x00, 0x32, - 0x00, 0x2c, 0x00, 0x32, 0x00, 0x2d, 0x00, 0x70, 0x00, 0x72, 0x00, 0x6f, - 0x00, 0x66, 0x00, 0x69, 0x00, 0x65, 0x00, 0x6c, 0x04, 0x1e, 0x04, 0x31, - 0x04, 0x49, 0x04, 0x30, 0x04, 0x4f, 0x00, 0x20, 0x04, 0x41, 0x04, 0x35, - 0x04, 0x40, 0x04, 0x30, 0x04, 0x4f, 0x00, 0x20, 0x04, 0x33, 0x04, 0x30, - 0x04, 0x3c, 0x04, 0x3c, 0x04, 0x30, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, - 0x00, 0x32, 0x00, 0x2d, 0x04, 0x3f, 0x04, 0x40, 0x04, 0x3e, 0x04, 0x44, - 0x04, 0x38, 0x04, 0x3b, 0x04, 0x4c, 0x00, 0x41, 0x00, 0x6c, 0x00, 0x6c, - 0x00, 0x67, 0x00, 0x65, 0x00, 0x6d, 0x00, 0x65, 0x00, 0x69, 0x00, 0x6e, - 0x00, 0x65, 0x00, 0x73, 0x00, 0x20, 0x00, 0x47, 0x00, 0x72, 0x00, 0x61, - 0x00, 0x75, 0x00, 0x73, 0x00, 0x74, 0x00, 0x75, 0x00, 0x66, 0x00, 0x65, - 0x00, 0x6e, 0x00, 0x70, 0x00, 0x72, 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, - 0x00, 0x6c, 0x00, 0x20, 0x00, 0x47, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, - 0x00, 0x61, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x47, - 0x00, 0x65, 0x00, 0x6e, 0x00, 0x65, 0x00, 0x72, 0x00, 0x69, 0x00, 0x73, - 0x00, 0x6b, 0x00, 0x20, 0x00, 0x67, 0x00, 0x72, 0x00, 0xe5, 0x00, 0x20, - 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, - 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, 0x00, 0x70, 0x00, 0x72, 0x00, 0x6f, - 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x00, 0x50, 0x00, 0x72, 0x00, 0x6f, - 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x00, 0x20, 0x00, 0x67, 0x00, 0xe9, - 0x00, 0x6e, 0x00, 0xe9, 0x00, 0x72, 0x00, 0x69, 0x00, 0x71, 0x00, 0x75, - 0x00, 0x65, 0x00, 0x20, 0x00, 0x67, 0x00, 0x72, 0x00, 0x69, 0x00, 0x73, - 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, - 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x59, 0x00, 0x6c, - 0x00, 0x65, 0x00, 0x69, 0x00, 0x6e, 0x00, 0x65, 0x00, 0x6e, 0x00, 0x20, - 0x00, 0x68, 0x00, 0x61, 0x00, 0x72, 0x00, 0x6d, 0x00, 0x61, 0x00, 0x61, - 0x00, 0x6e, 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, - 0x00, 0x61, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x20, - 0x00, 0x2d, 0x00, 0x70, 0x00, 0x72, 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, - 0x00, 0x69, 0x00, 0x6c, 0x00, 0x69, 0x00, 0x4f, 0x00, 0x67, 0x00, 0xf3, - 0x00, 0x6c, 0x00, 0x6e, 0x00, 0x79, 0x00, 0x20, 0x00, 0x70, 0x00, 0x72, - 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x00, 0x20, 0x00, 0x73, - 0x00, 0x7a, 0x00, 0x61, 0x00, 0x72, 0x00, 0x6f, 0x01, 0x5b, 0x00, 0x63, - 0x00, 0x69, 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, - 0x00, 0x61, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x50, - 0x00, 0x65, 0x00, 0x72, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x00, 0x20, - 0x00, 0x47, 0x00, 0x65, 0x00, 0x6e, 0x00, 0xe9, 0x00, 0x72, 0x00, 0x69, - 0x00, 0x63, 0x00, 0x6f, 0x00, 0x20, 0x00, 0x64, 0x00, 0x61, 0x00, 0x20, - 0x00, 0x47, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x61, 0x00, 0x20, 0x00, 0x64, - 0x00, 0x65, 0x00, 0x20, 0x00, 0x43, 0x00, 0x69, 0x00, 0x6e, 0x00, 0x7a, - 0x00, 0x61, 0x00, 0x73, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, - 0x00, 0x50, 0x00, 0x72, 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, - 0x00, 0x6f, 0x00, 0x20, 0x00, 0x67, 0x00, 0x65, 0x00, 0x6e, 0x00, 0x65, - 0x00, 0x72, 0x00, 0x69, 0x00, 0x63, 0x00, 0x6f, 0x00, 0x20, 0x00, 0x64, - 0x00, 0x65, 0x00, 0x6c, 0x00, 0x6c, 0x00, 0x61, 0x00, 0x20, 0x00, 0x67, - 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, 0x00, 0x20, 0x00, 0x64, - 0x00, 0x65, 0x00, 0x69, 0x00, 0x20, 0x00, 0x67, 0x00, 0x72, 0x00, 0x69, - 0x00, 0x67, 0x00, 0x69, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, - 0x00, 0x47, 0x00, 0x65, 0x00, 0x6e, 0x00, 0x65, 0x00, 0x72, 0x00, 0x69, - 0x00, 0x73, 0x00, 0x6b, 0x00, 0x20, 0x00, 0x67, 0x00, 0x72, 0x00, 0xe5, - 0x00, 0x20, 0x00, 0x67, 0x00, 0x61, 0x00, 0x6d, 0x00, 0x6d, 0x00, 0x61, - 0x00, 0x20, 0x00, 0x32, 0x00, 0x2c, 0x00, 0x32, 0x00, 0x2d, 0x00, 0x70, - 0x00, 0x72, 0x00, 0x6f, 0x00, 0x66, 0x00, 0x69, 0x00, 0x6c, 0x4e, 0x00, - 0x82, 0x2c, 0x30, 0xb0, 0x30, 0xec, 0x30, 0xa4, 0x30, 0xac, 0x30, 0xf3, - 0x30, 0xde, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2e, 0x00, 0x32, 0x00, 0x20, - 0x30, 0xd7, 0x30, 0xed, 0x30, 0xd5, 0x30, 0xa1, 0x30, 0xa4, 0x30, 0xeb, - 0xc7, 0x7c, 0xbc, 0x18, 0x00, 0x20, 0xd6, 0x8c, 0xc0, 0xc9, 0x00, 0x20, - 0xac, 0x10, 0xb9, 0xc8, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2e, 0x00, 0x32, - 0x00, 0x20, 0xd5, 0x04, 0xb8, 0x5c, 0xd3, 0x0c, 0xc7, 0x7c, 0x90, 0x1a, - 0x75, 0x28, 0x70, 0x70, 0x96, 0x8e, 0x51, 0x49, 0x5e, 0xa6, 0x00, 0x20, - 0x00, 0x32, 0x00, 0x2e, 0x00, 0x32, 0x00, 0x20, 0x82, 0x72, 0x5f, 0x69, - 0x63, 0xcf, 0x8f, 0xf0, 0x90, 0x1a, 0x75, 0x28, 0x70, 0x70, 0x5e, 0xa6, - 0x7c, 0xfb, 0x65, 0x70, 0x00, 0x20, 0x00, 0x32, 0x00, 0x2e, 0x00, 0x32, - 0x00, 0x20, 0x63, 0xcf, 0x8f, 0xf0, 0x65, 0x87, 0x4e, 0xf6, 0x00, 0x00, - } - - sRGBV2MicroICCProfilePathToken = "\x00srgb_v2_micro.icc" - sGrayV2MicroICCProfilePathToken = "\x00sgray_v2_micro.icc" - sRGBIEC6196621ICCProfilePathToken = "\x00srgb_iec61966_2_1.icc" - genericGrayGamma22ICCProfilePathToken = "\x00generic_gray_gamma_2_2.icc" - - temporaryDirectory = "" - SRGBV2MicroICCProfilePath = sRGBV2MicroICCProfilePathToken - SGrayV2MicroICCProfilePath = sGrayV2MicroICCProfilePathToken - SRGBIEC6196621ICCProfilePath = sRGBIEC6196621ICCProfilePathToken - GenericGrayGamma22ICCProfilePath = genericGrayGamma22ICCProfilePathToken -) - -// Back support -func ensureLoadICCPath(name *string) (err error) { - if len(*name) > 0 && (*name)[0] == 0 { - switch *name { - case sRGBV2MicroICCProfilePathToken: - *name, err = GetSRGBV2MicroICCProfilePath() - return - case sGrayV2MicroICCProfilePathToken: - *name, err = GetSGrayV2MicroICCProfilePath() - return - case sRGBIEC6196621ICCProfilePathToken: - *name, err = GetSRGBIEC6196621ICCProfilePath() - return - case genericGrayGamma22ICCProfilePathToken: - *name, err = GetGenericGrayGamma22ICCProfilePath() - return - } - } - return -} - -func getTemporaryDirectory() (string, error) { - if temporaryDirectory != "" { - return temporaryDirectory, nil - } - var err error - temporaryDirectory, err = os.MkdirTemp("", "govips-") - if err != nil { - return "", err - } - return temporaryDirectory, nil -} - -var lockIcc sync.Mutex - -func GetSRGBV2MicroICCProfilePath() (string, error) { - return getOrLoad(&SRGBV2MicroICCProfilePath, "srgb_v2_micro.icc", sRGBV2MicroICCProfile) -} - -func GetSGrayV2MicroICCProfilePath() (string, error) { - return getOrLoad(&SGrayV2MicroICCProfilePath, "sgray_v2_micro.icc", sGrayV2MicroICCProfile) -} - -func GetSRGBIEC6196621ICCProfilePath() (string, error) { - return getOrLoad(&SRGBIEC6196621ICCProfilePath, "srgb_iec61966_2_1.icc", sRGBIEC6196621ICCProfile) -} - -func GetGenericGrayGamma22ICCProfilePath() (string, error) { - return getOrLoad(&GenericGrayGamma22ICCProfilePath, "generic_gray_gamma_2_2.icc", genericGrayGamma22ICCProfile) -} - -func getOrLoad(pathFile *string, name string, fileBytes []byte) (string, error) { - lockIcc.Lock() - defer lockIcc.Unlock() - if len(*pathFile) > 0 && (*pathFile)[0] != 0 { - return *pathFile, nil - } - - if _, err := getTemporaryDirectory(); err != nil { - return "", err - } - - *pathFile = filepath.Join(temporaryDirectory, name) - if err := os.WriteFile(*pathFile, fileBytes, 0600); err != nil { - return "", err - } - return *pathFile, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/image.c b/vendor/github.com/davidbyttow/govips/v2/vips/image.c deleted file mode 100644 index 6352f0d184..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/image.c +++ /dev/null @@ -1,9 +0,0 @@ -#include "image.h" - -int has_alpha_channel(VipsImage *image) { return vips_image_hasalpha(image); } - -void clear_image(VipsImage **image) { - // Reference-counting in libvips: https://www.libvips.org/API/current/using-from-c.html#using-C-ref - // https://docs.gtk.org/gobject/method.Object.unref.html - if (G_IS_OBJECT(*image)) g_object_unref(*image); -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/image.go b/vendor/github.com/davidbyttow/govips/v2/vips/image.go deleted file mode 100644 index 1eb1d6fdba..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/image.go +++ /dev/null @@ -1,2184 +0,0 @@ -package vips - -// #include "image.h" -import "C" - -import ( - "bytes" - "errors" - "fmt" - "image" - _ "image/gif" - _ "image/jpeg" - _ "image/png" - "io" - "os" - "runtime" - "strconv" - "strings" - "sync" - "unsafe" -) - -const GaussBlurDefaultMinAMpl = 0.2 - -// PreMultiplicationState stores the pre-multiplication band format of the image -type PreMultiplicationState struct { - bandFormat BandFormat -} - -// ImageRef contains a libvips image and manages its lifecycle. -type ImageRef struct { - // NOTE: We keep a reference to this so that the input buffer is - // never garbage collected during processing. Some image loaders use random - // access transcoding and therefore need the original buffer to be in memory. - buf []byte - image *C.VipsImage - format ImageType - originalFormat ImageType - lock sync.Mutex - preMultiplication *PreMultiplicationState - optimizedIccProfile string -} - -// ImageMetadata is a data structure holding the width, height, orientation and other metadata of the picture. -type ImageMetadata struct { - Format ImageType - Width int - Height int - Colorspace Interpretation - Orientation int - Pages int -} - -type Parameter struct { - value interface{} - isSet bool -} - -func (p *Parameter) IsSet() bool { - return p.isSet -} - -func (p *Parameter) set(v interface{}) { - p.value = v - p.isSet = true -} - -type BoolParameter struct { - Parameter -} - -func (p *BoolParameter) Set(v bool) { - p.set(v) -} - -func (p *BoolParameter) Get() bool { - return p.value.(bool) -} - -type IntParameter struct { - Parameter -} - -func (p *IntParameter) Set(v int) { - p.set(v) -} - -func (p *IntParameter) Get() int { - return p.value.(int) -} - -type Float64Parameter struct { - Parameter -} - -func (p *Float64Parameter) Set(v float64) { - p.set(v) -} - -func (p *Float64Parameter) Get() float64 { - return p.value.(float64) -} - -// ImportParams are options for loading an image. Some are type-specific. -// For default loading, use NewImportParams() or specify nil -type ImportParams struct { - AutoRotate BoolParameter - FailOnError BoolParameter - Page IntParameter - NumPages IntParameter - Density IntParameter - - JpegShrinkFactor IntParameter - HeifThumbnail BoolParameter - SvgUnlimited BoolParameter -} - -// NewImportParams creates default ImportParams -func NewImportParams() *ImportParams { - p := &ImportParams{} - p.FailOnError.Set(true) - return p -} - -// OptionString convert import params to option_string -func (i *ImportParams) OptionString() string { - var values []string - if v := i.NumPages; v.IsSet() { - values = append(values, "n="+strconv.Itoa(v.Get())) - } - if v := i.Page; v.IsSet() { - values = append(values, "page="+strconv.Itoa(v.Get())) - } - if v := i.Density; v.IsSet() { - values = append(values, "dpi="+strconv.Itoa(v.Get())) - } - if v := i.FailOnError; v.IsSet() { - values = append(values, "fail="+boolToStr(v.Get())) - } - if v := i.JpegShrinkFactor; v.IsSet() { - values = append(values, "shrink="+strconv.Itoa(v.Get())) - } - if v := i.AutoRotate; v.IsSet() { - values = append(values, "autorotate="+boolToStr(v.Get())) - } - if v := i.SvgUnlimited; v.IsSet() { - values = append(values, "unlimited="+boolToStr(v.Get())) - } - if v := i.HeifThumbnail; v.IsSet() { - values = append(values, "thumbnail="+boolToStr(v.Get())) - } - return strings.Join(values, ",") -} - -func boolToStr(v bool) string { - if v { - return "TRUE" - } - return "FALSE" -} - -// ExportParams are options when exporting an image to file or buffer. -// Deprecated: Use format-specific params -type ExportParams struct { - Format ImageType - Quality int - Compression int - Interlaced bool - Lossless bool - Effort int - StripMetadata bool - OptimizeCoding bool // jpeg param - SubsampleMode SubsampleMode // jpeg param - TrellisQuant bool // jpeg param - OvershootDeringing bool // jpeg param - OptimizeScans bool // jpeg param - QuantTable int // jpeg param - Speed int // avif param -} - -// NewDefaultExportParams