Add message body blocks and structures

elementary/messages/README.md

@@ -0,0 +1,130 @@
+# Elementary Messages
+
+This package provides a flexible system for building structured messages that can be rendered across different platforms (like Slack, Teams, etc.).
+The system defines a minimal and simple format that can be formatted into different output formats.However, some blocks, styles, or icons might not be supported across all platforms.
+
+## Core Components
+
+- `MessageBody`: The root container for a message
+- `blocks`: Building blocks for message content (headers, code blocks, text, etc.)
+- `block_builders`: Helper functions to easily construct common block patterns
+
+## Message Structure
+
+A `MessageBody` can contain the following blocks directly:
+
+- `HeaderBlock`
+- `CodeBlock`
+- `DividerBlock`
+- `LinesBlock`
+- `FactListBlock`
+- `ExpandableBlock`
+
+## Basic Usage
+
+```python
+from elementary.messages.message_body import MessageBody, Color
+from elementary.messages.blocks import HeaderBlock, LinesBlock, TextBlock
+from elementary.messages.block_builders import TextLineBlock, BoldTextLineBlock
+
+# Create a simple message
+message = MessageBody(
+    blocks=[
+        HeaderBlock(text="My Message Title"),
+        TextLineBlock(text="This is a simple text line"),
+        BoldTextLineBlock(text="This is bold text"),
+    ],
+    color=Color.GREEN
+)
+```
+
+## Available Blocks
+
+### Text and Layout
+
+- `HeaderBlock`: Section headers
+- `TextBlock`: Basic text content with optional style (BOLD/ITALIC)
+- `LineBlock`: A line that can contain multiple inline elements:
+  - `TextBlock`: Text with optional styling
+  - `LinkBlock`: Clickable URL with display text
+  - `IconBlock`: Visual indicator (like ✓, ⚠️, etc.)
+- `LinesBlock`: Multiple lines of text
+- `DividerBlock`: Visual separator
+- `CodeBlock`: Code snippets or formatted text
+
+### Interactive Elements
+
+- `ExpandableBlock`: Collapsible sections
+- `LinkBlock`: Clickable URLs
+
+### Data Display
+
+- `FactBlock`: Key-value pairs
+- `FactListBlock`: Collection of facts
+
+### Styling
+
+- `TextStyle`: Text formatting (BOLD, ITALIC)
+- `Icon`: Various icons for visual indicators
+- `Color`: Message theme colors (RED, YELLOW, GREEN)
+
+## Block Builders
+
+The `block_builders` module provides convenient functions for creating common block patterns. These builders are wrappers around the basic blocks defined in the `blocks` module and help with constructing commonly used block combinations:
+
+```python
+from elementary.messages.block_builders import (
+    BulletListBlock,
+    FactsBlock,
+    JsonCodeBlock,
+    TitledParagraphBlock
+)
+from elementary.messages.blocks import Icon
+
+# Create a bullet list
+bullet_list = BulletListBlock(
+    icon=Icon.CHECK,
+    lines=[TextLineBlock(text="Item 1"), TextLineBlock(text="Item 2")]
+)
+
+# Create facts list
+facts = FactsBlock(
+    facts=[
+        ("Status", "Passed"),
+        ("Duration", "2.5s"),
+    ]
+)
+
+# Create JSON code block
+json_block = JsonCodeBlock(
+    content={"key": "value"}
+)
+
+# Create titled paragraph
+paragraph = TitledParagraphBlock(
+    title="Section Title",
+    lines=[TextLineBlock(text="Paragraph content")]
+)
+
+# Example of a line with multiple inline elements
+from elementary.messages.blocks import LineBlock, TextBlock, LinkBlock, IconBlock, Icon, TextStyle
+
+complex_line = LineBlock(
+    inlines=[
+        IconBlock(icon=Icon.CHECK),
+        TextBlock(text="Test passed - ", style=TextStyle.BOLD),
+        TextBlock(text="View details at "),
+        LinkBlock(text="dashboard", url="https://example.com"),
+    ]
+)
+```
+
+## Message Formatting
+
+To format messages into different output formats (like Slack or Teams), a formatter needs to support all the basic blocks defined in the `blocks` module:
+
+- Core blocks: `HeaderBlock`, `CodeBlock`, `DividerBlock`, `LinesBlock`, `FactListBlock`, `ExpandableBlock`
+- Inline blocks: `TextBlock`, `LinkBlock`, `IconBlock`
+- Styling: `TextStyle`, `Color`
+
+The block builders are convenience wrappers that ultimately create these basic blocks, so formatters only need to handle the core block types.