creates default values for an export when image type is not JPEG, PNG or WEBP. -// By default, govips creates interlaced, lossy images with a quality of 80/100 and compression of 6/10. -// As these are default values for a wide variety of image formats, their application varies. -// Some formats use the quality parameters, some compression, etc. -// Deprecated: Use format-specific params -func NewDefaultExportParams() *ExportParams { - return &ExportParams{ - Format: ImageTypeUnknown, // defaults to the starting encoder - Quality: 80, - Compression: 6, - Interlaced: true, - Lossless: false, - Effort: 4, - } -} - -// NewDefaultJPEGExportParams creates default values for an export of a JPEG image. -// By default, govips creates interlaced JPEGs with a quality of 80/100. -// Deprecated: Use NewJpegExportParams -func NewDefaultJPEGExportParams() *ExportParams { - return &ExportParams{ - Format: ImageTypeJPEG, - Quality: 80, - Interlaced: true, - } -} - -// NewDefaultPNGExportParams creates default values for an export of a PNG image. -// By default, govips creates non-interlaced PNGs with a compression of 6/10. -// Deprecated: Use NewPngExportParams -func NewDefaultPNGExportParams() *ExportParams { - return &ExportParams{ - Format: ImageTypePNG, - Compression: 6, - Interlaced: false, - } -} - -// NewDefaultWEBPExportParams creates default values for an export of a WEBP image. -// By default, govips creates lossy images with a quality of 75/100. -// Deprecated: Use NewWebpExportParams -func NewDefaultWEBPExportParams() *ExportParams { - return &ExportParams{ - Format: ImageTypeWEBP, - Quality: 75, - Lossless: false, - Effort: 4, - } -} - -// JpegExportParams are options when exporting a JPEG to file or buffer -type JpegExportParams struct { - StripMetadata bool - Quality int - Interlace bool - OptimizeCoding bool - SubsampleMode SubsampleMode - TrellisQuant bool - OvershootDeringing bool - OptimizeScans bool - QuantTable int -} - -// NewJpegExportParams creates default values for an export of a JPEG image. -// By default, govips creates interlaced JPEGs with a quality of 80/100. -func NewJpegExportParams() *JpegExportParams { - return &JpegExportParams{ - Quality: 80, - Interlace: true, - } -} - -// PngExportParams are options when exporting a PNG to file or buffer -type PngExportParams struct { - StripMetadata bool - Compression int - Filter PngFilter - Interlace bool - Quality int - Palette bool - Dither float64 - Bitdepth int - Profile string // TODO: Use this param during save -} - -// NewPngExportParams creates default values for an export of a PNG image. -// By default, govips creates non-interlaced PNGs with a compression of 6/10. -func NewPngExportParams() *PngExportParams { - return &PngExportParams{ - Compression: 6, - Filter: PngFilterNone, - Interlace: false, - Palette: false, - } -} - -// WebpExportParams are options when exporting a WEBP to file or buffer -// see https://www.libvips.org/API/current/VipsForeignSave.html#vips-webpsave -// for details on each parameter -type WebpExportParams struct { - StripMetadata bool - Quality int - Lossless bool - NearLossless bool - ReductionEffort int - IccProfile string - MinSize bool - MinKeyFrames int - MaxKeyFrames int -} - -// NewWebpExportParams creates default values for an export of a WEBP image. -// By default, govips creates lossy images with a quality of 75/100. -func NewWebpExportParams() *WebpExportParams { - return &WebpExportParams{ - Quality: 75, - Lossless: false, - NearLossless: false, - ReductionEffort: 4, - } -} - -// TiffExportParams are options when exporting a TIFF to file or buffer -type TiffExportParams struct { - StripMetadata bool - Quality int - Compression TiffCompression - Predictor TiffPredictor - Pyramid bool - Tile bool - TileHeight int - TileWidth int -} - -// NewTiffExportParams creates default values for an export of a TIFF image. -func NewTiffExportParams() *TiffExportParams { - return &TiffExportParams{ - Quality: 80, - Compression: TiffCompressionLzw, - Predictor: TiffPredictorHorizontal, - Pyramid: false, - Tile: false, - TileHeight: 256, - TileWidth: 256, - } -} - -// GifExportParams are options when exporting a GIF to file or buffer -// Please note that if vips version is above 8.12, then `vips_gifsave_buffer` is used, and only `Dither`, `Effort`, `Bitdepth` is used. -// If vips version is below 8.12, then `vips_magicksave_buffer` is used, and only `Bitdepth`, `Quality` is used. -// StripMetadata does nothing to Gif images. -type GifExportParams struct { - StripMetadata bool - Quality int - Dither float64 - Effort int - Bitdepth int -} - -// NewGifExportParams creates default values for an export of a GIF image. -func NewGifExportParams() *GifExportParams { - return &GifExportParams{ - Quality: 75, - Effort: 7, - Bitdepth: 8, - } -} - -// HeifExportParams are options when exporting a HEIF to file or buffer -type HeifExportParams struct { - Quality int - Bitdepth int - Effort int - Lossless bool -} - -// NewHeifExportParams creates default values for an export of a HEIF image. -func NewHeifExportParams() *HeifExportParams { - return &HeifExportParams{ - Quality: 80, - Bitdepth: 8, - Effort: 5, - Lossless: false, - } -} - -// AvifExportParams are options when exporting an AVIF to file or buffer. -type AvifExportParams struct { - StripMetadata bool - Quality int - Bitdepth int - Effort int - Lossless bool - - // DEPRECATED - Use Effort instead. - Speed int -} - -// NewAvifExportParams creates default values for an export of an AVIF image. -func NewAvifExportParams() *AvifExportParams { - return &AvifExportParams{ - Quality: 80, - Bitdepth: 8, - Effort: 5, - Lossless: false, - } -} - -// Jp2kExportParams are options when exporting an JPEG2000 to file or buffer. -type Jp2kExportParams struct { - Quality int - Lossless bool - TileWidth int - TileHeight int - SubsampleMode SubsampleMode -} - -// NewJp2kExportParams creates default values for an export of an JPEG2000 image. -func NewJp2kExportParams() *Jp2kExportParams { - return &Jp2kExportParams{ - Quality: 80, - Lossless: false, - TileWidth: 512, - TileHeight: 512, - } -} - -// JxlExportParams are options when exporting an JXL to file or buffer. -type JxlExportParams struct { - Quality int - Lossless bool - Tier int - Distance float64 - Effort int -} - -// NewJxlExportParams creates default values for an export of an JXL image. -func NewJxlExportParams() *JxlExportParams { - return &JxlExportParams{ - Quality: 75, - Lossless: false, - Effort: 7, - Distance: 1.0, - } -} - -// NewImageFromReader loads an ImageRef from the given reader -func NewImageFromReader(r io.Reader) (*ImageRef, error) { - buf, err := io.ReadAll(r) - if err != nil { - return nil, err - } - - return NewImageFromBuffer(buf) -} - -// NewImageFromFile loads an image from file and creates a new ImageRef -func NewImageFromFile(file string) (*ImageRef, error) { - return LoadImageFromFile(file, nil) -} - -// LoadImageFromFile loads an image from file and creates a new ImageRef -func LoadImageFromFile(file string, params *ImportParams) (*ImageRef, error) { - buf, err := os.ReadFile(file) - if err != nil { - return nil, err - } - - govipsLog("govips", LogLevelDebug, fmt.Sprintf("creating imageRef from file %s", file)) - return LoadImageFromBuffer(buf, params) -} - -// NewImageFromBuffer loads an image buffer and creates a new Image -func NewImageFromBuffer(buf []byte) (*ImageRef, error) { - return LoadImageFromBuffer(buf, nil) -} - -// LoadImageFromBuffer loads an image buffer and creates a new Image -func LoadImageFromBuffer(buf []byte, params *ImportParams) (*ImageRef, error) { - startupIfNeeded() - - if params == nil { - params = NewImportParams() - } - - vipsImage, currentFormat, originalFormat, err := vipsLoadFromBuffer(buf, params) - if err != nil { - return nil, err - } - - ref := newImageRef(vipsImage, currentFormat, originalFormat, buf) - - govipsLog("govips", LogLevelDebug, fmt.Sprintf("created imageRef %p", ref)) - return ref, nil -} - -// NewThumbnailFromFile loads an image from file and creates a new ImageRef with thumbnail crop -func NewThumbnailFromFile(file string, width, height int, crop Interesting) (*ImageRef, error) { - return LoadThumbnailFromFile(file, width, height, crop, SizeBoth, nil) -} - -// NewThumbnailFromBuffer loads an image buffer and creates a new Image with thumbnail crop -func NewThumbnailFromBuffer(buf []byte, width, height int, crop Interesting) (*ImageRef, error) { - return LoadThumbnailFromBuffer(buf, width, height, crop, SizeBoth, nil) -} - -// NewThumbnailWithSizeFromFile loads an image from file and creates a new ImageRef with thumbnail crop and size -func NewThumbnailWithSizeFromFile(file string, width, height int, crop Interesting, size Size) (*ImageRef, error) { - return LoadThumbnailFromFile(file, width, height, crop, size, nil) -} - -// LoadThumbnailFromFile loads an image from file and creates a new ImageRef with thumbnail crop and size -func LoadThumbnailFromFile(file string, width, height int, crop Interesting, size Size, params *ImportParams) (*ImageRef, error) { - startupIfNeeded() - - vipsImage, format, err := vipsThumbnailFromFile(file, width, height, crop, size, params) - if err != nil { - return nil, err - } - - ref := newImageRef(vipsImage, format, format, nil) - - govipsLog("govips", LogLevelDebug, fmt.Sprintf("created imageref %p", ref)) - return ref, nil -} - -// NewThumbnailWithSizeFromBuffer loads an image buffer and creates a new Image with thumbnail crop and size -func NewThumbnailWithSizeFromBuffer(buf []byte, width, height int, crop Interesting, size Size) (*ImageRef, error) { - return LoadThumbnailFromBuffer(buf, width, height, crop, size, nil) -} - -// LoadThumbnailFromBuffer loads an image buffer and creates a new Image with thumbnail crop and size -func LoadThumbnailFromBuffer(buf []byte, width, height int, crop Interesting, size Size, params *ImportParams) (*ImageRef, error) { - startupIfNeeded() - - vipsImage, format, err := vipsThumbnailFromBuffer(buf, width, height, crop, size, params) - if err != nil { - return nil, err - } - - ref := newImageRef(vipsImage, format, format, buf) - - govipsLog("govips", LogLevelDebug, fmt.Sprintf("created imageref %p", ref)) - return ref, nil -} - -// Metadata returns the metadata (ImageMetadata struct) of the associated ImageRef -func (r *ImageRef) Metadata() *ImageMetadata { - return &ImageMetadata{ - Format: r.Format(), - Width: r.Width(), - Height: r.Height(), - Orientation: r.Orientation(), - Colorspace: r.ColorSpace(), - Pages: r.Pages(), - } -} - -// Copy creates a new copy of the given image. -func (r *ImageRef) Copy() (*ImageRef, error) { - out, err := vipsCopyImage(r.image) - if err != nil { - return nil, err - } - - return newImageRef(out, r.format, r.originalFormat, r.buf), nil -} - -// Copy creates a new copy of the given image with the new X and Y resolution (PPI). -func (r *ImageRef) CopyChangingResolution(xres, yres float64) (*ImageRef, error) { - out, err := vipsCopyImageChangingResolution(r.image, xres, yres) - if err != nil { - return nil, err - } - - return newImageRef(out, r.format, r.originalFormat, r.buf), nil -} - -// Copy creates a new copy of the given image with the interpretation. -func (r *ImageRef) CopyChangingInterpretation(interpretation Interpretation) (*ImageRef, error) { - out, err := vipsCopyImageChangingInterpretation(r.image, interpretation) - if err != nil { - return nil, err - } - - return newImageRef(out, r.format, r.originalFormat, r.buf), nil -} - -// XYZ creates a two-band uint32 image where the elements in the first band have the value of their x coordinate -// and elements in the second band have their y coordinate. -func XYZ(width, height int) (*ImageRef, error) { - vipsImage, err := vipsXYZ(width, height) - return newImageRef(vipsImage, ImageTypeUnknown, ImageTypeUnknown, nil), err -} - -// Identity creates an identity lookup table, which will leave an image unchanged when applied with Maplut. -// Each entry in the table has a value equal to its position. -func Identity(ushort bool) (*ImageRef, error) { - img, err := vipsIdentity(ushort) - return newImageRef(img, ImageTypeUnknown, ImageTypeUnknown, nil), err -} - -// Black creates a new black image of the specified size -func Black(width, height int) (*ImageRef, error) { - vipsImage, err := vipsBlack(width, height) - imageRef := &ImageRef{ - image: vipsImage, - } - runtime.SetFinalizer(imageRef, finalizeImage) - return imageRef, err -} - -func newImageRef(vipsImage *C.VipsImage, currentFormat ImageType, originalFormat ImageType, buf []byte) *ImageRef { - imageRef := &ImageRef{ - image: vipsImage, - format: currentFormat, - originalFormat: originalFormat, - buf: buf, - } - runtime.SetFinalizer(imageRef, finalizeImage) - - return imageRef -} - -func finalizeImage(ref *ImageRef) { - govipsLog("govips", LogLevelDebug, fmt.Sprintf("closing image %p", ref)) - ref.Close() -} - -// Close manually closes the image and frees the memory. Calling Close() is optional. -// Images are automatically closed by GC. However, in high volume applications the GC -// can't keep up with the amount of memory, so you might want to manually close the images. -func (r *ImageRef) Close() { - r.lock.Lock() - - if r.image != nil { - clearImage(r.image) - r.image = nil - } - - r.buf = nil - - r.lock.Unlock() -} - -// Format returns the current format of the vips image. -func (r *ImageRef) Format() ImageType { - return r.format -} - -// OriginalFormat returns the original format of the image when loaded. -// In some cases the loaded image is converted on load, for example, a BMP is automatically converted to PNG -// This method returns the format of the original buffer, as opposed to Format() with will return the format of the -// currently held buffer content. -func (r *ImageRef) OriginalFormat() ImageType { - return r.originalFormat -} - -// Width returns the width of this image. -func (r *ImageRef) Width() int { - return int(r.image.Xsize) -} - -// Height returns the height of this image. -func (r *ImageRef) Height() int { - return int(r.image.Ysize) -} - -// Bands returns the number of bands for this image. -func (r *ImageRef) Bands() int { - return int(r.image.Bands) -} - -// HasProfile returns if the image has an ICC profile embedded. -func (r *ImageRef) HasProfile() bool { - return vipsHasICCProfile(r.image) -} - -// HasICCProfile checks whether the image has an ICC profile embedded. Alias to HasProfile -func (r *ImageRef) HasICCProfile() bool { - return r.HasProfile() -} - -// HasIPTC returns a boolean whether the image in question has IPTC data associated with it. -func (r *ImageRef) HasIPTC() bool { - return vipsHasIPTC(r.image) -} - -// HasAlpha returns if the image has an alpha layer. -func (r *ImageRef) HasAlpha() bool { - return vipsHasAlpha(r.image) -} - -// Orientation returns the orientation number as it appears in the EXIF, if present -func (r *ImageRef) Orientation() int { - return vipsGetMetaOrientation(r.image) -} - -// Deprecated: use Orientation() instead -func (r *ImageRef) GetOrientation() int { - return r.Orientation() -} - -// SetOrientation sets the orientation in the EXIF header of the associated image. -func (r *ImageRef) SetOrientation(orientation int) error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsSetMetaOrientation(out, orientation) - - r.setImage(out) - return nil -} - -// RemoveOrientation removes the EXIF orientation information of the image. -func (r *ImageRef) RemoveOrientation() error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsRemoveMetaOrientation(out) - - r.setImage(out) - return nil -} - -// ResX returns the X resolution -func (r *ImageRef) ResX() float64 { - return float64(r.image.Xres) -} - -// ResY returns the Y resolution -func (r *ImageRef) ResY() float64 { - return float64(r.image.Yres) -} - -// OffsetX returns the X offset -func (r *ImageRef) OffsetX() int { - return int(r.image.Xoffset) -} - -// OffsetY returns the Y offset -func (r *ImageRef) OffsetY() int { - return int(r.image.Yoffset) -} - -// BandFormat returns the current band format -func (r *ImageRef) BandFormat() BandFormat { - return BandFormat(int(r.image.BandFmt)) -} - -// Coding returns the image coding -func (r *ImageRef) Coding() Coding { - return Coding(int(r.image.Coding)) -} - -// Interpretation returns the current interpretation of the color space of the image. -func (r *ImageRef) Interpretation() Interpretation { - return Interpretation(int(r.image.Type)) -} - -// ColorSpace returns the interpretation of the current color space. Alias to Interpretation(). -func (r *ImageRef) ColorSpace() Interpretation { - return r.Interpretation() -} - -// IsColorSpaceSupported returns a boolean whether the image's color space is supported by libvips. -func (r *ImageRef) IsColorSpaceSupported() bool { - return vipsIsColorSpaceSupported(r.image) -} - -// Pages returns the number of pages in the Image -// For animated images this corresponds to the number of frames -func (r *ImageRef) Pages() int { - // libvips uses the same attribute (n_pages) to represent the number of pyramid layers in JP2K - // as we interpret the attribute as frames and JP2K does not support animation we override this with 1 - if r.format == ImageTypeJP2K { - return 1 - } - - return vipsGetImageNPages(r.image) -} - -// Deprecated: use Pages() instead -func (r *ImageRef) GetPages() int { - return r.Pages() -} - -// SetPages sets the number of pages in the Image -// For animated images this corresponds to the number of frames -func (r *ImageRef) SetPages(pages int) error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsSetImageNPages(out, pages) - - r.setImage(out) - return nil -} - -// PageHeight return the height of a single page -func (r *ImageRef) PageHeight() int { - return vipsGetPageHeight(r.image) -} - -// GetPageHeight return the height of a single page -// Deprecated use PageHeight() instead -func (r *ImageRef) GetPageHeight() int { - return vipsGetPageHeight(r.image) -} - -// SetPageHeight set the height of a page -// For animated images this is used when "unrolling" back to frames -func (r *ImageRef) SetPageHeight(height int) error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsSetPageHeight(out, height) - - r.setImage(out) - return nil -} - -// PageDelay get the page delay array for animation -func (r *ImageRef) PageDelay() ([]int, error) { - n := vipsGetImageNPages(r.image) - if n <= 1 { - // should not call if not multi page - return nil, nil - } - return vipsImageGetDelay(r.image, n) -} - -// SetPageDelay set the page delay array for animation -func (r *ImageRef) SetPageDelay(delay []int) error { - var data []C.int - for _, d := range delay { - data = append(data, C.int(d)) - } - return vipsImageSetDelay(r.image, data) -} - -// Export creates a byte array of the image for use. -// The function returns a byte array that can be written to a file e.g. via os.WriteFile(). -// N.B. govips does not currently have built-in support for directly exporting to a file. -// The function also returns a copy of the image metadata as well as an error. -// Deprecated: Use ExportNative or format-specific Export methods -func (r *ImageRef) Export(params *ExportParams) ([]byte, *ImageMetadata, error) { - if params == nil || params.Format == ImageTypeUnknown { - return r.ExportNative() - } - - format := params.Format - - if !IsTypeSupported(format) { - return nil, r.newMetadata(ImageTypeUnknown), fmt.Errorf("cannot save to %#v", ImageTypes[format]) - } - - switch format { - case ImageTypeGIF: - return r.ExportGIF(&GifExportParams{ - Quality: params.Quality, - }) - case ImageTypeWEBP: - return r.ExportWebp(&WebpExportParams{ - StripMetadata: params.StripMetadata, - Quality: params.Quality, - Lossless: params.Lossless, - ReductionEffort: params.Effort, - }) - case ImageTypePNG: - return r.ExportPng(&PngExportParams{ - StripMetadata: params.StripMetadata, - Compression: params.Compression, - Interlace: params.Interlaced, - }) - case ImageTypeTIFF: - compression := TiffCompressionLzw - if params.Lossless { - compression = TiffCompressionNone - } - return r.ExportTiff(&TiffExportParams{ - StripMetadata: params.StripMetadata, - Quality: params.Quality, - Compression: compression, - }) - case ImageTypeHEIF: - return r.ExportHeif(&HeifExportParams{ - Quality: params.Quality, - Lossless: params.Lossless, - }) - case ImageTypeAVIF: - return r.ExportAvif(&AvifExportParams{ - StripMetadata: params.StripMetadata, - Quality: params.Quality, - Lossless: params.Lossless, - Speed: params.Speed, - }) - case ImageTypeJXL: - return r.ExportJxl(&JxlExportParams{ - Quality: params.Quality, - Lossless: params.Lossless, - Effort: params.Effort, - }) - default: - format = ImageTypeJPEG - return r.ExportJpeg(&JpegExportParams{ - Quality: params.Quality, - StripMetadata: params.StripMetadata, - Interlace: params.Interlaced, - OptimizeCoding: params.OptimizeCoding, - SubsampleMode: params.SubsampleMode, - TrellisQuant: params.TrellisQuant, - OvershootDeringing: params.OvershootDeringing, - OptimizeScans: params.OptimizeScans, - QuantTable: params.QuantTable, - }) - } -} - -// ExportNative exports the image to a buffer based on its native format with default parameters. -func (r *ImageRef) ExportNative() ([]byte, *ImageMetadata, error) { - switch r.format { - case ImageTypeJPEG: - return r.ExportJpeg(NewJpegExportParams()) - case ImageTypePNG: - return r.ExportPng(NewPngExportParams()) - case ImageTypeWEBP: - return r.ExportWebp(NewWebpExportParams()) - case ImageTypeHEIF: - return r.ExportHeif(NewHeifExportParams()) - case ImageTypeTIFF: - return r.ExportTiff(NewTiffExportParams()) - case ImageTypeAVIF: - return r.ExportAvif(NewAvifExportParams()) - case ImageTypeJP2K: - return r.ExportJp2k(NewJp2kExportParams()) - case ImageTypeGIF: - return r.ExportGIF(NewGifExportParams()) - case ImageTypeJXL: - return r.ExportJxl(NewJxlExportParams()) - default: - return r.ExportJpeg(NewJpegExportParams()) - } -} - -// ExportJpeg exports the image as JPEG to a buffer. -func (r *ImageRef) ExportJpeg(params *JpegExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewJpegExportParams() - } - - buf, err := vipsSaveJPEGToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeJPEG), nil -} - -// ExportPng exports the image as PNG to a buffer. -func (r *ImageRef) ExportPng(params *PngExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewPngExportParams() - } - - buf, err := vipsSavePNGToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypePNG), nil -} - -// ExportWebp exports the image as WEBP to a buffer. -func (r *ImageRef) ExportWebp(params *WebpExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewWebpExportParams() - } - - paramsWithIccProfile := *params - paramsWithIccProfile.IccProfile = r.optimizedIccProfile - - buf, err := vipsSaveWebPToBuffer(r.image, paramsWithIccProfile) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeWEBP), nil -} - -// ExportHeif exports the image as HEIF to a buffer. -func (r *ImageRef) ExportHeif(params *HeifExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewHeifExportParams() - } - - buf, err := vipsSaveHEIFToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeHEIF), nil -} - -// ExportTiff exports the image as TIFF to a buffer. -func (r *ImageRef) ExportTiff(params *TiffExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewTiffExportParams() - } - - buf, err := vipsSaveTIFFToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeTIFF), nil -} - -// ExportGIF exports the image as GIF to a buffer. -func (r *ImageRef) ExportGIF(params *GifExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewGifExportParams() - } - - buf, err := vipsSaveGIFToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeGIF), nil -} - -// ExportAvif exports the image as AVIF to a buffer. -func (r *ImageRef) ExportAvif(params *AvifExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewAvifExportParams() - } - - buf, err := vipsSaveAVIFToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeAVIF), nil -} - -// ExportJp2k exports the image as JPEG2000 to a buffer. -func (r *ImageRef) ExportJp2k(params *Jp2kExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewJp2kExportParams() - } - - buf, err := vipsSaveJP2KToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeJP2K), nil -} - -// ExportJxl exports the image as JPEG XL to a buffer. -func (r *ImageRef) ExportJxl(params *JxlExportParams) ([]byte, *ImageMetadata, error) { - if params == nil { - params = NewJxlExportParams() - } - - buf, err := vipsSaveJxlToBuffer(r.image, *params) - if err != nil { - return nil, nil, err - } - - return buf, r.newMetadata(ImageTypeJXL), nil -} - -// CompositeMulti composites the given overlay image on top of the associated image with provided blending mode. -func (r *ImageRef) CompositeMulti(ins []*ImageComposite) error { - out, err := vipsComposite(toVipsCompositeStructs(r, ins)) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Composite composites the given overlay image on top of the associated image with provided blending mode. -func (r *ImageRef) Composite(overlay *ImageRef, mode BlendMode, x, y int) error { - out, err := vipsComposite2(r.image, overlay.image, mode, x, y) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Insert draws the image on top of the associated image at the given coordinates. -func (r *ImageRef) Insert(sub *ImageRef, x, y int, expand bool, background *ColorRGBA) error { - out, err := vipsInsert(r.image, sub.image, x, y, expand, background) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Join joins this image with another in the direction specified -func (r *ImageRef) Join(in *ImageRef, dir Direction) error { - out, err := vipsJoin(r.image, in.image, dir) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ArrayJoin joins an array of images together wrapping at each n images -func (r *ImageRef) ArrayJoin(images []*ImageRef, across int) error { - allImages := append([]*ImageRef{r}, images...) - inputs := make([]*C.VipsImage, len(allImages)) - for i := range inputs { - inputs[i] = allImages[i].image - } - out, err := vipsArrayJoin(inputs, across) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Mapim resamples an image using index to look up pixels -func (r *ImageRef) Mapim(index *ImageRef) error { - out, err := vipsMapim(r.image, index.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Maplut maps an image through another image acting as a LUT (Look Up Table) -func (r *ImageRef) Maplut(lut *ImageRef) error { - out, err := vipsMaplut(r.image, lut.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ExtractBand extracts one or more bands out of the image (replacing the associated ImageRef) -func (r *ImageRef) ExtractBand(band int, num int) error { - out, err := vipsExtractBand(r.image, band, num) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ExtractBandToImage extracts one or more bands out of the image to a new image -func (r *ImageRef) ExtractBandToImage(band int, num int) (*ImageRef, error) { - out, err := vipsExtractBand(r.image, band, num) - if err != nil { - return nil, err - } - return newImageRef(out, ImageTypeUnknown, ImageTypeUnknown, nil), nil -} - -// BandJoin joins a set of images together, bandwise. -func (r *ImageRef) BandJoin(images ...*ImageRef) error { - vipsImages := []*C.VipsImage{r.image} - for _, vipsImage := range images { - vipsImages = append(vipsImages, vipsImage.image) - } - - out, err := vipsBandJoin(vipsImages) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// BandSplit split an n-band image into n separate images.. -func (r *ImageRef) BandSplit() ([]*ImageRef, error) { - var out []*ImageRef - for i := 0; i < r.Bands(); i++ { - img, err := vipsExtractBand(r.image, i, 1) - if err != nil { - return out, err - } - out = append(out, &ImageRef{image: img}) - } - return out, nil -} - -// BandJoinConst appends a set of constant bands to an image. -func (r *ImageRef) BandJoinConst(constants []float64) error { - out, err := vipsBandJoinConst(r.image, constants) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// AddAlpha adds an alpha channel to the associated image. -func (r *ImageRef) AddAlpha() error { - if vipsHasAlpha(r.image) { - return nil - } - - out, err := vipsAddAlpha(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// PremultiplyAlpha premultiplies the alpha channel. -// See https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-premultiply -func (r *ImageRef) PremultiplyAlpha() error { - if r.preMultiplication != nil || !vipsHasAlpha(r.image) { - return nil - } - - band := r.BandFormat() - - out, err := vipsPremultiplyAlpha(r.image) - if err != nil { - return err - } - r.preMultiplication = &PreMultiplicationState{ - bandFormat: band, - } - r.setImage(out) - return nil -} - -// UnpremultiplyAlpha unpremultiplies any alpha channel. -// See https://libvips.github.io/libvips/API/current/libvips-conversion.html#vips-unpremultiply -func (r *ImageRef) UnpremultiplyAlpha() error { - if r.preMultiplication == nil { - return nil - } - - unpremultiplied, err := vipsUnpremultiplyAlpha(r.image) - if err != nil { - return err - } - defer clearImage(unpremultiplied) - - out, err := vipsCast(unpremultiplied, r.preMultiplication.bandFormat) - if err != nil { - return err - } - - r.preMultiplication = nil - r.setImage(out) - return nil -} - -// Cast converts the image to a target band format -func (r *ImageRef) Cast(format BandFormat) error { - out, err := vipsCast(r.image, format) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Add calculates a sum of the image + addend and stores it back in the image -func (r *ImageRef) Add(addend *ImageRef) error { - out, err := vipsAdd(r.image, addend.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Multiply calculates the product of the image * multiplier and stores it back in the image -func (r *ImageRef) Multiply(multiplier *ImageRef) error { - out, err := vipsMultiply(r.image, multiplier.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Divide calculates the product of the image / denominator and stores it back in the image -func (r *ImageRef) Divide(denominator *ImageRef) error { - out, err := vipsDivide(r.image, denominator.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Linear passes an image through a linear transformation (i.e. output = input * a + b). -// See https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-linear -func (r *ImageRef) Linear(a, b []float64) error { - if len(a) != len(b) { - return errors.New("a and b must be of same length") - } - - out, err := vipsLinear(r.image, a, b, len(a)) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Linear1 runs Linear() with a single constant. -// See https://libvips.github.io/libvips/API/current/libvips-arithmetic.html#vips-linear1 -func (r *ImageRef) Linear1(a, b float64) error { - out, err := vipsLinear1(r.image, a, b) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Adjusts the image's gamma value. -// See https://www.libvips.org/API/current/libvips-conversion.html#vips-gamma -func (r *ImageRef) Gamma(gamma float64) error { - out, err := vipsGamma(r.image, gamma) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// GetRotationAngleFromExif returns the angle which the image is currently rotated in. -// First returned value is the angle and second is a boolean indicating whether image is flipped. -// This is based on the EXIF orientation tag standard. -// If no proper orientation number is provided, the picture will be assumed to be upright. -func GetRotationAngleFromExif(orientation int) (Angle, bool) { - switch orientation { - case 0, 1, 2: - return Angle0, orientation == 2 - case 3, 4: - return Angle180, orientation == 4 - case 5, 8: - return Angle90, orientation == 5 - case 6, 7: - return Angle270, orientation == 7 - } - - return Angle0, false -} - -// AutoRotate rotates the image upright based on the EXIF Orientation tag. -// It also resets the orientation information in the EXIF tag to be 1 (i.e. upright). -// N.B. libvips does not flip images currently (i.e. no support for orientations 2, 4, 5 and 7). -// N.B. due to the HEIF image standard, HEIF images are always autorotated by default on load. -// Thus, calling AutoRotate for HEIF images is not needed. -// todo: use https://www.libvips.org/API/current/libvips-conversion.html#vips-autorot-remove-angle -func (r *ImageRef) AutoRotate() error { - out, err := vipsAutoRotate(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ExtractArea crops the image to a specified area -func (r *ImageRef) ExtractArea(left, top, width, height int) error { - if r.Height() > r.PageHeight() { - // use animated extract area if more than 1 pages loaded - out, err := vipsExtractAreaMultiPage(r.image, left, top, width, height) - if err != nil { - return err - } - r.setImage(out) - } else { - out, err := vipsExtractArea(r.image, left, top, width, height) - if err != nil { - return err - } - r.setImage(out) - } - return nil -} - -// GetICCProfile retrieves the ICC profile data (if any) from the image. -func (r *ImageRef) GetICCProfile() []byte { - bytes, _ := vipsGetICCProfile(r.image) - return bytes -} - -// RemoveICCProfile removes the ICC Profile information from the image. -// Typically, browsers and other software assume images without profile to be in the sRGB color space. -func (r *ImageRef) RemoveICCProfile() error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsRemoveICCProfile(out) - - r.setImage(out) - return nil -} - -// TransformICCProfileWithFallback transforms from the embedded ICC profile of the image to the ICC profile at the given path. -// The fallback ICC profile is used if the image does not have an embedded ICC profile. -func (r *ImageRef) TransformICCProfileWithFallback(targetProfilePath, fallbackProfilePath string) error { - if err := ensureLoadICCPath(&targetProfilePath); err != nil { - return err - } - if err := ensureLoadICCPath(&fallbackProfilePath); err != nil { - return err - } - - depth := 16 - if r.BandFormat() == BandFormatUchar || r.BandFormat() == BandFormatChar || r.BandFormat() == BandFormatNotSet { - depth = 8 - } - - out, err := vipsICCTransform(r.image, targetProfilePath, fallbackProfilePath, IntentPerceptual, depth, true) - if err != nil { - govipsLog("govips", LogLevelError, fmt.Sprintf("failed to do icc transform: %v", err.Error())) - return err - } - - r.setImage(out) - return nil -} - -// TransformICCProfile transforms from the embedded ICC profile of the image to the icc profile at the given path. -func (r *ImageRef) TransformICCProfile(outputProfilePath string) error { - return r.TransformICCProfileWithFallback(outputProfilePath, SRGBIEC6196621ICCProfilePath) -} - -// OptimizeICCProfile optimizes the ICC color profile of the image. -// For two color channel images, it sets a grayscale profile. -// For color images, it sets a CMYK or non-CMYK profile based on the image metadata. -func (r *ImageRef) OptimizeICCProfile() error { - inputProfile := r.determineInputICCProfile() - if !r.HasICCProfile() && (inputProfile == "") { - // No embedded ICC profile in the input image and no input profile determined, nothing to do. - return nil - } - - r.optimizedIccProfile = SRGBV2MicroICCProfilePath - if r.Bands() <= 2 { - r.optimizedIccProfile = SGrayV2MicroICCProfilePath - } - - if err := ensureLoadICCPath(&r.optimizedIccProfile); err != nil { - return err - } - - embedded := r.HasICCProfile() && (inputProfile == "") - - depth := 16 - if r.BandFormat() == BandFormatUchar || r.BandFormat() == BandFormatChar || r.BandFormat() == BandFormatNotSet { - depth = 8 - } - - out, err := vipsICCTransform(r.image, r.optimizedIccProfile, inputProfile, IntentPerceptual, depth, embedded) - if err != nil { - govipsLog("govips", LogLevelError, fmt.Sprintf("failed to do icc transform: %v", err.Error())) - return err - } - - r.setImage(out) - return nil -} - -// RemoveMetadata removes the EXIF metadata from the image. -// N.B. this function won't remove the ICC profile, orientation and pages metadata -// because govips needs it to correctly display the image. -func (r *ImageRef) RemoveMetadata(keep ...string) error { - out, err := vipsCopyImage(r.image) - if err != nil { - return err - } - - vipsRemoveMetadata(out, keep...) - - r.setImage(out) - - return nil -} - -func (r *ImageRef) ImageFields() []string { - return r.GetFields() -} - -func (r *ImageRef) GetFields() []string { - return vipsImageGetFields(r.image) -} - -func (r *ImageRef) SetBlob(name string, data []byte) { - vipsImageSetBlob(r.image, name, data) -} - -func (r *ImageRef) GetBlob(name string) []byte { - return vipsImageGetBlob(r.image, name) -} - -func (r *ImageRef) SetDouble(name string, f float64) { - vipsImageSetDouble(r.image, name, f) -} - -func (r *ImageRef) GetDouble(name string) float64 { - return vipsImageGetDouble(r.image, name) -} - -func (r *ImageRef) SetInt(name string, i int) { - vipsImageSetInt(r.image, name, i) -} - -func (r *ImageRef) GetInt(name string) int { - return vipsImageGetInt(r.image, name) -} - -func (r *ImageRef) SetString(name string, str string) { - vipsImageSetString(r.image, name, str) -} - -func (r *ImageRef) GetString(name string) string { - return vipsImageGetString(r.image, name) -} - -func (r *ImageRef) GetAsString(name string) string { - return vipsImageGetAsString(r.image, name) -} - -func (r *ImageRef) HasExif() bool { - for _, field := range r.ImageFields() { - if strings.HasPrefix(field, "exif-") { - return true - } - } - - return false -} - -func (r *ImageRef) GetExif() map[string]string { - return vipsImageGetExifData(r.image) -} - -// ToColorSpace changes the color space of the image to the interpretation supplied as the parameter. -func (r *ImageRef) ToColorSpace(interpretation Interpretation) error { - out, err := vipsToColorSpace(r.image, interpretation) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Flatten removes the alpha channel from the image and replaces it with the background color -func (r *ImageRef) Flatten(backgroundColor *Color) error { - out, err := vipsFlatten(r.image, backgroundColor) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// GaussianBlur blurs the image -// add support minAmpl -func (r *ImageRef) GaussianBlur(sigmas ...float64) error { - var ( - sigma = sigmas[0] - minAmpl = GaussBlurDefaultMinAMpl - ) - if len(sigmas) >= 2 { - minAmpl = sigmas[1] - } - out, err := vipsGaussianBlur(r.image, sigma, minAmpl) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Sharpen sharpens the image -// sigma: sigma of the gaussian -// x1: flat/jaggy threshold -// m2: slope for jaggy areas -func (r *ImageRef) Sharpen(sigma float64, x1 float64, m2 float64) error { - out, err := vipsSharpen(r.image, sigma, x1, m2) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Apply Sobel edge detector to the image. -func (r *ImageRef) Sobel() error { - out, err := vipsSobel(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Modulate the colors -func (r *ImageRef) Modulate(brightness, saturation, hue float64) error { - var err error - var multiplications []float64 - var additions []float64 - - colorspace := r.ColorSpace() - if colorspace == InterpretationRGB { - colorspace = InterpretationSRGB - } - - multiplications = []float64{brightness, saturation, 1} - additions = []float64{0, 0, hue} - - if r.HasAlpha() { - multiplications = append(multiplications, 1) - additions = append(additions, 0) - } - - err = r.ToColorSpace(InterpretationLCH) - if err != nil { - return err - } - - err = r.Linear(multiplications, additions) - if err != nil { - return err - } - - err = r.ToColorSpace(colorspace) - if err != nil { - return err - } - - return nil -} - -// ModulateHSV modulates the image HSV values based on the supplier parameters. -func (r *ImageRef) ModulateHSV(brightness, saturation float64, hue int) error { - var err error - var multiplications []float64 - var additions []float64 - - colorspace := r.ColorSpace() - if colorspace == InterpretationRGB { - colorspace = InterpretationSRGB - } - - if r.HasAlpha() { - multiplications = []float64{1, saturation, brightness, 1} - additions = []float64{float64(hue), 0, 0, 0} - } else { - multiplications = []float64{1, saturation, brightness} - additions = []float64{float64(hue), 0, 0} - } - - err = r.ToColorSpace(InterpretationHSV) - if err != nil { - return err - } - - err = r.Linear(multiplications, additions) - if err != nil { - return err - } - - err = r.ToColorSpace(colorspace) - if err != nil { - return err - } - - return nil -} - -// Invert inverts the image -func (r *ImageRef) Invert() error { - out, err := vipsInvert(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Average finds the average value in an image -func (r *ImageRef) Average() (float64, error) { - out, err := vipsAverage(r.image) - if err != nil { - return 0, err - } - return out, nil -} - -// FindTrim returns the bounding box of the non-border part of the image -// Returned values are left, top, width, height -func (r *ImageRef) FindTrim(threshold float64, backgroundColor *Color) (int, int, int, int, error) { - return vipsFindTrim(r.image, threshold, backgroundColor) -} - -// GetPoint reads a single pixel on an image. -// The pixel values are returned in a slice of length n. -func (r *ImageRef) GetPoint(x int, y int) ([]float64, error) { - n := 3 - if vipsHasAlpha(r.image) { - n = 4 - } - return vipsGetPoint(r.image, n, x, y) -} - -// Stats find many image statistics in a single pass through the data. Image is changed into a one-band -// `BandFormatDouble` image of at least 10 columns by n + 1 (where n is number of bands in image in) -// rows. Columns are statistics, and are, in order: minimum, maximum, sum, sum of squares, mean, -// standard deviation, x coordinate of minimum, y coordinate of minimum, x coordinate of maximum, -// y coordinate of maximum. -// -// Row 0 has statistics for all bands together, row 1 has stats for band 1, and so on. -// -// If there is more than one maxima or minima, one of them will be chosen at random. -func (r *ImageRef) Stats() error { - out, err := vipsStats(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// HistogramFind find the histogram the image. -// Find the histogram for all bands (producing a one-band histogram). -// char and uchar images are cast to uchar before histogramming, all other image types are cast to ushort. -func (r *ImageRef) HistogramFind() error { - out, err := vipsHistFind(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// HistogramCumulative form cumulative histogram. -func (r *ImageRef) HistogramCumulative() error { - out, err := vipsHistCum(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// HistogramNormalise -// The maximum of each band becomes equal to the maximum index, so for example the max for a uchar -// image becomes 255. Normalise each band separately. -func (r *ImageRef) HistogramNormalise() error { - out, err := vipsHistNorm(r.image) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// HistogramEntropy estimate image entropy from a histogram. Entropy is calculated as: -// `-sum(p * log2(p))` -// where p is histogram-value / sum-of-histogram-values. -func (r *ImageRef) HistogramEntropy() (float64, error) { - return vipsHistEntropy(r.image) -} - -// DrawRect draws an (optionally filled) rectangle with a single colour -func (r *ImageRef) DrawRect(ink ColorRGBA, left int, top int, width int, height int, fill bool) error { - err := vipsDrawRect(r.image, ink, left, top, width, height, fill) - if err != nil { - return err - } - return nil -} - -// Rank does rank filtering on an image. A window of size width by height is passed over the image. -// At each position, the pixels inside the window are sorted into ascending order and the pixel at position -// index is output. index numbers from 0. -func (r *ImageRef) Rank(width int, height int, index int) error { - out, err := vipsRank(r.image, width, height, index) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Resize resizes the image based on the scale, maintaining aspect ratio -func (r *ImageRef) Resize(scale float64, kernel Kernel) error { - return r.ResizeWithVScale(scale, -1, kernel) -} - -// ResizeWithVScale resizes the image with both horizontal and vertical scaling. -// The parameters are the scaling factors. -func (r *ImageRef) ResizeWithVScale(hScale, vScale float64, kernel Kernel) error { - if err := r.PremultiplyAlpha(); err != nil { - return err - } - - pages := r.Pages() - pageHeight := r.GetPageHeight() - - out, err := vipsResizeWithVScale(r.image, hScale, vScale, kernel) - if err != nil { - return err - } - r.setImage(out) - - if pages > 1 { - scale := hScale - if vScale != -1 { - scale = vScale - } - newPageHeight := int(float64(pageHeight)*scale + 0.5) - if err := r.SetPageHeight(newPageHeight); err != nil { - return err - } - } - - return r.UnpremultiplyAlpha() -} - -// Thumbnail resizes the image to the given width and height. -// crop decides algorithm vips uses to shrink and crop to fill target, -func (r *ImageRef) Thumbnail(width, height int, crop Interesting) error { - out, err := vipsThumbnail(r.image, width, height, crop, SizeBoth) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ThumbnailWithSize resizes the image to the given width and height. -// crop decides algorithm vips uses to shrink and crop to fill target, -// size controls upsize, downsize, both or force -func (r *ImageRef) ThumbnailWithSize(width, height int, crop Interesting, size Size) error { - out, err := vipsThumbnail(r.image, width, height, crop, size) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Embed embeds the given picture in a new one, i.e. the opposite of ExtractArea -func (r *ImageRef) Embed(left, top, width, height int, extend ExtendStrategy) error { - if r.Height() > r.PageHeight() { - out, err := vipsEmbedMultiPage(r.image, left, top, width, height, extend) - if err != nil { - return err - } - r.setImage(out) - } else { - out, err := vipsEmbed(r.image, left, top, width, height, extend) - if err != nil { - return err - } - r.setImage(out) - } - return nil -} - -// EmbedBackground embeds the given picture with a background color -func (r *ImageRef) EmbedBackground(left, top, width, height int, backgroundColor *Color) error { - c := &ColorRGBA{ - R: backgroundColor.R, - G: backgroundColor.G, - B: backgroundColor.B, - A: 255, - } - if r.Height() > r.PageHeight() { - out, err := vipsEmbedMultiPageBackground(r.image, left, top, width, height, c) - if err != nil { - return err - } - r.setImage(out) - } else { - out, err := vipsEmbedBackground(r.image, left, top, width, height, c) - if err != nil { - return err - } - r.setImage(out) - } - return nil -} - -// EmbedBackgroundRGBA embeds the given picture with a background rgba color -func (r *ImageRef) EmbedBackgroundRGBA(left, top, width, height int, backgroundColor *ColorRGBA) error { - if r.Height() > r.PageHeight() { - out, err := vipsEmbedMultiPageBackground(r.image, left, top, width, height, backgroundColor) - if err != nil { - return err - } - r.setImage(out) - } else { - out, err := vipsEmbedBackground(r.image, left, top, width, height, backgroundColor) - if err != nil { - return err - } - r.setImage(out) - } - return nil -} - -// Zoom zooms the image by repeating pixels (fast nearest-neighbour) -func (r *ImageRef) Zoom(xFactor int, yFactor int) error { - out, err := vipsZoom(r.image, xFactor, yFactor) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Flip flips the image either horizontally or vertically based on the parameter -func (r *ImageRef) Flip(direction Direction) error { - out, err := vipsFlip(r.image, direction) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Recomb recombines the image bands using the matrix provided -func (r *ImageRef) Recomb(matrix [][]float64) error { - numBands := r.Bands() - // Ensure the provided matrix is 3x3 - if len(matrix) != 3 || len(matrix[0]) != 3 || len(matrix[1]) != 3 || len(matrix[2]) != 3 { - return errors.New("Invalid recombination matrix") - } - // If the image is RGBA, expand the matrix to 4x4 - if numBands == 4 { - matrix = append(matrix, []float64{0, 0, 0, 1}) - for i := 0; i < 3; i++ { - matrix[i] = append(matrix[i], 0) - } - } else if numBands != 3 { - return errors.New("Unsupported number of bands") - } - - // Flatten the matrix - var matrixValues []float64 - for _, row := range matrix { - for _, value := range row { - matrixValues = append(matrixValues, value) - } - } - - // Convert the Go slice to a C array and get its size - matrixPtr := unsafe.Pointer(&matrixValues[0]) - matrixSize := C.size_t(len(matrixValues) * 8) // 8 bytes for each float64 - - // Create a VipsImage from the matrix in memory - matrixImage := C.vips_image_new_from_memory(matrixPtr, matrixSize, C.int(numBands), C.int(numBands), 