elementary/messages/block_builders.py

@@ -0,0 +1,122 @@
+import json
+from typing import List, Optional, Tuple, Union
+
+from .blocks import (
+    CodeBlock,
+    FactBlock,
+    FactListBlock,
+    Icon,
+    IconBlock,
+    InlineBlock,
+    LineBlock,
+    LinesBlock,
+    LinkBlock,
+    TextBlock,
+    TextStyle,
+)
+
+SimpleInlineBlock = Union[str, Icon]
+SimpleLineBlock = Union[str, Icon, List[SimpleInlineBlock]]
+
+
+def _build_inline_block(
+    content: SimpleInlineBlock, style: Optional[TextStyle] = None
+) -> InlineBlock:
+    return IconBlock(icon=content) if isinstance(content, Icon) else TextBlock(text=content, style=style)  # type: ignore
+
+
+def _build_inlines(
+    content: SimpleLineBlock, style: Optional[TextStyle] = None
+) -> List[InlineBlock]:
+    if isinstance(content, list):
+        return [_build_inline_block(line, style) for line in content]
+    return [_build_inline_block(content)]
+
+
+def BulletListBlock(
+    *,
+    icon: Union[Icon, str],
+    lines: List[LineBlock] = [],
+) -> LinesBlock:
+    icon_inline: InlineBlock = (
+        IconBlock(icon=icon) if isinstance(icon, Icon) else TextBlock(text=icon)
+    )
+    lines = [LineBlock(inlines=[icon_inline] + line.inlines) for line in lines]
+    return LinesBlock(lines=lines)
+
+
+def BoldTextBlock(*, text: str) -> TextBlock:
+    return TextBlock(text=text, style=TextStyle.BOLD)
+
+
+def ItalicTextBlock(*, text: str) -> TextBlock:
+    return TextBlock(text=text, style=TextStyle.ITALIC)
+
+
+def TextLineBlock(
+    *, text: SimpleLineBlock, style: Optional[TextStyle] = None
+) -> LineBlock:
+    return LineBlock(inlines=_build_inlines(text, style))
+
+
+def BoldTextLineBlock(*, text: SimpleLineBlock) -> LineBlock:
+    return TextLineBlock(text=text, style=TextStyle.BOLD)
+
+
+def ItalicTextLineBlock(*, text: SimpleLineBlock) -> LineBlock:
+    return TextLineBlock(text=text, style=TextStyle.ITALIC)
+
+
+def LinkLineBlock(*, text: str, url: str) -> LineBlock:
+    return LineBlock(inlines=[LinkBlock(text=text, url=url)])
+
+
+def SummaryLineBlock(
+    *,
+    summary: List[Tuple[SimpleLineBlock, SimpleLineBlock]],
+    include_empty_values: bool = False,
+) -> LineBlock:
+    text_blocks: List[InlineBlock] = []
+    for title, value in summary:
+        if not value and not include_empty_values:
+            continue
+        text_blocks.extend(_build_inlines(title, TextStyle.BOLD))
+        text_blocks.extend(_build_inlines(value))
+        text_blocks.append(TextBlock(text="|"))
+    text_blocks = text_blocks[:-1]
+    return LineBlock(inlines=text_blocks)
+
+
+def FactsBlock(
+    *,
+    facts: List[
+        Tuple[
+            SimpleLineBlock,
+            SimpleLineBlock,
+        ]
+    ],
+    include_empty_values: bool = False,
+) -> FactListBlock:
+    return FactListBlock(
+        facts=[
+            FactBlock(
+                title=LineBlock(inlines=_build_inlines(title)),
+                value=LineBlock(inlines=_build_inlines(value)),
+            )
+            for title, value in facts
+            if value or include_empty_values
+        ]
+    )
+
+
+def TitledParagraphBlock(
+    *,
+    title: SimpleLineBlock,
+    lines: List[LineBlock],
+) -> LinesBlock:
+    title_line = LineBlock(inlines=_build_inlines(title, TextStyle.BOLD))
+    return LinesBlock(lines=[title_line] + lines)
+
+
+def JsonCodeBlock(*, content: Union[str, dict, list], indent: int = 2) -> CodeBlock:
+    return CodeBlock(text=json.dumps(content, indent=indent))