1, C.VIPS_FORMAT_DOUBLE) - - // Check for any Vips errors - errMsg := C.GoString(C.vips_error_buffer()) - if errMsg != "" { - C.vips_error_clear() - return errors.New("Vips error: " + errMsg) - } - - // Recombine the image using the matrix - out, err := vipsRecomb(r.image, matrixImage) - if err != nil { - return err - } - - r.setImage(out) - return nil -} - -// Rotate rotates the image by multiples of 90 degrees. To rotate by arbitrary angles use Similarity. -func (r *ImageRef) Rotate(angle Angle) error { - width := r.Width() - - if r.Pages() > 1 && (angle == Angle90 || angle == Angle270) { - if angle == Angle270 { - if err := r.Flip(DirectionHorizontal); err != nil { - return err - } - } - - if err := r.Grid(r.GetPageHeight(), r.Pages(), 1); err != nil { - return err - } - - if angle == Angle270 { - if err := r.Flip(DirectionHorizontal); err != nil { - return err - } - } - - } - - out, err := vipsRotate(r.image, angle) - if err != nil { - return err - } - r.setImage(out) - - if r.Pages() > 1 && (angle == Angle90 || angle == Angle270) { - if err := r.SetPageHeight(width); err != nil { - return err - } - } - return nil -} - -// Similarity lets you scale, offset and rotate images by arbitrary angles in a single operation while defining the -// color of new background pixels. If the input image has no alpha channel, the alpha on `backgroundColor` will be -// ignored. You can add an alpha channel to an image with `BandJoinConst` (e.g. `img.BandJoinConst([]float64{255})`) or -// AddAlpha. -func (r *ImageRef) Similarity(scale float64, angle float64, backgroundColor *ColorRGBA, - idx float64, idy float64, odx float64, ody float64) error { - out, err := vipsSimilarity(r.image, scale, angle, backgroundColor, idx, idy, odx, ody) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Grid tiles the image pages into a matrix across*down -func (r *ImageRef) Grid(tileHeight, across, down int) error { - out, err := vipsGrid(r.image, tileHeight, across, down) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// SmartCrop will crop the image based on interesting factor -func (r *ImageRef) SmartCrop(width int, height int, interesting Interesting) error { - out, err := vipsSmartCrop(r.image, width, height, interesting) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Crop will crop the image based on coordinate and box size -func (r *ImageRef) Crop(left int, top int, width int, height int) error { - out, err := vipsCrop(r.image, left, top, width, height) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Label overlays a label on top of the image -func (r *ImageRef) Label(labelParams *LabelParams) error { - out, err := labelImage(r.image, labelParams) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// Replicate repeats an image many times across and down -func (r *ImageRef) Replicate(across int, down int) error { - out, err := vipsReplicate(r.image, across, down) - if err != nil { - return err - } - r.setImage(out) - return nil -} - -// ToBytes writes the image to memory in VIPs format and returns the raw bytes, useful for storage. -func (r *ImageRef) ToBytes() ([]byte, error) { - var cSize C.size_t - cData := C.vips_image_write_to_memory(r.image, &cSize) - if cData == nil { - return nil, errors.New("failed to write image to memory") - } - defer C.free(cData) - - data := C.GoBytes(unsafe.Pointer(cData), C.int(cSize)) - return data, nil -} - -func (r *ImageRef) determineInputICCProfile() (inputProfile string) { - if r.Interpretation() == InterpretationCMYK { - inputProfile = "cmyk" - } - return -} - -// ToImage converts a VIPs image to a golang image.Image object, useful for interoperability with other golang libraries -func (r *ImageRef) ToImage(params *ExportParams) (image.Image, error) { - imageBytes, _, err := r.Export(params) - if err != nil { - return nil, err - } - - reader := bytes.NewReader(imageBytes) - img, _, err := image.Decode(reader) - if err != nil { - return nil, err - } - - return img, nil -} - -// setImage resets the image for this image and frees the previous one -func (r *ImageRef) setImage(image *C.VipsImage) { - r.lock.Lock() - defer r.lock.Unlock() - - if r.image == image { - return - } - - if r.image != nil { - clearImage(r.image) - } - - r.image = image -} - -func vipsHasAlpha(in *C.VipsImage) bool { - return int(C.has_alpha_channel(in)) > 0 -} - -func clearImage(ref *C.VipsImage) { - C.clear_image(&ref) -} - -// Coding represents VIPS_CODING type -type Coding int - -// Coding enum -// -//goland:noinspection GoUnusedConst -const ( - CodingError Coding = C.VIPS_CODING_ERROR - CodingNone Coding = C.VIPS_CODING_NONE - CodingLABQ Coding = C.VIPS_CODING_LABQ - CodingRAD Coding = C.VIPS_CODING_RAD -) - -func (r *ImageRef) newMetadata(format ImageType) *ImageMetadata { - return &ImageMetadata{ - Format: format, - Width: r.Width(), - Height: r.Height(), - Colorspace: r.ColorSpace(), - Orientation: r.Orientation(), - Pages: r.Pages(), - } -} - -// Pixelate applies a simple pixelate filter to the image -func Pixelate(imageRef *ImageRef, factor float64) (err error) { - if factor < 1 { - return errors.New("factor must be greater then 1") - } - - width := imageRef.Width() - height := imageRef.Height() - - if err = imageRef.Resize(1/factor, KernelAuto); err != nil { - return - } - - hScale := float64(width) / float64(imageRef.Width()) - vScale := float64(height) / float64(imageRef.Height()) - if err = imageRef.ResizeWithVScale(hScale, vScale, KernelNearest); err != nil { - return - } - - return -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/image.h b/vendor/github.com/davidbyttow/govips/v2/vips/image.h deleted file mode 100644 index 0a116f0082..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/image.h +++ /dev/null @@ -1,8 +0,0 @@ -// https://libvips.github.io/libvips/API/current/VipsImage.html - -#include -#include - -int has_alpha_channel(VipsImage *image); - -void clear_image(VipsImage **image); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/label.c b/vendor/github.com/davidbyttow/govips/v2/vips/label.c deleted file mode 100644 index 01de813438..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/label.c +++ /dev/null @@ -1,37 +0,0 @@ -#include "label.h" - -int text(VipsImage **out, const char *text, const char *font, int width, - int height, VipsAlign align, int dpi) { - return vips_text(out, text, "font", font, "width", width, "height", height, - "align", align, "dpi", dpi, NULL); -} - -int label(VipsImage *in, VipsImage **out, LabelOptions *o) { - double ones[3] = {1, 1, 1}; - VipsImage *base = vips_image_new(); - VipsImage **t = (VipsImage **)vips_object_local_array(VIPS_OBJECT(base), 9); - if (vips_text(&t[0], o->Text, "font", o->Font, "width", o->Width, "height", - o->Height, "align", o->Align, NULL) || - vips_linear1(t[0], &t[1], o->Opacity, 0.0, NULL) || - vips_cast(t[1], &t[2], VIPS_FORMAT_UCHAR, NULL) || - vips_embed(t[2], &t[3], o->OffsetX, o->OffsetY, t[2]->Xsize + o->OffsetX, - t[2]->Ysize + o->OffsetY, NULL)) { - g_object_unref(base); - return 1; - } - if (vips_black(&t[4], 1, 1, NULL) || - vips_linear(t[4], &t[5], ones, o->Color, 3, NULL) || - vips_cast(t[5], &t[6], VIPS_FORMAT_UCHAR, NULL) || - vips_copy(t[6], &t[7], "interpretation", in->Type, NULL) || - vips_embed(t[7], &t[8], 0, 0, in->Xsize, in->Ysize, "extend", - VIPS_EXTEND_COPY, NULL)) { - g_object_unref(base); - return 1; - } - if (vips_ifthenelse(t[3], t[8], in, out, "blend", TRUE, NULL)) { - g_object_unref(base); - return 1; - } - g_object_unref(base); - return 0; -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/label.go b/vendor/github.com/davidbyttow/govips/v2/vips/label.go deleted file mode 100644 index 84320b6340..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/label.go +++ /dev/null @@ -1,84 +0,0 @@ -package vips - -// #include "label.h" -import "C" -import "unsafe" - -// Align represents VIPS_ALIGN -type Align int - -// Direction enum -const ( - AlignLow Align = C.VIPS_ALIGN_LOW - AlignCenter Align = C.VIPS_ALIGN_CENTRE - AlignHigh Align = C.VIPS_ALIGN_HIGH -) - -// DefaultFont is the default font to be used for label texts created by govips -const DefaultFont = "sans 10" - -// LabelParams represents a text-based label -type LabelParams struct { - Text string - Font string - Width Scalar - Height Scalar - OffsetX Scalar - OffsetY Scalar - Opacity float32 - Color Color - Alignment Align -} - -type vipsLabelOptions struct { - Text *C.char - Font *C.char - Width C.int - Height C.int - OffsetX C.int - OffsetY C.int - Alignment C.VipsAlign - DPI C.int - Margin C.int - Opacity C.float - Color [3]C.double -} - -func labelImage(in *C.VipsImage, params *LabelParams) (*C.VipsImage, error) { - incOpCounter("label") - var out *C.VipsImage - - text := C.CString(params.Text) - defer freeCString(text) - - font := C.CString(params.Font) - defer freeCString(font) - - // todo: release color? - color := [3]C.double{C.double(params.Color.R), C.double(params.Color.G), C.double(params.Color.B)} - - w := params.Width.GetRounded(int(in.Xsize)) - h := params.Height.GetRounded(int(in.Ysize)) - offsetX := params.OffsetX.GetRounded(int(in.Xsize)) - offsetY := params.OffsetY.GetRounded(int(in.Ysize)) - - opts := vipsLabelOptions{ - Text: text, - Font: font, - Width: C.int(w), - Height: C.int(h), - OffsetX: C.int(offsetX), - OffsetY: C.int(offsetY), - Alignment: C.VipsAlign(params.Alignment), - Opacity: C.float(params.Opacity), - Color: color, - } - - // todo: release inline pointer? - err := C.label(in, &out, (*C.LabelOptions)(unsafe.Pointer(&opts))) - if err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/label.h b/vendor/github.com/davidbyttow/govips/v2/vips/label.h deleted file mode 100644 index 332a5da30f..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/label.h +++ /dev/null @@ -1,21 +0,0 @@ -#include -#include - -typedef struct { - const char *Text; - const char *Font; - int Width; - int Height; - int OffsetX; - int OffsetY; - VipsAlign Align; - int DPI; - int Margin; - float Opacity; - double Color[3]; -} LabelOptions; - -int label(VipsImage *in, VipsImage **out, LabelOptions *o); - -int text(VipsImage **out, const char *text, const char *font, int width, - int height, VipsAlign align, int dpi); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/lang.go b/vendor/github.com/davidbyttow/govips/v2/vips/lang.go deleted file mode 100644 index 6889b798bf..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/lang.go +++ /dev/null @@ -1,49 +0,0 @@ -package vips - -// #include -// #include -import "C" - -import ( - "reflect" - "unsafe" -) - -func freeCString(s *C.char) { - C.free(unsafe.Pointer(s)) -} - -func gFreePointer(ref unsafe.Pointer) { - C.g_free(C.gpointer(ref)) -} - -func boolToInt(b bool) int { - if b { - return 1 - } - return 0 -} - -func toGboolean(b bool) C.gboolean { - if b { - return C.gboolean(1) - } - return C.gboolean(0) -} - -func fromGboolean(b C.gboolean) bool { - return b != 0 -} - -func fromCArrayInt(out *C.int, n int) []int { - var result = make([]int, n) - var data []C.int - sh := (*reflect.SliceHeader)(unsafe.Pointer(&data)) - sh.Data = uintptr(unsafe.Pointer(out)) - sh.Len = n - sh.Cap = n - for i := range data { - result[i] = int(data[i]) - } - return result -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/lang.h b/vendor/github.com/davidbyttow/govips/v2/vips/lang.h deleted file mode 100644 index 27c81384b6..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/lang.h +++ /dev/null @@ -1,4 +0,0 @@ -#include -#include - -#define INT_TO_GBOOLEAN(bool) (bool > 0 ? TRUE : FALSE) diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/logging.go b/vendor/github.com/davidbyttow/govips/v2/vips/logging.go deleted file mode 100644 index 5053d0162f..