elementary/messages/blocks.py

@@ -0,0 +1,101 @@
+from enum import Enum
+from typing import List, Optional, Union
+
+from pydantic import BaseModel
+
+
+class Icon(Enum):
+    RED_TRIANGLE = "red_triangle"
+    X = "x"
+    WARNING = "warning"
+    EXCLAMATION = "exclamation"
+    CHECK = "check"
+    MAGNIFYING_GLASS = "magnifying_glass"
+    HAMMER_AND_WRENCH = "hammer_and_wrench"
+    POLICE_LIGHT = "police_light"
+    INFO = "info"
+    EYE = "eye"
+    GEAR = "gear"
+    BELL = "bell"
+
+
+class TextStyle(Enum):
+    BOLD = "bold"
+    ITALIC = "italic"
+
+
+class BaseBlock(BaseModel):
+    pass
+
+
+class BaseInlineTextBlock(BaseBlock):
+    pass
+
+
+class TextBlock(BaseInlineTextBlock):
+    text: str
+    style: Optional[TextStyle] = None
+
+
+class LinkBlock(BaseInlineTextBlock):
+    text: str
+    url: str
+
+
+class IconBlock(BaseInlineTextBlock):
+    icon: Icon
+
+
+InlineBlock = Union[TextBlock, LinkBlock, IconBlock]
+
+
+class HeaderBlock(BaseBlock):
+    text: str
+
+
+class CodeBlock(BaseBlock):
+    text: str
+
+
+class DividerBlock(BaseBlock):
+    pass
+
+
+class LineBlock(BaseBlock):
+    inlines: List[InlineBlock]
+    sep: str = " "
+
+
+class BaseLinesBlock(BaseBlock):
+    lines: List[LineBlock]
+
+
+class LinesBlock(BaseLinesBlock):
+    pass
+
+
+class FactBlock(BaseBlock):
+    title: LineBlock
+    value: LineBlock
+
+
+class FactListBlock(BaseBlock):
+    facts: List[FactBlock]
+
+
+class ExpandableBlock(BaseBlock):
+    title: str
+    body: List["InExpandableBlock"]
+    expanded: bool = False
+
+
+InExpandableBlock = Union[
+    HeaderBlock,
+    CodeBlock,
+    DividerBlock,
+    LinesBlock,
+    FactListBlock,
+    "ExpandableBlock",
+]
+
+ExpandableBlock.model_rebuild()

elementary/messages/message_body.py

@@ -0,0 +1,37 @@
+from enum import Enum
+from typing import List, Optional, Union
+
+from pydantic import BaseModel
+
+from elementary.messages.blocks import (
+    CodeBlock,
+    DividerBlock,
+    ExpandableBlock,
+    FactListBlock,
+    HeaderBlock,
+    LinesBlock,
+)
+
+
+class Color(Enum):
+    RED = "red"
+    YELLOW = "yellow"
+    GREEN = "green"
+
+
+MessageBlock = Union[
+    HeaderBlock,
+    CodeBlock,
+    DividerBlock,
+    LinesBlock,
+    FactListBlock,
+    ExpandableBlock,
+]
+
+
+class MessageBody(BaseModel):
+    blocks: List[MessageBlock]
+    color: Optional[Color] = None
+
+
+MessageBody.model_rebuild()