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/logging.go +++ /dev/null @@ -1,98 +0,0 @@ -package vips - -// #include -import "C" -import ( - "log" -) - -// LogLevel is the enum controlling logging message verbosity. -type LogLevel int - -// The logging verbosity levels classify and filter logging messages. -// From most to least verbose, they are debug, info, message, warning, critical and error. -const ( - LogLevelError LogLevel = C.G_LOG_LEVEL_ERROR - LogLevelCritical LogLevel = C.G_LOG_LEVEL_CRITICAL - LogLevelWarning LogLevel = C.G_LOG_LEVEL_WARNING - LogLevelMessage LogLevel = C.G_LOG_LEVEL_MESSAGE - LogLevelInfo LogLevel = C.G_LOG_LEVEL_INFO - LogLevelDebug LogLevel = C.G_LOG_LEVEL_DEBUG -) - -// Three global variables which keep state of the current logging handler -// function, desired verbosity for logging and whether defaults have been -// overridden. Set by LoggingSettings() -var ( - currentLoggingHandlerFunction LoggingHandlerFunction - currentLoggingVerbosity LogLevel - currentLoggingOverridden bool -) - -// govipsLoggingHandler is the private bridge function exported to the C library -// and called by glib and libvips for each logging message. It will call govipsLog -// which in turn will filter based on verbosity and direct the messages to the -// currently chosen LoggingHandlerFunction. -// -//export govipsLoggingHandler -func govipsLoggingHandler(messageDomain *C.char, messageLevel C.int, message *C.char) { - govipsLog(C.GoString(messageDomain), LogLevel(messageLevel), C.GoString(message)) -} - -// LoggingHandlerFunction is a function which will be called for each log message. -// By default, govips sends logging messages to os.Stderr. If you want to log elsewhere -// such as to a file or to a state variable which you inspect yourself, define a new -// logging handler function and set it via LoggingSettings(). -type LoggingHandlerFunction func(messageDomain string, messageLevel LogLevel, message string) - -// LoggingSettings sets the logging handler and logging verbosity for govips. -// The handler function is the function which will be called for each log message. -// You can define one yourself to log somewhere else besides the default (stderr). -// Use nil as handler to use standard logging handler. -// Verbosity is the minimum logLevel you want to log. Default is logLevelInfo -// due to backwards compatibility but it's quite verbose for a library. -// Suggest setting it to at least logLevelWarning. Use logLevelDebug for debugging. -func LoggingSettings(handler LoggingHandlerFunction, verbosity LogLevel) { - currentLoggingOverridden = true - govipsLoggingSettings(handler, verbosity) -} - -func govipsLoggingSettings(handler LoggingHandlerFunction, verbosity LogLevel) { - if handler == nil { - currentLoggingHandlerFunction = defaultLoggingHandlerFunction - } else { - currentLoggingHandlerFunction = handler - } - - currentLoggingVerbosity = verbosity - // TODO turn on debugging in libvips and redirect to handler when setting verbosity to debug - // This way debugging information would go to the same channel as all other logging -} - -func defaultLoggingHandlerFunction(messageDomain string, messageLevel LogLevel, message string) { - var messageLevelDescription string - switch messageLevel { - case LogLevelError: - messageLevelDescription = "error" - case LogLevelCritical: - messageLevelDescription = "critical" - case LogLevelWarning: - messageLevelDescription = "warning" - case LogLevelMessage: - messageLevelDescription = "message" - case LogLevelInfo: - messageLevelDescription = "info" - case LogLevelDebug: - messageLevelDescription = "debug" - } - - log.Printf("[%v.%v] %v", messageDomain, messageLevelDescription, message) -} - -// govipsLog is the default function used to log debug or error messages internally in govips. -// It's used by all govips functionality directly, as well as by glib and libvips via the C bridge. -func govipsLog(messageDomain string, messageLevel LogLevel, message string) { - if messageLevel <= currentLoggingVerbosity { - currentLoggingHandlerFunction(messageDomain, messageLevel, message) - } -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/math.go b/vendor/github.com/davidbyttow/govips/v2/vips/math.go deleted file mode 100644 index c7176f1f45..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/math.go +++ /dev/null @@ -1,57 +0,0 @@ -package vips - -import "math" - -// Scalar is the basic scalar measurement of an image's height, width or offset coordinate. -type Scalar struct { - Value float64 - Relative bool -} - -// ValueOf takes a floating point value and returns a corresponding Scalar struct -func ValueOf(value float64) Scalar { - return Scalar{value, false} -} - -// IsZero checkes whether the associated Scalar's value is zero. -func (s *Scalar) IsZero() bool { - return s.Value == 0 && !s.Relative -} - -// SetInt sets an integer value for the associated Scalar. -func (s *Scalar) SetInt(value int) { - s.Set(float64(value)) -} - -// Set sets a float value for the associated Scalar. -func (s *Scalar) Set(value float64) { - s.Value = value - s.Relative = false -} - -// SetScale sets a float value for the associated Scalar and makes it relative. -func (s *Scalar) SetScale(f float64) { - s.Value = f - s.Relative = true -} - -// Get returns the value of the scalar. Either absolute, or if relative, multiplied by the base given as parameter. -func (s *Scalar) Get(base int) float64 { - if s.Relative { - return s.Value * float64(base) - } - return s.Value -} - -// GetRounded returns the value of the associated Scalar, rounded to the nearest integer, if absolute. -// If the Scalar is relative, it will be multiplied by the supplied base parameter. -func (s *Scalar) GetRounded(base int) int { - return roundFloat(s.Get(base)) -} - -func roundFloat(f float64) int { - if f < 0 { - return int(math.Ceil(f - 0.5)) - } - return int(math.Floor(f + 0.5)) -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.c b/vendor/github.com/davidbyttow/govips/v2/vips/morphology.c deleted file mode 100644 index b57fdd9192..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.c +++ /dev/null @@ -1,6 +0,0 @@ -#include "morphology.h" - -int rank(VipsImage *in, VipsImage **out, int width, int height, int index) { - return vips_rank(in, out, width, height, index, NULL); -} - diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.go b/vendor/github.com/davidbyttow/govips/v2/vips/morphology.go deleted file mode 100644 index 75e8668b9d..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.go +++ /dev/null @@ -1,17 +0,0 @@ -package vips - -// #include "morphology.h" -import "C" - -// https://libvips.github.io/libvips/API/current/libvips-morphology.html#vips-rank -func vipsRank(in *C.VipsImage, width int, height int, index int) (*C.VipsImage, error) { - incOpCounter("rank") - var out *C.VipsImage - - err := C.rank(in, &out, C.int(width), C.int(height), C.int(index)) - if int(err) != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.h b/vendor/github.com/davidbyttow/govips/v2/vips/morphology.h deleted file mode 100644 index fe8e9e1a04..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/morphology.h +++ /dev/null @@ -1,6 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-morphology.html - -#include -#include - -int rank(VipsImage *in, VipsImage **out, int width, int height, int index); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/resample.c b/vendor/github.com/davidbyttow/govips/v2/vips/resample.c deleted file mode 100644 index aabc4102a9..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/resample.c +++ /dev/null @@ -1,61 +0,0 @@ -#include "resample.h" - -int shrink_image(VipsImage *in, VipsImage **out, double xshrink, - double yshrink) { - return vips_shrink(in, out, xshrink, yshrink, NULL); -} - -int reduce_image(VipsImage *in, VipsImage **out, double xshrink, - double yshrink) { - return vips_reduce(in, out, xshrink, yshrink, NULL); -} - -int affine_image(VipsImage *in, VipsImage **out, double a, double b, double c, - double d, VipsInterpolate *interpolator) { - return vips_affine(in, out, a, b, c, d, "interpolate", interpolator, NULL); -} - -int resize_image(VipsImage *in, VipsImage **out, double scale, gdouble vscale, - int kernel) { - if (vscale > 0) { - return vips_resize(in, out, scale, "vscale", vscale, "kernel", kernel, - NULL); - } - - return vips_resize(in, out, scale, "kernel", kernel, NULL); -} - -int thumbnail(const char *filename, VipsImage **out, - int width, int height, int crop, int size) { - return vips_thumbnail(filename, out, width, "height", height, - "crop", crop, "size", size, NULL); -} - -int thumbnail_image(VipsImage *in, VipsImage **out, int width, int height, - int crop, int size) { - return vips_thumbnail_image(in, out, width, "height", height, "crop", crop, - "size", size, NULL); -} - -int thumbnail_buffer_with_option(void *buf, size_t len, VipsImage **out, - int width, int height, int crop, int size, - const char *option_string) { - return vips_thumbnail_buffer(buf, len, out, width, "height", height, - "crop", crop, "size", size, - "option_string", option_string, NULL); -} - -int thumbnail_buffer(void *buf, size_t len, VipsImage **out, - int width, int height, int crop, int size) { - return vips_thumbnail_buffer(buf, len, out, width, "height", height, - "crop", crop, "size", size, NULL); -} - -int mapim(VipsImage *in, VipsImage **out, VipsImage *index) { - return vips_mapim(in, out, index, NULL); -} - -int maplut(VipsImage *in, VipsImage **out, VipsImage *lut) { - return vips_maplut(in, out, lut, NULL); -} - diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/resample.go b/vendor/github.com/davidbyttow/govips/v2/vips/resample.go deleted file mode 100644 index 9998d52327..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/resample.go +++ /dev/null @@ -1,146 +0,0 @@ -package vips - -// #include "resample.h" -import "C" -import ( - "os" - "runtime" - "unsafe" -) - -// Kernel represents VipsKernel type -type Kernel int - -// Kernel enum -const ( - KernelAuto Kernel = -1 - KernelNearest Kernel = C.VIPS_KERNEL_NEAREST - KernelLinear Kernel = C.VIPS_KERNEL_LINEAR - KernelCubic Kernel = C.VIPS_KERNEL_CUBIC - KernelLanczos2 Kernel = C.VIPS_KERNEL_LANCZOS2 - KernelLanczos3 Kernel = C.VIPS_KERNEL_LANCZOS3 - KernelMitchell Kernel = C.VIPS_KERNEL_MITCHELL -) - -// Size represents VipsSize type -type Size int - -const ( - SizeBoth Size = C.VIPS_SIZE_BOTH - SizeUp Size = C.VIPS_SIZE_UP - SizeDown Size = C.VIPS_SIZE_DOWN - SizeForce Size = C.VIPS_SIZE_FORCE - SizeLast Size = C.VIPS_SIZE_LAST -) - -// https://libvips.github.io/libvips/API/current/libvips-resample.html#vips-resize -func vipsResizeWithVScale(in *C.VipsImage, hscale, vscale float64, kernel Kernel) (*C.VipsImage, error) { - incOpCounter("resize") - var out *C.VipsImage - - // libvips recommends Lanczos3 as the default kernel - if kernel == KernelAuto { - kernel = KernelLanczos3 - } - - if err := C.resize_image(in, &out, C.double(hscale), C.double(vscale), C.int(kernel)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -func vipsThumbnail(in *C.VipsImage, width, height int, crop Interesting, size Size) (*C.VipsImage, error) { - incOpCounter("thumbnail") - var out *C.VipsImage - - if err := C.thumbnail_image(in, &out, C.int(width), C.int(height), C.int(crop), C.int(size)); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://www.libvips.org/API/current/libvips-resample.html#vips-thumbnail -func vipsThumbnailFromFile(filename string, width, height int, crop Interesting, size Size, params *ImportParams) (*C.VipsImage, ImageType, error) { - var out *C.VipsImage - - filenameOption := filename - if params != nil { - filenameOption += "[" + params.OptionString() + "]" - } - - cFileName := C.CString(filenameOption) - defer freeCString(cFileName) - - if err := C.thumbnail(cFileName, &out, C.int(width), C.int(height), C.int(crop), C.int(size)); err != 0 { - err := handleImageError(out) - if src, err2 := os.ReadFile(filename); err2 == nil { - if isBMP(src) { - if src2, err3 := bmpToPNG(src); err3 == nil { - return vipsThumbnailFromBuffer(src2, width, height, crop, size, params) - } - } - } - return nil, ImageTypeUnknown, err - } - - imageType := vipsDetermineImageTypeFromMetaLoader(out) - return out, imageType, nil -} - -// https://www.libvips.org/API/current/libvips-resample.html#vips-thumbnail-buffer -func vipsThumbnailFromBuffer(buf []byte, width, height int, crop Interesting, size Size, params *ImportParams) (*C.VipsImage, ImageType, error) { - src := buf - // Reference src here so it's not garbage collected during image initialization. - defer runtime.KeepAlive(src) - - var out *C.VipsImage - - var err C.int - - if params == nil { - err = C.thumbnail_buffer(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(width), C.int(height), C.int(crop), C.int(size)) - } else { - cOptionString := C.CString(params.OptionString()) - defer freeCString(cOptionString) - - err = C.thumbnail_buffer_with_option(unsafe.Pointer(&src[0]), C.size_t(len(src)), &out, C.int(width), C.int(height), C.int(crop), C.int(size), cOptionString) - } - if err != 0 { - err := handleImageError(out) - if isBMP(src) { - if src2, err2 := bmpToPNG(src); err2 == nil { - return vipsThumbnailFromBuffer(src2, width, height, crop, size, params) - } - } - return nil, ImageTypeUnknown, err - } - - imageType := vipsDetermineImageTypeFromMetaLoader(out) - return out, imageType, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-resample.html#vips-mapim -func vipsMapim(in *C.VipsImage, index *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("mapim") - var out *C.VipsImage - - if err := C.mapim(in, &out, index); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} - -// https://libvips.github.io/libvips/API/current/libvips-histogram.html#vips-maplut -func vipsMaplut(in *C.VipsImage, lut *C.VipsImage) (*C.VipsImage, error) { - incOpCounter("maplut") - var out *C.VipsImage - - if err := C.maplut(in, &out, lut); err != 0 { - return nil, handleImageError(out) - } - - return out, nil -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/resample.h b/vendor/github.com/davidbyttow/govips/v2/vips/resample.h deleted file mode 100644 index 9df5e132c9..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/resample.h +++ /dev/null @@ -1,24 +0,0 @@ -// https://libvips.github.io/libvips/API/current/libvips-resample.html - -#include -#include - -int shrink_image(VipsImage *in, VipsImage **out, double xshrink, - double yshrink); -int reduce_image(VipsImage *in, VipsImage **out, double xshrink, - double yshrink); -int affine_image(VipsImage *in, VipsImage **out, double a, double b, double c, - double d, VipsInterpolate *interpolator); -int resize_image(VipsImage *in, VipsImage **out, double scale, gdouble vscale, - int kernel); -int thumbnail(const char *filename, VipsImage **out, int width, int height, - int crop, int size); -int thumbnail_image(VipsImage *in, VipsImage **out, int width, int height, - int crop, int size); -int thumbnail_buffer(void *buf, size_t len, VipsImage **out, int width, int height, - int crop, int size); -int thumbnail_buffer_with_option(void *buf, size_t len, VipsImage **out, - int width, int height, int crop, int size, - const char *option_string); -int mapim(VipsImage *in, VipsImage **out, VipsImage *index); -int maplut(VipsImage *in, VipsImage **out, VipsImage *lut); diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/stats.go b/vendor/github.com/davidbyttow/govips/v2/vips/stats.go deleted file mode 100644 index d3208c75cf..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/stats.go +++ /dev/null @@ -1,56 +0,0 @@ -package vips - -import "sync" - -// RuntimeStats is a data structure to house a map of govips operation counts -type RuntimeStats struct { - OperationCounts map[string]int64 -} - -var ( - operationCounter chan string - runtimeStats *RuntimeStats - statLock sync.RWMutex -) - -func incOpCounter(op string) { - if operationCounter != nil { - operationCounter <- op - } -} - -func collectStats() chan struct{} { - operationCounter = make(chan string, 100) - done := make(chan struct{}) - exit := false - go func() { - for !exit { - select { - case op := <-operationCounter: - statLock.Lock() - runtimeStats.OperationCounts[op] = runtimeStats.OperationCounts[op] + 1 - statLock.Unlock() - case <-done: - exit = true - break - } - } - }() - return done -} - -// ReadRuntimeStats returns operation counts for govips -func ReadRuntimeStats(stats *RuntimeStats) { - statLock.RLock() - defer statLock.RUnlock() - stats.OperationCounts = make(map[string]int64) - for k, v := range runtimeStats.OperationCounts { - stats.OperationCounts[k] = v - } -} - -func init() { - runtimeStats = &RuntimeStats{ - OperationCounts: make(map[string]int64), - } -} diff --git a/vendor/github.com/davidbyttow/govips/v2/vips/test_resources.go b/vendor/github.com/davidbyttow/govips/v2/vips/test_resources.go deleted file mode 100644 index b2e91e4cd3..0000000000 --- a/vendor/github.com/davidbyttow/govips/v2/vips/test_resources.go +++ /dev/null @@ -1,6 +0,0 @@ -package vips - -// relative to "/vips/.." -const ( - resources = "../resources/" -) diff --git a/vendor/modules.txt b/vendor/modules.txt index 77046e89ef..f8624d73bd 100644 --- a/vendor/modules.txt +++ b/vendor/modules.txt @@ -355,15 +355,16 @@ github.com/cs3org/go-cs3apis/cs3/storage/provider/v1beta1 github.com/cs3org/go-cs3apis/cs3/storage/registry/v1beta1 github.com/cs3org/go-cs3apis/cs3/tx/v1beta1 github.com/cs3org/go-cs3apis/cs3/types/v1beta1 +# github.com/cshum/vipsgen v1.1.1 +## explicit; go 1.24.2 +github.com/cshum/vipsgen/pointer +github.com/cshum/vipsgen/vips # github.com/cyphar/filepath-securejoin v0.3.6 ## explicit; go 1.18 github.com/cyphar/filepath-securejoin # github.com/davecgh/go-spew v1.1.2-0.20180830191138-d8f796af33cc ## explicit github.com/davecgh/go-spew/spew -# github.com/davidbyttow/govips/v2 v2.16.0 -## explicit; go 1.15 -github.com/davidbyttow/govips/v2/vips # github.com/deckarep/golang-set v1.8.0 ## explicit; go 1.17 github.com/deckarep/golang-set From 2f2cbdbe064a44243d4f45feb4538ecb545fe648 Mon Sep 17 00:00:00 2001 From: Thomas Heijligen Date: Tue, 12 Aug 2025 19:48:10 +0200 Subject: [PATCH 2/4] thumbnail: replace Reader by ReadCloser for vips A vips source is based on a ReadCloser. And the reva cs3 api provides this datatype --- .../pkg/preprocessor/preprocessor.go | 19 ++++++++++++------- .../pkg/preprocessor/preprocessor_imaging.go | 3 ++- .../pkg/preprocessor/preprocessor_vips.go | 17 +++++++---------- 3 files changed, 21 insertions(+), 18 deletions(-) diff --git a/services/thumbnails/pkg/preprocessor/preprocessor.go b/services/thumbnails/pkg/preprocessor/preprocessor.go index f24b4f80db..1d8a3cd3ff 100644 --- a/services/thumbnails/pkg/preprocessor/preprocessor.go +++ b/services/thumbnails/pkg/preprocessor/preprocessor.go @@ -25,14 +25,15 @@ import ( // FileConverter is the interface for the file converter type FileConverter interface { - Convert(r io.Reader) (interface{}, error) + Convert(r io.ReadCloser) (interface{}, error) } // GifDecoder is a converter for the gif file type GifDecoder struct{} // Convert reads the gif file and returns the thumbnail image -func (i GifDecoder) Convert(r io.Reader) (interface{}, error) { +func (i GifDecoder) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() img, err := gif.DecodeAll(r) if err != nil { return nil, errors.Wrap(err, `could not decode the image`) @@ -44,7 +45,8 @@ func (i GifDecoder) Convert(r io.Reader) (interface{}, error) { type GgsDecoder struct{ thumbnailpath string } // Convert reads the ggs file and returns the thumbnail image -func (g GgsDecoder) Convert(r io.Reader) (interface{}, error) { +func (g GgsDecoder) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() var buf bytes.Buffer _, err := io.Copy(&buf, r) if err != nil { @@ -78,7 +80,8 @@ func (g GgsDecoder) Convert(r io.Reader) (interface{}, error) { type AudioDecoder struct{} // Convert reads the audio file and extracts the thumbnail image from the id3 tag -func (i AudioDecoder) Convert(r io.Reader) (interface{}, error) { +func (i AudioDecoder) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() b, err := io.ReadAll(r) if err != nil { return nil, err @@ -98,7 +101,7 @@ func (i AudioDecoder) Convert(r io.Reader) (interface{}, error) { return nil, thumbnailerErrors.ErrNoConverterForExtractedImageFromAudioFile } - return converter.Convert(bytes.NewReader(picture.Data)) + return converter.Convert(io.NopCloser(bytes.NewReader(picture.Data))) } // TxtToImageConverter is a converter for the text file @@ -107,7 +110,8 @@ type TxtToImageConverter struct { } // Convert reads the text file and renders it into a thumbnail image -func (t TxtToImageConverter) Convert(r io.Reader) (interface{}, error) { +func (t TxtToImageConverter) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() img := image.NewRGBA(image.Rect(0, 0, 640, 480)) imgBounds := img.Bounds() @@ -195,7 +199,8 @@ type GGPStruct struct { type GgpDecoder struct{} // Convert reads the ggp file and returns the first thumbnail image -func (j GgpDecoder) Convert(r io.Reader) (interface{}, error) { +func (j GgpDecoder) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() ggp := &GGPStruct{} err := json.NewDecoder(r).Decode(ggp) if err != nil { diff --git a/services/thumbnails/pkg/preprocessor/preprocessor_imaging.go b/services/thumbnails/pkg/preprocessor/preprocessor_imaging.go index 4510e234e6..2dc2a45d4e 100644 --- a/services/thumbnails/pkg/preprocessor/preprocessor_imaging.go +++ b/services/thumbnails/pkg/preprocessor/preprocessor_imaging.go @@ -13,7 +13,8 @@ import ( type ImageDecoder struct{} // Convert reads the image file and returns the thumbnail image -func (i ImageDecoder) Convert(r io.Reader) (interface{}, error) { +func (i ImageDecoder) Convert(r io.ReadCloser) (interface{}, error) { + defer r.Close() img, err := imaging.Decode(r, imaging.AutoOrientation(true)) if err != nil { return nil, errors.Wrap(err, `could not decode the image`) diff --git a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go index 244e42007b..79b86029a7 100644 --- a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go +++ b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go @@ -17,19 +17,16 @@ func init() { type ImageDecoder struct{} -func (v ImageDecoder) Convert(r io.Reader) (interface{}, error) { - buf, err := io.ReadAll(r) - if err != nil { - return nil, err - } - img, err := vips.NewImageFromBuffer(buf, nil) +func (v ImageDecoder) Convert(r io.ReadCloser) (interface{}, error) { + src := vips.NewSource(r) + return vips.NewImageFromSource(src, nil) // Alternative with vips 1.8+ - // First test the RAW decoder, this is not implemented in NewImageFromBuffer + // First test the RAW decoder, this is not implemented in NewImageFromSrc // - // img, err := vips.NewDcrawloadBuffer(buf, nil) + // img, err := vips.NewDcrawloadBuffer(src, nil) // if err != nil { - // img, err = vips.NewImageFromBuffer(buf, nil) + // img, err = vips.NewImageFromSource(src, nil) // } - return img, err + // return img, err } From 8d3874a3b403fe2f03ca37b2ae2a9e0f80b16bd5 Mon Sep 17 00:00:00 2001 From: Thomas Heijligen Date: Tue, 12 Aug 2025 19:48:11 +0200 Subject: [PATCH 3/4] thumbnails: vips: do not fail on first errer This allows the thumbnail generation for images with invalid SOS parameters --- services/thumbnails/pkg/preprocessor/preprocessor_vips.go | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go index 79b86029a7..bd5bff7444 100644 --- a/services/thumbnails/pkg/preprocessor/preprocessor_vips.go +++ b/services/thumbnails/pkg/preprocessor/preprocessor_vips.go @@ -19,7 +19,8 @@ type ImageDecoder struct{} func (v ImageDecoder) Convert(r io.ReadCloser) (interface{}, error) { src := vips.NewSource(r) - return vips.NewImageFromSource(src, nil) + // This fiexs the SOS invalid length but might be a security nightmare + return vips.NewImageFromSource(src, &vips.LoadOptions{FailOnError: false}) // Alternative with vips 1.8+ // First test the RAW decoder, this is not implemented in NewImageFromSrc From 8982dff675efdd6d5d93d3051fa5cc6aa7e0d7da Mon Sep 17 00:00:00 2001 From: Thomas Heijligen Date: Tue, 12 Aug 2025 20:31:06 +0200 Subject: [PATCH 4/4] [DO NOT MERGE] thumbnails: Enable heif/heic support for libvips --- services/thumbnails/pkg/thumbnail/mimetypes_vips.go | 2 ++ 1 file changed, 2 insertions(+) diff --git a/services/thumbnails/pkg/thumbnail/mimetypes_vips.go b/services/thumbnails/pkg/thumbnail/mimetypes_vips.go index b94fafafaf..7b019fd59c 100644 --- a/services/thumbnails/pkg/thumbnail/mimetypes_vips.go +++ b/services/thumbnails/pkg/thumbnail/mimetypes_vips.go @@ -19,5 +19,7 @@ var ( "application/vnd.geogebra.slides": {}, "application/vnd.geogebra.pinboard": {}, "image/webp": {}, + "image/heif": {}, + "image/heic": {}, } )